--- a/client/player/js/LdtPlayer.js Fri Jun 11 00:25:17 2010 +0200
+++ b/client/player/js/LdtPlayer.js Sat Jun 12 00:33:37 2010 +0200
@@ -146,7 +146,7 @@
if (tmp) { tmp.innerHTML = "volume: " + currentVolume; }
}
- function createPlayer(width,height,url) {
+ function createPlayer(width,height,url, playerUrl) {
myUrlFragment = url.split("/");
//
@@ -174,7 +174,7 @@
name:"Ldtplayer1"
}
- swfobject.embedSWF("swf/player.swf", "ldtPlaceHolder", width, height, "9.0.115", false, flashvars, params, attributes);
+ swfobject.embedSWF(playerUrl, "ldtPlaceHolder", width, height, "9.0.115", false, flashvars, params, attributes);
}
@@ -218,20 +218,20 @@
/* START PARSING ----------------------- */
/* metas , medias , annotation-types , annotations , lists , tags , views */
/* # fonction avec 1 seul media et 1 seul annotation type code a cleaner */
- /* # créer le player */
+ /* # cr�er le player */
//$jIRI.each(json.medias, function(i,item) {
//});
$jIRI("<div></div>").appendTo("#output");
MyMedia = new Media(json.medias[0].id,json.medias[0].url,json.medias[0]["dc:duration"],json.medias[0]['dc:title'],json.medias[0]['dc:description']);
MyMedia.createPlayer(playerLdtWidth,playerLdtHeight);
- /* # créer lignes */
+ /* # cr�er lignes */
/*$jIRI.each(json['annotation-types'], function(i,item) {
});*/
MyLdt = new Ligne (json['annotation-types'][0].id,json['annotation-types'][0]['dc:title'],json['annotation-types'][0]['dc:description'],json.medias[0]["dc:duration"]);
//alert("duration : "+json.medias[0]["dc:duration"]);
- /* # créer les annotations */
+ /* # cr�er les annotations */
$jIRI.each(json.annotations, function(i,item) {
MyLdt.addAnnotation(
@@ -374,7 +374,7 @@
this.addAnnotation = addLigneAnnotation;
this.checkTime = checkTimeLigne;
this.duration = duration;
- trace("LIGNE ","créer ");
+ trace("LIGNE ","cr�er ");
}
function addLigneAnnotation(id,begin,end,media,title,description,color){
@@ -451,7 +451,7 @@
this.onClick = onClickAnnotation;
this.toolTip = rollOverAnnotation;
this.draw = drawAnnotation;
- trace("annotation ","réussi")
+ trace("annotation ","r�ussi")
}
function Annotation (id,begin,end,media,title,description,color,duration){
@@ -478,7 +478,7 @@
function drawAnnotation (){
//alert (this.duration);
- startPourcent = timeToPourcent(this.begin,this.duration); // temps du média
+ startPourcent = timeToPourcent(this.begin,this.duration); // temps du m�dia
endPourcent = timeToPourcent(this.end,this.duration)-startPourcent;
$AnnotationTemplate = "<div title='"+this.title+"' id='"+this.id+"' class='ui-slider-range ui-slider-range-min ui-widget-header iri-chapter' width='100%' style='left:"+startPourcent+"%; width:"+endPourcent+"%; padding-top:15px; border-left:solid 1px #aaaaaa; border-right:solid 1px #aaaaaa;' onclick=\"player.sendEvent('SEEK', '"+Math.round(this.begin/1000)+"');$jIRI('#ShowAnnotation').slideDown().delay(5000).slideUp();\" ></div> ";
--- a/web/eulalie/settings.py Fri Jun 11 00:25:17 2010 +0200
+++ b/web/eulalie/settings.py Sat Jun 12 00:33:37 2010 +0200
@@ -89,6 +89,7 @@
"ldt.utils.context_processors.ldt",
"eulalie.utils.context_processors.version",
"eulalie.utils.context_processors.base",
+ "eulalie.utils.context_processors.web",
)
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/eulalie/templates/eulalie/embed_popup.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,62 @@
+{% load i18n %}
+<html>
+ <head>
+ <meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
+ <meta http-equiv="Cache-Control" content="no-cache, must-revalidate" />
+ <meta http-equiv="Pragma" content="no-cache" />
+ <meta http-equiv="Cache" content="no store" />
+ <meta http-equiv="Expires" content="-1" />
+ <title>Ligne de Temps - IRI</title>
+ <script type="text/javascript" src="{{MEDIA_URL}}js/jquery.min.js"></script>
+ <script type="text/javascript" src="{{MEDIA_URL}}js/swfobject.js"></script>
+ <script type="text/javascript" src="{{MEDIA_URL}}js/ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="{{MEDIA_URL}}js/ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="{{MEDIA_URL}}js/ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="{{MEDIA_URL}}js/ui/jquery.ui.slider.js"></script>
+ <script type="text/javascript" src="{{MEDIA_URL}}js/ui/jquery.ui.button.js"></script>
+ <script type="text/javascript" src="{{MEDIA_URL}}js/jquery.tools.min.js"></script>
+ <script type="text/javascript">
+ var $jIRI = $;
+ </script>
+ <script type="text/javascript" src="{{MEDIA_URL}}js/LdtPlayer.js"></script>
+ <script type="text/javascript">
+ $(document).ready(function(){
+ $('.ldt_json_link').click(function(e) {
+ e.preventDefault();
+ link = $(e.target);
+ $("#res_link_{{player_id}}").load(link.attr("href"));
+ $("#res_link_{{player_id}}").show();
+ return false;
+ });
+ });
+ </script>
+
+ <link rel="stylesheet" href="{{MEDIA_URL}}css/custom_player.css" type="text/css"/>
+ <link rel="stylesheet" href="{{MEDIA_URL}}css/workspace.css" type="text/css"/>
+ <link type="text/css" href="{{MEDIA_URL}}css/jq-css/themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <link type="text/css" href="{{MEDIA_URL}}css/jq-css/demos.css" rel="stylesheet" />
+
+ </head>
+
+ <body id="init_embed_popup">
+
+ <div class="ldt_player" id="wrapper_{{player_id}}">
+ {% include "eulalie/partial/embed.html" %}
+ </div>
+
+ <code id ="code_{{player_id}}" >
+ <div class="ldt_player_code"><pre>
+{{ player_embed_rendered }}<br/>
+ </pre></div>
+ </code>
+
+
+ <a href="{{json_url}}?escape=true&mimetype=text/plain" class="ldt_json_link" >{% trans 'clik here to see the project content' %}</a>
+
+ <code id ="json_{{player_id}}" ><pre>
+ <div id="res_link_{{player_id}}" class="ldt_player_code" style="display: none;">
+ </div>
+ </pre></code>
+ </body>
+</html>
+
--- a/web/eulalie/templates/eulalie/partial/embed.html Fri Jun 11 00:25:17 2010 +0200
+++ b/web/eulalie/templates/eulalie/partial/embed.html Sat Jun 12 00:33:37 2010 +0200
@@ -1,5 +1,5 @@
<div id="{{ player_id }}">
</div>
<script type="text/javascript">
- playerLdt(550,310, "{{ json_url }}","{{ player_id }}");
+ playerLdt(550,310, "{{ json_url }}","{{ player_id }}","{{WEB_URL}}{{MEDIA_URL}}swf/player.swf");
</script>
\ No newline at end of file
--- a/web/eulalie/templates/eulalie/partial/embed_popup.html Fri Jun 11 00:25:17 2010 +0200
+++ /dev/null Thu Jan 01 00:00:00 1970 +0000
@@ -1,3 +0,0 @@
-<div class="player_ldt">
-{% include "embed.html" %}
-</div>
\ No newline at end of file
--- a/web/eulalie/templates/eulalie/workspace.html Fri Jun 11 00:25:17 2010 +0200
+++ b/web/eulalie/templates/eulalie/workspace.html Sat Jun 12 00:33:37 2010 +0200
@@ -1,45 +1,65 @@
{% extends "base.html" %}
{% load i18n %}
-{% load render_partial %}
-{# {% url ldt.ldt_utils.views.project_json_externalid content.external_id as json_url %} #}
-{# {% render_partial "embed_popup.html" player_id:"1234" json_url:json_url %} #}
{% block js_declaration %}
{{block.super}}
<script type="text/javascript">
$(document).ready(function(){
- $('.ldt_link').nyroModal({
- type: 'iframe',
- forceType: 'iframe',
- height:662,
- width:1022,
- bgColor: 'rgb(239, 239, 239)',
- padding: 5,
- titleFromIframe: false
- });
- $('.ldt_link_create').nyroModal({
- type: 'iframe',
- forceType: 'iframe',
- height:662,
- width:1022,
- bgColor: 'rgb(239, 239, 239)',
- padding: 5,
- titleFromIframe: false,
- beforeHideContent: function(elts, settings, callback){
- try {
- var res = $('#ldtInitSwf',$('#nyroModalIframe').contents());
- if(res.length > 0)
- {
- res.get(0).forceSave();
- }
- }
- catch(err)
- {
- // do nothing
- }
- callback();
- }
- });
+
+ $('.ldt_link').nyroModal({
+ type: 'iframe',
+ forceType: 'iframe',
+ height:662,
+ width:1022,
+ bgColor: 'rgb(239, 239, 239)',
+ padding: 5,
+ titleFromIframe: false
+ });
+
+ $('.ldt_link_create').nyroModal({
+ type: 'iframe',
+ forceType: 'iframe',
+ height:662,
+ width:1022,
+ bgColor: 'rgb(239, 239, 239)',
+ padding: 5,
+ titleFromIframe: false,
+ beforeHideContent: function(elts, settings, callback){
+ try {
+ var res = $('#ldtInitSwf',$('#nyroModalIframe').contents());
+ if(res.length > 0)
+ {
+ res.get(0).forceSave();
+ }
+ }
+ catch(err)
+ {
+ // do nothing
+ }
+ callback();
+ }
+ });
+
+ $('.ldt_link_embed').click(function(e) {
+ e.preventDefault();
+ link = $(e.target);
+ json_url = link.attr("href");
+ player_id = link.attr("id");
+ /*$.nyroModalSettings({
+ ajax: { data: ({ json_url:json_url, player_id:player_id }) }
+ });*/
+ $.nyroModalManual({
+ type: 'iframe',
+ forceType: 'iframe',
+ titleFromIframe: false,
+ height:662,
+ width:650,
+ bgColor: 'rgb(239, 239, 239)',
+ padding: 5,
+ url: '{% url eulalie.views.popup_embed %}?json_url='+escape(json_url)+'&player_id='+escape(player_id),
+ });
+ return false;
+ });
});
</script>
@@ -60,7 +80,9 @@
<td>{{ content.title }}</td>
<td><a href="{% url ldt.ldt_utils.views.index content.iri_id %}" class="ldt_link">{% trans "open ldt" %}</a></td>
<td><a href="{% url ldt.ldt_utils.views.create_project content.iri_id %}" class="ldt_link_create">{% trans "create project" %}</a></td>
- <td><a href="{% url ldt.ldt_utils.views.project_json_externalid content.external_id %}" class="ldt_link">{% trans "link json by externalid" %}</a></td>
+ {% url ldt.ldt_utils.views.project_json_externalid content.external_id as json_url_externalid %}
+ <td><a href="{{json_url_externalid}}" class="ldt_link_embed" id="player_project_{{content.iri_id}}">{% trans "link json by externalid" %}</a>
+ </td>
</tr>
{% endfor %}
</table>
@@ -74,7 +96,8 @@
<td>{{ project.title }}</td>
<td><a href="{% url ldt.ldt_utils.views.indexProject project.ldt_id %}" class="ldt_link">{% trans "open ldt" %}</a></td>
<td><a href="{% url ldt.ldt_utils.views.copy_project project.ldt_id %}" class="ldt_link_create">{% trans "copy project" %}</a></td>
- <td><a href="{% url ldt.ldt_utils.views.project_json_id project.ldt_id %}" class="ldt_link">{% trans "link json by id" %}</a></td>
+ {% url ldt.ldt_utils.views.project_json_id project.ldt_id as json_url_id %}
+ <td><a href="{{json_url_id}}" class="ldt_link_embed" id="player_project_{{project.ldt_id}}">{% trans "link json by id" %}</a>
</tr>
{% endfor %}
</table>
--- a/web/eulalie/templatetags/render_partial.py Fri Jun 11 00:25:17 2010 +0200
+++ /dev/null Thu Jan 01 00:00:00 1970 +0000
@@ -1,36 +0,0 @@
-from django import template
-
-register = template.Library()
-
-class PartialNode(template.Node):
- def __init__(self, partial, params):
- self.partial = partial
- self.params = params
-
- def render(self, context):
- context_params = {}
- for k, v in self.params.items():
- try:
- context_params[k] = eval(v)
- except:
- context_params[k] = template.Variable(v).resolve(context)
-
- t = template.loader.get_template('partials/%s' % self.partial)
- return t.render(template.Context(context_params))
-
-@register.tag
-def render_partial(parser, token):
- parts = token.split_contents()
- params = {}
- try:
- tag_name, partial = parts[:2]
- if partial.startswith('"'): partial = partial[1:-1]
- for p in parts[2:]:
- k, v = p.split(':')
- params[k] = v
-
- except ValueError:
- raise template.TemplateSyntaxError, '%r tag requires at least a single argument and no ' \
- 'spaces in name:value list' % parts[0]
-
- return PartialNode(partial, params)
\ No newline at end of file
--- a/web/eulalie/urls.py Fri Jun 11 00:25:17 2010 +0200
+++ b/web/eulalie/urls.py Sat Jun 12 00:33:37 2010 +0200
@@ -23,4 +23,5 @@
(r'^accounts/', include('registration.backends.default.urls')),
(r'^/?$', "eulalie.views.workspace"),
+ (r'^embedpopup/?$', "eulalie.views.popup_embed"),
)
--- a/web/eulalie/views.py Fri Jun 11 00:25:17 2010 +0200
+++ b/web/eulalie/views.py Sat Jun 12 00:33:37 2010 +0200
@@ -1,6 +1,8 @@
from django.shortcuts import render_to_response
from django.contrib.auth.decorators import login_required
from django.template import RequestContext
+from django.utils.html import escape
+from django.template.loader import render_to_string
from ldt.ldt_utils.models import Content, Project
@@ -17,3 +19,16 @@
return render_to_response("eulalie/workspace.html",
{'contents': content_list, 'projects': project_list},
context_instance=RequestContext(request))
+
+def popup_embed(request):
+
+ json_url = request.GET.get("json_url")
+ player_id = request.GET.get("player_id")
+
+
+ embed_rendered = escape(render_to_string('eulalie/partial/embed.html', {'json_url':json_url,'player_id':player_id}, context_instance=RequestContext(request)))
+
+
+ return render_to_response("eulalie/embed_popup.html",
+ {'json_url':json_url,'player_id':player_id, 'player_embed_rendered':embed_rendered},
+ context_instance=RequestContext(request))
--- a/web/ldt/ldt_utils/templates/ldt/ldt_utils/init_ldt.html Fri Jun 11 00:25:17 2010 +0200
+++ b/web/ldt/ldt_utils/templates/ldt/ldt_utils/init_ldt.html Sat Jun 12 00:33:37 2010 +0200
@@ -7,9 +7,6 @@
<meta http-equiv="Expires" content="-1" />
<title>Ligne de Temps - IRI</title>
<script type="text/javascript" src="{{MEDIA_URL}}js/swfobject.js"></script>
-<script type="text/javascript">
-
- </script>
</head>
<body id="init_ldt_view">
--- a/web/ldt/ldt_utils/views.py Fri Jun 11 00:25:17 2010 +0200
+++ b/web/ldt/ldt_utils/views.py Sat Jun 12 00:33:37 2010 +0200
@@ -7,6 +7,7 @@
from django.conf import settings
from django.core import serializers
from django.utils import simplejson
+from django.utils.html import escape
from fileimport import *
from forms import LdtImportForm, LdtAddForm, SearchForm, AddProjectForm, CopyProjectForm
from ldt.core.models import Owner
@@ -221,6 +222,11 @@
indent = int(indent)
callback = request.REQUEST.get("callback")
+ escape_str = request.REQUEST.get("escape")
+ escape_bool = False
+ if escape_str:
+ escape_bool = {'true': True, 'false': False, "0": False, "1": True}.get(escape_str.lower())
+
ps = ProjectSerializer(project)
project_dict = ps.serialize_to_cinelab()
@@ -230,6 +236,9 @@
if callback is not None:
json_str = "%s(%s)" % (callback,json_str)
+ if escape_bool:
+ json_str = escape(json_str)
+
resp.write(json_str)
return resp
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/custom_player.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,57 @@
+#demo-frame > div.demo { padding: 5px !important; };
+.iri-chapter{
+ padding-top:10px;
+ padding-bottom:5px;
+ border-left:solid 1px #aaaaaa;
+ border-right:solid 1px #aaaaaa;'
+}
+
+.tooltip {
+ display:none;
+ background:transparent url(css/jq-css/tooltip/white_arrow.png);
+ font-size:12px;
+ height:100px;
+ width:180px;
+ padding:10px;
+ padding-left:15px;
+ padding-right:15px;
+ color:#000;
+}
+
+#Annotations{
+ padding-left:5px;
+ width:470px;
+ float:left;
+}
+#ldtSaTitle{
+ padding-top:2px;
+ padding-bottom:5px;
+ font-size:18px;
+ color:#FFF;
+ height:22p;
+}
+#ldtSaDescription{
+ font-size:12px;
+ color:#FFF;
+}
+#ShowAnnotation{
+ position:absolute;
+ z-index: 999;
+ padding:5px;
+ background:url(css/custom/images/transBlack.png);
+}
+
+#ldtPlaceHolder{
+ position:absolue;
+ float:none;
+}
+.ldtControl1{
+ width:70px;
+ float:left;
+}
+.ldtControl2{
+ padding-left:10px;
+ width:70px;
+ float:left;
+}
+
Binary file web/static/css/jq-css/custom-theme/images/trans.png has changed
Binary file web/static/css/jq-css/custom-theme/images/ui-bg_flat_0_aaaaaa_40x100.png has changed
Binary file web/static/css/jq-css/custom-theme/images/ui-bg_glass_55_fbf9ee_1x400.png has changed
Binary file web/static/css/jq-css/custom-theme/images/ui-bg_glass_65_ffffff_1x400.png has changed
Binary file web/static/css/jq-css/custom-theme/images/ui-bg_glass_75_dadada_1x400.png has changed
Binary file web/static/css/jq-css/custom-theme/images/ui-bg_glass_75_e6e6e6_1x400.png has changed
Binary file web/static/css/jq-css/custom-theme/images/ui-bg_glass_75_ffffff_1x400.png has changed
Binary file web/static/css/jq-css/custom-theme/images/ui-bg_highlight-soft_75_cccccc_1x100.png has changed
Binary file web/static/css/jq-css/custom-theme/images/ui-bg_inset-soft_95_fef1ec_1x100.png has changed
Binary file web/static/css/jq-css/custom-theme/images/ui-icons_222222_256x240.png has changed
Binary file web/static/css/jq-css/custom-theme/images/ui-icons_2e83ff_256x240.png has changed
Binary file web/static/css/jq-css/custom-theme/images/ui-icons_454545_256x240.png has changed
Binary file web/static/css/jq-css/custom-theme/images/ui-icons_888888_256x240.png has changed
Binary file web/static/css/jq-css/custom-theme/images/ui-icons_cd0a0a_256x240.png has changed
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/custom-theme/jquery-ui-1.8.1.custom.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,486 @@
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* To view and modify this theme, visit http://jqueryui.com/themeroller/?ctl=themeroller
+*/
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Verdana,Arial,sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_75_ffffff_1x400.png) 50% 50% repeat-x; color: #222222; }
+.ui-widget-content a { color: #222222; }
+.ui-widget-header { border: 1px solid #aaaaaa; background: #cccccc url(images/ui-bg_highlight-soft_75_cccccc_1x100.png) 50% 50% repeat-x; color: #222222; font-weight: bold; }
+.ui-widget-header a { color: #222222; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3; background: #e6e6e6 url(images/ui-bg_glass_75_e6e6e6_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #555555; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999; background: #dadada url(images/ui-bg_glass_75_dadada_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: normal; color: #212121; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/ui-bg_glass_55_fbf9ee_1x400.png) 50% 50% repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/ui-bg_inset-soft_95_fef1ec_1x100.png) 50% bottom repeat-x; color: #cd0a0a; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+.ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/ui-bg_flat_0_aaaaaa_40x100.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; border-radius: 8px; }/* Resizable
+----------------------------------*/
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* Accordion
+----------------------------------*/
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+/* IE7-/Win - Fix extra vertical space in lists */
+.ui-accordion a { zoom: 1; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }/* Autocomplete
+----------------------------------*/
+.ui-autocomplete { position: absolute; cursor: default; }
+.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/* Menu
+----------------------------------*/
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
+/* Button
+----------------------------------*/
+
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+
+
+
+
+
+/* Dialog
+----------------------------------*/
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/* Slider
+----------------------------------*/
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/* Tabs
+----------------------------------*/
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
+/* Datepicker
+----------------------------------*/
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/* Progressbar
+----------------------------------*/
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,334 @@
+body {
+ font-size: 62.5%;
+}
+
+table {
+ font-size: 1em;
+}
+
+/* Site
+ -------------------------------- */
+
+body {
+ font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
+}
+
+/* Layout
+ -------------------------------- */
+
+.layout-grid {
+ width: 960px;
+}
+
+.layout-grid td {
+ vertical-align: top;
+}
+
+.layout-grid td.left-nav {
+ width: 140px;
+}
+
+.layout-grid td.normal {
+ border-left: 1px solid #eee;
+ padding: 20px 24px;
+ font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
+}
+
+.layout-grid td.demos {
+ background: url('/images/demos_bg.jpg') no-repeat;
+ height: 337px;
+ overflow: hidden;
+}
+
+/* Normal
+ -------------------------------- */
+
+.normal h3,
+.normal h4 {
+ margin: 0;
+ font-weight: normal;
+}
+
+.normal h3 {
+ padding: 0 0 9px;
+ font-size: 1.8em;
+}
+
+.normal h4 {
+ padding-bottom: 21px;
+ border-bottom: 1px dashed #999;
+ font-size: 1.2em;
+ font-weight: bold;
+}
+
+.normal p {
+ font-size: 1.2em;
+}
+
+/* Demos */
+
+.demos-nav, .demos-nav dt, .demos-nav dd, .demos-nav ul, .demos-nav li {
+ margin: 0;
+ padding: 0
+}
+
+.demos-nav {
+ float: left;
+ width: 170px;
+ font-size: 1.3em;
+}
+
+.demos-nav dt,
+.demos-nav h4 {
+ margin: 0;
+ padding: 0;
+ font: normal 1.1em "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
+ color: #e87b10;
+}
+
+.demos-nav dt,
+.demos-nav h4 {
+ margin-top: 1.5em;
+ margin-bottom: 0;
+ padding-left: 8px;
+ padding-bottom:5px;
+ line-height: 1.2em;
+ border-bottom: 1px solid #F4F4F4;
+}
+
+.demos-nav dd a,
+.demos-nav li a {
+ border-bottom: 1px solid #F4F4F4;
+ display:block;
+ padding: 4px 3px 4px 8px;
+ font-size: 90%;
+ text-decoration: none;
+ color: #555 ;
+ margin:2px 0;
+ height:13px;
+}
+
+.demos-nav dd a:hover,
+.demos-nav dd a:focus,
+.demos-nav dd a:hover,
+.demos-nav dd a:focus {
+ background: #f3f3f3;
+ color:#000;
+ -moz-border-radius: 5px; -webkit-border-radius: 5px;
+}
+ .demos-nav dd a.selected {
+ background: #555;
+ color:#ffffff;
+ -moz-border-radius: 5px; -webkit-border-radius: 5px;
+}
+
+
+/* new styles for demo pages, added by Filament 12.29.08
+eventually we should convert the font sizes to ems -- using px for now to minimize style conflicts
+*/
+
+.normal h3.demo-header { font-size:32px; padding:0 0 5px; border-bottom:1px solid #eee; text-transform: capitalize; }
+.normal h4.demo-subheader { font-size:10px; text-transform: uppercase; color:#999; padding:8px 0 3px; border:0; margin:0; }
+.normal a:link,
+.normal a:visited { color:#1b75bb; text-decoration:none; }
+.normal a:hover,
+.normal a:active { color:#0b559b; }
+
+#demo-config { padding:20px 0 0; }
+
+#demo-frame { float:left; width:540px; height:380px; border:1px solid #ddd; overflow: auto; position: relative; }
+#demo-frame h3, #demo-frame h4 { padding: 0; font-weight: bold; font-size: 1em; }
+
+#demo-config-menu { float:right; width:180px; }
+#demo-config-menu h4 { font-size:13px; color:#666; font-weight:normal; border:0; padding-left:18px; }
+
+#demo-config-menu ul { list-style: none; padding: 0; margin: 0; }
+
+#demo-config-menu li { font-size:12px; padding:0 0 0 10px; margin:3px 0; zoom: 1; }
+
+#demo-config-menu li a:link,
+#demo-config-menu li a:visited { display:block; padding:1px 8px 4px; border-bottom:1px dotted #b3b3b3; }
+* html #demo-config-menu li a:link,
+* html #demo-config-menu li a:visited { padding:1px 8px 2px; }
+#demo-config-menu li a:hover,
+#demo-config-menu li a:active { background-color:#f6f6f6; }
+
+#demo-config-menu li.demo-config-on { background: url(images/demo-config-on-tile.gif) repeat-x left center; }
+
+#demo-config-menu li.demo-config-on a:link,
+#demo-config-menu li.demo-config-on a:visited,
+#demo-config-menu li.demo-config-on a:hover,
+#demo-config-menu li.demo-config-on a:active { background: url(images/demo-config-on.gif) no-repeat left; padding-left:18px; color:#fff; border:0; margin-left:-10px; margin-top: 0px; margin-bottom: 0px; }
+
+#demo-source, #demo-notes {
+ clear: both;
+ padding: 20px 0 0;
+ font-size: 1.3em;
+}
+
+#demo-notes { width:520px; color:#333; font-size: 1em; }
+#demo-notes p code, .demo-description p code { padding: 0; font-weight: bold; }
+#demo-source pre, #demo-source code { padding: 0; }
+code, pre { padding:8px 0 8px 20px ; font-size: 1.2em; line-height:130%; }
+
+#demo-source a:link,
+#demo-source a:visited,
+#demo-source a:hover,
+#demo-source a:active { font-size:12px; padding-left:13px; background-position: left center; background-repeat: no-repeat; }
+
+#demo-source a.source-open:link,
+#demo-source a.source-open:visited,
+#demo-source a.source-open:hover,
+#demo-source a.source-open:active { background-image: url(images/demo-spindown-open.gif); }
+
+#demo-source a.source-closed:link,
+#demo-source a.source-closed:visited,
+#demo-source a.source-closed:hover,
+#demo-source a.source-closed:active { background-image: url(images/demo-spindown-closed.gif); }
+
+div.demo {
+ padding:12px;
+ font-family: "Trebuchet MS", "Arial", "Helvetica", "Verdana", "sans-serif";
+}
+
+div.demo h3.docs { clear:left; font-size:12px; font-weight:normal; padding:0 0 1em; margin:0; }
+
+div.demo-description {
+ clear:both;
+ padding:12px;
+ font-family: "Trebuchet MS", "Arial", "Helvetica", "Verdana", "sans-serif";
+ font-size: 1.3em;
+ line-height: 1.4em;
+}
+
+.ui-draggable, .ui-droppable {
+ background-position: top left;
+}
+
+.left-nav .demos-nav {
+ padding-right: 10px;
+}
+
+#demo-link { font-size:11px; padding-top: 6px; clear: both; overflow: hidden; }
+#demo-link a span.ui-icon { float:left; margin-right:3px; }
+
+/* Component containers
+----------------------------------*/
+#widget-docs .ui-widget { font-family: Trebuchet MS,Verdana,Arial,sans-serif; font-size: 1em; }
+#widget-docs .ui-widget input, #widget-docs .ui-widget select, #widget-docs .ui-widget textarea, #widget-docs .ui-widget button { font-family: Trebuchet MS,Verdana,Arial,sans-serif; font-size: 1em; }
+#widget-docs .ui-widget-header { border: 1px solid #ffffff; background: #464646 url(images/464646_40x100_textures_01_flat_100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+#widget-docs .ui-widget-header a { color: #ffffff; }
+#widget-docs .ui-widget-content { border: 1px solid #ffffff; background: #ffffff url(images/ffffff_40x100_textures_01_flat_75.png) 50% 50% repeat-x; color: #222222; }
+#widget-docs .ui-widget-content a { color: #222222; }
+
+/* Interaction states
+----------------------------------*/
+#widget-docs .ui-state-default, #widget-docs .ui-widget-content #widget-docs .ui-state-default { border: 1px solid #666666; background: #555555 url(images/555555_40x100_textures_03_highlight_soft_75.png) 50% 50% repeat-x; font-weight: normal; color: #ffffff; outline: none; }
+#widget-docs .ui-state-default a { color: #ffffff; text-decoration: none; outline: none; }
+#widget-docs .ui-state-hover, #widget-docs .ui-widget-content #widget-docs .ui-state-hover, #widget-docs .ui-state-focus, #widget-docs .ui-widget-content #widget-docs .ui-state-focus { border: 1px solid #666666; background: #444444 url(images/444444_40x100_textures_03_highlight_soft_60.png) 50% 50% repeat-x; font-weight: normal; color: #ffffff; outline: none; }
+#widget-docs .ui-state-hover a { color: #ffffff; text-decoration: none; outline: none; }
+#widget-docs .ui-state-active, #widget-docs .ui-widget-content #widget-docs .ui-state-active { border: 1px solid #666666; background: #ffffff url(images/ffffff_40x100_textures_01_flat_65.png) 50% 50% repeat-x; font-weight: normal; color: #F6921E; outline: none; }
+#widget-docs .ui-state-active a { color: #F6921E; outline: none; text-decoration: none; }
+
+/* Interaction Cues
+----------------------------------*/
+#widget-docs .ui-state-highlight, #widget-docs .ui-widget-content #widget-docs .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/fbf9ee_40x100_textures_02_glass_55.png) 50% 50% repeat-x; color: #363636; }
+#widget-docs .ui-state-error, #widget-docs .ui-widget-content #widget-docs .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/fef1ec_40x100_textures_05_inset_soft_95.png) 50% bottom repeat-x; color: #cd0a0a; }
+#widget-docs .ui-state-error-text, #widget-docs .ui-widget-content #widget-docs .ui-state-error-text { color: #cd0a0a; }
+#widget-docs .ui-state-disabled, #widget-docs .ui-widget-content #widget-docs .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+#widget-docs .ui-priority-primary, #widget-docs .ui-widget-content #widget-docs .ui-priority-primary { font-weight: bold; }
+#widget-docs .ui-priority-secondary, #widget-docs .ui-widget-content #widget-docs .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+#demo-frame-wrapper .ui-icon, #widget-docs .ui-icon { width: 16px; height: 16px; background-image: url(images/222222_256x240_icons_icons.png); }
+#widget-docs .ui-widget-content .ui-icon {background-image: url(images/222222_256x240_icons_icons.png); }
+#widget-docs .ui-widget-header .ui-icon {background-image: url(images/222222_256x240_icons_icons.png); }
+#widget-docs .ui-state-default .ui-icon { background-image: url(images/888888_256x240_icons_icons.png); }
+#widget-docs .ui-state-hover .ui-icon, #widget-docs .ui-state-focus .ui-icon {background-image: url(images/454545_256x240_icons_icons.png); }
+#widget-docs .ui-state-active .ui-icon {background-image: url(images/454545_256x240_icons_icons.png); }
+#widget-docs .ui-state-highlight .ui-icon {background-image: url(images/2e83ff_256x240_icons_icons.png); }
+#widget-docs .ui-state-error .ui-icon, #widget-docs .ui-state-error-text .ui-icon {background-image: url(images/cd0a0a_256x240_icons_icons.png); }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+#widget-docs .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; }
+#widget-docs .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; }
+#widget-docs .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; }
+#widget-docs .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+#widget-docs .ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; }
+#widget-docs .ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+#widget-docs .ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+#widget-docs .ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; }
+#widget-docs .ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; }
+
+/* Overlays */
+#widget-docs .ui-widget-overlay { background: #aaaaaa url(images/aaaaaa_40x100_textures_01_flat_0.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+#widget-docs .ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/aaaaaa_40x100_textures_01_flat_0.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; }
+
+/*
+----------------------------------*/
+
+#widget-docs { margin:20px 0 0; border: none; }
+
+#widget-docs h2, #widget-docs h3, #widget-docs h4, #widget-docs p, #widget-docs ul, #widget-docs code { margin:0; padding:0; }
+#widget-docs code { display:block; color:#444; font-size:.9em; margin:0 0 1em; }
+#widget-docs code strong { color:#000; }
+#widget-docs p { margin:0 3em 1.2em 0; }
+#widget-docs p.intro { font-size:13px; color:#666; line-height:1.3; }
+#widget-docs ul { list-style-type: none; }
+
+#widget-docs h2 { font-size:16px; margin:1.2em 0 .5em; }
+#widget-docs h3 { font-size:14px; color:#e6820E; margin:1.5em 0 .5em; }
+.normal #widget-docs h4 { font-size:12px; color:#000; border:0; margin:0 0 .5em; }
+
+#docs-overview-main { width:400px; }
+#docs-overview-sidebar { float:right; width:200px; }
+#docs-overview-sidebar a span { color:#666; }
+#widget-docs #docs-overview-main p { margin-right:0; }
+#widget-docs #docs-overview-sidebar h4 { padding-left:0; }
+
+.docs-list-header { float:left; width:100%; margin:10px 0 0; border-bottom:1px solid #eee; }
+#widget-docs .docs-list-header h2 { float:left; margin:0; }
+#widget-docs .docs-list-header p { float:right; margin:5px 0; font-size:11px; }
+
+.docs-list { float:left; width:100%; padding:0 0 10px; }
+.docs-list .param-header { float:left; clear:left; width:100%; padding:8px 0; border-top:1px solid #eee; }
+#widget-docs .param-header h3, #widget-docs .param-header p { margin:0; float:left; }
+#widget-docs .param-header h3 { width:50%; }
+#widget-docs .param-header h3 span { background: url(images/demo-spindown-closed.gif) no-repeat left; padding-left:13px; }
+#widget-docs .param-open .param-header h3 span { background: url(images/demo-spindown-open.gif) no-repeat left; }
+#widget-docs .param-header p { width:24%; }
+#widget-docs .param-header p.param-type span { background: url(images/icon-docs-info.gif) no-repeat left; cursor:pointer; border-bottom:1px dashed #ccc; padding-left:15px; }
+
+.param-details { padding-left:13px; }
+.param-args { margin:0 0 1.5em; border-top:1px dotted #ccc;}
+.param-args td { padding:3px 30px 3px 5px; border-bottom:1px dotted #ccc; }
+
+
+/* overrides for ui-tab styles */
+#widget-docs ul.ui-tabs-nav { padding:0 0 0 8px; }
+#widget-docs .ui-tabs-nav li { margin:5px 5px 0 0; }
+
+#widget-docs .ui-tabs-nav li a:link,
+#widget-docs .ui-tabs-nav li a:visited,
+#widget-docs .ui-tabs-nav li a:hover,
+#widget-docs .ui-tabs-nav li a:active { font-size:14px; padding:4px 1.2em 3px; color:#fff; }
+
+#widget-docs .ui-tabs-nav li.ui-tabs-selected a:link,
+#widget-docs .ui-tabs-nav li.ui-tabs-selected a:visited,
+#widget-docs .ui-tabs-nav li.ui-tabs-selected a:hover,
+#widget-docs .ui-tabs-nav li.ui-tabs-selected a:active { color:#e6820E; }
+
+#widget-docs .ui-tabs-panel { padding:20px 9px; font-size:12px; line-height:1.4; color:#000; }
+
+#widget-docs .ui-widget-content a:link,
+#widget-docs .ui-widget-content a:visited { color:#1b75bb; text-decoration:none; }
+#widget-docs .ui-widget-content a:hover,
+#widget-docs .ui-widget-content a:active { color:#0b559b; }
+
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/accordion/collapsible.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,60 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Accordion - Collapse content</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#accordion").accordion({
+ collapsible: true
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="accordion">
+ <h3><a href="#">Section 1</a></h3>
+ <div>
+ <p>Mauris mauris ante, blandit et, ultrices a, suscipit eget, quam. Integer ut neque. Vivamus nisi metus, molestie vel, gravida in, condimentum sit amet, nunc. Nam a nibh. Donec suscipit eros. Nam mi. Proin viverra leo ut odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.</p>
+ </div>
+ <h3><a href="#">Section 2</a></h3>
+ <div>
+ <p>Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In suscipit faucibus urna. </p>
+ </div>
+ <h3><a href="#">Section 3</a></h3>
+ <div>
+ <p>Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis. Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui. </p>
+ <ul>
+ <li>List item one</li>
+ <li>List item two</li>
+ <li>List item three</li>
+ </ul>
+ </div>
+ <h3><a href="#">Section 4</a></h3>
+ <div>
+ <p>Cras dictum. Pellentesque habitant morbi tristique senectus et netus et malesuada fames ac turpis egestas. Vestibulum ante ipsum primis in faucibus orci luctus et ultrices posuere cubilia Curae; Aenean lacinia mauris vel est. </p><p>Suspendisse eu nisl. Nullam ut libero. Integer dignissim consequat lectus. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. </p>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+
+<p>By default, accordions always keep one section open. To allow for all sections to be be collapsible, set the <code>collapsible</code> option to true. Click on the currently open section to collapse its content pane.</p>
+
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/accordion/custom-icons.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,71 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Accordion - Customize icons</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.button.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ var icons = {
+ header: "ui-icon-circle-arrow-e",
+ headerSelected: "ui-icon-circle-arrow-s"
+ };
+ $("#accordion").accordion({
+ icons: icons
+ });
+ $("#toggle").button().toggle(function() {
+ $("#accordion").accordion("option", "icons", false);
+ }, function() {
+ $("#accordion").accordion("option", "icons", icons);
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="accordion">
+ <h3><a href="#">Section 1</a></h3>
+ <div>
+ <p>Mauris mauris ante, blandit et, ultrices a, suscipit eget, quam. Integer ut neque. Vivamus nisi metus, molestie vel, gravida in, condimentum sit amet, nunc. Nam a nibh. Donec suscipit eros. Nam mi. Proin viverra leo ut odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.</p>
+ </div>
+ <h3><a href="#">Section 2</a></h3>
+ <div>
+ <p>Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In suscipit faucibus urna. </p>
+ </div>
+ <h3><a href="#">Section 3</a></h3>
+ <div>
+ <p>Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis. Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui. </p>
+ <ul>
+ <li>List item one</li>
+ <li>List item two</li>
+ <li>List item three</li>
+ </ul>
+ </div>
+ <h3><a href="#">Section 4</a></h3>
+ <div>
+ <p>Cras dictum. Pellentesque habitant morbi tristique senectus et netus et malesuada fames ac turpis egestas. Vestibulum ante ipsum primis in faucibus orci luctus et ultrices posuere cubilia Curae; Aenean lacinia mauris vel est. </p><p>Suspendisse eu nisl. Nullam ut libero. Integer dignissim consequat lectus. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. </p>
+ </div>
+</div>
+
+<button id="toggle">Toggle icons</button>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+
+<p>Customize the header icons with the <code>icons</code> option, which accepts classes for the header's default and selected (open) state. Use any class from the UI CSS framework, or create custom classes with background images.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/accordion/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,85 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Accordion - Default functionality</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#accordion").accordion();
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="accordion">
+ <h3><a href="#">Section 1</a></h3>
+ <div>
+ <p>
+ Mauris mauris ante, blandit et, ultrices a, suscipit eget, quam. Integer
+ ut neque. Vivamus nisi metus, molestie vel, gravida in, condimentum sit
+ amet, nunc. Nam a nibh. Donec suscipit eros. Nam mi. Proin viverra leo ut
+ odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.
+ </p>
+ </div>
+ <h3><a href="#">Section 2</a></h3>
+ <div>
+ <p>
+ Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet
+ purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor
+ velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In
+ suscipit faucibus urna.
+ </p>
+ </div>
+ <h3><a href="#">Section 3</a></h3>
+ <div>
+ <p>
+ Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis.
+ Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero
+ ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis
+ lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui.
+ </p>
+ <ul>
+ <li>List item one</li>
+ <li>List item two</li>
+ <li>List item three</li>
+ </ul>
+ </div>
+ <h3><a href="#">Section 4</a></h3>
+ <div>
+ <p>
+ Cras dictum. Pellentesque habitant morbi tristique senectus et netus
+ et malesuada fames ac turpis egestas. Vestibulum ante ipsum primis in
+ faucibus orci luctus et ultrices posuere cubilia Curae; Aenean lacinia
+ mauris vel est.
+ </p>
+ <p>
+ Suspendisse eu nisl. Nullam ut libero. Integer dignissim consequat lectus.
+ Class aptent taciti sociosqu ad litora torquent per conubia nostra, per
+ inceptos himenaeos.
+ </p>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+<p>
+Click headers to expand/collapse content that is broken into logical sections, much like tabs.
+Optionally, toggle sections open/closed on mouseover.
+</p>
+<p>
+The underlying HTML markup is a series of headers (H3 tags) and content divs so the content is
+usable without JavaScript.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/accordion/fillspace.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,79 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Accordion - Fill space</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#accordion").accordion({
+ fillSpace: true
+ });
+ });
+ $(function() {
+ $("#accordionResizer").resizable({
+ resize: function() {
+ $("#accordion").accordion("resize");
+ },
+ minHeight: 140
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<h3 class="docs">Resize the outer container:</h3>
+
+<div id="accordionResizer" style="padding:10px; width:350px; height:220px;" class="ui-widget-content">
+
+<div id="accordion">
+ <h3><a href="#">Section 1</a></h3>
+ <div>
+ <p>Mauris mauris ante, blandit et, ultrices a, suscipit eget, quam. Integer ut neque. Vivamus nisi metus, molestie vel, gravida in, condimentum sit amet, nunc. Nam a nibh. Donec suscipit eros. Nam mi. Proin viverra leo ut odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.</p>
+ </div>
+ <h3><a href="#">Section 2</a></h3>
+ <div>
+ <p>Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In suscipit faucibus urna. </p>
+ </div>
+ <h3><a href="#">Section 3</a></h3>
+ <div>
+ <p>Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis. Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui. </p>
+ <ul>
+ <li>List item one</li>
+ <li>List item two</li>
+ <li>List item three</li>
+ </ul>
+ </div>
+ <h3><a href="#">Section 4</a></h3>
+ <div>
+ <p>Cras dictum. Pellentesque habitant morbi tristique senectus et netus et malesuada fames ac turpis egestas. Vestibulum ante ipsum primis in faucibus orci luctus et ultrices posuere cubilia Curae; Aenean lacinia mauris vel est. </p><p>Suspendisse eu nisl. Nullam ut libero. Integer dignissim consequat lectus. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. </p>
+ </div>
+</div>
+
+<span class="ui-icon ui-icon-grip-dotted-horizontal" style="margin:2px auto;"></span>
+</div><!-- End accordionResizer -->
+
+<div style="margin-top:7px; padding:10px; width:350px; height:50px;" class="ui-widget-content">I'm another panel</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+
+<p>Because the accordion is comprised of block-level elements, by default its width fills the available horizontal space. To fill the vertical space allocated by its container, set the boolean <code>fillSpace</code> option to true, and the script will automatically set the dimensions of the accordion to the height of its parent container. The accordion will also resize with its container if the container is <code>resizable</code>.</p>
+
+</div><!-- End demo-description -->
+
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/accordion/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,22 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Accordion Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+ <div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ <li><a href="fillspace.html">Fill space</a></li>
+ <li><a href="no-auto-height.html">No auto height</a></li>
+ <li><a href="collapsible.html">Collapse content</a></li>
+ <li><a href="mouseover.html">Open on mouseover</a></li>
+ <li><a href="custom-icons.html">Customize icons</a></li>
+ <li><a href="sortable.html">Sortable</a></li>
+ </ul>
+ </div>
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/accordion/mouseover.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,59 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Accordion - Open on mouseover</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#accordion").accordion({
+ event: "mouseover"
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="accordion">
+ <h3><a href="#">Section 1</a></h3>
+ <div>
+ <p>Mauris mauris ante, blandit et, ultrices a, suscipit eget, quam. Integer ut neque. Vivamus nisi metus, molestie vel, gravida in, condimentum sit amet, nunc. Nam a nibh. Donec suscipit eros. Nam mi. Proin viverra leo ut odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.</p>
+ </div>
+ <h3><a href="#">Section 2</a></h3>
+ <div>
+ <p>Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In suscipit faucibus urna. </p>
+ </div>
+ <h3><a href="#">Section 3</a></h3>
+ <div>
+ <p>Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis. Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui. </p>
+ <ul>
+ <li>List item one</li>
+ <li>List item two</li>
+ <li>List item three</li>
+ </ul>
+ </div>
+ <h3><a href="#">Section 4</a></h3>
+ <div>
+ <p>Cras dictum. Pellentesque habitant morbi tristique senectus et netus et malesuada fames ac turpis egestas. Vestibulum ante ipsum primis in faucibus orci luctus et ultrices posuere cubilia Curae; Aenean lacinia mauris vel est. </p><p>Suspendisse eu nisl. Nullam ut libero. Integer dignissim consequat lectus. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. </p>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+
+<p>Toggle sections open/closed on mouseover with the <code>event</code> option. The default value for event is "click."</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/accordion/no-auto-height.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,63 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Accordion - No Auto Height</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#accordion").accordion({
+ autoHeight: false,
+ navigation: true
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="accordion">
+ <h3><a href="#section1">Section 1</a></h3>
+ <div>
+ <p>Mauris mauris ante, blandit et, ultrices a, susceros. Nam mi. Proin viverra leo ut odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.</p>
+ </div>
+ <h3><a href="#section2">Section 2</a></h3>
+ <div>
+ <p>Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In suscipit faucibus urna. </p>
+ </div>
+ <h3><a href="#section3">Section 3</a></h3>
+ <div>
+ <p>Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis. Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui. </p>
+ <ul>
+ <li>List item</li>
+ <li>List item</li>
+ <li>List item</li>
+ <li>List item</li>
+ <li>List item</li>
+ <li>List item</li>
+ <li>List item</li>
+ </ul>
+ <a href="#othercontent">Link to other content</a>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+
+<p>Setting <code>autoHeight: false</code> allows to accordion panels to keep their native height.</p>
+
+<p>In addition, the <code>navigation</code> option is enabled, opening the panel based on the current location, eg. no-auto-height.html#panel2 would open the second panel on page load. It also finds anchors within the content, so #othercontent will open the third section, as it contains a link with that href.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/accordion/sortable.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,83 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Accordion - Sortable</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ var stop = false;
+ $("#accordion h3").click(function(event) {
+ if (stop) {
+ event.stopImmediatePropagation();
+ event.preventDefault();
+ stop = false;
+ }
+ });
+ $("#accordion").accordion({
+ header: "> div > h3"
+ }).sortable({
+ axis: "y",
+ handle: "h3",
+ stop: function(event, ui) {
+ stop = true;
+ }
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="accordion">
+ <div>
+ <h3><a href="#">Section 1</a></h3>
+ <div>
+ <p>Mauris mauris ante, blandit et, ultrices a, suscipit eget, quam. Integer ut neque. Vivamus nisi metus, molestie vel, gravida in, condimentum sit amet, nunc. Nam a nibh. Donec suscipit eros. Nam mi. Proin viverra leo ut odio. Curabitur malesuada. Vestibulum a velit eu ante scelerisque vulputate.</p>
+ </div>
+ </div>
+ <div>
+ <h3><a href="#">Section 2</a></h3>
+ <div>
+ <p>Sed non urna. Donec et ante. Phasellus eu ligula. Vestibulum sit amet purus. Vivamus hendrerit, dolor at aliquet laoreet, mauris turpis porttitor velit, faucibus interdum tellus libero ac justo. Vivamus non quam. In suscipit faucibus urna. </p>
+ </div>
+ </div>
+ <div>
+ <h3><a href="#">Section 3</a></h3>
+ <div>
+ <p>Nam enim risus, molestie et, porta ac, aliquam ac, risus. Quisque lobortis. Phasellus pellentesque purus in massa. Aenean in pede. Phasellus ac libero ac tellus pellentesque semper. Sed ac felis. Sed commodo, magna quis lacinia ornare, quam ante aliquam nisi, eu iaculis leo purus venenatis dui. </p>
+ <ul>
+ <li>List item one</li>
+ <li>List item two</li>
+ <li>List item three</li>
+ </ul>
+ </div>
+ </div>
+ <div>
+ <h3><a href="#">Section 4</a></h3>
+ <div>
+ <p>Cras dictum. Pellentesque habitant morbi tristique senectus et netus et malesuada fames ac turpis egestas. Vestibulum ante ipsum primis in faucibus orci luctus et ultrices posuere cubilia Curae; Aenean lacinia mauris vel est. </p><p>Suspendisse eu nisl. Nullam ut libero. Integer dignissim consequat lectus. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. </p>
+ </div>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+
+<p>Drag the header to re-order panels.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/addClass/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,52 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects - addClass Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .toggler { width: 500px; height: 200px; position: relative;}
+ #button { padding: .5em 1em; text-decoration: none; }
+ #effect { width: 240px; padding: 1em; font-size: 1.2em; border: 1px solid #000; background: #eee; color: #333; }
+ #effect.newClass { text-indent: 40px; letter-spacing: .4em; width: 410px; height: 100px; padding: 30px; margin: 10px; font-size: 1.6em; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#button").click(function() {
+ $('#effect').addClass('newClass', 1000, callback);
+ return false;
+ });
+
+ function callback(){
+ setTimeout(function(){
+ $('#effect').removeClass('newClass');
+ }, 1500);
+ }
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="toggler">
+ <div id="effect" class=" ui-corner-all">
+ Etiam libero neque, luctus a, eleifend nec, semper at, lorem. Sed pede.
+ </div>
+</div>
+
+<a href="#" id="button" class="ui-state-default ui-corner-all">Run Effect</a>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>This demo adds a class which animates: text-indent, letter-spacing, width, height, padding, margin, and font-size.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/addClass/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,18 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/animate/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,53 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects - Animate Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .toggler { width: 500px; height: 200px; position: relative;}
+ #button { padding: .5em 1em; text-decoration: none; }
+ #effect { width: 240px; height: 135px; padding: 0.4em; position: relative; background: #fff; }
+ #effect h3 { margin: 0; padding: 0.4em; text-align: center; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#button").toggle(
+ function() {
+ $("#effect").animate({backgroundColor: '#aa0000', color: '#fff', width: 500}, 1000);
+ },
+ function() {
+ $("#effect").animate({backgroundColor: '#fff', color: '#000', width: 240}, 1000);
+ }
+ );
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="toggler">
+ <div id="effect" class="ui-widget-content ui-corner-all">
+ <h3 class="ui-widget-header ui-corner-all">Animate</h3>
+ <p>
+ Etiam libero neque, luctus a, eleifend nec, semper at, lorem. Sed pede. Nulla lorem metus, adipiscing ut, luctus sed, hendrerit vitae, mi.
+ </p>
+ </div>
+</div>
+
+<a href="#" id="button" class="ui-state-default ui-corner-all">Toggle Effect</a>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Click the button above to preview the effect.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/animate/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,18 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/autocomplete/categories.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,71 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Autocomplete Custom Data Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.autocomplete.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .ui-autocomplete-category {
+ font-weight:bold;
+ padding:.2em .4em;
+ margin:.8em 0 .2em;
+ line-height:1.5;
+ }
+ </style>
+ <script type="text/javascript">
+ $.widget("custom.catcomplete", $.ui.autocomplete, {
+ _renderMenu: function( ul, items ) {
+ var self = this,
+ currentCategory = "";
+ $.each( items, function( index, item ) {
+ if ( item.category != currentCategory ) {
+ ul.append( "<li class='ui-autocomplete-category'>" + item.category + "</li>" );
+ currentCategory = item.category;
+ }
+ self._renderItem( ul, item );
+ });
+ }
+ });
+ </script>
+ <script type="text/javascript">
+ $(function() {
+ var data = [
+ { label: "anders", category: "" },
+ { label: "andreas", category: "" },
+ { label: "antal", category: "" },
+ { label: "annhhx10", category: "Products" },
+ { label: "annk K12", category: "Products" },
+ { label: "annttop C13", category: "Products" },
+ { label: "anders andersson", category: "People" },
+ { label: "andreas andersson", category: "People" },
+ { label: "andreas johnson", category: "People" }
+ ];
+
+ $('#search').catcomplete({
+ delay: 0,
+ source: data
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+ <label for="search">Search: </label>
+ <input id="search" />
+</div><!-- End demo -->
+
+<div class="demo-description">
+<p>
+ A categorized search result. Try typing "a" or "n".
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/autocomplete/combobox.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,128 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Autocomplete Combobox Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.button.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.autocomplete.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ /* TODO shouldn't be necessary */
+ .ui-button { margin-left: -1px; }
+ .ui-button-icon-only .ui-button-text { padding: 0.35em; }
+ .ui-autocomplete-input { margin: 0; padding: 0.48em 0 0.47em 0.45em; }
+ </style>
+ <script type="text/javascript">
+ (function($) {
+ $.widget("ui.combobox", {
+ _create: function() {
+ var self = this;
+ var select = this.element.hide();
+ var input = $("<input>")
+ .insertAfter(select)
+ .autocomplete({
+ source: function(request, response) {
+ var matcher = new RegExp(request.term, "i");
+ response(select.children("option").map(function() {
+ var text = $(this).text();
+ if (this.value && (!request.term || matcher.test(text)))
+ return {
+ id: this.value,
+ label: text.replace(new RegExp("(?![^&;]+;)(?!<[^<>]*)(" + $.ui.autocomplete.escapeRegex(request.term) + ")(?![^<>]*>)(?![^&;]+;)", "gi"), "<strong>$1</strong>"),
+ value: text
+ };
+ }));
+ },
+ delay: 0,
+ change: function(event, ui) {
+ if (!ui.item) {
+ // remove invalid value, as it didn't match anything
+ $(this).val("");
+ return false;
+ }
+ select.val(ui.item.id);
+ self._trigger("selected", event, {
+ item: select.find("[value='" + ui.item.id + "']")
+ });
+
+ },
+ minLength: 0
+ })
+ .addClass("ui-widget ui-widget-content ui-corner-left");
+ $("<button> </button>")
+ .attr("tabIndex", -1)
+ .attr("title", "Show All Items")
+ .insertAfter(input)
+ .button({
+ icons: {
+ primary: "ui-icon-triangle-1-s"
+ },
+ text: false
+ }).removeClass("ui-corner-all")
+ .addClass("ui-corner-right ui-button-icon")
+ .click(function() {
+ // close if already visible
+ if (input.autocomplete("widget").is(":visible")) {
+ input.autocomplete("close");
+ return;
+ }
+ // pass empty string as value to search for, displaying all results
+ input.autocomplete("search", "");
+ input.focus();
+ });
+ }
+ });
+
+ })(jQuery);
+
+ $(function() {
+ $("#combobox").combobox();
+ $("#toggle").click(function() {
+ $("#combobox").toggle();
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+ <label>Your preferred programming language: </label>
+ <select id="combobox">
+ <option value="">Select one...</option>
+ <option value="a">asp</option>
+ <option value="c">c</option>
+ <option value="cpp">c++</option>
+ <option value="cf">coldfusion</option>
+ <option value="g">groovy</option>
+ <option value="h">haskell</option>
+ <option value="j">java</option>
+ <option value="js">javascript</option>
+ <option value="p1">perl</option>
+ <option value="p2">php</option>
+ <option value="p3">python</option>
+ <option value="r">ruby</option>
+ <option value="s">scala</option>
+ </select>
+</div>
+<button id="toggle">Show underlying select</button>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+<p>
+A custom widget built by composition of Autocomplete and Button. You can either type something into the field to get filtered suggestions based on your input, or use the button to get the full list of selections.
+</p>
+<p>
+The input is read from an existing select-element for progressive enhancement, passed to Autocomplete with a customized source-option.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/autocomplete/custom-data.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,97 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Autocomplete Custom Data Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.autocomplete.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #project-label {
+ display: block;
+ font-weight: bold;
+ margin-bottom: 1em;
+ }
+ #project-icon {
+ float: left;
+ height: 32px;
+ width: 32px;
+ }
+ #project-description {
+ margin: 0;
+ padding: 0;
+ }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ var projects = [
+ {
+ value: 'jquery',
+ label: 'jQuery',
+ desc: 'the write less, do more, JavaScript library',
+ icon: 'jquery_32x32.png'
+ },
+ {
+ value: 'jquery-ui',
+ label: 'jQuery UI',
+ desc: 'the official user interface library for jQuery',
+ icon: 'jqueryui_32x32.png'
+ },
+ {
+ value: 'sizzlejs',
+ label: 'Sizzle JS',
+ desc: 'a pure-JavaScript CSS selector engine',
+ icon: 'sizzlejs_32x32.png'
+ }
+ ];
+
+ $('#project').autocomplete({
+ minLength: 0,
+ source: projects,
+ focus: function(event, ui) {
+ $('#project').val(ui.item.label);
+ return false;
+ },
+ select: function(event, ui) {
+ $('#project').val(ui.item.label);
+ $('#project-id').val(ui.item.value);
+ $('#project-description').html(ui.item.desc);
+ $('#project-icon').attr('src', '../images/' + ui.item.icon);
+
+ return false;
+ }
+ })
+ .data( "autocomplete" )._renderItem = function( ul, item ) {
+ return $( "<li></li>" )
+ .data( "item.autocomplete", item )
+ .append( "<a>" + item.label + "<br>" + item.desc + "</a>" )
+ .appendTo( ul );
+ };
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+ <div id="project-label">Select a project (type "j" for a start):</div>
+ <img id="project-icon" src="../images/transparent_1x1.png" class="ui-state-default"/>
+ <input id="project"/>
+ <input type="hidden" id="project-id"/>
+ <p id="project-description"></p>
+</div><!-- End demo -->
+
+<div class="demo-description">
+<p>
+You can use your own custom data formats and displays by simply overriding the default focus and select actions.
+</p>
+<p>
+Try typing "j" to get a list of projects or just press the down arrow.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/autocomplete/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,43 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Autocomplete Default Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.autocomplete.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ var availableTags = ["c++", "java", "php", "coldfusion", "javascript", "asp", "ruby", "python", "c", "scala", "groovy", "haskell", "perl"];
+ $("#tags").autocomplete({
+ source: availableTags
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+ <label for="tags">Tags: </label>
+ <input id="tags" />
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+<p>
+The Autocomplete widgets provides suggestions while you type into the field. Here the suggestions are tags for programming languages, give "ja" (for Java or JavaScript) a try.
+</p>
+<p>
+The datasource is a simple JavaScript array, provided to the widget using the source-option.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/autocomplete/folding.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,64 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Autocomplete Accent Folding Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.autocomplete.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ var names = [ "Jörn Zaefferer", "Scott González", "John Resig" ];
+
+ var accentMap = {
+ 'á':'a',
+ 'ö':'o'
+ };
+ var normalize = function( term ) {
+ var ret = '';
+ for ( var i = 0; i < term.length; i++ ) {
+ ret += accentMap[ term.charAt(i) ] || term.charAt(i);
+ }
+ return ret;
+ };
+
+ $( "#developer" ).autocomplete({
+ source: function( request, response ) {
+ var matcher = new RegExp( $.ui.autocomplete.escapeRegex( request.term ), "i" );
+ response( $.grep( names, function( value ) {
+ value = value.label || value.value || value;
+ return matcher.test( value ) || matcher.test( normalize( value ) );
+ }) );
+ }
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+ <form>
+ <label for="developer">Developer: </label>
+ <input id="developer" />
+ </form>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+<p>
+The autocomplete field uses a custom source option which will match results that have accented characters even when the text field doesn't contain accented characters. However if the you type in accented characters in the text field it is smart enough not to show results that aren't accented.
+</p>
+<p>
+Try typing "Jo" to see "John" and "Jörn", then type "Jö" to see only "Jörn".
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/autocomplete/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,25 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Autocomplete Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+ <div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ <li><a href="remote.html">Remote datasource</a></li>
+ <li><a href="remote-with-cache.html">Remote with caching</a></li>
+ <li><a href="remote-jsonp.html">Remote JSONP datasource</a></li>
+ <li><a href="combobox.html">Combobox</a></li>
+ <li><a href="custom-data.html">Custom data and display</a></li>
+ <li><a href="xml.html">XML data parsed once</a></li>
+ <li><a href="categories.html">Categories</a></li>
+ <li><a href="multiple.html">Multiple values</a></li>
+ <li><a href="multiple-remote.html">Multiple, remote</a></li>
+ </ul>
+ </div>
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/autocomplete/london.xml Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,114 @@
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<geonames style="MEDIUM">
+<totalResultsCount>6987</totalResultsCount>
+<geoname>
+<name>London</name>
+<lat>51.5084152563931</lat>
+<lng>-0.125532746315002</lng>
+<geonameId>2643743</geonameId>
+<countryCode>GB</countryCode>
+<countryName>United Kingdom</countryName>
+
+<fcl>P</fcl>
+<fcode>PPLC</fcode>
+</geoname>
+<geoname>
+<name>London</name>
+<lat>42.983389283</lat>
+<lng>-81.233042387</lng>
+<geonameId>6058560</geonameId>
+<countryCode>CA</countryCode>
+<countryName>Canada</countryName>
+
+<fcl>P</fcl>
+<fcode>PPL</fcode>
+</geoname>
+<geoname>
+<name>East London</name>
+<lat>-33.0152850934643</lat>
+<lng>27.9116249084473</lng>
+<geonameId>1006984</geonameId>
+<countryCode>ZA</countryCode>
+<countryName>South Africa</countryName>
+
+<fcl>P</fcl>
+<fcode>PPL</fcode>
+</geoname>
+<geoname>
+<name>City</name>
+<lat>51.5133363996235</lat>
+<lng>-0.0890064239501953</lng>
+<geonameId>2643744</geonameId>
+<countryCode>GB</countryCode>
+<countryName>United Kingdom</countryName>
+
+<fcl>A</fcl>
+<fcode>ADM2</fcode>
+</geoname>
+<geoname>
+<name>London</name>
+<lat>37.1289771</lat>
+<lng>-84.0832646</lng>
+<geonameId>4298960</geonameId>
+<countryCode>US</countryCode>
+<countryName>United States</countryName>
+
+<fcl>P</fcl>
+<fcode>PPL</fcode>
+</geoname>
+<geoname>
+<name>The Tower of London</name>
+<lat>51.5082349601834</lat>
+<lng>-0.0763034820556641</lng>
+<geonameId>6286786</geonameId>
+<countryCode>GB</countryCode>
+<countryName>United Kingdom</countryName>
+
+<fcl>S</fcl>
+<fcode>CSTL</fcode>
+</geoname>
+<geoname>
+<name>London Reefs</name>
+<lat>8.85</lat>
+<lng>112.5333333</lng>
+<geonameId>1879967</geonameId>
+<countryCode> </countryCode>
+<countryName> </countryName>
+
+<fcl>U</fcl>
+<fcode>RFSU</fcode>
+</geoname>
+<geoname>
+<name>Greater London</name>
+<lat>51.5</lat>
+<lng>-0.1666667</lng>
+<geonameId>2648110</geonameId>
+<countryCode>GB</countryCode>
+<countryName>United Kingdom</countryName>
+
+<fcl>A</fcl>
+<fcode>ADM2</fcode>
+</geoname>
+<geoname>
+<name>London</name>
+<lat>46.1666667</lat>
+<lng>6.0166667</lng>
+<geonameId>2661811</geonameId>
+<countryCode>CH</countryCode>
+<countryName>Switzerland</countryName>
+
+<fcl>H</fcl>
+<fcode>STM</fcode>
+</geoname>
+<geoname>
+<name>London Borough of Islington</name>
+<lat>51.5333333</lat>
+<lng>-0.1333333</lng>
+<geonameId>3333156</geonameId>
+<countryCode>GB</countryCode>
+<countryName>United Kingdom</countryName>
+
+<fcl>A</fcl>
+<fcode>ADM2</fcode>
+</geoname>
+</geonames>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/autocomplete/multiple-remote.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,75 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Autocomplete multiple demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.autocomplete.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ function split(val) {
+ return val.split(/,\s*/);
+ }
+ function extractLast(term) {
+ return split(term).pop();
+ }
+
+ $("#birds").autocomplete({
+ source: function(request, response) {
+ $.getJSON("search.php", {
+ term: extractLast(request.term)
+ }, response);
+ },
+ search: function() {
+ // custom minLength
+ var term = extractLast(this.value);
+ if (term.length < 2) {
+ return false;
+ }
+ },
+ focus: function() {
+ // prevent value inserted on focus
+ return false;
+ },
+ select: function(event, ui) {
+ var terms = split( this.value );
+ // remove the current input
+ terms.pop();
+ // add the selected item
+ terms.push( ui.item.value );
+ // add placeholder to get the comma-and-space at the end
+ terms.push("");
+ this.value = terms.join(", ");
+ return false;
+ }
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+ <label for="birds">Birds: </label>
+ <input id="birds" size="50" />
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+<p>
+Usage: Enter at least two characters to get bird name suggestions. Select a value to continue adding more names.
+</p>
+<p>
+This is an example showing how to use the source-option along with some events to enable autocompleting multiple values into a single field.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/autocomplete/multiple.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,69 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Autocomplete multiple demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.autocomplete.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ var availableTags = ["c++", "java", "php", "coldfusion", "javascript", "asp", "ruby", "python", "c", "scala", "groovy", "haskell", "perl"];
+ function split(val) {
+ return val.split(/,\s*/);
+ }
+ function extractLast(term) {
+ return split(term).pop();
+ }
+
+ $("#tags").autocomplete({
+ minLength: 0,
+ source: function(request, response) {
+ // delegate back to autocomplete, but extract the last term
+ response($.ui.autocomplete.filter(availableTags, extractLast(request.term)));
+ },
+ focus: function() {
+ // prevent value inserted on focus
+ return false;
+ },
+ select: function(event, ui) {
+ var terms = split( this.value );
+ // remove the current input
+ terms.pop();
+ // add the selected item
+ terms.push( ui.item.value );
+ // add placeholder to get the comma-and-space at the end
+ terms.push("");
+ this.value = terms.join(", ");
+ return false;
+ }
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+ <label for="tags">Tag programming languages: </label>
+ <input id="tags" size="50" />
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+<p>
+Usage: Type something, eg. "j" to see suggestions for tagging with programming languages. Select a value, then continue typing to add more.
+</p>
+<p>
+This is an example showing how to use the source-option along with some events to enable autocompleting multiple values into a single field.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/autocomplete/remote-jsonp.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,86 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Autocomplete Remote JSONP datasource demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.autocomplete.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ function log(message) {
+ $("<div/>").text(message).prependTo("#log");
+ $("#log").attr("scrollTop", 0);
+ }
+
+ $("#city").autocomplete({
+ source: function(request, response) {
+ $.ajax({
+ url: "http://ws.geonames.org/searchJSON",
+ dataType: "jsonp",
+ data: {
+ featureClass: "P",
+ style: "full",
+ maxRows: 12,
+ name_startsWith: request.term
+ },
+ success: function(data) {
+ response($.map(data.geonames, function(item) {
+ return {
+ label: item.name + (item.adminName1 ? ", " + item.adminName1 : "") + ", " + item.countryName,
+ value: item.name
+ }
+ }))
+ }
+ })
+ },
+ minLength: 2,
+ select: function(event, ui) {
+ log(ui.item ? ("Selected: " + ui.item.label) : "Nothing selected, input was " + this.value);
+ },
+ open: function() {
+ $(this).removeClass("ui-corner-all").addClass("ui-corner-top");
+ },
+ close: function() {
+ $(this).removeClass("ui-corner-top").addClass("ui-corner-all");
+ }
+ });
+ });
+ </script>
+ <style>
+ .ui-autocomplete-loading { background: url(indicator.gif) no-repeat right; }
+ #city { width: 25em; }
+ </style>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+ <label for="city">Your city: </label>
+ <input id="city" />
+ Powered by <a href="http://geonames.org">geonames.org</a>
+</div>
+
+<div class="ui-widget" style="margin-top:2em; font-family:Arial">
+ Result:
+ <div id="log" style="height: 200px; width: 300px; overflow: auto;" class="ui-widget-content"></div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+<p>
+The Autocomplete widgets provides suggestions while you type into the field. Here the suggestions are cities, displayed when at least two characters are entered into the field.
+</p>
+<p>
+In this case, the datasource is the <a href="http://geonames.org">geonames.org webservice</a>. While only the city name itself ends up in the input after selecting an element, more info is displayed in the suggestions to help find the right entry. That data is also available in callbacks, as illustrated by the Result area below the input.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/autocomplete/remote-with-cache.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,76 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Autocomplete Remote with caching demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.autocomplete.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ function log(message) {
+ $("<div/>").text(message).prependTo("#log");
+ $("#log").attr("scrollTop", 0);
+ }
+
+ var cache = {};
+ $("#birds").autocomplete({
+ source: function(request, response) {
+ if (cache.term == request.term && cache.content) {
+ response(cache.content);
+ return;
+ }
+ if (new RegExp(cache.term).test(request.term) && cache.content && cache.content.length < 13) {
+ response($.ui.autocomplete.filter(cache.content, request.term));
+ return;
+ }
+ $.ajax({
+ url: "search.php",
+ dataType: "json",
+ data: request,
+ success: function(data) {
+ cache.term = request.term;
+ cache.content = data;
+ response(data);
+ }
+ });
+ },
+ minLength: 2,
+ select: function(event, ui) {
+ log(ui.item ? ("Selected: " + ui.item.value + " aka " + ui.item.id) : "Nothing selected, input was " + this.value);
+ }
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+ <label for="birds">Birds: </label>
+ <input id="birds" />
+</div>
+
+<div class="ui-widget" style="margin-top:2em; font-family:Arial">
+ Result:
+ <div id="log" style="height: 200px; width: 300px; overflow: auto;" class="ui-widget-content"></div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+<p>
+The Autocomplete widgets provides suggestions while you type into the field. Here the suggestions are bird names, displayed when at least two characters are entered into the field.
+</p>
+<p>
+Similar to the remote datasource demo, though this adds some local caching to improve performance. The cache here saves just one query, and could be extended to cache multiple values, one for each term.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/autocomplete/remote.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,56 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Autocomplete Remote datasource demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.autocomplete.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ function log(message) {
+ $("<div/>").text(message).prependTo("#log");
+ $("#log").attr("scrollTop", 0);
+ }
+
+ $("#birds").autocomplete({
+ source: "search.php",
+ minLength: 2,
+ select: function(event, ui) {
+ log(ui.item ? ("Selected: " + ui.item.value + " aka " + ui.item.id) : "Nothing selected, input was " + this.value);
+ }
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+ <label for="birds">Birds: </label>
+ <input id="birds" />
+</div>
+
+<div class="ui-widget" style="margin-top:2em; font-family:Arial">
+ Result:
+ <div id="log" style="height: 200px; width: 300px; overflow: auto;" class="ui-widget-content"></div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+<p>
+The Autocomplete widgets provides suggestions while you type into the field. Here the suggestions are bird names, displayed when at least two characters are entered into the field.
+</p>
+<p>
+The datasource is a server-side script which returns JSON data, specified via a simple URL for the source-option. In addition, the minLength-option is set to 2 to avoid queries that would return too many results and the select-event is used to display some feedback.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/autocomplete/search.php Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,640 @@
+<?php
+
+$q = strtolower($_GET["term"]);
+if (!$q) return;
+$items = array(
+"Great <em>Bittern</em>"=>"Botaurus stellaris",
+"Little <em>Grebe</em>"=>"Tachybaptus ruficollis",
+"Black-necked Grebe"=>"Podiceps nigricollis",
+"Little Bittern"=>"Ixobrychus minutus",
+"Black-crowned Night Heron"=>"Nycticorax nycticorax",
+"Purple Heron"=>"Ardea purpurea",
+"White Stork"=>"Ciconia ciconia",
+"Spoonbill"=>"Platalea leucorodia",
+"Red-crested Pochard"=>"Netta rufina",
+"Common Eider"=>"Somateria mollissima",
+"Red Kite"=>"Milvus milvus",
+"Hen Harrier"=>"Circus cyaneus",
+"Montagu`s Harrier"=>"Circus pygargus",
+"Black Grouse"=>"Tetrao tetrix",
+"Grey Partridge"=>"Perdix perdix",
+"Spotted Crake"=>"Porzana porzana",
+"Corncrake"=>"Crex crex",
+"Common Crane"=>"Grus grus",
+"Avocet"=>"Recurvirostra avosetta",
+"Stone Curlew"=>"Burhinus oedicnemus",
+"Common Ringed Plover"=>"Charadrius hiaticula",
+"Kentish Plover"=>"Charadrius alexandrinus",
+"Ruff"=>"Philomachus pugnax",
+"Common Snipe"=>"Gallinago gallinago",
+"Black-tailed Godwit"=>"Limosa limosa",
+"Common Redshank"=>"Tringa totanus",
+"Sandwich Tern"=>"Sterna sandvicensis",
+"Common Tern"=>"Sterna hirundo",
+"Arctic Tern"=>"Sterna paradisaea",
+"Little Tern"=>"Sternula albifrons",
+"Black Tern"=>"Chlidonias niger",
+"Barn Owl"=>"Tyto alba",
+"Little Owl"=>"Athene noctua",
+"Short-eared Owl"=>"Asio flammeus",
+"European Nightjar"=>"Caprimulgus europaeus",
+"Common Kingfisher"=>"Alcedo atthis",
+"Eurasian Hoopoe"=>"Upupa epops",
+"Eurasian Wryneck"=>"Jynx torquilla",
+"European Green Woodpecker"=>"Picus viridis",
+"Crested Lark"=>"Galerida cristata",
+"White-headed Duck"=>"Oxyura leucocephala",
+"Pale-bellied Brent Goose"=>"Branta hrota",
+"Tawny Pipit"=>"Anthus campestris",
+"Whinchat"=>"Saxicola rubetra",
+"European Stonechat"=>"Saxicola rubicola",
+"Northern Wheatear"=>"Oenanthe oenanthe",
+"Savi`s Warbler"=>"Locustella luscinioides",
+"Sedge Warbler"=>"Acrocephalus schoenobaenus",
+"Great Reed Warbler"=>"Acrocephalus arundinaceus",
+"Bearded Reedling"=>"Panurus biarmicus",
+"Red-backed Shrike"=>"Lanius collurio",
+"Great Grey Shrike"=>"Lanius excubitor",
+"Woodchat Shrike"=>"Lanius senator",
+"Common Raven"=>"Corvus corax",
+"Yellowhammer"=>"Emberiza citrinella",
+"Ortolan Bunting"=>"Emberiza hortulana",
+"Corn Bunting"=>"Emberiza calandra",
+"Great Cormorant"=>"Phalacrocorax carbo",
+"Hawfinch"=>"Coccothraustes coccothraustes",
+"Common Shelduck"=>"Tadorna tadorna",
+"Bluethroat"=>"Luscinia svecica",
+"Grey Heron"=>"Ardea cinerea",
+"Barn Swallow"=>"Hirundo rustica",
+"Hooded Crow"=>"Corvus cornix",
+"Dunlin"=>"Calidris alpina",
+"Eurasian Pied Flycatcher"=>"Ficedula hypoleuca",
+"Eurasian Nuthatch"=>"Sitta europaea",
+"Short-toed Tree Creeper"=>"Certhia brachydactyla",
+"Wood Lark"=>"Lullula arborea",
+"Tree Pipit"=>"Anthus trivialis",
+"Eurasian Hobby"=>"Falco subbuteo",
+"Marsh Warbler"=>"Acrocephalus palustris",
+"Wood Sandpiper"=>"Tringa glareola",
+"Tawny Owl"=>"Strix aluco",
+"Lesser Whitethroat"=>"Sylvia curruca",
+"Barnacle Goose"=>"Branta leucopsis",
+"Common Goldeneye"=>"Bucephala clangula",
+"Western Marsh Harrier"=>"Circus aeruginosus",
+"Common Buzzard"=>"Buteo buteo",
+"Sanderling"=>"Calidris alba",
+"Little Gull"=>"Larus minutus",
+"Eurasian Magpie"=>"Pica pica",
+"Willow Warbler"=>"Phylloscopus trochilus",
+"Wood Warbler"=>"Phylloscopus sibilatrix",
+"Great Crested Grebe"=>"Podiceps cristatus",
+"Eurasian Jay"=>"Garrulus glandarius",
+"Common Redstart"=>"Phoenicurus phoenicurus",
+"Blue-headed Wagtail"=>"Motacilla flava",
+"Common Swift"=>"Apus apus",
+"Marsh Tit"=>"Poecile palustris",
+"Goldcrest"=>"Regulus regulus",
+"European Golden Plover"=>"Pluvialis apricaria",
+"Eurasian Bullfinch"=>"Pyrrhula pyrrhula",
+"Common Whitethroat"=>"Sylvia communis",
+"Meadow Pipit"=>"Anthus pratensis",
+"Greylag Goose"=>"Anser anser",
+"Spotted Flycatcher"=>"Muscicapa striata",
+"European Greenfinch"=>"Carduelis chloris",
+"Common Greenshank"=>"Tringa nebularia",
+"Great Spotted Woodpecker"=>"Dendrocopos major",
+"Greater Canada Goose"=>"Branta canadensis",
+"Mistle Thrush"=>"Turdus viscivorus",
+"Great Black-backed Gull"=>"Larus marinus",
+"Goosander"=>"Mergus merganser",
+"Great Egret"=>"Casmerodius albus",
+"Northern Goshawk"=>"Accipiter gentilis",
+"Dunnock"=>"Prunella modularis",
+"Stock Dove"=>"Columba oenas",
+"Common Wood Pigeon"=>"Columba palumbus",
+"Eurasian Woodcock"=>"Scolopax rusticola",
+"House Sparrow"=>"Passer domesticus",
+"Common House Martin"=>"Delichon urbicum",
+"Red Knot"=>"Calidris canutus",
+"Western Jackdaw"=>"Corvus monedula",
+"Brambling"=>"Fringilla montifringilla",
+"Northern Lapwing"=>"Vanellus vanellus",
+"European Reed Warbler"=>"Acrocephalus scirpaceus",
+"Lesser Black-backed Gull"=>"Larus fuscus",
+"Little Egret"=>"Egretta garzetta",
+"Little Stint"=>"Calidris minuta",
+"Common Linnet"=>"Carduelis cannabina",
+"Mute Swan"=>"Cygnus olor",
+"Common Cuckoo"=>"Cuculus canorus",
+"Black-headed Gull"=>"Larus ridibundus",
+"Greater White-fronted Goose"=>"Anser albifrons",
+"Great Tit"=>"Parus major",
+"Redwing"=>"Turdus iliacus",
+"Gadwall"=>"Anas strepera",
+"Fieldfare"=>"Turdus pilaris",
+"Tufted Duck"=>"Aythya fuligula",
+"Crested Tit"=>"Lophophanes cristatus",
+"Willow Tit"=>"Poecile montanus",
+"Eurasian Coot"=>"Fulica atra",
+"Common Blackbird"=>"Turdus merula",
+"Smew"=>"Mergus albellus",
+"Common Sandpiper"=>"Actitis hypoleucos",
+"Sand Martin"=>"Riparia riparia",
+"Purple Sandpiper"=>"Calidris maritima",
+"Northern Pintail"=>"Anas acuta",
+"Blue Tit"=>"Cyanistes caeruleus",
+"European Goldfinch"=>"Carduelis carduelis",
+"Eurasian Whimbrel"=>"Numenius phaeopus",
+"Common Reed Bunting"=>"Emberiza schoeniclus",
+"Eurasian Tree Sparrow"=>"Passer montanus",
+"Rook"=>"Corvus frugilegus",
+"European Robin"=>"Erithacus rubecula",
+"Bar-tailed Godwit"=>"Limosa lapponica",
+"Dark-bellied Brent Goose"=>"Branta bernicla",
+"Eurasian Oystercatcher"=>"Haematopus ostralegus",
+"Eurasian Siskin"=>"Carduelis spinus",
+"Northern Shoveler"=>"Anas clypeata",
+"Eurasian Wigeon"=>"Anas penelope",
+"Eurasian Sparrow Hawk"=>"Accipiter nisus",
+"Icterine Warbler"=>"Hippolais icterina",
+"Common Starling"=>"Sturnus vulgaris",
+"Long-tailed Tit"=>"Aegithalos caudatus",
+"Ruddy Turnstone"=>"Arenaria interpres",
+"Mew Gull"=>"Larus canus",
+"Common Pochard"=>"Aythya ferina",
+"Common Chiffchaff"=>"Phylloscopus collybita",
+"Greater Scaup"=>"Aythya marila",
+"Common Kestrel"=>"Falco tinnunculus",
+"Garden Warbler"=>"Sylvia borin",
+"Eurasian Collared Dove"=>"Streptopelia decaocto",
+"Eurasian Skylark"=>"Alauda arvensis",
+"Common Chaffinch"=>"Fringilla coelebs",
+"Common Moorhen"=>"Gallinula chloropus",
+"Water Pipit"=>"Anthus spinoletta",
+"Mallard"=>"Anas platyrhynchos",
+"Winter Wren"=>"Troglodytes troglodytes",
+"Common Teal"=>"Anas crecca",
+"Green Sandpiper"=>"Tringa ochropus",
+"White Wagtail"=>"Motacilla alba",
+"Eurasian Curlew"=>"Numenius arquata",
+"Song Thrush"=>"Turdus philomelos",
+"European Herring Gull"=>"Larus argentatus",
+"Grey Plover"=>"Pluvialis squatarola",
+"Carrion Crow"=>"Corvus corone",
+"Coal Tit"=>"Periparus ater",
+"Spotted Redshank"=>"Tringa erythropus",
+"Blackcap"=>"Sylvia atricapilla",
+"Egyptian Vulture"=>"Neophron percnopterus",
+"Razorbill"=>"Alca torda",
+"Alpine Swift"=>"Apus melba",
+"Long-legged Buzzard"=>"Buteo rufinus",
+"Audouin`s Gull"=>"Larus audouinii",
+"Balearic Shearwater"=>"Puffinus mauretanicus",
+"Upland Sandpiper"=>"Bartramia longicauda",
+"Greater Spotted Eagle"=>"Aquila clanga",
+"Ring Ouzel"=>"Turdus torquatus",
+"Yellow-browed Warbler"=>"Phylloscopus inornatus",
+"Blue Rock Thrush"=>"Monticola solitarius",
+"Buff-breasted Sandpiper"=>"Tryngites subruficollis",
+"Jack Snipe"=>"Lymnocryptes minimus",
+"White-rumped Sandpiper"=>"Calidris fuscicollis",
+"Ruddy Shelduck"=>"Tadorna ferruginea",
+"Cetti's Warbler"=>"Cettia cetti",
+"Citrine Wagtail"=>"Motacilla citreola",
+"Roseate Tern"=>"Sterna dougallii",
+"Black-legged Kittiwake"=>"Rissa tridactyla",
+"Pygmy Cormorant"=>"Phalacrocorax pygmeus",
+"Booted Eagle"=>"Aquila pennata",
+"Lesser White-fronted Goose"=>"Anser erythropus",
+"Little Bunting"=>"Emberiza pusilla",
+"Eleonora's Falcon"=>"Falco eleonorae",
+"European Serin"=>"Serinus serinus",
+"Twite"=>"Carduelis flavirostris",
+"Yellow-legged Gull"=>"Larus michahellis",
+"Gyr Falcon"=>"Falco rusticolus",
+"Greenish Warbler"=>"Phylloscopus trochiloides",
+"Red-necked Phalarope"=>"Phalaropus lobatus",
+"Mealy Redpoll"=>"Carduelis flammea",
+"Glaucous Gull"=>"Larus hyperboreus",
+"Great Skua"=>"Stercorarius skua",
+"Great Bustard"=>"Otis tarda",
+"Velvet Scoter"=>"Melanitta fusca",
+"Pine Grosbeak"=>"Pinicola enucleator",
+"House Crow"=>"Corvus splendens",
+"Hume`s Leaf Warbler"=>"Phylloscopus humei",
+"Great Northern Loon"=>"Gavia immer",
+"Long-tailed Duck"=>"Clangula hyemalis",
+"Lapland Longspur"=>"Calcarius lapponicus",
+"Northern Gannet"=>"Morus bassanus",
+"Eastern Imperial Eagle"=>"Aquila heliaca",
+"Little Auk"=>"Alle alle",
+"Lesser Spotted Woodpecker"=>"Dendrocopos minor",
+"Iceland Gull"=>"Larus glaucoides",
+"Parasitic Jaeger"=>"Stercorarius parasiticus",
+"Bewick`s Swan"=>"Cygnus bewickii",
+"Little Bustard"=>"Tetrax tetrax",
+"Little Crake"=>"Porzana parva",
+"Baillon`s Crake"=>"Porzana pusilla",
+"Long-tailed Jaeger"=>"Stercorarius longicaudus",
+"King Eider"=>"Somateria spectabilis",
+"Greater Short-toed Lark"=>"Calandrella brachydactyla",
+"Houbara Bustard"=>"Chlamydotis undulata",
+"Curlew Sandpiper"=>"Calidris ferruginea",
+"Common Crossbill"=>"Loxia curvirostra",
+"European Shag"=>"Phalacrocorax aristotelis",
+"Horned Grebe"=>"Podiceps auritus",
+"Common Quail"=>"Coturnix coturnix",
+"Bearded Vulture"=>"Gypaetus barbatus",
+"Lanner Falcon"=>"Falco biarmicus",
+"Middle Spotted Woodpecker"=>"Dendrocopos medius",
+"Pomarine Jaeger"=>"Stercorarius pomarinus",
+"Red-breasted Merganser"=>"Mergus serrator",
+"Eurasian Black Vulture"=>"Aegypius monachus",
+"Eurasian Dotterel"=>"Charadrius morinellus",
+"Common Nightingale"=>"Luscinia megarhynchos",
+"Northern willow warbler"=>"Phylloscopus trochilus acredula",
+"Manx Shearwater"=>"Puffinus puffinus",
+"Northern Fulmar"=>"Fulmarus glacialis",
+"Eurasian Eagle Owl"=>"Bubo bubo",
+"Orphean Warbler"=>"Sylvia hortensis",
+"Melodious Warbler"=>"Hippolais polyglotta",
+"Pallas's Leaf Warbler"=>"Phylloscopus proregulus",
+"Atlantic Puffin"=>"Fratercula arctica",
+"Black-throated Loon"=>"Gavia arctica",
+"Bohemian Waxwing"=>"Bombycilla garrulus",
+"Marsh Sandpiper"=>"Tringa stagnatilis",
+"Great Snipe"=>"Gallinago media",
+"Squacco Heron"=>"Ardeola ralloides",
+"Long-eared Owl"=>"Asio otus",
+"Caspian Tern"=>"Hydroprogne caspia",
+"Red-breasted Goose"=>"Branta ruficollis",
+"Red-throated Loon"=>"Gavia stellata",
+"Common Rosefinch"=>"Carpodacus erythrinus",
+"Red-footed Falcon"=>"Falco vespertinus",
+"Ross's Goose"=>"Anser rossii",
+"Red Phalarope"=>"Phalaropus fulicarius",
+"Pied Wagtail"=>"Motacilla yarrellii",
+"Rose-coloured Starling"=>"Sturnus roseus",
+"Rough-legged Buzzard"=>"Buteo lagopus",
+"Saker Falcon"=>"Falco cherrug",
+"European Roller"=>"Coracias garrulus",
+"Short-toed Eagle"=>"Circaetus gallicus",
+"Peregrine Falcon"=>"Falco peregrinus",
+"Merlin"=>"Falco columbarius",
+"Snow Goose"=>"Anser caerulescens",
+"Snowy Owl"=>"Bubo scandiacus",
+"Snow Bunting"=>"Plectrophenax nivalis",
+"Common Grasshopper Warbler"=>"Locustella naevia",
+"Golden Eagle"=>"Aquila chrysaetos",
+"Black-winged Stilt"=>"Himantopus himantopus",
+"Steppe Eagle"=>"Aquila nipalensis",
+"Pallid Harrier"=>"Circus macrourus",
+"European Storm-petrel"=>"Hydrobates pelagicus",
+"Horned Lark"=>"Eremophila alpestris",
+"Eurasian Treecreeper"=>"Certhia familiaris",
+"Taiga Bean Goose"=>"Anser fabalis",
+"Temminck`s Stint"=>"Calidris temminckii",
+"Terek Sandpiper"=>"Xenus cinereus",
+"Tundra Bean Goose"=>"Anser serrirostris",
+"European Turtle Dove"=>"Streptopelia turtur",
+"Leach`s Storm-petrel"=>"Oceanodroma leucorhoa",
+"Eurasian Griffon Vulture"=>"Gyps fulvus",
+"Paddyfield Warbler"=>"Acrocephalus agricola",
+"Osprey"=>"Pandion haliaetus",
+"Firecrest"=>"Regulus ignicapilla",
+"Water Rail"=>"Rallus aquaticus",
+"European Honey Buzzard"=>"Pernis apivorus",
+"Eurasian Golden Oriole"=>"Oriolus oriolus",
+"Whooper Swan"=>"Cygnus cygnus",
+"Two-barred Crossbill"=>"Loxia leucoptera",
+"White-tailed Eagle"=>"Haliaeetus albicilla",
+"Atlantic Murre"=>"Uria aalge",
+"Garganey"=>"Anas querquedula",
+"Black Redstart"=>"Phoenicurus ochruros",
+"Common Scoter"=>"Melanitta nigra",
+"Rock Pipit"=>"Anthus petrosus",
+"Lesser Spotted Eagle"=>"Aquila pomarina",
+"Cattle Egret"=>"Bubulcus ibis",
+"White-winged Black Tern"=>"Chlidonias leucopterus",
+"Black Stork"=>"Ciconia nigra",
+"Mediterranean Gull"=>"Larus melanocephalus",
+"Black Kite"=>"Milvus migrans",
+"Yellow Wagtail"=>"Motacilla flavissima",
+"Red-necked Grebe"=>"Podiceps grisegena",
+"Gull-billed Tern"=>"Gelochelidon nilotica",
+"Pectoral Sandpiper"=>"Calidris melanotos",
+"Barred Warbler"=>"Sylvia nisoria",
+"Red-throated Pipit"=>"Anthus cervinus",
+"Grey Wagtail"=>"Motacilla cinerea",
+"Richard`s Pipit"=>"Anthus richardi",
+"Black Woodpecker"=>"Dryocopus martius",
+"Little Ringed Plover"=>"Charadrius dubius",
+"Whiskered Tern"=>"Chlidonias hybrida",
+"Lesser Redpoll"=>"Carduelis cabaret",
+"Pallas' Bunting"=>"Emberiza pallasi",
+"Ferruginous Duck"=>"Aythya nyroca",
+"Whistling Swan"=>"Cygnus columbianus",
+"Black Brant"=>"Branta nigricans",
+"Marbled Teal"=>"Marmaronetta angustirostris",
+"Canvasback"=>"Aythya valisineria",
+"Redhead"=>"Aythya americana",
+"Lesser Scaup"=>"Aythya affinis",
+"Steller`s Eider"=>"Polysticta stelleri",
+"Spectacled Eider"=>"Somateria fischeri",
+"Harlequin Duck"=>"Histronicus histrionicus",
+"Black Scoter"=>"Melanitta americana",
+"Surf Scoter"=>"Melanitta perspicillata",
+"Barrow`s Goldeneye"=>"Bucephala islandica",
+"Falcated Duck"=>"Anas falcata",
+"American Wigeon"=>"Anas americana",
+"Blue-winged Teal"=>"Anas discors",
+"American Black Duck"=>"Anas rubripes",
+"Baikal Teal"=>"Anas formosa",
+"Green-Winged Teal"=>"Anas carolinensis",
+"Hazel Grouse"=>"Bonasa bonasia",
+"Rock Partridge"=>"Alectoris graeca",
+"Red-legged Partridge"=>"Alectoris rufa",
+"Yellow-billed Loon"=>"Gavia adamsii",
+"Cory`s Shearwater"=>"Calonectris borealis",
+"Madeiran Storm-Petrel"=>"Oceanodroma castro",
+"Great White Pelican"=>"Pelecanus onocrotalus",
+"Dalmatian Pelican"=>"Pelecanus crispus",
+"American Bittern"=>"Botaurus lentiginosus",
+"Glossy Ibis"=>"Plegadis falcinellus",
+"Spanish Imperial Eagle"=>"Aquila adalberti",
+"Lesser Kestrel"=>"Falco naumanni",
+"Houbara Bustard"=>"Chlamydotis undulata",
+"Crab-Plover"=>"Dromas ardeola",
+"Cream-coloured Courser"=>"Cursorius cursor",
+"Collared Pratincole"=>"Glareola pratincola",
+"Black-winged Pratincole"=>"Glareola nordmanni",
+"Killdeer"=>"Charadrius vociferus",
+"Lesser Sand Plover"=>"Charadrius mongolus",
+"Greater Sand Plover"=>"Charadrius leschenaultii",
+"Caspian Plover"=>"Charadrius asiaticus",
+"American Golden Plover"=>"Pluvialis dominica",
+"Pacific Golden Plover"=>"Pluvialis fulva",
+"Sharp-tailed Sandpiper"=>"Calidris acuminata",
+"Broad-billed Sandpiper"=>"Limicola falcinellus",
+"Spoon-Billed Sandpiper"=>"Eurynorhynchus pygmaeus",
+"Short-Billed Dowitcher"=>"Limnodromus griseus",
+"Long-billed Dowitcher"=>"Limnodromus scolopaceus",
+"Hudsonian Godwit"=>"Limosa haemastica",
+"Little Curlew"=>"Numenius minutus",
+"Lesser Yellowlegs"=>"Tringa flavipes",
+"Wilson`s Phalarope"=>"Phalaropus tricolor",
+"Pallas`s Gull"=>"Larus ichthyaetus",
+"Laughing Gull"=>"Larus atricilla",
+"Franklin`s Gull"=>"Larus pipixcan",
+"Bonaparte`s Gull"=>"Larus philadelphia",
+"Ring-billed Gull"=>"Larus delawarensis",
+"American Herring Gull"=>"Larus smithsonianus",
+"Caspian Gull"=>"Larus cachinnans",
+"Ivory Gull"=>"Pagophila eburnea",
+"Royal Tern"=>"Sterna maxima",
+"Brünnich`s Murre"=>"Uria lomvia",
+"Crested Auklet"=>"Aethia cristatella",
+"Parakeet Auklet"=>"Cyclorrhynchus psittacula",
+"Tufted Puffin"=>"Lunda cirrhata",
+"Laughing Dove"=>"Streptopelia senegalensis",
+"Great Spotted Cuckoo"=>"Clamator glandarius",
+"Great Grey Owl"=>"Strix nebulosa",
+"Tengmalm`s Owl"=>"Aegolius funereus",
+"Red-Necked Nightjar"=>"Caprimulgus ruficollis",
+"Chimney Swift"=>"Chaetura pelagica",
+"Green Bea-Eater"=>"Merops orientalis",
+"Grey-headed Woodpecker"=>"Picus canus",
+"Lesser Short-Toed Lark"=>"Calandrella rufescens",
+"Eurasian Crag Martin"=>"Hirundo rupestris",
+"Red-rumped Swallow"=>"Cecropis daurica",
+"Blyth`s Pipit"=>"Anthus godlewskii",
+"Pechora Pipit"=>"Anthus gustavi",
+"Grey-headed Wagtail"=>"Motacilla thunbergi",
+"Yellow-Headed Wagtail"=>"Motacilla lutea",
+"White-throated Dipper"=>"Cinclus cinclus",
+"Rufous-Tailed Scrub Robin"=>"Cercotrichas galactotes",
+"Thrush Nightingale"=>"Luscinia luscinia",
+"White-throated Robin"=>"Irania gutturalis",
+"Caspian Stonechat"=>"Saxicola maura variegata",
+"Western Black-eared Wheatear"=>"Oenanthe hispanica",
+"Rufous-tailed Rock Thrush"=>"Monticola saxatilis",
+"Red-throated Thrush/Black-throated"=>"Turdus ruficollis",
+"American Robin"=>"Turdus migratorius",
+"Zitting Cisticola"=>"Cisticola juncidis",
+"Lanceolated Warbler"=>"Locustella lanceolata",
+"River Warbler"=>"Locustella fluviatilis",
+"Blyth`s Reed Warbler"=>"Acrocephalus dumetorum",
+"Caspian Reed Warbler"=>"Acrocephalus fuscus",
+"Aquatic Warbler"=>"Acrocephalus paludicola",
+"Booted Warbler"=>"Acrocephalus caligatus",
+"Marmora's Warbler"=>"Sylvia sarda",
+"Dartford Warbler"=>"Sylvia undata",
+"Subalpine Warbler"=>"Sylvia cantillans",
+"Ménétries's Warbler"=>"Sylvia mystacea",
+"Rüppel's Warbler"=>"Sylvia rueppelli",
+"Asian Desert Warbler"=>"Sylvia nana",
+"Western Orphean Warbler"=>"Sylvia hortensis hortensis",
+"Arctic Warbler"=>"Phylloscopus borealis",
+"Radde`s Warbler"=>"Phylloscopus schwarzi",
+"Western Bonelli`s Warbler"=>"Phylloscopus bonelli",
+"Red-breasted Flycatcher"=>"Ficedula parva",
+"Eurasian Penduline Tit"=>"Remiz pendulinus",
+"Daurian Shrike"=>"Lanius isabellinus",
+"Long-Tailed Shrike"=>"Lanius schach",
+"Lesser Grey Shrike"=>"Lanius minor",
+"Southern Grey Shrike"=>"Lanius meridionalis",
+"Masked Shrike"=>"Lanius nubicus",
+"Spotted Nutcracker"=>"Nucifraga caryocatactes",
+"Daurian Jackdaw"=>"Corvus dauuricus",
+"Purple-Backed Starling"=>"Sturnus sturninus",
+"Red-Fronted Serin"=>"Serinus pusillus",
+"Arctic Redpoll"=>"Carduelis hornemanni",
+"Scottish Crossbill"=>"Loxia scotica",
+"Parrot Crossbill"=>"Loxia pytyopsittacus",
+"Black-faced Bunting"=>"Emberiza spodocephala",
+"Pink-footed Goose"=>"Anser brachyrhynchus",
+"Black-winged Kite"=>"Elanus caeruleus",
+"European Bee-eater"=>"Merops apiaster",
+"Sabine`s Gull"=>"Larus sabini",
+"Sooty Shearwater"=>"Puffinus griseus",
+"Lesser Canada Goose"=>"Branta hutchinsii",
+"Ring-necked Duck"=>"Aythya collaris",
+"Greater Flamingo"=>"Phoenicopterus roseus",
+"Iberian Chiffchaff"=>"Phylloscopus ibericus",
+"Ashy-headed Wagtail"=>"Motacilla cinereocapilla",
+"Stilt Sandpiper"=>"Calidris himantopus",
+"Siberian Stonechat"=>"Saxicola maurus",
+"Greater Yellowlegs"=>"Tringa melanoleuca",
+"Forster`s Tern"=>"Sterna forsteri",
+"Dusky Warbler"=>"Phylloscopus fuscatus",
+"Cirl Bunting"=>"Emberiza cirlus",
+"Olive-backed Pipit"=>"Anthus hodgsoni",
+"Sociable Lapwing"=>"Vanellus gregarius",
+"Spotted Sandpiper"=>"Actitis macularius",
+"Baird`s Sandpiper"=>"Calidris bairdii",
+"Rustic Bunting"=>"Emberiza rustica",
+"Yellow-browed Bunting"=>"Emberiza chrysophrys",
+"Great Shearwater"=>"Puffinus gravis",
+"Bonelli`s Eagle"=>"Aquila fasciata",
+"Calandra Lark"=>"Melanocorypha calandra",
+"Sardinian Warbler"=>"Sylvia melanocephala",
+"Ross's Gull"=>"Larus roseus",
+"Yellow-Breasted Bunting"=>"Emberiza aureola",
+"Pine Bunting"=>"Emberiza leucocephalos",
+"Black Guillemot"=>"Cepphus grylle",
+"Pied-billed Grebe"=>"Podilymbus podiceps",
+"Soft-plumaged Petrel"=>"Pterodroma mollis",
+"Bulwer's Petrel"=>"Bulweria bulwerii",
+"White-Faced Storm-Petrel"=>"Pelagodroma marina",
+"Pallas’s Fish Eagle"=>"Haliaeetus leucoryphus",
+"Sandhill Crane"=>"Grus canadensis",
+"Macqueen’s Bustard"=>"Chlamydotis macqueenii",
+"White-tailed Lapwing"=>"Vanellus leucurus",
+"Great Knot"=>"Calidris tenuirostris",
+"Semipalmated Sandpiper"=>"Calidris pusilla",
+"Red-necked Stint"=>"Calidris ruficollis",
+"Slender-billed Curlew"=>"Numenius tenuirostris",
+"Bridled Tern"=>"Onychoprion anaethetus",
+"Pallas’s Sandgrouse"=>"Syrrhaptes paradoxus",
+"European Scops Owl"=>"Otus scops",
+"Northern Hawk Owl"=>"Surnia ulula",
+"White-Throated Needletail"=>"Hirundapus caudacutus",
+"Belted Kingfisher"=>"Ceryle alcyon",
+"Blue-cheeked Bee-eater"=>"Merops persicus",
+"Black-headed Wagtail"=>"Motacilla feldegg",
+"Northern Mockingbird"=>"Mimus polyglottos",
+"Alpine Accentor"=>"Prunella collaris",
+"Red-flanked Bluetail"=>"Tarsiger cyanurus",
+"Isabelline Wheatear"=>"Oenanthe isabellina",
+"Pied Wheatear"=>"Oenanthe pleschanka",
+"Eastern Black-eared Wheatear"=>"Oenanthe melanoleuca",
+"Desert Wheatear"=>"Oenanthe deserti",
+"White`s Thrush"=>"Zoothera aurea",
+"Siberian Thrush"=>"Zoothera sibirica",
+"Eyebrowed Thrush"=>"Turdus obscurus",
+"Dusky Thrush"=>"Turdus eunomus",
+"Black-throated Thrush"=>"Turdus atrogularis",
+"Pallas`s Grasshopper Warbler"=>"Locustella certhiola",
+"Spectacled Warbler"=>"Sylvia conspicillata",
+"Two-barred Warbler"=>"Phylloscopus plumbeitarsus",
+"Eastern Bonelli’s Warbler"=>"Phylloscopus orientalis",
+"Collared Flycatcher"=>"Ficedula albicollis",
+"Wallcreeper"=>"Tichodroma muraria",
+"Turkestan Shrike"=>"Lanius phoenicuroides",
+"Steppe Grey Shrike"=>"Lanius pallidirostris",
+"Spanish Sparrow"=>"Passer hispaniolensis",
+"Red-eyed Vireo"=>"Vireo olivaceus",
+"Myrtle Warbler"=>"Dendroica coronata",
+"White-crowned Sparrow"=>"Zonotrichia leucophrys",
+"White-throated Sparrow"=>"Zonotrichia albicollis",
+"Cretzschmar`s Bunting"=>"Emberiza caesia",
+"Chestnut Bunting"=>"Emberiza rutila",
+"Red-headed Bunting"=>"Emberiza bruniceps",
+"Black-headed Bunting"=>"Emberiza melanocephala",
+"Indigo Bunting"=>"Passerina cyanea",
+"Balearic Woodchat Shrike"=>"Lanius senator badius",
+"Demoiselle Crane"=>"Grus virgo",
+"Chough"=>"Pyrrhocorax pyrrhocorax",
+"Red-Billed Chough"=>"Pyrrhocorax graculus",
+"Elegant Tern"=>"Sterna elegans",
+"Chukar"=>"Alectoris chukar",
+"Yellow-Billed Cuckoo"=>"Coccyzus americanus",
+"American Sandwich Tern"=>"Sterna sandvicensis acuflavida",
+"Olive-Tree Warbler"=>"Hippolais olivetorum",
+"Eastern Olivaceous Warbler"=>"Acrocephalus pallidus",
+"Indian Cormorant"=>"Phalacrocorax fuscicollis",
+"Spur-Winged Lapwing"=>"Vanellus spinosus",
+"Yelkouan Shearwater"=>"Puffinus yelkouan",
+"Trumpeter Finch"=>"Bucanetes githagineus",
+"Red Grouse"=>"Lagopus scoticus",
+"Rock Ptarmigan"=>"Lagopus mutus",
+"Long-Tailed Cormorant"=>"Phalacrocorax africanus",
+"Double-crested Cormorant"=>"Phalacrocorax auritus",
+"Magnificent Frigatebird"=>"Fregata magnificens",
+"Naumann's Thrush"=>"Turdus naumanni",
+"Oriental Pratincole"=>"Glareola maldivarum",
+"Bufflehead"=>"Bucephala albeola",
+"Snowfinch"=>"Montifrigilla nivalis",
+"Ural owl"=>"Strix uralensis",
+"Spanish Wagtail"=>"Motacilla iberiae",
+"Song Sparrow"=>"Melospiza melodia",
+"Rock Bunting"=>"Emberiza cia",
+"Siberian Rubythroat"=>"Luscinia calliope",
+"Pallid Swift"=>"Apus pallidus",
+"Eurasian Pygmy Owl"=>"Glaucidium passerinum",
+"Madeira Little Shearwater"=>"Puffinus baroli",
+"House Finch"=>"Carpodacus mexicanus",
+"Green Heron"=>"Butorides virescens",
+"Solitary Sandpiper"=>"Tringa solitaria",
+"Heuglin's Gull"=>"Larus heuglini"
+);
+
+function array_to_json( $array ){
+
+ if( !is_array( $array ) ){
+ return false;
+ }
+
+ $associative = count( array_diff( array_keys($array), array_keys( array_keys( $array )) ));
+ if( $associative ){
+
+ $construct = array();
+ foreach( $array as $key => $value ){
+
+ // We first copy each key/value pair into a staging array,
+ // formatting each key and value properly as we go.
+
+ // Format the key:
+ if( is_numeric($key) ){
+ $key = "key_$key";
+ }
+ $key = "\"".addslashes($key)."\"";
+
+ // Format the value:
+ if( is_array( $value )){
+ $value = array_to_json( $value );
+ } else if( !is_numeric( $value ) || is_string( $value ) ){
+ $value = "\"".addslashes($value)."\"";
+ }
+
+ // Add to staging array:
+ $construct[] = "$key: $value";
+ }
+
+ // Then we collapse the staging array into the JSON form:
+ $result = "{ " . implode( ", ", $construct ) . " }";
+
+ } else { // If the array is a vector (not associative):
+
+ $construct = array();
+ foreach( $array as $value ){
+
+ // Format the value:
+ if( is_array( $value )){
+ $value = array_to_json( $value );
+ } else if( !is_numeric( $value ) || is_string( $value ) ){
+ $value = "'".addslashes($value)."'";
+ }
+
+ // Add to staging array:
+ $construct[] = $value;
+ }
+
+ // Then we collapse the staging array into the JSON form:
+ $result = "[ " . implode( ", ", $construct ) . " ]";
+ }
+
+ return $result;
+}
+
+$result = array();
+foreach ($items as $key=>$value) {
+ if (strpos(strtolower($key), $q) !== false) {
+ array_push($result, array("id"=>$value, "label"=>$key, "value" => strip_tags($key)));
+ }
+ if (count($result) > 11)
+ break;
+}
+echo array_to_json($result);
+
+?>
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/autocomplete/xml.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,69 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Autocomplete Remote datasource demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.autocomplete.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ function log(message) {
+ $("<div/>").text(message).prependTo("#log");
+ $("#log").attr("scrollTop", 0);
+ }
+
+ $.ajax({
+ url: "london.xml",
+ dataType: "xml",
+ success: function(xmlResponse) {
+ var data = $("geoname", xmlResponse).map(function() {
+ return {
+ value: $("name", this).text() + ", " + ($.trim($("countryName", this).text()) || "(unknown country)"),
+ id: $("geonameId", this).text()
+ };
+ }).get();
+ $("#birds").autocomplete({
+ source: data,
+ minLength: 0,
+ select: function(event, ui) {
+ log(ui.item ? ("Selected: " + ui.item.value + ", geonameId: " + ui.item.id) : "Nothing selected, input was " + this.value);
+ }
+ });
+ }
+ })
+
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="ui-widget">
+ <label for="birds">London matches: </label>
+ <input id="birds" />
+</div>
+
+<div class="ui-widget" style="margin-top:2em; font-family:Arial">
+ Result:
+ <div id="log" style="height: 200px; width: 300px; overflow: auto;" class="ui-widget-content"></div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+<p>
+This demo shows how to retrieve some XML data, parse it using jQuery's methods, then provide it to the autocomplete as the datasource.
+</p>
+<p>
+This should also serve as a reference on how to parse a remote XML datasource - the parsing would just happen for each request within the source-callback.
+</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/button/checkbox.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,49 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Button - Checkboxes demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.button.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#check").button();
+ $("#format").buttonset();
+ });
+ </script>
+ <style>
+ #format { margin-top: 2em; }
+ </style>
+</head>
+<body>
+
+<div class="demo">
+
+ <input type="checkbox" id="check" /><label for="check">Toggle</label>
+
+ <div id="format">
+ <input type="checkbox" id="check1" /><label for="check1">B</label>
+ <input type="checkbox" id="check2" /><label for="check2">I</label>
+ <input type="checkbox" id="check3" /><label for="check3">U</label>
+ </div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+
+<p>A checkbox is styled as a toggle button with the button widget. The label element associated with the checkbox is used for the button text.</p>
+
+<p>This demo also demonstrates three checkboxes styled as a button set by calling <code>.buttonset()</code> on a common container.</p>
+
+</div><!-- End demo-description -->
+
+
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/button/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,46 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Button - Default demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.button.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("button, input:submit, a", ".demo").button();
+
+ $("a", ".demo").click(function() { return false; });
+ });
+ </script>
+ <style>
+
+ </style>
+</head>
+<body>
+
+<div class="demo">
+
+ <button>A button element</button>
+
+ <input type="submit" value="A submit button"/>
+
+ <a href="#">An anchor</a>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+
+<p>Examples of the markup that can be used for buttons: A button element, an input of type submit and an anchor.</p>
+
+</div><!-- End demo-description -->
+
+
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/button/icons.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,63 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Button - Icons demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.button.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $(".demo button:first").button({
+ icons: {
+ primary: 'ui-icon-locked'
+ },
+ text: false
+ }).next().button({
+ icons: {
+ primary: 'ui-icon-locked'
+ }
+ }).next().button({
+ icons: {
+ primary: 'ui-icon-gear',
+ secondary: 'ui-icon-triangle-1-s'
+ }
+ }).next().button({
+ icons: {
+ primary: 'ui-icon-gear',
+ secondary: 'ui-icon-triangle-1-s'
+ },
+ text: false
+ });
+ });
+ </script>
+ <style>
+
+ </style>
+</head>
+<body>
+
+<div class="demo">
+
+ <button>Button with icon only</button>
+ <button>Button with icon on the left</button>
+ <button>Button with two icons</button>
+ <button>Button with two icons and no text</button>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+
+<p>Some buttons with various combinations of text and icons, here specified via metadata.</p>
+
+</div><!-- End demo-description -->
+
+
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/button/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Button Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ <li><a href="radio.html">Radios</a></li>
+ <li><a href="checkbox.html">Checkboxes</a></li>
+ <li><a href="icons.html">Icons</a></li>
+ <li><a href="toolbar.html">Toolbar</a></li>
+ <li><a href="splitbutton.html">Split Button</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/button/radio.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,46 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Button - Radio Buttons demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.button.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#radio").buttonset();
+ });
+ </script>
+ <style>
+
+ </style>
+</head>
+<body>
+
+<div class="demo">
+
+ <form>
+ <div id="radio">
+ <input type="radio" id="radio1" name="radio" /><label for="radio1">Choice 1</label>
+ <input type="radio" id="radio2" name="radio" checked="checked" /><label for="radio2">Choice 2</label>
+ <input type="radio" id="radio3" name="radio" /><label for="radio3">Choice 3</label>
+ </div>
+ </form>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+
+<p>A set of three radio buttons transformed into a button set.</p>
+
+</div><!-- End demo-description -->
+
+
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/button/splitbutton.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,60 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Button - Default demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.button.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#rerun")
+ .button()
+ .click( function() {
+ alert( "Running the last action" );
+ })
+ .next()
+ .button( {
+ text: false,
+ icons: {
+ primary: "ui-icon-triangle-1-s"
+ }
+ })
+ .click( function() {
+ alert( "Could display a menu to select an action" );
+ })
+ .parent()
+ .buttonset();
+ });
+ </script>
+ <style>
+
+ </style>
+</head>
+<body>
+
+<div class="demo">
+
+ <div>
+ <button id="rerun">Run last action</button>
+ <button id="select">Select an action</button>
+ </div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+
+<p>An example of a split button built with two buttons: A plan button with just text, one with only a primary icon
+and no text. Both are grouped together in a set.</p>
+
+</div><!-- End demo-description -->
+
+
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/button/toolbar.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,124 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Button - Toolbar demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.button.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #toolbar {
+ padding: 10px 4px;
+ }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $('#beginning').button({
+ text: false,
+ icons: {
+ primary: 'ui-icon-seek-start'
+ }
+ });
+ $('#rewind').button({
+ text: false,
+ icons: {
+ primary: 'ui-icon-seek-prev'
+ }
+ });
+ $('#play').button({
+ text: false,
+ icons: {
+ primary: 'ui-icon-play'
+ }
+ })
+ .click(function() {
+ var options;
+ if ($(this).text() == 'play') {
+ options = {
+ label: 'pause',
+ icons: {
+ primary: 'ui-icon-pause'
+ }
+ };
+ } else {
+ options = {
+ label: 'play',
+ icons: {
+ primary: 'ui-icon-play'
+ }
+ };
+ }
+ $(this).button('option', options);
+ });
+ $('#stop').button({
+ text: false,
+ icons: {
+ primary: 'ui-icon-stop'
+ }
+ })
+ .click(function() {
+ $('#play').button('option', {
+ label: 'play',
+ icons: {
+ primary: 'ui-icon-play'
+ }
+ });
+ });
+ $('#forward').button({
+ text: false,
+ icons: {
+ primary: 'ui-icon-seek-next'
+ }
+ });
+ $('#end').button({
+ text: false,
+ icons: {
+ primary: 'ui-icon-seek-end'
+ }
+ });
+ $("#shuffle").button();
+ $("#repeat").buttonset();
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+ <span id="toolbar" class="ui-widget-header ui-corner-all">
+ <button id="beginning">go to beginning</button>
+ <button id="rewind">rewind</button>
+ <button id="play">play</button>
+ <button id="stop">stop</button>
+ <button id="forward">fast forward</button>
+ <button id="end">go to end</button>
+
+ <input type="checkbox" id="shuffle" /><label for="shuffle">Shuffle</label>
+
+ <span id="repeat">
+ <input type="radio" id="repeat0" name="repeat" checked="checked" /><label for="repeat0">No Repeat</label>
+ <input type="radio" id="repeat1" name="repeat" /><label for="repeat1">Once</label>
+ <input type="radio" id="repeatall" name="repeat" /><label for="repeatall">All</label>
+ </span>
+ </span>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+
+<p>
+ A mediaplayer toolbar. Take a look at the underlying markup: A few button elements,
+ an input of type checkbox for the Shuffle button, and three inputs of type radio for the Repeat options.
+</p>
+
+</div><!-- End demo-description -->
+
+
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/alt-field.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,33 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker - Populate alternate field</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#datepicker").datepicker({altField: '#alternate', altFormat: 'DD, d MM, yy'});
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>Date: <input type="text" id="datepicker"> <input type="text" id="alternate" size="30"/></p>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Populate an alternate field with its own date format whenever a date is selected using the <code>altField</code> and <code>altFormat</code> options. This feature could be used to present a human-friendly date for user selection, while passing a more computer-friendly date through for further processing.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/animation.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,56 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker - Animations</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.effects.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.effects.blind.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.effects.bounce.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.effects.clip.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.effects.drop.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.effects.fold.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.effects.slide.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#datepicker").datepicker();
+ $("#anim").change(function() { $('#datepicker').datepicker('option', {showAnim: $(this).val()}); });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>Date: <input type="text" id="datepicker" size="30"/></p>
+
+<p>Animations:<br />
+ <select id="anim">
+ <option value="show">Show (default)</option>
+ <option value="slideDown">Slide down</option>
+ <option value="fadeIn">Fade in</option>
+ <!-- <option value="blind">Blind (UI Effect)</option>
+ <option value="bounce">Bounce (UI Effect)</option>
+ <option value="clip">Clip (UI Effect)</option>
+ <option value="drop">Drop (UI Effect)</option>
+ <option value="fold">Fold (UI Effect)</option>
+ <option value="slide">Slide (UI Effect)</option> -->
+ <option value="">None</option>
+ </select>
+</p>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Use different animations when opening or closing the datepicker. Choose an animation from the dropdown, then click on the input to see its effect. You can use one of the three standard animations or any of the UI Effects.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/buttonbar.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,35 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker - Display button bar</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $('#datepicker').datepicker({
+ showButtonPanel: true
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>Date: <input type="text" id="datepicker"></p>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Display a button for selecting Today's date and a Done button for closing the calendar with the boolean <code>showButtonPanel</code> option. Each button is enabled by default when the bar is displayed, but can be turned off with additional options. Button text is customizable.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/date-formats.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,45 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker - Format date</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#datepicker").datepicker();
+ $("#format").change(function() { $('#datepicker').datepicker('option', {dateFormat: $(this).val()}); });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>Date: <input type="text" id="datepicker" size="30"/></p>
+
+<p>Format options:<br />
+ <select id="format">
+ <option value="mm/dd/yy">Default - mm/dd/yy</option>
+ <option value="yy-mm-dd">ISO 8601 - yy-mm-dd</option>
+ <option value="d M, y">Short - d M, y</option>
+ <option value="d MM, y">Medium - d MM, y</option>
+ <option value="DD, d MM, yy">Full - DD, d MM, yy</option>
+ <option value="'day' d 'of' MM 'in the year' yy">With text - 'day' d 'of' MM 'in the year' yy</option>
+ </select>
+</p>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Display date feedback in a variety of ways. Choose a date format from the dropdown, then click on the input and select a date to see it in that format.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,33 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker - Default functionality</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#datepicker").datepicker();
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>Date: <input type="text" id="datepicker"></p>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>The datepicker is tied to a standard form input field. Focus on the input (click, or use the tab key) to open an interactive calendar in a small overlay. Choose a date, click elsewhere on the page (blur the input), or hit the Esc key to close. If a date is chosen, feedback is shown as the input's value.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/dropdown-month-year.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,36 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker - Display month & year menus</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $('#datepicker').datepicker({
+ changeMonth: true,
+ changeYear: true
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>Date: <input type="text" id="datepicker"></p>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Show month and year dropdowns in place of the static month/year header to facilitate navigation through large timeframes. Add the boolean <code>changeMonth</code> and <code>changeYear</code> options.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/event-search.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,46 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker - Display multiple months</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ var dates = $('#from, #to').datepicker({
+ defaultDate: "+1w",
+ changeMonth: true,
+ numberOfMonths: 3,
+ onSelect: function(selectedDate) {
+ var option = this.id == "from" ? "minDate" : "maxDate";
+ var instance = $(this).data("datepicker");
+ var date = $.datepicker.parseDate(instance.settings.dateFormat || $.datepicker._defaults.dateFormat, selectedDate, instance.settings);
+ dates.not(this).datepicker("option", option, date);
+ }
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<label for="from">From</label>
+<input type="text" id="from" name="from"/>
+<label for="to">to</label>
+<input type="text" id="to" name="to"/>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Select the date range to search for.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/icon-trigger.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,37 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker - Icon trigger</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#datepicker").datepicker({
+ showOn: 'button',
+ buttonImage: 'images/calendar.gif',
+ buttonImageOnly: true
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>Date: <input type="text" id="datepicker"></p>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Click the icon next to the input field to show the datepicker. Set the datepicker to open on focus (default behavior), on icon click, or both.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
Binary file web/static/css/jq-css/demos/datepicker/images/calendar.gif has changed
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,31 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ <li><a href="date-formats.html">Format date</a></li>
+ <li><a href="min-max.html">Restrict date range</a></li>
+ <li><a href="localization.html">Localize calendar</a></li>
+ <li><a href="alt-field.html">Populate alternate field</a></li>
+ <li><a href="inline.html">Display inline</a></li>
+ <li><a href="buttonbar.html">Display button bar</a></li>
+ <li><a href="dropdown-month-year.html">Display month & year menus</a></li>
+ <li><a href="other-months.html">Dates in other months</a></li>
+ <li><a href="show-week.html">Show week of the year</a></li>
+ <li><a href="multiple-calendars.html">Display multiple months</a></li>
+ <li><a href="icon-trigger.html">Icon trigger</a></li>
+ <li><a href="animation.html">Animations</a></li>
+ <li><a href="event-search.html">Event Search</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/inline.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,33 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker - Display inline</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#datepicker").datepicker();
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+Date: <div id="datepicker"></div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Display the datepicker embedded in the page instead of in an overlay. Simply call .datepicker() on a div instead of an input.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/localization.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,143 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker - Localize calendar</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-af.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ar.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-az.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-bg.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-bs.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ca.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-cs.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-da.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-de.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-el.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-en-GB.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-eo.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-es.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-et.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-eu.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-fa.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-fi.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-fo.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-fr.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-fr-CH.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-he.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-hr.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-hu.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-hy.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-id.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-is.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-it.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ja.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ko.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-lt.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-lv.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ms.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-nl.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-no.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-pl.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-pt-BR.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ro.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ru.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-sk.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-sl.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-sq.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-sr.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-sr-SR.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-sv.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ta.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-th.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-tr.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-uk.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-vi.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-zh-CN.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-zh-HK.js"></script>
+ <script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-zh-TW.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $.datepicker.setDefaults($.datepicker.regional['']);
+ $("#datepicker").datepicker($.datepicker.regional['fr']);
+ $("#locale").change(function() {
+ $('#datepicker').datepicker('option', $.datepicker.regional[$(this).val()]);
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>Date: <input type="text" id="datepicker"/>
+ <select id="locale">
+ <option value="af">Afrikaans</option>
+ <option value="sq">Albanian (Gjuha shqipe)</option>
+ <option value="ar">Arabic (‫(لعربي</option>
+ <option value="hy">Armenian (Հայերեն)</option>
+ <option value="az">Azerbaijani (Azərbaycan dili)</option>
+ <option value="eu">Basque (Euskara)</option>
+ <option value="bs">Bosnian (Bosanski)</option>
+ <option value="bg">Bulgarian (български език)</option>
+ <option value="ca">Catalan (Català)</option>
+ <option value="zh-HK">Chinese Hong Kong (繁體中文)</option>
+ <option value="zh-CN">Chinese Simplified (简体中文)</option>
+ <option value="zh-TW">Chinese Traditional (繁體中文)</option>
+ <option value="hr">Croatian (Hrvatski jezik)</option>
+ <option value="cs">Czech (Ceötina)</option>
+ <option value="da">Danish (Dansk)</option>
+ <option value="nl">Dutch (Nederlands)</option>
+ <option value="en-GB">English/UK</option>
+ <option value="eo">Esperanto</option>
+ <option value="et">Estonian (eesti keel)</option>
+ <option value="fo">Faroese (føroyskt)</option>
+ <option value="fa">Farsi/Persian (‫(فارسی</option>
+ <option value="fi">Finnish (suomi)</option>
+ <option value="fr" selected="selected">French (Français)</option>
+ <option value="fr-CH">French/Swiss (Français de Suisse)</option>
+ <option value="de">German (Deutsch)</option>
+ <option value="el">Greek (Ελληνικά)</option>
+ <option value="he">Hebrew (‫(עברית</option>
+ <option value="hu">Hungarian (Magyar)</option>
+ <option value="is">Icelandic (Õslenska)</option>
+ <option value="id">Indonesian (Bahasa Indonesia)</option>
+ <option value="it">Italian (Italiano)</option>
+ <option value="ja">Japanese (日本語)</option>
+ <option value="ko">Korean (한국어)</option>
+ <option value="lv">Latvian (Latvieöu Valoda)</option>
+ <option value="lt">Lithuanian (lietuviu kalba)</option>
+ <option value="ms">Malaysian (Bahasa Malaysia)</option>
+ <option value="no">Norwegian (Norsk)</option>
+ <option value="pl">Polish (Polski)</option>
+ <option value="pt-BR">Portuguese/Brazilian (Português)</option>
+ <option value="ro">Romanian (Română)</option>
+ <option value="ru">Russian (Русский)</option>
+ <option value="sr">Serbian (српски језик)</option>
+ <option value="sr-SR">Serbian (srpski jezik)</option>
+ <option value="sk">Slovak (Slovencina)</option>
+ <option value="sl">Slovenian (Slovenski Jezik)</option>
+ <option value="es">Spanish (Español)</option>
+ <option value="sv">Swedish (Svenska)</option>
+ <option value="ta">Tamil (தமிழ்)</option>
+ <option value="th">Thai (ภาษาไทย)</option>
+ <option value="tr">Turkish (Türkçe)</option>
+ <option value="uk">Ukranian (Українська)</option>
+ <option value="vi">Vietnamese (Tiếng Việt)</option>
+ </select></p>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Localize the datepicker calendar language and format (English / Western formatting is the default). The datepicker includes built-in support for languages that read right-to-left, such as Arabic and Hebrew.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/min-max.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,33 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker - Restrict date range</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#datepicker").datepicker({minDate: -20, maxDate: '+1M +10D'});
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>Date: <input type="text" id="datepicker"></p>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Restrict the range of selectable dates with the <code>minDate</code> and <code>maxDate</code> options. Set the beginning and end dates as actual dates (new Date(2009, 1 - 1, 26)), as a numeric offset from today (-20), or as a string of periods and units ('+1M +10D'). For the last, use 'D' for days, 'W' for weeks, 'M' for months, or 'Y' for years.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/multiple-calendars.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,36 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker - Display multiple months</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $('#datepicker').datepicker({
+ numberOfMonths: 3,
+ showButtonPanel: true
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>Date: <input type="text" id="datepicker"></p>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Set the <code>numberOfMonths</code> option to an integer of 2 or more to show multiple months in a single datepicker.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/other-months.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,34 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker - Dates in other months</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#datepicker").datepicker({showOtherMonths: true, selectOtherMonths: true});
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>Date: <input type="text" id="datepicker"></p>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>The datepicker can show dates that come from other than the main month
+ being displayed. These other dates can also be made selectable.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/datepicker/show-week.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,36 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Datepicker - Show week of the year</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#datepicker").datepicker({showWeek: true, firstDay: 1});
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>Date: <input type="text" id="datepicker"></p>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>The datepicker can show the week of the year. The default calculation follows
+ the ISO 8601 definition: the week starts on Monday, the first week of the year
+ contains the first Thursday of the year. This means that some days from one
+ year may be placed into weeks 'belonging' to another year.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/demos.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,334 @@
+body {
+ font-size: 62.5%;
+}
+
+table {
+ font-size: 1em;
+}
+
+/* Site
+ -------------------------------- */
+
+body {
+ font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
+}
+
+/* Layout
+ -------------------------------- */
+
+.layout-grid {
+ width: 960px;
+}
+
+.layout-grid td {
+ vertical-align: top;
+}
+
+.layout-grid td.left-nav {
+ width: 140px;
+}
+
+.layout-grid td.normal {
+ border-left: 1px solid #eee;
+ padding: 20px 24px;
+ font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
+}
+
+.layout-grid td.demos {
+ background: url('/images/demos_bg.jpg') no-repeat;
+ height: 337px;
+ overflow: hidden;
+}
+
+/* Normal
+ -------------------------------- */
+
+.normal h3,
+.normal h4 {
+ margin: 0;
+ font-weight: normal;
+}
+
+.normal h3 {
+ padding: 0 0 9px;
+ font-size: 1.8em;
+}
+
+.normal h4 {
+ padding-bottom: 21px;
+ border-bottom: 1px dashed #999;
+ font-size: 1.2em;
+ font-weight: bold;
+}
+
+.normal p {
+ font-size: 1.2em;
+}
+
+/* Demos */
+
+.demos-nav, .demos-nav dt, .demos-nav dd, .demos-nav ul, .demos-nav li {
+ margin: 0;
+ padding: 0
+}
+
+.demos-nav {
+ float: left;
+ width: 170px;
+ font-size: 1.3em;
+}
+
+.demos-nav dt,
+.demos-nav h4 {
+ margin: 0;
+ padding: 0;
+ font: normal 1.1em "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
+ color: #e87b10;
+}
+
+.demos-nav dt,
+.demos-nav h4 {
+ margin-top: 1.5em;
+ margin-bottom: 0;
+ padding-left: 8px;
+ padding-bottom:5px;
+ line-height: 1.2em;
+ border-bottom: 1px solid #F4F4F4;
+}
+
+.demos-nav dd a,
+.demos-nav li a {
+ border-bottom: 1px solid #F4F4F4;
+ display:block;
+ padding: 4px 3px 4px 8px;
+ font-size: 90%;
+ text-decoration: none;
+ color: #555 ;
+ margin:2px 0;
+ height:13px;
+}
+
+.demos-nav dd a:hover,
+.demos-nav dd a:focus,
+.demos-nav dd a:hover,
+.demos-nav dd a:focus {
+ background: #f3f3f3;
+ color:#000;
+ -moz-border-radius: 5px; -webkit-border-radius: 5px;
+}
+ .demos-nav dd a.selected {
+ background: #555;
+ color:#ffffff;
+ -moz-border-radius: 5px; -webkit-border-radius: 5px;
+}
+
+
+/* new styles for demo pages, added by Filament 12.29.08
+eventually we should convert the font sizes to ems -- using px for now to minimize style conflicts
+*/
+
+.normal h3.demo-header { font-size:32px; padding:0 0 5px; border-bottom:1px solid #eee; text-transform: capitalize; }
+.normal h4.demo-subheader { font-size:10px; text-transform: uppercase; color:#999; padding:8px 0 3px; border:0; margin:0; }
+.normal a:link,
+.normal a:visited { color:#1b75bb; text-decoration:none; }
+.normal a:hover,
+.normal a:active { color:#0b559b; }
+
+#demo-config { padding:20px 0 0; }
+
+#demo-frame { float:left; width:540px; height:380px; border:1px solid #ddd; overflow: auto; position: relative; }
+#demo-frame h3, #demo-frame h4 { padding: 0; font-weight: bold; font-size: 1em; }
+
+#demo-config-menu { float:right; width:180px; }
+#demo-config-menu h4 { font-size:13px; color:#666; font-weight:normal; border:0; padding-left:18px; }
+
+#demo-config-menu ul { list-style: none; padding: 0; margin: 0; }
+
+#demo-config-menu li { font-size:12px; padding:0 0 0 10px; margin:3px 0; zoom: 1; }
+
+#demo-config-menu li a:link,
+#demo-config-menu li a:visited { display:block; padding:1px 8px 4px; border-bottom:1px dotted #b3b3b3; }
+* html #demo-config-menu li a:link,
+* html #demo-config-menu li a:visited { padding:1px 8px 2px; }
+#demo-config-menu li a:hover,
+#demo-config-menu li a:active { background-color:#f6f6f6; }
+
+#demo-config-menu li.demo-config-on { background: url(images/demo-config-on-tile.gif) repeat-x left center; }
+
+#demo-config-menu li.demo-config-on a:link,
+#demo-config-menu li.demo-config-on a:visited,
+#demo-config-menu li.demo-config-on a:hover,
+#demo-config-menu li.demo-config-on a:active { background: url(images/demo-config-on.gif) no-repeat left; padding-left:18px; color:#fff; border:0; margin-left:-10px; margin-top: 0px; margin-bottom: 0px; }
+
+#demo-source, #demo-notes {
+ clear: both;
+ padding: 20px 0 0;
+ font-size: 1.3em;
+}
+
+#demo-notes { width:520px; color:#333; font-size: 1em; }
+#demo-notes p code, .demo-description p code { padding: 0; font-weight: bold; }
+#demo-source pre, #demo-source code { padding: 0; }
+code, pre { padding:8px 0 8px 20px ; font-size: 1.2em; line-height:130%; }
+
+#demo-source a:link,
+#demo-source a:visited,
+#demo-source a:hover,
+#demo-source a:active { font-size:12px; padding-left:13px; background-position: left center; background-repeat: no-repeat; }
+
+#demo-source a.source-open:link,
+#demo-source a.source-open:visited,
+#demo-source a.source-open:hover,
+#demo-source a.source-open:active { background-image: url(images/demo-spindown-open.gif); }
+
+#demo-source a.source-closed:link,
+#demo-source a.source-closed:visited,
+#demo-source a.source-closed:hover,
+#demo-source a.source-closed:active { background-image: url(images/demo-spindown-closed.gif); }
+
+div.demo {
+ padding:12px;
+ font-family: "Trebuchet MS", "Arial", "Helvetica", "Verdana", "sans-serif";
+}
+
+div.demo h3.docs { clear:left; font-size:12px; font-weight:normal; padding:0 0 1em; margin:0; }
+
+div.demo-description {
+ clear:both;
+ padding:12px;
+ font-family: "Trebuchet MS", "Arial", "Helvetica", "Verdana", "sans-serif";
+ font-size: 1.3em;
+ line-height: 1.4em;
+}
+
+.ui-draggable, .ui-droppable {
+ background-position: top left;
+}
+
+.left-nav .demos-nav {
+ padding-right: 10px;
+}
+
+#demo-link { font-size:11px; padding-top: 6px; clear: both; overflow: hidden; }
+#demo-link a span.ui-icon { float:left; margin-right:3px; }
+
+/* Component containers
+----------------------------------*/
+#widget-docs .ui-widget { font-family: Trebuchet MS,Verdana,Arial,sans-serif; font-size: 1em; }
+#widget-docs .ui-widget input, #widget-docs .ui-widget select, #widget-docs .ui-widget textarea, #widget-docs .ui-widget button { font-family: Trebuchet MS,Verdana,Arial,sans-serif; font-size: 1em; }
+#widget-docs .ui-widget-header { border: 1px solid #ffffff; background: #464646 url(images/464646_40x100_textures_01_flat_100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+#widget-docs .ui-widget-header a { color: #ffffff; }
+#widget-docs .ui-widget-content { border: 1px solid #ffffff; background: #ffffff url(images/ffffff_40x100_textures_01_flat_75.png) 50% 50% repeat-x; color: #222222; }
+#widget-docs .ui-widget-content a { color: #222222; }
+
+/* Interaction states
+----------------------------------*/
+#widget-docs .ui-state-default, #widget-docs .ui-widget-content #widget-docs .ui-state-default { border: 1px solid #666666; background: #555555 url(images/555555_40x100_textures_03_highlight_soft_75.png) 50% 50% repeat-x; font-weight: normal; color: #ffffff; outline: none; }
+#widget-docs .ui-state-default a { color: #ffffff; text-decoration: none; outline: none; }
+#widget-docs .ui-state-hover, #widget-docs .ui-widget-content #widget-docs .ui-state-hover, #widget-docs .ui-state-focus, #widget-docs .ui-widget-content #widget-docs .ui-state-focus { border: 1px solid #666666; background: #444444 url(images/444444_40x100_textures_03_highlight_soft_60.png) 50% 50% repeat-x; font-weight: normal; color: #ffffff; outline: none; }
+#widget-docs .ui-state-hover a { color: #ffffff; text-decoration: none; outline: none; }
+#widget-docs .ui-state-active, #widget-docs .ui-widget-content #widget-docs .ui-state-active { border: 1px solid #666666; background: #ffffff url(images/ffffff_40x100_textures_01_flat_65.png) 50% 50% repeat-x; font-weight: normal; color: #F6921E; outline: none; }
+#widget-docs .ui-state-active a { color: #F6921E; outline: none; text-decoration: none; }
+
+/* Interaction Cues
+----------------------------------*/
+#widget-docs .ui-state-highlight, #widget-docs .ui-widget-content #widget-docs .ui-state-highlight {border: 1px solid #fcefa1; background: #fbf9ee url(images/fbf9ee_40x100_textures_02_glass_55.png) 50% 50% repeat-x; color: #363636; }
+#widget-docs .ui-state-error, #widget-docs .ui-widget-content #widget-docs .ui-state-error {border: 1px solid #cd0a0a; background: #fef1ec url(images/fef1ec_40x100_textures_05_inset_soft_95.png) 50% bottom repeat-x; color: #cd0a0a; }
+#widget-docs .ui-state-error-text, #widget-docs .ui-widget-content #widget-docs .ui-state-error-text { color: #cd0a0a; }
+#widget-docs .ui-state-disabled, #widget-docs .ui-widget-content #widget-docs .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+#widget-docs .ui-priority-primary, #widget-docs .ui-widget-content #widget-docs .ui-priority-primary { font-weight: bold; }
+#widget-docs .ui-priority-secondary, #widget-docs .ui-widget-content #widget-docs .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+#demo-frame-wrapper .ui-icon, #widget-docs .ui-icon { width: 16px; height: 16px; background-image: url(images/222222_256x240_icons_icons.png); }
+#widget-docs .ui-widget-content .ui-icon {background-image: url(images/222222_256x240_icons_icons.png); }
+#widget-docs .ui-widget-header .ui-icon {background-image: url(images/222222_256x240_icons_icons.png); }
+#widget-docs .ui-state-default .ui-icon { background-image: url(images/888888_256x240_icons_icons.png); }
+#widget-docs .ui-state-hover .ui-icon, #widget-docs .ui-state-focus .ui-icon {background-image: url(images/454545_256x240_icons_icons.png); }
+#widget-docs .ui-state-active .ui-icon {background-image: url(images/454545_256x240_icons_icons.png); }
+#widget-docs .ui-state-highlight .ui-icon {background-image: url(images/2e83ff_256x240_icons_icons.png); }
+#widget-docs .ui-state-error .ui-icon, #widget-docs .ui-state-error-text .ui-icon {background-image: url(images/cd0a0a_256x240_icons_icons.png); }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+#widget-docs .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; }
+#widget-docs .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; }
+#widget-docs .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; }
+#widget-docs .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+#widget-docs .ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; }
+#widget-docs .ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+#widget-docs .ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; }
+#widget-docs .ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; }
+#widget-docs .ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; }
+
+/* Overlays */
+#widget-docs .ui-widget-overlay { background: #aaaaaa url(images/aaaaaa_40x100_textures_01_flat_0.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); }
+#widget-docs .ui-widget-shadow { margin: -8px 0 0 -8px; padding: 8px; background: #aaaaaa url(images/aaaaaa_40x100_textures_01_flat_0.png) 50% 50% repeat-x; opacity: .30;filter:Alpha(Opacity=30); -moz-border-radius: 8px; -webkit-border-radius: 8px; }
+
+/*
+----------------------------------*/
+
+#widget-docs { margin:20px 0 0; border: none; }
+
+#widget-docs h2, #widget-docs h3, #widget-docs h4, #widget-docs p, #widget-docs ul, #widget-docs code { margin:0; padding:0; }
+#widget-docs code { display:block; color:#444; font-size:.9em; margin:0 0 1em; }
+#widget-docs code strong { color:#000; }
+#widget-docs p { margin:0 3em 1.2em 0; }
+#widget-docs p.intro { font-size:13px; color:#666; line-height:1.3; }
+#widget-docs ul { list-style-type: none; }
+
+#widget-docs h2 { font-size:16px; margin:1.2em 0 .5em; }
+#widget-docs h3 { font-size:14px; color:#e6820E; margin:1.5em 0 .5em; }
+.normal #widget-docs h4 { font-size:12px; color:#000; border:0; margin:0 0 .5em; }
+
+#docs-overview-main { width:400px; }
+#docs-overview-sidebar { float:right; width:200px; }
+#docs-overview-sidebar a span { color:#666; }
+#widget-docs #docs-overview-main p { margin-right:0; }
+#widget-docs #docs-overview-sidebar h4 { padding-left:0; }
+
+.docs-list-header { float:left; width:100%; margin:10px 0 0; border-bottom:1px solid #eee; }
+#widget-docs .docs-list-header h2 { float:left; margin:0; }
+#widget-docs .docs-list-header p { float:right; margin:5px 0; font-size:11px; }
+
+.docs-list { float:left; width:100%; padding:0 0 10px; }
+.docs-list .param-header { float:left; clear:left; width:100%; padding:8px 0; border-top:1px solid #eee; }
+#widget-docs .param-header h3, #widget-docs .param-header p { margin:0; float:left; }
+#widget-docs .param-header h3 { width:50%; }
+#widget-docs .param-header h3 span { background: url(images/demo-spindown-closed.gif) no-repeat left; padding-left:13px; }
+#widget-docs .param-open .param-header h3 span { background: url(images/demo-spindown-open.gif) no-repeat left; }
+#widget-docs .param-header p { width:24%; }
+#widget-docs .param-header p.param-type span { background: url(images/icon-docs-info.gif) no-repeat left; cursor:pointer; border-bottom:1px dashed #ccc; padding-left:15px; }
+
+.param-details { padding-left:13px; }
+.param-args { margin:0 0 1.5em; border-top:1px dotted #ccc;}
+.param-args td { padding:3px 30px 3px 5px; border-bottom:1px dotted #ccc; }
+
+
+/* overrides for ui-tab styles */
+#widget-docs ul.ui-tabs-nav { padding:0 0 0 8px; }
+#widget-docs .ui-tabs-nav li { margin:5px 5px 0 0; }
+
+#widget-docs .ui-tabs-nav li a:link,
+#widget-docs .ui-tabs-nav li a:visited,
+#widget-docs .ui-tabs-nav li a:hover,
+#widget-docs .ui-tabs-nav li a:active { font-size:14px; padding:4px 1.2em 3px; color:#fff; }
+
+#widget-docs .ui-tabs-nav li.ui-tabs-selected a:link,
+#widget-docs .ui-tabs-nav li.ui-tabs-selected a:visited,
+#widget-docs .ui-tabs-nav li.ui-tabs-selected a:hover,
+#widget-docs .ui-tabs-nav li.ui-tabs-selected a:active { color:#e6820E; }
+
+#widget-docs .ui-tabs-panel { padding:20px 9px; font-size:12px; line-height:1.4; color:#000; }
+
+#widget-docs .ui-widget-content a:link,
+#widget-docs .ui-widget-content a:visited { color:#1b75bb; text-decoration:none; }
+#widget-docs .ui-widget-content a:hover,
+#widget-docs .ui-widget-content a:active { color:#0b559b; }
+
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/dialog/animated.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,56 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Dialog - Animation</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../external/jquery.bgiframe-2.1.1.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.blind.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.explode.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ // increase the default animation speed to exaggerate the effect
+ $.fx.speeds._default = 1000;
+ $(function() {
+ $('#dialog').dialog({
+ autoOpen: false,
+ show: 'blind',
+ hide: 'explode'
+ });
+
+ $('#opener').click(function() {
+ $('#dialog').dialog('open');
+ return false;
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="dialog" title="Basic dialog">
+ <p>This is an animated dialog which is useful for displaying information. The dialog window can be moved, resized and closed with the 'x' icon.</p>
+</div>
+
+<button id="opener">Open Dialog</button>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Dialogs may be animated by specifying an effect for the show and/or hide properties. You must include the individual effects file for any effects you would like to use.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/dialog/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,54 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Dialog - Default functionality</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../external/jquery.bgiframe-2.1.1.js.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#dialog").dialog();
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="dialog" title="Basic dialog">
+ <p>This is the default dialog which is useful for displaying information. The dialog window can be moved, resized and closed with the 'x' icon.</p>
+</div>
+
+<!-- Sample page content to illustrate the layering of the dialog -->
+<div class="hiddenInViewSource" style="padding:20px;">
+<p>Sed vel diam id libero <a href="http://example.com">rutrum convallis</a>. Donec aliquet leo vel magna. Phasellus rhoncus faucibus ante. Etiam bibendum, enim faucibus aliquet rhoncus, arcu felis ultricies neque, sit amet auctor elit eros a lectus.</p>
+<form>
+ <input value="text input" /><br />
+ <input type="checkbox" />checkbox<br />
+ <input type="radio" />radio<br />
+ <select>
+ <option>select</option>
+ </select><br /><br />
+ <textarea>textarea</textarea><br />
+</form>
+</div><!-- End sample page content -->
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>The basic dialog window is an overlay positioned within the viewport and is protected from page content (like select elements) shining through with an iframe. It has a title bar and a content area, and can be moved, resized and closed with the 'x' icon by default.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/dialog/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Dialog Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ <li><a href="animated.html">Animated dialog</a></li>
+ <li><a href="modal.html">Modal dialog</a></li>
+ <li><a href="modal-message.html">Modal message</a></li>
+ <li><a href="modal-confirmation.html">Modal confirmation</a></li>
+ <li><a href="modal-form.html">Modal form</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/dialog/modal-confirmation.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,69 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Dialog - Modal confirmation</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../external/jquery.bgiframe-2.1.1.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.button.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ // a workaround for a flaw in the demo system (http://dev.jqueryui.com/ticket/4375), ignore!
+ $("#dialog").dialog("destroy");
+
+ $("#dialog-confirm").dialog({
+ resizable: false,
+ height:140,
+ modal: true,
+ buttons: {
+ 'Delete all items': function() {
+ $(this).dialog('close');
+ },
+ Cancel: function() {
+ $(this).dialog('close');
+ }
+ }
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="dialog-confirm" title="Empty the recycle bin?">
+ <p><span class="ui-icon ui-icon-alert" style="float:left; margin:0 7px 20px 0;"></span>These items will be permanently deleted and cannot be recovered. Are you sure?</p>
+</div>
+
+<!-- Sample page content to illustrate the layering of the dialog -->
+<div class="hiddenInViewSource" style="padding:20px;">
+ <p>Sed vel diam id libero <a href="http://example.com">rutrum convallis</a>. Donec aliquet leo vel magna. Phasellus rhoncus faucibus ante. Etiam bibendum, enim faucibus aliquet rhoncus, arcu felis ultricies neque, sit amet auctor elit eros a lectus.</p>
+ <form>
+ <input value="text input" /><br />
+ <input type="checkbox" />checkbox<br />
+ <input type="radio" />radio<br />
+ <select>
+ <option>select</option>
+ </select><br /><br />
+ <textarea>textarea</textarea><br />
+ </form>
+</div><!-- End sample page content -->
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Confirm an action that may be destructive or important. Set the <code>modal</code> option to true, and specify primary and secondary user actions with the <code>buttons</code> option.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/dialog/modal-form.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,177 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Dialog - Modal form</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../external/jquery.bgiframe-2.1.1.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.button.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ body { font-size: 62.5%; }
+ label, input { display:block; }
+ input.text { margin-bottom:12px; width:95%; padding: .4em; }
+ fieldset { padding:0; border:0; margin-top:25px; }
+ h1 { font-size: 1.2em; margin: .6em 0; }
+ div#users-contain { width: 350px; margin: 20px 0; }
+ div#users-contain table { margin: 1em 0; border-collapse: collapse; width: 100%; }
+ div#users-contain table td, div#users-contain table th { border: 1px solid #eee; padding: .6em 10px; text-align: left; }
+ .ui-dialog .ui-state-error { padding: .3em; }
+ .validateTips { border: 1px solid transparent; padding: 0.3em; }
+
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ // a workaround for a flaw in the demo system (http://dev.jqueryui.com/ticket/4375), ignore!
+ $("#dialog").dialog("destroy");
+
+ var name = $("#name"),
+ email = $("#email"),
+ password = $("#password"),
+ allFields = $([]).add(name).add(email).add(password),
+ tips = $(".validateTips");
+
+ function updateTips(t) {
+ tips
+ .text(t)
+ .addClass('ui-state-highlight');
+ setTimeout(function() {
+ tips.removeClass('ui-state-highlight', 1500);
+ }, 500);
+ }
+
+ function checkLength(o,n,min,max) {
+
+ if ( o.val().length > max || o.val().length < min ) {
+ o.addClass('ui-state-error');
+ updateTips("Length of " + n + " must be between "+min+" and "+max+".");
+ return false;
+ } else {
+ return true;
+ }
+
+ }
+
+ function checkRegexp(o,regexp,n) {
+
+ if ( !( regexp.test( o.val() ) ) ) {
+ o.addClass('ui-state-error');
+ updateTips(n);
+ return false;
+ } else {
+ return true;
+ }
+
+ }
+
+ $("#dialog-form").dialog({
+ autoOpen: false,
+ height: 300,
+ width: 350,
+ modal: true,
+ buttons: {
+ 'Create an account': function() {
+ var bValid = true;
+ allFields.removeClass('ui-state-error');
+
+ bValid = bValid && checkLength(name,"username",3,16);
+ bValid = bValid && checkLength(email,"email",6,80);
+ bValid = bValid && checkLength(password,"password",5,16);
+
+ bValid = bValid && checkRegexp(name,/^[a-z]([0-9a-z_])+$/i,"Username may consist of a-z, 0-9, underscores, begin with a letter.");
+ // From jquery.validate.js (by joern), contributed by Scott Gonzalez: http://projects.scottsplayground.com/email_address_validation/
+ bValid = bValid && checkRegexp(email,/^((([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+(\.([a-z]|\d|[!#\$%&'\*\+\-\/=\?\^_`{\|}~]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])+)*)|((\x22)((((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(([\x01-\x08\x0b\x0c\x0e-\x1f\x7f]|\x21|[\x23-\x5b]|[\x5d-\x7e]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(\\([\x01-\x09\x0b\x0c\x0d-\x7f]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF]))))*(((\x20|\x09)*(\x0d\x0a))?(\x20|\x09)+)?(\x22)))@((([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|\d|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.)+(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])|(([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])([a-z]|\d|-|\.|_|~|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])*([a-z]|[\u00A0-\uD7FF\uF900-\uFDCF\uFDF0-\uFFEF])))\.?$/i,"eg. ui@jquery.com");
+ bValid = bValid && checkRegexp(password,/^([0-9a-zA-Z])+$/,"Password field only allow : a-z 0-9");
+
+ if (bValid) {
+ $('#users tbody').append('<tr>' +
+ '<td>' + name.val() + '</td>' +
+ '<td>' + email.val() + '</td>' +
+ '<td>' + password.val() + '</td>' +
+ '</tr>');
+ $(this).dialog('close');
+ }
+ },
+ Cancel: function() {
+ $(this).dialog('close');
+ }
+ },
+ close: function() {
+ allFields.val('').removeClass('ui-state-error');
+ }
+ });
+
+
+
+ $('#create-user')
+ .button()
+ .click(function() {
+ $('#dialog-form').dialog('open');
+ });
+
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="dialog-form" title="Create new user">
+ <p class="validateTips">All form fields are required.</p>
+
+ <form>
+ <fieldset>
+ <label for="name">Name</label>
+ <input type="text" name="name" id="name" class="text ui-widget-content ui-corner-all" />
+ <label for="email">Email</label>
+ <input type="text" name="email" id="email" value="" class="text ui-widget-content ui-corner-all" />
+ <label for="password">Password</label>
+ <input type="password" name="password" id="password" value="" class="text ui-widget-content ui-corner-all" />
+ </fieldset>
+ </form>
+</div>
+
+
+<div id="users-contain" class="ui-widget">
+
+ <h1>Existing Users:</h1>
+
+
+ <table id="users" class="ui-widget ui-widget-content">
+ <thead>
+ <tr class="ui-widget-header ">
+ <th>Name</th>
+ <th>Email</th>
+ <th>Password</th>
+ </tr>
+ </thead>
+ <tbody>
+ <tr>
+ <td>John Doe</td>
+ <td>john.doe@example.com</td>
+ <td>johndoe1</td>
+ </tr>
+ </tbody>
+ </table>
+</div>
+<button id="create-user">Create new user</button>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Use a modal dialog to require that the user enter data during a multi-step process. Embed form markup in the content area, set the <code>modal</code> option to true, and specify primary and secondary user actions with the <code>buttons</code> option.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/dialog/modal-message.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,71 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Dialog - Modal message</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../external/jquery.bgiframe-2.1.1.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.button.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ // a workaround for a flaw in the demo system (http://dev.jqueryui.com/ticket/4375), ignore!
+ $("#dialog").dialog("destroy");
+
+ $("#dialog-message").dialog({
+ modal: true,
+ buttons: {
+ Ok: function() {
+ $(this).dialog('close');
+ }
+ }
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="dialog-message" title="Download complete">
+ <p>
+ <span class="ui-icon ui-icon-circle-check" style="float:left; margin:0 7px 50px 0;"></span>
+ Your files have downloaded successfully into the My Downloads folder.
+ </p>
+ <p>
+ Currently using <b>36% of your storage space</b>.
+ </p>
+</div>
+
+<!-- Sample page content to illustrate the layering of the dialog -->
+<div class="hiddenInViewSource" style="padding:20px;">
+ <p>Sed vel diam id libero <a href="http://example.com">rutrum convallis</a>. Donec aliquet leo vel magna. Phasellus rhoncus faucibus ante. Etiam bibendum, enim faucibus aliquet rhoncus, arcu felis ultricies neque, sit amet auctor elit eros a lectus.</p>
+ <form>
+ <input value="text input" /><br />
+ <input type="checkbox" />checkbox<br />
+ <input type="radio" />radio<br />
+ <select>
+ <option>select</option>
+ </select><br /><br />
+ <textarea>textarea</textarea><br />
+ </form>
+</div><!-- End sample page content -->
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Use a modal dialog to explicitly acknowledge information or an action before continuing their work. Set the <code>modal</code> option to true, and specify a primary action (Ok) with the <code>buttons</code> option.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/dialog/modal.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,61 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Dialog - Basic modal</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../external/jquery.bgiframe-2.1.1.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ // a workaround for a flaw in the demo system (http://dev.jqueryui.com/ticket/4375), ignore!
+ $("#dialog").dialog("destroy");
+
+ $("#dialog-modal").dialog({
+ height: 140,
+ modal: true
+ });
+ });
+ </script>
+</head>
+<body>
+
+
+<div class="demo">
+
+<div id="dialog-modal" title="Basic modal dialog">
+ <p>Adding the modal overlay screen makes the dialog look more prominent because it dims out the page content.</p>
+</div>
+
+<!-- Sample page content to illustrate the layering of the dialog -->
+<div class="hiddenInViewSource" style="padding:20px;">
+ <p>Sed vel diam id libero <a href="http://example.com">rutrum convallis</a>. Donec aliquet leo vel magna. Phasellus rhoncus faucibus ante. Etiam bibendum, enim faucibus aliquet rhoncus, arcu felis ultricies neque, sit amet auctor elit eros a lectus.</p>
+ <form>
+ <input value="text input" /><br />
+ <input type="checkbox" />checkbox<br />
+ <input type="radio" />radio<br />
+ <select>
+ <option>select</option>
+ </select><br /><br />
+ <textarea>textarea</textarea><br />
+ </form>
+</div><!-- End sample page content -->
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>A modal dialog prevents the user from interacting with the rest of the page until it is closed. To add a semi-transparent layer that dims out the page content behind the dialog, set the background color and opacity of the <code>overlay</code> option.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/draggable/constrain-movement.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,70 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Draggable - Constrain movement</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .draggable { width: 90px; height: 90px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
+ #draggable, #draggable2 { margin-bottom:20px; }
+ #draggable { cursor: n-resize; }
+ #draggable2 { cursor: e-resize; }
+ #containment-wrapper { width: 95%; height:150px; border:2px solid #ccc; padding: 10px;}
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#draggable").draggable({ axis: 'y' });
+ $("#draggable2").draggable({ axis: 'x' });
+
+ $("#draggable3").draggable({ containment: '#containment-wrapper', scroll: false });
+ $("#draggable4").draggable({ containment: '#demo-frame' });
+ $("#draggable5").draggable({ containment: 'parent' });
+
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<h3 class="docs">Constrain movement along an axis:</h3>
+
+<div id="draggable" class="draggable ui-widget-content">
+ <p>I can be dragged only vertically</p>
+</div>
+
+<div id="draggable2" class="draggable ui-widget-content">
+ <p>I can be dragged only horizontally</p>
+</div>
+
+<h3 class="docs">Or to within another DOM element:</h3>
+<div id="containment-wrapper">
+<div id="draggable3" class="draggable ui-widget-content">
+ <p>I'm contained within the box</p>
+</div>
+
+<div id="draggable4" class="draggable ui-widget-content">
+ <p>I'm contained within the box's parent</p>
+</div>
+
+<div class="draggable ui-widget-content">
+ <p id="draggable5" class="ui-widget-header">I'm contained within my parent</p>
+</div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+Constrain the movement of each draggable by defining the boundaries of the draggable area. Set the <code>axis</code> option to limit the draggable's path to the x- or y-axis, or use the <code>containment</code> option to specify a parent DOM element or a jQuery selector, like 'document.'
+</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/draggable/cursor-style.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,49 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Draggable - Cursor style</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #draggable, #draggable2, #draggable3 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#draggable").draggable({ cursorAt: { cursor: 'move', top: 56, left: 56 } });
+ $("#draggable2").draggable({ cursorAt: { cursor: 'crosshair', top: -5, left: -5 } });
+ $("#draggable3").draggable({ cursorAt: { bottom: 0 } });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="draggable" class="ui-widget-content">
+ <p>I will always stick to the center (relative to the mouse)</p>
+</div>
+
+<div id="draggable2" class="ui-widget-content">
+ <p>My cursor is at left -5 and top -5</p>
+</div>
+
+<div id="draggable3" class="ui-widget-content">
+ <p>My cursor position is only controlled for the 'bottom' value</p>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+Position the cursor while dragging the object. By default the cursor appears in the center of the dragged object; use the <code>cursorAt</code> option to specify another location relative to the draggable (specify a pixel value from the top, right, bottom, and/or left). Customize the cursor's appearance by supplying the <code>cursor</code> option with a valid CSS cursor value: default, move, pointer, crosshair, etc.
+</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/draggable/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,41 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Draggable - Default functionality</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #draggable { width: 150px; height: 150px; padding: 0.5em; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#draggable").draggable();
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="draggable" class="ui-widget-content">
+ <p>Drag me around</p>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+Enable draggable functionality on any DOM element. Move the draggable object by clicking on it with the mouse and dragging it anywhere within the viewport.
+</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/draggable/delay-start.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,45 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Draggable - Delay start</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #draggable, #draggable2 { width: 120px; height: 120px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#draggable").draggable({ distance: 20 });
+ $("#draggable2").draggable({ delay: 1000 });
+ $(".ui-draggable").disableSelection();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="draggable" class="ui-widget-content">
+ <p>Only if you drag me by 20 pixels, the dragging will start</p>
+</div>
+
+<div id="draggable2" class="ui-widget-content">
+ <p>Regardless of the distance, you have to drag and wait for 1000ms before dragging starts</p>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+Delay the start of dragging for a number of milliseconds with the <code>delay</code> option; prevent dragging until the cursor is held down and dragged a specifed number of pixels with the <code>distance</code> option.
+</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/draggable/events.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,77 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Draggable - Events</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #draggable { width: 16em; padding: 0 1em; }
+ #draggable ul li { margin: 1em 0; padding: 0.5em 0; } * html #draggable ul li { height: 1%; }
+ #draggable ul li span.ui-icon { float: left; }
+ #draggable ul li span.count { font-weight: bold; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ var $start_counter = $('#event-start'), $drag_counter = $('#event-drag'), $stop_counter = $('#event-stop');
+ var counts = [0,0,0];
+
+ $("#draggable").draggable({
+ start: function() {
+ counts[0]++;
+ updateCounterStatus($start_counter,counts[0]);
+ },
+ drag: function() {
+ counts[1]++;
+ updateCounterStatus($drag_counter,counts[1]);
+ },
+ stop: function() {
+ counts[2]++;
+ updateCounterStatus($stop_counter,counts[2]);
+ }
+ });
+ });
+
+ function updateCounterStatus($event_counter,new_count) {
+ // first update the status visually...
+ if (!$event_counter.hasClass('ui-state-hover')) {
+ $event_counter.addClass('ui-state-hover')
+ .siblings().removeClass('ui-state-hover');
+ }
+ // ...then update the numbers
+ $('span.count',$event_counter).text(new_count);
+ }
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="draggable" class="ui-widget ui-widget-content">
+
+ <p>Drag me to trigger the chain of events.</p>
+
+ <ul class="ui-helper-reset">
+ <li id="event-start" class="ui-state-default ui-corner-all"><span class="ui-icon ui-icon-play"></span>"start" invoked <span class="count">0</span>x</li>
+ <li id="event-drag" class="ui-state-default ui-corner-all"><span class="ui-icon ui-icon-arrow-4"></span>"drag" invoked <span class="count">0</span>x</li>
+ <li id="event-stop" class="ui-state-default ui-corner-all"><span class="ui-icon ui-icon-stop"></span>"stop" invoked <span class="count">0</span>x</li>
+ </ul>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+Layer functionality onto the draggable using the <code>start</code>, <code>drag</code>, and <code>stop</code> events. Start is fired at the start of the drag; drag during the drag; and stop when dragging stops.
+</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/draggable/handle.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,48 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Draggable - Handles</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #draggable, #draggable2 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
+ #draggable p { cursor: move; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#draggable").draggable({ handle: 'p' });
+ $("#draggable2").draggable({ cancel: "p.ui-widget-header" });
+ $("div, p").disableSelection();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="draggable" class="ui-widget-content">
+ <p class="ui-widget-header">I can be dragged only by this handle</p>
+</div>
+
+<div id="draggable2" class="ui-widget-content">
+ <p>You can drag me around…</p>
+ <p class="ui-widget-header">…but you can't drag me by this handle.</p>
+</div>
+
+<!-- ADD CANCEL DEMO -->
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Allow dragging only when the cursor is over a specific part of the draggable. Use the <code>handle</code> option to specify the jQuery selector of an element (or group of elements) used to drag the object.</p>
+<p>Or prevent dragging when the cursor is over a specific element (or group of elements) within the draggable. Use the <code>cancel</code> option to specify a jQuery selector over which to "cancel" draggable functionality.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/draggable/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,28 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Draggable Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ <li><a href="events.html">Events</a></li>
+ <li><a href="constrain-movement.html">Constrain movement</a></li>
+ <li><a href="delay-start.html">Delay start</a></li>
+ <li><a href="snap-to.html">Snap to element or grid</a></li>
+ <li><a href="scroll.html">Auto-scroll</a></li>
+ <li><a href="revert.html">Revert position</a></li>
+ <li><a href="visual-feedback.html">Visual feedback</a></li>
+ <li><a href="handle.html">Drag handle</a></li>
+ <li><a href="cursor-style.html">Cursor style</a></li>
+ <li><a href="sortable.html">Draggable + Sortable</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/draggable/revert.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,44 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Draggable - Revert position</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #draggable, #draggable2 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#draggable").draggable({ revert: true });
+ $("#draggable2").draggable({ revert: true, helper: 'clone' });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="draggable" class="ui-widget-content">
+ <p>Revert the original</p>
+</div>
+
+<div id="draggable2" class="ui-widget-content">
+ <p>Revert the helper</p>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+Return the draggable (or it's helper) to its original location when dragging stops with the boolean <code>revert</code> option.
+</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/draggable/scroll.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,51 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Draggable - Auto-scroll</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #draggable, #draggable2, #draggable3 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#draggable").draggable({ scroll: true });
+ $("#draggable2").draggable({ scroll: true, scrollSensitivity: 100 });
+ $("#draggable3").draggable({ scroll: true, scrollSpeed: 100 });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="draggable" class="ui-widget-content">
+ <p>Scroll set to true, default settings</p>
+</div>
+
+<div id="draggable2" class="ui-widget-content">
+ <p>scrollSensitivity set to 100</p>
+</div>
+
+<div id="draggable3" class="ui-widget-content">
+ <p>scrollSpeed set to 100</p>
+</div>
+
+<div style='height: 5000px; width: 1px;'></div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+Automatically scroll the document when the draggable is moved beyond the viewport. Set the <code>scroll</code> option to true to enable auto-scrolling, and fine-tune when scrolling is triggered and its speed with the <code>scrollSensitivity</code> and <code>scrollSpeed</code> options.
+</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/draggable/snap-to.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,70 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Draggable - Snap to element or grid</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .draggable { width: 90px; height: 80px; padding: 5px; float: left; margin: 0 10px 10px 0; font-size: .9em; }
+ .ui-widget-header p, .ui-widget-content p { margin: 0; }
+ #snaptarget { height: 140px; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#draggable").draggable({ snap: true });
+ $("#draggable2").draggable({ snap: '.ui-widget-header' });
+ $("#draggable3").draggable({ snap: '.ui-widget-header', snapMode: 'outer' });
+ $("#draggable4").draggable({ grid: [20,20] });
+ $("#draggable5").draggable({ grid: [80, 80] });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="snaptarget" class="ui-widget-header">
+ <p>I'm a snap target</p>
+</div>
+
+<br clear="both" />
+
+<div id="draggable" class="draggable ui-widget-content">
+ <p>Default (snap: true), snaps to all other draggable elements</p>
+</div>
+
+<div id="draggable2" class="draggable ui-widget-content">
+ <p>I only snap to the big box</p>
+</div>
+
+<div id="draggable3" class="draggable ui-widget-content">
+ <p>I only snap to the outer edges of the big box</p>
+</div>
+
+<div id="draggable4" class="draggable ui-widget-content">
+ <p>I snap to a 20 x 20 grid</p>
+</div>
+
+<div id="draggable5" class="draggable ui-widget-content">
+ <p>I snap to a 80 x 80 grid</p>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Snap the draggable to the inner or outer boundaries of a DOM element. Use the <code>snap</code>, <code>snapMode</code> (inner, outer, both), and <code>snapTolerance</code> (distance in pixels the draggable must be from the element when snapping is invoked) options. </p>
+
+<p>Or snap the draggable to a grid. Set the dimensions of grid cells (height and width in pixels) with the <code>grid</code> option.</p>
+
+</div><!-- End demo-description -->
+
+
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/draggable/sortable.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,57 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Draggable + Sortable</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .demo ul { list-style-type: none; margin: 0; padding: 0; margin-bottom: 10px; }
+ .demo li { margin: 5px; padding: 5px; width: 150px; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#sortable").sortable({
+ revert: true
+ });
+ $("#draggable").draggable({
+ connectToSortable: '#sortable',
+ helper: 'clone',
+ revert: 'invalid'
+ });
+ $("ul, li").disableSelection();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<ul>
+ <li id="draggable" class="ui-state-highlight">Drag me down</li>
+</ul>
+
+<ul id="sortable">
+ <li class="ui-state-default">Item 1</li>
+ <li class="ui-state-default">Item 2</li>
+ <li class="ui-state-default">Item 3</li>
+ <li class="ui-state-default">Item 4</li>
+ <li class="ui-state-default">Item 5</li>
+</ul>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+Draggables are built to interact seamlessly with <a href="#">sortables</a>.
+</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/draggable/visual-feedback.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,76 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Draggable - Visual feedback</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #draggable, #draggable2, #draggable3, #set div { width: 90px; height: 90px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
+ #draggable, #draggable2, #draggable3 { margin-bottom:20px; }
+ #set { clear:both; float:left; width: 368px; height: 120px; }
+ p { clear:both; margin:0; padding:1em 0; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#draggable").draggable({ helper: 'original' });
+ $("#draggable2").draggable({ opacity: 0.7, helper: 'clone' });
+ $("#draggable3").draggable({
+ cursor: 'move',
+ cursorAt: { top: -12, left: -20 },
+ helper: function(event) {
+ return $('<div class="ui-widget-header">I\'m a custom helper</div>');
+ }
+ });
+ $("#set div").draggable({ stack: '#set div' });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<h3 class="docs">With helpers:</h3>
+
+<div id="draggable" class="ui-widget-content">
+ <p>Original</p>
+</div>
+
+<div id="draggable2" class="ui-widget-content">
+ <p>Semi-transparent clone</p>
+</div>
+
+<div id="draggable3" class="ui-widget-content">
+ <p>Custom helper (in combination with cursorAt)</p>
+</div>
+
+<h3 class="docs">Stacked:</h3>
+<div id="set">
+ <div class="ui-widget-content">
+ <p>We are draggables..</p>
+ </div>
+
+ <div class="ui-widget-content">
+ <p>..whose z-indexes are controlled automatically..</p>
+ </div>
+
+ <div class="ui-widget-content">
+ <p>..with the stack option.</p>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Provide feedback to users as they drag an object in the form of a helper. The <code>helper</code> option accepts the values 'original' (the draggable object moves with the cursor), 'clone' (a duplicate of the draggable moves with the cursor), or a function that returns a DOM element (that element is shown near the cursor during drag). Control the helper's transparency with the <code>opacity</code> option.</p>
+
+<p>To clarify which draggable is in play, bring the draggable in motion to front. Use the <code>zIndex</code> option to set a higher z-index for the helper, if in play, or use the <code>stack</code> option to ensure that the last item dragged will appear on top of others in the same group on drag stop.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/droppable/accepted-elements.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,58 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Droppable - Accept Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #droppable { width: 150px; height: 150px; padding: 0.5em; float: left; margin: 10px; }
+ #draggable, #draggable-nonvalid { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+
+ $("#draggable, #draggable-nonvalid").draggable();
+
+ $("#droppable").droppable({
+ accept: '#draggable',
+ activeClass: 'ui-state-hover',
+ hoverClass: 'ui-state-active',
+ drop: function(event, ui) {
+ $(this).addClass('ui-state-highlight').find('p').html('Dropped!');
+ }
+ });
+
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="draggable-nonvalid" class="ui-widget-content">
+ <p>I'm draggable but can't be dropped</p>
+</div>
+
+<div id="draggable" class="ui-widget-content">
+ <p>Drag me to my target</p>
+</div>
+
+<div id="droppable" class="ui-widget-header">
+ <p>accept: '#draggable'</p>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Specify using the <code>accept</code> option which element (or group of elements) is accepted by the target droppable.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/droppable/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,49 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Droppable - Default Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #draggable { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; }
+ #droppable { width: 150px; height: 150px; padding: 0.5em; float: left; margin: 10px; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#draggable").draggable();
+ $("#droppable").droppable({
+ drop: function(event, ui) {
+ $(this).addClass('ui-state-highlight').find('p').html('Dropped!');
+ }
+ });
+
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="draggable" class="ui-widget-content">
+ <p>Drag me to my target</p>
+</div>
+
+<div id="droppable" class="ui-widget-header">
+ <p>Drop here</p>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Enable any DOM element to be droppable, a target for draggable elements.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
Binary file web/static/css/jq-css/demos/droppable/images/high_tatras.jpg has changed
Binary file web/static/css/jq-css/demos/droppable/images/high_tatras2.jpg has changed
Binary file web/static/css/jq-css/demos/droppable/images/high_tatras2_min.jpg has changed
Binary file web/static/css/jq-css/demos/droppable/images/high_tatras3.jpg has changed
Binary file web/static/css/jq-css/demos/droppable/images/high_tatras3_min.jpg has changed
Binary file web/static/css/jq-css/demos/droppable/images/high_tatras4.jpg has changed
Binary file web/static/css/jq-css/demos/droppable/images/high_tatras4_min.jpg has changed
Binary file web/static/css/jq-css/demos/droppable/images/high_tatras_min.jpg has changed
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/droppable/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,24 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Droppable Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ <li><a href="accepted-elements.html">Accepted elements</a></li>
+ <li><a href="propagation.html">Prevent propagation</a></li>
+ <li><a href="visual-feedback.html">Visual feedback</a></li>
+ <li><a href="revert.html">Revert draggable position</a></li>
+ <li><a href="shopping-cart.html">Shopping Cart</a></li>
+ <li><a href="photo-manager.html">Simple photo manager</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/droppable/photo-manager.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,167 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Droppable - Simple photo manager</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #gallery { float: left; width: 65%; min-height: 12em; } * html #gallery { height: 12em; } /* IE6 */
+ .gallery.custom-state-active { background: #eee; }
+ .gallery li { float: left; width: 96px; padding: 0.4em; margin: 0 0.4em 0.4em 0; text-align: center; }
+ .gallery li h5 { margin: 0 0 0.4em; cursor: move; }
+ .gallery li a { float: right; }
+ .gallery li a.ui-icon-zoomin { float: left; }
+ .gallery li img { width: 100%; cursor: move; }
+
+ #trash { float: right; width: 32%; min-height: 18em; padding: 1%;} * html #trash { height: 18em; } /* IE6 */
+ #trash h4 { line-height: 16px; margin: 0 0 0.4em; }
+ #trash h4 .ui-icon { float: left; }
+ #trash .gallery h5 { display: none; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ // there's the gallery and the trash
+ var $gallery = $('#gallery'), $trash = $('#trash');
+
+ // let the gallery items be draggable
+ $('li',$gallery).draggable({
+ cancel: 'a.ui-icon',// clicking an icon won't initiate dragging
+ revert: 'invalid', // when not dropped, the item will revert back to its initial position
+ containment: $('#demo-frame').length ? '#demo-frame' : 'document', // stick to demo-frame if present
+ helper: 'clone',
+ cursor: 'move'
+ });
+
+ // let the trash be droppable, accepting the gallery items
+ $trash.droppable({
+ accept: '#gallery > li',
+ activeClass: 'ui-state-highlight',
+ drop: function(ev, ui) {
+ deleteImage(ui.draggable);
+ }
+ });
+
+ // let the gallery be droppable as well, accepting items from the trash
+ $gallery.droppable({
+ accept: '#trash li',
+ activeClass: 'custom-state-active',
+ drop: function(ev, ui) {
+ recycleImage(ui.draggable);
+ }
+ });
+
+ // image deletion function
+ var recycle_icon = '<a href="link/to/recycle/script/when/we/have/js/off" title="Recycle this image" class="ui-icon ui-icon-refresh">Recycle image</a>';
+ function deleteImage($item) {
+ $item.fadeOut(function() {
+ var $list = $('ul',$trash).length ? $('ul',$trash) : $('<ul class="gallery ui-helper-reset"/>').appendTo($trash);
+
+ $item.find('a.ui-icon-trash').remove();
+ $item.append(recycle_icon).appendTo($list).fadeIn(function() {
+ $item.animate({ width: '48px' }).find('img').animate({ height: '36px' });
+ });
+ });
+ }
+
+ // image recycle function
+ var trash_icon = '<a href="link/to/trash/script/when/we/have/js/off" title="Delete this image" class="ui-icon ui-icon-trash">Delete image</a>';
+ function recycleImage($item) {
+ $item.fadeOut(function() {
+ $item.find('a.ui-icon-refresh').remove();
+ $item.css('width','96px').append(trash_icon).find('img').css('height','72px').end().appendTo($gallery).fadeIn();
+ });
+ }
+
+ // image preview function, demonstrating the ui.dialog used as a modal window
+ function viewLargerImage($link) {
+ var src = $link.attr('href');
+ var title = $link.siblings('img').attr('alt');
+ var $modal = $('img[src$="'+src+'"]');
+
+ if ($modal.length) {
+ $modal.dialog('open')
+ } else {
+ var img = $('<img alt="'+title+'" width="384" height="288" style="display:none;padding: 8px;" />')
+ .attr('src',src).appendTo('body');
+ setTimeout(function() {
+ img.dialog({
+ title: title,
+ width: 400,
+ modal: true
+ });
+ }, 1);
+ }
+ }
+
+ // resolve the icons behavior with event delegation
+ $('ul.gallery > li').click(function(ev) {
+ var $item = $(this);
+ var $target = $(ev.target);
+
+ if ($target.is('a.ui-icon-trash')) {
+ deleteImage($item);
+ } else if ($target.is('a.ui-icon-zoomin')) {
+ viewLargerImage($target);
+ } else if ($target.is('a.ui-icon-refresh')) {
+ recycleImage($item);
+ }
+
+ return false;
+ });
+ });
+ </script>
+</head>
+<body>
+ <div class="demo ui-widget ui-helper-clearfix">
+
+ <ul id="gallery" class="gallery ui-helper-reset ui-helper-clearfix">
+ <li class="ui-widget-content ui-corner-tr">
+ <h5 class="ui-widget-header">High Tatras</h5>
+ <img src="images/high_tatras_min.jpg" alt="The peaks of High Tatras" width="96" height="72" />
+ <a href="images/high_tatras.jpg" title="View larger image" class="ui-icon ui-icon-zoomin">View larger</a>
+ <a href="link/to/trash/script/when/we/have/js/off" title="Delete this image" class="ui-icon ui-icon-trash">Delete image</a>
+ </li>
+ <li class="ui-widget-content ui-corner-tr">
+ <h5 class="ui-widget-header">High Tatras 2</h5>
+ <img src="images/high_tatras2_min.jpg" alt="The chalet at the Green mountain lake" width="96" height="72" />
+ <a href="images/high_tatras2.jpg" title="View larger image" class="ui-icon ui-icon-zoomin">View larger</a>
+ <a href="link/to/trash/script/when/we/have/js/off" title="Delete this image" class="ui-icon ui-icon-trash">Delete image</a>
+ </li>
+ <li class="ui-widget-content ui-corner-tr">
+ <h5 class="ui-widget-header">High Tatras 3</h5>
+ <img src="images/high_tatras3_min.jpg" alt="Planning the ascent" width="96" height="72" />
+ <a href="images/high_tatras3.jpg" title="View larger image" class="ui-icon ui-icon-zoomin">View larger</a>
+ <a href="link/to/trash/script/when/we/have/js/off" title="Delete this image" class="ui-icon ui-icon-trash">Delete image</a>
+ </li>
+ <li class="ui-widget-content ui-corner-tr">
+ <h5 class="ui-widget-header">High Tatras 4</h5>
+ <img src="images/high_tatras4_min.jpg" alt="On top of Kozi kopka" width="96" height="72" />
+ <a href="images/high_tatras4.jpg" title="View larger image" class="ui-icon ui-icon-zoomin">View larger</a>
+ <a href="link/to/trash/script/when/we/have/js/off" title="Delete this image" class="ui-icon ui-icon-trash">Delete image</a>
+ </li>
+ </ul>
+
+ <div id="trash" class="ui-widget-content ui-state-default">
+ <h4 class="ui-widget-header"><span class="ui-icon ui-icon-trash">Trash</span> Trash</h4>
+ </div>
+
+ </div><!-- End demo -->
+
+ <div class="demo-description">
+
+ <p>You can delete an image either by dragging it to the Trash or by clicking the trash icon.</p>
+ <p>You can "recycle" an image by dragging it back to the gallery or by clicking the recycle icon.</p>
+ <p>You can view larger image by clicking the zoom icon. jQuery UI dialog widget is used for the modal window.</p>
+
+ </div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/droppable/propagation.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,74 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Droppable - Prevent propagation</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #draggable { width: 100px; height: 40px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; }
+ #droppable, #droppable2 { width: 230px; height: 120px; padding: 0.5em; float: left; margin: 10px; }
+ #droppable-inner, #droppable2-inner { width: 170px; height: 60px; padding: 0.5em; float: left; margin: 10px; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+
+ $("#draggable").draggable();
+
+ $("#droppable, #droppable-inner").droppable({
+ activeClass: 'ui-state-hover',
+ hoverClass: 'ui-state-active',
+ drop: function(event, ui) {
+ $(this).addClass('ui-state-highlight').find('> p').html('Dropped!');
+ return false;
+ }
+ });
+
+ $("#droppable2, #droppable2-inner").droppable({
+ greedy: true,
+ activeClass: 'ui-state-hover',
+ hoverClass: 'ui-state-active',
+ drop: function(event, ui) {
+ $(this).addClass('ui-state-highlight').find('> p').html('Dropped!');
+ }
+ });
+
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="draggable" class="ui-widget-content">
+ <p>Drag me to my target</p>
+</div>
+
+<div id="droppable" class="ui-widget-header">
+ <p>Outer droppable</p>
+ <div id="droppable-inner" class="ui-widget-header">
+ <p>Inner droppable (not greedy)</p>
+ </div>
+</div>
+
+<div id="droppable2" class="ui-widget-header">
+ <p>Outer droppable</p>
+ <div id="droppable2-inner" class="ui-widget-header">
+ <p>Inner droppable (greedy)</p>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>When working with nested droppables — for example, you may have an editable directory structure displayed as a tree, with folder and document nodes — the <code>greedy</code> option set to true prevents event propagation when a draggable is dropped on a child node (droppable).</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/droppable/revert.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,58 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Droppable - Revert draggable position</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #draggable, #draggable2 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; }
+ #droppable { width: 150px; height: 150px; padding: 0.5em; float: left; margin: 10px; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+
+ $("#draggable").draggable({ revert: 'valid' });
+ $("#draggable2").draggable({ revert: 'invalid' });
+
+ $("#droppable").droppable({
+ activeClass: 'ui-state-hover',
+ hoverClass: 'ui-state-active',
+ drop: function(event, ui) {
+ $(this).addClass('ui-state-highlight').find('p').html('Dropped!');
+ }
+ });
+
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="draggable" class="ui-widget-content">
+ <p>I revert when I'm dropped</p>
+</div>
+
+<div id="draggable2" class="ui-widget-content">
+ <p>I revert when I'm not dropped</p>
+</div>
+
+<div id="droppable" class="ui-widget-header">
+ <p>Drop me here</p>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Return the draggable (or it's helper) to its original location when dragging stops with the boolean <code>revert</code> option set on the draggable.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/droppable/shopping-cart.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,101 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Droppable - Shopping Cart Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ h1 { padding: .2em; margin: 0; }
+ #products { float:left; width: 500px; margin-right: 2em; }
+ #cart { width: 200px; float: left; }
+ /* style the list to maximize the droppable hitarea */
+ #cart ol { margin: 0; padding: 1em 0 1em 3em; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#catalog").accordion();
+ $("#catalog li").draggable({
+ appendTo: "body",
+ helper: "clone"
+ });
+ $("#cart ol").droppable({
+ activeClass: "ui-state-default",
+ hoverClass: "ui-state-hover",
+ accept: ":not(.ui-sortable-helper)",
+ drop: function(event, ui) {
+ $(this).find(".placeholder").remove();
+ $("<li></li>").text(ui.draggable.text()).appendTo(this);
+ }
+ }).sortable({
+ items: "li:not(.placeholder)",
+ sort: function() {
+ // gets added unintentionally by droppable interacting with sortable
+ // using connectWithSortable fixes this, but doesn't allow you to customize active/hoverClass options
+ $(this).removeClass("ui-state-default");
+ }
+ });
+
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="products">
+ <h1 class="ui-widget-header">Products</h1>
+ <div id="catalog">
+ <h3><a href="#">T-Shirts</a></h3>
+ <div>
+ <ul>
+ <li>Lolcat Shirt</li>
+ <li>Cheezeburger Shirt</li>
+ <li>Buckit Shirt</li>
+ </ul>
+ </div>
+ <h3><a href="#">Bags</a></h3>
+ <div>
+ <ul>
+ <li>Zebra Striped</li>
+ <li>Black Leather</li>
+ <li>Alligator Leather</li>
+ </ul>
+ </div>
+ <h3><a href="#">Gadgets</a></h3>
+ <div>
+ <ul>
+ <li>iPhone</li>
+ <li>iPod</li>
+ <li>iPad</li>
+ </ul>
+ </div>
+ </div>
+</div>
+
+<div id="cart">
+ <h1 class="ui-widget-header">Shopping Cart</h1>
+ <div class="ui-widget-content">
+ <ol>
+ <li class="placeholder">Add your items here</li>
+ </ol>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Demonstrate how to use an accordion to structure products into a catalog and make use drag and drop for adding
+them to a shopping cart, where they are sortable.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/droppable/visual-feedback.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,73 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Droppable - Visual feedback</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #draggable, #draggable2 { width: 90px; height: 90px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; }
+ #droppable, #droppable2 { width: 120px; height: 120px; padding: 0.5em; float: left; margin: 10px; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#draggable").draggable();
+ $("#droppable").droppable({
+ hoverClass: 'ui-state-active',
+ drop: function(event, ui) {
+ $(this).addClass('ui-state-highlight').find('p').html('Dropped!');
+ }
+ });
+
+ $("#draggable2").draggable();
+ $("#droppable2").droppable({
+ accept: "#draggable2",
+ activeClass: 'ui-state-hover',
+ drop: function(event, ui) {
+ $(this).addClass('ui-state-highlight').find('p').html('Dropped!');
+ }
+ });
+
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<h3 class="docs">Feedback on hover:</h3>
+
+<div id="draggable" class="ui-widget-content">
+ <p>Drag me to my target</p>
+</div>
+
+<div id="droppable" class="ui-widget-header">
+ <p>Drop here</p>
+</div>
+
+<h3 class="docs">Feedback on activating draggable:</h3>
+
+<div id="draggable2" class="ui-widget-content">
+ <p>Drag me to my target</p>
+</div>
+
+<div id="droppable2" class="ui-widget-header">
+ <p>Drop here</p>
+</div>
+
+<!-- add active class demo -->
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Change the droppable's appearance on hover, or when the droppable is active (an acceptable draggable is dropped on it). Use the <code>hoverClass</code> or <code>activeClass</code> options to specify respective classes.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/effect/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,107 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects - Effect Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.blind.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.bounce.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.clip.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.drop.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.explode.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.fade.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.fold.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.highlight.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.pulsate.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.scale.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.shake.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.slide.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.transfer.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .toggler { width: 500px; height: 200px; position: relative;}
+ #button { padding: .5em 1em; text-decoration: none; }
+ #effect { width: 240px; height: 135px; padding: 0.4em; position: relative; }
+ #effect h3 { margin: 0; padding: 0.4em; text-align: center; }
+ .ui-effects-transfer { border: 2px dotted gray; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+
+ //run the currently selected effect
+ function runEffect(){
+ //get effect type from
+ var selectedEffect = $('#effectTypes').val();
+
+ //most effect types need no options passed by default
+ var options = {};
+ //check if it's scale, transfer, or size - they need options explicitly set
+ if(selectedEffect == 'scale'){ options = {percent: 0}; }
+ else if(selectedEffect == 'transfer'){ options = { to: "#button", className: 'ui-effects-transfer' }; }
+ else if(selectedEffect == 'size'){ options = { to: {width: 200,height: 60} }; }
+
+ //run the effect
+ $("#effect").effect(selectedEffect,options,500,callback);
+ };
+
+ //callback function to bring a hidden box back
+ function callback(){
+ setTimeout(function(){
+ $("#effect:hidden").removeAttr('style').hide().fadeIn();
+ }, 1000);
+ };
+
+ //set effect from select menu value
+ $("#button").click(function() {
+ runEffect();
+ return false;
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="toggler">
+ <div id="effect" class="ui-widget-content ui-corner-all">
+ <h3 class="ui-widget-header ui-corner-all">Effect</h3>
+ <p>
+ Etiam libero neque, luctus a, eleifend nec, semper at, lorem. Sed pede. Nulla lorem metus, adipiscing ut, luctus sed, hendrerit vitae, mi.
+ </p>
+ </div>
+</div>
+
+<select name="effects" id="effectTypes">
+ <option value="blind">Blind</option>
+ <option value="bounce">Bounce</option>
+ <option value="clip">Clip</option>
+ <option value="drop">Drop</option>
+ <option value="explode">Explode</option>
+ <option value="fade">Fade</option>
+ <option value="fold">Fold</option>
+ <option value="highlight">Highlight</option>
+ <option value="puff">Puff</option>
+ <option value="pulsate">Pulsate</option>
+ <option value="scale">Scale</option>
+ <option value="shake">Shake</option>
+ <option value="size">Size</option>
+ <option value="slide">Slide</option>
+ <option value="transfer">Transfer</option>
+</select>
+
+<a href="#" id="button" class="ui-state-default ui-corner-all">Run Effect</a>
+
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Click the button above to show the effect.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/effect/easing.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,101 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects - Effect Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .graph {
+ float: left;
+ margin-left: 10px;
+ }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ if (!$("<canvas/>")[0].getContext) {
+ $("<div/>").text("Your browser doesn't support canvas, which is required for this demo. Give Firefox 3 a try!").appendTo("#graphs");
+ return;
+ }
+ var i = 0;
+ var width = 100,
+ height = 100;
+ $.each($.easing, function(name, impl) {
+ // skip linera/jswing and any non functioning implementation
+ if (!$.isFunction(impl) || /jswing/.test(name))
+ return;
+ var graph = $("<div/>").addClass("graph").appendTo("#graphs");
+ var text = $("<div/>").text(++i + ". " + name).appendTo(graph);
+
+ var canvas = $("<canvas/>").appendTo(graph)[0]
+ canvas.width = width;
+ canvas.height = height;
+ var drawHeight = height * 0.8;
+ var cradius = 10;
+ var ctx = canvas.getContext("2d");
+ ctx.fillStyle = "black";
+
+ ctx.beginPath();
+ ctx.moveTo(cradius, 0);
+ ctx.quadraticCurveTo(0, 0, 0, cradius);
+ ctx.lineTo(0, height - cradius);
+ ctx.quadraticCurveTo(0, height, cradius, height);
+ ctx.lineTo(width - cradius, height);
+ ctx.quadraticCurveTo(width, height, width, height - cradius);
+ ctx.lineTo(width, 0);
+ ctx.lineTo(cradius, 0);
+ ctx.fill();
+
+ ctx.strokeStyle = "#555";
+ ctx.beginPath();
+ ctx.moveTo(width * 0.1, drawHeight + .5);
+ ctx.lineTo(width * 0.9, drawHeight + .5);
+ ctx.stroke();
+
+ ctx.strokeStyle = "#555";
+ ctx.beginPath();
+ ctx.moveTo(width * 0.1, drawHeight * .3 - .5);
+ ctx.lineTo(width * 0.9, drawHeight * .3 - .5);
+ ctx.stroke();
+
+ ctx.strokeStyle = "white";
+ ctx.beginPath();
+ ctx.lineWidth = 2;
+ ctx.moveTo(width * 0.1, drawHeight);
+ $.each(new Array(width), function(position) {
+ var val = impl(0, position, 0, 1, height);
+ if (/linear|jswing/.test(name)) val = position / width;
+ ctx.lineTo(position * 0.8 + width * 0.1, drawHeight - drawHeight * val * 0.7);
+ });
+ ctx.stroke();
+ graph.click(function() {
+ $(canvas).animate({height: "hide"}, 2000, name).animate({"left": "0"}, 800).animate({height: "show"}, 2000, name);
+ });
+
+ graph.width(width).height(height + text.height() + 10);
+ //return false;
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+ <div id="graphs"></div>
+
+ <div id="animted"></div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p><strong>All easings provided by jQuery UI are drawn above, using a HTML canvas element</strong>. Click a diagram to see the easing in action.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
+
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/effect/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,24 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effect Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Effect showcase</a></li>
+ <li><a href="easing.html">Easing showcase</a></li>
+ <!-- WIP
+ <li class="demo-config-on"><a href="scale.html">Scale effect</a></li>
+ <li class="demo-config-on"><a href="size.html">Size effect</a></li>
+ <li class="demo-config-on"><a href="transfer.html">Transfer effect</a></li>
+ -->
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/hide/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,106 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects - Hide Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.blind.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.bounce.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.clip.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.drop.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.explode.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.fold.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.highlight.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.pulsate.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.scale.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.shake.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.slide.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.transfer.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .toggler { width: 500px; height: 200px; }
+ #button { padding: .5em 1em; text-decoration: none; }
+ #effect { width: 240px; height: 135px; padding: 0.4em; position: relative; }
+ #effect h3 { margin: 0; padding: 0.4em; text-align: center; }
+ .ui-effects-transfer { border: 2px dotted gray; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+
+ //run the currently selected effect
+ function runEffect(){
+ //get effect type from
+ var selectedEffect = $('#effectTypes').val();
+
+ //most effect types need no options passed by default
+ var options = {};
+ //check if it's scale, transfer, or size - they need options explicitly set
+ if(selectedEffect == 'scale'){ options = {percent: 0}; }
+ else if(selectedEffect == 'transfer'){ options = { to: "#button", className: 'ui-effects-transfer' }; }
+ else if(selectedEffect == 'size'){ options = { to: {width: 200,height: 60} }; }
+
+ //run the effect
+ $("#effect").hide(selectedEffect,options,500,callback);
+ };
+
+ //callback function to bring a hidden box back
+ function callback(){
+ setTimeout(function(){
+ $("#effect:hidden").removeAttr('style').hide().fadeIn();
+ }, 1000);
+ };
+
+ //set effect from select menu value
+ $("#button").click(function() {
+ runEffect();
+ return false;
+ });
+
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="toggler">
+ <div id="effect" class="ui-widget-content ui-corner-all">
+ <h3 class="ui-widget-header ui-corner-all">Hide</h3>
+ <p>
+ Etiam libero neque, luctus a, eleifend nec, semper at, lorem. Sed pede. Nulla lorem metus, adipiscing ut, luctus sed, hendrerit vitae, mi.
+ </p>
+ </div>
+</div>
+
+<select name="effects" id="effectTypes">
+ <option value="blind">Blind</option>
+ <option value="bounce">Bounce</option>
+ <option value="clip">Clip</option>
+ <option value="drop">Drop</option>
+ <option value="explode">Explode</option>
+ <option value="fold">Fold</option>
+ <option value="highlight">Highlight</option>
+ <option value="puff">Puff</option>
+ <option value="pulsate">Pulsate</option>
+ <option value="scale">Scale</option>
+ <option value="shake">Shake</option>
+ <option value="size">Size</option>
+ <option value="slide">Slide</option>
+ <option value="transfer">Transfer</option>
+</select>
+
+<a href="#" id="button" class="ui-state-default ui-corner-all">Run Effect</a>
+
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Click the button above to preview the effect.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/hide/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,18 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
Binary file web/static/css/jq-css/demos/images/calendar.gif has changed
Binary file web/static/css/jq-css/demos/images/demo-config-on-tile.gif has changed
Binary file web/static/css/jq-css/demos/images/demo-config-on.gif has changed
Binary file web/static/css/jq-css/demos/images/demo-spindown-closed.gif has changed
Binary file web/static/css/jq-css/demos/images/demo-spindown-open.gif has changed
Binary file web/static/css/jq-css/demos/images/icon-docs-info.gif has changed
Binary file web/static/css/jq-css/demos/images/jquery_32x32.png has changed
Binary file web/static/css/jq-css/demos/images/jqueryui_32x32.png has changed
Binary file web/static/css/jq-css/demos/images/pbar-ani.gif has changed
Binary file web/static/css/jq-css/demos/images/sizzlejs_32x32.png has changed
Binary file web/static/css/jq-css/demos/images/transparent_1x1.png has changed
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,313 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
+ <title>jQuery UI Demos</title>
+ <link type="text/css" href="../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <link type="text/css" href="demos.css" rel="stylesheet" />
+ <script type="text/javascript" src="../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../external/jquery.bgiframe-2.1.1.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.accordion.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.autocomplete.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.button.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.datepicker.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.dialog.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.droppable.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.position.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.progressbar.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.resizable.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.selectable.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.slider.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.sortable.js"></script>
+ <script type="text/javascript" src="../ui/jquery.ui.tabs.js"></script>
+ <script type="text/javascript" src="../ui/jquery.effects.core.js"></script>
+ <script type="text/javascript" src="../ui/jquery.effects.blind.js"></script>
+ <script type="text/javascript" src="../ui/jquery.effects.bounce.js"></script>
+ <script type="text/javascript" src="../ui/jquery.effects.clip.js"></script>
+ <script type="text/javascript" src="../ui/jquery.effects.drop.js"></script>
+ <script type="text/javascript" src="../ui/jquery.effects.explode.js"></script>
+ <script type="text/javascript" src="../ui/jquery.effects.fold.js"></script>
+ <script type="text/javascript" src="../ui/jquery.effects.highlight.js"></script>
+ <script type="text/javascript" src="../ui/jquery.effects.pulsate.js"></script>
+ <script type="text/javascript" src="../ui/jquery.effects.scale.js"></script>
+ <script type="text/javascript" src="../ui/jquery.effects.shake.js"></script>
+ <script type="text/javascript" src="../ui/jquery.effects.slide.js"></script>
+ <script type="text/javascript" src="../ui/jquery.effects.transfer.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-af.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ar.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-az.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-bs.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-bg.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ca.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-cs.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-da.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-de.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-el.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-en-GB.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-eo.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-es.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-et.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-eu.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-fa.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-fi.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-fo.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-fr.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-fr-CH.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-he.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-hr.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-hu.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-hy.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-id.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-is.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-it.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ja.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ko.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-lt.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-lv.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ms.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-nl.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-no.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-pl.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-pt-BR.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ro.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ru.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-sk.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-sl.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-sq.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-sr.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-sr-SR.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-sv.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ta.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-th.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-tr.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-uk.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-vi.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-zh-CN.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-zh-HK.js"></script>
+ <script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-zh-TW.js"></script>
+ <script type="text/javascript">
+ jQuery(function($) {
+
+ $('.left-nav a').click(function(ev) {
+ window.location.hash = this.href.replace(/.+\/([^\/]+)\/index\.html/,'$1') + '|default';
+ loadPage(this.href);
+ $('.left-nav a.selected').removeClass('selected');
+ $(this).addClass('selected');
+ ev.preventDefault();
+ });
+
+ if (window.location.hash) {
+ if (window.location.hash.indexOf('|') === -1) {
+ window.location.hash += '|default';
+ }
+ var path = window.location.href.replace(/(index\.html)?#/,'');
+ path = path.replace('\|','/') + '.html';
+ loadPage(path);
+ }
+
+ function loadPage(path) {
+ var section = path.replace(/\/[^\/]+\.html/,'');
+ var header = section.replace(/.+\/([^\/]+)/,'$1').replace(/_/, ' ');
+
+ $('td.normal div.normal')
+ .empty()
+ .append('<h4 class="demo-subheader">Functional demo:</h4>')
+ .append('<h3 class="demo-header">'+ header +'</h3>')
+ .append('<div id="demo-config"></div>')
+ .find('#demo-config')
+ .append('<div id="demo-frame"></div><div id="demo-config-menu"></div><div id="demo-link"><a class="demoWindowLink" href="#"><span class="ui-icon ui-icon-newwin"></span>Open demo in a new window</a></div>')
+ .find('#demo-config-menu')
+ .load(section + '/index.html .demos-nav', function() {
+ $('#demo-config-menu a').each(function() {
+ this.setAttribute('href', section + '/' + this.getAttribute('href').replace(/.+\/([^\/]+)/,'$1'));
+ $(this).attr('target', 'demo-frame');
+ $(this).click(function() {
+
+ resetDemos();
+
+ $(this).parents('ul').find('li').removeClass('demo-config-on');
+ $(this).parent().addClass('demo-config-on');
+ $('#demo-notes').fadeOut();
+
+ //Set the hash to the actual page without ".html"
+ window.location.hash = header + '|' + this.getAttribute('href').match((/\/([^\/\\]+)\.html/))[1];
+
+ loadDemo(this.getAttribute('href'));
+
+ return false;
+ });
+ });
+
+ if (window.location.hash) {
+ var demo = window.location.hash.split('|')[1];
+ $('#demo-config-menu a').each(function(){
+ if (this.href.indexOf(demo + '.html') !== -1) {
+ $(this).parents('ul').find('li').removeClass('demo-config-on');
+ $(this).parent().addClass('demo-config-on');
+ loadDemo(this.href);
+ }
+ });
+ }
+
+ updateDemoNotes();
+ })
+ .end()
+ .find('#demo-link a')
+ .bind('click', function(ev){
+ window.open(this.href);
+ ev.preventDefault();
+ })
+ .end()
+ .end()
+ ;
+
+ resetDemos();
+ }
+
+ function loadDemo(path) {
+ var directory = path.match(/([^\/]+)\/[^\/\.]+\.html$/)[1];
+ $.get(path, function(data) {
+ var source = data;
+ data = data.replace(/<script.*>.*<\/script>/ig,""); // Remove script tags
+ data = data.replace(/<\/?link.*>/ig,""); //Remove link tags
+ data = data.replace(/<\/?html.*>/ig,""); //Remove html tag
+ data = data.replace(/<\/?body.*>/ig,""); //Remove body tag
+ data = data.replace(/<\/?head.*>/ig,""); //Remove head tag
+ data = data.replace(/<\/?!doctype.*>/ig,""); //Remove doctype
+ data = data.replace(/<title.*>.*<\/title>/ig,""); // Remove title tags
+ data = data.replace(/((href|src)=["'])(?!(http|#))/ig, "$1" + directory + "/");
+
+ $('#demo-style').remove();
+ $('#demo-frame').empty().html(data);
+ $('#demo-frame style').clone().appendTo('head').attr('id','demo-style');
+ $('#demo-link a').attr('href', path);
+ updateDemoNotes();
+ updateDemoSource(source);
+
+ if (/default.html$/.test(path)) {
+ $.get("documentation/docs-" + path.match(/demos\/(.+)\//)[1] + ".html", function(html) {
+ $("#demo-source").after(html);
+ $("#widget-docs").tabs();
+ $(".param-header").click(function() {
+ $(this).parent().toggleClass("param-open").end().next().toggle();
+ });
+ $(".docs-list-header").each(function() {
+ var header = $(this);
+ var details = header.next().find(".param-details").hide();
+ $("a:first", header).click(function() {
+ details.show().parent().addClass("param-open");
+ return false;
+ });
+ $("a:last", header).click(function() {
+ details.hide().parent().removeClass("param-open");
+ return false;
+ });
+ });
+ });
+ }
+ });
+ }
+
+ function updateDemoNotes() {
+ var notes = $('#demo-frame .demo-description');
+ if ($('#demo-notes').length == 0) {
+ $('<div id="demo-notes"></div>').insertAfter('#demo-config');
+ }
+ $('#demo-notes').hide().empty().html(notes.html());
+ $('#demo-notes').show();
+ notes.hide();
+ }
+
+ function updateDemoSource(source) {
+ if ($('#demo-source').length == 0) {
+ $('<div id="demo-source"><a href="#" class="source-closed">View Source</a><div><pre><code></code></pre></div></div>').insertAfter('#demo-notes');
+ $('#demo-source').find(">a").click(function() {
+ $(this).toggleClass("source-closed").toggleClass("source-open").next().toggle();
+ return false;
+ }).end().find(">div").hide();
+ }
+ var cleanedSource = source
+ .replace('themes/base/jquery.ui.all.css', 'theme/jquery.ui.all.css')
+ .replace(/\s*\x3Clink.*demos\x2Ecss.*\x3E\s*/, '\r\n\t')
+ .replace(/\x2E\x2E\x2F\x2E\x2E\x2F/g, '');
+
+ $('#demo-source code').empty().text(cleanedSource);
+ }
+
+ function resetDemos() {
+ $.datepicker.setDefaults($.extend({showMonthAfterYear: false}, $.datepicker.regional['']));
+ $(".ui-dialog-content").remove();
+ }
+
+ });
+ </script>
+</head>
+<body>
+
+<table class="layout-grid" cellspacing="0" cellpadding="0">
+ <tr>
+ <td class="left-nav">
+ <dl class="demos-nav">
+ <dt>Interactions</dt>
+ <dd><a href="draggable/index.html">Draggable</a></dd>
+ <dd><a href="droppable/index.html">Droppable</a></dd>
+ <dd><a href="resizable/index.html">Resizable</a></dd>
+ <dd><a href="selectable/index.html">Selectable</a></dd>
+ <dd><a href="sortable/index.html">Sortable</a></dd>
+ <dt>Widgets</dt>
+ <dd><a href="accordion/index.html">Accordion</a></dd>
+ <dd><a href="autocomplete/index.html">Autocomplete</a></dd>
+ <dd><a href="button/index.html">Button</a></dd>
+ <dd><a href="datepicker/index.html">Datepicker</a></dd>
+ <dd><a href="dialog/index.html">Dialog</a></dd>
+ <dd><a href="progressbar/index.html">Progressbar</a></dd>
+ <dd><a href="slider/index.html">Slider</a></dd>
+ <dd><a href="tabs/index.html">Tabs</a></dd>
+ <dt>Effects</dt>
+ <dd><a href="animate/index.html">Color Animation</a></dd>
+ <dd><a href="toggleClass/index.html">Toggle Class</a></dd>
+ <dd><a href="addClass/index.html">Add Class</a></dd>
+ <dd><a href="removeClass/index.html">Remove Class</a></dd>
+ <dd><a href="switchClass/index.html">Switch Class</a></dd>
+ <dd><a href="effect/index.html">Effect</a></dd>
+ <dd><a href="toggle/index.html">Toggle</a></dd>
+ <dd><a href="hide/index.html">Hide</a></dd>
+ <dd><a href="show/index.html">Show</a></dd>
+ <dt>Utilities</dt>
+ <dd><a href="position/index.html">Position</a></dd>
+ <dt>About jQuery UI</dt>
+ <dd><a href="http://jqueryui.com/docs/Getting_Started">Getting Started</a></dd>
+ <dd><a href="http://jqueryui.com/docs/Upgrade_Guide">Upgrade Guide</a></dd>
+ <dd><a href="http://jqueryui.com/docs/Changelog">Changelog</a></dd>
+ <dd><a href="http://jqueryui.com/docs/Roadmap">Roadmap</a></dd>
+ <dd><a href="http://jqueryui.com/docs/Subversion">Subversion Access</a></dd>
+ <dd><a href="http://jqueryui.com/docs/Developer_Guide">UI Developer Guidelines</a></dd>
+ <dt>Theming</dt>
+ <dd><a href="http://jqueryui.com/docs/Theming">Theming jQuery UI</a></dd>
+ <dd><a href="http://jqueryui.com/docs/Theming/API">jQuery UI CSS Framework</a></dd>
+ <dd><a href="http://jqueryui.com/docs/Theming/Themeroller">ThemeRoller application</a></dd>
+ <dd><a href="http://jqueryui.com/docs/Theming/ThemeSwitcher">Theme Switcher Widget</a></dd>
+
+ </dl>
+ </td>
+ <td class="normal">
+
+ <div class="normal">
+
+ <h3>Instructions</h3>
+ <p>
+ These demos showcase some common uses of each jQuery UI plugin. Simply copy and paste code from the demos to get started. Have fun playing with them.
+ </p>
+
+ </div>
+
+ </td>
+ </tr>
+</table>
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/position/cycler.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,125 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Position - Default functionality</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+
+ <style type="text/css">
+ html, body {
+ margin: 0;
+ padding: 0
+ }
+ </style>
+
+ <script type="text/javascript">
+ $(function() {
+
+ $.fn.position2 = function(options) {
+ return this.position($.extend({
+ of: window,
+ using: function(to) {
+ $(this).css({
+ top: to.top,
+ left: to.left
+ })
+ },
+ collision: "none"
+ }, options));
+ }
+
+ $.fn.left = function(using) {
+ return this.position2({
+ my: "right middle",
+ at: "left middle",
+ offset: "25 0",
+ using: using
+ });
+ }
+ $.fn.right = function(using) {
+ return this.position2({
+ my: "left middle",
+ at: "right middle",
+ offset: "-25 0",
+ using: using
+ });
+ }
+ $.fn.center = function(using) {
+ return this.position2({
+ my: "center middle",
+ at: "center middle",
+ using: using
+ });
+ };
+
+ $("img:eq(0)").left();
+ $("img:eq(1)").center();
+ $("img:eq(2)").right();
+
+ $("body").css({
+ overflow: "hidden"
+ })
+ $(".demo").css({
+ position: "relative",
+ });
+ $(".demo img").css({
+ position: "absolute",
+ });
+
+ function animate(to) {
+ $(this).animate(to);
+ }
+ function next() {
+ $("img:eq(2)").center(animate);
+ $("img:eq(1)").left(animate)
+ $("img:eq(0)").right().appendTo(".demo");
+ }
+ function previous() {
+ $("img:eq(0)").center(animate);
+ $("img:eq(1)").right(animate);
+ $("img:eq(2)").left().prependTo(".demo");
+ }
+ $("#previous").click(previous);
+ $("#next").click(next);
+
+ $(".demo img").click(function() {
+ $(".demo img").index(this) == 0 ? previous() : next();
+ });
+
+ $(window).resize(function() {
+ $("img:eq(0)").left(animate);
+ $("img:eq(1)").center(animate);
+ $("img:eq(2)").right(animate);
+ })
+ });
+ </script>
+
+</head>
+<body>
+
+<div class="demo">
+
+ <img src="images/earth.jpg" />
+ <img src="images/flight.jpg" />
+ <img src="images/rocket.jpg" />
+
+ <a id="previous" href="#">Previous</a>
+ <a id="next" href="#">Next</a>
+</div>
+
+<div class="demo-description">
+
+<p>A prototype for the <a href="http://wiki.jqueryui.com/Photoviewer">Photoviewer</a> using Position to place images at the center, left and right and cycle them.
+<br/>Use the links at the top to cycle, or click on the images on the left and right.
+<br/>Note how the images are repositioned when resizing the window.
+<br/>Warning: Doesn't currently work inside the demo viewer; open in a new window instead!</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/position/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,159 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Position - Default functionality</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+
+ div#parent {
+ width: 60%;
+ margin: 10px auto;
+ padding: 5px;
+
+ border: 1px solid #777;
+ background-color: #fbca93;
+ text-align: center;
+ }
+
+ div.positionable {
+ width: 75px;
+ height: 75px;
+ position: absolute;
+ display: block;
+ right: 0;
+ bottom: 0;
+ background-color: #bcd5e6;
+ text-align: center;
+ }
+
+ select, input {
+ margin-left: 15px;
+ }
+
+ </style>
+ <script type="text/javascript">
+ $(function() {
+
+ function position(using) {
+ $('.positionable').position({
+ of: $('#parent'),
+ my: $('#my_horizontal').val() + ' ' + $('#my_vertical').val(),
+ at: $('#at_horizontal').val() + ' '+ $('#at_vertical').val(),
+ offset: $('#offset').val(),
+ using: using,
+ collision: $("#collision_horizontal").val() + ' ' + $("#collision_vertical").val()
+ });
+ }
+
+ $('.positionable').css("opacity", 0.5);
+
+ $(':input').bind('click keyup change', function() { position(); });
+
+ $("#parent").draggable({
+ drag: function() { position(); }
+ });
+
+ $('.positionable').draggable({
+ drag: function(event, ui) {
+ // reset offset before calculating it
+ $("#offset").val("0");
+ position(function(result) {
+ $("#offset").val("" + (ui.offset.left - result.left) + " " + (ui.offset.top - result.top));
+ position();
+ });
+ }
+ });
+
+ position();
+ });
+ </script>
+
+</head>
+<body>
+
+<div class="demo">
+
+<div id="parent">
+ <p>
+ This is the position parent element.
+ </p>
+</div>
+
+<div class="positionable">
+ <p>
+ to position
+ </p>
+</div>
+
+<div class="positionable" style="width:120px; height: 40px;">
+ <p>
+ to position 2
+ </p>
+</div>
+
+<div style="padding: 20px; margin-top: 75px;">
+ position...
+ <div style="padding-bottom: 20px;">
+ <b>my:</b>
+ <select id="my_horizontal">
+ <option value="left">left</option>
+ <option value="center">center</option>
+ <option value="right">right</option>
+ </select>
+ <select id="my_vertical">
+ <option value="top">top</option>
+ <option value="middle">center</option>
+ <option value="bottom">bottom</option>
+ </select>
+ </div>
+ <div style="padding-bottom: 20px;">
+ <b>at:</b>
+ <select id="at_horizontal">
+ <option value="left">left</option>
+ <option value="center">center</option>
+ <option value="right">right</option>
+ </select>
+ <select id="at_vertical">
+ <option value="top">top</option>
+ <option value="middle">center</option>
+ <option value="bottom">bottom</option>
+ </select>
+ </div>
+ <div style="padding-bottom: 20px;">
+ <b>offset:</b>
+ <input id="offset" type="text" size="15"/>
+ </div>
+ <div style="padding-bottom: 20px;">
+ <b>collision:</b>
+ <select id="collision_horizontal">
+ <option value="flip">flip</option>
+ <option value="fit">fit</option>
+ <option value="none">none</option>
+ </select>
+ <select id="collision_vertical">
+ <option value="flip">flip</option>
+ <option value="fit">fit</option>
+ <option value="none">none</option>
+ </select>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Use the form controls to configure the positioning, or drag the positioned element to modify its offset.
+<br/>Drag around the parent element to see collision detection in action.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
Binary file web/static/css/jq-css/demos/position/images/earth.jpg has changed
Binary file web/static/css/jq-css/demos/position/images/flight.jpg has changed
Binary file web/static/css/jq-css/demos/position/images/rocket.jpg has changed
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/position/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,19 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Position Demo</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ <li><a href="cycler.html">Cycling images</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/progressbar/animated.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,44 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Progressbar - Animated</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.progressbar.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .ui-progressbar-value { background-image: url(images/pbar-ani.gif); }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#progressbar").progressbar({
+ value: 59
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="progressbar"></div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+This progressbar has an animated fill by setting the
+<code>background-image</code>
+on the
+<code>.ui-progressbar-value</code>
+element, using css.
+</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/progressbar/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,39 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Progressbar - Default functionality</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.progressbar.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#progressbar").progressbar({
+ value: 37
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+ <div id="progressbar"></div>
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+
+<p>Default determinate progress bar.</p>
+
+</div><!-- End demo-description -->
+
+
+
+</body>
+</html>
Binary file web/static/css/jq-css/demos/progressbar/images/pbar-ani.gif has changed
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/progressbar/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,20 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Progressbar Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ <li><a href="animated.html">Animated</a></li>
+ <li><a href="resize.html">Resizable progressbar</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/progressbar/resize.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,39 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Progressbar - Resizable</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.progressbar.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#progressbar").progressbar({
+ value: 37
+ });
+ $("#progressbarWrapper").resizable();
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+ <div id="progressbarWrapper" style="height:30px; " class="ui-widget-default">
+ <div id="progressbar" style="height:100%;"></div>
+ </div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>The progress bar's widths are specified in percentages for flexible sizing so it will resize to fit its container. Try resizing the height and width of this bar to see how it maintains the correct proportions. (This is not necessarily a real-world example, but it's a good illustration of how flexibly all the plugins are coded.)</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/removeClass/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,52 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects - removeClass Demo</title>
+ <link type="text/css" href="http://jquery-ui.googlecode.com/svn/trunk/themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="http://jquery-ui.googlecode.com/svn/trunk/jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="http://jquery-ui.googlecode.com/svn/trunk/ui/jquery.effects.core.js"></script>
+ <link type="text/css" href="http://jquery-ui.googlecode.com/svn/trunk/demos/demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .toggler { width: 500px; height: 200px; position: relative;}
+ #button { padding: .5em 1em; text-decoration: none; }
+ #effect {position: relative; width: 240px; padding: 1em; letter-spacing: 0; font-size: 1.2em; border: 1px solid #000; background: #eee; color: #333; }
+ #effect.newClass { text-indent: 40px; letter-spacing: .4em; width: 410px; height: 100px; padding: 30px; margin: 10px; font-size: 1.6em; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#button").click(function() {
+ $('#effect').removeClass('newClass', 1000, callback);
+ return false;
+ });
+
+ function callback(){
+ setTimeout(function(){
+ $('#effect').addClass('newClass');
+ }, 1500);
+ }
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="toggler">
+ <div id="effect" class="newClass ui-corner-all">
+ Etiam libero neque, luctus a, eleifend nec, semper at, lorem. Sed pede.
+ </div>
+</div>
+
+<a href="#" id="button" class="ui-state-default ui-corner-all">Run Effect</a>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Click the button above to preview the effect.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/removeClass/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,18 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/resizable/animate.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,41 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Resizable - Animate</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #resizable { width: 150px; height: 150px; padding: 0.5em; }
+ #resizable h3 { text-align: center; margin: 0; }
+ .ui-resizable-helper { border: 1px dotted gray; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#resizable").resizable({
+ animate: true
+ });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="resizable" class="ui-widget-content">
+ <h3 class="ui-widget-header">Animate</h3>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Animate the resize action using the <code>animate</code> option (boolean). When this option is set to true, drag the outline to the desired location; the element animates to that size on drag stop.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/resizable/aspect-ratio.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,40 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Resizable - Preserve aspect ratio</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #resizable { width: 160px; height: 90px; padding: 0.5em; }
+ #resizable h3 { text-align: center; margin: 0; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#resizable").resizable({
+ aspectRatio: 16/9
+ });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="resizable" class="ui-widget-content">
+ <h3 class="ui-widget-header">Preserve aspect ratio</h3>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Maintain the existing aspect ratio or set a new one to constrain the proportions on resize. Set the <code>aspectRatio</code> option to true, and optionally pass in a new ratio (i.e., 4/3)</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/resizable/constrain-area.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,45 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Resizable - Constrain resize area</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #container { width: 300px; height: 300px; }
+ #container h3 { text-align: center; margin: 0; margin-bottom: 10px; }
+ #resizable { background-position: top left; width: 150px; height: 150px; }
+ #resizable, #container { padding: 0.5em; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#resizable").resizable({
+ containment: '#container'
+ });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="container" class="ui-widget-content">
+ <h3 class="ui-widget-header">Containment</h3>
+ <div id="resizable" class="ui-state-active">
+ <h3 class="ui-widget-header">Resizable</h3>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Define the boundaries of the resizable area. Use the <code>containment</code> option to specify a parent DOM element or a jQuery selector, like 'document.'</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/resizable/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,38 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Resizable - Default functionality</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #resizable { width: 150px; height: 150px; padding: 0.5em; }
+ #resizable h3 { text-align: center; margin: 0; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#resizable").resizable();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="resizable" class="ui-widget-content">
+ <h3 class="ui-widget-header">Resizable</h3>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Enable any DOM element to be resizable. With the cursor grab the right or bottom border and drag to the desired width or height.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/resizable/delay-start.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,52 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Resizable - Delay start</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #resizable, #resizable2 { width: 150px; height: 150px; padding: 0.5em; }
+ #resizable h3, #resizable2 h3 { text-align: center; margin: 0; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#resizable").resizable({
+ delay: 1000
+ });
+
+ $("#resizable2").resizable({
+ distance: 40
+ });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<h3 class="docs">Time delay (ms):</h3>
+<div id="resizable" class="ui-widget-content">
+ <h3 class="ui-widget-header">Time</h3>
+</div>
+
+<h3 class="docs">Distance delay (px):</h3>
+<div id="resizable2" class="ui-widget-content">
+ <h3 class="ui-widget-header">Distance</h3>
+</div>
+
+<!-- ADD DISTANCE DEMO -->
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Delay the start of resizng for a number of milliseconds with the <code>delay</code> option; prevent resizing until the cursor is held down and dragged a specifed number of pixels with the <code>distance</code> option.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/resizable/helper.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,41 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Resizable - Helper</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #resizable { width: 150px; height: 150px; padding: 0.5em; }
+ #resizable h3 { text-align: center; margin: 0; }
+ .ui-resizable-helper { border: 2px dotted #00F; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#resizable").resizable({
+ helper: 'ui-resizable-helper'
+ });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="resizable" class="ui-widget-content">
+ <h3 class="ui-widget-header">Helper</h3>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Display only an outline of the element while resizing by setting the <code>helper</code> option to a CSS class.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/resizable/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,28 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Resizable Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ <li><a href="aspect-ratio.html">Preserve aspect ratio</a></li>
+ <li><a href="max-min.html">Maximum / minimum size</a></li>
+ <li><a href="constrain-area.html">Constrain resize area</a></li>
+ <li><a href="delay-start.html">Delay start</a></li>
+ <li><a href="snap-to-grid.html">Snap to grid</a></li>
+ <li><a href="visual-feedback.html">Visual feedback</a></li>
+ <li><a href="synchronous-resize.html">Synchronous resize</a></li>
+ <li><a href="animate.html">Animate</a></li>
+ <li><a href="helper.html">Resize Helper</a></li>
+ <li><a href="textarea.html">Textarea</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/resizable/max-min.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,43 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Resizable - Maximum / minimum size</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #resizable { width: 200px; height: 150px; padding: 5px; }
+ #resizable h3 { text-align: center; margin: 0; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#resizable").resizable({
+ maxHeight: 250,
+ maxWidth: 350,
+ minHeight: 150,
+ minWidth: 200
+ });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="resizable" class="ui-widget-content">
+ <h3 class="ui-widget-header">Resize larger / smaller</h3>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Limit the resizable element to a maximum or minimum height or width using the <code>maxHeight</code>, <code>maxWidth</code>, <code>minHeight</code>, and <code>minWidth</code> options.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/resizable/snap-to-grid.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,40 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Resizable - Snap to grid</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #resizable { width: 150px; height: 150px; padding: 0.5em; }
+ #resizable h3 { text-align: center; margin: 0; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#resizable").resizable({
+ grid: 50
+ });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="resizable" class="ui-widget-content">
+ <h3 class="ui-widget-header">Grid</h3>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Snap the resizable element to a grid. Set the dimensions of grid cells (height and width in pixels) with the <code>grid</code> option.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/resizable/synchronous-resize.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,47 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Resizable - Synchronous resize</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #resizable { background-position: top left; }
+ #resizable, #also { width: 150px; height: 120px; padding: 0.5em; }
+ #resizable h3, #also h3 { text-align: center; margin: 0; }
+ #also { margin-top: 1em; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#resizable").resizable({
+ alsoResize: '#also'
+ });
+ $("#also").resizable();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="resizable" class="ui-widget-header">
+ <h3 class="ui-state-active">Resize</h3>
+</div>
+
+<div id="also" class="ui-widget-content">
+ <h3 class="ui-widget-header">will also resize</h3>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Resize multiple elements simultaneously by clicking and dragging the sides of one. Pass a shared selector into the <code>alsoResize</code> option.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/resizable/textarea.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,39 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Resizable - Textarea</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .ui-resizable-se {
+ bottom: 17px;
+ }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#resizable").resizable({
+ handles: "se"
+ });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<textarea id="resizable" rows="5" cols="20"></textarea>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Display only an outline of the element while resizing by setting the <code>helper</code> option to a CSS class.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/resizable/visual-feedback.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,41 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Resizable - Visual feedback</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #resizable { width: 150px; height: 150px; padding: 0.5em; }
+ #resizable h3 { text-align: center; margin: 0; }
+ .ui-resizable-ghost { border: 1px dotted gray; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#resizable").resizable({
+ ghost: true
+ });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="resizable" class="ui-widget-content">
+ <h3 class="ui-widget-header">Ghost</h3>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Instead of showing the actual element during resize, set the <code>ghost</code> option to true to show a semi-transparent part of the element.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/selectable/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,48 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Selectable - Default functionality</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.selectable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+
+ <style type="text/css">
+ #feedback { font-size: 1.4em; }
+ #selectable .ui-selecting { background: #FECA40; }
+ #selectable .ui-selected { background: #F39814; color: white; }
+ #selectable { list-style-type: none; margin: 0; padding: 0; width: 60%; }
+ #selectable li { margin: 3px; padding: 0.4em; font-size: 1.4em; height: 18px; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#selectable").selectable();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<ol id="selectable">
+ <li class="ui-widget-content">Item 1</li>
+ <li class="ui-widget-content">Item 2</li>
+ <li class="ui-widget-content">Item 3</li>
+ <li class="ui-widget-content">Item 4</li>
+ <li class="ui-widget-content">Item 5</li>
+ <li class="ui-widget-content">Item 6</li>
+ <li class="ui-widget-content">Item 7</li>
+</ol>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Enable a DOM element (or group of elements) to be selectable. Draw a box with your cursor to select items. Hold down the Ctrl key to make multiple non-adjacent selections. </p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/selectable/display-grid.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,53 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Selectable - Display as grid</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.selectable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+
+ <style type="text/css">
+ #feedback { font-size: 1.4em; }
+ #selectable .ui-selecting { background: #FECA40; }
+ #selectable .ui-selected { background: #F39814; color: white; }
+ #selectable { list-style-type: none; margin: 0; padding: 0; }
+ #selectable li { margin: 3px; padding: 1px; float: left; width: 100px; height: 80px; font-size: 4em; text-align: center; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#selectable").selectable();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<ol id="selectable">
+ <li class="ui-state-default">1</li>
+ <li class="ui-state-default">2</li>
+ <li class="ui-state-default">3</li>
+ <li class="ui-state-default">4</li>
+ <li class="ui-state-default">5</li>
+ <li class="ui-state-default">6</li>
+ <li class="ui-state-default">7</li>
+ <li class="ui-state-default">8</li>
+ <li class="ui-state-default">9</li>
+ <li class="ui-state-default">10</li>
+ <li class="ui-state-default">11</li>
+ <li class="ui-state-default">12</li>
+</ol>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>To arrange selectable items as a grid, give them identical dimensions and float them using CSS.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/selectable/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,20 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Selectable Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ <li><a href="serialize.html">Serialize</a></li>
+ <li><a href="display-grid.html">Display as grid</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/selectable/serialize.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,59 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Selectable - Serialize</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.selectable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+
+ <style type="text/css">
+ #feedback { font-size: 1.4em; }
+ #selectable .ui-selecting { background: #FECA40; }
+ #selectable .ui-selected { background: #F39814; color: white; }
+ #selectable { list-style-type: none; margin: 0; padding: 0; width: 60%; }
+ #selectable li { margin: 3px; padding: 0.4em; font-size: 1.4em; height: 18px; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#selectable").selectable({
+ stop: function(){
+ var result = $("#select-result").empty();
+ $(".ui-selected", this).each(function(){
+ var index = $("#selectable li").index(this);
+ result.append(" #" + (index + 1));
+ });
+ }
+ });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<p id="feedback">
+You've selected: <span id="select-result">none</span>.
+</p>
+
+<ol id="selectable">
+ <li class="ui-widget-content">Item 1</li>
+ <li class="ui-widget-content">Item 2</li>
+ <li class="ui-widget-content">Item 3</li>
+ <li class="ui-widget-content">Item 4</li>
+ <li class="ui-widget-content">Item 5</li>
+ <li class="ui-widget-content">Item 6</li>
+</ol>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Write a function that fires on the <code>stop</code> event to collect the index values of selected items. Present values as feedback, or pass as a data string.</p>
+
+</div><!-- End demo-description -->
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/show/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,107 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects - Show Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.blind.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.bounce.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.clip.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.drop.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.explode.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.fold.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.highlight.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.pulsate.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.scale.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.shake.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.slide.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.transfer.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .toggler { width: 500px; height: 200px; }
+ #button { padding: .5em 1em; text-decoration: none; }
+ #effect { width: 240px; height: 135px; padding: 0.4em; position: relative; }
+ #effect h3 { margin: 0; padding: 0.4em; text-align: center; }
+ .ui-effects-transfer { border: 2px dotted gray; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+
+ //run the currently selected effect
+ function runEffect(){
+ //get effect type from
+ var selectedEffect = $('#effectTypes').val();
+
+ //most effect types need no options passed by default
+ var options = {};
+ //check if it's scale, transfer, or size - they need options explicitly set
+ if(selectedEffect == 'scale'){ options = {percent: 100}; }
+ else if(selectedEffect == 'transfer'){ options = { to: "#button", className: 'ui-effects-transfer' }; }
+ else if(selectedEffect == 'size'){ options = { to: {width: 280,height: 185} }; }
+
+ //run the effect
+ $("#effect").show(selectedEffect,options,500,callback);
+ };
+
+ //callback function to bring a hidden box back
+ function callback(){
+ setTimeout(function(){
+ $("#effect:visible").removeAttr('style').hide().fadeOut();
+ }, 1000);
+ };
+
+ //set effect from select menu value
+ $("#button").click(function() {
+ runEffect();
+ return false;
+ });
+
+ $("#effect").hide();
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="toggler">
+ <div id="effect" class="ui-widget-content ui-corner-all">
+ <h3 class="ui-widget-header ui-corner-all">Show</h3>
+ <p>
+ Etiam libero neque, luctus a, eleifend nec, semper at, lorem. Sed pede. Nulla lorem metus, adipiscing ut, luctus sed, hendrerit vitae, mi.
+ </p>
+ </div>
+</div>
+
+<select name="effects" id="effectTypes">
+ <option value="blind">Blind</option>
+ <option value="bounce">Bounce</option>
+ <option value="clip">Clip</option>
+ <option value="drop">Drop</option>
+ <option value="explode">Explode</option>
+ <option value="fold">Fold</option>
+ <option value="highlight">Highlight</option>
+ <option value="puff">Puff</option>
+ <option value="pulsate">Pulsate</option>
+ <option value="scale">Scale</option>
+ <option value="shake">Shake</option>
+ <option value="size">Size</option>
+ <option value="slide">Slide</option>
+ <option value="transfer">Transfer</option>
+</select>
+
+<a href="#" id="button" class="ui-state-default ui-corner-all">Run Effect</a>
+
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Click the button above to preview the effect.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/show/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,18 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/slider/colorpicker.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,95 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Slider - Colorpicker</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #red, #green, #blue {
+ float: left;
+ clear: left;
+ width: 300px;
+ margin: 15px;
+ }
+ #swatch {
+ width: 120px;
+ height: 100px;
+ margin-top: 18px;
+ margin-left: 350px;
+ background-image: none;
+ }
+ #red .ui-slider-range { background: #ef2929; }
+ #red .ui-slider-handle { border-color: #ef2929; }
+ #green .ui-slider-range { background: #8ae234; }
+ #green .ui-slider-handle { border-color: #8ae234; }
+ #blue .ui-slider-range { background: #729fcf; }
+ #blue .ui-slider-handle { border-color: #729fcf; }
+ #demo-frame > div.demo { padding: 10px !important; };
+ </style>
+ <script type="text/javascript">
+ function hexFromRGB (r, g, b) {
+ var hex = [
+ r.toString(16),
+ g.toString(16),
+ b.toString(16)
+ ];
+ $.each(hex, function (nr, val) {
+ if (val.length == 1) {
+ hex[nr] = '0' + val;
+ }
+ });
+ return hex.join('').toUpperCase();
+ }
+ function refreshSwatch() {
+ var red = $("#red").slider("value")
+ ,green = $("#green").slider("value")
+ ,blue = $("#blue").slider("value")
+ ,hex = hexFromRGB(red, green, blue);
+ $("#swatch").css("background-color", "#" + hex);
+ }
+ $(function() {
+ $("#red, #green, #blue").slider({
+ orientation: 'horizontal',
+ range: "min",
+ max: 255,
+ value: 127,
+ slide: refreshSwatch,
+ change: refreshSwatch
+ });
+ $("#red").slider("value", 255);
+ $("#green").slider("value", 140);
+ $("#blue").slider("value", 60);
+ });
+ </script>
+</head>
+<body class="ui-widget-content" style="border:0;">
+
+<div class="demo">
+
+<p class="ui-state-default ui-corner-all ui-helper-clearfix" style="padding:4px;">
+<span class="ui-icon ui-icon-pencil" style="float:left; margin:-2px 5px 0 0;"></span>
+Simple Colorpicker
+</p>
+
+<div id="red"></div>
+<div id="green"></div>
+<div id="blue"></div>
+
+<div id="swatch" class="ui-widget-content ui-corner-all"></div>
+
+</div><!-- End demo -->
+
+<div class="demo-description" style="clear:left;">
+
+<p>Combine three sliders to create a simple RGB colorpicker.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/slider/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,37 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Slider - Default functionality</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #demo-frame > div.demo { padding: 10px !important; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#slider").slider();
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="slider"></div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>The basic slider is horizontal and has a single handle that can be moved with the mouse or by using the arrow keys.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/slider/hotelrooms.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,59 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Slider - Range with fixed minimum</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #demo-frame > div.demo { padding: 10px !important; };
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ var select = $("#minbeds");
+ var slider = $('<div id="slider"></div>').insertAfter(select).slider({
+ min: 1,
+ max: 6,
+ range: "min",
+ value: select[0].selectedIndex + 1,
+ slide: function(event, ui) {
+ select[0].selectedIndex = ui.value - 1;
+ }
+ });
+ $("#minbeds").click(function() {
+ slider.slider("value", this.selectedIndex + 1);
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<form id="reservation">
+ <label for="minbeds">Minimum number of beds</label>
+ <select name="minbeds" id="minbeds">
+ <option>1</option>
+ <option>2</option>
+ <option>3</option>
+ <option>4</option>
+ <option>5</option>
+ <option>6</option>
+ </select>
+</form>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>How to bind a slider to an existing select element. The select stays visible to display the change. When the select is changed, the slider is updated, too.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/slider/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,29 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Slider Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ <li><a href="steps.html">Snap to increments</a></li>
+ <li><a href="range.html">Range slider</a></li>
+ <li><a href="rangemin.html">Range with fixed minimum</a></li>
+ <li><a href="hotelrooms.html">Room reservation</a></li>
+ <li><a href="rangemax.html">Range with fixed maximum</a></li>
+ <li><a href="slider-vertical.html">Vertical slider</a></li>
+ <li><a href="range-vertical.html">Vertical range slider</a></li>
+ <li><a href="multiple-vertical.html">Multiple sliders</a></li>
+ <li><a href="colorpicker.html">Simple colorpicker</a></li>
+ <li><a href="side-scroll.html">Simple scrollbar</a></li>
+ <li><a href="tabs.html">Slider controls tabs</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/slider/multiple-vertical.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,77 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Slider - Multiple sliders</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #demo-frame > div.demo { padding: 10px !important; }
+ #eq span {
+ height:120px; float:left; margin:15px
+ }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ // setup master volume
+ $("#master").slider({
+ value: 60,
+ orientation: "horizontal",
+ range: "min",
+ animate: true
+ });
+ // setup graphic EQ
+ $("#eq > span").each(function() {
+ // read initial values from markup and remove that
+ var value = parseInt($(this).text());
+ $(this).empty().slider({
+ value: value,
+ range: "min",
+ animate: true,
+ orientation: "vertical"
+ });
+ });
+ });
+ </script>
+</head>
+<body class="ui-widget-content" style="border:0;">
+
+<div class="demo">
+
+<p class="ui-state-default ui-corner-all ui-helper-clearfix" style="padding:4px;">
+<span class="ui-icon ui-icon-volume-on" style="float:left; margin:-2px 5px 0 0;"></span>
+Master volume
+</p>
+
+<div id="master" style="width:260px; margin:15px;"></div>
+
+<p class="ui-state-default ui-corner-all" style="padding:4px;margin-top:4em;">
+<span class="ui-icon ui-icon-signal" style="float:left; margin:-2px 5px 0 0;"></span>
+Graphic EQ
+</p>
+
+<div id="eq">
+ <span>88</span>
+ <span>77</span>
+ <span>55</span>
+ <span>33</span>
+ <span>40</span>
+ <span>45</span>
+ <span>70</span>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description" style="clear:left;">
+
+<p>Combine horizontal and vertical sliders, each with their own options, to create the UI for a music player.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/slider/range-vertical.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,50 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Slider - Vertical range slider</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #demo-frame > div.demo { padding: 10px !important; };
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#slider-range").slider({
+ orientation: "vertical",
+ range: true,
+ values: [17, 67],
+ slide: function(event, ui) {
+ $("#amount").val('$' + ui.values[0] + ' - $' + ui.values[1]);
+ }
+ });
+ $("#amount").val('$' + $("#slider-range").slider("values", 0) + ' - $' + $("#slider-range").slider("values", 1));
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>
+<label for="amount">Target sales goal (Millions):</label>
+<input type="text" id="amount" style="border:0; color:#f6931f; font-weight:bold;" />
+</p>
+
+<div id="slider-range" style="height:250px;"></div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Change the orientation of the range slider to vertical. Assign a height value via <code>.height()</code> or by setting the height through CSS, and set the <code>orientation</code> option to "vertical."</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/slider/range.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,51 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Slider - Range slider</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #demo-frame > div.demo { padding: 10px !important; };
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#slider-range").slider({
+ range: true,
+ min: 0,
+ max: 500,
+ values: [75, 300],
+ slide: function(event, ui) {
+ $("#amount").val('$' + ui.values[0] + ' - $' + ui.values[1]);
+ }
+ });
+ $("#amount").val('$' + $("#slider-range").slider("values", 0) + ' - $' + $("#slider-range").slider("values", 1));
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>
+<label for="amount">Price range:</label>
+<input type="text" id="amount" style="border:0; color:#f6931f; font-weight:bold;" />
+</p>
+
+<div id="slider-range"></div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Set the <code>range</code> option to true to capture a range of values with two drag handles. The space between the handles is filled with a different background color to indicate those values are selected.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/slider/rangemax.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,50 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Slider - Range with fixed maximum</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #demo-frame > div.demo { padding: 10px !important; };
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#slider-range-max").slider({
+ range: "max",
+ min: 1,
+ max: 10,
+ value: 2,
+ slide: function(event, ui) {
+ $("#amount").val(ui.value);
+ }
+ });
+ $("#amount").val($("#slider-range-max").slider("value"));
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>
+<labe for="amount">Minimum number of bedrooms:</label>
+<input type="text" id="amount" style="border:0; color:#f6931f; font-weight:bold;" />
+</p>
+<div id="slider-range-max"></div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Fix the maximum value of the range slider so that the user can only select a minimum. Set the <code>range</code> option to "max."</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/slider/rangemin.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,51 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Slider - Range with fixed minimum</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #demo-frame > div.demo { padding: 10px !important; };
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#slider-range-min").slider({
+ range: "min",
+ value: 37,
+ min: 1,
+ max: 700,
+ slide: function(event, ui) {
+ $("#amount").val('$' + ui.value);
+ }
+ });
+ $("#amount").val('$' + $("#slider-range-min").slider("value"));
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>
+<label for="amount">Maximum price:</label>
+<input type="text" id="amount" style="border:0; color:#f6931f; font-weight:bold;" />
+</p>
+
+<div id="slider-range-min"></div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Fix the minimum value of the range slider so that the user can only select a maximum. Set the <code>range</code> option to "min."</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/slider/side-scroll.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,138 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Slider - Slider scrollbar</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #demo-frame > div.demo { padding: 10px !important; }
+ .scroll-pane { overflow: auto; width: 99%; float:left; }
+ .scroll-content { width: 2440px; float: left; }
+ .scroll-content-item { width: 100px; height: 100px; float: left; margin: 10px; font-size: 3em; line-height: 96px; text-align: center; }
+ * html .scroll-content-item { display: inline; } /* IE6 float double margin bug */
+ .scroll-bar-wrap { clear: left; padding: 0 4px 0 2px; margin: 0 -1px -1px -1px; }
+ .scroll-bar-wrap .ui-slider { background: none; border:0; height: 2em; margin: 0 auto; }
+ .scroll-bar-wrap .ui-handle-helper-parent { position: relative; width: 100%; height: 100%; margin: 0 auto; }
+ .scroll-bar-wrap .ui-slider-handle { top:.2em; height: 1.5em; }
+ .scroll-bar-wrap .ui-slider-handle .ui-icon { margin: -8px auto 0; position: relative; top: 50%; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ //scrollpane parts
+ var scrollPane = $('.scroll-pane');
+ var scrollContent = $('.scroll-content');
+
+ //build slider
+ var scrollbar = $(".scroll-bar").slider({
+ slide:function(e, ui){
+ if( scrollContent.width() > scrollPane.width() ){ scrollContent.css('margin-left', Math.round( ui.value / 100 * ( scrollPane.width() - scrollContent.width() )) + 'px'); }
+ else { scrollContent.css('margin-left', 0); }
+ }
+ });
+
+ //append icon to handle
+ var handleHelper = scrollbar.find('.ui-slider-handle')
+ .mousedown(function(){
+ scrollbar.width( handleHelper.width() );
+ })
+ .mouseup(function(){
+ scrollbar.width( '100%' );
+ })
+ .append('<span class="ui-icon ui-icon-grip-dotted-vertical"></span>')
+ .wrap('<div class="ui-handle-helper-parent"></div>').parent();
+
+ //change overflow to hidden now that slider handles the scrolling
+ scrollPane.css('overflow','hidden');
+
+ //size scrollbar and handle proportionally to scroll distance
+ function sizeScrollbar(){
+ var remainder = scrollContent.width() - scrollPane.width();
+ var proportion = remainder / scrollContent.width();
+ var handleSize = scrollPane.width() - (proportion * scrollPane.width());
+ scrollbar.find('.ui-slider-handle').css({
+ width: handleSize,
+ 'margin-left': -handleSize/2
+ });
+ handleHelper.width('').width( scrollbar.width() - handleSize);
+ }
+
+ //reset slider value based on scroll content position
+ function resetValue(){
+ var remainder = scrollPane.width() - scrollContent.width();
+ var leftVal = scrollContent.css('margin-left') == 'auto' ? 0 : parseInt(scrollContent.css('margin-left'));
+ var percentage = Math.round(leftVal / remainder * 100);
+ scrollbar.slider("value", percentage);
+ }
+ //if the slider is 100% and window gets larger, reveal content
+ function reflowContent(){
+ var showing = scrollContent.width() + parseInt( scrollContent.css('margin-left') );
+ var gap = scrollPane.width() - showing;
+ if(gap > 0){
+ scrollContent.css('margin-left', parseInt( scrollContent.css('margin-left') ) + gap);
+ }
+ }
+
+ //change handle position on window resize
+ $(window)
+ .resize(function(){
+ resetValue();
+ sizeScrollbar();
+ reflowContent();
+ });
+ //init scrollbar size
+ setTimeout(sizeScrollbar,10);//safari wants a timeout
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="scroll-pane ui-widget ui-widget-header ui-corner-all">
+ <div class="scroll-content">
+ <div class="scroll-content-item ui-widget-header">1</div>
+ <div class="scroll-content-item ui-widget-header">2</div>
+ <div class="scroll-content-item ui-widget-header">3</div>
+ <div class="scroll-content-item ui-widget-header">4</div>
+ <div class="scroll-content-item ui-widget-header">5</div>
+ <div class="scroll-content-item ui-widget-header">6</div>
+ <div class="scroll-content-item ui-widget-header">7</div>
+ <div class="scroll-content-item ui-widget-header">8</div>
+ <div class="scroll-content-item ui-widget-header">9</div>
+ <div class="scroll-content-item ui-widget-header">10</div>
+ <div class="scroll-content-item ui-widget-header">11</div>
+ <div class="scroll-content-item ui-widget-header">12</div>
+ <div class="scroll-content-item ui-widget-header">13</div>
+ <div class="scroll-content-item ui-widget-header">14</div>
+ <div class="scroll-content-item ui-widget-header">15</div>
+ <div class="scroll-content-item ui-widget-header">16</div>
+ <div class="scroll-content-item ui-widget-header">17</div>
+ <div class="scroll-content-item ui-widget-header">18</div>
+ <div class="scroll-content-item ui-widget-header">19</div>
+ <div class="scroll-content-item ui-widget-header">20</div>
+ </div>
+ <div class="scroll-bar-wrap ui-widget-content ui-corner-bottom">
+ <div class="scroll-bar"></div>
+ </div>
+</div>
+
+
+
+</div><!-- End demo -->
+
+
+
+<div class="demo-description">
+
+<p>Use a slider to manipulate the positioning of content on the page. In this case, it acts as a scrollbar with the potential to capture values if needed.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/slider/slider-vertical.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,52 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Slider - Vertical slider</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #demo-frame > div.demo { padding: 10px !important; };
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#slider-vertical").slider({
+ orientation: "vertical",
+ range: "min",
+ min: 0,
+ max: 100,
+ value: 60,
+ slide: function(event, ui) {
+ $("#amount").val(ui.value);
+ }
+ });
+ $("#amount").val($("#slider-vertical").slider("value"));
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>
+<label for="amount">Volume:</label>
+<input type="text" id="amount" style="border:0; color:#f6931f; font-weight:bold;" />
+</p>
+
+<div id="slider-vertical" style="height:200px;"></div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Change the orientation of the slider to vertical. Assign a height value via <code>.height()</code> or by setting the height through CSS, and set the <code>orientation</code> option to "vertical."</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/slider/steps.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,51 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Slider - Snap to increments</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #demo-frame > div.demo { padding: 10px !important; };
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#slider").slider({
+ value:100,
+ min: 0,
+ max: 500,
+ step: 50,
+ slide: function(event, ui) {
+ $("#amount").val('$' + ui.value);
+ }
+ });
+ $("#amount").val('$' + $("#slider").slider("value"));
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<p>
+<label for="amount">Donation amount ($50 increments):</label>
+<input type="text" id="amount" style="border:0; color:#f6931f; font-weight:bold;" />
+</p>
+
+<div id="slider"></div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Increment slider values with the <code>step</code> option set to an integer, commonly a dividend of the slider's maximum value. The default increment is 1.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/slider/tabs.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,67 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Slider - Snap to increments</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #demo-frame > div.demo { padding: 10px !important; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#tabs").tabs({
+ select: function(event, ui) {
+ $("#slider").slider("value", ui.index);
+ }
+ });
+ $("#slider").slider({
+ min: 0,
+ max: $("#tabs").tabs("length") - 1,
+ slide: function(event, ui) {
+ $("#tabs").tabs("select", ui.value);
+ }
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="slider" style="width:100px"></div>
+
+<div id="tabs">
+ <ul>
+ <li><a href="#tabs-1">Nunc tincidunt</a></li>
+ <li><a href="#tabs-2">Proin dolor</a></li>
+ <li><a href="#tabs-3">Aenean lacinia</a></li>
+ </ul>
+ <div id="tabs-1">
+ <p>Proin elit arcu, rutrum commodo, vehicula tempus, commodo a, risus. Curabitur nec arcu. Donec sollicitudin mi sit amet mauris. Nam elementum quam ullamcorper ante. Etiam aliquet massa et lorem. Mauris dapibus lacus auctor risus. Aenean tempor ullamcorper leo. Vivamus sed magna quis ligula eleifend adipiscing. Duis orci. Aliquam sodales tortor vitae ipsum. Aliquam nulla. Duis aliquam molestie erat. Ut et mauris vel pede varius sollicitudin. Sed ut dolor nec orci tincidunt interdum. Phasellus ipsum. Nunc tristique tempus lectus.</p>
+ </div>
+ <div id="tabs-2">
+ <p>Morbi tincidunt, dui sit amet facilisis feugiat, odio metus gravida ante, ut pharetra massa metus id nunc. Duis scelerisque molestie turpis. Sed fringilla, massa eget luctus malesuada, metus eros molestie lectus, ut tempus eros massa ut dolor. Aenean aliquet fringilla sem. Suspendisse sed ligula in ligula suscipit aliquam. Praesent in eros vestibulum mi adipiscing adipiscing. Morbi facilisis. Curabitur ornare consequat nunc. Aenean vel metus. Ut posuere viverra nulla. Aliquam erat volutpat. Pellentesque convallis. Maecenas feugiat, tellus pellentesque pretium posuere, felis lorem euismod felis, eu ornare leo nisi vel felis. Mauris consectetur tortor et purus.</p>
+ </div>
+ <div id="tabs-3">
+ <p>Mauris eleifend est et turpis. Duis id erat. Suspendisse potenti. Aliquam vulputate, pede vel vehicula accumsan, mi neque rutrum erat, eu congue orci lorem eget lorem. Vestibulum non ante. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. Fusce sodales. Quisque eu urna vel enim commodo pellentesque. Praesent eu risus hendrerit ligula tempus pretium. Curabitur lorem enim, pretium nec, feugiat nec, luctus a, lacus.</p>
+ <p>Duis cursus. Maecenas ligula eros, blandit nec, pharetra at, semper at, magna. Nullam ac lacus. Nulla facilisi. Praesent viverra justo vitae neque. Praesent blandit adipiscing velit. Suspendisse potenti. Donec mattis, pede vel pharetra blandit, magna ligula faucibus eros, id euismod lacus dolor eget odio. Nam scelerisque. Donec non libero sed nulla mattis commodo. Ut sagittis. Donec nisi lectus, feugiat porttitor, tempor ac, tempor vitae, pede. Aenean vehicula velit eu tellus interdum rutrum. Maecenas commodo. Pellentesque nec elit. Fusce in lacus. Vivamus a libero vitae lectus hendrerit hendrerit.</p>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Control tabs with a slider.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/sortable/connect-lists-through-tabs.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,79 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Sortable - Connect lists with Tabs</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #sortable1 li, #sortable2 li { margin: 0 5px 5px 5px; padding: 5px; font-size: 1.2em; width: 120px; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#sortable1, #sortable2").sortable().disableSelection();
+
+ var $tabs = $("#tabs").tabs();
+
+ var $tab_items = $("ul:first li",$tabs).droppable({
+ accept: ".connectedSortable li",
+ hoverClass: "ui-state-hover",
+ drop: function(ev, ui) {
+ var $item = $(this);
+ var $list = $($item.find('a').attr('href')).find('.connectedSortable');
+
+ ui.draggable.hide('slow', function() {
+ $tabs.tabs('select', $tab_items.index($item));
+ $(this).appendTo($list).show('slow');
+ });
+ }
+ });
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div id="tabs">
+ <ul>
+ <li><a href="#tabs-1">Nunc tincidunt</a></li>
+ <li><a href="#tabs-2">Proin dolor</a></li>
+ </ul>
+ <div id="tabs-1">
+ <ul id="sortable1" class="connectedSortable ui-helper-reset">
+ <li class="ui-state-default">Item 1</li>
+ <li class="ui-state-default">Item 2</li>
+ <li class="ui-state-default">Item 3</li>
+ <li class="ui-state-default">Item 4</li>
+ <li class="ui-state-default">Item 5</li>
+ </ul>
+ </div>
+ <div id="tabs-2">
+ <ul id="sortable2" class="connectedSortable ui-helper-reset">
+ <li class="ui-state-highlight">Item 1</li>
+ <li class="ui-state-highlight">Item 2</li>
+ <li class="ui-state-highlight">Item 3</li>
+ <li class="ui-state-highlight">Item 4</li>
+ <li class="ui-state-highlight">Item 5</li>
+ </ul>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+ Sort items from one list into another and vice versa, by dropping the list item on the appropriate tab above.
+</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/sortable/connect-lists.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,58 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Sortable - Connect lists</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #sortable1, #sortable2 { list-style-type: none; margin: 0; padding: 0; float: left; margin-right: 10px; }
+ #sortable1 li, #sortable2 li { margin: 0 5px 5px 5px; padding: 5px; font-size: 1.2em; width: 120px; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#sortable1, #sortable2").sortable({
+ connectWith: '.connectedSortable'
+ }).disableSelection();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<ul id="sortable1" class="connectedSortable">
+ <li class="ui-state-default">Item 1</li>
+ <li class="ui-state-default">Item 2</li>
+ <li class="ui-state-default">Item 3</li>
+ <li class="ui-state-default">Item 4</li>
+ <li class="ui-state-default">Item 5</li>
+</ul>
+
+<ul id="sortable2" class="connectedSortable">
+ <li class="ui-state-highlight">Item 1</li>
+ <li class="ui-state-highlight">Item 2</li>
+ <li class="ui-state-highlight">Item 3</li>
+ <li class="ui-state-highlight">Item 4</li>
+ <li class="ui-state-highlight">Item 5</li>
+</ul>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+ Sort items from one list into another and vice versa, by passing a selector into
+ the <code>connectWith</code> option. The simplest way to do this is to
+ group all related lists with a CSS class, and then pass that class into the
+ sortable function (i.e., <code>connectWith: '.myclass'</code>).
+</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/sortable/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,51 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Sortable - Default functionality</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #sortable { list-style-type: none; margin: 0; padding: 0; width: 60%; }
+ #sortable li { margin: 0 3px 3px 3px; padding: 0.4em; padding-left: 1.5em; font-size: 1.4em; height: 18px; }
+ #sortable li span { position: absolute; margin-left: -1.3em; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#sortable").sortable();
+ $("#sortable").disableSelection();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<ul id="sortable">
+ <li class="ui-state-default"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span>Item 1</li>
+ <li class="ui-state-default"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span>Item 2</li>
+ <li class="ui-state-default"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span>Item 3</li>
+ <li class="ui-state-default"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span>Item 4</li>
+ <li class="ui-state-default"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span>Item 5</li>
+ <li class="ui-state-default"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span>Item 6</li>
+ <li class="ui-state-default"><span class="ui-icon ui-icon-arrowthick-2-n-s"></span>Item 7</li>
+</ul>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+ Enable a group of DOM elements to be sortable. Click on and drag an
+ element to a new spot within the list, and the other items will adjust to
+ fit. By default, sortable items share <code>draggable</code> properties.
+</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/sortable/delay-start.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,67 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Sortable - Delay start</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #sortable1, #sortable2 { list-style-type: none; margin: 0; padding: 0; margin-bottom: 15px;zoom: 1; }
+ #sortable1 li, #sortable2 li { margin: 0 5px 5px 5px; padding: 5px; font-size: 1.2em; width: 95%; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#sortable1").sortable({
+ delay: 300
+ });
+
+ $("#sortable2").sortable({
+ distance: 15
+ });
+
+ $("li").disableSelection();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<h3 class="docs">Time delay of 300ms:</h3>
+
+<ul id="sortable1">
+ <li class="ui-state-default">Item 1</li>
+ <li class="ui-state-default">Item 2</li>
+ <li class="ui-state-default">Item 3</li>
+ <li class="ui-state-default">Item 4</li>
+</ul>
+
+<h3 class="docs">Distance delay of 15px:</h3>
+
+<ul id="sortable2">
+ <li class="ui-state-default">Item 1</li>
+ <li class="ui-state-default">Item 2</li>
+ <li class="ui-state-default">Item 3</li>
+ <li class="ui-state-default">Item 4</li>
+</ul>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+ Prevent accidental sorting either by delay (time) or distance. Set a number of
+ milliseconds the element needs to be dragged before sorting starts
+ with the <code>delay</code> option. Set a distance in pixels the element
+ needs to be dragged before sorting starts with the <code>distance</code>
+ option.
+</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/sortable/display-grid.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,54 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Sortable - Display as grid</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #sortable { list-style-type: none; margin: 0; padding: 0; }
+ #sortable li { margin: 3px 3px 3px 0; padding: 1px; float: left; width: 100px; height: 90px; font-size: 4em; text-align: center; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#sortable").sortable();
+ $("#sortable").disableSelection();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<ul id="sortable">
+ <li class="ui-state-default">1</li>
+ <li class="ui-state-default">2</li>
+ <li class="ui-state-default">3</li>
+ <li class="ui-state-default">4</li>
+ <li class="ui-state-default">5</li>
+ <li class="ui-state-default">6</li>
+ <li class="ui-state-default">7</li>
+ <li class="ui-state-default">8</li>
+ <li class="ui-state-default">9</li>
+ <li class="ui-state-default">10</li>
+ <li class="ui-state-default">11</li>
+ <li class="ui-state-default">12</li>
+</ul>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+ To arrange sortable items as a grid, give them identical dimensions and
+ float them using CSS.
+</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/sortable/empty-lists.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,69 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Sortable - Handle empty lists</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #sortable1, #sortable2, #sortable3 { list-style-type: none; margin: 0; padding: 0; float: left; margin-right: 10px; background: #eee; padding: 5px; width: 143px;}
+ #sortable1 li, #sortable2 li, #sortable3 li { margin: 5px; padding: 5px; font-size: 1.2em; width: 120px; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("ul.droptrue").sortable({
+ connectWith: 'ul'
+ });
+
+ $("ul.dropfalse").sortable({
+ connectWith: 'ul',
+ dropOnEmpty: false
+ });
+
+ $("#sortable1, #sortable2, #sortable3").disableSelection();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<ul id="sortable1" class='droptrue'>
+ <li class="ui-state-default">Can be dropped..</li>
+ <li class="ui-state-default">..on an empty list</li>
+ <li class="ui-state-default">Item 3</li>
+ <li class="ui-state-default">Item 4</li>
+ <li class="ui-state-default">Item 5</li>
+</ul>
+
+<ul id="sortable2" class='dropfalse'>
+ <li class="ui-state-highlight">Cannot be dropped..</li>
+ <li class="ui-state-highlight">..on an empty list</li>
+ <li class="ui-state-highlight">Item 3</li>
+ <li class="ui-state-highlight">Item 4</li>
+ <li class="ui-state-highlight">Item 5</li>
+</ul>
+
+<ul id="sortable3" class='droptrue'>
+</ul>
+
+<br clear="both" />
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+ Prevent all items in a list from being dropped into a separate, empty list
+ using the <code>dropOnEmpty</code> option set to <code>false</code>. By default,
+ sortable items can be dropped on empty lists.
+</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/sortable/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,26 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Sortable Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ <li><a href="placeholder.html">Drop placeholder</a></li>
+ <li><a href="connect-lists.html">Connect lists</a></li>
+ <li><a href="connect-lists-through-tabs.html">Connect lists through tabs</a></li>
+ <li><a href="empty-lists.html">Handle empty lists</a></li>
+ <li><a href="items.html">Include / exclude items</a></li>
+ <li><a href="delay-start.html">Delay start</a></li>
+ <li><a href="display-grid.html">Display as grid</a></li>
+ <li><a href="portlets.html">Portlets</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/sortable/items.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,71 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Sortable - Include / exclude items</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #sortable1, #sortable2 { list-style-type: none; margin: 0; padding: 0; zoom: 1; }
+ #sortable1 li, #sortable2 li { margin: 0 5px 5px 5px; padding: 3px; width: 90%; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#sortable1").sortable({
+ items: 'li:not(.ui-state-disabled)'
+ });
+
+ $("#sortable2").sortable({
+ cancel: '.ui-state-disabled'
+ });
+
+ $("#sortable1 li, #sortable2 li").disableSelection();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<h3 class="docs">Specify which items are sortable:</h3>
+
+<ul id="sortable1">
+ <li class="ui-state-default">Item 1</li>
+ <li class="ui-state-default ui-state-disabled">(I'm not sortable or a drop target)</li>
+ <li class="ui-state-default ui-state-disabled">(I'm not sortable or a drop target)</li>
+ <li class="ui-state-default">Item 4</li>
+</ul>
+
+<h3 class="docs">Cancel sorting (but keep as drop targets):</h3>
+
+<ul id="sortable2">
+ <li class="ui-state-default">Item 1</li>
+ <li class="ui-state-default ui-state-disabled">(I'm not sortable)</li>
+ <li class="ui-state-default ui-state-disabled">(I'm not sortable)</li>
+ <li class="ui-state-default">Item 4</li>
+</ul>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+ Specify which items are eligible to sort by passing a jQuery selector into
+ the <code>items</code> option. Items excluded from this option are not
+ sortable, nor are they valid targets for sortable items.
+</p>
+
+<p>
+ To only prevent sorting on certain items, pass a jQuery selector into the
+ <code>cancel</code> option. Cancelled items remain valid sort targets for
+ others.
+</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/sortable/placeholder.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,56 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Sortable - Drop placeholder</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #sortable { list-style-type: none; margin: 0; padding: 0; width: 60%; }
+ #sortable li { margin: 0 5px 5px 5px; padding: 5px; font-size: 1.2em; height: 1.5em; }
+ html>body #sortable li { height: 1.5em; line-height: 1.2em; }
+ .ui-state-highlight { height: 1.5em; line-height: 1.2em; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#sortable").sortable({
+ placeholder: 'ui-state-highlight'
+ });
+ $("#sortable").disableSelection();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<ul id="sortable">
+ <li class="ui-state-default">Item 1</li>
+ <li class="ui-state-default">Item 2</li>
+ <li class="ui-state-default">Item 3</li>
+ <li class="ui-state-default">Item 4</li>
+ <li class="ui-state-default">Item 5</li>
+ <li class="ui-state-default">Item 6</li>
+ <li class="ui-state-default">Item 7</li>
+</ul>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+ When dragging a sortable item to a new location, other items will make room
+ for the that item by shifting to allow white space between them. Pass a
+ class into the <code>placeholder</code> option to style that space to
+ be visible. Use the boolean <code>forcePlaceholderSize</code> option
+ to set dimensions on the placeholder.
+</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/sortable/portlets.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,96 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Sortable - Portlets</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .column { width: 170px; float: left; padding-bottom: 100px; }
+ .portlet { margin: 0 1em 1em 0; }
+ .portlet-header { margin: 0.3em; padding-bottom: 4px; padding-left: 0.2em; }
+ .portlet-header .ui-icon { float: right; }
+ .portlet-content { padding: 0.4em; }
+ .ui-sortable-placeholder { border: 1px dotted black; visibility: visible !important; height: 50px !important; }
+ .ui-sortable-placeholder * { visibility: hidden; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $(".column").sortable({
+ connectWith: '.column'
+ });
+
+ $(".portlet").addClass("ui-widget ui-widget-content ui-helper-clearfix ui-corner-all")
+ .find(".portlet-header")
+ .addClass("ui-widget-header ui-corner-all")
+ .prepend('<span class="ui-icon ui-icon-minusthick"></span>')
+ .end()
+ .find(".portlet-content");
+
+ $(".portlet-header .ui-icon").click(function() {
+ $(this).toggleClass("ui-icon-minusthick").toggleClass("ui-icon-plusthick");
+ $(this).parents(".portlet:first").find(".portlet-content").toggle();
+ });
+
+ $(".column").disableSelection();
+ });
+ </script>
+</head>
+<body>
+<div class="demo">
+
+<div class="column">
+
+ <div class="portlet">
+ <div class="portlet-header">Feeds</div>
+ <div class="portlet-content">Lorem ipsum dolor sit amet, consectetuer adipiscing elit</div>
+ </div>
+
+ <div class="portlet">
+ <div class="portlet-header">News</div>
+ <div class="portlet-content">Lorem ipsum dolor sit amet, consectetuer adipiscing elit</div>
+ </div>
+
+</div>
+
+<div class="column">
+
+ <div class="portlet">
+ <div class="portlet-header">Shopping</div>
+ <div class="portlet-content">Lorem ipsum dolor sit amet, consectetuer adipiscing elit</div>
+ </div>
+
+</div>
+
+<div class="column">
+
+ <div class="portlet">
+ <div class="portlet-header">Links</div>
+ <div class="portlet-content">Lorem ipsum dolor sit amet, consectetuer adipiscing elit</div>
+ </div>
+
+ <div class="portlet">
+ <div class="portlet-header">Images</div>
+ <div class="portlet-content">Lorem ipsum dolor sit amet, consectetuer adipiscing elit</div>
+ </div>
+
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+ Enable portlets (styled divs) as sortables and use the <code>connectWith</code>
+ option to allow sorting between columns.
+</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/switchClass/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,48 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects - switchClass Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .toggler { width: 500px; height: 200px; position: relative;}
+ #button { padding: .5em 1em; text-decoration: none; }
+ #effect {position: relative; }
+ #effect.newClass { width: 240px; padding: 1em; letter-spacing: 0; font-size: 1.2em; }
+ #effect.anotherNewClass { text-indent: 40px; letter-spacing: .4em; width: 410px; height: 100px; padding: 30px; margin: 10px; font-size: 1.6em; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#button").click(function(){
+ $(".newClass").switchClass('newClass', 'anotherNewClass', 1000);
+ $(".anotherNewClass").switchClass('anotherNewClass', 'newClass', 1000);
+ return false;
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+
+<div class="toggler">
+ <div id="effect" class="newClass ui-corner-all">
+ Etiam libero neque, luctus a, eleifend nec, semper at, lorem. Sed pede.
+ </div>
+</div>
+<a href="#" id="button" class="ui-state-default ui-corner-all">Run Effect</a>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Click the button above to preview the effect.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/switchClass/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,18 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/tabs/ajax.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,51 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Tabs - Content via Ajax</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#tabs").tabs({
+ ajaxOptions: {
+ error: function(xhr, status, index, anchor) {
+ $(anchor.hash).html("Couldn't load this tab. We'll try to fix this as soon as possible. If this wouldn't be a demo.");
+ }
+ }
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="tabs">
+ <ul>
+ <li><a href="#tabs-1">Preloaded</a></li>
+ <li><a href="ajax/content1.html">Tab 1</a></li>
+ <li><a href="ajax/content2.html">Tab 2</a></li>
+ <li><a href="ajax/content3-slow.php">Tab 3 (slow)</a></li>
+ <li><a href="ajax/content4-broken.php">Tab 4 (broken)</a></li>
+ </ul>
+ <div id="tabs-1">
+ <p>Proin elit arcu, rutrum commodo, vehicula tempus, commodo a, risus. Curabitur nec arcu. Donec sollicitudin mi sit amet mauris. Nam elementum quam ullamcorper ante. Etiam aliquet massa et lorem. Mauris dapibus lacus auctor risus. Aenean tempor ullamcorper leo. Vivamus sed magna quis ligula eleifend adipiscing. Duis orci. Aliquam sodales tortor vitae ipsum. Aliquam nulla. Duis aliquam molestie erat. Ut et mauris vel pede varius sollicitudin. Sed ut dolor nec orci tincidunt interdum. Phasellus ipsum. Nunc tristique tempus lectus.</p>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Fetch external content via Ajax for the tabs by setting an href value in the tab links. While the Ajax request is waiting for a response, the tab label changes to say "Loading...", then returns to the normal label once loaded.</p>
+
+<p>Tabs 3 and 4 demonstrate slow-loading and broken AJAX tabs, and how to handle serverside errors in those cases. Note: These two require a webserver to interpret PHP. They won't work from the filesystem.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/tabs/ajax/content1.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,4 @@
+<p><strong>This content was loaded via ajax.</strong>
+<p>Proin elit arcu, rutrum commodo, vehicula tempus, commodo a, risus. Curabitur nec arcu. Donec sollicitudin mi sit amet mauris. Nam elementum quam ullamcorper ante. Etiam aliquet massa et lorem. Mauris dapibus lacus auctor risus. Aenean tempor ullamcorper leo. Vivamus sed magna quis ligula eleifend adipiscing. Duis orci. Aliquam sodales tortor vitae ipsum. Aliquam nulla. Duis aliquam molestie erat. Ut et mauris vel pede varius sollicitudin. Sed ut dolor nec orci tincidunt interdum. Phasellus ipsum. Nunc tristique tempus lectus.</p>
+<p>Mauris vitae ante. Curabitur augue. Nulla purus nibh, lobortis ut, feugiat at, aliquam id, purus. Sed venenatis, lorem venenatis volutpat commodo, purus quam lacinia justo, mattis interdum pede pede a odio. Fusce nibh. Morbi nisl mauris, dapibus in, tristique eget, accumsan et, pede. Donec mauris risus, pulvinar ut, faucibus eu, mollis in, nunc. In augue massa, commodo a, cursus vehicula, varius eu, dui. Suspendisse sodales suscipit lorem. Morbi malesuada, eros quis condimentum dignissim, lectus nibh tristique urna, non bibendum diam massa vel risus. Morbi suscipit. Proin egestas, eros at scelerisque scelerisque, dolor lacus fringilla lacus, ut ullamcorper mi magna at quam. Aliquam sed elit. Aliquam turpis purus, congue quis, iaculis id, ullamcorper sit amet, justo. Maecenas sed mauris. Proin magna justo, interdum in, tincidunt eu, viverra eu, turpis. Suspendisse mollis. In magna. Phasellus pellentesque, urna pellentesque convallis pellentesque, augue sem blandit pede, at rhoncus libero nisl a odio.</p>
+<p>Sed vitae nibh non magna semper tempor. Duis dolor. Nam congue laoreet arcu. Fusce lobortis enim quis ligula. Maecenas commodo odio id mi. Maecenas scelerisque tellus eu odio. Etiam dolor purus, lacinia a, imperdiet in, aliquam et, eros. In pellentesque. Nullam ac massa. Integer et turpis. Ut quam augue, congue non, imperdiet id, eleifend ac, nisi. Etiam ac arcu. Cras iaculis accumsan erat. Nullam vulputate sapien nec nisi pretium rhoncus. Aliquam a nibh. Vivamus est ante, fermentum a, tincidunt ut, imperdiet nec, velit. Aenean non tortor. Sed nec mauris eget tellus condimentum rutrum.</p>
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/tabs/ajax/content2.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,4 @@
+<p><strong>This other content was loaded via ajax.</strong>
+<p>Lorem ipsum dolor sit amet, consectetur adipiscing elit. Aenean nec turpis justo, et facilisis ligula. In congue interdum odio, a scelerisque eros posuere ac. Aenean massa tellus, dictum sit amet laoreet ut, aliquam in orci. Duis eu aliquam ligula. Nullam vel placerat ligula. Fusce venenatis viverra dictum. Phasellus dui dolor, imperdiet in sodales at, mattis sed libero. Morbi ac ipsum ligula. Quisque suscipit dui vel diam pretium nec cursus lacus malesuada. Donec sollicitudin, eros eget dignissim mollis, risus leo feugiat tellus, vel posuere nisl ipsum eu erat. Quisque posuere lacinia imperdiet. Quisque nunc leo, elementum quis ultricies et, vehicula sit amet turpis. Nullam sed nunc nec nibh condimentum mattis. Quisque sed ligula sit amet nisi ultricies bibendum eget id nisi.</p>
+<p>Proin ut erat vel nunc tincidunt commodo. Curabitur feugiat, nisi et vehicula viverra, nisl orci eleifend arcu, sed blandit lectus nisl quis nisi. In hac habitasse platea dictumst. In hac habitasse platea dictumst. Aenean rutrum gravida velit ac imperdiet. Integer vitae arcu risus. Vestibulum ante ipsum primis in faucibus orci luctus et ultrices posuere cubilia Curae; Proin tincidunt orci at leo egestas porta. Vivamus ac augue et enim bibendum hendrerit ut id urna. Donec sollicitudin pulvinar turpis vitae scelerisque. Etiam tempor porttitor est sed blandit. Phasellus varius consequat leo eget tincidunt. Aliquam ac dui lectus. In et consectetur orci. Duis posuere nulla ac turpis faucibus vestibulum. Sed ut velit et dolor rhoncus dapibus. Sed sit amet pellentesque est.</p>
+<p>Nam in volutpat orci. Morbi sit amet orci in erat egestas dignissim. Etiam mi sapien, tempus sed iaculis a, adipiscing quis tellus. Suspendisse potenti. Nam malesuada tristique vestibulum. In tempor tellus dignissim neque consectetur eu vestibulum nisl pellentesque. Phasellus ultrices cursus velit, id aliquam nisl fringilla quis. Cras varius elit sed urna ultrices congue. Sed ornare odio sed velit pellentesque id varius nisl sodales. Sed auctor ligula egestas mi pharetra ut consectetur erat pharetra.</p>
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/tabs/ajax/content3-slow.php Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,7 @@
+<?php
+sleep(1);
+?>
+<p><strong>This content was loaded via ajax, though it took a second.</strong>
+<p>Lorem ipsum dolor sit amet, consectetur adipiscing elit. Aenean nec turpis justo, et facilisis ligula. In congue interdum odio, a scelerisque eros posuere ac. Aenean massa tellus, dictum sit amet laoreet ut, aliquam in orci. Duis eu aliquam ligula. Nullam vel placerat ligula. Fusce venenatis viverra dictum. Phasellus dui dolor, imperdiet in sodales at, mattis sed libero. Morbi ac ipsum ligula. Quisque suscipit dui vel diam pretium nec cursus lacus malesuada. Donec sollicitudin, eros eget dignissim mollis, risus leo feugiat tellus, vel posuere nisl ipsum eu erat. Quisque posuere lacinia imperdiet. Quisque nunc leo, elementum quis ultricies et, vehicula sit amet turpis. Nullam sed nunc nec nibh condimentum mattis. Quisque sed ligula sit amet nisi ultricies bibendum eget id nisi.</p>
+<p>Proin ut erat vel nunc tincidunt commodo. Curabitur feugiat, nisi et vehicula viverra, nisl orci eleifend arcu, sed blandit lectus nisl quis nisi. In hac habitasse platea dictumst. In hac habitasse platea dictumst. Aenean rutrum gravida velit ac imperdiet. Integer vitae arcu risus. Vestibulum ante ipsum primis in faucibus orci luctus et ultrices posuere cubilia Curae; Proin tincidunt orci at leo egestas porta. Vivamus ac augue et enim bibendum hendrerit ut id urna. Donec sollicitudin pulvinar turpis vitae scelerisque. Etiam tempor porttitor est sed blandit. Phasellus varius consequat leo eget tincidunt. Aliquam ac dui lectus. In et consectetur orci. Duis posuere nulla ac turpis faucibus vestibulum. Sed ut velit et dolor rhoncus dapibus. Sed sit amet pellentesque est.</p>
+<p>Nam in volutpat orci. Morbi sit amet orci in erat egestas dignissim. Etiam mi sapien, tempus sed iaculis a, adipiscing quis tellus. Suspendisse potenti. Nam malesuada tristique vestibulum. In tempor tellus dignissim neque consectetur eu vestibulum nisl pellentesque. Phasellus ultrices cursus velit, id aliquam nisl fringilla quis. Cras varius elit sed urna ultrices congue. Sed ornare odio sed velit pellentesque id varius nisl sodales. Sed auctor ligula egestas mi pharetra ut consectetur erat pharetra.</p>
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/tabs/ajax/content4-broken.php Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,3 @@
+<?php
+header("HTTP/1.0 404 Not Found");
+?>
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/tabs/bottom.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,60 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Tabs - Tabs at bottom</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#tabs").tabs();
+ $(".tabs-bottom .ui-tabs-nav, .tabs-bottom .ui-tabs-nav > *")
+ .removeClass("ui-corner-all ui-corner-top")
+ .addClass("ui-corner-bottom");
+ });
+ </script>
+ <style>
+ #tabs { height: 200px; }
+ .tabs-bottom { position: relative; }
+ .tabs-bottom .ui-tabs-panel { height: 140px; overflow: auto; }
+ .tabs-bottom .ui-tabs-nav { position: absolute !important; left: 0; bottom: 0; right:0; padding: 0 0.2em 0.2em 0; }
+ .tabs-bottom .ui-tabs-nav li { margin-top: -2px !important; margin-bottom: 1px !important; border-top: none; border-bottom-width: 1px; }
+ .ui-tabs-selected { margin-top: -3px !important; }
+ </style>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="tabs" class="tabs-bottom">
+ <ul>
+ <li><a href="#tabs-1">Nunc tincidunt</a></li>
+ <li><a href="#tabs-2">Proin dolor</a></li>
+ <li><a href="#tabs-3">Aenean lacinia</a></li>
+ </ul>
+ <div id="tabs-1">
+ <p>Proin elit arcu, rutrum commodo, vehicula tempus, commodo a, risus. Curabitur nec arcu. Donec sollicitudin mi sit amet mauris. Nam elementum quam ullamcorper ante. Etiam aliquet massa et lorem. Mauris dapibus lacus auctor risus. Aenean tempor ullamcorper leo. Vivamus sed magna quis ligula eleifend adipiscing. Duis orci. Aliquam sodales tortor vitae ipsum. Aliquam nulla. Duis aliquam molestie erat. Ut et mauris vel pede varius sollicitudin. Sed ut dolor nec orci tincidunt interdum. Phasellus ipsum. Nunc tristique tempus lectus.</p>
+ </div>
+ <div id="tabs-2">
+ <p>Morbi tincidunt, dui sit amet facilisis feugiat, odio metus gravida ante, ut pharetra massa metus id nunc. Duis scelerisque molestie turpis. Sed fringilla, massa eget luctus malesuada, metus eros molestie lectus, ut tempus eros massa ut dolor. Aenean aliquet fringilla sem. Suspendisse sed ligula in ligula suscipit aliquam. Praesent in eros vestibulum mi adipiscing adipiscing. Morbi facilisis. Curabitur ornare consequat nunc. Aenean vel metus. Ut posuere viverra nulla. Aliquam erat volutpat. Pellentesque convallis. Maecenas feugiat, tellus pellentesque pretium posuere, felis lorem euismod felis, eu ornare leo nisi vel felis. Mauris consectetur tortor et purus.</p>
+ </div>
+ <div id="tabs-3">
+ <p>Mauris eleifend est et turpis. Duis id erat. Suspendisse potenti. Aliquam vulputate, pede vel vehicula accumsan, mi neque rutrum erat, eu congue orci lorem eget lorem. Vestibulum non ante. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. Fusce sodales. Quisque eu urna vel enim commodo pellentesque. Praesent eu risus hendrerit ligula tempus pretium. Curabitur lorem enim, pretium nec, feugiat nec, luctus a, lacus.</p>
+ <p>Duis cursus. Maecenas ligula eros, blandit nec, pharetra at, semper at, magna. Nullam ac lacus. Nulla facilisi. Praesent viverra justo vitae neque. Praesent blandit adipiscing velit. Suspendisse potenti. Donec mattis, pede vel pharetra blandit, magna ligula faucibus eros, id euismod lacus dolor eget odio. Nam scelerisque. Donec non libero sed nulla mattis commodo. Ut sagittis. Donec nisi lectus, feugiat porttitor, tempor ac, tempor vitae, pede. Aenean vehicula velit eu tellus interdum rutrum. Maecenas commodo. Pellentesque nec elit. Fusce in lacus. Vivamus a libero vitae lectus hendrerit hendrerit.</p>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>With some additional CSS (for positioning) and JS (to put the right classes on elements) the tabs can be placed below their content.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/tabs/collapsible.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,56 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Tabs - Collapse content</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#tabs").tabs({
+ collapsible: true
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="tabs">
+ <ul>
+ <li><a href="#tabs-1">Nunc tincidunt</a></li>
+ <li><a href="#tabs-2">Proin dolor</a></li>
+ <li><a href="#tabs-3">Aenean lacinia</a></li>
+ </ul>
+ <div id="tabs-1">
+ <p><strong>Click this tab again to close the content pane.</strong></p>
+ <p>Proin elit arcu, rutrum commodo, vehicula tempus, commodo a, risus. Curabitur nec arcu. Donec sollicitudin mi sit amet mauris. Nam elementum quam ullamcorper ante. Etiam aliquet massa et lorem. Mauris dapibus lacus auctor risus. Aenean tempor ullamcorper leo. Vivamus sed magna quis ligula eleifend adipiscing. Duis orci. Aliquam sodales tortor vitae ipsum. Aliquam nulla. Duis aliquam molestie erat. Ut et mauris vel pede varius sollicitudin. Sed ut dolor nec orci tincidunt interdum. Phasellus ipsum. Nunc tristique tempus lectus.</p>
+ </div>
+ <div id="tabs-2">
+ <p><strong>Click this tab again to close the content pane.</strong></p>
+ <p>Morbi tincidunt, dui sit amet facilisis feugiat, odio metus gravida ante, ut pharetra massa metus id nunc. Duis scelerisque molestie turpis. Sed fringilla, massa eget luctus malesuada, metus eros molestie lectus, ut tempus eros massa ut dolor. Aenean aliquet fringilla sem. Suspendisse sed ligula in ligula suscipit aliquam. Praesent in eros vestibulum mi adipiscing adipiscing. Morbi facilisis. Curabitur ornare consequat nunc. Aenean vel metus. Ut posuere viverra nulla. Aliquam erat volutpat. Pellentesque convallis. Maecenas feugiat, tellus pellentesque pretium posuere, felis lorem euismod felis, eu ornare leo nisi vel felis. Mauris consectetur tortor et purus.</p>
+ </div>
+ <div id="tabs-3">
+ <p><strong>Click this tab again to close the content pane.</strong></p>
+ <p>Duis cursus. Maecenas ligula eros, blandit nec, pharetra at, semper at, magna. Nullam ac lacus. Nulla facilisi. Praesent viverra justo vitae neque. Praesent blandit adipiscing velit. Suspendisse potenti. Donec mattis, pede vel pharetra blandit, magna ligula faucibus eros, id euismod lacus dolor eget odio. Nam scelerisque. Donec non libero sed nulla mattis commodo. Ut sagittis. Donec nisi lectus, feugiat porttitor, tempor ac, tempor vitae, pede. Aenean vehicula velit eu tellus interdum rutrum. Maecenas commodo. Pellentesque nec elit. Fusce in lacus. Vivamus a libero vitae lectus hendrerit hendrerit.</p>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Click the selected tab to toggle its content closed/open. To enable this functionality, set the <code>collapsible</code> option to true.</p>
+
+<pre><code>collapsible: true
+</code></pre>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/tabs/cookie.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,57 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Tabs - Default functionality</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../external/jquery.cookie.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#tabs").tabs({
+ cookie: {
+ // store cookie for a day, without, it would be a session cookie
+ expires: 1
+ }
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="tabs">
+ <ul>
+ <li><a href="#tabs-1">Nunc tincidunt</a></li>
+ <li><a href="#tabs-2">Proin dolor</a></li>
+ <li><a href="#tabs-3">Aenean lacinia</a></li>
+ </ul>
+ <div id="tabs-1">
+ <p>Proin elit arcu, rutrum commodo, vehicula tempus, commodo a, risus. Curabitur nec arcu. Donec sollicitudin mi sit amet mauris. Nam elementum quam ullamcorper ante. Etiam aliquet massa et lorem. Mauris dapibus lacus auctor risus. Aenean tempor ullamcorper leo. Vivamus sed magna quis ligula eleifend adipiscing. Duis orci. Aliquam sodales tortor vitae ipsum. Aliquam nulla. Duis aliquam molestie erat. Ut et mauris vel pede varius sollicitudin. Sed ut dolor nec orci tincidunt interdum. Phasellus ipsum. Nunc tristique tempus lectus.</p>
+ </div>
+ <div id="tabs-2">
+ <p>Morbi tincidunt, dui sit amet facilisis feugiat, odio metus gravida ante, ut pharetra massa metus id nunc. Duis scelerisque molestie turpis. Sed fringilla, massa eget luctus malesuada, metus eros molestie lectus, ut tempus eros massa ut dolor. Aenean aliquet fringilla sem. Suspendisse sed ligula in ligula suscipit aliquam. Praesent in eros vestibulum mi adipiscing adipiscing. Morbi facilisis. Curabitur ornare consequat nunc. Aenean vel metus. Ut posuere viverra nulla. Aliquam erat volutpat. Pellentesque convallis. Maecenas feugiat, tellus pellentesque pretium posuere, felis lorem euismod felis, eu ornare leo nisi vel felis. Mauris consectetur tortor et purus.</p>
+ </div>
+ <div id="tabs-3">
+ <p>Mauris eleifend est et turpis. Duis id erat. Suspendisse potenti. Aliquam vulputate, pede vel vehicula accumsan, mi neque rutrum erat, eu congue orci lorem eget lorem. Vestibulum non ante. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. Fusce sodales. Quisque eu urna vel enim commodo pellentesque. Praesent eu risus hendrerit ligula tempus pretium. Curabitur lorem enim, pretium nec, feugiat nec, luctus a, lacus.</p>
+ <p>Duis cursus. Maecenas ligula eros, blandit nec, pharetra at, semper at, magna. Nullam ac lacus. Nulla facilisi. Praesent viverra justo vitae neque. Praesent blandit adipiscing velit. Suspendisse potenti. Donec mattis, pede vel pharetra blandit, magna ligula faucibus eros, id euismod lacus dolor eget odio. Nam scelerisque. Donec non libero sed nulla mattis commodo. Ut sagittis. Donec nisi lectus, feugiat porttitor, tempor ac, tempor vitae, pede. Aenean vehicula velit eu tellus interdum rutrum. Maecenas commodo. Pellentesque nec elit. Fusce in lacus. Vivamus a libero vitae lectus hendrerit hendrerit.</p>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Looks the same as the default demo, but uses cookie to store the selected tab, and restore it when the page (re)loads.
+
+The cookie is stored for a day, so tabs will be restored even after closing the browser. Use cookie: {} for using cookies with default options.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/tabs/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,49 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Tabs - Default functionality</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#tabs").tabs();
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="tabs">
+ <ul>
+ <li><a href="#tabs-1">Nunc tincidunt</a></li>
+ <li><a href="#tabs-2">Proin dolor</a></li>
+ <li><a href="#tabs-3">Aenean lacinia</a></li>
+ </ul>
+ <div id="tabs-1">
+ <p>Proin elit arcu, rutrum commodo, vehicula tempus, commodo a, risus. Curabitur nec arcu. Donec sollicitudin mi sit amet mauris. Nam elementum quam ullamcorper ante. Etiam aliquet massa et lorem. Mauris dapibus lacus auctor risus. Aenean tempor ullamcorper leo. Vivamus sed magna quis ligula eleifend adipiscing. Duis orci. Aliquam sodales tortor vitae ipsum. Aliquam nulla. Duis aliquam molestie erat. Ut et mauris vel pede varius sollicitudin. Sed ut dolor nec orci tincidunt interdum. Phasellus ipsum. Nunc tristique tempus lectus.</p>
+ </div>
+ <div id="tabs-2">
+ <p>Morbi tincidunt, dui sit amet facilisis feugiat, odio metus gravida ante, ut pharetra massa metus id nunc. Duis scelerisque molestie turpis. Sed fringilla, massa eget luctus malesuada, metus eros molestie lectus, ut tempus eros massa ut dolor. Aenean aliquet fringilla sem. Suspendisse sed ligula in ligula suscipit aliquam. Praesent in eros vestibulum mi adipiscing adipiscing. Morbi facilisis. Curabitur ornare consequat nunc. Aenean vel metus. Ut posuere viverra nulla. Aliquam erat volutpat. Pellentesque convallis. Maecenas feugiat, tellus pellentesque pretium posuere, felis lorem euismod felis, eu ornare leo nisi vel felis. Mauris consectetur tortor et purus.</p>
+ </div>
+ <div id="tabs-3">
+ <p>Mauris eleifend est et turpis. Duis id erat. Suspendisse potenti. Aliquam vulputate, pede vel vehicula accumsan, mi neque rutrum erat, eu congue orci lorem eget lorem. Vestibulum non ante. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. Fusce sodales. Quisque eu urna vel enim commodo pellentesque. Praesent eu risus hendrerit ligula tempus pretium. Curabitur lorem enim, pretium nec, feugiat nec, luctus a, lacus.</p>
+ <p>Duis cursus. Maecenas ligula eros, blandit nec, pharetra at, semper at, magna. Nullam ac lacus. Nulla facilisi. Praesent viverra justo vitae neque. Praesent blandit adipiscing velit. Suspendisse potenti. Donec mattis, pede vel pharetra blandit, magna ligula faucibus eros, id euismod lacus dolor eget odio. Nam scelerisque. Donec non libero sed nulla mattis commodo. Ut sagittis. Donec nisi lectus, feugiat porttitor, tempor ac, tempor vitae, pede. Aenean vehicula velit eu tellus interdum rutrum. Maecenas commodo. Pellentesque nec elit. Fusce in lacus. Vivamus a libero vitae lectus hendrerit hendrerit.</p>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Click tabs to swap between content that is broken into logical sections.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/tabs/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,25 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Tabs Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ <li><a href="ajax.html">Content via Ajax</a></li>
+ <li><a href="mouseover.html">Open on mouseover</a></li>
+ <li><a href="collapsible.html">Collapse content</a></li>
+ <li><a href="sortable.html">Sortable</a></li>
+ <li><a href="manipulation.html">Simple manipulation</a></li>
+ <li><a href="bottom.html">Tabs below content</a></li>
+ <li><a href="cookie.html">Cookie persistence</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/tabs/manipulation.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,120 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Tabs - Simple manipulation</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.button.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ #dialog label, #dialog input { display:block; }
+ #dialog label { margin-top: 0.5em; }
+ #dialog input, #dialog textarea { width: 95%; }
+ #tabs { margin-top: 1em; }
+ #tabs li .ui-icon-close { float: left; margin: 0.4em 0.2em 0 0; cursor: pointer; }
+ #add_tab { cursor: pointer; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ var $tab_title_input = $('#tab_title'), $tab_content_input = $('#tab_content');
+ var tab_counter = 2;
+
+ // tabs init with a custom tab template and an "add" callback filling in the content
+ var $tabs = $('#tabs').tabs({
+ tabTemplate: '<li><a href="#{href}">#{label}</a> <span class="ui-icon ui-icon-close">Remove Tab</span></li>',
+ add: function(event, ui) {
+ var tab_content = $tab_content_input.val() || 'Tab '+tab_counter+' content.';
+ $(ui.panel).append('<p>'+tab_content+'</p>');
+ }
+ });
+
+ // modal dialog init: custom buttons and a "close" callback reseting the form inside
+ var $dialog = $('#dialog').dialog({
+ autoOpen: false,
+ modal: true,
+ buttons: {
+ 'Add': function() {
+ addTab();
+ $(this).dialog('close');
+ },
+ 'Cancel': function() {
+ $(this).dialog('close');
+ }
+ },
+ open: function() {
+ $tab_title_input.focus();
+ },
+ close: function() {
+ $form[0].reset();
+ }
+ });
+
+ // addTab form: calls addTab function on submit and closes the dialog
+ var $form = $('form',$dialog).submit(function() {
+ addTab();
+ $dialog.dialog('close');
+ return false;
+ });
+
+ // actual addTab function: adds new tab using the title input from the form above
+ function addTab() {
+ var tab_title = $tab_title_input.val() || 'Tab '+tab_counter;
+ $tabs.tabs('add', '#tabs-'+tab_counter, tab_title);
+ tab_counter++;
+ }
+
+ // addTab button: just opens the dialog
+ $('#add_tab')
+ .button()
+ .click(function() {
+ $dialog.dialog('open');
+ });
+
+ // close icon: removing the tab on click
+ // note: closable tabs gonna be an option in the future - see http://dev.jqueryui.com/ticket/3924
+ $('#tabs span.ui-icon-close').live('click', function() {
+ var index = $('li',$tabs).index($(this).parent());
+ $tabs.tabs('remove', index);
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+ <div id="dialog" title="Tab data">
+ <form>
+ <fieldset class="ui-helper-reset">
+ <label for="tab_title">Title</label>
+ <input type="text" name="tab_title" id="tab_title" value="" class="ui-widget-content ui-corner-all" />
+ <label for="tab_content">Content</label>
+ <textarea name="tab_content" id="tab_content" class="ui-widget-content ui-corner-all"></textarea>
+ </fieldset>
+ </form>
+ </div>
+
+ <button id="add_tab">Add Tab</button>
+
+ <div id="tabs">
+ <ul>
+ <li><a href="#tabs-1">Nunc tincidunt</a> <span class="ui-icon ui-icon-close">Remove Tab</span></li>
+ </ul>
+ <div id="tabs-1">
+ <p>Proin elit arcu, rutrum commodo, vehicula tempus, commodo a, risus. Curabitur nec arcu. Donec sollicitudin mi sit amet mauris. Nam elementum quam ullamcorper ante. Etiam aliquet massa et lorem. Mauris dapibus lacus auctor risus. Aenean tempor ullamcorper leo. Vivamus sed magna quis ligula eleifend adipiscing. Duis orci. Aliquam sodales tortor vitae ipsum. Aliquam nulla. Duis aliquam molestie erat. Ut et mauris vel pede varius sollicitudin. Sed ut dolor nec orci tincidunt interdum. Phasellus ipsum. Nunc tristique tempus lectus.</p>
+ </div>
+ </div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+ <p>Simple tabs adding and removing.</p>
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/tabs/mouseover.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,54 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Tabs - Open on mouseover</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#tabs").tabs({
+ event: 'mouseover'
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="tabs">
+ <ul>
+ <li><a href="#tabs-1">Nunc tincidunt</a></li>
+ <li><a href="#tabs-2">Proin dolor</a></li>
+ <li><a href="#tabs-3">Aenean lacinia</a></li>
+ </ul>
+ <div id="tabs-1">
+ <p>Proin elit arcu, rutrum commodo, vehicula tempus, commodo a, risus. Curabitur nec arcu. Donec sollicitudin mi sit amet mauris. Nam elementum quam ullamcorper ante. Etiam aliquet massa et lorem. Mauris dapibus lacus auctor risus. Aenean tempor ullamcorper leo. Vivamus sed magna quis ligula eleifend adipiscing. Duis orci. Aliquam sodales tortor vitae ipsum. Aliquam nulla. Duis aliquam molestie erat. Ut et mauris vel pede varius sollicitudin. Sed ut dolor nec orci tincidunt interdum. Phasellus ipsum. Nunc tristique tempus lectus.</p>
+ </div>
+ <div id="tabs-2">
+ <p>Morbi tincidunt, dui sit amet facilisis feugiat, odio metus gravida ante, ut pharetra massa metus id nunc. Duis scelerisque molestie turpis. Sed fringilla, massa eget luctus malesuada, metus eros molestie lectus, ut tempus eros massa ut dolor. Aenean aliquet fringilla sem. Suspendisse sed ligula in ligula suscipit aliquam. Praesent in eros vestibulum mi adipiscing adipiscing. Morbi facilisis. Curabitur ornare consequat nunc. Aenean vel metus. Ut posuere viverra nulla. Aliquam erat volutpat. Pellentesque convallis. Maecenas feugiat, tellus pellentesque pretium posuere, felis lorem euismod felis, eu ornare leo nisi vel felis. Mauris consectetur tortor et purus.</p>
+ </div>
+ <div id="tabs-3">
+ <p>Mauris eleifend est et turpis. Duis id erat. Suspendisse potenti. Aliquam vulputate, pede vel vehicula accumsan, mi neque rutrum erat, eu congue orci lorem eget lorem. Vestibulum non ante. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. Fusce sodales. Quisque eu urna vel enim commodo pellentesque. Praesent eu risus hendrerit ligula tempus pretium. Curabitur lorem enim, pretium nec, feugiat nec, luctus a, lacus.</p>
+ <p>Duis cursus. Maecenas ligula eros, blandit nec, pharetra at, semper at, magna. Nullam ac lacus. Nulla facilisi. Praesent viverra justo vitae neque. Praesent blandit adipiscing velit. Suspendisse potenti. Donec mattis, pede vel pharetra blandit, magna ligula faucibus eros, id euismod lacus dolor eget odio. Nam scelerisque. Donec non libero sed nulla mattis commodo. Ut sagittis. Donec nisi lectus, feugiat porttitor, tempor ac, tempor vitae, pede. Aenean vehicula velit eu tellus interdum rutrum. Maecenas commodo. Pellentesque nec elit. Fusce in lacus. Vivamus a libero vitae lectus hendrerit hendrerit.</p>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Toggle sections open/closed on mouseover with the <code>event</code> option. The default value for event is "click."</p>
+
+<pre><code>event: 'mouseover'
+</code></pre>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/tabs/sortable.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,65 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Tabs - Sortable</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.mouse.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#tabs").tabs().find(".ui-tabs-nav").sortable({axis:'x'});
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="tabs">
+ <ul>
+ <li><a href="#tabs-1">Nunc tincidunt</a></li>
+ <li><a href="#tabs-2">Proin dolor</a></li>
+ <li><a href="#tabs-3">Aenean lacinia</a></li>
+ </ul>
+ <div id="tabs-1">
+ <p>Proin elit arcu, rutrum commodo, vehicula tempus, commodo a, risus. Curabitur nec arcu. Donec sollicitudin mi sit amet mauris. Nam elementum quam ullamcorper ante. Etiam aliquet massa et lorem. Mauris dapibus lacus auctor risus. Aenean tempor ullamcorper leo. Vivamus sed magna quis ligula eleifend adipiscing. Duis orci. Aliquam sodales tortor vitae ipsum. Aliquam nulla. Duis aliquam molestie erat. Ut et mauris vel pede varius sollicitudin. Sed ut dolor nec orci tincidunt interdum. Phasellus ipsum. Nunc tristique tempus lectus.</p>
+ </div>
+ <div id="tabs-2">
+ <p>Morbi tincidunt, dui sit amet facilisis feugiat, odio metus gravida ante, ut pharetra massa metus id nunc. Duis scelerisque molestie turpis. Sed fringilla, massa eget luctus malesuada, metus eros molestie lectus, ut tempus eros massa ut dolor. Aenean aliquet fringilla sem. Suspendisse sed ligula in ligula suscipit aliquam. Praesent in eros vestibulum mi adipiscing adipiscing. Morbi facilisis. Curabitur ornare consequat nunc. Aenean vel metus. Ut posuere viverra nulla. Aliquam erat volutpat. Pellentesque convallis. Maecenas feugiat, tellus pellentesque pretium posuere, felis lorem euismod felis, eu ornare leo nisi vel felis. Mauris consectetur tortor et purus.</p>
+ </div>
+ <div id="tabs-3">
+ <p>Mauris eleifend est et turpis. Duis id erat. Suspendisse potenti. Aliquam vulputate, pede vel vehicula accumsan, mi neque rutrum erat, eu congue orci lorem eget lorem. Vestibulum non ante. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. Fusce sodales. Quisque eu urna vel enim commodo pellentesque. Praesent eu risus hendrerit ligula tempus pretium. Curabitur lorem enim, pretium nec, feugiat nec, luctus a, lacus.</p>
+ <p>Duis cursus. Maecenas ligula eros, blandit nec, pharetra at, semper at, magna. Nullam ac lacus. Nulla facilisi. Praesent viverra justo vitae neque. Praesent blandit adipiscing velit. Suspendisse potenti. Donec mattis, pede vel pharetra blandit, magna ligula faucibus eros, id euismod lacus dolor eget odio. Nam scelerisque. Donec non libero sed nulla mattis commodo. Ut sagittis. Donec nisi lectus, feugiat porttitor, tempor ac, tempor vitae, pede. Aenean vehicula velit eu tellus interdum rutrum. Maecenas commodo. Pellentesque nec elit. Fusce in lacus. Vivamus a libero vitae lectus hendrerit hendrerit.</p>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>
+Drag the tabs above to re-order them.
+<p>
+
+<p>
+Making tabs sortable is as simple as calling
+
+<code>.sortable()</code>
+
+on the
+
+<code>.ui-tabs-nav</code>
+
+element.
+</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/tabs/vertical.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,64 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Tabs - Vertical Tabs functionality</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.widget.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <script type="text/javascript">
+ $(function() {
+ $("#tabs").tabs().addClass('ui-tabs-vertical ui-helper-clearfix');
+ $("#tabs li").removeClass('ui-corner-top').addClass('ui-corner-left');
+ });
+ </script>
+ <style type="text/css">
+
+/* Vertical Tabs
+----------------------------------*/
+.ui-tabs-vertical { width: 55em; }
+.ui-tabs-vertical .ui-tabs-nav { padding: .2em .1em .2em .2em; float: left; width: 12em; }
+.ui-tabs-vertical .ui-tabs-nav li { clear: left; width: 100%; border-bottom-width: 1px !important; border-right-width: 0 !important; margin: 0 -1px .2em 0; }
+.ui-tabs-vertical .ui-tabs-nav li a { display:block; }
+.ui-tabs-vertical .ui-tabs-nav li.ui-tabs-selected { padding-bottom: 0; padding-right: .1em; border-right-width: 1px; border-right-width: 1px; }
+.ui-tabs-vertical .ui-tabs-panel { padding: 1em; float: right; width: 40em;}
+ </style>
+</head>
+<body>
+
+<div class="demo">
+
+<div id="tabs">
+ <ul>
+ <li><a href="#tabs-1">Nunc tincidunt</a></li>
+ <li><a href="#tabs-2">Proin dolor</a></li>
+ <li><a href="#tabs-3">Aenean lacinia</a></li>
+ </ul>
+ <div id="tabs-1">
+ <h2>Content heading 1</h2>
+ <p>Proin elit arcu, rutrum commodo, vehicula tempus, commodo a, risus. Curabitur nec arcu. Donec sollicitudin mi sit amet mauris. Nam elementum quam ullamcorper ante. Etiam aliquet massa et lorem. Mauris dapibus lacus auctor risus. Aenean tempor ullamcorper leo. Vivamus sed magna quis ligula eleifend adipiscing. Duis orci. Aliquam sodales tortor vitae ipsum. Aliquam nulla. Duis aliquam molestie erat. Ut et mauris vel pede varius sollicitudin. Sed ut dolor nec orci tincidunt interdum. Phasellus ipsum. Nunc tristique tempus lectus.</p>
+ </div>
+ <div id="tabs-2">
+ <h2>Content heading 2</h2>
+ <p>Morbi tincidunt, dui sit amet facilisis feugiat, odio metus gravida ante, ut pharetra massa metus id nunc. Duis scelerisque molestie turpis. Sed fringilla, massa eget luctus malesuada, metus eros molestie lectus, ut tempus eros massa ut dolor. Aenean aliquet fringilla sem. Suspendisse sed ligula in ligula suscipit aliquam. Praesent in eros vestibulum mi adipiscing adipiscing. Morbi facilisis. Curabitur ornare consequat nunc. Aenean vel metus. Ut posuere viverra nulla. Aliquam erat volutpat. Pellentesque convallis. Maecenas feugiat, tellus pellentesque pretium posuere, felis lorem euismod felis, eu ornare leo nisi vel felis. Mauris consectetur tortor et purus.</p>
+ </div>
+ <div id="tabs-3">
+ <h2>Content heading 3</h2>
+ <p>Mauris eleifend est et turpis. Duis id erat. Suspendisse potenti. Aliquam vulputate, pede vel vehicula accumsan, mi neque rutrum erat, eu congue orci lorem eget lorem. Vestibulum non ante. Class aptent taciti sociosqu ad litora torquent per conubia nostra, per inceptos himenaeos. Fusce sodales. Quisque eu urna vel enim commodo pellentesque. Praesent eu risus hendrerit ligula tempus pretium. Curabitur lorem enim, pretium nec, feugiat nec, luctus a, lacus.</p>
+ <p>Duis cursus. Maecenas ligula eros, blandit nec, pharetra at, semper at, magna. Nullam ac lacus. Nulla facilisi. Praesent viverra justo vitae neque. Praesent blandit adipiscing velit. Suspendisse potenti. Donec mattis, pede vel pharetra blandit, magna ligula faucibus eros, id euismod lacus dolor eget odio. Nam scelerisque. Donec non libero sed nulla mattis commodo. Ut sagittis. Donec nisi lectus, feugiat porttitor, tempor ac, tempor vitae, pede. Aenean vehicula velit eu tellus interdum rutrum. Maecenas commodo. Pellentesque nec elit. Fusce in lacus. Vivamus a libero vitae lectus hendrerit hendrerit.</p>
+ </div>
+</div>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Click tabs to swap between content that is broken into logical sections.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/toggle/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,95 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects - Toggle Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.blind.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.bounce.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.clip.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.drop.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.explode.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.fold.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.highlight.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.pulsate.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.scale.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.shake.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.slide.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.transfer.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .toggler { width: 500px; height: 200px; }
+ #button { padding: .5em 1em; text-decoration: none; }
+ #effect { width: 240px; height: 135px; padding: 0.4em; position: relative; }
+ #effect h3 { margin: 0; padding: 0.4em; text-align: center; }
+ .ui-effects-transfer { border: 2px dotted gray; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ //run the currently selected effect
+ function runEffect(){
+ //get effect type from
+ var selectedEffect = $('#effectTypes').val();
+
+ //most effect types need no options passed by default
+ var options = {};
+ //check if it's scale, transfer, or size - they need options explicitly set
+ if(selectedEffect == 'scale'){ options = {percent: 0}; }
+ else if(selectedEffect == 'size'){ options = { to: {width: 200,height: 60} }; }
+
+ //run the effect
+ $("#effect").toggle(selectedEffect,options,500);
+ };
+
+ //set effect from select menu value
+ $("#button").click(function() {
+ runEffect();
+ return false;
+ });
+
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="toggler">
+ <div id="effect" class="ui-widget-content ui-corner-all">
+ <h3 class="ui-widget-header ui-corner-all">Toggle</h3>
+ <p>
+ Etiam libero neque, luctus a, eleifend nec, semper at, lorem. Sed pede. Nulla lorem metus, adipiscing ut, luctus sed, hendrerit vitae, mi.
+ </p>
+ </div>
+</div>
+
+<select name="effects" id="effectTypes">
+ <option value="blind">Blind</option>
+ <option value="bounce">Bounce</option>
+ <option value="clip">Clip</option>
+ <option value="drop">Drop</option>
+ <option value="explode">Explode</option>
+ <option value="fold">Fold</option>
+ <option value="highlight">Highlight</option>
+ <option value="puff">Puff</option>
+ <option value="pulsate">Pulsate</option>
+ <option value="scale">Scale</option>
+ <option value="shake">Shake</option>
+ <option value="size">Size</option>
+ <option value="slide">Slide</option>
+ <option value="transfer">Transfer</option>
+</select>
+
+<a href="#" id="button" class="ui-state-default ui-corner-all">Run Effect</a>
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Click the button above to preview the effect.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/toggle/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,18 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/toggleClass/default.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,46 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects - toggleClass Demo</title>
+ <link type="text/css" href="../../themes/base/jquery.ui.all.css" rel="stylesheet" />
+ <script type="text/javascript" src="../../jquery-1.4.2.js"></script>
+ <script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+ <style type="text/css">
+ .toggler { width: 500px; height: 200px; position: relative;}
+ #button { padding: .5em 1em; text-decoration: none; }
+ #effect {position: relative; width: 240px; padding: 1em; letter-spacing: 0; font-size: 1.2em; border: 1px solid #000; background: #eee; color: #333; }
+ #effect.newClass { text-indent: 40px; letter-spacing: .4em; width: 410px; height: 100px; padding: 30px; margin: 10px; font-size: 1.6em; }
+ </style>
+ <script type="text/javascript">
+ $(function() {
+ $("#button").click(function() {
+ $('#effect').toggleClass('newClass', 1000);
+ return false;
+ });
+ });
+ </script>
+</head>
+<body>
+
+<div class="demo">
+
+<div class="toggler">
+ <div id="effect" class="newClass ui-corner-all">
+ Etiam libero neque, luctus a, eleifend nec, semper at, lorem. Sed pede.
+ </div>
+</div>
+
+<a href="#" id="button" class="ui-state-default ui-corner-all">Run Effect</a>
+
+</div><!-- End demo -->
+
+<div class="demo-description">
+
+<p>Click the button above to preview the effect.</p>
+
+</div><!-- End demo-description -->
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/demos/toggleClass/index.html Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,18 @@
+<!DOCTYPE html>
+<html lang="en">
+<head>
+ <meta charset="UTF-8" />
+ <title>jQuery UI Effects Demos</title>
+ <link type="text/css" href="../demos.css" rel="stylesheet" />
+</head>
+<body>
+
+<div class="demos-nav">
+ <h4>Examples</h4>
+ <ul>
+ <li class="demo-config-on"><a href="default.html">Default functionality</a></li>
+ </ul>
+</div>
+
+</body>
+</html>
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/jscontrolbar.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,7 @@
+.ui-slider-horizontal .ui-slider-handle {
+ margin-left:-1px;
+}
+
+.ui-slider .ui-slider-handle {
+ width:1px;
+}
\ No newline at end of file
Binary file web/static/css/jq-css/themes/base/images/ui-anim_basic_16x16.gif has changed
Binary file web/static/css/jq-css/themes/base/images/ui-bg_flat_0_aaaaaa_40x100.png has changed
Binary file web/static/css/jq-css/themes/base/images/ui-bg_flat_75_ffffff_40x100.png has changed
Binary file web/static/css/jq-css/themes/base/images/ui-bg_glass_55_fbf9ee_1x400.png has changed
Binary file web/static/css/jq-css/themes/base/images/ui-bg_glass_65_ffffff_1x400.png has changed
Binary file web/static/css/jq-css/themes/base/images/ui-bg_glass_75_dadada_1x400.png has changed
Binary file web/static/css/jq-css/themes/base/images/ui-bg_glass_75_e6e6e6_1x400.png has changed
Binary file web/static/css/jq-css/themes/base/images/ui-bg_glass_95_fef1ec_1x400.png has changed
Binary file web/static/css/jq-css/themes/base/images/ui-bg_highlight-soft_75_cccccc_1x100.png has changed
Binary file web/static/css/jq-css/themes/base/images/ui-icons_222222_256x240.png has changed
Binary file web/static/css/jq-css/themes/base/images/ui-icons_2e83ff_256x240.png has changed
Binary file web/static/css/jq-css/themes/base/images/ui-icons_454545_256x240.png has changed
Binary file web/static/css/jq-css/themes/base/images/ui-icons_888888_256x240.png has changed
Binary file web/static/css/jq-css/themes/base/images/ui-icons_cd0a0a_256x240.png has changed
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/base/jquery.ui.accordion.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,12 @@
+/* Accordion
+----------------------------------*/
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+/* IE7-/Win - Fix extra vertical space in lists */
+.ui-accordion a { zoom: 1; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/base/jquery.ui.all.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,2 @@
+@import "jquery.ui.base.css";
+@import "jquery.ui.theme.css";
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/base/jquery.ui.autocomplete.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,39 @@
+/* Autocomplete
+----------------------------------*/
+.ui-autocomplete { position: absolute; cursor: default; }
+.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/* Menu
+----------------------------------*/
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/base/jquery.ui.base.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,10 @@
+@import url("jquery.ui.core.css");
+@import url("jquery.ui.resizable.css");
+@import url("jquery.ui.accordion.css");
+@import url("jquery.ui.autocomplete.css");
+@import url("jquery.ui.button.css");
+@import url("jquery.ui.dialog.css");
+@import url("jquery.ui.slider.css");
+@import url("jquery.ui.tabs.css");
+@import url("jquery.ui.datepicker.css");
+@import url("jquery.ui.progressbar.css");
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/base/jquery.ui.button.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,35 @@
+/* Button
+----------------------------------*/
+
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+
+
+
+
+
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/base/jquery.ui.core.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,37 @@
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/base/jquery.ui.datepicker.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,61 @@
+/* Datepicker
+----------------------------------*/
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/base/jquery.ui.dialog.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,13 @@
+/* Dialog
+----------------------------------*/
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/base/jquery.ui.progressbar.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,4 @@
+/* Progressbar
+----------------------------------*/
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/base/jquery.ui.resizable.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,13 @@
+/* Resizable
+----------------------------------*/
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/base/jquery.ui.slider.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,17 @@
+/* Slider
+----------------------------------*/
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/base/jquery.ui.tabs.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,11 @@
+/* Tabs
+----------------------------------*/
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/base/jquery.ui.theme.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,247 @@
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* To view and modify this theme, visit http://jqueryui.com/themeroller/
+*/
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; }
+.ui-widget-content a { color: #222222/*{fcContent}*/; }
+.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; }
+.ui-widget-header a { color: #222222/*{fcHeader}*/; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-top { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-right { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-left { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-all { -moz-border-radius: 4px/*{cornerRadius}*/; -webkit-border-radius: 4px/*{cornerRadius}*/; border-radius: 4px/*{cornerRadius}*/; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; }
+.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; }
\ No newline at end of file
Binary file web/static/css/jq-css/themes/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png has changed
Binary file web/static/css/jq-css/themes/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png has changed
Binary file web/static/css/jq-css/themes/ui-lightness/images/ui-bg_flat_10_000000_40x100.png has changed
Binary file web/static/css/jq-css/themes/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png has changed
Binary file web/static/css/jq-css/themes/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png has changed
Binary file web/static/css/jq-css/themes/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png has changed
Binary file web/static/css/jq-css/themes/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png has changed
Binary file web/static/css/jq-css/themes/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png has changed
Binary file web/static/css/jq-css/themes/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png has changed
Binary file web/static/css/jq-css/themes/ui-lightness/images/ui-icons_222222_256x240.png has changed
Binary file web/static/css/jq-css/themes/ui-lightness/images/ui-icons_228ef1_256x240.png has changed
Binary file web/static/css/jq-css/themes/ui-lightness/images/ui-icons_ef8c08_256x240.png has changed
Binary file web/static/css/jq-css/themes/ui-lightness/images/ui-icons_ffd27a_256x240.png has changed
Binary file web/static/css/jq-css/themes/ui-lightness/images/ui-icons_ffffff_256x240.png has changed
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/ui-lightness/jquery-ui-1.8.1.custom.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,486 @@
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px
+*/
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; }
+.ui-widget-content a { color: #333333; }
+.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+.ui-widget-header a { color: #ffffff; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); }
+.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }/* Resizable
+----------------------------------*/
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* Accordion
+----------------------------------*/
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+/* IE7-/Win - Fix extra vertical space in lists */
+.ui-accordion a { zoom: 1; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }/* Autocomplete
+----------------------------------*/
+.ui-autocomplete { position: absolute; cursor: default; }
+.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/* Menu
+----------------------------------*/
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
+/* Button
+----------------------------------*/
+
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+
+
+
+
+
+/* Dialog
+----------------------------------*/
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/* Slider
+----------------------------------*/
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/* Tabs
+----------------------------------*/
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
+/* Datepicker
+----------------------------------*/
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/* Progressbar
+----------------------------------*/
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/ui-lightness/jquery.ui.accordion.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,12 @@
+/* Accordion
+----------------------------------*/
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+/* IE7-/Win - Fix extra vertical space in lists */
+.ui-accordion a { zoom: 1; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/ui-lightness/jquery.ui.all.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,2 @@
+@import "jquery.ui.base.css";
+@import "jquery.ui.theme.css";
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/ui-lightness/jquery.ui.autocomplete.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,39 @@
+/* Autocomplete
+----------------------------------*/
+.ui-autocomplete { position: absolute; cursor: default; }
+.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/* Menu
+----------------------------------*/
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/ui-lightness/jquery.ui.base.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,10 @@
+@import url("jquery.ui.core.css");
+@import url("jquery.ui.resizable.css");
+@import url("jquery.ui.accordion.css");
+@import url("jquery.ui.autocomplete.css");
+@import url("jquery.ui.button.css");
+@import url("jquery.ui.dialog.css");
+@import url("jquery.ui.slider.css");
+@import url("jquery.ui.tabs.css");
+@import url("jquery.ui.datepicker.css");
+@import url("jquery.ui.progressbar.css");
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/ui-lightness/jquery.ui.button.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,35 @@
+/* Button
+----------------------------------*/
+
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+
+
+
+
+
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/ui-lightness/jquery.ui.core.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,37 @@
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/ui-lightness/jquery.ui.datepicker.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,61 @@
+/* Datepicker
+----------------------------------*/
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/ui-lightness/jquery.ui.dialog.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,13 @@
+/* Dialog
+----------------------------------*/
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/ui-lightness/jquery.ui.progressbar.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,4 @@
+/* Progressbar
+----------------------------------*/
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/ui-lightness/jquery.ui.resizable.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,13 @@
+/* Resizable
+----------------------------------*/
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/ui-lightness/jquery.ui.slider.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,17 @@
+/* Slider
+----------------------------------*/
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/ui-lightness/jquery.ui.tabs.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,11 @@
+/* Tabs
+----------------------------------*/
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/themes/ui-lightness/jquery.ui.theme.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,249 @@
+
+
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px
+*/
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; }
+.ui-widget-content a { color: #333333; }
+.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+.ui-widget-header a { color: #ffffff; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); }
+.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }
\ No newline at end of file
Binary file web/static/css/jq-css/tooltip/black.png has changed
Binary file web/static/css/jq-css/tooltip/black_arrow.png has changed
Binary file web/static/css/jq-css/tooltip/black_arrow_big.png has changed
Binary file web/static/css/jq-css/tooltip/black_big.png has changed
Binary file web/static/css/jq-css/tooltip/white.png has changed
Binary file web/static/css/jq-css/tooltip/white_arrow.png has changed
Binary file web/static/css/jq-css/tooltip/white_arrow_big.png has changed
Binary file web/static/css/jq-css/tooltip/white_big.png has changed
Binary file web/static/css/jq-css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png has changed
Binary file web/static/css/jq-css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png has changed
Binary file web/static/css/jq-css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png has changed
Binary file web/static/css/jq-css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png has changed
Binary file web/static/css/jq-css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png has changed
Binary file web/static/css/jq-css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png has changed
Binary file web/static/css/jq-css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png has changed
Binary file web/static/css/jq-css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png has changed
Binary file web/static/css/jq-css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png has changed
Binary file web/static/css/jq-css/ui-lightness/images/ui-icons_222222_256x240.png has changed
Binary file web/static/css/jq-css/ui-lightness/images/ui-icons_228ef1_256x240.png has changed
Binary file web/static/css/jq-css/ui-lightness/images/ui-icons_ef8c08_256x240.png has changed
Binary file web/static/css/jq-css/ui-lightness/images/ui-icons_ffd27a_256x240.png has changed
Binary file web/static/css/jq-css/ui-lightness/images/ui-icons_ffffff_256x240.png has changed
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/css/jq-css/ui-lightness/jquery-ui-1.8.1.custom.css Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,486 @@
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+*/
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+* jQuery UI CSS Framework
+* Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+* Dual licensed under the MIT (MIT-LICENSE.txt) and GPL (GPL-LICENSE.txt) licenses.
+* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px
+*/
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; }
+.ui-widget-content a { color: #333333; }
+.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+.ui-widget-header a { color: #ffffff; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); }
+.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }/* Resizable
+----------------------------------*/
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* Accordion
+----------------------------------*/
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+/* IE7-/Win - Fix extra vertical space in lists */
+.ui-accordion a { zoom: 1; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }/* Autocomplete
+----------------------------------*/
+.ui-autocomplete { position: absolute; cursor: default; }
+.ui-autocomplete-loading { background: white url('images/ui-anim_basic_16x16.gif') right center no-repeat; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/* Menu
+----------------------------------*/
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
+/* Button
+----------------------------------*/
+
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+
+
+
+
+
+/* Dialog
+----------------------------------*/
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane button { float: right; margin: .5em .4em .5em 0; cursor: pointer; padding: .2em .6em .3em .6em; line-height: 1.4em; width:auto; overflow:visible; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/* Slider
+----------------------------------*/
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/* Tabs
+----------------------------------*/
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
+/* Datepicker
+----------------------------------*/
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/* Progressbar
+----------------------------------*/
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file
--- a/web/static/css/workspace.css Fri Jun 11 00:25:17 2010 +0200
+++ b/web/static/css/workspace.css Sat Jun 12 00:33:37 2010 +0200
@@ -13,3 +13,13 @@
#projectsdiv table {
border: 1px solid black;
}
+
+.ldt_player_code {
+ width: 580px;
+ overflow: auto;
+ border-style: inset;
+ border: 1px solid silver;
+ margin: 10px 5px;
+ padding: 2px;
+}
+
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/LdtPlayer.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,529 @@
+/* ----------------------------------------------------------------
+ ----------------------------------------------------------------
+ ----------------------------------------------------------------
+
+ LDTPlayer is created by http://www.iri.centrepompidou.fr
+ 2010-06-10
+
+ Initiated By Samuel Huron < samuel.huron (at) cybunk (dot) com
+ this version is the 0.06
+
+ ----------------------------------------------------------------
+*/
+
+
+
+
+/* ----------------------------------------------------------------
+ ----------------------------------------------------------------
+ INTERFACE : SLIDER ( CONTROL BAR ) | BUTTON () */
+
+
+ function createInterface (width,height,duration){
+ $jIRI(function() {
+
+ $jIRI("#Annotations").width(width-(78*2));
+ $jIRI("#ShowAnnotation").width(width-10);
+ $jIRI("#controlerLdt").width(width);
+ $jIRI("#Ldtplayer1").attr("z-index","100");
+
+ $jIRI("#ShowAnnotation").click(function () {
+ $jIRI(this).slideUp();
+ });
+
+ var LdtpPlayerY = $jIRI("#ldtPlaceHolder").attr("top");
+ var LdtpPlayerX = $jIRI("#ldtPlaceHolder").attr("left");
+
+ //alert(LdtpPlayerY+" | "+LdtpPlayerX);
+ //$jIRI("#ShowAnnotation").attr("position","absolute");
+ /*$jIRI("#ShowAnnotation").attr("top",0);
+ $jIRI("#ShowAnnotation").attr("left",0);*/
+
+ //$jIRI("#slider-range-min").roll
+ $jIRI("#slider-range-min").slider({ //range: "min",
+ value: 0,
+ min: 1,
+ max: duration/1000,//1:54:52.66 = 3600+3240+
+ step: 0.1,
+ slide: function(event, ui) {
+
+ //$jIRI("#amount").val(ui.value+" s");
+ player.sendEvent('SEEK', ui.value)
+ //player.sendEvent('PAUSE')
+ }
+ });
+ $jIRI("#amount").val($jIRI("#slider-range-min").slider("value")+" s");
+
+ $jIRI(".ldtControl1 button:first").button({
+ icons: {
+ primary: 'ui-icon-play'
+ },
+ text: false
+ }).next().button({
+ icons: {
+ primary: 'ui-icon-seek-next'
+ },
+ text: false
+ });
+
+ $jIRI(".ldtControl2 button:first").button({
+ icons: {
+ primary: 'ui-icon-newwin'//,
+ //secondary: 'ui-icon-volume-off'
+ },
+ text: false
+ }).next().button({
+ icons: {
+ primary: 'ui-icon-volume-on'
+ },
+ text: false
+ });
+
+ });
+ }
+
+/* ----------------------------------------------------------------
+ ----------------------------------------------------------------
+ CREER JW PLAYER creation + listener */
+
+
+ var currentPosition = 0;
+ var currentVolume = 50;
+ var player = null;
+
+ function playerReady(thePlayer) {
+ //alert("ready");
+ player = window.document[thePlayer.id];
+ addListeners();
+ }
+
+ function addListeners() {
+ if (player) {
+ player.addModelListener("TIME", "positionListener");
+ player.addControllerListener("VOLUME", "volumeListener");
+ player.addPlayPauseListener("PLAY", "state");
+ } else {
+ setTimeout("addListeners()",100);
+ }
+
+ // et changer les boutons
+ }
+
+ //function
+
+ function addPlayPauseListener(obj) {
+ if(obj){
+ $jIRI(".control1 button:first").button({
+ icons: {
+ primary: 'ui-icon-pause'
+ },
+ text: false
+ });
+ }else{
+ $jIRI(".control1 button:first").button({
+ icons: {
+ primary: 'ui-icon-play'
+ },
+ text: false
+ });
+ }
+ }
+
+ function positionListener(obj) {
+ currentPosition = obj.position;
+ var tmp = document.getElementById("posit");
+ if (tmp) { tmp.innerHTML = "position: " + currentPosition; }
+ $jIRI("#slider-range-min").slider("value", obj.position);
+ $jIRI("#amount").val(obj.position+" s");
+ // afficher annotation
+
+ MyLdt.checkTime(currentPosition);
+ }
+
+ function volumeListener(obj) {
+ currentVolume = obj.percentage;
+ var tmp = document.getElementById("vol");
+ if (tmp) { tmp.innerHTML = "volume: " + currentVolume; }
+ }
+
+ function createPlayer(width,height,url, playerUrl) {
+
+ myUrlFragment = url.split("/");
+ //
+ file = myUrlFragment[myUrlFragment.length-3]+"/"+myUrlFragment[myUrlFragment.length-2]+"/"+myUrlFragment[myUrlFragment.length-1];
+ indexofff = url.lastIndexOf(file);
+ streamer = url.substr(0,indexofff);
+ alert(url+"="+streamer+" - "+file);
+
+ var flashvars = {
+ streamer:streamer,
+ file:file,
+ //live:"true",
+ autostart:"true",
+ controlbar:"none"
+ }
+
+ var params = {
+ allowfullscreen:"true",
+ allowscriptaccess:"always",
+ wmode:"transparent"
+ }
+
+ var attributes = {
+ id:"Ldtplayer1",
+ name:"Ldtplayer1"
+ }
+
+ swfobject.embedSWF(playerUrl, "ldtPlaceHolder", width, height, "9.0.115", false, flashvars, params, attributes);
+ }
+
+
+
+
+
+
+/* ----------------------------------------------------------------
+ ----------------------------------------------------------------
+
+LOAD JSON AND PARSE IT
+*/
+
+
+ var MyLdt;
+ var Durration;
+ var playerLdtWidth;
+ var playerLdtHeight;
+
+ function loadJson (width,height,urlJson){
+
+ playerLdtWidth=width;
+ playerLdtHeight=height;
+
+ $jIRI.ajax({
+ dataType: 'jsonp',
+ url:urlJson,
+ success: function(json){
+
+ //alert("success !");
+
+
+ }
+ ,error: function(data){
+ alert("ERROR : "+data);
+ }
+ });
+ }
+
+ function callbackLdts(json){
+ /* START PARSING ----------------------- */
+ /* metas , medias , annotation-types , annotations , lists , tags , views */
+ /* # fonction avec 1 seul media et 1 seul annotation type code a cleaner */
+ /* # cr�er le player */
+ //$jIRI.each(json.medias, function(i,item) {
+ //});
+ $jIRI("<div></div>").appendTo("#output");
+ MyMedia = new Media(json.medias[0].id,json.medias[0].url,json.medias[0]["dc:duration"],json.medias[0]['dc:title'],json.medias[0]['dc:description']);
+ MyMedia.createPlayer(playerLdtWidth,playerLdtHeight);
+
+ /* # cr�er lignes */
+ /*$jIRI.each(json['annotation-types'], function(i,item) {
+ });*/
+ MyLdt = new Ligne (json['annotation-types'][0].id,json['annotation-types'][0]['dc:title'],json['annotation-types'][0]['dc:description'],json.medias[0]["dc:duration"]);
+ //alert("duration : "+json.medias[0]["dc:duration"]);
+
+ /* # cr�er les annotations */
+ $jIRI.each(json.annotations, function(i,item) {
+
+ MyLdt.addAnnotation(
+ item.id,
+ item.begin,
+ item.end,
+ item.media,
+ item.content.title,
+ item.content.description,
+ item.content.color);
+
+ });
+ $jIRI.each(json.lists, function(i,item) {
+ trace("lists","");
+ });
+ $jIRI.each(json.tags, function(i,item) {
+ trace("tags","");
+ });
+ $jIRI.each(json.views, function(i,item) {
+ trace("views","");
+ });
+ /* END PARSING ----------------------- */
+
+ }
+
+ function trace (msg,value){
+ $jIRI("<div>"+msg+" : "+value+"</div>").appendTo("#output");
+ }
+
+
+
+
+/* ----------------------------------------------------------------
+ ----------------------------------------------------------------
+INIT player LDT
+*/
+
+ function playerLdt (width,height,file,divId){
+
+ //$jIRI("#playerLdt").append("<div id=\"div1\">hello</div>");
+
+
+ $jIRI("#"+divId).append("<div id=\"ldtShow\">\n <div id=\"ShowAnnotation\" class=\"demo\" >\n <div id=\"ldtSaTitle\"></div>\n <div id=\"ldtSaDescription\"></div>\n </div> <div id=\"ldtPlaceHolder\">\n <a href=\"http://www.adobe.com/go/getflashplayer\">Get flash</a> to see this player \n </div>\n </div>\n <div id=\"controlerLdt\" class=\"demo\">\n <div class=\"ldtControl1\" >\n <button id=\"ldtCtrlPlay\" onclick=\"player.sendEvent('PLAY')\">Play</button>\n <button id=\"ldtCtrlNext\" onclick=\"player.sendEvent('SEEK', currentPosition+10)\">next</button>\n </div>\n <div id=\"Annotations\" class=\"ui-slider\">\n <div id=\"slider-range-min\"></div>\n </div>\n <div class=\"ldtControl2\">\n <button id=\"ldtCtrlScreen\" onclick=\"player.fullscreen('true')\">Enlarge</button>\n <button id=\"ldtCtrlSound\" onclick=\"player.sendEvent('MUTE')\">Sound</button>\n </div>\n </div>");
+ loadJson(width,height,file);
+ }
+
+
+
+
+
+/* ----------------------------------------------------------------
+ ----------------------------------------------------------------
+ API player */
+
+
+ function APIplayer (){
+
+ }
+
+
+
+/* ----------------------------------------------------------------
+ ----------------------------------------------------------------
+ Class Media
+
+
+ "http://advene.liris.cnrs.fr/ns/frame_of_reference/ms":"o=0",
+ "id":"kia_closeup",
+ "url":"D:/Thibaut/Outils_techno/IRI-LignesDeTemps/media/video/kia_closeup_BQ.flv",
+ "dc:creator":"tcavalie",
+ "dc:created":"2010-05-04T00:00:00",
+ "dc:contributor":"tcavalie",
+ "dc:modified":"2010-05-04T00:00:00",
+ "dc:creator.contents":"Abbas Kiarostami",
+ "dc:created.contents":"1990",
+ "dc:title":"Close Up is a very very long title",
+ "dc:description":"Analyse de Close Up",
+ "dc:duration":"689266"
+ */
+ function Media (id,url,duration,title,description){
+ this.id = id;
+ this.url = url;
+ this.title = title;
+ this.description = description;
+ this.duration = duration;
+
+ this.lignes = new Array();
+ this.updatePlayer = updatePlayerMedia;
+ this.getDuration = getMediaDuration;
+ this.createPlayer = createPlayerMedia;
+
+ trace("Media ID :",id);
+ trace("Media URL :",this.url);
+ trace("- content : color",url);
+ trace("- content : audio",title);
+ }
+ function createPlayerMedia(width,height){
+ createPlayer(width,height,this.url,this.duration);
+ createInterface(width,height,this.duration);
+ }
+ function updatePlayerMedia(){
+
+ }
+ function getMediaDuration(){
+ return (this.duration);
+ }
+ function getMediaTitle(){
+ return (this.title);
+ }
+
+
+/* ----------------------------------------------------------------
+ ----------------------------------------------------------------
+ Class Ligne (annotationType)
+
+ "id":"dp_1",
+ "dc:creator":"tcavalie",
+ "dc:created":"2010-04-04T19:09:44",
+ "dc:contributor":"perso",
+ "dc:modified":"15/2/2008",
+ "dc:title":"dqsdkljfh qklsdhf very very very long",
+ "dc:description":"sdfg sdfg sdfg sdfg"
+ */
+ function Ligne (){
+ this.id = id;
+ this.title = title;
+ this.description = description;
+ this.annotations = new Array();
+ this.addAnnotation = addAnnotationligne;
+ this.clickAnnotation= onClickLigneAnnotation;
+ this.checkTime = checkTimeLigne;
+ }
+
+ function Ligne (id,title,description,duration){
+ this.id = id;
+ this.title = title;
+ this.description = description;
+ //
+ this.annotations = new Array();
+ this.addAnnotation = addLigneAnnotation;
+ this.checkTime = checkTimeLigne;
+ this.duration = duration;
+ trace("LIGNE ","cr�er ");
+ }
+
+ function addLigneAnnotation(id,begin,end,media,title,description,color){
+ var myAnnotation = new Annotation(id,begin,end,media,title,description,color,this.duration);
+ this.annotations.push(myAnnotation);
+ trace("LIGNE ","add annotation ");
+ }
+
+ function onClickLigneAnnotation(id){
+ player.sendEvent('SEEK', this.start);
+ }
+
+ function searchLigneAnnotation(id){
+ /*for (){
+ }*/
+ }
+
+ function listAnnotations(){
+
+ }
+
+ function checkTimeLigne(time){
+ var annotationTempo;
+ for (var i=0; i < this.annotations.length; ++i){
+ var annotationTempo = this.annotations[i];
+ //trace("check... ",time+" = "+annotationTempo.begin+" -- "+annotationTempo.end);
+ //if (time>annotationTempo.begin){
+ if (time>annotationTempo.begin/1000 && time<annotationTempo.end/1000){
+ //trace("check ",annotationTempo.begin+" "+annotationTempo.end +" "+annotationTempo.title);
+ $jIRI("#ldtSaTitle").text(annotationTempo.title);
+ $jIRI("#ldtSaDescription").text(annotationTempo.description);
+ break;
+ }
+ }
+ }
+
+
+
+/* ----------------------------------------------------------------
+ ----------------------------------------------------------------
+ CLASSE Annotation
+
+
+ "begin":"767",
+ "end":"785",
+ "id":"dp_1_sp_3",
+ "media":"kia_closeup",
+ "content": {
+ "mimetype":"application/x-ldt-structured",
+ "title":"mon titre",
+ "description":"ma description en <b>gras</b> .",
+ "color":"16763904",
+ "audio":{"src":"","mimetype":"audio/mp3","href":""}
+ },
+ "meta":
+ {
+ "id-ref":"dp_1",
+ "dc:creator":"tcavalie",
+ "dc:created":"2010-04-04T19:09:44",
+ "dc:contributor":"perso",
+ "dc:modified":"9/10/2007"
+ }
+ */
+
+ function Annotation (){
+ this.id = null;
+ this.begin = null;
+ this.end = null;
+ this.media = null;
+ this.description = null;
+ this.title = null;
+ this.color = null;
+ this.onRollOver = onRollOverAnnotation;
+ this.onClick = onClickAnnotation;
+ this.toolTip = rollOverAnnotation;
+ this.draw = drawAnnotation;
+ trace("annotation ","r�ussi")
+ }
+
+ function Annotation (id,begin,end,media,title,description,color,duration){
+ this.id = id;
+ this.begin = begin;
+ this.end = end;
+ this.media = media;
+ this.description = description;
+ this.title = title;
+ this.color = title;
+ this.duration = duration;
+ //
+ this.onRollOver = onRollOverAnnotation;
+ //this.onClick = onClickAnnotation;
+ this.toolTip = tootTipAnnotation;
+ this.draw = drawAnnotation;
+ //this.show = showAnnotationNotice;
+ // draw it
+ this.draw();
+
+ //
+ trace("Annotation created : ",id);
+ }
+
+ function drawAnnotation (){
+ //alert (this.duration);
+ startPourcent = timeToPourcent(this.begin,this.duration); // temps du m�dia
+ endPourcent = timeToPourcent(this.end,this.duration)-startPourcent;
+
+ $AnnotationTemplate = "<div title='"+this.title+"' id='"+this.id+"' class='ui-slider-range ui-slider-range-min ui-widget-header iri-chapter' width='100%' style='left:"+startPourcent+"%; width:"+endPourcent+"%; padding-top:15px; border-left:solid 1px #aaaaaa; border-right:solid 1px #aaaaaa;' onclick=\"player.sendEvent('SEEK', '"+Math.round(this.begin/1000)+"');$jIRI('#ShowAnnotation').slideDown().delay(5000).slideUp();\" ></div> ";
+
+
+
+ $toolTipTemplate = "<div class='tooltip'>"
+ +"<div class='title'>"+this.title+"</div>"
+ +"<div class='time'>"+this.begin+" : "+this.end+"</div>"
+ +"<div class='description'>"+this.description+"</div>"
+ +"</div>";
+
+
+ $jIRI("<div>"+$AnnotationTemplate+"</div>").appendTo("#Annotations");
+ $jIRI("#"+this.id).tooltip({ effect: 'slide'});
+
+ trace(" ### ","ADD ANOTATION : "+this.begin+" "+this.end+" "+this.title+" | "+startPourcent+" | "+endPourcent+" | duration = "+this.duration);
+ }
+
+ function tootTipAnnotation() {
+ // 1 chercher le div correspondant
+ // 2 y mettre les information
+ return this.color + ' ' + this.type + ' apple';
+ }
+
+ function onRollOverAnnotation(){
+ this.tootTip();
+ }
+
+ function timeToPourcent(time,timetotal){
+ return (parseInt(Math.round(time/timetotal*100)));
+ }
+
+
+/* ----------------------------------------------------------------
+ ----------------------------------------------------------------
+ Class tracess */
+
+ function Tracer (){
+
+ }
+
+ function addTrace(){
+
+ }
+
+
+
\ No newline at end of file
--- a/web/static/js/jquery.DOMWindow.js Fri Jun 11 00:25:17 2010 +0200
+++ /dev/null Thu Jan 01 00:00:00 1970 +0000
@@ -1,369 +0,0 @@
-(function($){
-
- //closeDOMWindow
- $.fn.closeDOMWindow = function(settings){
-
- if(!settings){settings={};}
-
- var run = function(passingThis){
-
- if(settings.anchoredClassName){
- var $anchorClassName = $('.'+settings.anchoredClassName);
- $anchorClassName.fadeOut('fast',function(){
- if($.fn.draggable){
- $anchorClassName.draggable('destory').trigger("unload").remove();
- }else{
- $anchorClassName.trigger("unload").remove();
- }
- });
- if(settings.functionCallOnClose){settings.functionCallAfterClose();}
- }else{
- var $DOMWindowOverlay = $('#DOMWindowOverlay');
- var $DOMWindow = $('#DOMWindow');
- $DOMWindowOverlay.fadeOut('fast',function(){
- $DOMWindowOverlay.trigger('unload').unbind().remove();
- });
- $DOMWindow.fadeOut('fast',function(){
- if($.fn.draggable){
- $DOMWindow.draggable("destroy").trigger("unload").remove();
- }else{
- $DOMWindow.trigger("unload").remove();
- }
- });
-
- $(window).unbind('scroll.DOMWindow');
- $(window).unbind('resize.DOMWindow');
-
- if($.fn.openDOMWindow.isIE6){$('#DOMWindowIE6FixIframe').remove();}
- if(settings.functionCallOnClose){settings.functionCallAfterClose();}
- }
- };
-
- if(settings.eventType){//if used with $().
- return this.each(function(index){
- $(this).bind(settings.eventType, function(){
- run(this);
- return false;
- });
- });
- }else{//else called as $.function
- run();
- }
-
- };
-
- //allow for public call, pass settings
- $.closeDOMWindow = function(s){$.fn.closeDOMWindow(s);};
-
- //openDOMWindow
- $.fn.openDOMWindow = function(instanceSettings){
-
- var shortcut = $.fn.openDOMWindow;
-
- //default settings combined with callerSettings////////////////////////////////////////////////////////////////////////
-
- shortcut.defaultsSettings = {
- anchoredClassName:'',
- anchoredSelector:'',
- borderColor:'#ccc',
- borderSize:'4',
- draggable:0,
- eventType:null, //click, blur, change, dblclick, error, focus, load, mousedown, mouseout, mouseup etc...
- fixedWindowY:100,
- functionCallOnOpen:null,
- functionCallOnClose:null,
- height:500,
- loader:0,
- loaderHeight:0,
- loaderImagePath:'',
- loaderWidth:0,
- modal:0,
- overlay:1,
- overlayColor:'#000',
- overlayOpacity:'85',
- positionLeft:0,
- positionTop:0,
- positionType:'centered', // centered, anchored, absolute, fixed
- width:500,
- windowBGColor:'#fff',
- windowBGImage:null, // http path
- windowHTTPType:'get',
- windowPadding:10,
- windowSource:'inline', //inline, ajax, iframe
- windowSourceID:'',
- windowSourceURL:'',
- windowSourceAttrURL:'href'
- };
-
- var settings = $.extend({}, $.fn.openDOMWindow.defaultsSettings , instanceSettings || {});
-
- //Public functions
-
- shortcut.viewPortHeight = function(){ return self.innerHeight || document.documentElement.clientHeight || document.body.clientHeight;};
- shortcut.viewPortWidth = function(){ return self.innerWidth || document.documentElement.clientWidth || document.body.clientWidth;};
- shortcut.scrollOffsetHeight = function(){ return self.pageYOffset || document.documentElement.scrollTop || document.body.scrollTop;};
- shortcut.scrollOffsetWidth = function(){ return self.pageXOffset || document.documentElement.scrollLeft || document.body.scrollLeft;};
- shortcut.isIE6 = typeof document.body.style.maxHeight === "undefined";
-
- //Private Functions/////////////////////////////////////////////////////////////////////////////////////////////////////////
-
- var sizeOverlay = function(){
- var $DOMWindowOverlay = $('#DOMWindowOverlay');
- if(shortcut.isIE6){//if IE 6
- var overlayViewportHeight = document.documentElement.offsetHeight + document.documentElement.scrollTop - 4;
- var overlayViewportWidth = document.documentElement.offsetWidth - 21;
- $DOMWindowOverlay.css({'height':overlayViewportHeight +'px','width':overlayViewportWidth+'px'});
- }else{//else Firefox, safari, opera, IE 7+
- $DOMWindowOverlay.css({'height':'100%','width':'100%','position':'fixed'});
- }
- };
-
- var sizeIE6Iframe = function(){
- var overlayViewportHeight = document.documentElement.offsetHeight + document.documentElement.scrollTop - 4;
- var overlayViewportWidth = document.documentElement.offsetWidth - 21;
- $('#DOMWindowIE6FixIframe').css({'height':overlayViewportHeight +'px','width':overlayViewportWidth+'px'});
- };
-
- var centerDOMWindow = function() {
- var $DOMWindow = $('#DOMWindow');
- if(settings.height + 50 > shortcut.viewPortHeight()){//added 50 to be safe
- $DOMWindow.css('left',Math.round(shortcut.viewPortWidth()/2) + shortcut.scrollOffsetWidth() - Math.round(($DOMWindow.outerWidth())/2));
- }else{
- $DOMWindow.css('left',Math.round(shortcut.viewPortWidth()/2) + shortcut.scrollOffsetWidth() - Math.round(($DOMWindow.outerWidth())/2));
- $DOMWindow.css('top',Math.round(shortcut.viewPortHeight()/2) + shortcut.scrollOffsetHeight() - Math.round(($DOMWindow.outerHeight())/2));
- }
- };
-
- var centerLoader = function() {
- var $DOMWindowLoader = $('#DOMWindowLoader');
- if(shortcut.isIE6){//if IE 6
- $DOMWindowLoader.css({'left':Math.round(shortcut.viewPortWidth()/2) + shortcut.scrollOffsetWidth() - Math.round(($DOMWindowLoader.innerWidth())/2),'position':'absolute'});
- $DOMWindowLoader.css({'top':Math.round(shortcut.viewPortHeight()/2) + shortcut.scrollOffsetHeight() - Math.round(($DOMWindowLoader.innerHeight())/2),'position':'absolute'});
- }else{
- $DOMWindowLoader.css({'left':'50%','top':'50%','position':'fixed'});
- }
-
- };
-
- var fixedDOMWindow = function(){
- var $DOMWindow = $('#DOMWindow');
- $DOMWindow.css('left', settings.positionLeft + shortcut.scrollOffsetWidth());
- $DOMWindow.css('top', + settings.positionTop + shortcut.scrollOffsetHeight());
- };
-
- var showDOMWindow = function(instance){
- if(arguments[0]){
- $('.'+instance+' #DOMWindowLoader').remove();
- $('.'+instance+' #DOMWindowContent').fadeIn('fast',function(){if(settings.functionCallOnOpen){settings.functionCallOnOpen();}});
- $('.'+instance+ '.closeDOMWindow').click(function(){
- $.closeDOMWindow();
- return false;
- });
- }else{
- $('#DOMWindowLoader').remove();
- $('#DOMWindow').fadeIn('fast',function(){if(settings.functionCallOnOpen){settings.functionCallOnOpen();}});
- $('#DOMWindow .closeDOMWindow').click(function(){
- $.closeDOMWindow();
- return false;
- });
- }
-
- };
-
- var urlQueryToObject = function(s){
- var query = {};
- s.replace(/b([^&=]*)=([^&=]*)b/g, function (m, a, d) {
- if (typeof query[a] != 'undefined') {
- query[a] += ',' + d;
- } else {
- query[a] = d;
- }
- });
- return query;
- };
-
- //Run Routine ///////////////////////////////////////////////////////////////////////////////////////////////////////////////
- var run = function(passingThis){
-
- //get values from element clicked, or assume its passed as an option
- settings.windowSourceID = $(passingThis).attr('href') || settings.windowSourceID;
- settings.windowSourceURL = $(passingThis).attr(settings.windowSourceAttrURL) || settings.windowSourceURL;
- settings.windowBGImage = settings.windowBGImage ? 'background-image:url('+settings.windowBGImage+')' : '';
- var urlOnly, urlQueryObject;
-
- if(settings.positionType == 'anchored'){//anchored DOM window
-
- var anchoredPositions = $(settings.anchoredSelector).position();
- var anchoredPositionX = anchoredPositions.left + settings.positionLeft;
- var anchoredPositionY = anchoredPositions.top + settings.positionTop;
-
- $('body').append('<div class="'+settings.anchoredClassName+'" style="'+settings.windowBGImage+';background-repeat:no-repeat;padding:'+settings.windowPadding+'px;overflow:auto;position:absolute;top:'+anchoredPositionY+'px;left:'+anchoredPositionX+'px;height:'+settings.height+'px;width:'+settings.width+'px;background-color:'+settings.windowBGColor+';border:'+settings.borderSize+'px solid '+settings.borderColor+';z-index:10001"><div id="DOMWindowContent" style="display:none"></div></div>');
- //loader
- if(settings.loader && settings.loaderImagePath !== ''){
- $('.'+settings.anchoredClassName).append('<div id="DOMWindowLoader" style="width:'+settings.loaderWidth+'px;height:'+settings.loaderHeight+'px;"><img src="'+settings.loaderImagePath+'" /></div>');
-
- }
-
- if($.fn.draggable){
- if(settings.draggable){$('.' + settings.anchoredClassName).draggable({cursor:'move'});}
- }
-
- switch(settings.windowSource){
- case 'inline'://////////////////////////////// inline //////////////////////////////////////////
- $('.' + settings.anchoredClassName+" #DOMWindowContent").append($(settings.windowSourceID).children());
- $('.' + settings.anchoredClassName).unload(function(){// move elements back when you're finished
- $('.' + settings.windowSourceID).append( $('.' + settings.anchoredClassName+" #DOMWindowContent").children());
- });
- showDOMWindow(settings.anchoredClassName);
- break;
- case 'iframe'://////////////////////////////// iframe //////////////////////////////////////////
- $('.' + settings.anchoredClassName+" #DOMWindowContent").append('<iframe frameborder="0" hspace="0" wspace="0" src="'+settings.windowSourceURL+'" name="DOMWindowIframe'+Math.round(Math.random()*1000)+'" style="width:100%;height:100%;border:none;background-color:#fff;" class="'+settings.anchoredClassName+'Iframe" ></iframe>');
- $('.'+settings.anchoredClassName+'Iframe').load(showDOMWindow(settings.anchoredClassName));
- break;
- case 'ajax'://////////////////////////////// ajax //////////////////////////////////////////
- if(settings.windowHTTPType == 'post'){
-
- if(settings.windowSourceURL.indexOf("?") !== -1){//has a query string
- urlOnly = settings.windowSourceURL.substr(0, settings.windowSourceURL.indexOf("?"));
- urlQueryObject = urlQueryToObject(settings.windowSourceURL);
- }else{
- urlOnly = settings.windowSourceURL;
- urlQueryObject = {};
- }
- $('.' + settings.anchoredClassName+" #DOMWindowContent").load(urlOnly,urlQueryObject,function(){
- showDOMWindow(settings.anchoredClassName);
- });
- }else{
- if(settings.windowSourceURL.indexOf("?") == -1){ //no query string, so add one
- settings.windowSourceURL += '?';
- }
- $('.' + settings.anchoredClassName+" #DOMWindowContent").load(
- settings.windowSourceURL + '&random=' + (new Date().getTime()),function(){
- showDOMWindow(settings.anchoredClassName);
- });
- }
- break;
- }
-
- }else{//centered, fixed, absolute DOM window
-
- //overlay & modal
- if(settings.overlay){
- $('body').append('<div id="DOMWindowOverlay" style="z-index:10000;display:none;position:absolute;top:0;left:0;background-color:'+settings.overlayColor+';filter:alpha(opacity='+settings.overlayOpacity+');-moz-opacity: 0.'+settings.overlayOpacity+';opacity: 0.'+settings.overlayOpacity+';"></div>');
- if(shortcut.isIE6){//if IE 6
- $('body').append('<iframe id="DOMWindowIE6FixIframe" src="blank.html" style="width:100%;height:100%;z-index:9999;position:absolute;top:0;left:0;filter:alpha(opacity=0);"></iframe>');
- sizeIE6Iframe();
- }
- sizeOverlay();
- var $DOMWindowOverlay = $('#DOMWindowOverlay');
- $DOMWindowOverlay.fadeIn('fast');
- if(!settings.modal){$DOMWindowOverlay.click(function(){$.closeDOMWindow();});}
- }
-
- //loader
- if(settings.loader && settings.loaderImagePath !== ''){
- $('body').append('<div id="DOMWindowLoader" style="z-index:10002;width:'+settings.loaderWidth+'px;height:'+settings.loaderHeight+'px;"><img src="'+settings.loaderImagePath+'" /></div>');
- centerLoader();
- }
-
- //add DOMwindow
- $('body').append('<div id="DOMWindow" style="background-repeat:no-repeat;'+settings.windowBGImage+';overflow:auto;padding:'+settings.windowPadding+'px;display:none;height:'+settings.height+'px;width:'+settings.width+'px;background-color:'+settings.windowBGColor+';border:'+settings.borderSize+'px solid '+settings.borderColor+'; position:absolute;z-index:10001"></div>');
-
- var $DOMWindow = $('#DOMWindow');
- //centered, absolute, or fixed
- switch(settings.positionType){
- case 'centered':
- centerDOMWindow();
- if(settings.height + 50 > shortcut.viewPortHeight()){//added 50 to be safe
- $DOMWindow.css('top', (settings.fixedWindowY + shortcut.scrollOffsetHeight()) + 'px');
- }
- break;
- case 'absolute':
- $DOMWindow.css({'top':(settings.positionTop+shortcut.scrollOffsetHeight())+'px','left':(settings.positionLeft+shortcut.scrollOffsetWidth())+'px'});
- if($.fn.draggable){
- if(settings.draggable){$DOMWindow.draggable({cursor:'move'});}
- }
- break;
- case 'fixed':
- fixedDOMWindow();
- break;
- case 'anchoredSingleWindow':
- var anchoredPositions = $(settings.anchoredSelector).position();
- var anchoredPositionX = anchoredPositions.left + settings.positionLeft;
- var anchoredPositionY = anchoredPositions.top + settings.positionTop;
- $DOMWindow.css({'top':anchoredPositionY + 'px','left':anchoredPositionX+'px'});
-
- break;
- }
-
- $(window).bind('scroll.DOMWindow',function(){
- if(settings.overlay){sizeOverlay();}
- if(shortcut.isIE6){sizeIE6Iframe();}
- if(settings.positionType == 'centered'){centerDOMWindow();}
- if(settings.positionType == 'fixed'){fixedDOMWindow();}
- });
-
- $(window).bind('resize.DOMWindow',function(){
- if(shortcut.isIE6){sizeIE6Iframe();}
- if(settings.overlay){sizeOverlay();}
- if(settings.positionType == 'centered'){centerDOMWindow();}
- });
-
- switch(settings.windowSource){
- case 'inline'://////////////////////////////// inline //////////////////////////////////////////
- $DOMWindow.append($(settings.windowSourceID).children());
- $DOMWindow.unload(function(){// move elements back when you're finished
- $(settings.windowSourceID).append($DOMWindow.children());
- });
- showDOMWindow();
- break;
- case 'iframe'://////////////////////////////// iframe //////////////////////////////////////////
- $DOMWindow.append('<iframe frameborder="0" hspace="0" wspace="0" src="'+settings.windowSourceURL+'" name="DOMWindowIframe'+Math.round(Math.random()*1000)+'" style="width:100%;height:100%;border:none;background-color:#fff;" id="DOMWindowIframe" ></iframe>');
- $('#DOMWindowIframe').load(showDOMWindow());
- break;
- case 'ajax'://////////////////////////////// ajax //////////////////////////////////////////
- if(settings.windowHTTPType == 'post'){
-
- if(settings.windowSourceURL.indexOf("?") !== -1){//has a query string
- urlOnly = settings.windowSourceURL.substr(0, settings.windowSourceURL.indexOf("?"));
- urlQueryObject = urlQueryToObject(settings.windowSourceURL);
- }else{
- urlOnly = settings.windowSourceURL;
- urlQueryObject = {};
- }
- $DOMWindow.load(urlOnly,urlQueryObject,function(){
- showDOMWindow();
- });
- }else{
- if(settings.windowSourceURL.indexOf("?") == -1){ //no query string, so add one
- settings.windowSourceURL += '?';
- }
- $DOMWindow.load(
- settings.windowSourceURL + '&random=' + (new Date().getTime()),function(){
- showDOMWindow();
- });
- }
- break;
- }
-
- }//end if anchored, or absolute, fixed, centered
-
- };//end run()
-
- if(settings.eventType){//if used with $().
- return this.each(function(index){
- $(this).bind(settings.eventType,function(){
- run(this);
- return false;
- });
- });
- }else{//else called as $.function
- run();
- }
-
- };//end function openDOMWindow
-
- //allow for public call, pass settings
- $.openDOMWindow = function(s){$.fn.openDOMWindow(s);};
-
-})(jQuery);
--- a/web/static/js/jquery.min.js Fri Jun 11 00:25:17 2010 +0200
+++ b/web/static/js/jquery.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -1,5 +1,5 @@
/*!
- * jQuery JavaScript Library v1.4.1
+ * jQuery JavaScript Library v1.4.2
* http://jquery.com/
*
* Copyright 2010, John Resig
@@ -11,142 +11,144 @@
* Copyright 2010, The Dojo Foundation
* Released under the MIT, BSD, and GPL Licenses.
*
- * Date: Mon Jan 25 19:43:33 2010 -0500
+ * Date: Sat Feb 13 22:33:48 2010 -0500
*/
-(function(z,v){function la(){if(!c.isReady){try{r.documentElement.doScroll("left")}catch(a){setTimeout(la,1);return}c.ready()}}function Ma(a,b){b.src?c.ajax({url:b.src,async:false,dataType:"script"}):c.globalEval(b.text||b.textContent||b.innerHTML||"");b.parentNode&&b.parentNode.removeChild(b)}function X(a,b,d,f,e,i){var j=a.length;if(typeof b==="object"){for(var n in b)X(a,n,b[n],f,e,d);return a}if(d!==v){f=!i&&f&&c.isFunction(d);for(n=0;n<j;n++)e(a[n],b,f?d.call(a[n],n,e(a[n],b)):d,i);return a}return j?
-e(a[0],b):null}function J(){return(new Date).getTime()}function Y(){return false}function Z(){return true}function ma(a,b,d){d[0].type=a;return c.event.handle.apply(b,d)}function na(a){var b,d=[],f=[],e=arguments,i,j,n,o,m,s,x=c.extend({},c.data(this,"events").live);if(!(a.button&&a.type==="click")){for(o in x){j=x[o];if(j.live===a.type||j.altLive&&c.inArray(a.type,j.altLive)>-1){i=j.data;i.beforeFilter&&i.beforeFilter[a.type]&&!i.beforeFilter[a.type](a)||f.push(j.selector)}else delete x[o]}i=c(a.target).closest(f,
-a.currentTarget);m=0;for(s=i.length;m<s;m++)for(o in x){j=x[o];n=i[m].elem;f=null;if(i[m].selector===j.selector){if(j.live==="mouseenter"||j.live==="mouseleave")f=c(a.relatedTarget).closest(j.selector)[0];if(!f||f!==n)d.push({elem:n,fn:j})}}m=0;for(s=d.length;m<s;m++){i=d[m];a.currentTarget=i.elem;a.data=i.fn.data;if(i.fn.apply(i.elem,e)===false){b=false;break}}return b}}function oa(a,b){return"live."+(a?a+".":"")+b.replace(/\./g,"`").replace(/ /g,"&")}function pa(a){return!a||!a.parentNode||a.parentNode.nodeType===
-11}function qa(a,b){var d=0;b.each(function(){if(this.nodeName===(a[d]&&a[d].nodeName)){var f=c.data(a[d++]),e=c.data(this,f);if(f=f&&f.events){delete e.handle;e.events={};for(var i in f)for(var j in f[i])c.event.add(this,i,f[i][j],f[i][j].data)}}})}function ra(a,b,d){var f,e,i;if(a.length===1&&typeof a[0]==="string"&&a[0].length<512&&a[0].indexOf("<option")<0&&(c.support.checkClone||!sa.test(a[0]))){e=true;if(i=c.fragments[a[0]])if(i!==1)f=i}if(!f){b=b&&b[0]?b[0].ownerDocument||b[0]:r;f=b.createDocumentFragment();
-c.clean(a,b,f,d)}if(e)c.fragments[a[0]]=i?f:1;return{fragment:f,cacheable:e}}function K(a,b){var d={};c.each(ta.concat.apply([],ta.slice(0,b)),function(){d[this]=a});return d}function ua(a){return"scrollTo"in a&&a.document?a:a.nodeType===9?a.defaultView||a.parentWindow:false}var c=function(a,b){return new c.fn.init(a,b)},Na=z.jQuery,Oa=z.$,r=z.document,S,Pa=/^[^<]*(<[\w\W]+>)[^>]*$|^#([\w-]+)$/,Qa=/^.[^:#\[\.,]*$/,Ra=/\S/,Sa=/^(\s|\u00A0)+|(\s|\u00A0)+$/g,Ta=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,O=navigator.userAgent,
-va=false,P=[],L,$=Object.prototype.toString,aa=Object.prototype.hasOwnProperty,ba=Array.prototype.push,Q=Array.prototype.slice,wa=Array.prototype.indexOf;c.fn=c.prototype={init:function(a,b){var d,f;if(!a)return this;if(a.nodeType){this.context=this[0]=a;this.length=1;return this}if(typeof a==="string")if((d=Pa.exec(a))&&(d[1]||!b))if(d[1]){f=b?b.ownerDocument||b:r;if(a=Ta.exec(a))if(c.isPlainObject(b)){a=[r.createElement(a[1])];c.fn.attr.call(a,b,true)}else a=[f.createElement(a[1])];else{a=ra([d[1]],
-[f]);a=(a.cacheable?a.fragment.cloneNode(true):a.fragment).childNodes}}else{if(b=r.getElementById(d[2])){if(b.id!==d[2])return S.find(a);this.length=1;this[0]=b}this.context=r;this.selector=a;return this}else if(!b&&/^\w+$/.test(a)){this.selector=a;this.context=r;a=r.getElementsByTagName(a)}else return!b||b.jquery?(b||S).find(a):c(b).find(a);else if(c.isFunction(a))return S.ready(a);if(a.selector!==v){this.selector=a.selector;this.context=a.context}return c.isArray(a)?this.setArray(a):c.makeArray(a,
-this)},selector:"",jquery:"1.4.1",length:0,size:function(){return this.length},toArray:function(){return Q.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this.slice(a)[0]:this[a]},pushStack:function(a,b,d){a=c(a||null);a.prevObject=this;a.context=this.context;if(b==="find")a.selector=this.selector+(this.selector?" ":"")+d;else if(b)a.selector=this.selector+"."+b+"("+d+")";return a},setArray:function(a){this.length=0;ba.apply(this,a);return this},each:function(a,b){return c.each(this,
-a,b)},ready:function(a){c.bindReady();if(c.isReady)a.call(r,c);else P&&P.push(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(Q.apply(this,arguments),"slice",Q.call(arguments).join(","))},map:function(a){return this.pushStack(c.map(this,function(b,d){return a.call(b,d,b)}))},end:function(){return this.prevObject||c(null)},push:ba,sort:[].sort,splice:[].splice};
-c.fn.init.prototype=c.fn;c.extend=c.fn.extend=function(){var a=arguments[0]||{},b=1,d=arguments.length,f=false,e,i,j,n;if(typeof a==="boolean"){f=a;a=arguments[1]||{};b=2}if(typeof a!=="object"&&!c.isFunction(a))a={};if(d===b){a=this;--b}for(;b<d;b++)if((e=arguments[b])!=null)for(i in e){j=a[i];n=e[i];if(a!==n)if(f&&n&&(c.isPlainObject(n)||c.isArray(n))){j=j&&(c.isPlainObject(j)||c.isArray(j))?j:c.isArray(n)?[]:{};a[i]=c.extend(f,j,n)}else if(n!==v)a[i]=n}return a};c.extend({noConflict:function(a){z.$=
-Oa;if(a)z.jQuery=Na;return c},isReady:false,ready:function(){if(!c.isReady){if(!r.body)return setTimeout(c.ready,13);c.isReady=true;if(P){for(var a,b=0;a=P[b++];)a.call(r,c);P=null}c.fn.triggerHandler&&c(r).triggerHandler("ready")}},bindReady:function(){if(!va){va=true;if(r.readyState==="complete")return c.ready();if(r.addEventListener){r.addEventListener("DOMContentLoaded",L,false);z.addEventListener("load",c.ready,false)}else if(r.attachEvent){r.attachEvent("onreadystatechange",L);z.attachEvent("onload",
-c.ready);var a=false;try{a=z.frameElement==null}catch(b){}r.documentElement.doScroll&&a&&la()}}},isFunction:function(a){return $.call(a)==="[object Function]"},isArray:function(a){return $.call(a)==="[object Array]"},isPlainObject:function(a){if(!a||$.call(a)!=="[object Object]"||a.nodeType||a.setInterval)return false;if(a.constructor&&!aa.call(a,"constructor")&&!aa.call(a.constructor.prototype,"isPrototypeOf"))return false;var b;for(b in a);return b===v||aa.call(a,b)},isEmptyObject:function(a){for(var b in a)return false;
-return true},error:function(a){throw a;},parseJSON:function(a){if(typeof a!=="string"||!a)return null;if(/^[\],:{}\s]*$/.test(a.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,"@").replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,"]").replace(/(?:^|:|,)(?:\s*\[)+/g,"")))return z.JSON&&z.JSON.parse?z.JSON.parse(a):(new Function("return "+a))();else c.error("Invalid JSON: "+a)},noop:function(){},globalEval:function(a){if(a&&Ra.test(a)){var b=r.getElementsByTagName("head")[0]||
-r.documentElement,d=r.createElement("script");d.type="text/javascript";if(c.support.scriptEval)d.appendChild(r.createTextNode(a));else d.text=a;b.insertBefore(d,b.firstChild);b.removeChild(d)}},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,b,d){var f,e=0,i=a.length,j=i===v||c.isFunction(a);if(d)if(j)for(f in a){if(b.apply(a[f],d)===false)break}else for(;e<i;){if(b.apply(a[e++],d)===false)break}else if(j)for(f in a){if(b.call(a[f],f,a[f])===false)break}else for(d=
-a[0];e<i&&b.call(d,e,d)!==false;d=a[++e]);return a},trim:function(a){return(a||"").replace(Sa,"")},makeArray:function(a,b){b=b||[];if(a!=null)a.length==null||typeof a==="string"||c.isFunction(a)||typeof a!=="function"&&a.setInterval?ba.call(b,a):c.merge(b,a);return b},inArray:function(a,b){if(b.indexOf)return b.indexOf(a);for(var d=0,f=b.length;d<f;d++)if(b[d]===a)return d;return-1},merge:function(a,b){var d=a.length,f=0;if(typeof b.length==="number")for(var e=b.length;f<e;f++)a[d++]=b[f];else for(;b[f]!==
-v;)a[d++]=b[f++];a.length=d;return a},grep:function(a,b,d){for(var f=[],e=0,i=a.length;e<i;e++)!d!==!b(a[e],e)&&f.push(a[e]);return f},map:function(a,b,d){for(var f=[],e,i=0,j=a.length;i<j;i++){e=b(a[i],i,d);if(e!=null)f[f.length]=e}return f.concat.apply([],f)},guid:1,proxy:function(a,b,d){if(arguments.length===2)if(typeof b==="string"){d=a;a=d[b];b=v}else if(b&&!c.isFunction(b)){d=b;b=v}if(!b&&a)b=function(){return a.apply(d||this,arguments)};if(a)b.guid=a.guid=a.guid||b.guid||c.guid++;return b},
-uaMatch:function(a){a=a.toLowerCase();a=/(webkit)[ \/]([\w.]+)/.exec(a)||/(opera)(?:.*version)?[ \/]([\w.]+)/.exec(a)||/(msie) ([\w.]+)/.exec(a)||!/compatible/.test(a)&&/(mozilla)(?:.*? rv:([\w.]+))?/.exec(a)||[];return{browser:a[1]||"",version:a[2]||"0"}},browser:{}});O=c.uaMatch(O);if(O.browser){c.browser[O.browser]=true;c.browser.version=O.version}if(c.browser.webkit)c.browser.safari=true;if(wa)c.inArray=function(a,b){return wa.call(b,a)};S=c(r);if(r.addEventListener)L=function(){r.removeEventListener("DOMContentLoaded",
-L,false);c.ready()};else if(r.attachEvent)L=function(){if(r.readyState==="complete"){r.detachEvent("onreadystatechange",L);c.ready()}};(function(){c.support={};var a=r.documentElement,b=r.createElement("script"),d=r.createElement("div"),f="script"+J();d.style.display="none";d.innerHTML=" <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";var e=d.getElementsByTagName("*"),i=d.getElementsByTagName("a")[0];if(!(!e||!e.length||!i)){c.support=
-{leadingWhitespace:d.firstChild.nodeType===3,tbody:!d.getElementsByTagName("tbody").length,htmlSerialize:!!d.getElementsByTagName("link").length,style:/red/.test(i.getAttribute("style")),hrefNormalized:i.getAttribute("href")==="/a",opacity:/^0.55$/.test(i.style.opacity),cssFloat:!!i.style.cssFloat,checkOn:d.getElementsByTagName("input")[0].value==="on",optSelected:r.createElement("select").appendChild(r.createElement("option")).selected,checkClone:false,scriptEval:false,noCloneEvent:true,boxModel:null};
-b.type="text/javascript";try{b.appendChild(r.createTextNode("window."+f+"=1;"))}catch(j){}a.insertBefore(b,a.firstChild);if(z[f]){c.support.scriptEval=true;delete z[f]}a.removeChild(b);if(d.attachEvent&&d.fireEvent){d.attachEvent("onclick",function n(){c.support.noCloneEvent=false;d.detachEvent("onclick",n)});d.cloneNode(true).fireEvent("onclick")}d=r.createElement("div");d.innerHTML="<input type='radio' name='radiotest' checked='checked'/>";a=r.createDocumentFragment();a.appendChild(d.firstChild);
-c.support.checkClone=a.cloneNode(true).cloneNode(true).lastChild.checked;c(function(){var n=r.createElement("div");n.style.width=n.style.paddingLeft="1px";r.body.appendChild(n);c.boxModel=c.support.boxModel=n.offsetWidth===2;r.body.removeChild(n).style.display="none"});a=function(n){var o=r.createElement("div");n="on"+n;var m=n in o;if(!m){o.setAttribute(n,"return;");m=typeof o[n]==="function"}return m};c.support.submitBubbles=a("submit");c.support.changeBubbles=a("change");a=b=d=e=i=null}})();c.props=
-{"for":"htmlFor","class":"className",readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan",colspan:"colSpan",tabindex:"tabIndex",usemap:"useMap",frameborder:"frameBorder"};var G="jQuery"+J(),Ua=0,xa={},Va={};c.extend({cache:{},expando:G,noData:{embed:true,object:true,applet:true},data:function(a,b,d){if(!(a.nodeName&&c.noData[a.nodeName.toLowerCase()])){a=a==z?xa:a;var f=a[G],e=c.cache;if(!b&&!f)return null;f||(f=++Ua);if(typeof b==="object"){a[G]=f;e=e[f]=c.extend(true,
-{},b)}else e=e[f]?e[f]:typeof d==="undefined"?Va:(e[f]={});if(d!==v){a[G]=f;e[b]=d}return typeof b==="string"?e[b]:e}},removeData:function(a,b){if(!(a.nodeName&&c.noData[a.nodeName.toLowerCase()])){a=a==z?xa:a;var d=a[G],f=c.cache,e=f[d];if(b){if(e){delete e[b];c.isEmptyObject(e)&&c.removeData(a)}}else{try{delete a[G]}catch(i){a.removeAttribute&&a.removeAttribute(G)}delete f[d]}}}});c.fn.extend({data:function(a,b){if(typeof a==="undefined"&&this.length)return c.data(this[0]);else if(typeof a==="object")return this.each(function(){c.data(this,
-a)});var d=a.split(".");d[1]=d[1]?"."+d[1]:"";if(b===v){var f=this.triggerHandler("getData"+d[1]+"!",[d[0]]);if(f===v&&this.length)f=c.data(this[0],a);return f===v&&d[1]?this.data(d[0]):f}else return this.trigger("setData"+d[1]+"!",[d[0],b]).each(function(){c.data(this,a,b)})},removeData:function(a){return this.each(function(){c.removeData(this,a)})}});c.extend({queue:function(a,b,d){if(a){b=(b||"fx")+"queue";var f=c.data(a,b);if(!d)return f||[];if(!f||c.isArray(d))f=c.data(a,b,c.makeArray(d));else f.push(d);
-return f}},dequeue:function(a,b){b=b||"fx";var d=c.queue(a,b),f=d.shift();if(f==="inprogress")f=d.shift();if(f){b==="fx"&&d.unshift("inprogress");f.call(a,function(){c.dequeue(a,b)})}}});c.fn.extend({queue:function(a,b){if(typeof a!=="string"){b=a;a="fx"}if(b===v)return c.queue(this[0],a);return this.each(function(){var d=c.queue(this,a,b);a==="fx"&&d[0]!=="inprogress"&&c.dequeue(this,a)})},dequeue:function(a){return this.each(function(){c.dequeue(this,a)})},delay:function(a,b){a=c.fx?c.fx.speeds[a]||
-a:a;b=b||"fx";return this.queue(b,function(){var d=this;setTimeout(function(){c.dequeue(d,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])}});var ya=/[\n\t]/g,ca=/\s+/,Wa=/\r/g,Xa=/href|src|style/,Ya=/(button|input)/i,Za=/(button|input|object|select|textarea)/i,$a=/^(a|area)$/i,za=/radio|checkbox/;c.fn.extend({attr:function(a,b){return X(this,a,b,true,c.attr)},removeAttr:function(a){return this.each(function(){c.attr(this,a,"");this.nodeType===1&&this.removeAttribute(a)})},addClass:function(a){if(c.isFunction(a))return this.each(function(o){var m=
-c(this);m.addClass(a.call(this,o,m.attr("class")))});if(a&&typeof a==="string")for(var b=(a||"").split(ca),d=0,f=this.length;d<f;d++){var e=this[d];if(e.nodeType===1)if(e.className)for(var i=" "+e.className+" ",j=0,n=b.length;j<n;j++){if(i.indexOf(" "+b[j]+" ")<0)e.className+=" "+b[j]}else e.className=a}return this},removeClass:function(a){if(c.isFunction(a))return this.each(function(o){var m=c(this);m.removeClass(a.call(this,o,m.attr("class")))});if(a&&typeof a==="string"||a===v)for(var b=(a||"").split(ca),
-d=0,f=this.length;d<f;d++){var e=this[d];if(e.nodeType===1&&e.className)if(a){for(var i=(" "+e.className+" ").replace(ya," "),j=0,n=b.length;j<n;j++)i=i.replace(" "+b[j]+" "," ");e.className=i.substring(1,i.length-1)}else e.className=""}return this},toggleClass:function(a,b){var d=typeof a,f=typeof b==="boolean";if(c.isFunction(a))return this.each(function(e){var i=c(this);i.toggleClass(a.call(this,e,i.attr("class"),b),b)});return this.each(function(){if(d==="string")for(var e,i=0,j=c(this),n=b,o=
-a.split(ca);e=o[i++];){n=f?n:!j.hasClass(e);j[n?"addClass":"removeClass"](e)}else if(d==="undefined"||d==="boolean"){this.className&&c.data(this,"__className__",this.className);this.className=this.className||a===false?"":c.data(this,"__className__")||""}})},hasClass:function(a){a=" "+a+" ";for(var b=0,d=this.length;b<d;b++)if((" "+this[b].className+" ").replace(ya," ").indexOf(a)>-1)return true;return false},val:function(a){if(a===v){var b=this[0];if(b){if(c.nodeName(b,"option"))return(b.attributes.value||
-{}).specified?b.value:b.text;if(c.nodeName(b,"select")){var d=b.selectedIndex,f=[],e=b.options;b=b.type==="select-one";if(d<0)return null;var i=b?d:0;for(d=b?d+1:e.length;i<d;i++){var j=e[i];if(j.selected){a=c(j).val();if(b)return a;f.push(a)}}return f}if(za.test(b.type)&&!c.support.checkOn)return b.getAttribute("value")===null?"on":b.value;return(b.value||"").replace(Wa,"")}return v}var n=c.isFunction(a);return this.each(function(o){var m=c(this),s=a;if(this.nodeType===1){if(n)s=a.call(this,o,m.val());
-if(typeof s==="number")s+="";if(c.isArray(s)&&za.test(this.type))this.checked=c.inArray(m.val(),s)>=0;else if(c.nodeName(this,"select")){var x=c.makeArray(s);c("option",this).each(function(){this.selected=c.inArray(c(this).val(),x)>=0});if(!x.length)this.selectedIndex=-1}else this.value=s}})}});c.extend({attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(a,b,d,f){if(!a||a.nodeType===3||a.nodeType===8)return v;if(f&&b in c.attrFn)return c(a)[b](d);
-f=a.nodeType!==1||!c.isXMLDoc(a);var e=d!==v;b=f&&c.props[b]||b;if(a.nodeType===1){var i=Xa.test(b);if(b in a&&f&&!i){if(e){b==="type"&&Ya.test(a.nodeName)&&a.parentNode&&c.error("type property can't be changed");a[b]=d}if(c.nodeName(a,"form")&&a.getAttributeNode(b))return a.getAttributeNode(b).nodeValue;if(b==="tabIndex")return(b=a.getAttributeNode("tabIndex"))&&b.specified?b.value:Za.test(a.nodeName)||$a.test(a.nodeName)&&a.href?0:v;return a[b]}if(!c.support.style&&f&&b==="style"){if(e)a.style.cssText=
-""+d;return a.style.cssText}e&&a.setAttribute(b,""+d);a=!c.support.hrefNormalized&&f&&i?a.getAttribute(b,2):a.getAttribute(b);return a===null?v:a}return c.style(a,b,d)}});var ab=function(a){return a.replace(/[^\w\s\.\|`]/g,function(b){return"\\"+b})};c.event={add:function(a,b,d,f){if(!(a.nodeType===3||a.nodeType===8)){if(a.setInterval&&a!==z&&!a.frameElement)a=z;if(!d.guid)d.guid=c.guid++;if(f!==v){d=c.proxy(d);d.data=f}var e=c.data(a,"events")||c.data(a,"events",{}),i=c.data(a,"handle"),j;if(!i){j=
-function(){return typeof c!=="undefined"&&!c.event.triggered?c.event.handle.apply(j.elem,arguments):v};i=c.data(a,"handle",j)}if(i){i.elem=a;b=b.split(/\s+/);for(var n,o=0;n=b[o++];){var m=n.split(".");n=m.shift();if(o>1){d=c.proxy(d);if(f!==v)d.data=f}d.type=m.slice(0).sort().join(".");var s=e[n],x=this.special[n]||{};if(!s){s=e[n]={};if(!x.setup||x.setup.call(a,f,m,d)===false)if(a.addEventListener)a.addEventListener(n,i,false);else a.attachEvent&&a.attachEvent("on"+n,i)}if(x.add)if((m=x.add.call(a,
-d,f,m,s))&&c.isFunction(m)){m.guid=m.guid||d.guid;m.data=m.data||d.data;m.type=m.type||d.type;d=m}s[d.guid]=d;this.global[n]=true}a=null}}},global:{},remove:function(a,b,d){if(!(a.nodeType===3||a.nodeType===8)){var f=c.data(a,"events"),e,i,j;if(f){if(b===v||typeof b==="string"&&b.charAt(0)===".")for(i in f)this.remove(a,i+(b||""));else{if(b.type){d=b.handler;b=b.type}b=b.split(/\s+/);for(var n=0;i=b[n++];){var o=i.split(".");i=o.shift();var m=!o.length,s=c.map(o.slice(0).sort(),ab);s=new RegExp("(^|\\.)"+
-s.join("\\.(?:.*\\.)?")+"(\\.|$)");var x=this.special[i]||{};if(f[i]){if(d){j=f[i][d.guid];delete f[i][d.guid]}else for(var A in f[i])if(m||s.test(f[i][A].type))delete f[i][A];x.remove&&x.remove.call(a,o,j);for(e in f[i])break;if(!e){if(!x.teardown||x.teardown.call(a,o)===false)if(a.removeEventListener)a.removeEventListener(i,c.data(a,"handle"),false);else a.detachEvent&&a.detachEvent("on"+i,c.data(a,"handle"));e=null;delete f[i]}}}}for(e in f)break;if(!e){if(A=c.data(a,"handle"))A.elem=null;c.removeData(a,
-"events");c.removeData(a,"handle")}}}},trigger:function(a,b,d,f){var e=a.type||a;if(!f){a=typeof a==="object"?a[G]?a:c.extend(c.Event(e),a):c.Event(e);if(e.indexOf("!")>=0){a.type=e=e.slice(0,-1);a.exclusive=true}if(!d){a.stopPropagation();this.global[e]&&c.each(c.cache,function(){this.events&&this.events[e]&&c.event.trigger(a,b,this.handle.elem)})}if(!d||d.nodeType===3||d.nodeType===8)return v;a.result=v;a.target=d;b=c.makeArray(b);b.unshift(a)}a.currentTarget=d;(f=c.data(d,"handle"))&&f.apply(d,
-b);f=d.parentNode||d.ownerDocument;try{if(!(d&&d.nodeName&&c.noData[d.nodeName.toLowerCase()]))if(d["on"+e]&&d["on"+e].apply(d,b)===false)a.result=false}catch(i){}if(!a.isPropagationStopped()&&f)c.event.trigger(a,b,f,true);else if(!a.isDefaultPrevented()){d=a.target;var j;if(!(c.nodeName(d,"a")&&e==="click")&&!(d&&d.nodeName&&c.noData[d.nodeName.toLowerCase()])){try{if(d[e]){if(j=d["on"+e])d["on"+e]=null;this.triggered=true;d[e]()}}catch(n){}if(j)d["on"+e]=j;this.triggered=false}}},handle:function(a){var b,
-d;a=arguments[0]=c.event.fix(a||z.event);a.currentTarget=this;d=a.type.split(".");a.type=d.shift();b=!d.length&&!a.exclusive;var f=new RegExp("(^|\\.)"+d.slice(0).sort().join("\\.(?:.*\\.)?")+"(\\.|$)");d=(c.data(this,"events")||{})[a.type];for(var e in d){var i=d[e];if(b||f.test(i.type)){a.handler=i;a.data=i.data;i=i.apply(this,arguments);if(i!==v){a.result=i;if(i===false){a.preventDefault();a.stopPropagation()}}if(a.isImmediatePropagationStopped())break}}return a.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
-fix:function(a){if(a[G])return a;var b=a;a=c.Event(b);for(var d=this.props.length,f;d;){f=this.props[--d];a[f]=b[f]}if(!a.target)a.target=a.srcElement||r;if(a.target.nodeType===3)a.target=a.target.parentNode;if(!a.relatedTarget&&a.fromElement)a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement;if(a.pageX==null&&a.clientX!=null){b=r.documentElement;d=r.body;a.pageX=a.clientX+(b&&b.scrollLeft||d&&d.scrollLeft||0)-(b&&b.clientLeft||d&&d.clientLeft||0);a.pageY=a.clientY+(b&&b.scrollTop||
-d&&d.scrollTop||0)-(b&&b.clientTop||d&&d.clientTop||0)}if(!a.which&&(a.charCode||a.charCode===0?a.charCode:a.keyCode))a.which=a.charCode||a.keyCode;if(!a.metaKey&&a.ctrlKey)a.metaKey=a.ctrlKey;if(!a.which&&a.button!==v)a.which=a.button&1?1:a.button&2?3:a.button&4?2:0;return a},guid:1E8,proxy:c.proxy,special:{ready:{setup:c.bindReady,teardown:c.noop},live:{add:function(a,b){c.extend(a,b||{});a.guid+=b.selector+b.live;b.liveProxy=a;c.event.add(this,b.live,na,b)},remove:function(a){if(a.length){var b=
-0,d=new RegExp("(^|\\.)"+a[0]+"(\\.|$)");c.each(c.data(this,"events").live||{},function(){d.test(this.type)&&b++});b<1&&c.event.remove(this,a[0],na)}},special:{}},beforeunload:{setup:function(a,b,d){if(this.setInterval)this.onbeforeunload=d;return false},teardown:function(a,b){if(this.onbeforeunload===b)this.onbeforeunload=null}}}};c.Event=function(a){if(!this.preventDefault)return new c.Event(a);if(a&&a.type){this.originalEvent=a;this.type=a.type}else this.type=a;this.timeStamp=J();this[G]=true};
-c.Event.prototype={preventDefault:function(){this.isDefaultPrevented=Z;var a=this.originalEvent;if(a){a.preventDefault&&a.preventDefault();a.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=Z;var a=this.originalEvent;if(a){a.stopPropagation&&a.stopPropagation();a.cancelBubble=true}},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=Z;this.stopPropagation()},isDefaultPrevented:Y,isPropagationStopped:Y,isImmediatePropagationStopped:Y};var Aa=function(a){for(var b=
-a.relatedTarget;b&&b!==this;)try{b=b.parentNode}catch(d){break}if(b!==this){a.type=a.data;c.event.handle.apply(this,arguments)}},Ba=function(a){a.type=a.data;c.event.handle.apply(this,arguments)};c.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){c.event.special[a]={setup:function(d){c.event.add(this,b,d&&d.selector?Ba:Aa,a)},teardown:function(d){c.event.remove(this,b,d&&d.selector?Ba:Aa)}}});if(!c.support.submitBubbles)c.event.special.submit={setup:function(a,b,d){if(this.nodeName.toLowerCase()!==
-"form"){c.event.add(this,"click.specialSubmit."+d.guid,function(f){var e=f.target,i=e.type;if((i==="submit"||i==="image")&&c(e).closest("form").length)return ma("submit",this,arguments)});c.event.add(this,"keypress.specialSubmit."+d.guid,function(f){var e=f.target,i=e.type;if((i==="text"||i==="password")&&c(e).closest("form").length&&f.keyCode===13)return ma("submit",this,arguments)})}else return false},remove:function(a,b){c.event.remove(this,"click.specialSubmit"+(b?"."+b.guid:""));c.event.remove(this,
-"keypress.specialSubmit"+(b?"."+b.guid:""))}};if(!c.support.changeBubbles){var da=/textarea|input|select/i;function Ca(a){var b=a.type,d=a.value;if(b==="radio"||b==="checkbox")d=a.checked;else if(b==="select-multiple")d=a.selectedIndex>-1?c.map(a.options,function(f){return f.selected}).join("-"):"";else if(a.nodeName.toLowerCase()==="select")d=a.selectedIndex;return d}function ea(a,b){var d=a.target,f,e;if(!(!da.test(d.nodeName)||d.readOnly)){f=c.data(d,"_change_data");e=Ca(d);if(a.type!=="focusout"||
-d.type!=="radio")c.data(d,"_change_data",e);if(!(f===v||e===f))if(f!=null||e){a.type="change";return c.event.trigger(a,b,d)}}}c.event.special.change={filters:{focusout:ea,click:function(a){var b=a.target,d=b.type;if(d==="radio"||d==="checkbox"||b.nodeName.toLowerCase()==="select")return ea.call(this,a)},keydown:function(a){var b=a.target,d=b.type;if(a.keyCode===13&&b.nodeName.toLowerCase()!=="textarea"||a.keyCode===32&&(d==="checkbox"||d==="radio")||d==="select-multiple")return ea.call(this,a)},beforeactivate:function(a){a=
-a.target;a.nodeName.toLowerCase()==="input"&&a.type==="radio"&&c.data(a,"_change_data",Ca(a))}},setup:function(a,b,d){for(var f in T)c.event.add(this,f+".specialChange."+d.guid,T[f]);return da.test(this.nodeName)},remove:function(a,b){for(var d in T)c.event.remove(this,d+".specialChange"+(b?"."+b.guid:""),T[d]);return da.test(this.nodeName)}};var T=c.event.special.change.filters}r.addEventListener&&c.each({focus:"focusin",blur:"focusout"},function(a,b){function d(f){f=c.event.fix(f);f.type=b;return c.event.handle.call(this,
-f)}c.event.special[b]={setup:function(){this.addEventListener(a,d,true)},teardown:function(){this.removeEventListener(a,d,true)}}});c.each(["bind","one"],function(a,b){c.fn[b]=function(d,f,e){if(typeof d==="object"){for(var i in d)this[b](i,f,d[i],e);return this}if(c.isFunction(f)){e=f;f=v}var j=b==="one"?c.proxy(e,function(n){c(this).unbind(n,j);return e.apply(this,arguments)}):e;return d==="unload"&&b!=="one"?this.one(d,f,e):this.each(function(){c.event.add(this,d,j,f)})}});c.fn.extend({unbind:function(a,
-b){if(typeof a==="object"&&!a.preventDefault){for(var d in a)this.unbind(d,a[d]);return this}return this.each(function(){c.event.remove(this,a,b)})},trigger:function(a,b){return this.each(function(){c.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0]){a=c.Event(a);a.preventDefault();a.stopPropagation();c.event.trigger(a,b,this[0]);return a.result}},toggle:function(a){for(var b=arguments,d=1;d<b.length;)c.proxy(a,b[d++]);return this.click(c.proxy(a,function(f){var e=(c.data(this,"lastToggle"+
-a.guid)||0)%d;c.data(this,"lastToggle"+a.guid,e+1);f.preventDefault();return b[e].apply(this,arguments)||false}))},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});c.each(["live","die"],function(a,b){c.fn[b]=function(d,f,e){var i,j=0;if(c.isFunction(f)){e=f;f=v}for(d=(d||"").split(/\s+/);(i=d[j++])!=null;){i=i==="focus"?"focusin":i==="blur"?"focusout":i==="hover"?d.push("mouseleave")&&"mouseenter":i;b==="live"?c(this.context).bind(oa(i,this.selector),{data:f,selector:this.selector,
-live:i},e):c(this.context).unbind(oa(i,this.selector),e?{guid:e.guid+this.selector+i}:null)}return this}});c.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){c.fn[b]=function(d){return d?this.bind(b,d):this.trigger(b)};if(c.attrFn)c.attrFn[b]=true});z.attachEvent&&!z.addEventListener&&z.attachEvent("onunload",function(){for(var a in c.cache)if(c.cache[a].handle)try{c.event.remove(c.cache[a].handle.elem)}catch(b){}});
-(function(){function a(g){for(var h="",k,l=0;g[l];l++){k=g[l];if(k.nodeType===3||k.nodeType===4)h+=k.nodeValue;else if(k.nodeType!==8)h+=a(k.childNodes)}return h}function b(g,h,k,l,q,p){q=0;for(var u=l.length;q<u;q++){var t=l[q];if(t){t=t[g];for(var y=false;t;){if(t.sizcache===k){y=l[t.sizset];break}if(t.nodeType===1&&!p){t.sizcache=k;t.sizset=q}if(t.nodeName.toLowerCase()===h){y=t;break}t=t[g]}l[q]=y}}}function d(g,h,k,l,q,p){q=0;for(var u=l.length;q<u;q++){var t=l[q];if(t){t=t[g];for(var y=false;t;){if(t.sizcache===
-k){y=l[t.sizset];break}if(t.nodeType===1){if(!p){t.sizcache=k;t.sizset=q}if(typeof h!=="string"){if(t===h){y=true;break}}else if(o.filter(h,[t]).length>0){y=t;break}}t=t[g]}l[q]=y}}}var f=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,e=0,i=Object.prototype.toString,j=false,n=true;[0,0].sort(function(){n=false;return 0});var o=function(g,h,k,l){k=k||[];var q=h=h||r;if(h.nodeType!==1&&h.nodeType!==9)return[];if(!g||
-typeof g!=="string")return k;for(var p=[],u,t,y,R,H=true,M=w(h),I=g;(f.exec(""),u=f.exec(I))!==null;){I=u[3];p.push(u[1]);if(u[2]){R=u[3];break}}if(p.length>1&&s.exec(g))if(p.length===2&&m.relative[p[0]])t=fa(p[0]+p[1],h);else for(t=m.relative[p[0]]?[h]:o(p.shift(),h);p.length;){g=p.shift();if(m.relative[g])g+=p.shift();t=fa(g,t)}else{if(!l&&p.length>1&&h.nodeType===9&&!M&&m.match.ID.test(p[0])&&!m.match.ID.test(p[p.length-1])){u=o.find(p.shift(),h,M);h=u.expr?o.filter(u.expr,u.set)[0]:u.set[0]}if(h){u=
-l?{expr:p.pop(),set:A(l)}:o.find(p.pop(),p.length===1&&(p[0]==="~"||p[0]==="+")&&h.parentNode?h.parentNode:h,M);t=u.expr?o.filter(u.expr,u.set):u.set;if(p.length>0)y=A(t);else H=false;for(;p.length;){var D=p.pop();u=D;if(m.relative[D])u=p.pop();else D="";if(u==null)u=h;m.relative[D](y,u,M)}}else y=[]}y||(y=t);y||o.error(D||g);if(i.call(y)==="[object Array]")if(H)if(h&&h.nodeType===1)for(g=0;y[g]!=null;g++){if(y[g]&&(y[g]===true||y[g].nodeType===1&&E(h,y[g])))k.push(t[g])}else for(g=0;y[g]!=null;g++)y[g]&&
-y[g].nodeType===1&&k.push(t[g]);else k.push.apply(k,y);else A(y,k);if(R){o(R,q,k,l);o.uniqueSort(k)}return k};o.uniqueSort=function(g){if(C){j=n;g.sort(C);if(j)for(var h=1;h<g.length;h++)g[h]===g[h-1]&&g.splice(h--,1)}return g};o.matches=function(g,h){return o(g,null,null,h)};o.find=function(g,h,k){var l,q;if(!g)return[];for(var p=0,u=m.order.length;p<u;p++){var t=m.order[p];if(q=m.leftMatch[t].exec(g)){var y=q[1];q.splice(1,1);if(y.substr(y.length-1)!=="\\"){q[1]=(q[1]||"").replace(/\\/g,"");l=m.find[t](q,
-h,k);if(l!=null){g=g.replace(m.match[t],"");break}}}}l||(l=h.getElementsByTagName("*"));return{set:l,expr:g}};o.filter=function(g,h,k,l){for(var q=g,p=[],u=h,t,y,R=h&&h[0]&&w(h[0]);g&&h.length;){for(var H in m.filter)if((t=m.leftMatch[H].exec(g))!=null&&t[2]){var M=m.filter[H],I,D;D=t[1];y=false;t.splice(1,1);if(D.substr(D.length-1)!=="\\"){if(u===p)p=[];if(m.preFilter[H])if(t=m.preFilter[H](t,u,k,p,l,R)){if(t===true)continue}else y=I=true;if(t)for(var U=0;(D=u[U])!=null;U++)if(D){I=M(D,t,U,u);var Da=
-l^!!I;if(k&&I!=null)if(Da)y=true;else u[U]=false;else if(Da){p.push(D);y=true}}if(I!==v){k||(u=p);g=g.replace(m.match[H],"");if(!y)return[];break}}}if(g===q)if(y==null)o.error(g);else break;q=g}return u};o.error=function(g){throw"Syntax error, unrecognized expression: "+g;};var m=o.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,
-TAG:/^((?:[\w\u00c0-\uFFFF\*-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(g){return g.getAttribute("href")}},relative:{"+":function(g,h){var k=typeof h==="string",l=k&&!/\W/.test(h);k=k&&!l;if(l)h=h.toLowerCase();l=0;for(var q=g.length,
-p;l<q;l++)if(p=g[l]){for(;(p=p.previousSibling)&&p.nodeType!==1;);g[l]=k||p&&p.nodeName.toLowerCase()===h?p||false:p===h}k&&o.filter(h,g,true)},">":function(g,h){var k=typeof h==="string";if(k&&!/\W/.test(h)){h=h.toLowerCase();for(var l=0,q=g.length;l<q;l++){var p=g[l];if(p){k=p.parentNode;g[l]=k.nodeName.toLowerCase()===h?k:false}}}else{l=0;for(q=g.length;l<q;l++)if(p=g[l])g[l]=k?p.parentNode:p.parentNode===h;k&&o.filter(h,g,true)}},"":function(g,h,k){var l=e++,q=d;if(typeof h==="string"&&!/\W/.test(h)){var p=
-h=h.toLowerCase();q=b}q("parentNode",h,l,g,p,k)},"~":function(g,h,k){var l=e++,q=d;if(typeof h==="string"&&!/\W/.test(h)){var p=h=h.toLowerCase();q=b}q("previousSibling",h,l,g,p,k)}},find:{ID:function(g,h,k){if(typeof h.getElementById!=="undefined"&&!k)return(g=h.getElementById(g[1]))?[g]:[]},NAME:function(g,h){if(typeof h.getElementsByName!=="undefined"){var k=[];h=h.getElementsByName(g[1]);for(var l=0,q=h.length;l<q;l++)h[l].getAttribute("name")===g[1]&&k.push(h[l]);return k.length===0?null:k}},
-TAG:function(g,h){return h.getElementsByTagName(g[1])}},preFilter:{CLASS:function(g,h,k,l,q,p){g=" "+g[1].replace(/\\/g,"")+" ";if(p)return g;p=0;for(var u;(u=h[p])!=null;p++)if(u)if(q^(u.className&&(" "+u.className+" ").replace(/[\t\n]/g," ").indexOf(g)>=0))k||l.push(u);else if(k)h[p]=false;return false},ID:function(g){return g[1].replace(/\\/g,"")},TAG:function(g){return g[1].toLowerCase()},CHILD:function(g){if(g[1]==="nth"){var h=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(g[2]==="even"&&"2n"||g[2]==="odd"&&
-"2n+1"||!/\D/.test(g[2])&&"0n+"+g[2]||g[2]);g[2]=h[1]+(h[2]||1)-0;g[3]=h[3]-0}g[0]=e++;return g},ATTR:function(g,h,k,l,q,p){h=g[1].replace(/\\/g,"");if(!p&&m.attrMap[h])g[1]=m.attrMap[h];if(g[2]==="~=")g[4]=" "+g[4]+" ";return g},PSEUDO:function(g,h,k,l,q){if(g[1]==="not")if((f.exec(g[3])||"").length>1||/^\w/.test(g[3]))g[3]=o(g[3],null,null,h);else{g=o.filter(g[3],h,k,true^q);k||l.push.apply(l,g);return false}else if(m.match.POS.test(g[0])||m.match.CHILD.test(g[0]))return true;return g},POS:function(g){g.unshift(true);
-return g}},filters:{enabled:function(g){return g.disabled===false&&g.type!=="hidden"},disabled:function(g){return g.disabled===true},checked:function(g){return g.checked===true},selected:function(g){return g.selected===true},parent:function(g){return!!g.firstChild},empty:function(g){return!g.firstChild},has:function(g,h,k){return!!o(k[3],g).length},header:function(g){return/h\d/i.test(g.nodeName)},text:function(g){return"text"===g.type},radio:function(g){return"radio"===g.type},checkbox:function(g){return"checkbox"===
-g.type},file:function(g){return"file"===g.type},password:function(g){return"password"===g.type},submit:function(g){return"submit"===g.type},image:function(g){return"image"===g.type},reset:function(g){return"reset"===g.type},button:function(g){return"button"===g.type||g.nodeName.toLowerCase()==="button"},input:function(g){return/input|select|textarea|button/i.test(g.nodeName)}},setFilters:{first:function(g,h){return h===0},last:function(g,h,k,l){return h===l.length-1},even:function(g,h){return h%2===
-0},odd:function(g,h){return h%2===1},lt:function(g,h,k){return h<k[3]-0},gt:function(g,h,k){return h>k[3]-0},nth:function(g,h,k){return k[3]-0===h},eq:function(g,h,k){return k[3]-0===h}},filter:{PSEUDO:function(g,h,k,l){var q=h[1],p=m.filters[q];if(p)return p(g,k,h,l);else if(q==="contains")return(g.textContent||g.innerText||a([g])||"").indexOf(h[3])>=0;else if(q==="not"){h=h[3];k=0;for(l=h.length;k<l;k++)if(h[k]===g)return false;return true}else o.error("Syntax error, unrecognized expression: "+
-q)},CHILD:function(g,h){var k=h[1],l=g;switch(k){case "only":case "first":for(;l=l.previousSibling;)if(l.nodeType===1)return false;if(k==="first")return true;l=g;case "last":for(;l=l.nextSibling;)if(l.nodeType===1)return false;return true;case "nth":k=h[2];var q=h[3];if(k===1&&q===0)return true;h=h[0];var p=g.parentNode;if(p&&(p.sizcache!==h||!g.nodeIndex)){var u=0;for(l=p.firstChild;l;l=l.nextSibling)if(l.nodeType===1)l.nodeIndex=++u;p.sizcache=h}g=g.nodeIndex-q;return k===0?g===0:g%k===0&&g/k>=
-0}},ID:function(g,h){return g.nodeType===1&&g.getAttribute("id")===h},TAG:function(g,h){return h==="*"&&g.nodeType===1||g.nodeName.toLowerCase()===h},CLASS:function(g,h){return(" "+(g.className||g.getAttribute("class"))+" ").indexOf(h)>-1},ATTR:function(g,h){var k=h[1];g=m.attrHandle[k]?m.attrHandle[k](g):g[k]!=null?g[k]:g.getAttribute(k);k=g+"";var l=h[2];h=h[4];return g==null?l==="!=":l==="="?k===h:l==="*="?k.indexOf(h)>=0:l==="~="?(" "+k+" ").indexOf(h)>=0:!h?k&&g!==false:l==="!="?k!==h:l==="^="?
-k.indexOf(h)===0:l==="$="?k.substr(k.length-h.length)===h:l==="|="?k===h||k.substr(0,h.length+1)===h+"-":false},POS:function(g,h,k,l){var q=m.setFilters[h[2]];if(q)return q(g,k,h,l)}}},s=m.match.POS;for(var x in m.match){m.match[x]=new RegExp(m.match[x].source+/(?![^\[]*\])(?![^\(]*\))/.source);m.leftMatch[x]=new RegExp(/(^(?:.|\r|\n)*?)/.source+m.match[x].source.replace(/\\(\d+)/g,function(g,h){return"\\"+(h-0+1)}))}var A=function(g,h){g=Array.prototype.slice.call(g,0);if(h){h.push.apply(h,g);return h}return g};
-try{Array.prototype.slice.call(r.documentElement.childNodes,0)}catch(B){A=function(g,h){h=h||[];if(i.call(g)==="[object Array]")Array.prototype.push.apply(h,g);else if(typeof g.length==="number")for(var k=0,l=g.length;k<l;k++)h.push(g[k]);else for(k=0;g[k];k++)h.push(g[k]);return h}}var C;if(r.documentElement.compareDocumentPosition)C=function(g,h){if(!g.compareDocumentPosition||!h.compareDocumentPosition){if(g==h)j=true;return g.compareDocumentPosition?-1:1}g=g.compareDocumentPosition(h)&4?-1:g===
-h?0:1;if(g===0)j=true;return g};else if("sourceIndex"in r.documentElement)C=function(g,h){if(!g.sourceIndex||!h.sourceIndex){if(g==h)j=true;return g.sourceIndex?-1:1}g=g.sourceIndex-h.sourceIndex;if(g===0)j=true;return g};else if(r.createRange)C=function(g,h){if(!g.ownerDocument||!h.ownerDocument){if(g==h)j=true;return g.ownerDocument?-1:1}var k=g.ownerDocument.createRange(),l=h.ownerDocument.createRange();k.setStart(g,0);k.setEnd(g,0);l.setStart(h,0);l.setEnd(h,0);g=k.compareBoundaryPoints(Range.START_TO_END,
-l);if(g===0)j=true;return g};(function(){var g=r.createElement("div"),h="script"+(new Date).getTime();g.innerHTML="<a name='"+h+"'/>";var k=r.documentElement;k.insertBefore(g,k.firstChild);if(r.getElementById(h)){m.find.ID=function(l,q,p){if(typeof q.getElementById!=="undefined"&&!p)return(q=q.getElementById(l[1]))?q.id===l[1]||typeof q.getAttributeNode!=="undefined"&&q.getAttributeNode("id").nodeValue===l[1]?[q]:v:[]};m.filter.ID=function(l,q){var p=typeof l.getAttributeNode!=="undefined"&&l.getAttributeNode("id");
-return l.nodeType===1&&p&&p.nodeValue===q}}k.removeChild(g);k=g=null})();(function(){var g=r.createElement("div");g.appendChild(r.createComment(""));if(g.getElementsByTagName("*").length>0)m.find.TAG=function(h,k){k=k.getElementsByTagName(h[1]);if(h[1]==="*"){h=[];for(var l=0;k[l];l++)k[l].nodeType===1&&h.push(k[l]);k=h}return k};g.innerHTML="<a href='#'></a>";if(g.firstChild&&typeof g.firstChild.getAttribute!=="undefined"&&g.firstChild.getAttribute("href")!=="#")m.attrHandle.href=function(h){return h.getAttribute("href",
-2)};g=null})();r.querySelectorAll&&function(){var g=o,h=r.createElement("div");h.innerHTML="<p class='TEST'></p>";if(!(h.querySelectorAll&&h.querySelectorAll(".TEST").length===0)){o=function(l,q,p,u){q=q||r;if(!u&&q.nodeType===9&&!w(q))try{return A(q.querySelectorAll(l),p)}catch(t){}return g(l,q,p,u)};for(var k in g)o[k]=g[k];h=null}}();(function(){var g=r.createElement("div");g.innerHTML="<div class='test e'></div><div class='test'></div>";if(!(!g.getElementsByClassName||g.getElementsByClassName("e").length===
-0)){g.lastChild.className="e";if(g.getElementsByClassName("e").length!==1){m.order.splice(1,0,"CLASS");m.find.CLASS=function(h,k,l){if(typeof k.getElementsByClassName!=="undefined"&&!l)return k.getElementsByClassName(h[1])};g=null}}})();var E=r.compareDocumentPosition?function(g,h){return g.compareDocumentPosition(h)&16}:function(g,h){return g!==h&&(g.contains?g.contains(h):true)},w=function(g){return(g=(g?g.ownerDocument||g:0).documentElement)?g.nodeName!=="HTML":false},fa=function(g,h){var k=[],
-l="",q;for(h=h.nodeType?[h]:h;q=m.match.PSEUDO.exec(g);){l+=q[0];g=g.replace(m.match.PSEUDO,"")}g=m.relative[g]?g+"*":g;q=0;for(var p=h.length;q<p;q++)o(g,h[q],k);return o.filter(l,k)};c.find=o;c.expr=o.selectors;c.expr[":"]=c.expr.filters;c.unique=o.uniqueSort;c.getText=a;c.isXMLDoc=w;c.contains=E})();var bb=/Until$/,cb=/^(?:parents|prevUntil|prevAll)/,db=/,/;Q=Array.prototype.slice;var Ea=function(a,b,d){if(c.isFunction(b))return c.grep(a,function(e,i){return!!b.call(e,i,e)===d});else if(b.nodeType)return c.grep(a,
-function(e){return e===b===d});else if(typeof b==="string"){var f=c.grep(a,function(e){return e.nodeType===1});if(Qa.test(b))return c.filter(b,f,!d);else b=c.filter(b,f)}return c.grep(a,function(e){return c.inArray(e,b)>=0===d})};c.fn.extend({find:function(a){for(var b=this.pushStack("","find",a),d=0,f=0,e=this.length;f<e;f++){d=b.length;c.find(a,this[f],b);if(f>0)for(var i=d;i<b.length;i++)for(var j=0;j<d;j++)if(b[j]===b[i]){b.splice(i--,1);break}}return b},has:function(a){var b=c(a);return this.filter(function(){for(var d=
-0,f=b.length;d<f;d++)if(c.contains(this,b[d]))return true})},not:function(a){return this.pushStack(Ea(this,a,false),"not",a)},filter:function(a){return this.pushStack(Ea(this,a,true),"filter",a)},is:function(a){return!!a&&c.filter(a,this).length>0},closest:function(a,b){if(c.isArray(a)){var d=[],f=this[0],e,i={},j;if(f&&a.length){e=0;for(var n=a.length;e<n;e++){j=a[e];i[j]||(i[j]=c.expr.match.POS.test(j)?c(j,b||this.context):j)}for(;f&&f.ownerDocument&&f!==b;){for(j in i){e=i[j];if(e.jquery?e.index(f)>
--1:c(f).is(e)){d.push({selector:j,elem:f});delete i[j]}}f=f.parentNode}}return d}var o=c.expr.match.POS.test(a)?c(a,b||this.context):null;return this.map(function(m,s){for(;s&&s.ownerDocument&&s!==b;){if(o?o.index(s)>-1:c(s).is(a))return s;s=s.parentNode}return null})},index:function(a){if(!a||typeof a==="string")return c.inArray(this[0],a?c(a):this.parent().children());return c.inArray(a.jquery?a[0]:a,this)},add:function(a,b){a=typeof a==="string"?c(a,b||this.context):c.makeArray(a);b=c.merge(this.get(),
-a);return this.pushStack(pa(a[0])||pa(b[0])?b:c.unique(b))},andSelf:function(){return this.add(this.prevObject)}});c.each({parent:function(a){return(a=a.parentNode)&&a.nodeType!==11?a:null},parents:function(a){return c.dir(a,"parentNode")},parentsUntil:function(a,b,d){return c.dir(a,"parentNode",d)},next:function(a){return c.nth(a,2,"nextSibling")},prev:function(a){return c.nth(a,2,"previousSibling")},nextAll:function(a){return c.dir(a,"nextSibling")},prevAll:function(a){return c.dir(a,"previousSibling")},
-nextUntil:function(a,b,d){return c.dir(a,"nextSibling",d)},prevUntil:function(a,b,d){return c.dir(a,"previousSibling",d)},siblings:function(a){return c.sibling(a.parentNode.firstChild,a)},children:function(a){return c.sibling(a.firstChild)},contents:function(a){return c.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:c.makeArray(a.childNodes)}},function(a,b){c.fn[a]=function(d,f){var e=c.map(this,b,d);bb.test(a)||(f=d);if(f&&typeof f==="string")e=c.filter(f,e);e=this.length>1?c.unique(e):
-e;if((this.length>1||db.test(f))&&cb.test(a))e=e.reverse();return this.pushStack(e,a,Q.call(arguments).join(","))}});c.extend({filter:function(a,b,d){if(d)a=":not("+a+")";return c.find.matches(a,b)},dir:function(a,b,d){var f=[];for(a=a[b];a&&a.nodeType!==9&&(d===v||a.nodeType!==1||!c(a).is(d));){a.nodeType===1&&f.push(a);a=a[b]}return f},nth:function(a,b,d){b=b||1;for(var f=0;a;a=a[d])if(a.nodeType===1&&++f===b)break;return a},sibling:function(a,b){for(var d=[];a;a=a.nextSibling)a.nodeType===1&&a!==
-b&&d.push(a);return d}});var Fa=/ jQuery\d+="(?:\d+|null)"/g,V=/^\s+/,Ga=/(<([\w:]+)[^>]*?)\/>/g,eb=/^(?:area|br|col|embed|hr|img|input|link|meta|param)$/i,Ha=/<([\w:]+)/,fb=/<tbody/i,gb=/<|&\w+;/,sa=/checked\s*(?:[^=]|=\s*.checked.)/i,Ia=function(a,b,d){return eb.test(d)?a:b+"></"+d+">"},F={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],
-col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};F.optgroup=F.option;F.tbody=F.tfoot=F.colgroup=F.caption=F.thead;F.th=F.td;if(!c.support.htmlSerialize)F._default=[1,"div<div>","</div>"];c.fn.extend({text:function(a){if(c.isFunction(a))return this.each(function(b){var d=c(this);d.text(a.call(this,b,d.text()))});if(typeof a!=="object"&&a!==v)return this.empty().append((this[0]&&this[0].ownerDocument||r).createTextNode(a));return c.getText(this)},
-wrapAll:function(a){if(c.isFunction(a))return this.each(function(d){c(this).wrapAll(a.call(this,d))});if(this[0]){var b=c(a,this[0].ownerDocument).eq(0).clone(true);this[0].parentNode&&b.insertBefore(this[0]);b.map(function(){for(var d=this;d.firstChild&&d.firstChild.nodeType===1;)d=d.firstChild;return d}).append(this)}return this},wrapInner:function(a){if(c.isFunction(a))return this.each(function(b){c(this).wrapInner(a.call(this,b))});return this.each(function(){var b=c(this),d=b.contents();d.length?
-d.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){c(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){c.nodeName(this,"body")||c(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,
-false,function(b){this.parentNode.insertBefore(b,this)});else if(arguments.length){var a=c(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,this.nextSibling)});else if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,c(arguments[0]).toArray());return a}},clone:function(a){var b=this.map(function(){if(!c.support.noCloneEvent&&
-!c.isXMLDoc(this)){var d=this.outerHTML,f=this.ownerDocument;if(!d){d=f.createElement("div");d.appendChild(this.cloneNode(true));d=d.innerHTML}return c.clean([d.replace(Fa,"").replace(V,"")],f)[0]}else return this.cloneNode(true)});if(a===true){qa(this,b);qa(this.find("*"),b.find("*"))}return b},html:function(a){if(a===v)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(Fa,""):null;else if(typeof a==="string"&&!/<script/i.test(a)&&(c.support.leadingWhitespace||!V.test(a))&&!F[(Ha.exec(a)||
-["",""])[1].toLowerCase()]){a=a.replace(Ga,Ia);try{for(var b=0,d=this.length;b<d;b++)if(this[b].nodeType===1){c.cleanData(this[b].getElementsByTagName("*"));this[b].innerHTML=a}}catch(f){this.empty().append(a)}}else c.isFunction(a)?this.each(function(e){var i=c(this),j=i.html();i.empty().append(function(){return a.call(this,e,j)})}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(c.isFunction(a))return this.each(function(b){var d=c(this),f=d.html();d.replaceWith(a.call(this,
-b,f))});else a=c(a).detach();return this.each(function(){var b=this.nextSibling,d=this.parentNode;c(this).remove();b?c(b).before(a):c(d).append(a)})}else return this.pushStack(c(c.isFunction(a)?a():a),"replaceWith",a)},detach:function(a){return this.remove(a,true)},domManip:function(a,b,d){function f(s){return c.nodeName(s,"table")?s.getElementsByTagName("tbody")[0]||s.appendChild(s.ownerDocument.createElement("tbody")):s}var e,i,j=a[0],n=[];if(!c.support.checkClone&&arguments.length===3&&typeof j===
-"string"&&sa.test(j))return this.each(function(){c(this).domManip(a,b,d,true)});if(c.isFunction(j))return this.each(function(s){var x=c(this);a[0]=j.call(this,s,b?x.html():v);x.domManip(a,b,d)});if(this[0]){e=a[0]&&a[0].parentNode&&a[0].parentNode.nodeType===11?{fragment:a[0].parentNode}:ra(a,this,n);if(i=e.fragment.firstChild){b=b&&c.nodeName(i,"tr");for(var o=0,m=this.length;o<m;o++)d.call(b?f(this[o],i):this[o],e.cacheable||this.length>1||o>0?e.fragment.cloneNode(true):e.fragment)}n&&c.each(n,
-Ma)}return this}});c.fragments={};c.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){c.fn[a]=function(d){var f=[];d=c(d);for(var e=0,i=d.length;e<i;e++){var j=(e>0?this.clone(true):this).get();c.fn[b].apply(c(d[e]),j);f=f.concat(j)}return this.pushStack(f,a,d.selector)}});c.each({remove:function(a,b){if(!a||c.filter(a,[this]).length){if(!b&&this.nodeType===1){c.cleanData(this.getElementsByTagName("*"));c.cleanData([this])}this.parentNode&&
-this.parentNode.removeChild(this)}},empty:function(){for(this.nodeType===1&&c.cleanData(this.getElementsByTagName("*"));this.firstChild;)this.removeChild(this.firstChild)}},function(a,b){c.fn[a]=function(){return this.each(b,arguments)}});c.extend({clean:function(a,b,d,f){b=b||r;if(typeof b.createElement==="undefined")b=b.ownerDocument||b[0]&&b[0].ownerDocument||r;var e=[];c.each(a,function(i,j){if(typeof j==="number")j+="";if(j){if(typeof j==="string"&&!gb.test(j))j=b.createTextNode(j);else if(typeof j===
-"string"){j=j.replace(Ga,Ia);var n=(Ha.exec(j)||["",""])[1].toLowerCase(),o=F[n]||F._default,m=o[0];i=b.createElement("div");for(i.innerHTML=o[1]+j+o[2];m--;)i=i.lastChild;if(!c.support.tbody){m=fb.test(j);n=n==="table"&&!m?i.firstChild&&i.firstChild.childNodes:o[1]==="<table>"&&!m?i.childNodes:[];for(o=n.length-1;o>=0;--o)c.nodeName(n[o],"tbody")&&!n[o].childNodes.length&&n[o].parentNode.removeChild(n[o])}!c.support.leadingWhitespace&&V.test(j)&&i.insertBefore(b.createTextNode(V.exec(j)[0]),i.firstChild);
-j=c.makeArray(i.childNodes)}if(j.nodeType)e.push(j);else e=c.merge(e,j)}});if(d)for(a=0;e[a];a++)if(f&&c.nodeName(e[a],"script")&&(!e[a].type||e[a].type.toLowerCase()==="text/javascript"))f.push(e[a].parentNode?e[a].parentNode.removeChild(e[a]):e[a]);else{e[a].nodeType===1&&e.splice.apply(e,[a+1,0].concat(c.makeArray(e[a].getElementsByTagName("script"))));d.appendChild(e[a])}return e},cleanData:function(a){for(var b=0,d;(d=a[b])!=null;b++){c.event.remove(d);c.removeData(d)}}});var hb=/z-?index|font-?weight|opacity|zoom|line-?height/i,
-Ja=/alpha\([^)]*\)/,Ka=/opacity=([^)]*)/,ga=/float/i,ha=/-([a-z])/ig,ib=/([A-Z])/g,jb=/^-?\d+(?:px)?$/i,kb=/^-?\d/,lb={position:"absolute",visibility:"hidden",display:"block"},mb=["Left","Right"],nb=["Top","Bottom"],ob=r.defaultView&&r.defaultView.getComputedStyle,La=c.support.cssFloat?"cssFloat":"styleFloat",ia=function(a,b){return b.toUpperCase()};c.fn.css=function(a,b){return X(this,a,b,true,function(d,f,e){if(e===v)return c.curCSS(d,f);if(typeof e==="number"&&!hb.test(f))e+="px";c.style(d,f,e)})};
-c.extend({style:function(a,b,d){if(!a||a.nodeType===3||a.nodeType===8)return v;if((b==="width"||b==="height")&&parseFloat(d)<0)d=v;var f=a.style||a,e=d!==v;if(!c.support.opacity&&b==="opacity"){if(e){f.zoom=1;b=parseInt(d,10)+""==="NaN"?"":"alpha(opacity="+d*100+")";a=f.filter||c.curCSS(a,"filter")||"";f.filter=Ja.test(a)?a.replace(Ja,b):b}return f.filter&&f.filter.indexOf("opacity=")>=0?parseFloat(Ka.exec(f.filter)[1])/100+"":""}if(ga.test(b))b=La;b=b.replace(ha,ia);if(e)f[b]=d;return f[b]},css:function(a,
-b,d,f){if(b==="width"||b==="height"){var e,i=b==="width"?mb:nb;function j(){e=b==="width"?a.offsetWidth:a.offsetHeight;f!=="border"&&c.each(i,function(){f||(e-=parseFloat(c.curCSS(a,"padding"+this,true))||0);if(f==="margin")e+=parseFloat(c.curCSS(a,"margin"+this,true))||0;else e-=parseFloat(c.curCSS(a,"border"+this+"Width",true))||0})}a.offsetWidth!==0?j():c.swap(a,lb,j);return Math.max(0,Math.round(e))}return c.curCSS(a,b,d)},curCSS:function(a,b,d){var f,e=a.style;if(!c.support.opacity&&b==="opacity"&&
-a.currentStyle){f=Ka.test(a.currentStyle.filter||"")?parseFloat(RegExp.$1)/100+"":"";return f===""?"1":f}if(ga.test(b))b=La;if(!d&&e&&e[b])f=e[b];else if(ob){if(ga.test(b))b="float";b=b.replace(ib,"-$1").toLowerCase();e=a.ownerDocument.defaultView;if(!e)return null;if(a=e.getComputedStyle(a,null))f=a.getPropertyValue(b);if(b==="opacity"&&f==="")f="1"}else if(a.currentStyle){d=b.replace(ha,ia);f=a.currentStyle[b]||a.currentStyle[d];if(!jb.test(f)&&kb.test(f)){b=e.left;var i=a.runtimeStyle.left;a.runtimeStyle.left=
-a.currentStyle.left;e.left=d==="fontSize"?"1em":f||0;f=e.pixelLeft+"px";e.left=b;a.runtimeStyle.left=i}}return f},swap:function(a,b,d){var f={};for(var e in b){f[e]=a.style[e];a.style[e]=b[e]}d.call(a);for(e in b)a.style[e]=f[e]}});if(c.expr&&c.expr.filters){c.expr.filters.hidden=function(a){var b=a.offsetWidth,d=a.offsetHeight,f=a.nodeName.toLowerCase()==="tr";return b===0&&d===0&&!f?true:b>0&&d>0&&!f?false:c.curCSS(a,"display")==="none"};c.expr.filters.visible=function(a){return!c.expr.filters.hidden(a)}}var pb=
-J(),qb=/<script(.|\s)*?\/script>/gi,rb=/select|textarea/i,sb=/color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week/i,N=/=\?(&|$)/,ja=/\?/,tb=/(\?|&)_=.*?(&|$)/,ub=/^(\w+:)?\/\/([^\/?#]+)/,vb=/%20/g;c.fn.extend({_load:c.fn.load,load:function(a,b,d){if(typeof a!=="string")return this._load(a);else if(!this.length)return this;var f=a.indexOf(" ");if(f>=0){var e=a.slice(f,a.length);a=a.slice(0,f)}f="GET";if(b)if(c.isFunction(b)){d=b;b=null}else if(typeof b==="object"){b=
-c.param(b,c.ajaxSettings.traditional);f="POST"}var i=this;c.ajax({url:a,type:f,dataType:"html",data:b,complete:function(j,n){if(n==="success"||n==="notmodified")i.html(e?c("<div />").append(j.responseText.replace(qb,"")).find(e):j.responseText);d&&i.each(d,[j.responseText,n,j])}});return this},serialize:function(){return c.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?c.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&
-(this.checked||rb.test(this.nodeName)||sb.test(this.type))}).map(function(a,b){a=c(this).val();return a==null?null:c.isArray(a)?c.map(a,function(d){return{name:b.name,value:d}}):{name:b.name,value:a}}).get()}});c.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){c.fn[b]=function(d){return this.bind(b,d)}});c.extend({get:function(a,b,d,f){if(c.isFunction(b)){f=f||d;d=b;b=null}return c.ajax({type:"GET",url:a,data:b,success:d,dataType:f})},getScript:function(a,
-b){return c.get(a,null,b,"script")},getJSON:function(a,b,d){return c.get(a,b,d,"json")},post:function(a,b,d,f){if(c.isFunction(b)){f=f||d;d=b;b={}}return c.ajax({type:"POST",url:a,data:b,success:d,dataType:f})},ajaxSetup:function(a){c.extend(c.ajaxSettings,a)},ajaxSettings:{url:location.href,global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:z.XMLHttpRequest&&(z.location.protocol!=="file:"||!z.ActiveXObject)?function(){return new z.XMLHttpRequest}:
-function(){try{return new z.ActiveXObject("Microsoft.XMLHTTP")}catch(a){}},accepts:{xml:"application/xml, text/xml",html:"text/html",script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},lastModified:{},etag:{},ajax:function(a){function b(){e.success&&e.success.call(o,n,j,w);e.global&&f("ajaxSuccess",[w,e])}function d(){e.complete&&e.complete.call(o,w,j);e.global&&f("ajaxComplete",[w,e]);e.global&&!--c.active&&c.event.trigger("ajaxStop")}
-function f(q,p){(e.context?c(e.context):c.event).trigger(q,p)}var e=c.extend(true,{},c.ajaxSettings,a),i,j,n,o=a&&a.context||e,m=e.type.toUpperCase();if(e.data&&e.processData&&typeof e.data!=="string")e.data=c.param(e.data,e.traditional);if(e.dataType==="jsonp"){if(m==="GET")N.test(e.url)||(e.url+=(ja.test(e.url)?"&":"?")+(e.jsonp||"callback")+"=?");else if(!e.data||!N.test(e.data))e.data=(e.data?e.data+"&":"")+(e.jsonp||"callback")+"=?";e.dataType="json"}if(e.dataType==="json"&&(e.data&&N.test(e.data)||
-N.test(e.url))){i=e.jsonpCallback||"jsonp"+pb++;if(e.data)e.data=(e.data+"").replace(N,"="+i+"$1");e.url=e.url.replace(N,"="+i+"$1");e.dataType="script";z[i]=z[i]||function(q){n=q;b();d();z[i]=v;try{delete z[i]}catch(p){}A&&A.removeChild(B)}}if(e.dataType==="script"&&e.cache===null)e.cache=false;if(e.cache===false&&m==="GET"){var s=J(),x=e.url.replace(tb,"$1_="+s+"$2");e.url=x+(x===e.url?(ja.test(e.url)?"&":"?")+"_="+s:"")}if(e.data&&m==="GET")e.url+=(ja.test(e.url)?"&":"?")+e.data;e.global&&!c.active++&&
-c.event.trigger("ajaxStart");s=(s=ub.exec(e.url))&&(s[1]&&s[1]!==location.protocol||s[2]!==location.host);if(e.dataType==="script"&&m==="GET"&&s){var A=r.getElementsByTagName("head")[0]||r.documentElement,B=r.createElement("script");B.src=e.url;if(e.scriptCharset)B.charset=e.scriptCharset;if(!i){var C=false;B.onload=B.onreadystatechange=function(){if(!C&&(!this.readyState||this.readyState==="loaded"||this.readyState==="complete")){C=true;b();d();B.onload=B.onreadystatechange=null;A&&B.parentNode&&
-A.removeChild(B)}}}A.insertBefore(B,A.firstChild);return v}var E=false,w=e.xhr();if(w){e.username?w.open(m,e.url,e.async,e.username,e.password):w.open(m,e.url,e.async);try{if(e.data||a&&a.contentType)w.setRequestHeader("Content-Type",e.contentType);if(e.ifModified){c.lastModified[e.url]&&w.setRequestHeader("If-Modified-Since",c.lastModified[e.url]);c.etag[e.url]&&w.setRequestHeader("If-None-Match",c.etag[e.url])}s||w.setRequestHeader("X-Requested-With","XMLHttpRequest");w.setRequestHeader("Accept",
-e.dataType&&e.accepts[e.dataType]?e.accepts[e.dataType]+", */*":e.accepts._default)}catch(fa){}if(e.beforeSend&&e.beforeSend.call(o,w,e)===false){e.global&&!--c.active&&c.event.trigger("ajaxStop");w.abort();return false}e.global&&f("ajaxSend",[w,e]);var g=w.onreadystatechange=function(q){if(!w||w.readyState===0||q==="abort"){E||d();E=true;if(w)w.onreadystatechange=c.noop}else if(!E&&w&&(w.readyState===4||q==="timeout")){E=true;w.onreadystatechange=c.noop;j=q==="timeout"?"timeout":!c.httpSuccess(w)?
-"error":e.ifModified&&c.httpNotModified(w,e.url)?"notmodified":"success";var p;if(j==="success")try{n=c.httpData(w,e.dataType,e)}catch(u){j="parsererror";p=u}if(j==="success"||j==="notmodified")i||b();else c.handleError(e,w,j,p);d();q==="timeout"&&w.abort();if(e.async)w=null}};try{var h=w.abort;w.abort=function(){w&&h.call(w);g("abort")}}catch(k){}e.async&&e.timeout>0&&setTimeout(function(){w&&!E&&g("timeout")},e.timeout);try{w.send(m==="POST"||m==="PUT"||m==="DELETE"?e.data:null)}catch(l){c.handleError(e,
-w,null,l);d()}e.async||g();return w}},handleError:function(a,b,d,f){if(a.error)a.error.call(a.context||a,b,d,f);if(a.global)(a.context?c(a.context):c.event).trigger("ajaxError",[b,a,f])},active:0,httpSuccess:function(a){try{return!a.status&&location.protocol==="file:"||a.status>=200&&a.status<300||a.status===304||a.status===1223||a.status===0}catch(b){}return false},httpNotModified:function(a,b){var d=a.getResponseHeader("Last-Modified"),f=a.getResponseHeader("Etag");if(d)c.lastModified[b]=d;if(f)c.etag[b]=
-f;return a.status===304||a.status===0},httpData:function(a,b,d){var f=a.getResponseHeader("content-type")||"",e=b==="xml"||!b&&f.indexOf("xml")>=0;a=e?a.responseXML:a.responseText;e&&a.documentElement.nodeName==="parsererror"&&c.error("parsererror");if(d&&d.dataFilter)a=d.dataFilter(a,b);if(typeof a==="string")if(b==="json"||!b&&f.indexOf("json")>=0)a=c.parseJSON(a);else if(b==="script"||!b&&f.indexOf("javascript")>=0)c.globalEval(a);return a},param:function(a,b){function d(j,n){if(c.isArray(n))c.each(n,
-function(o,m){b?f(j,m):d(j+"["+(typeof m==="object"||c.isArray(m)?o:"")+"]",m)});else!b&&n!=null&&typeof n==="object"?c.each(n,function(o,m){d(j+"["+o+"]",m)}):f(j,n)}function f(j,n){n=c.isFunction(n)?n():n;e[e.length]=encodeURIComponent(j)+"="+encodeURIComponent(n)}var e=[];if(b===v)b=c.ajaxSettings.traditional;if(c.isArray(a)||a.jquery)c.each(a,function(){f(this.name,this.value)});else for(var i in a)d(i,a[i]);return e.join("&").replace(vb,"+")}});var ka={},wb=/toggle|show|hide/,xb=/^([+-]=)?([\d+-.]+)(.*)$/,
-W,ta=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];c.fn.extend({show:function(a,b){if(a||a===0)return this.animate(K("show",3),a,b);else{a=0;for(b=this.length;a<b;a++){var d=c.data(this[a],"olddisplay");this[a].style.display=d||"";if(c.css(this[a],"display")==="none"){d=this[a].nodeName;var f;if(ka[d])f=ka[d];else{var e=c("<"+d+" />").appendTo("body");f=e.css("display");if(f==="none")f="block";e.remove();
-ka[d]=f}c.data(this[a],"olddisplay",f)}}a=0;for(b=this.length;a<b;a++)this[a].style.display=c.data(this[a],"olddisplay")||"";return this}},hide:function(a,b){if(a||a===0)return this.animate(K("hide",3),a,b);else{a=0;for(b=this.length;a<b;a++){var d=c.data(this[a],"olddisplay");!d&&d!=="none"&&c.data(this[a],"olddisplay",c.css(this[a],"display"))}a=0;for(b=this.length;a<b;a++)this[a].style.display="none";return this}},_toggle:c.fn.toggle,toggle:function(a,b){var d=typeof a==="boolean";if(c.isFunction(a)&&
-c.isFunction(b))this._toggle.apply(this,arguments);else a==null||d?this.each(function(){var f=d?a:c(this).is(":hidden");c(this)[f?"show":"hide"]()}):this.animate(K("toggle",3),a,b);return this},fadeTo:function(a,b,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,d)},animate:function(a,b,d,f){var e=c.speed(b,d,f);if(c.isEmptyObject(a))return this.each(e.complete);return this[e.queue===false?"each":"queue"](function(){var i=c.extend({},e),j,n=this.nodeType===1&&c(this).is(":hidden"),
-o=this;for(j in a){var m=j.replace(ha,ia);if(j!==m){a[m]=a[j];delete a[j];j=m}if(a[j]==="hide"&&n||a[j]==="show"&&!n)return i.complete.call(this);if((j==="height"||j==="width")&&this.style){i.display=c.css(this,"display");i.overflow=this.style.overflow}if(c.isArray(a[j])){(i.specialEasing=i.specialEasing||{})[j]=a[j][1];a[j]=a[j][0]}}if(i.overflow!=null)this.style.overflow="hidden";i.curAnim=c.extend({},a);c.each(a,function(s,x){var A=new c.fx(o,i,s);if(wb.test(x))A[x==="toggle"?n?"show":"hide":x](a);
-else{var B=xb.exec(x),C=A.cur(true)||0;if(B){x=parseFloat(B[2]);var E=B[3]||"px";if(E!=="px"){o.style[s]=(x||1)+E;C=(x||1)/A.cur(true)*C;o.style[s]=C+E}if(B[1])x=(B[1]==="-="?-1:1)*x+C;A.custom(C,x,E)}else A.custom(C,x,"")}});return true})},stop:function(a,b){var d=c.timers;a&&this.queue([]);this.each(function(){for(var f=d.length-1;f>=0;f--)if(d[f].elem===this){b&&d[f](true);d.splice(f,1)}});b||this.dequeue();return this}});c.each({slideDown:K("show",1),slideUp:K("hide",1),slideToggle:K("toggle",
-1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"}},function(a,b){c.fn[a]=function(d,f){return this.animate(b,d,f)}});c.extend({speed:function(a,b,d){var f=a&&typeof a==="object"?a:{complete:d||!d&&b||c.isFunction(a)&&a,duration:a,easing:d&&b||b&&!c.isFunction(b)&&b};f.duration=c.fx.off?0:typeof f.duration==="number"?f.duration:c.fx.speeds[f.duration]||c.fx.speeds._default;f.old=f.complete;f.complete=function(){f.queue!==false&&c(this).dequeue();c.isFunction(f.old)&&f.old.call(this)};return f},easing:{linear:function(a,
-b,d,f){return d+f*a},swing:function(a,b,d,f){return(-Math.cos(a*Math.PI)/2+0.5)*f+d}},timers:[],fx:function(a,b,d){this.options=b;this.elem=a;this.prop=d;if(!b.orig)b.orig={}}});c.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this);(c.fx.step[this.prop]||c.fx.step._default)(this);if((this.prop==="height"||this.prop==="width")&&this.elem.style)this.elem.style.display="block"},cur:function(a){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==
-null))return this.elem[this.prop];return(a=parseFloat(c.css(this.elem,this.prop,a)))&&a>-10000?a:parseFloat(c.curCSS(this.elem,this.prop))||0},custom:function(a,b,d){function f(i){return e.step(i)}this.startTime=J();this.start=a;this.end=b;this.unit=d||this.unit||"px";this.now=this.start;this.pos=this.state=0;var e=this;f.elem=this.elem;if(f()&&c.timers.push(f)&&!W)W=setInterval(c.fx.tick,13)},show:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.show=true;this.custom(this.prop===
-"width"||this.prop==="height"?1:0,this.cur());c(this.elem).show()},hide:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(a){var b=J(),d=true;if(a||b>=this.options.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;for(var f in this.options.curAnim)if(this.options.curAnim[f]!==true)d=false;if(d){if(this.options.display!=null){this.elem.style.overflow=
-this.options.overflow;a=c.data(this.elem,"olddisplay");this.elem.style.display=a?a:this.options.display;if(c.css(this.elem,"display")==="none")this.elem.style.display="block"}this.options.hide&&c(this.elem).hide();if(this.options.hide||this.options.show)for(var e in this.options.curAnim)c.style(this.elem,e,this.options.orig[e]);this.options.complete.call(this.elem)}return false}else{e=b-this.startTime;this.state=e/this.options.duration;a=this.options.easing||(c.easing.swing?"swing":"linear");this.pos=
-c.easing[this.options.specialEasing&&this.options.specialEasing[this.prop]||a](this.state,e,0,1,this.options.duration);this.now=this.start+(this.end-this.start)*this.pos;this.update()}return true}};c.extend(c.fx,{tick:function(){for(var a=c.timers,b=0;b<a.length;b++)a[b]()||a.splice(b--,1);a.length||c.fx.stop()},stop:function(){clearInterval(W);W=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){c.style(a.elem,"opacity",a.now)},_default:function(a){if(a.elem.style&&a.elem.style[a.prop]!=
-null)a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit;else a.elem[a.prop]=a.now}}});if(c.expr&&c.expr.filters)c.expr.filters.animated=function(a){return c.grep(c.timers,function(b){return a===b.elem}).length};c.fn.offset="getBoundingClientRect"in r.documentElement?function(a){var b=this[0];if(a)return this.each(function(e){c.offset.setOffset(this,a,e)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);var d=b.getBoundingClientRect(),
-f=b.ownerDocument;b=f.body;f=f.documentElement;return{top:d.top+(self.pageYOffset||c.support.boxModel&&f.scrollTop||b.scrollTop)-(f.clientTop||b.clientTop||0),left:d.left+(self.pageXOffset||c.support.boxModel&&f.scrollLeft||b.scrollLeft)-(f.clientLeft||b.clientLeft||0)}}:function(a){var b=this[0];if(a)return this.each(function(s){c.offset.setOffset(this,a,s)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);c.offset.initialize();var d=b.offsetParent,f=
-b,e=b.ownerDocument,i,j=e.documentElement,n=e.body;f=(e=e.defaultView)?e.getComputedStyle(b,null):b.currentStyle;for(var o=b.offsetTop,m=b.offsetLeft;(b=b.parentNode)&&b!==n&&b!==j;){if(c.offset.supportsFixedPosition&&f.position==="fixed")break;i=e?e.getComputedStyle(b,null):b.currentStyle;o-=b.scrollTop;m-=b.scrollLeft;if(b===d){o+=b.offsetTop;m+=b.offsetLeft;if(c.offset.doesNotAddBorder&&!(c.offset.doesAddBorderForTableAndCells&&/^t(able|d|h)$/i.test(b.nodeName))){o+=parseFloat(i.borderTopWidth)||
-0;m+=parseFloat(i.borderLeftWidth)||0}f=d;d=b.offsetParent}if(c.offset.subtractsBorderForOverflowNotVisible&&i.overflow!=="visible"){o+=parseFloat(i.borderTopWidth)||0;m+=parseFloat(i.borderLeftWidth)||0}f=i}if(f.position==="relative"||f.position==="static"){o+=n.offsetTop;m+=n.offsetLeft}if(c.offset.supportsFixedPosition&&f.position==="fixed"){o+=Math.max(j.scrollTop,n.scrollTop);m+=Math.max(j.scrollLeft,n.scrollLeft)}return{top:o,left:m}};c.offset={initialize:function(){var a=r.body,b=r.createElement("div"),
-d,f,e,i=parseFloat(c.curCSS(a,"marginTop",true))||0;c.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"});b.innerHTML="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";a.insertBefore(b,a.firstChild);
-d=b.firstChild;f=d.firstChild;e=d.nextSibling.firstChild.firstChild;this.doesNotAddBorder=f.offsetTop!==5;this.doesAddBorderForTableAndCells=e.offsetTop===5;f.style.position="fixed";f.style.top="20px";this.supportsFixedPosition=f.offsetTop===20||f.offsetTop===15;f.style.position=f.style.top="";d.style.overflow="hidden";d.style.position="relative";this.subtractsBorderForOverflowNotVisible=f.offsetTop===-5;this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==i;a.removeChild(b);c.offset.initialize=c.noop},
-bodyOffset:function(a){var b=a.offsetTop,d=a.offsetLeft;c.offset.initialize();if(c.offset.doesNotIncludeMarginInBodyOffset){b+=parseFloat(c.curCSS(a,"marginTop",true))||0;d+=parseFloat(c.curCSS(a,"marginLeft",true))||0}return{top:b,left:d}},setOffset:function(a,b,d){if(/static/.test(c.curCSS(a,"position")))a.style.position="relative";var f=c(a),e=f.offset(),i=parseInt(c.curCSS(a,"top",true),10)||0,j=parseInt(c.curCSS(a,"left",true),10)||0;if(c.isFunction(b))b=b.call(a,d,e);d={top:b.top-e.top+i,left:b.left-
-e.left+j};"using"in b?b.using.call(a,d):f.css(d)}};c.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),d=this.offset(),f=/^body|html$/i.test(b[0].nodeName)?{top:0,left:0}:b.offset();d.top-=parseFloat(c.curCSS(a,"marginTop",true))||0;d.left-=parseFloat(c.curCSS(a,"marginLeft",true))||0;f.top+=parseFloat(c.curCSS(b[0],"borderTopWidth",true))||0;f.left+=parseFloat(c.curCSS(b[0],"borderLeftWidth",true))||0;return{top:d.top-f.top,left:d.left-f.left}},offsetParent:function(){return this.map(function(){for(var a=
-this.offsetParent||r.body;a&&!/^body|html$/i.test(a.nodeName)&&c.css(a,"position")==="static";)a=a.offsetParent;return a})}});c.each(["Left","Top"],function(a,b){var d="scroll"+b;c.fn[d]=function(f){var e=this[0],i;if(!e)return null;if(f!==v)return this.each(function(){if(i=ua(this))i.scrollTo(!a?f:c(i).scrollLeft(),a?f:c(i).scrollTop());else this[d]=f});else return(i=ua(e))?"pageXOffset"in i?i[a?"pageYOffset":"pageXOffset"]:c.support.boxModel&&i.document.documentElement[d]||i.document.body[d]:e[d]}});
-c.each(["Height","Width"],function(a,b){var d=b.toLowerCase();c.fn["inner"+b]=function(){return this[0]?c.css(this[0],d,false,"padding"):null};c.fn["outer"+b]=function(f){return this[0]?c.css(this[0],d,false,f?"margin":"border"):null};c.fn[d]=function(f){var e=this[0];if(!e)return f==null?null:this;if(c.isFunction(f))return this.each(function(i){var j=c(this);j[d](f.call(this,i,j[d]()))});return"scrollTo"in e&&e.document?e.document.compatMode==="CSS1Compat"&&e.document.documentElement["client"+b]||
-e.document.body["client"+b]:e.nodeType===9?Math.max(e.documentElement["client"+b],e.body["scroll"+b],e.documentElement["scroll"+b],e.body["offset"+b],e.documentElement["offset"+b]):f===v?c.css(e,d):this.css(d,typeof f==="string"?f:f+"px")}});z.jQuery=z.$=c})(window);
+(function(A,w){function ma(){if(!c.isReady){try{s.documentElement.doScroll("left")}catch(a){setTimeout(ma,1);return}c.ready()}}function Qa(a,b){b.src?c.ajax({url:b.src,async:false,dataType:"script"}):c.globalEval(b.text||b.textContent||b.innerHTML||"");b.parentNode&&b.parentNode.removeChild(b)}function X(a,b,d,f,e,j){var i=a.length;if(typeof b==="object"){for(var o in b)X(a,o,b[o],f,e,d);return a}if(d!==w){f=!j&&f&&c.isFunction(d);for(o=0;o<i;o++)e(a[o],b,f?d.call(a[o],o,e(a[o],b)):d,j);return a}return i?
+e(a[0],b):w}function J(){return(new Date).getTime()}function Y(){return false}function Z(){return true}function na(a,b,d){d[0].type=a;return c.event.handle.apply(b,d)}function oa(a){var b,d=[],f=[],e=arguments,j,i,o,k,n,r;i=c.data(this,"events");if(!(a.liveFired===this||!i||!i.live||a.button&&a.type==="click")){a.liveFired=this;var u=i.live.slice(0);for(k=0;k<u.length;k++){i=u[k];i.origType.replace(O,"")===a.type?f.push(i.selector):u.splice(k--,1)}j=c(a.target).closest(f,a.currentTarget);n=0;for(r=
+j.length;n<r;n++)for(k=0;k<u.length;k++){i=u[k];if(j[n].selector===i.selector){o=j[n].elem;f=null;if(i.preType==="mouseenter"||i.preType==="mouseleave")f=c(a.relatedTarget).closest(i.selector)[0];if(!f||f!==o)d.push({elem:o,handleObj:i})}}n=0;for(r=d.length;n<r;n++){j=d[n];a.currentTarget=j.elem;a.data=j.handleObj.data;a.handleObj=j.handleObj;if(j.handleObj.origHandler.apply(j.elem,e)===false){b=false;break}}return b}}function pa(a,b){return"live."+(a&&a!=="*"?a+".":"")+b.replace(/\./g,"`").replace(/ /g,
+"&")}function qa(a){return!a||!a.parentNode||a.parentNode.nodeType===11}function ra(a,b){var d=0;b.each(function(){if(this.nodeName===(a[d]&&a[d].nodeName)){var f=c.data(a[d++]),e=c.data(this,f);if(f=f&&f.events){delete e.handle;e.events={};for(var j in f)for(var i in f[j])c.event.add(this,j,f[j][i],f[j][i].data)}}})}function sa(a,b,d){var f,e,j;b=b&&b[0]?b[0].ownerDocument||b[0]:s;if(a.length===1&&typeof a[0]==="string"&&a[0].length<512&&b===s&&!ta.test(a[0])&&(c.support.checkClone||!ua.test(a[0]))){e=
+true;if(j=c.fragments[a[0]])if(j!==1)f=j}if(!f){f=b.createDocumentFragment();c.clean(a,b,f,d)}if(e)c.fragments[a[0]]=j?f:1;return{fragment:f,cacheable:e}}function K(a,b){var d={};c.each(va.concat.apply([],va.slice(0,b)),function(){d[this]=a});return d}function wa(a){return"scrollTo"in a&&a.document?a:a.nodeType===9?a.defaultView||a.parentWindow:false}var c=function(a,b){return new c.fn.init(a,b)},Ra=A.jQuery,Sa=A.$,s=A.document,T,Ta=/^[^<]*(<[\w\W]+>)[^>]*$|^#([\w-]+)$/,Ua=/^.[^:#\[\.,]*$/,Va=/\S/,
+Wa=/^(\s|\u00A0)+|(\s|\u00A0)+$/g,Xa=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,P=navigator.userAgent,xa=false,Q=[],L,$=Object.prototype.toString,aa=Object.prototype.hasOwnProperty,ba=Array.prototype.push,R=Array.prototype.slice,ya=Array.prototype.indexOf;c.fn=c.prototype={init:function(a,b){var d,f;if(!a)return this;if(a.nodeType){this.context=this[0]=a;this.length=1;return this}if(a==="body"&&!b){this.context=s;this[0]=s.body;this.selector="body";this.length=1;return this}if(typeof a==="string")if((d=Ta.exec(a))&&
+(d[1]||!b))if(d[1]){f=b?b.ownerDocument||b:s;if(a=Xa.exec(a))if(c.isPlainObject(b)){a=[s.createElement(a[1])];c.fn.attr.call(a,b,true)}else a=[f.createElement(a[1])];else{a=sa([d[1]],[f]);a=(a.cacheable?a.fragment.cloneNode(true):a.fragment).childNodes}return c.merge(this,a)}else{if(b=s.getElementById(d[2])){if(b.id!==d[2])return T.find(a);this.length=1;this[0]=b}this.context=s;this.selector=a;return this}else if(!b&&/^\w+$/.test(a)){this.selector=a;this.context=s;a=s.getElementsByTagName(a);return c.merge(this,
+a)}else return!b||b.jquery?(b||T).find(a):c(b).find(a);else if(c.isFunction(a))return T.ready(a);if(a.selector!==w){this.selector=a.selector;this.context=a.context}return c.makeArray(a,this)},selector:"",jquery:"1.4.2",length:0,size:function(){return this.length},toArray:function(){return R.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this.slice(a)[0]:this[a]},pushStack:function(a,b,d){var f=c();c.isArray(a)?ba.apply(f,a):c.merge(f,a);f.prevObject=this;f.context=this.context;if(b===
+"find")f.selector=this.selector+(this.selector?" ":"")+d;else if(b)f.selector=this.selector+"."+b+"("+d+")";return f},each:function(a,b){return c.each(this,a,b)},ready:function(a){c.bindReady();if(c.isReady)a.call(s,c);else Q&&Q.push(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(R.apply(this,arguments),"slice",R.call(arguments).join(","))},map:function(a){return this.pushStack(c.map(this,
+function(b,d){return a.call(b,d,b)}))},end:function(){return this.prevObject||c(null)},push:ba,sort:[].sort,splice:[].splice};c.fn.init.prototype=c.fn;c.extend=c.fn.extend=function(){var a=arguments[0]||{},b=1,d=arguments.length,f=false,e,j,i,o;if(typeof a==="boolean"){f=a;a=arguments[1]||{};b=2}if(typeof a!=="object"&&!c.isFunction(a))a={};if(d===b){a=this;--b}for(;b<d;b++)if((e=arguments[b])!=null)for(j in e){i=a[j];o=e[j];if(a!==o)if(f&&o&&(c.isPlainObject(o)||c.isArray(o))){i=i&&(c.isPlainObject(i)||
+c.isArray(i))?i:c.isArray(o)?[]:{};a[j]=c.extend(f,i,o)}else if(o!==w)a[j]=o}return a};c.extend({noConflict:function(a){A.$=Sa;if(a)A.jQuery=Ra;return c},isReady:false,ready:function(){if(!c.isReady){if(!s.body)return setTimeout(c.ready,13);c.isReady=true;if(Q){for(var a,b=0;a=Q[b++];)a.call(s,c);Q=null}c.fn.triggerHandler&&c(s).triggerHandler("ready")}},bindReady:function(){if(!xa){xa=true;if(s.readyState==="complete")return c.ready();if(s.addEventListener){s.addEventListener("DOMContentLoaded",
+L,false);A.addEventListener("load",c.ready,false)}else if(s.attachEvent){s.attachEvent("onreadystatechange",L);A.attachEvent("onload",c.ready);var a=false;try{a=A.frameElement==null}catch(b){}s.documentElement.doScroll&&a&&ma()}}},isFunction:function(a){return $.call(a)==="[object Function]"},isArray:function(a){return $.call(a)==="[object Array]"},isPlainObject:function(a){if(!a||$.call(a)!=="[object Object]"||a.nodeType||a.setInterval)return false;if(a.constructor&&!aa.call(a,"constructor")&&!aa.call(a.constructor.prototype,
+"isPrototypeOf"))return false;var b;for(b in a);return b===w||aa.call(a,b)},isEmptyObject:function(a){for(var b in a)return false;return true},error:function(a){throw a;},parseJSON:function(a){if(typeof a!=="string"||!a)return null;a=c.trim(a);if(/^[\],:{}\s]*$/.test(a.replace(/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,"@").replace(/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,"]").replace(/(?:^|:|,)(?:\s*\[)+/g,"")))return A.JSON&&A.JSON.parse?A.JSON.parse(a):(new Function("return "+
+a))();else c.error("Invalid JSON: "+a)},noop:function(){},globalEval:function(a){if(a&&Va.test(a)){var b=s.getElementsByTagName("head")[0]||s.documentElement,d=s.createElement("script");d.type="text/javascript";if(c.support.scriptEval)d.appendChild(s.createTextNode(a));else d.text=a;b.insertBefore(d,b.firstChild);b.removeChild(d)}},nodeName:function(a,b){return a.nodeName&&a.nodeName.toUpperCase()===b.toUpperCase()},each:function(a,b,d){var f,e=0,j=a.length,i=j===w||c.isFunction(a);if(d)if(i)for(f in a){if(b.apply(a[f],
+d)===false)break}else for(;e<j;){if(b.apply(a[e++],d)===false)break}else if(i)for(f in a){if(b.call(a[f],f,a[f])===false)break}else for(d=a[0];e<j&&b.call(d,e,d)!==false;d=a[++e]);return a},trim:function(a){return(a||"").replace(Wa,"")},makeArray:function(a,b){b=b||[];if(a!=null)a.length==null||typeof a==="string"||c.isFunction(a)||typeof a!=="function"&&a.setInterval?ba.call(b,a):c.merge(b,a);return b},inArray:function(a,b){if(b.indexOf)return b.indexOf(a);for(var d=0,f=b.length;d<f;d++)if(b[d]===
+a)return d;return-1},merge:function(a,b){var d=a.length,f=0;if(typeof b.length==="number")for(var e=b.length;f<e;f++)a[d++]=b[f];else for(;b[f]!==w;)a[d++]=b[f++];a.length=d;return a},grep:function(a,b,d){for(var f=[],e=0,j=a.length;e<j;e++)!d!==!b(a[e],e)&&f.push(a[e]);return f},map:function(a,b,d){for(var f=[],e,j=0,i=a.length;j<i;j++){e=b(a[j],j,d);if(e!=null)f[f.length]=e}return f.concat.apply([],f)},guid:1,proxy:function(a,b,d){if(arguments.length===2)if(typeof b==="string"){d=a;a=d[b];b=w}else if(b&&
+!c.isFunction(b)){d=b;b=w}if(!b&&a)b=function(){return a.apply(d||this,arguments)};if(a)b.guid=a.guid=a.guid||b.guid||c.guid++;return b},uaMatch:function(a){a=a.toLowerCase();a=/(webkit)[ \/]([\w.]+)/.exec(a)||/(opera)(?:.*version)?[ \/]([\w.]+)/.exec(a)||/(msie) ([\w.]+)/.exec(a)||!/compatible/.test(a)&&/(mozilla)(?:.*? rv:([\w.]+))?/.exec(a)||[];return{browser:a[1]||"",version:a[2]||"0"}},browser:{}});P=c.uaMatch(P);if(P.browser){c.browser[P.browser]=true;c.browser.version=P.version}if(c.browser.webkit)c.browser.safari=
+true;if(ya)c.inArray=function(a,b){return ya.call(b,a)};T=c(s);if(s.addEventListener)L=function(){s.removeEventListener("DOMContentLoaded",L,false);c.ready()};else if(s.attachEvent)L=function(){if(s.readyState==="complete"){s.detachEvent("onreadystatechange",L);c.ready()}};(function(){c.support={};var a=s.documentElement,b=s.createElement("script"),d=s.createElement("div"),f="script"+J();d.style.display="none";d.innerHTML=" <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";
+var e=d.getElementsByTagName("*"),j=d.getElementsByTagName("a")[0];if(!(!e||!e.length||!j)){c.support={leadingWhitespace:d.firstChild.nodeType===3,tbody:!d.getElementsByTagName("tbody").length,htmlSerialize:!!d.getElementsByTagName("link").length,style:/red/.test(j.getAttribute("style")),hrefNormalized:j.getAttribute("href")==="/a",opacity:/^0.55$/.test(j.style.opacity),cssFloat:!!j.style.cssFloat,checkOn:d.getElementsByTagName("input")[0].value==="on",optSelected:s.createElement("select").appendChild(s.createElement("option")).selected,
+parentNode:d.removeChild(d.appendChild(s.createElement("div"))).parentNode===null,deleteExpando:true,checkClone:false,scriptEval:false,noCloneEvent:true,boxModel:null};b.type="text/javascript";try{b.appendChild(s.createTextNode("window."+f+"=1;"))}catch(i){}a.insertBefore(b,a.firstChild);if(A[f]){c.support.scriptEval=true;delete A[f]}try{delete b.test}catch(o){c.support.deleteExpando=false}a.removeChild(b);if(d.attachEvent&&d.fireEvent){d.attachEvent("onclick",function k(){c.support.noCloneEvent=
+false;d.detachEvent("onclick",k)});d.cloneNode(true).fireEvent("onclick")}d=s.createElement("div");d.innerHTML="<input type='radio' name='radiotest' checked='checked'/>";a=s.createDocumentFragment();a.appendChild(d.firstChild);c.support.checkClone=a.cloneNode(true).cloneNode(true).lastChild.checked;c(function(){var k=s.createElement("div");k.style.width=k.style.paddingLeft="1px";s.body.appendChild(k);c.boxModel=c.support.boxModel=k.offsetWidth===2;s.body.removeChild(k).style.display="none"});a=function(k){var n=
+s.createElement("div");k="on"+k;var r=k in n;if(!r){n.setAttribute(k,"return;");r=typeof n[k]==="function"}return r};c.support.submitBubbles=a("submit");c.support.changeBubbles=a("change");a=b=d=e=j=null}})();c.props={"for":"htmlFor","class":"className",readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan",colspan:"colSpan",tabindex:"tabIndex",usemap:"useMap",frameborder:"frameBorder"};var G="jQuery"+J(),Ya=0,za={};c.extend({cache:{},expando:G,noData:{embed:true,object:true,
+applet:true},data:function(a,b,d){if(!(a.nodeName&&c.noData[a.nodeName.toLowerCase()])){a=a==A?za:a;var f=a[G],e=c.cache;if(!f&&typeof b==="string"&&d===w)return null;f||(f=++Ya);if(typeof b==="object"){a[G]=f;e[f]=c.extend(true,{},b)}else if(!e[f]){a[G]=f;e[f]={}}a=e[f];if(d!==w)a[b]=d;return typeof b==="string"?a[b]:a}},removeData:function(a,b){if(!(a.nodeName&&c.noData[a.nodeName.toLowerCase()])){a=a==A?za:a;var d=a[G],f=c.cache,e=f[d];if(b){if(e){delete e[b];c.isEmptyObject(e)&&c.removeData(a)}}else{if(c.support.deleteExpando)delete a[c.expando];
+else a.removeAttribute&&a.removeAttribute(c.expando);delete f[d]}}}});c.fn.extend({data:function(a,b){if(typeof a==="undefined"&&this.length)return c.data(this[0]);else if(typeof a==="object")return this.each(function(){c.data(this,a)});var d=a.split(".");d[1]=d[1]?"."+d[1]:"";if(b===w){var f=this.triggerHandler("getData"+d[1]+"!",[d[0]]);if(f===w&&this.length)f=c.data(this[0],a);return f===w&&d[1]?this.data(d[0]):f}else return this.trigger("setData"+d[1]+"!",[d[0],b]).each(function(){c.data(this,
+a,b)})},removeData:function(a){return this.each(function(){c.removeData(this,a)})}});c.extend({queue:function(a,b,d){if(a){b=(b||"fx")+"queue";var f=c.data(a,b);if(!d)return f||[];if(!f||c.isArray(d))f=c.data(a,b,c.makeArray(d));else f.push(d);return f}},dequeue:function(a,b){b=b||"fx";var d=c.queue(a,b),f=d.shift();if(f==="inprogress")f=d.shift();if(f){b==="fx"&&d.unshift("inprogress");f.call(a,function(){c.dequeue(a,b)})}}});c.fn.extend({queue:function(a,b){if(typeof a!=="string"){b=a;a="fx"}if(b===
+w)return c.queue(this[0],a);return this.each(function(){var d=c.queue(this,a,b);a==="fx"&&d[0]!=="inprogress"&&c.dequeue(this,a)})},dequeue:function(a){return this.each(function(){c.dequeue(this,a)})},delay:function(a,b){a=c.fx?c.fx.speeds[a]||a:a;b=b||"fx";return this.queue(b,function(){var d=this;setTimeout(function(){c.dequeue(d,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])}});var Aa=/[\n\t]/g,ca=/\s+/,Za=/\r/g,$a=/href|src|style/,ab=/(button|input)/i,bb=/(button|input|object|select|textarea)/i,
+cb=/^(a|area)$/i,Ba=/radio|checkbox/;c.fn.extend({attr:function(a,b){return X(this,a,b,true,c.attr)},removeAttr:function(a){return this.each(function(){c.attr(this,a,"");this.nodeType===1&&this.removeAttribute(a)})},addClass:function(a){if(c.isFunction(a))return this.each(function(n){var r=c(this);r.addClass(a.call(this,n,r.attr("class")))});if(a&&typeof a==="string")for(var b=(a||"").split(ca),d=0,f=this.length;d<f;d++){var e=this[d];if(e.nodeType===1)if(e.className){for(var j=" "+e.className+" ",
+i=e.className,o=0,k=b.length;o<k;o++)if(j.indexOf(" "+b[o]+" ")<0)i+=" "+b[o];e.className=c.trim(i)}else e.className=a}return this},removeClass:function(a){if(c.isFunction(a))return this.each(function(k){var n=c(this);n.removeClass(a.call(this,k,n.attr("class")))});if(a&&typeof a==="string"||a===w)for(var b=(a||"").split(ca),d=0,f=this.length;d<f;d++){var e=this[d];if(e.nodeType===1&&e.className)if(a){for(var j=(" "+e.className+" ").replace(Aa," "),i=0,o=b.length;i<o;i++)j=j.replace(" "+b[i]+" ",
+" ");e.className=c.trim(j)}else e.className=""}return this},toggleClass:function(a,b){var d=typeof a,f=typeof b==="boolean";if(c.isFunction(a))return this.each(function(e){var j=c(this);j.toggleClass(a.call(this,e,j.attr("class"),b),b)});return this.each(function(){if(d==="string")for(var e,j=0,i=c(this),o=b,k=a.split(ca);e=k[j++];){o=f?o:!i.hasClass(e);i[o?"addClass":"removeClass"](e)}else if(d==="undefined"||d==="boolean"){this.className&&c.data(this,"__className__",this.className);this.className=
+this.className||a===false?"":c.data(this,"__className__")||""}})},hasClass:function(a){a=" "+a+" ";for(var b=0,d=this.length;b<d;b++)if((" "+this[b].className+" ").replace(Aa," ").indexOf(a)>-1)return true;return false},val:function(a){if(a===w){var b=this[0];if(b){if(c.nodeName(b,"option"))return(b.attributes.value||{}).specified?b.value:b.text;if(c.nodeName(b,"select")){var d=b.selectedIndex,f=[],e=b.options;b=b.type==="select-one";if(d<0)return null;var j=b?d:0;for(d=b?d+1:e.length;j<d;j++){var i=
+e[j];if(i.selected){a=c(i).val();if(b)return a;f.push(a)}}return f}if(Ba.test(b.type)&&!c.support.checkOn)return b.getAttribute("value")===null?"on":b.value;return(b.value||"").replace(Za,"")}return w}var o=c.isFunction(a);return this.each(function(k){var n=c(this),r=a;if(this.nodeType===1){if(o)r=a.call(this,k,n.val());if(typeof r==="number")r+="";if(c.isArray(r)&&Ba.test(this.type))this.checked=c.inArray(n.val(),r)>=0;else if(c.nodeName(this,"select")){var u=c.makeArray(r);c("option",this).each(function(){this.selected=
+c.inArray(c(this).val(),u)>=0});if(!u.length)this.selectedIndex=-1}else this.value=r}})}});c.extend({attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(a,b,d,f){if(!a||a.nodeType===3||a.nodeType===8)return w;if(f&&b in c.attrFn)return c(a)[b](d);f=a.nodeType!==1||!c.isXMLDoc(a);var e=d!==w;b=f&&c.props[b]||b;if(a.nodeType===1){var j=$a.test(b);if(b in a&&f&&!j){if(e){b==="type"&&ab.test(a.nodeName)&&a.parentNode&&c.error("type property can't be changed");
+a[b]=d}if(c.nodeName(a,"form")&&a.getAttributeNode(b))return a.getAttributeNode(b).nodeValue;if(b==="tabIndex")return(b=a.getAttributeNode("tabIndex"))&&b.specified?b.value:bb.test(a.nodeName)||cb.test(a.nodeName)&&a.href?0:w;return a[b]}if(!c.support.style&&f&&b==="style"){if(e)a.style.cssText=""+d;return a.style.cssText}e&&a.setAttribute(b,""+d);a=!c.support.hrefNormalized&&f&&j?a.getAttribute(b,2):a.getAttribute(b);return a===null?w:a}return c.style(a,b,d)}});var O=/\.(.*)$/,db=function(a){return a.replace(/[^\w\s\.\|`]/g,
+function(b){return"\\"+b})};c.event={add:function(a,b,d,f){if(!(a.nodeType===3||a.nodeType===8)){if(a.setInterval&&a!==A&&!a.frameElement)a=A;var e,j;if(d.handler){e=d;d=e.handler}if(!d.guid)d.guid=c.guid++;if(j=c.data(a)){var i=j.events=j.events||{},o=j.handle;if(!o)j.handle=o=function(){return typeof c!=="undefined"&&!c.event.triggered?c.event.handle.apply(o.elem,arguments):w};o.elem=a;b=b.split(" ");for(var k,n=0,r;k=b[n++];){j=e?c.extend({},e):{handler:d,data:f};if(k.indexOf(".")>-1){r=k.split(".");
+k=r.shift();j.namespace=r.slice(0).sort().join(".")}else{r=[];j.namespace=""}j.type=k;j.guid=d.guid;var u=i[k],z=c.event.special[k]||{};if(!u){u=i[k]=[];if(!z.setup||z.setup.call(a,f,r,o)===false)if(a.addEventListener)a.addEventListener(k,o,false);else a.attachEvent&&a.attachEvent("on"+k,o)}if(z.add){z.add.call(a,j);if(!j.handler.guid)j.handler.guid=d.guid}u.push(j);c.event.global[k]=true}a=null}}},global:{},remove:function(a,b,d,f){if(!(a.nodeType===3||a.nodeType===8)){var e,j=0,i,o,k,n,r,u,z=c.data(a),
+C=z&&z.events;if(z&&C){if(b&&b.type){d=b.handler;b=b.type}if(!b||typeof b==="string"&&b.charAt(0)==="."){b=b||"";for(e in C)c.event.remove(a,e+b)}else{for(b=b.split(" ");e=b[j++];){n=e;i=e.indexOf(".")<0;o=[];if(!i){o=e.split(".");e=o.shift();k=new RegExp("(^|\\.)"+c.map(o.slice(0).sort(),db).join("\\.(?:.*\\.)?")+"(\\.|$)")}if(r=C[e])if(d){n=c.event.special[e]||{};for(B=f||0;B<r.length;B++){u=r[B];if(d.guid===u.guid){if(i||k.test(u.namespace)){f==null&&r.splice(B--,1);n.remove&&n.remove.call(a,u)}if(f!=
+null)break}}if(r.length===0||f!=null&&r.length===1){if(!n.teardown||n.teardown.call(a,o)===false)Ca(a,e,z.handle);delete C[e]}}else for(var B=0;B<r.length;B++){u=r[B];if(i||k.test(u.namespace)){c.event.remove(a,n,u.handler,B);r.splice(B--,1)}}}if(c.isEmptyObject(C)){if(b=z.handle)b.elem=null;delete z.events;delete z.handle;c.isEmptyObject(z)&&c.removeData(a)}}}}},trigger:function(a,b,d,f){var e=a.type||a;if(!f){a=typeof a==="object"?a[G]?a:c.extend(c.Event(e),a):c.Event(e);if(e.indexOf("!")>=0){a.type=
+e=e.slice(0,-1);a.exclusive=true}if(!d){a.stopPropagation();c.event.global[e]&&c.each(c.cache,function(){this.events&&this.events[e]&&c.event.trigger(a,b,this.handle.elem)})}if(!d||d.nodeType===3||d.nodeType===8)return w;a.result=w;a.target=d;b=c.makeArray(b);b.unshift(a)}a.currentTarget=d;(f=c.data(d,"handle"))&&f.apply(d,b);f=d.parentNode||d.ownerDocument;try{if(!(d&&d.nodeName&&c.noData[d.nodeName.toLowerCase()]))if(d["on"+e]&&d["on"+e].apply(d,b)===false)a.result=false}catch(j){}if(!a.isPropagationStopped()&&
+f)c.event.trigger(a,b,f,true);else if(!a.isDefaultPrevented()){f=a.target;var i,o=c.nodeName(f,"a")&&e==="click",k=c.event.special[e]||{};if((!k._default||k._default.call(d,a)===false)&&!o&&!(f&&f.nodeName&&c.noData[f.nodeName.toLowerCase()])){try{if(f[e]){if(i=f["on"+e])f["on"+e]=null;c.event.triggered=true;f[e]()}}catch(n){}if(i)f["on"+e]=i;c.event.triggered=false}}},handle:function(a){var b,d,f,e;a=arguments[0]=c.event.fix(a||A.event);a.currentTarget=this;b=a.type.indexOf(".")<0&&!a.exclusive;
+if(!b){d=a.type.split(".");a.type=d.shift();f=new RegExp("(^|\\.)"+d.slice(0).sort().join("\\.(?:.*\\.)?")+"(\\.|$)")}e=c.data(this,"events");d=e[a.type];if(e&&d){d=d.slice(0);e=0;for(var j=d.length;e<j;e++){var i=d[e];if(b||f.test(i.namespace)){a.handler=i.handler;a.data=i.data;a.handleObj=i;i=i.handler.apply(this,arguments);if(i!==w){a.result=i;if(i===false){a.preventDefault();a.stopPropagation()}}if(a.isImmediatePropagationStopped())break}}}return a.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "),
+fix:function(a){if(a[G])return a;var b=a;a=c.Event(b);for(var d=this.props.length,f;d;){f=this.props[--d];a[f]=b[f]}if(!a.target)a.target=a.srcElement||s;if(a.target.nodeType===3)a.target=a.target.parentNode;if(!a.relatedTarget&&a.fromElement)a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement;if(a.pageX==null&&a.clientX!=null){b=s.documentElement;d=s.body;a.pageX=a.clientX+(b&&b.scrollLeft||d&&d.scrollLeft||0)-(b&&b.clientLeft||d&&d.clientLeft||0);a.pageY=a.clientY+(b&&b.scrollTop||
+d&&d.scrollTop||0)-(b&&b.clientTop||d&&d.clientTop||0)}if(!a.which&&(a.charCode||a.charCode===0?a.charCode:a.keyCode))a.which=a.charCode||a.keyCode;if(!a.metaKey&&a.ctrlKey)a.metaKey=a.ctrlKey;if(!a.which&&a.button!==w)a.which=a.button&1?1:a.button&2?3:a.button&4?2:0;return a},guid:1E8,proxy:c.proxy,special:{ready:{setup:c.bindReady,teardown:c.noop},live:{add:function(a){c.event.add(this,a.origType,c.extend({},a,{handler:oa}))},remove:function(a){var b=true,d=a.origType.replace(O,"");c.each(c.data(this,
+"events").live||[],function(){if(d===this.origType.replace(O,""))return b=false});b&&c.event.remove(this,a.origType,oa)}},beforeunload:{setup:function(a,b,d){if(this.setInterval)this.onbeforeunload=d;return false},teardown:function(a,b){if(this.onbeforeunload===b)this.onbeforeunload=null}}}};var Ca=s.removeEventListener?function(a,b,d){a.removeEventListener(b,d,false)}:function(a,b,d){a.detachEvent("on"+b,d)};c.Event=function(a){if(!this.preventDefault)return new c.Event(a);if(a&&a.type){this.originalEvent=
+a;this.type=a.type}else this.type=a;this.timeStamp=J();this[G]=true};c.Event.prototype={preventDefault:function(){this.isDefaultPrevented=Z;var a=this.originalEvent;if(a){a.preventDefault&&a.preventDefault();a.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=Z;var a=this.originalEvent;if(a){a.stopPropagation&&a.stopPropagation();a.cancelBubble=true}},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=Z;this.stopPropagation()},isDefaultPrevented:Y,isPropagationStopped:Y,
+isImmediatePropagationStopped:Y};var Da=function(a){var b=a.relatedTarget;try{for(;b&&b!==this;)b=b.parentNode;if(b!==this){a.type=a.data;c.event.handle.apply(this,arguments)}}catch(d){}},Ea=function(a){a.type=a.data;c.event.handle.apply(this,arguments)};c.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){c.event.special[a]={setup:function(d){c.event.add(this,b,d&&d.selector?Ea:Da,a)},teardown:function(d){c.event.remove(this,b,d&&d.selector?Ea:Da)}}});if(!c.support.submitBubbles)c.event.special.submit=
+{setup:function(){if(this.nodeName.toLowerCase()!=="form"){c.event.add(this,"click.specialSubmit",function(a){var b=a.target,d=b.type;if((d==="submit"||d==="image")&&c(b).closest("form").length)return na("submit",this,arguments)});c.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,d=b.type;if((d==="text"||d==="password")&&c(b).closest("form").length&&a.keyCode===13)return na("submit",this,arguments)})}else return false},teardown:function(){c.event.remove(this,".specialSubmit")}};
+if(!c.support.changeBubbles){var da=/textarea|input|select/i,ea,Fa=function(a){var b=a.type,d=a.value;if(b==="radio"||b==="checkbox")d=a.checked;else if(b==="select-multiple")d=a.selectedIndex>-1?c.map(a.options,function(f){return f.selected}).join("-"):"";else if(a.nodeName.toLowerCase()==="select")d=a.selectedIndex;return d},fa=function(a,b){var d=a.target,f,e;if(!(!da.test(d.nodeName)||d.readOnly)){f=c.data(d,"_change_data");e=Fa(d);if(a.type!=="focusout"||d.type!=="radio")c.data(d,"_change_data",
+e);if(!(f===w||e===f))if(f!=null||e){a.type="change";return c.event.trigger(a,b,d)}}};c.event.special.change={filters:{focusout:fa,click:function(a){var b=a.target,d=b.type;if(d==="radio"||d==="checkbox"||b.nodeName.toLowerCase()==="select")return fa.call(this,a)},keydown:function(a){var b=a.target,d=b.type;if(a.keyCode===13&&b.nodeName.toLowerCase()!=="textarea"||a.keyCode===32&&(d==="checkbox"||d==="radio")||d==="select-multiple")return fa.call(this,a)},beforeactivate:function(a){a=a.target;c.data(a,
+"_change_data",Fa(a))}},setup:function(){if(this.type==="file")return false;for(var a in ea)c.event.add(this,a+".specialChange",ea[a]);return da.test(this.nodeName)},teardown:function(){c.event.remove(this,".specialChange");return da.test(this.nodeName)}};ea=c.event.special.change.filters}s.addEventListener&&c.each({focus:"focusin",blur:"focusout"},function(a,b){function d(f){f=c.event.fix(f);f.type=b;return c.event.handle.call(this,f)}c.event.special[b]={setup:function(){this.addEventListener(a,
+d,true)},teardown:function(){this.removeEventListener(a,d,true)}}});c.each(["bind","one"],function(a,b){c.fn[b]=function(d,f,e){if(typeof d==="object"){for(var j in d)this[b](j,f,d[j],e);return this}if(c.isFunction(f)){e=f;f=w}var i=b==="one"?c.proxy(e,function(k){c(this).unbind(k,i);return e.apply(this,arguments)}):e;if(d==="unload"&&b!=="one")this.one(d,f,e);else{j=0;for(var o=this.length;j<o;j++)c.event.add(this[j],d,i,f)}return this}});c.fn.extend({unbind:function(a,b){if(typeof a==="object"&&
+!a.preventDefault)for(var d in a)this.unbind(d,a[d]);else{d=0;for(var f=this.length;d<f;d++)c.event.remove(this[d],a,b)}return this},delegate:function(a,b,d,f){return this.live(b,d,f,a)},undelegate:function(a,b,d){return arguments.length===0?this.unbind("live"):this.die(b,null,d,a)},trigger:function(a,b){return this.each(function(){c.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0]){a=c.Event(a);a.preventDefault();a.stopPropagation();c.event.trigger(a,b,this[0]);return a.result}},
+toggle:function(a){for(var b=arguments,d=1;d<b.length;)c.proxy(a,b[d++]);return this.click(c.proxy(a,function(f){var e=(c.data(this,"lastToggle"+a.guid)||0)%d;c.data(this,"lastToggle"+a.guid,e+1);f.preventDefault();return b[e].apply(this,arguments)||false}))},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var Ga={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};c.each(["live","die"],function(a,b){c.fn[b]=function(d,f,e,j){var i,o=0,k,n,r=j||this.selector,
+u=j?this:c(this.context);if(c.isFunction(f)){e=f;f=w}for(d=(d||"").split(" ");(i=d[o++])!=null;){j=O.exec(i);k="";if(j){k=j[0];i=i.replace(O,"")}if(i==="hover")d.push("mouseenter"+k,"mouseleave"+k);else{n=i;if(i==="focus"||i==="blur"){d.push(Ga[i]+k);i+=k}else i=(Ga[i]||i)+k;b==="live"?u.each(function(){c.event.add(this,pa(i,r),{data:f,selector:r,handler:e,origType:i,origHandler:e,preType:n})}):u.unbind(pa(i,r),e)}}return this}});c.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),
+function(a,b){c.fn[b]=function(d){return d?this.bind(b,d):this.trigger(b)};if(c.attrFn)c.attrFn[b]=true});A.attachEvent&&!A.addEventListener&&A.attachEvent("onunload",function(){for(var a in c.cache)if(c.cache[a].handle)try{c.event.remove(c.cache[a].handle.elem)}catch(b){}});(function(){function a(g){for(var h="",l,m=0;g[m];m++){l=g[m];if(l.nodeType===3||l.nodeType===4)h+=l.nodeValue;else if(l.nodeType!==8)h+=a(l.childNodes)}return h}function b(g,h,l,m,q,p){q=0;for(var v=m.length;q<v;q++){var t=m[q];
+if(t){t=t[g];for(var y=false;t;){if(t.sizcache===l){y=m[t.sizset];break}if(t.nodeType===1&&!p){t.sizcache=l;t.sizset=q}if(t.nodeName.toLowerCase()===h){y=t;break}t=t[g]}m[q]=y}}}function d(g,h,l,m,q,p){q=0;for(var v=m.length;q<v;q++){var t=m[q];if(t){t=t[g];for(var y=false;t;){if(t.sizcache===l){y=m[t.sizset];break}if(t.nodeType===1){if(!p){t.sizcache=l;t.sizset=q}if(typeof h!=="string"){if(t===h){y=true;break}}else if(k.filter(h,[t]).length>0){y=t;break}}t=t[g]}m[q]=y}}}var f=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,
+e=0,j=Object.prototype.toString,i=false,o=true;[0,0].sort(function(){o=false;return 0});var k=function(g,h,l,m){l=l||[];var q=h=h||s;if(h.nodeType!==1&&h.nodeType!==9)return[];if(!g||typeof g!=="string")return l;for(var p=[],v,t,y,S,H=true,M=x(h),I=g;(f.exec(""),v=f.exec(I))!==null;){I=v[3];p.push(v[1]);if(v[2]){S=v[3];break}}if(p.length>1&&r.exec(g))if(p.length===2&&n.relative[p[0]])t=ga(p[0]+p[1],h);else for(t=n.relative[p[0]]?[h]:k(p.shift(),h);p.length;){g=p.shift();if(n.relative[g])g+=p.shift();
+t=ga(g,t)}else{if(!m&&p.length>1&&h.nodeType===9&&!M&&n.match.ID.test(p[0])&&!n.match.ID.test(p[p.length-1])){v=k.find(p.shift(),h,M);h=v.expr?k.filter(v.expr,v.set)[0]:v.set[0]}if(h){v=m?{expr:p.pop(),set:z(m)}:k.find(p.pop(),p.length===1&&(p[0]==="~"||p[0]==="+")&&h.parentNode?h.parentNode:h,M);t=v.expr?k.filter(v.expr,v.set):v.set;if(p.length>0)y=z(t);else H=false;for(;p.length;){var D=p.pop();v=D;if(n.relative[D])v=p.pop();else D="";if(v==null)v=h;n.relative[D](y,v,M)}}else y=[]}y||(y=t);y||k.error(D||
+g);if(j.call(y)==="[object Array]")if(H)if(h&&h.nodeType===1)for(g=0;y[g]!=null;g++){if(y[g]&&(y[g]===true||y[g].nodeType===1&&E(h,y[g])))l.push(t[g])}else for(g=0;y[g]!=null;g++)y[g]&&y[g].nodeType===1&&l.push(t[g]);else l.push.apply(l,y);else z(y,l);if(S){k(S,q,l,m);k.uniqueSort(l)}return l};k.uniqueSort=function(g){if(B){i=o;g.sort(B);if(i)for(var h=1;h<g.length;h++)g[h]===g[h-1]&&g.splice(h--,1)}return g};k.matches=function(g,h){return k(g,null,null,h)};k.find=function(g,h,l){var m,q;if(!g)return[];
+for(var p=0,v=n.order.length;p<v;p++){var t=n.order[p];if(q=n.leftMatch[t].exec(g)){var y=q[1];q.splice(1,1);if(y.substr(y.length-1)!=="\\"){q[1]=(q[1]||"").replace(/\\/g,"");m=n.find[t](q,h,l);if(m!=null){g=g.replace(n.match[t],"");break}}}}m||(m=h.getElementsByTagName("*"));return{set:m,expr:g}};k.filter=function(g,h,l,m){for(var q=g,p=[],v=h,t,y,S=h&&h[0]&&x(h[0]);g&&h.length;){for(var H in n.filter)if((t=n.leftMatch[H].exec(g))!=null&&t[2]){var M=n.filter[H],I,D;D=t[1];y=false;t.splice(1,1);if(D.substr(D.length-
+1)!=="\\"){if(v===p)p=[];if(n.preFilter[H])if(t=n.preFilter[H](t,v,l,p,m,S)){if(t===true)continue}else y=I=true;if(t)for(var U=0;(D=v[U])!=null;U++)if(D){I=M(D,t,U,v);var Ha=m^!!I;if(l&&I!=null)if(Ha)y=true;else v[U]=false;else if(Ha){p.push(D);y=true}}if(I!==w){l||(v=p);g=g.replace(n.match[H],"");if(!y)return[];break}}}if(g===q)if(y==null)k.error(g);else break;q=g}return v};k.error=function(g){throw"Syntax error, unrecognized expression: "+g;};var n=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF-]|\\.)+)/,
+CLASS:/\.((?:[\w\u00c0-\uFFFF-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(g){return g.getAttribute("href")}},
+relative:{"+":function(g,h){var l=typeof h==="string",m=l&&!/\W/.test(h);l=l&&!m;if(m)h=h.toLowerCase();m=0;for(var q=g.length,p;m<q;m++)if(p=g[m]){for(;(p=p.previousSibling)&&p.nodeType!==1;);g[m]=l||p&&p.nodeName.toLowerCase()===h?p||false:p===h}l&&k.filter(h,g,true)},">":function(g,h){var l=typeof h==="string";if(l&&!/\W/.test(h)){h=h.toLowerCase();for(var m=0,q=g.length;m<q;m++){var p=g[m];if(p){l=p.parentNode;g[m]=l.nodeName.toLowerCase()===h?l:false}}}else{m=0;for(q=g.length;m<q;m++)if(p=g[m])g[m]=
+l?p.parentNode:p.parentNode===h;l&&k.filter(h,g,true)}},"":function(g,h,l){var m=e++,q=d;if(typeof h==="string"&&!/\W/.test(h)){var p=h=h.toLowerCase();q=b}q("parentNode",h,m,g,p,l)},"~":function(g,h,l){var m=e++,q=d;if(typeof h==="string"&&!/\W/.test(h)){var p=h=h.toLowerCase();q=b}q("previousSibling",h,m,g,p,l)}},find:{ID:function(g,h,l){if(typeof h.getElementById!=="undefined"&&!l)return(g=h.getElementById(g[1]))?[g]:[]},NAME:function(g,h){if(typeof h.getElementsByName!=="undefined"){var l=[];
+h=h.getElementsByName(g[1]);for(var m=0,q=h.length;m<q;m++)h[m].getAttribute("name")===g[1]&&l.push(h[m]);return l.length===0?null:l}},TAG:function(g,h){return h.getElementsByTagName(g[1])}},preFilter:{CLASS:function(g,h,l,m,q,p){g=" "+g[1].replace(/\\/g,"")+" ";if(p)return g;p=0;for(var v;(v=h[p])!=null;p++)if(v)if(q^(v.className&&(" "+v.className+" ").replace(/[\t\n]/g," ").indexOf(g)>=0))l||m.push(v);else if(l)h[p]=false;return false},ID:function(g){return g[1].replace(/\\/g,"")},TAG:function(g){return g[1].toLowerCase()},
+CHILD:function(g){if(g[1]==="nth"){var h=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(g[2]==="even"&&"2n"||g[2]==="odd"&&"2n+1"||!/\D/.test(g[2])&&"0n+"+g[2]||g[2]);g[2]=h[1]+(h[2]||1)-0;g[3]=h[3]-0}g[0]=e++;return g},ATTR:function(g,h,l,m,q,p){h=g[1].replace(/\\/g,"");if(!p&&n.attrMap[h])g[1]=n.attrMap[h];if(g[2]==="~=")g[4]=" "+g[4]+" ";return g},PSEUDO:function(g,h,l,m,q){if(g[1]==="not")if((f.exec(g[3])||"").length>1||/^\w/.test(g[3]))g[3]=k(g[3],null,null,h);else{g=k.filter(g[3],h,l,true^q);l||m.push.apply(m,
+g);return false}else if(n.match.POS.test(g[0])||n.match.CHILD.test(g[0]))return true;return g},POS:function(g){g.unshift(true);return g}},filters:{enabled:function(g){return g.disabled===false&&g.type!=="hidden"},disabled:function(g){return g.disabled===true},checked:function(g){return g.checked===true},selected:function(g){return g.selected===true},parent:function(g){return!!g.firstChild},empty:function(g){return!g.firstChild},has:function(g,h,l){return!!k(l[3],g).length},header:function(g){return/h\d/i.test(g.nodeName)},
+text:function(g){return"text"===g.type},radio:function(g){return"radio"===g.type},checkbox:function(g){return"checkbox"===g.type},file:function(g){return"file"===g.type},password:function(g){return"password"===g.type},submit:function(g){return"submit"===g.type},image:function(g){return"image"===g.type},reset:function(g){return"reset"===g.type},button:function(g){return"button"===g.type||g.nodeName.toLowerCase()==="button"},input:function(g){return/input|select|textarea|button/i.test(g.nodeName)}},
+setFilters:{first:function(g,h){return h===0},last:function(g,h,l,m){return h===m.length-1},even:function(g,h){return h%2===0},odd:function(g,h){return h%2===1},lt:function(g,h,l){return h<l[3]-0},gt:function(g,h,l){return h>l[3]-0},nth:function(g,h,l){return l[3]-0===h},eq:function(g,h,l){return l[3]-0===h}},filter:{PSEUDO:function(g,h,l,m){var q=h[1],p=n.filters[q];if(p)return p(g,l,h,m);else if(q==="contains")return(g.textContent||g.innerText||a([g])||"").indexOf(h[3])>=0;else if(q==="not"){h=
+h[3];l=0;for(m=h.length;l<m;l++)if(h[l]===g)return false;return true}else k.error("Syntax error, unrecognized expression: "+q)},CHILD:function(g,h){var l=h[1],m=g;switch(l){case "only":case "first":for(;m=m.previousSibling;)if(m.nodeType===1)return false;if(l==="first")return true;m=g;case "last":for(;m=m.nextSibling;)if(m.nodeType===1)return false;return true;case "nth":l=h[2];var q=h[3];if(l===1&&q===0)return true;h=h[0];var p=g.parentNode;if(p&&(p.sizcache!==h||!g.nodeIndex)){var v=0;for(m=p.firstChild;m;m=
+m.nextSibling)if(m.nodeType===1)m.nodeIndex=++v;p.sizcache=h}g=g.nodeIndex-q;return l===0?g===0:g%l===0&&g/l>=0}},ID:function(g,h){return g.nodeType===1&&g.getAttribute("id")===h},TAG:function(g,h){return h==="*"&&g.nodeType===1||g.nodeName.toLowerCase()===h},CLASS:function(g,h){return(" "+(g.className||g.getAttribute("class"))+" ").indexOf(h)>-1},ATTR:function(g,h){var l=h[1];g=n.attrHandle[l]?n.attrHandle[l](g):g[l]!=null?g[l]:g.getAttribute(l);l=g+"";var m=h[2];h=h[4];return g==null?m==="!=":m===
+"="?l===h:m==="*="?l.indexOf(h)>=0:m==="~="?(" "+l+" ").indexOf(h)>=0:!h?l&&g!==false:m==="!="?l!==h:m==="^="?l.indexOf(h)===0:m==="$="?l.substr(l.length-h.length)===h:m==="|="?l===h||l.substr(0,h.length+1)===h+"-":false},POS:function(g,h,l,m){var q=n.setFilters[h[2]];if(q)return q(g,l,h,m)}}},r=n.match.POS;for(var u in n.match){n.match[u]=new RegExp(n.match[u].source+/(?![^\[]*\])(?![^\(]*\))/.source);n.leftMatch[u]=new RegExp(/(^(?:.|\r|\n)*?)/.source+n.match[u].source.replace(/\\(\d+)/g,function(g,
+h){return"\\"+(h-0+1)}))}var z=function(g,h){g=Array.prototype.slice.call(g,0);if(h){h.push.apply(h,g);return h}return g};try{Array.prototype.slice.call(s.documentElement.childNodes,0)}catch(C){z=function(g,h){h=h||[];if(j.call(g)==="[object Array]")Array.prototype.push.apply(h,g);else if(typeof g.length==="number")for(var l=0,m=g.length;l<m;l++)h.push(g[l]);else for(l=0;g[l];l++)h.push(g[l]);return h}}var B;if(s.documentElement.compareDocumentPosition)B=function(g,h){if(!g.compareDocumentPosition||
+!h.compareDocumentPosition){if(g==h)i=true;return g.compareDocumentPosition?-1:1}g=g.compareDocumentPosition(h)&4?-1:g===h?0:1;if(g===0)i=true;return g};else if("sourceIndex"in s.documentElement)B=function(g,h){if(!g.sourceIndex||!h.sourceIndex){if(g==h)i=true;return g.sourceIndex?-1:1}g=g.sourceIndex-h.sourceIndex;if(g===0)i=true;return g};else if(s.createRange)B=function(g,h){if(!g.ownerDocument||!h.ownerDocument){if(g==h)i=true;return g.ownerDocument?-1:1}var l=g.ownerDocument.createRange(),m=
+h.ownerDocument.createRange();l.setStart(g,0);l.setEnd(g,0);m.setStart(h,0);m.setEnd(h,0);g=l.compareBoundaryPoints(Range.START_TO_END,m);if(g===0)i=true;return g};(function(){var g=s.createElement("div"),h="script"+(new Date).getTime();g.innerHTML="<a name='"+h+"'/>";var l=s.documentElement;l.insertBefore(g,l.firstChild);if(s.getElementById(h)){n.find.ID=function(m,q,p){if(typeof q.getElementById!=="undefined"&&!p)return(q=q.getElementById(m[1]))?q.id===m[1]||typeof q.getAttributeNode!=="undefined"&&
+q.getAttributeNode("id").nodeValue===m[1]?[q]:w:[]};n.filter.ID=function(m,q){var p=typeof m.getAttributeNode!=="undefined"&&m.getAttributeNode("id");return m.nodeType===1&&p&&p.nodeValue===q}}l.removeChild(g);l=g=null})();(function(){var g=s.createElement("div");g.appendChild(s.createComment(""));if(g.getElementsByTagName("*").length>0)n.find.TAG=function(h,l){l=l.getElementsByTagName(h[1]);if(h[1]==="*"){h=[];for(var m=0;l[m];m++)l[m].nodeType===1&&h.push(l[m]);l=h}return l};g.innerHTML="<a href='#'></a>";
+if(g.firstChild&&typeof g.firstChild.getAttribute!=="undefined"&&g.firstChild.getAttribute("href")!=="#")n.attrHandle.href=function(h){return h.getAttribute("href",2)};g=null})();s.querySelectorAll&&function(){var g=k,h=s.createElement("div");h.innerHTML="<p class='TEST'></p>";if(!(h.querySelectorAll&&h.querySelectorAll(".TEST").length===0)){k=function(m,q,p,v){q=q||s;if(!v&&q.nodeType===9&&!x(q))try{return z(q.querySelectorAll(m),p)}catch(t){}return g(m,q,p,v)};for(var l in g)k[l]=g[l];h=null}}();
+(function(){var g=s.createElement("div");g.innerHTML="<div class='test e'></div><div class='test'></div>";if(!(!g.getElementsByClassName||g.getElementsByClassName("e").length===0)){g.lastChild.className="e";if(g.getElementsByClassName("e").length!==1){n.order.splice(1,0,"CLASS");n.find.CLASS=function(h,l,m){if(typeof l.getElementsByClassName!=="undefined"&&!m)return l.getElementsByClassName(h[1])};g=null}}})();var E=s.compareDocumentPosition?function(g,h){return!!(g.compareDocumentPosition(h)&16)}:
+function(g,h){return g!==h&&(g.contains?g.contains(h):true)},x=function(g){return(g=(g?g.ownerDocument||g:0).documentElement)?g.nodeName!=="HTML":false},ga=function(g,h){var l=[],m="",q;for(h=h.nodeType?[h]:h;q=n.match.PSEUDO.exec(g);){m+=q[0];g=g.replace(n.match.PSEUDO,"")}g=n.relative[g]?g+"*":g;q=0;for(var p=h.length;q<p;q++)k(g,h[q],l);return k.filter(m,l)};c.find=k;c.expr=k.selectors;c.expr[":"]=c.expr.filters;c.unique=k.uniqueSort;c.text=a;c.isXMLDoc=x;c.contains=E})();var eb=/Until$/,fb=/^(?:parents|prevUntil|prevAll)/,
+gb=/,/;R=Array.prototype.slice;var Ia=function(a,b,d){if(c.isFunction(b))return c.grep(a,function(e,j){return!!b.call(e,j,e)===d});else if(b.nodeType)return c.grep(a,function(e){return e===b===d});else if(typeof b==="string"){var f=c.grep(a,function(e){return e.nodeType===1});if(Ua.test(b))return c.filter(b,f,!d);else b=c.filter(b,f)}return c.grep(a,function(e){return c.inArray(e,b)>=0===d})};c.fn.extend({find:function(a){for(var b=this.pushStack("","find",a),d=0,f=0,e=this.length;f<e;f++){d=b.length;
+c.find(a,this[f],b);if(f>0)for(var j=d;j<b.length;j++)for(var i=0;i<d;i++)if(b[i]===b[j]){b.splice(j--,1);break}}return b},has:function(a){var b=c(a);return this.filter(function(){for(var d=0,f=b.length;d<f;d++)if(c.contains(this,b[d]))return true})},not:function(a){return this.pushStack(Ia(this,a,false),"not",a)},filter:function(a){return this.pushStack(Ia(this,a,true),"filter",a)},is:function(a){return!!a&&c.filter(a,this).length>0},closest:function(a,b){if(c.isArray(a)){var d=[],f=this[0],e,j=
+{},i;if(f&&a.length){e=0;for(var o=a.length;e<o;e++){i=a[e];j[i]||(j[i]=c.expr.match.POS.test(i)?c(i,b||this.context):i)}for(;f&&f.ownerDocument&&f!==b;){for(i in j){e=j[i];if(e.jquery?e.index(f)>-1:c(f).is(e)){d.push({selector:i,elem:f});delete j[i]}}f=f.parentNode}}return d}var k=c.expr.match.POS.test(a)?c(a,b||this.context):null;return this.map(function(n,r){for(;r&&r.ownerDocument&&r!==b;){if(k?k.index(r)>-1:c(r).is(a))return r;r=r.parentNode}return null})},index:function(a){if(!a||typeof a===
+"string")return c.inArray(this[0],a?c(a):this.parent().children());return c.inArray(a.jquery?a[0]:a,this)},add:function(a,b){a=typeof a==="string"?c(a,b||this.context):c.makeArray(a);b=c.merge(this.get(),a);return this.pushStack(qa(a[0])||qa(b[0])?b:c.unique(b))},andSelf:function(){return this.add(this.prevObject)}});c.each({parent:function(a){return(a=a.parentNode)&&a.nodeType!==11?a:null},parents:function(a){return c.dir(a,"parentNode")},parentsUntil:function(a,b,d){return c.dir(a,"parentNode",
+d)},next:function(a){return c.nth(a,2,"nextSibling")},prev:function(a){return c.nth(a,2,"previousSibling")},nextAll:function(a){return c.dir(a,"nextSibling")},prevAll:function(a){return c.dir(a,"previousSibling")},nextUntil:function(a,b,d){return c.dir(a,"nextSibling",d)},prevUntil:function(a,b,d){return c.dir(a,"previousSibling",d)},siblings:function(a){return c.sibling(a.parentNode.firstChild,a)},children:function(a){return c.sibling(a.firstChild)},contents:function(a){return c.nodeName(a,"iframe")?
+a.contentDocument||a.contentWindow.document:c.makeArray(a.childNodes)}},function(a,b){c.fn[a]=function(d,f){var e=c.map(this,b,d);eb.test(a)||(f=d);if(f&&typeof f==="string")e=c.filter(f,e);e=this.length>1?c.unique(e):e;if((this.length>1||gb.test(f))&&fb.test(a))e=e.reverse();return this.pushStack(e,a,R.call(arguments).join(","))}});c.extend({filter:function(a,b,d){if(d)a=":not("+a+")";return c.find.matches(a,b)},dir:function(a,b,d){var f=[];for(a=a[b];a&&a.nodeType!==9&&(d===w||a.nodeType!==1||!c(a).is(d));){a.nodeType===
+1&&f.push(a);a=a[b]}return f},nth:function(a,b,d){b=b||1;for(var f=0;a;a=a[d])if(a.nodeType===1&&++f===b)break;return a},sibling:function(a,b){for(var d=[];a;a=a.nextSibling)a.nodeType===1&&a!==b&&d.push(a);return d}});var Ja=/ jQuery\d+="(?:\d+|null)"/g,V=/^\s+/,Ka=/(<([\w:]+)[^>]*?)\/>/g,hb=/^(?:area|br|col|embed|hr|img|input|link|meta|param)$/i,La=/<([\w:]+)/,ib=/<tbody/i,jb=/<|&#?\w+;/,ta=/<script|<object|<embed|<option|<style/i,ua=/checked\s*(?:[^=]|=\s*.checked.)/i,Ma=function(a,b,d){return hb.test(d)?
+a:b+"></"+d+">"},F={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};F.optgroup=F.option;F.tbody=F.tfoot=F.colgroup=F.caption=F.thead;F.th=F.td;if(!c.support.htmlSerialize)F._default=[1,"div<div>","</div>"];c.fn.extend({text:function(a){if(c.isFunction(a))return this.each(function(b){var d=
+c(this);d.text(a.call(this,b,d.text()))});if(typeof a!=="object"&&a!==w)return this.empty().append((this[0]&&this[0].ownerDocument||s).createTextNode(a));return c.text(this)},wrapAll:function(a){if(c.isFunction(a))return this.each(function(d){c(this).wrapAll(a.call(this,d))});if(this[0]){var b=c(a,this[0].ownerDocument).eq(0).clone(true);this[0].parentNode&&b.insertBefore(this[0]);b.map(function(){for(var d=this;d.firstChild&&d.firstChild.nodeType===1;)d=d.firstChild;return d}).append(this)}return this},
+wrapInner:function(a){if(c.isFunction(a))return this.each(function(b){c(this).wrapInner(a.call(this,b))});return this.each(function(){var b=c(this),d=b.contents();d.length?d.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){c(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){c.nodeName(this,"body")||c(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.appendChild(a)})},
+prepend:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,this)});else if(arguments.length){var a=c(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,
+this.nextSibling)});else if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,c(arguments[0]).toArray());return a}},remove:function(a,b){for(var d=0,f;(f=this[d])!=null;d++)if(!a||c.filter(a,[f]).length){if(!b&&f.nodeType===1){c.cleanData(f.getElementsByTagName("*"));c.cleanData([f])}f.parentNode&&f.parentNode.removeChild(f)}return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++)for(b.nodeType===1&&c.cleanData(b.getElementsByTagName("*"));b.firstChild;)b.removeChild(b.firstChild);
+return this},clone:function(a){var b=this.map(function(){if(!c.support.noCloneEvent&&!c.isXMLDoc(this)){var d=this.outerHTML,f=this.ownerDocument;if(!d){d=f.createElement("div");d.appendChild(this.cloneNode(true));d=d.innerHTML}return c.clean([d.replace(Ja,"").replace(/=([^="'>\s]+\/)>/g,'="$1">').replace(V,"")],f)[0]}else return this.cloneNode(true)});if(a===true){ra(this,b);ra(this.find("*"),b.find("*"))}return b},html:function(a){if(a===w)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(Ja,
+""):null;else if(typeof a==="string"&&!ta.test(a)&&(c.support.leadingWhitespace||!V.test(a))&&!F[(La.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Ka,Ma);try{for(var b=0,d=this.length;b<d;b++)if(this[b].nodeType===1){c.cleanData(this[b].getElementsByTagName("*"));this[b].innerHTML=a}}catch(f){this.empty().append(a)}}else c.isFunction(a)?this.each(function(e){var j=c(this),i=j.html();j.empty().append(function(){return a.call(this,e,i)})}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&
+this[0].parentNode){if(c.isFunction(a))return this.each(function(b){var d=c(this),f=d.html();d.replaceWith(a.call(this,b,f))});if(typeof a!=="string")a=c(a).detach();return this.each(function(){var b=this.nextSibling,d=this.parentNode;c(this).remove();b?c(b).before(a):c(d).append(a)})}else return this.pushStack(c(c.isFunction(a)?a():a),"replaceWith",a)},detach:function(a){return this.remove(a,true)},domManip:function(a,b,d){function f(u){return c.nodeName(u,"table")?u.getElementsByTagName("tbody")[0]||
+u.appendChild(u.ownerDocument.createElement("tbody")):u}var e,j,i=a[0],o=[],k;if(!c.support.checkClone&&arguments.length===3&&typeof i==="string"&&ua.test(i))return this.each(function(){c(this).domManip(a,b,d,true)});if(c.isFunction(i))return this.each(function(u){var z=c(this);a[0]=i.call(this,u,b?z.html():w);z.domManip(a,b,d)});if(this[0]){e=i&&i.parentNode;e=c.support.parentNode&&e&&e.nodeType===11&&e.childNodes.length===this.length?{fragment:e}:sa(a,this,o);k=e.fragment;if(j=k.childNodes.length===
+1?(k=k.firstChild):k.firstChild){b=b&&c.nodeName(j,"tr");for(var n=0,r=this.length;n<r;n++)d.call(b?f(this[n],j):this[n],n>0||e.cacheable||this.length>1?k.cloneNode(true):k)}o.length&&c.each(o,Qa)}return this}});c.fragments={};c.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){c.fn[a]=function(d){var f=[];d=c(d);var e=this.length===1&&this[0].parentNode;if(e&&e.nodeType===11&&e.childNodes.length===1&&d.length===1){d[b](this[0]);
+return this}else{e=0;for(var j=d.length;e<j;e++){var i=(e>0?this.clone(true):this).get();c.fn[b].apply(c(d[e]),i);f=f.concat(i)}return this.pushStack(f,a,d.selector)}}});c.extend({clean:function(a,b,d,f){b=b||s;if(typeof b.createElement==="undefined")b=b.ownerDocument||b[0]&&b[0].ownerDocument||s;for(var e=[],j=0,i;(i=a[j])!=null;j++){if(typeof i==="number")i+="";if(i){if(typeof i==="string"&&!jb.test(i))i=b.createTextNode(i);else if(typeof i==="string"){i=i.replace(Ka,Ma);var o=(La.exec(i)||["",
+""])[1].toLowerCase(),k=F[o]||F._default,n=k[0],r=b.createElement("div");for(r.innerHTML=k[1]+i+k[2];n--;)r=r.lastChild;if(!c.support.tbody){n=ib.test(i);o=o==="table"&&!n?r.firstChild&&r.firstChild.childNodes:k[1]==="<table>"&&!n?r.childNodes:[];for(k=o.length-1;k>=0;--k)c.nodeName(o[k],"tbody")&&!o[k].childNodes.length&&o[k].parentNode.removeChild(o[k])}!c.support.leadingWhitespace&&V.test(i)&&r.insertBefore(b.createTextNode(V.exec(i)[0]),r.firstChild);i=r.childNodes}if(i.nodeType)e.push(i);else e=
+c.merge(e,i)}}if(d)for(j=0;e[j];j++)if(f&&c.nodeName(e[j],"script")&&(!e[j].type||e[j].type.toLowerCase()==="text/javascript"))f.push(e[j].parentNode?e[j].parentNode.removeChild(e[j]):e[j]);else{e[j].nodeType===1&&e.splice.apply(e,[j+1,0].concat(c.makeArray(e[j].getElementsByTagName("script"))));d.appendChild(e[j])}return e},cleanData:function(a){for(var b,d,f=c.cache,e=c.event.special,j=c.support.deleteExpando,i=0,o;(o=a[i])!=null;i++)if(d=o[c.expando]){b=f[d];if(b.events)for(var k in b.events)e[k]?
+c.event.remove(o,k):Ca(o,k,b.handle);if(j)delete o[c.expando];else o.removeAttribute&&o.removeAttribute(c.expando);delete f[d]}}});var kb=/z-?index|font-?weight|opacity|zoom|line-?height/i,Na=/alpha\([^)]*\)/,Oa=/opacity=([^)]*)/,ha=/float/i,ia=/-([a-z])/ig,lb=/([A-Z])/g,mb=/^-?\d+(?:px)?$/i,nb=/^-?\d/,ob={position:"absolute",visibility:"hidden",display:"block"},pb=["Left","Right"],qb=["Top","Bottom"],rb=s.defaultView&&s.defaultView.getComputedStyle,Pa=c.support.cssFloat?"cssFloat":"styleFloat",ja=
+function(a,b){return b.toUpperCase()};c.fn.css=function(a,b){return X(this,a,b,true,function(d,f,e){if(e===w)return c.curCSS(d,f);if(typeof e==="number"&&!kb.test(f))e+="px";c.style(d,f,e)})};c.extend({style:function(a,b,d){if(!a||a.nodeType===3||a.nodeType===8)return w;if((b==="width"||b==="height")&&parseFloat(d)<0)d=w;var f=a.style||a,e=d!==w;if(!c.support.opacity&&b==="opacity"){if(e){f.zoom=1;b=parseInt(d,10)+""==="NaN"?"":"alpha(opacity="+d*100+")";a=f.filter||c.curCSS(a,"filter")||"";f.filter=
+Na.test(a)?a.replace(Na,b):b}return f.filter&&f.filter.indexOf("opacity=")>=0?parseFloat(Oa.exec(f.filter)[1])/100+"":""}if(ha.test(b))b=Pa;b=b.replace(ia,ja);if(e)f[b]=d;return f[b]},css:function(a,b,d,f){if(b==="width"||b==="height"){var e,j=b==="width"?pb:qb;function i(){e=b==="width"?a.offsetWidth:a.offsetHeight;f!=="border"&&c.each(j,function(){f||(e-=parseFloat(c.curCSS(a,"padding"+this,true))||0);if(f==="margin")e+=parseFloat(c.curCSS(a,"margin"+this,true))||0;else e-=parseFloat(c.curCSS(a,
+"border"+this+"Width",true))||0})}a.offsetWidth!==0?i():c.swap(a,ob,i);return Math.max(0,Math.round(e))}return c.curCSS(a,b,d)},curCSS:function(a,b,d){var f,e=a.style;if(!c.support.opacity&&b==="opacity"&&a.currentStyle){f=Oa.test(a.currentStyle.filter||"")?parseFloat(RegExp.$1)/100+"":"";return f===""?"1":f}if(ha.test(b))b=Pa;if(!d&&e&&e[b])f=e[b];else if(rb){if(ha.test(b))b="float";b=b.replace(lb,"-$1").toLowerCase();e=a.ownerDocument.defaultView;if(!e)return null;if(a=e.getComputedStyle(a,null))f=
+a.getPropertyValue(b);if(b==="opacity"&&f==="")f="1"}else if(a.currentStyle){d=b.replace(ia,ja);f=a.currentStyle[b]||a.currentStyle[d];if(!mb.test(f)&&nb.test(f)){b=e.left;var j=a.runtimeStyle.left;a.runtimeStyle.left=a.currentStyle.left;e.left=d==="fontSize"?"1em":f||0;f=e.pixelLeft+"px";e.left=b;a.runtimeStyle.left=j}}return f},swap:function(a,b,d){var f={};for(var e in b){f[e]=a.style[e];a.style[e]=b[e]}d.call(a);for(e in b)a.style[e]=f[e]}});if(c.expr&&c.expr.filters){c.expr.filters.hidden=function(a){var b=
+a.offsetWidth,d=a.offsetHeight,f=a.nodeName.toLowerCase()==="tr";return b===0&&d===0&&!f?true:b>0&&d>0&&!f?false:c.curCSS(a,"display")==="none"};c.expr.filters.visible=function(a){return!c.expr.filters.hidden(a)}}var sb=J(),tb=/<script(.|\s)*?\/script>/gi,ub=/select|textarea/i,vb=/color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week/i,N=/=\?(&|$)/,ka=/\?/,wb=/(\?|&)_=.*?(&|$)/,xb=/^(\w+:)?\/\/([^\/?#]+)/,yb=/%20/g,zb=c.fn.load;c.fn.extend({load:function(a,b,d){if(typeof a!==
+"string")return zb.call(this,a);else if(!this.length)return this;var f=a.indexOf(" ");if(f>=0){var e=a.slice(f,a.length);a=a.slice(0,f)}f="GET";if(b)if(c.isFunction(b)){d=b;b=null}else if(typeof b==="object"){b=c.param(b,c.ajaxSettings.traditional);f="POST"}var j=this;c.ajax({url:a,type:f,dataType:"html",data:b,complete:function(i,o){if(o==="success"||o==="notmodified")j.html(e?c("<div />").append(i.responseText.replace(tb,"")).find(e):i.responseText);d&&j.each(d,[i.responseText,o,i])}});return this},
+serialize:function(){return c.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?c.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||ub.test(this.nodeName)||vb.test(this.type))}).map(function(a,b){a=c(this).val();return a==null?null:c.isArray(a)?c.map(a,function(d){return{name:b.name,value:d}}):{name:b.name,value:a}}).get()}});c.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),
+function(a,b){c.fn[b]=function(d){return this.bind(b,d)}});c.extend({get:function(a,b,d,f){if(c.isFunction(b)){f=f||d;d=b;b=null}return c.ajax({type:"GET",url:a,data:b,success:d,dataType:f})},getScript:function(a,b){return c.get(a,null,b,"script")},getJSON:function(a,b,d){return c.get(a,b,d,"json")},post:function(a,b,d,f){if(c.isFunction(b)){f=f||d;d=b;b={}}return c.ajax({type:"POST",url:a,data:b,success:d,dataType:f})},ajaxSetup:function(a){c.extend(c.ajaxSettings,a)},ajaxSettings:{url:location.href,
+global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:A.XMLHttpRequest&&(A.location.protocol!=="file:"||!A.ActiveXObject)?function(){return new A.XMLHttpRequest}:function(){try{return new A.ActiveXObject("Microsoft.XMLHTTP")}catch(a){}},accepts:{xml:"application/xml, text/xml",html:"text/html",script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},lastModified:{},etag:{},ajax:function(a){function b(){e.success&&
+e.success.call(k,o,i,x);e.global&&f("ajaxSuccess",[x,e])}function d(){e.complete&&e.complete.call(k,x,i);e.global&&f("ajaxComplete",[x,e]);e.global&&!--c.active&&c.event.trigger("ajaxStop")}function f(q,p){(e.context?c(e.context):c.event).trigger(q,p)}var e=c.extend(true,{},c.ajaxSettings,a),j,i,o,k=a&&a.context||e,n=e.type.toUpperCase();if(e.data&&e.processData&&typeof e.data!=="string")e.data=c.param(e.data,e.traditional);if(e.dataType==="jsonp"){if(n==="GET")N.test(e.url)||(e.url+=(ka.test(e.url)?
+"&":"?")+(e.jsonp||"callback")+"=?");else if(!e.data||!N.test(e.data))e.data=(e.data?e.data+"&":"")+(e.jsonp||"callback")+"=?";e.dataType="json"}if(e.dataType==="json"&&(e.data&&N.test(e.data)||N.test(e.url))){j=e.jsonpCallback||"jsonp"+sb++;if(e.data)e.data=(e.data+"").replace(N,"="+j+"$1");e.url=e.url.replace(N,"="+j+"$1");e.dataType="script";A[j]=A[j]||function(q){o=q;b();d();A[j]=w;try{delete A[j]}catch(p){}z&&z.removeChild(C)}}if(e.dataType==="script"&&e.cache===null)e.cache=false;if(e.cache===
+false&&n==="GET"){var r=J(),u=e.url.replace(wb,"$1_="+r+"$2");e.url=u+(u===e.url?(ka.test(e.url)?"&":"?")+"_="+r:"")}if(e.data&&n==="GET")e.url+=(ka.test(e.url)?"&":"?")+e.data;e.global&&!c.active++&&c.event.trigger("ajaxStart");r=(r=xb.exec(e.url))&&(r[1]&&r[1]!==location.protocol||r[2]!==location.host);if(e.dataType==="script"&&n==="GET"&&r){var z=s.getElementsByTagName("head")[0]||s.documentElement,C=s.createElement("script");C.src=e.url;if(e.scriptCharset)C.charset=e.scriptCharset;if(!j){var B=
+false;C.onload=C.onreadystatechange=function(){if(!B&&(!this.readyState||this.readyState==="loaded"||this.readyState==="complete")){B=true;b();d();C.onload=C.onreadystatechange=null;z&&C.parentNode&&z.removeChild(C)}}}z.insertBefore(C,z.firstChild);return w}var E=false,x=e.xhr();if(x){e.username?x.open(n,e.url,e.async,e.username,e.password):x.open(n,e.url,e.async);try{if(e.data||a&&a.contentType)x.setRequestHeader("Content-Type",e.contentType);if(e.ifModified){c.lastModified[e.url]&&x.setRequestHeader("If-Modified-Since",
+c.lastModified[e.url]);c.etag[e.url]&&x.setRequestHeader("If-None-Match",c.etag[e.url])}r||x.setRequestHeader("X-Requested-With","XMLHttpRequest");x.setRequestHeader("Accept",e.dataType&&e.accepts[e.dataType]?e.accepts[e.dataType]+", */*":e.accepts._default)}catch(ga){}if(e.beforeSend&&e.beforeSend.call(k,x,e)===false){e.global&&!--c.active&&c.event.trigger("ajaxStop");x.abort();return false}e.global&&f("ajaxSend",[x,e]);var g=x.onreadystatechange=function(q){if(!x||x.readyState===0||q==="abort"){E||
+d();E=true;if(x)x.onreadystatechange=c.noop}else if(!E&&x&&(x.readyState===4||q==="timeout")){E=true;x.onreadystatechange=c.noop;i=q==="timeout"?"timeout":!c.httpSuccess(x)?"error":e.ifModified&&c.httpNotModified(x,e.url)?"notmodified":"success";var p;if(i==="success")try{o=c.httpData(x,e.dataType,e)}catch(v){i="parsererror";p=v}if(i==="success"||i==="notmodified")j||b();else c.handleError(e,x,i,p);d();q==="timeout"&&x.abort();if(e.async)x=null}};try{var h=x.abort;x.abort=function(){x&&h.call(x);
+g("abort")}}catch(l){}e.async&&e.timeout>0&&setTimeout(function(){x&&!E&&g("timeout")},e.timeout);try{x.send(n==="POST"||n==="PUT"||n==="DELETE"?e.data:null)}catch(m){c.handleError(e,x,null,m);d()}e.async||g();return x}},handleError:function(a,b,d,f){if(a.error)a.error.call(a.context||a,b,d,f);if(a.global)(a.context?c(a.context):c.event).trigger("ajaxError",[b,a,f])},active:0,httpSuccess:function(a){try{return!a.status&&location.protocol==="file:"||a.status>=200&&a.status<300||a.status===304||a.status===
+1223||a.status===0}catch(b){}return false},httpNotModified:function(a,b){var d=a.getResponseHeader("Last-Modified"),f=a.getResponseHeader("Etag");if(d)c.lastModified[b]=d;if(f)c.etag[b]=f;return a.status===304||a.status===0},httpData:function(a,b,d){var f=a.getResponseHeader("content-type")||"",e=b==="xml"||!b&&f.indexOf("xml")>=0;a=e?a.responseXML:a.responseText;e&&a.documentElement.nodeName==="parsererror"&&c.error("parsererror");if(d&&d.dataFilter)a=d.dataFilter(a,b);if(typeof a==="string")if(b===
+"json"||!b&&f.indexOf("json")>=0)a=c.parseJSON(a);else if(b==="script"||!b&&f.indexOf("javascript")>=0)c.globalEval(a);return a},param:function(a,b){function d(i,o){if(c.isArray(o))c.each(o,function(k,n){b||/\[\]$/.test(i)?f(i,n):d(i+"["+(typeof n==="object"||c.isArray(n)?k:"")+"]",n)});else!b&&o!=null&&typeof o==="object"?c.each(o,function(k,n){d(i+"["+k+"]",n)}):f(i,o)}function f(i,o){o=c.isFunction(o)?o():o;e[e.length]=encodeURIComponent(i)+"="+encodeURIComponent(o)}var e=[];if(b===w)b=c.ajaxSettings.traditional;
+if(c.isArray(a)||a.jquery)c.each(a,function(){f(this.name,this.value)});else for(var j in a)d(j,a[j]);return e.join("&").replace(yb,"+")}});var la={},Ab=/toggle|show|hide/,Bb=/^([+-]=)?([\d+-.]+)(.*)$/,W,va=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];c.fn.extend({show:function(a,b){if(a||a===0)return this.animate(K("show",3),a,b);else{a=0;for(b=this.length;a<b;a++){var d=c.data(this[a],"olddisplay");
+this[a].style.display=d||"";if(c.css(this[a],"display")==="none"){d=this[a].nodeName;var f;if(la[d])f=la[d];else{var e=c("<"+d+" />").appendTo("body");f=e.css("display");if(f==="none")f="block";e.remove();la[d]=f}c.data(this[a],"olddisplay",f)}}a=0;for(b=this.length;a<b;a++)this[a].style.display=c.data(this[a],"olddisplay")||"";return this}},hide:function(a,b){if(a||a===0)return this.animate(K("hide",3),a,b);else{a=0;for(b=this.length;a<b;a++){var d=c.data(this[a],"olddisplay");!d&&d!=="none"&&c.data(this[a],
+"olddisplay",c.css(this[a],"display"))}a=0;for(b=this.length;a<b;a++)this[a].style.display="none";return this}},_toggle:c.fn.toggle,toggle:function(a,b){var d=typeof a==="boolean";if(c.isFunction(a)&&c.isFunction(b))this._toggle.apply(this,arguments);else a==null||d?this.each(function(){var f=d?a:c(this).is(":hidden");c(this)[f?"show":"hide"]()}):this.animate(K("toggle",3),a,b);return this},fadeTo:function(a,b,d){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,d)},
+animate:function(a,b,d,f){var e=c.speed(b,d,f);if(c.isEmptyObject(a))return this.each(e.complete);return this[e.queue===false?"each":"queue"](function(){var j=c.extend({},e),i,o=this.nodeType===1&&c(this).is(":hidden"),k=this;for(i in a){var n=i.replace(ia,ja);if(i!==n){a[n]=a[i];delete a[i];i=n}if(a[i]==="hide"&&o||a[i]==="show"&&!o)return j.complete.call(this);if((i==="height"||i==="width")&&this.style){j.display=c.css(this,"display");j.overflow=this.style.overflow}if(c.isArray(a[i])){(j.specialEasing=
+j.specialEasing||{})[i]=a[i][1];a[i]=a[i][0]}}if(j.overflow!=null)this.style.overflow="hidden";j.curAnim=c.extend({},a);c.each(a,function(r,u){var z=new c.fx(k,j,r);if(Ab.test(u))z[u==="toggle"?o?"show":"hide":u](a);else{var C=Bb.exec(u),B=z.cur(true)||0;if(C){u=parseFloat(C[2]);var E=C[3]||"px";if(E!=="px"){k.style[r]=(u||1)+E;B=(u||1)/z.cur(true)*B;k.style[r]=B+E}if(C[1])u=(C[1]==="-="?-1:1)*u+B;z.custom(B,u,E)}else z.custom(B,u,"")}});return true})},stop:function(a,b){var d=c.timers;a&&this.queue([]);
+this.each(function(){for(var f=d.length-1;f>=0;f--)if(d[f].elem===this){b&&d[f](true);d.splice(f,1)}});b||this.dequeue();return this}});c.each({slideDown:K("show",1),slideUp:K("hide",1),slideToggle:K("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"}},function(a,b){c.fn[a]=function(d,f){return this.animate(b,d,f)}});c.extend({speed:function(a,b,d){var f=a&&typeof a==="object"?a:{complete:d||!d&&b||c.isFunction(a)&&a,duration:a,easing:d&&b||b&&!c.isFunction(b)&&b};f.duration=c.fx.off?0:typeof f.duration===
+"number"?f.duration:c.fx.speeds[f.duration]||c.fx.speeds._default;f.old=f.complete;f.complete=function(){f.queue!==false&&c(this).dequeue();c.isFunction(f.old)&&f.old.call(this)};return f},easing:{linear:function(a,b,d,f){return d+f*a},swing:function(a,b,d,f){return(-Math.cos(a*Math.PI)/2+0.5)*f+d}},timers:[],fx:function(a,b,d){this.options=b;this.elem=a;this.prop=d;if(!b.orig)b.orig={}}});c.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this);(c.fx.step[this.prop]||
+c.fx.step._default)(this);if((this.prop==="height"||this.prop==="width")&&this.elem.style)this.elem.style.display="block"},cur:function(a){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];return(a=parseFloat(c.css(this.elem,this.prop,a)))&&a>-10000?a:parseFloat(c.curCSS(this.elem,this.prop))||0},custom:function(a,b,d){function f(j){return e.step(j)}this.startTime=J();this.start=a;this.end=b;this.unit=d||this.unit||"px";this.now=this.start;
+this.pos=this.state=0;var e=this;f.elem=this.elem;if(f()&&c.timers.push(f)&&!W)W=setInterval(c.fx.tick,13)},show:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.show=true;this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur());c(this.elem).show()},hide:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(a){var b=J(),d=true;if(a||b>=this.options.duration+this.startTime){this.now=
+this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;for(var f in this.options.curAnim)if(this.options.curAnim[f]!==true)d=false;if(d){if(this.options.display!=null){this.elem.style.overflow=this.options.overflow;a=c.data(this.elem,"olddisplay");this.elem.style.display=a?a:this.options.display;if(c.css(this.elem,"display")==="none")this.elem.style.display="block"}this.options.hide&&c(this.elem).hide();if(this.options.hide||this.options.show)for(var e in this.options.curAnim)c.style(this.elem,
+e,this.options.orig[e]);this.options.complete.call(this.elem)}return false}else{e=b-this.startTime;this.state=e/this.options.duration;a=this.options.easing||(c.easing.swing?"swing":"linear");this.pos=c.easing[this.options.specialEasing&&this.options.specialEasing[this.prop]||a](this.state,e,0,1,this.options.duration);this.now=this.start+(this.end-this.start)*this.pos;this.update()}return true}};c.extend(c.fx,{tick:function(){for(var a=c.timers,b=0;b<a.length;b++)a[b]()||a.splice(b--,1);a.length||
+c.fx.stop()},stop:function(){clearInterval(W);W=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){c.style(a.elem,"opacity",a.now)},_default:function(a){if(a.elem.style&&a.elem.style[a.prop]!=null)a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit;else a.elem[a.prop]=a.now}}});if(c.expr&&c.expr.filters)c.expr.filters.animated=function(a){return c.grep(c.timers,function(b){return a===b.elem}).length};c.fn.offset="getBoundingClientRect"in s.documentElement?
+function(a){var b=this[0];if(a)return this.each(function(e){c.offset.setOffset(this,a,e)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);var d=b.getBoundingClientRect(),f=b.ownerDocument;b=f.body;f=f.documentElement;return{top:d.top+(self.pageYOffset||c.support.boxModel&&f.scrollTop||b.scrollTop)-(f.clientTop||b.clientTop||0),left:d.left+(self.pageXOffset||c.support.boxModel&&f.scrollLeft||b.scrollLeft)-(f.clientLeft||b.clientLeft||0)}}:function(a){var b=
+this[0];if(a)return this.each(function(r){c.offset.setOffset(this,a,r)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);c.offset.initialize();var d=b.offsetParent,f=b,e=b.ownerDocument,j,i=e.documentElement,o=e.body;f=(e=e.defaultView)?e.getComputedStyle(b,null):b.currentStyle;for(var k=b.offsetTop,n=b.offsetLeft;(b=b.parentNode)&&b!==o&&b!==i;){if(c.offset.supportsFixedPosition&&f.position==="fixed")break;j=e?e.getComputedStyle(b,null):b.currentStyle;
+k-=b.scrollTop;n-=b.scrollLeft;if(b===d){k+=b.offsetTop;n+=b.offsetLeft;if(c.offset.doesNotAddBorder&&!(c.offset.doesAddBorderForTableAndCells&&/^t(able|d|h)$/i.test(b.nodeName))){k+=parseFloat(j.borderTopWidth)||0;n+=parseFloat(j.borderLeftWidth)||0}f=d;d=b.offsetParent}if(c.offset.subtractsBorderForOverflowNotVisible&&j.overflow!=="visible"){k+=parseFloat(j.borderTopWidth)||0;n+=parseFloat(j.borderLeftWidth)||0}f=j}if(f.position==="relative"||f.position==="static"){k+=o.offsetTop;n+=o.offsetLeft}if(c.offset.supportsFixedPosition&&
+f.position==="fixed"){k+=Math.max(i.scrollTop,o.scrollTop);n+=Math.max(i.scrollLeft,o.scrollLeft)}return{top:k,left:n}};c.offset={initialize:function(){var a=s.body,b=s.createElement("div"),d,f,e,j=parseFloat(c.curCSS(a,"marginTop",true))||0;c.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px",height:"1px",visibility:"hidden"});b.innerHTML="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";
+a.insertBefore(b,a.firstChild);d=b.firstChild;f=d.firstChild;e=d.nextSibling.firstChild.firstChild;this.doesNotAddBorder=f.offsetTop!==5;this.doesAddBorderForTableAndCells=e.offsetTop===5;f.style.position="fixed";f.style.top="20px";this.supportsFixedPosition=f.offsetTop===20||f.offsetTop===15;f.style.position=f.style.top="";d.style.overflow="hidden";d.style.position="relative";this.subtractsBorderForOverflowNotVisible=f.offsetTop===-5;this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==j;a.removeChild(b);
+c.offset.initialize=c.noop},bodyOffset:function(a){var b=a.offsetTop,d=a.offsetLeft;c.offset.initialize();if(c.offset.doesNotIncludeMarginInBodyOffset){b+=parseFloat(c.curCSS(a,"marginTop",true))||0;d+=parseFloat(c.curCSS(a,"marginLeft",true))||0}return{top:b,left:d}},setOffset:function(a,b,d){if(/static/.test(c.curCSS(a,"position")))a.style.position="relative";var f=c(a),e=f.offset(),j=parseInt(c.curCSS(a,"top",true),10)||0,i=parseInt(c.curCSS(a,"left",true),10)||0;if(c.isFunction(b))b=b.call(a,
+d,e);d={top:b.top-e.top+j,left:b.left-e.left+i};"using"in b?b.using.call(a,d):f.css(d)}};c.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),d=this.offset(),f=/^body|html$/i.test(b[0].nodeName)?{top:0,left:0}:b.offset();d.top-=parseFloat(c.curCSS(a,"marginTop",true))||0;d.left-=parseFloat(c.curCSS(a,"marginLeft",true))||0;f.top+=parseFloat(c.curCSS(b[0],"borderTopWidth",true))||0;f.left+=parseFloat(c.curCSS(b[0],"borderLeftWidth",true))||0;return{top:d.top-
+f.top,left:d.left-f.left}},offsetParent:function(){return this.map(function(){for(var a=this.offsetParent||s.body;a&&!/^body|html$/i.test(a.nodeName)&&c.css(a,"position")==="static";)a=a.offsetParent;return a})}});c.each(["Left","Top"],function(a,b){var d="scroll"+b;c.fn[d]=function(f){var e=this[0],j;if(!e)return null;if(f!==w)return this.each(function(){if(j=wa(this))j.scrollTo(!a?f:c(j).scrollLeft(),a?f:c(j).scrollTop());else this[d]=f});else return(j=wa(e))?"pageXOffset"in j?j[a?"pageYOffset":
+"pageXOffset"]:c.support.boxModel&&j.document.documentElement[d]||j.document.body[d]:e[d]}});c.each(["Height","Width"],function(a,b){var d=b.toLowerCase();c.fn["inner"+b]=function(){return this[0]?c.css(this[0],d,false,"padding"):null};c.fn["outer"+b]=function(f){return this[0]?c.css(this[0],d,false,f?"margin":"border"):null};c.fn[d]=function(f){var e=this[0];if(!e)return f==null?null:this;if(c.isFunction(f))return this.each(function(j){var i=c(this);i[d](f.call(this,j,i[d]()))});return"scrollTo"in
+e&&e.document?e.document.compatMode==="CSS1Compat"&&e.document.documentElement["client"+b]||e.document.body["client"+b]:e.nodeType===9?Math.max(e.documentElement["client"+b],e.body["scroll"+b],e.documentElement["scroll"+b],e.body["offset"+b],e.documentElement["offset"+b]):f===w?c.css(e,d):this.css(d,typeof f==="string"?f:f+"px")}});A.jQuery=A.$=c})(window);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/jquery.tools.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,20 @@
+/*
+ * jQuery Tools 1.2.2 - The missing UI library for the Web
+ *
+ * [tooltip, tooltip.slide]
+ *
+ * NO COPYRIGHTS OR LICENSES. DO WHAT YOU LIKE.
+ *
+ * http://flowplayer.org/tools/
+ *
+ * File generated: Tue May 25 12:04:24 GMT 2010
+ */
+(function(f){function p(a,b,c){var h=c.relative?a.position().top:a.offset().top,e=c.relative?a.position().left:a.offset().left,i=c.position[0];h-=b.outerHeight()-c.offset[0];e+=a.outerWidth()+c.offset[1];var j=b.outerHeight()+a.outerHeight();if(i=="center")h+=j/2;if(i=="bottom")h+=j;i=c.position[1];a=b.outerWidth()+a.outerWidth();if(i=="center")e-=a/2;if(i=="left")e-=a;return{top:h,left:e}}function t(a,b){var c=this,h=a.add(c),e,i=0,j=0,m=a.attr("title"),q=n[b.effect],k,r=a.is(":input"),u=r&&a.is(":checkbox, :radio, select, :button"),
+s=a.attr("type"),l=b.events[s]||b.events[r?u?"widget":"input":"def"];if(!q)throw'Nonexistent effect "'+b.effect+'"';l=l.split(/,\s*/);if(l.length!=2)throw"Tooltip: bad events configuration for "+s;a.bind(l[0],function(d){if(b.predelay){clearTimeout(i);j=setTimeout(function(){c.show(d)},b.predelay)}else c.show(d)}).bind(l[1],function(d){if(b.delay){clearTimeout(j);i=setTimeout(function(){c.hide(d)},b.delay)}else c.hide(d)});if(m&&b.cancelDefault){a.removeAttr("title");a.data("title",m)}f.extend(c,
+{show:function(d){if(!e){if(m)e=f(b.layout).addClass(b.tipClass).appendTo(document.body).hide().append(m);else if(b.tip)e=f(b.tip).eq(0);else{e=a.next();e.length||(e=a.parent().next())}if(!e.length)throw"Cannot find tooltip for "+a;}if(c.isShown())return c;e.stop(true,true);var g=p(a,e,b);d=d||f.Event();d.type="onBeforeShow";h.trigger(d,[g]);if(d.isDefaultPrevented())return c;g=p(a,e,b);e.css({position:"absolute",top:g.top,left:g.left});k=true;q[0].call(c,function(){d.type="onShow";k="full";h.trigger(d)});
+g=b.events.tooltip.split(/,\s*/);e.bind(g[0],function(){clearTimeout(i);clearTimeout(j)});g[1]&&!a.is("input:not(:checkbox, :radio), textarea")&&e.bind(g[1],function(o){o.relatedTarget!=a[0]&&a.trigger(l[1].split(" ")[0])});return c},hide:function(d){if(!e||!c.isShown())return c;d=d||f.Event();d.type="onBeforeHide";h.trigger(d);if(!d.isDefaultPrevented()){k=false;n[b.effect][1].call(c,function(){d.type="onHide";k=false;h.trigger(d)});return c}},isShown:function(d){return d?k=="full":k},getConf:function(){return b},
+getTip:function(){return e},getTrigger:function(){return a}});f.each("onHide,onBeforeShow,onShow,onBeforeHide".split(","),function(d,g){f.isFunction(b[g])&&f(c).bind(g,b[g]);c[g]=function(o){f(c).bind(g,o);return c}})}f.tools=f.tools||{version:"1.2.2"};f.tools.tooltip={conf:{effect:"toggle",fadeOutSpeed:"fast",predelay:0,delay:30,opacity:1,tip:0,position:["top","center"],offset:[0,0],relative:false,cancelDefault:true,events:{def:"mouseenter,mouseleave",input:"focus,blur",widget:"focus mouseenter,blur mouseleave",
+tooltip:"mouseenter,mouseleave"},layout:"<div/>",tipClass:"tooltip"},addEffect:function(a,b,c){n[a]=[b,c]}};var n={toggle:[function(a){var b=this.getConf(),c=this.getTip();b=b.opacity;b<1&&c.css({opacity:b});c.show();a.call()},function(a){this.getTip().hide();a.call()}],fade:[function(a){var b=this.getConf();this.getTip().fadeTo(b.fadeInSpeed,b.opacity,a)},function(a){this.getTip().fadeOut(this.getConf().fadeOutSpeed,a)}]};f.fn.tooltip=function(a){var b=this.data("tooltip");if(b)return b;a=f.extend(true,
+{},f.tools.tooltip.conf,a);if(typeof a.position=="string")a.position=a.position.split(/,?\s/);this.each(function(){b=new t(f(this),a);f(this).data("tooltip",b)});return a.api?b:this}})(jQuery);
+(function(d){var i=d.tools.tooltip;d.extend(i.conf,{direction:"up",bounce:false,slideOffset:10,slideInSpeed:200,slideOutSpeed:200,slideFade:!d.browser.msie});var e={up:["-","top"],down:["+","top"],left:["-","left"],right:["+","left"]};i.addEffect("slide",function(g){var a=this.getConf(),f=this.getTip(),b=a.slideFade?{opacity:a.opacity}:{},c=e[a.direction]||e.up;b[c[1]]=c[0]+"="+a.slideOffset;a.slideFade&&f.css({opacity:0});f.show().animate(b,a.slideInSpeed,g)},function(g){var a=this.getConf(),f=a.slideOffset,
+b=a.slideFade?{opacity:0}:{},c=e[a.direction]||e.up,h=""+c[0];if(a.bounce)h=h=="+"?"-":"+";b[c[1]]=h+"="+f;this.getTip().animate(b,a.slideOutSpeed,function(){d(this).hide();g.call()})})})(jQuery);
--- a/web/static/js/swfobject.js Fri Jun 11 00:25:17 2010 +0200
+++ b/web/static/js/swfobject.js Sat Jun 12 00:33:37 2010 +0200
@@ -1,4 +1,5 @@
-/* SWFObject v2.2 <http://code.google.com/p/swfobject/>
- is released under the MIT License <http://www.opensource.org/licenses/mit-license.php>
-*/
-var swfobject=function(){var D="undefined",r="object",S="Shockwave Flash",W="ShockwaveFlash.ShockwaveFlash",q="application/x-shockwave-flash",R="SWFObjectExprInst",x="onreadystatechange",O=window,j=document,t=navigator,T=false,U=[h],o=[],N=[],I=[],l,Q,E,B,J=false,a=false,n,G,m=true,M=function(){var aa=typeof j.getElementById!=D&&typeof j.getElementsByTagName!=D&&typeof j.createElement!=D,ah=t.userAgent.toLowerCase(),Y=t.platform.toLowerCase(),ae=Y?/win/.test(Y):/win/.test(ah),ac=Y?/mac/.test(Y):/mac/.test(ah),af=/webkit/.test(ah)?parseFloat(ah.replace(/^.*webkit\/(\d+(\.\d+)?).*$/,"$1")):false,X=!+"\v1",ag=[0,0,0],ab=null;if(typeof t.plugins!=D&&typeof t.plugins[S]==r){ab=t.plugins[S].description;if(ab&&!(typeof t.mimeTypes!=D&&t.mimeTypes[q]&&!t.mimeTypes[q].enabledPlugin)){T=true;X=false;ab=ab.replace(/^.*\s+(\S+\s+\S+$)/,"$1");ag[0]=parseInt(ab.replace(/^(.*)\..*$/,"$1"),10);ag[1]=parseInt(ab.replace(/^.*\.(.*)\s.*$/,"$1"),10);ag[2]=/[a-zA-Z]/.test(ab)?parseInt(ab.replace(/^.*[a-zA-Z]+(.*)$/,"$1"),10):0}}else{if(typeof O.ActiveXObject!=D){try{var ad=new ActiveXObject(W);if(ad){ab=ad.GetVariable("$version");if(ab){X=true;ab=ab.split(" ")[1].split(",");ag=[parseInt(ab[0],10),parseInt(ab[1],10),parseInt(ab[2],10)]}}}catch(Z){}}}return{w3:aa,pv:ag,wk:af,ie:X,win:ae,mac:ac}}(),k=function(){if(!M.w3){return}if((typeof j.readyState!=D&&j.readyState=="complete")||(typeof j.readyState==D&&(j.getElementsByTagName("body")[0]||j.body))){f()}if(!J){if(typeof j.addEventListener!=D){j.addEventListener("DOMContentLoaded",f,false)}if(M.ie&&M.win){j.attachEvent(x,function(){if(j.readyState=="complete"){j.detachEvent(x,arguments.callee);f()}});if(O==top){(function(){if(J){return}try{j.documentElement.doScroll("left")}catch(X){setTimeout(arguments.callee,0);return}f()})()}}if(M.wk){(function(){if(J){return}if(!/loaded|complete/.test(j.readyState)){setTimeout(arguments.callee,0);return}f()})()}s(f)}}();function f(){if(J){return}try{var Z=j.getElementsByTagName("body")[0].appendChild(C("span"));Z.parentNode.removeChild(Z)}catch(aa){return}J=true;var X=U.length;for(var Y=0;Y<X;Y++){U[Y]()}}function K(X){if(J){X()}else{U[U.length]=X}}function s(Y){if(typeof O.addEventListener!=D){O.addEventListener("load",Y,false)}else{if(typeof j.addEventListener!=D){j.addEventListener("load",Y,false)}else{if(typeof O.attachEvent!=D){i(O,"onload",Y)}else{if(typeof O.onload=="function"){var X=O.onload;O.onload=function(){X();Y()}}else{O.onload=Y}}}}}function h(){if(T){V()}else{H()}}function V(){var X=j.getElementsByTagName("body")[0];var aa=C(r);aa.setAttribute("type",q);var Z=X.appendChild(aa);if(Z){var Y=0;(function(){if(typeof Z.GetVariable!=D){var ab=Z.GetVariable("$version");if(ab){ab=ab.split(" ")[1].split(",");M.pv=[parseInt(ab[0],10),parseInt(ab[1],10),parseInt(ab[2],10)]}}else{if(Y<10){Y++;setTimeout(arguments.callee,10);return}}X.removeChild(aa);Z=null;H()})()}else{H()}}function H(){var ag=o.length;if(ag>0){for(var af=0;af<ag;af++){var Y=o[af].id;var ab=o[af].callbackFn;var aa={success:false,id:Y};if(M.pv[0]>0){var ae=c(Y);if(ae){if(F(o[af].swfVersion)&&!(M.wk&&M.wk<312)){w(Y,true);if(ab){aa.success=true;aa.ref=z(Y);ab(aa)}}else{if(o[af].expressInstall&&A()){var ai={};ai.data=o[af].expressInstall;ai.width=ae.getAttribute("width")||"0";ai.height=ae.getAttribute("height")||"0";if(ae.getAttribute("class")){ai.styleclass=ae.getAttribute("class")}if(ae.getAttribute("align")){ai.align=ae.getAttribute("align")}var ah={};var X=ae.getElementsByTagName("param");var ac=X.length;for(var ad=0;ad<ac;ad++){if(X[ad].getAttribute("name").toLowerCase()!="movie"){ah[X[ad].getAttribute("name")]=X[ad].getAttribute("value")}}P(ai,ah,Y,ab)}else{p(ae);if(ab){ab(aa)}}}}}else{w(Y,true);if(ab){var Z=z(Y);if(Z&&typeof Z.SetVariable!=D){aa.success=true;aa.ref=Z}ab(aa)}}}}}function z(aa){var X=null;var Y=c(aa);if(Y&&Y.nodeName=="OBJECT"){if(typeof Y.SetVariable!=D){X=Y}else{var Z=Y.getElementsByTagName(r)[0];if(Z){X=Z}}}return X}function A(){return !a&&F("6.0.65")&&(M.win||M.mac)&&!(M.wk&&M.wk<312)}function P(aa,ab,X,Z){a=true;E=Z||null;B={success:false,id:X};var ae=c(X);if(ae){if(ae.nodeName=="OBJECT"){l=g(ae);Q=null}else{l=ae;Q=X}aa.id=R;if(typeof aa.width==D||(!/%$/.test(aa.width)&&parseInt(aa.width,10)<310)){aa.width="310"}if(typeof aa.height==D||(!/%$/.test(aa.height)&&parseInt(aa.height,10)<137)){aa.height="137"}j.title=j.title.slice(0,47)+" - Flash Player Installation";var ad=M.ie&&M.win?"ActiveX":"PlugIn",ac="MMredirectURL="+O.location.toString().replace(/&/g,"%26")+"&MMplayerType="+ad+"&MMdoctitle="+j.title;if(typeof ab.flashvars!=D){ab.flashvars+="&"+ac}else{ab.flashvars=ac}if(M.ie&&M.win&&ae.readyState!=4){var Y=C("div");X+="SWFObjectNew";Y.setAttribute("id",X);ae.parentNode.insertBefore(Y,ae);ae.style.display="none";(function(){if(ae.readyState==4){ae.parentNode.removeChild(ae)}else{setTimeout(arguments.callee,10)}})()}u(aa,ab,X)}}function p(Y){if(M.ie&&M.win&&Y.readyState!=4){var X=C("div");Y.parentNode.insertBefore(X,Y);X.parentNode.replaceChild(g(Y),X);Y.style.display="none";(function(){if(Y.readyState==4){Y.parentNode.removeChild(Y)}else{setTimeout(arguments.callee,10)}})()}else{Y.parentNode.replaceChild(g(Y),Y)}}function g(ab){var aa=C("div");if(M.win&&M.ie){aa.innerHTML=ab.innerHTML}else{var Y=ab.getElementsByTagName(r)[0];if(Y){var ad=Y.childNodes;if(ad){var X=ad.length;for(var Z=0;Z<X;Z++){if(!(ad[Z].nodeType==1&&ad[Z].nodeName=="PARAM")&&!(ad[Z].nodeType==8)){aa.appendChild(ad[Z].cloneNode(true))}}}}}return aa}function u(ai,ag,Y){var X,aa=c(Y);if(M.wk&&M.wk<312){return X}if(aa){if(typeof ai.id==D){ai.id=Y}if(M.ie&&M.win){var ah="";for(var ae in ai){if(ai[ae]!=Object.prototype[ae]){if(ae.toLowerCase()=="data"){ag.movie=ai[ae]}else{if(ae.toLowerCase()=="styleclass"){ah+=' class="'+ai[ae]+'"'}else{if(ae.toLowerCase()!="classid"){ah+=" "+ae+'="'+ai[ae]+'"'}}}}}var af="";for(var ad in ag){if(ag[ad]!=Object.prototype[ad]){af+='<param name="'+ad+'" value="'+ag[ad]+'" />'}}aa.outerHTML='<object classid="clsid:D27CDB6E-AE6D-11cf-96B8-444553540000"'+ah+">"+af+"</object>";N[N.length]=ai.id;X=c(ai.id)}else{var Z=C(r);Z.setAttribute("type",q);for(var ac in ai){if(ai[ac]!=Object.prototype[ac]){if(ac.toLowerCase()=="styleclass"){Z.setAttribute("class",ai[ac])}else{if(ac.toLowerCase()!="classid"){Z.setAttribute(ac,ai[ac])}}}}for(var ab in ag){if(ag[ab]!=Object.prototype[ab]&&ab.toLowerCase()!="movie"){e(Z,ab,ag[ab])}}aa.parentNode.replaceChild(Z,aa);X=Z}}return X}function e(Z,X,Y){var aa=C("param");aa.setAttribute("name",X);aa.setAttribute("value",Y);Z.appendChild(aa)}function y(Y){var X=c(Y);if(X&&X.nodeName=="OBJECT"){if(M.ie&&M.win){X.style.display="none";(function(){if(X.readyState==4){b(Y)}else{setTimeout(arguments.callee,10)}})()}else{X.parentNode.removeChild(X)}}}function b(Z){var Y=c(Z);if(Y){for(var X in Y){if(typeof Y[X]=="function"){Y[X]=null}}Y.parentNode.removeChild(Y)}}function c(Z){var X=null;try{X=j.getElementById(Z)}catch(Y){}return X}function C(X){return j.createElement(X)}function i(Z,X,Y){Z.attachEvent(X,Y);I[I.length]=[Z,X,Y]}function F(Z){var Y=M.pv,X=Z.split(".");X[0]=parseInt(X[0],10);X[1]=parseInt(X[1],10)||0;X[2]=parseInt(X[2],10)||0;return(Y[0]>X[0]||(Y[0]==X[0]&&Y[1]>X[1])||(Y[0]==X[0]&&Y[1]==X[1]&&Y[2]>=X[2]))?true:false}function v(ac,Y,ad,ab){if(M.ie&&M.mac){return}var aa=j.getElementsByTagName("head")[0];if(!aa){return}var X=(ad&&typeof ad=="string")?ad:"screen";if(ab){n=null;G=null}if(!n||G!=X){var Z=C("style");Z.setAttribute("type","text/css");Z.setAttribute("media",X);n=aa.appendChild(Z);if(M.ie&&M.win&&typeof j.styleSheets!=D&&j.styleSheets.length>0){n=j.styleSheets[j.styleSheets.length-1]}G=X}if(M.ie&&M.win){if(n&&typeof n.addRule==r){n.addRule(ac,Y)}}else{if(n&&typeof j.createTextNode!=D){n.appendChild(j.createTextNode(ac+" {"+Y+"}"))}}}function w(Z,X){if(!m){return}var Y=X?"visible":"hidden";if(J&&c(Z)){c(Z).style.visibility=Y}else{v("#"+Z,"visibility:"+Y)}}function L(Y){var Z=/[\\\"<>\.;]/;var X=Z.exec(Y)!=null;return X&&typeof encodeURIComponent!=D?encodeURIComponent(Y):Y}var d=function(){if(M.ie&&M.win){window.attachEvent("onunload",function(){var ac=I.length;for(var ab=0;ab<ac;ab++){I[ab][0].detachEvent(I[ab][1],I[ab][2])}var Z=N.length;for(var aa=0;aa<Z;aa++){y(N[aa])}for(var Y in M){M[Y]=null}M=null;for(var X in swfobject){swfobject[X]=null}swfobject=null})}}();return{registerObject:function(ab,X,aa,Z){if(M.w3&&ab&&X){var Y={};Y.id=ab;Y.swfVersion=X;Y.expressInstall=aa;Y.callbackFn=Z;o[o.length]=Y;w(ab,false)}else{if(Z){Z({success:false,id:ab})}}},getObjectById:function(X){if(M.w3){return z(X)}},embedSWF:function(ab,ah,ae,ag,Y,aa,Z,ad,af,ac){var X={success:false,id:ah};if(M.w3&&!(M.wk&&M.wk<312)&&ab&&ah&&ae&&ag&&Y){w(ah,false);K(function(){ae+="";ag+="";var aj={};if(af&&typeof af===r){for(var al in af){aj[al]=af[al]}}aj.data=ab;aj.width=ae;aj.height=ag;var am={};if(ad&&typeof ad===r){for(var ak in ad){am[ak]=ad[ak]}}if(Z&&typeof Z===r){for(var ai in Z){if(typeof am.flashvars!=D){am.flashvars+="&"+ai+"="+Z[ai]}else{am.flashvars=ai+"="+Z[ai]}}}if(F(Y)){var an=u(aj,am,ah);if(aj.id==ah){w(ah,true)}X.success=true;X.ref=an}else{if(aa&&A()){aj.data=aa;P(aj,am,ah,ac);return}else{w(ah,true)}}if(ac){ac(X)}})}else{if(ac){ac(X)}}},switchOffAutoHideShow:function(){m=false},ua:M,getFlashPlayerVersion:function(){return{major:M.pv[0],minor:M.pv[1],release:M.pv[2]}},hasFlashPlayerVersion:F,createSWF:function(Z,Y,X){if(M.w3){return u(Z,Y,X)}else{return undefined}},showExpressInstall:function(Z,aa,X,Y){if(M.w3&&A()){P(Z,aa,X,Y)}},removeSWF:function(X){if(M.w3){y(X)}},createCSS:function(aa,Z,Y,X){if(M.w3){v(aa,Z,Y,X)}},addDomLoadEvent:K,addLoadEvent:s,getQueryParamValue:function(aa){var Z=j.location.search||j.location.hash;if(Z){if(/\?/.test(Z)){Z=Z.split("?")[1]}if(aa==null){return L(Z)}var Y=Z.split("&");for(var X=0;X<Y.length;X++){if(Y[X].substring(0,Y[X].indexOf("="))==aa){return L(Y[X].substring((Y[X].indexOf("=")+1)))}}}return""},expressInstallCallback:function(){if(a){var X=c(R);if(X&&l){X.parentNode.replaceChild(l,X);if(Q){w(Q,true);if(M.ie&&M.win){l.style.display="block"}}if(E){E(B)}}a=false}}}}();
\ No newline at end of file
+/* SWFObject v2.1 <http://code.google.com/p/swfobject/>
+ Copyright (c) 2007-2008 Geoff Stearns, Michael Williams, and Bobby van der Sluis
+ This software is released under the MIT License <http://www.opensource.org/licenses/mit-license.php>
+*/
+var swfobject=function(){var b="undefined",Q="object",n="Shockwave Flash",p="ShockwaveFlash.ShockwaveFlash",P="application/x-shockwave-flash",m="SWFObjectExprInst",j=window,K=document,T=navigator,o=[],N=[],i=[],d=[],J,Z=null,M=null,l=null,e=false,A=false;var h=function(){var v=typeof K.getElementById!=b&&typeof K.getElementsByTagName!=b&&typeof K.createElement!=b,AC=[0,0,0],x=null;if(typeof T.plugins!=b&&typeof T.plugins[n]==Q){x=T.plugins[n].description;if(x&&!(typeof T.mimeTypes!=b&&T.mimeTypes[P]&&!T.mimeTypes[P].enabledPlugin)){x=x.replace(/^.*\s+(\S+\s+\S+$)/,"$1");AC[0]=parseInt(x.replace(/^(.*)\..*$/,"$1"),10);AC[1]=parseInt(x.replace(/^.*\.(.*)\s.*$/,"$1"),10);AC[2]=/r/.test(x)?parseInt(x.replace(/^.*r(.*)$/,"$1"),10):0}}else{if(typeof j.ActiveXObject!=b){var y=null,AB=false;try{y=new ActiveXObject(p+".7")}catch(t){try{y=new ActiveXObject(p+".6");AC=[6,0,21];y.AllowScriptAccess="always"}catch(t){if(AC[0]==6){AB=true}}if(!AB){try{y=new ActiveXObject(p)}catch(t){}}}if(!AB&&y){try{x=y.GetVariable("$version");if(x){x=x.split(" ")[1].split(",");AC=[parseInt(x[0],10),parseInt(x[1],10),parseInt(x[2],10)]}}catch(t){}}}}var AD=T.userAgent.toLowerCase(),r=T.platform.toLowerCase(),AA=/webkit/.test(AD)?parseFloat(AD.replace(/^.*webkit\/(\d+(\.\d+)?).*$/,"$1")):false,q=false,z=r?/win/.test(r):/win/.test(AD),w=r?/mac/.test(r):/mac/.test(AD);/*@cc_on q=true;@if(@_win32)z=true;@elif(@_mac)w=true;@end@*/return{w3cdom:v,pv:AC,webkit:AA,ie:q,win:z,mac:w}}();var L=function(){if(!h.w3cdom){return }f(H);if(h.ie&&h.win){try{K.write("<script id=__ie_ondomload defer=true src=//:><\/script>");J=C("__ie_ondomload");if(J){I(J,"onreadystatechange",S)}}catch(q){}}if(h.webkit&&typeof K.readyState!=b){Z=setInterval(function(){if(/loaded|complete/.test(K.readyState)){E()}},10)}if(typeof K.addEventListener!=b){K.addEventListener("DOMContentLoaded",E,null)}R(E)}();function S(){if(J.readyState=="complete"){J.parentNode.removeChild(J);E()}}function E(){if(e){return }if(h.ie&&h.win){var v=a("span");try{var u=K.getElementsByTagName("body")[0].appendChild(v);u.parentNode.removeChild(u)}catch(w){return }}e=true;if(Z){clearInterval(Z);Z=null}var q=o.length;for(var r=0;r<q;r++){o[r]()}}function f(q){if(e){q()}else{o[o.length]=q}}function R(r){if(typeof j.addEventListener!=b){j.addEventListener("load",r,false)}else{if(typeof K.addEventListener!=b){K.addEventListener("load",r,false)}else{if(typeof j.attachEvent!=b){I(j,"onload",r)}else{if(typeof j.onload=="function"){var q=j.onload;j.onload=function(){q();r()}}else{j.onload=r}}}}}function H(){var t=N.length;for(var q=0;q<t;q++){var u=N[q].id;if(h.pv[0]>0){var r=C(u);if(r){N[q].width=r.getAttribute("width")?r.getAttribute("width"):"0";N[q].height=r.getAttribute("height")?r.getAttribute("height"):"0";if(c(N[q].swfVersion)){if(h.webkit&&h.webkit<312){Y(r)}W(u,true)}else{if(N[q].expressInstall&&!A&&c("6.0.65")&&(h.win||h.mac)){k(N[q])}else{O(r)}}}}else{W(u,true)}}}function Y(t){var q=t.getElementsByTagName(Q)[0];if(q){var w=a("embed"),y=q.attributes;if(y){var v=y.length;for(var u=0;u<v;u++){if(y[u].nodeName=="DATA"){w.setAttribute("src",y[u].nodeValue)}else{w.setAttribute(y[u].nodeName,y[u].nodeValue)}}}var x=q.childNodes;if(x){var z=x.length;for(var r=0;r<z;r++){if(x[r].nodeType==1&&x[r].nodeName=="PARAM"){w.setAttribute(x[r].getAttribute("name"),x[r].getAttribute("value"))}}}t.parentNode.replaceChild(w,t)}}function k(w){A=true;var u=C(w.id);if(u){if(w.altContentId){var y=C(w.altContentId);if(y){M=y;l=w.altContentId}}else{M=G(u)}if(!(/%$/.test(w.width))&&parseInt(w.width,10)<310){w.width="310"}if(!(/%$/.test(w.height))&&parseInt(w.height,10)<137){w.height="137"}K.title=K.title.slice(0,47)+" - Flash Player Installation";var z=h.ie&&h.win?"ActiveX":"PlugIn",q=K.title,r="MMredirectURL="+j.location+"&MMplayerType="+z+"&MMdoctitle="+q,x=w.id;if(h.ie&&h.win&&u.readyState!=4){var t=a("div");x+="SWFObjectNew";t.setAttribute("id",x);u.parentNode.insertBefore(t,u);u.style.display="none";var v=function(){u.parentNode.removeChild(u)};I(j,"onload",v)}U({data:w.expressInstall,id:m,width:w.width,height:w.height},{flashvars:r},x)}}function O(t){if(h.ie&&h.win&&t.readyState!=4){var r=a("div");t.parentNode.insertBefore(r,t);r.parentNode.replaceChild(G(t),r);t.style.display="none";var q=function(){t.parentNode.removeChild(t)};I(j,"onload",q)}else{t.parentNode.replaceChild(G(t),t)}}function G(v){var u=a("div");if(h.win&&h.ie){u.innerHTML=v.innerHTML}else{var r=v.getElementsByTagName(Q)[0];if(r){var w=r.childNodes;if(w){var q=w.length;for(var t=0;t<q;t++){if(!(w[t].nodeType==1&&w[t].nodeName=="PARAM")&&!(w[t].nodeType==8)){u.appendChild(w[t].cloneNode(true))}}}}}return u}function U(AG,AE,t){var q,v=C(t);if(v){if(typeof AG.id==b){AG.id=t}if(h.ie&&h.win){var AF="";for(var AB in AG){if(AG[AB]!=Object.prototype[AB]){if(AB.toLowerCase()=="data"){AE.movie=AG[AB]}else{if(AB.toLowerCase()=="styleclass"){AF+=' class="'+AG[AB]+'"'}else{if(AB.toLowerCase()!="classid"){AF+=" "+AB+'="'+AG[AB]+'"'}}}}}var AD="";for(var AA in AE){if(AE[AA]!=Object.prototype[AA]){AD+='<param name="'+AA+'" value="'+AE[AA]+'" />'}}v.outerHTML='<object classid="clsid:D27CDB6E-AE6D-11cf-96B8-444553540000"'+AF+">"+AD+"</object>";i[i.length]=AG.id;q=C(AG.id)}else{if(h.webkit&&h.webkit<312){var AC=a("embed");AC.setAttribute("type",P);for(var z in AG){if(AG[z]!=Object.prototype[z]){if(z.toLowerCase()=="data"){AC.setAttribute("src",AG[z])}else{if(z.toLowerCase()=="styleclass"){AC.setAttribute("class",AG[z])}else{if(z.toLowerCase()!="classid"){AC.setAttribute(z,AG[z])}}}}}for(var y in AE){if(AE[y]!=Object.prototype[y]){if(y.toLowerCase()!="movie"){AC.setAttribute(y,AE[y])}}}v.parentNode.replaceChild(AC,v);q=AC}else{var u=a(Q);u.setAttribute("type",P);for(var x in AG){if(AG[x]!=Object.prototype[x]){if(x.toLowerCase()=="styleclass"){u.setAttribute("class",AG[x])}else{if(x.toLowerCase()!="classid"){u.setAttribute(x,AG[x])}}}}for(var w in AE){if(AE[w]!=Object.prototype[w]&&w.toLowerCase()!="movie"){F(u,w,AE[w])}}v.parentNode.replaceChild(u,v);q=u}}}return q}function F(t,q,r){var u=a("param");u.setAttribute("name",q);u.setAttribute("value",r);t.appendChild(u)}function X(r){var q=C(r);if(q&&(q.nodeName=="OBJECT"||q.nodeName=="EMBED")){if(h.ie&&h.win){if(q.readyState==4){B(r)}else{j.attachEvent("onload",function(){B(r)})}}else{q.parentNode.removeChild(q)}}}function B(t){var r=C(t);if(r){for(var q in r){if(typeof r[q]=="function"){r[q]=null}}r.parentNode.removeChild(r)}}function C(t){var q=null;try{q=K.getElementById(t)}catch(r){}return q}function a(q){return K.createElement(q)}function I(t,q,r){t.attachEvent(q,r);d[d.length]=[t,q,r]}function c(t){var r=h.pv,q=t.split(".");q[0]=parseInt(q[0],10);q[1]=parseInt(q[1],10)||0;q[2]=parseInt(q[2],10)||0;return(r[0]>q[0]||(r[0]==q[0]&&r[1]>q[1])||(r[0]==q[0]&&r[1]==q[1]&&r[2]>=q[2]))?true:false}function V(v,r){if(h.ie&&h.mac){return }var u=K.getElementsByTagName("head")[0],t=a("style");t.setAttribute("type","text/css");t.setAttribute("media","screen");if(!(h.ie&&h.win)&&typeof K.createTextNode!=b){t.appendChild(K.createTextNode(v+" {"+r+"}"))}u.appendChild(t);if(h.ie&&h.win&&typeof K.styleSheets!=b&&K.styleSheets.length>0){var q=K.styleSheets[K.styleSheets.length-1];if(typeof q.addRule==Q){q.addRule(v,r)}}}function W(t,q){var r=q?"visible":"hidden";if(e&&C(t)){C(t).style.visibility=r}else{V("#"+t,"visibility:"+r)}}function g(s){var r=/[\\\"<>\.;]/;var q=r.exec(s)!=null;return q?encodeURIComponent(s):s}var D=function(){if(h.ie&&h.win){window.attachEvent("onunload",function(){var w=d.length;for(var v=0;v<w;v++){d[v][0].detachEvent(d[v][1],d[v][2])}var t=i.length;for(var u=0;u<t;u++){X(i[u])}for(var r in h){h[r]=null}h=null;for(var q in swfobject){swfobject[q]=null}swfobject=null})}}();return{registerObject:function(u,q,t){if(!h.w3cdom||!u||!q){return }var r={};r.id=u;r.swfVersion=q;r.expressInstall=t?t:false;N[N.length]=r;W(u,false)},getObjectById:function(v){var q=null;if(h.w3cdom){var t=C(v);if(t){var u=t.getElementsByTagName(Q)[0];if(!u||(u&&typeof t.SetVariable!=b)){q=t}else{if(typeof u.SetVariable!=b){q=u}}}}return q},embedSWF:function(x,AE,AB,AD,q,w,r,z,AC){if(!h.w3cdom||!x||!AE||!AB||!AD||!q){return }AB+="";AD+="";if(c(q)){W(AE,false);var AA={};if(AC&&typeof AC===Q){for(var v in AC){if(AC[v]!=Object.prototype[v]){AA[v]=AC[v]}}}AA.data=x;AA.width=AB;AA.height=AD;var y={};if(z&&typeof z===Q){for(var u in z){if(z[u]!=Object.prototype[u]){y[u]=z[u]}}}if(r&&typeof r===Q){for(var t in r){if(r[t]!=Object.prototype[t]){if(typeof y.flashvars!=b){y.flashvars+="&"+t+"="+r[t]}else{y.flashvars=t+"="+r[t]}}}}f(function(){U(AA,y,AE);if(AA.id==AE){W(AE,true)}})}else{if(w&&!A&&c("6.0.65")&&(h.win||h.mac)){A=true;W(AE,false);f(function(){var AF={};AF.id=AF.altContentId=AE;AF.width=AB;AF.height=AD;AF.expressInstall=w;k(AF)})}}},getFlashPlayerVersion:function(){return{major:h.pv[0],minor:h.pv[1],release:h.pv[2]}},hasFlashPlayerVersion:c,createSWF:function(t,r,q){if(h.w3cdom){return U(t,r,q)}else{return undefined}},removeSWF:function(q){if(h.w3cdom){X(q)}},createCSS:function(r,q){if(h.w3cdom){V(r,q)}},addDomLoadEvent:f,addLoadEvent:R,getQueryParamValue:function(v){var u=K.location.search||K.location.hash;if(v==null){return g(u)}if(u){var t=u.substring(1).split("&");for(var r=0;r<t.length;r++){if(t[r].substring(0,t[r].indexOf("="))==v){return g(t[r].substring((t[r].indexOf("=")+1)))}}}return""},expressInstallCallback:function(){if(A&&M){var q=C(m);if(q){q.parentNode.replaceChild(M,q);if(l){W(l,true);if(h.ie&&h.win){M.style.display="block"}}M=null;l=null;A=false}}}}}();
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery-ui-i18n.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,1176 @@
+/* Afrikaans initialisation for the jQuery UI date picker plugin. */
+/* Written by Renier Pretorius. */
+jQuery(function($){
+ $.datepicker.regional['af'] = {
+ closeText: 'Selekteer',
+ prevText: 'Vorige',
+ nextText: 'Volgende',
+ currentText: 'Vandag',
+ monthNames: ['Januarie','Februarie','Maart','April','Mei','Junie',
+ 'Julie','Augustus','September','Oktober','November','Desember'],
+ monthNamesShort: ['Jan', 'Feb', 'Mrt', 'Apr', 'Mei', 'Jun',
+ 'Jul', 'Aug', 'Sep', 'Okt', 'Nov', 'Des'],
+ dayNames: ['Sondag', 'Maandag', 'Dinsdag', 'Woensdag', 'Donderdag', 'Vrydag', 'Saterdag'],
+ dayNamesShort: ['Son', 'Maa', 'Din', 'Woe', 'Don', 'Vry', 'Sat'],
+ dayNamesMin: ['So','Ma','Di','Wo','Do','Vr','Sa'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['af']);
+});
+/* Arabic Translation for jQuery UI date picker plugin. */
+/* Khaled Al Horani -- koko.dw@gmail.com */
+/* خالد الØوراني -- koko.dw@gmail.com */
+/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name Ùبراير - يناير and there isn't any Arabic roots for these months */
+jQuery(function($){
+ $.datepicker.regional['ar'] = {
+ closeText: 'إغلاق',
+ prevText: '<السابق',
+ nextText: 'التالي>',
+ currentText: 'اليوم',
+ monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'Øزيران',
+ 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'],
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
+ dayNames: ['السبت', 'الأØد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'],
+ dayNamesShort: ['سبت', 'Ø£Øد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
+ dayNamesMin: ['سبت', 'Ø£Øد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
+ weekHeader: 'أسبوع',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: true,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ar']);
+});/* Azerbaijani (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Jamil Najafov (necefov33@gmail.com). */
+jQuery(function($) {
+ $.datepicker.regional['az'] = {
+ closeText: 'BaÄŸla',
+ prevText: '<Geri',
+ nextText: 'İrəli>',
+ currentText: 'Bugün',
+ monthNames: ['Yanvar','Fevral','Mart','Aprel','May','Ä°yun',
+ 'Ä°yul','Avqust','Sentyabr','Oktyabr','Noyabr','Dekabr'],
+ monthNamesShort: ['Yan','Fev','Mar','Apr','May','Ä°yun',
+ 'Ä°yul','Avq','Sen','Okt','Noy','Dek'],
+ dayNames: ['Bazar','Bazar ertəsi','Çərşənbə axşamı','Çərşənbə','Cümə axşamı','Cümə','Şənbə'],
+ dayNamesShort: ['B','Be','Ça','Ç','Ca','C','Ş'],
+ dayNamesMin: ['B','B','Ç','С','Ç','C','Ş'],
+ weekHeader: 'Hf',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['az']);
+});/* Bulgarian initialisation for the jQuery UI date picker plugin. */
+/* Written by Stoyan Kyosev (http://svest.org). */
+jQuery(function($){
+ $.datepicker.regional['bg'] = {
+ closeText: 'затвори',
+ prevText: '<назад',
+ nextText: 'напред>',
+ nextBigText: '>>',
+ currentText: 'днеÑ',
+ monthNames: ['Януари','Февруари','Март','Ðприл','Май','Юни',
+ 'Юли','ÐвгуÑÑ‚','Септември','Октомври','Ðоември','Декември'],
+ monthNamesShort: ['Яну','Фев','Мар','Ðпр','Май','Юни',
+ 'Юли','Ðвг','Сеп','Окт','Ðов','Дек'],
+ dayNames: ['ÐеделÑ','Понеделник','Вторник','СрÑда','Четвъртък','Петък','Събота'],
+ dayNamesShort: ['Ðед','Пон','Вто','СрÑ','Чет','Пет','Съб'],
+ dayNamesMin: ['Ðе','По','Ð’Ñ‚','Ср','Че','Пе','Съ'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['bg']);
+});
+/* Bosnian i18n for the jQuery UI date picker plugin. */
+/* Written by Kenan Konjo. */
+jQuery(function($){
+ $.datepicker.regional['bs'] = {
+ closeText: 'Zatvori',
+ prevText: '<',
+ nextText: '>',
+ currentText: 'Danas',
+ monthNames: ['Januar','Februar','Mart','April','Maj','Juni',
+ 'Juli','August','Septembar','Oktobar','Novembar','Decembar'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedelja','Ponedeljak','Utorak','Srijeda','ÄŒetvrtak','Petak','Subota'],
+ dayNamesShort: ['Ned','Pon','Uto','Sri','ÄŒet','Pet','Sub'],
+ dayNamesMin: ['Ne','Po','Ut','Sr','ÄŒe','Pe','Su'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['bs']);
+});/* Inicialització en català per a l'extenció 'calendar' per jQuery. */
+/* Writers: (joan.leon@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ca'] = {
+ closeText: 'Tancar',
+ prevText: '<Ant',
+ nextText: 'Seg>',
+ currentText: 'Avui',
+ monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny',
+ 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'],
+ monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun',
+ 'Jul','Ago','Set','Oct','Nov','Des'],
+ dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'],
+ dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'],
+ dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ca']);
+});/* Czech initialisation for the jQuery UI date picker plugin. */
+/* Written by Tomas Muller (tomas@tomas-muller.net). */
+jQuery(function($){
+ $.datepicker.regional['cs'] = {
+ closeText: 'ZavÅ™Ãt',
+ prevText: '<DÅ™Ãve',
+ nextText: 'Později>',
+ currentText: 'NynÃ',
+ monthNames: ['leden','únor','bÅ™ezen','duben','kvÄ›ten','Äerven',
+ 'Äervenec','srpen','zářÃ','Å™Ãjen','listopad','prosinec'],
+ monthNamesShort: ['led','úno','bÅ™e','dub','kvÄ›','Äer',
+ 'Ävc','srp','zář','Å™Ãj','lis','pro'],
+ dayNames: ['nedÄ›le', 'pondÄ›lÃ', 'úterý', 'stÅ™eda', 'Ätvrtek', 'pátek', 'sobota'],
+ dayNamesShort: ['ne', 'po', 'út', 'st', 'Ät', 'pá', 'so'],
+ dayNamesMin: ['ne','po','út','st','Ät','pá','so'],
+ weekHeader: 'Týd',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['cs']);
+});
+/* Danish initialisation for the jQuery UI date picker plugin. */
+/* Written by Jan Christensen ( deletestuff@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['da'] = {
+ closeText: 'Luk',
+ prevText: '<Forrige',
+ nextText: 'Næste>',
+ currentText: 'Idag',
+ monthNames: ['Januar','Februar','Marts','April','Maj','Juni',
+ 'Juli','August','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
+ weekHeader: 'Uge',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['da']);
+});
+/* German initialisation for the jQuery UI date picker plugin. */
+/* Written by Milian Wolff (mail@milianw.de). */
+jQuery(function($){
+ $.datepicker.regional['de'] = {
+ closeText: 'schließen',
+ prevText: '<zurück',
+ nextText: 'Vor>',
+ currentText: 'heute',
+ monthNames: ['Januar','Februar','März','April','Mai','Juni',
+ 'Juli','August','September','Oktober','November','Dezember'],
+ monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dez'],
+ dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'],
+ dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+ dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+ weekHeader: 'Wo',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['de']);
+});
+/* Greek (el) initialisation for the jQuery UI date picker plugin. */
+/* Written by Alex Cicovic (http://www.alexcicovic.com) */
+jQuery(function($){
+ $.datepicker.regional['el'] = {
+ closeText: 'Κλείσιμο',
+ prevText: 'Î ÏοηγοÏμενος',
+ nextText: 'Επόμενος',
+ currentText: 'ΤÏÎχων Μήνας',
+ monthNames: ['ΙανουάÏιος','ΦεβÏουάÏιος','ΜάÏτιος','ΑπÏίλιος','Μάιος','ΙοÏνιος',
+ 'ΙοÏλιος','ΑÏγουστος','ΣεπτÎμβÏιος','ΟκτώβÏιος','ÎοÎμβÏιος','ΔεκÎμβÏιος'],
+ monthNamesShort: ['Ιαν','Φεβ','ΜαÏ','ΑπÏ','Μαι','Ιουν',
+ 'Ιουλ','Αυγ','Σεπ','Οκτ','Îοε','Δεκ'],
+ dayNames: ['ΚυÏιακή','ΔευτÎÏα','ΤÏίτη','ΤετάÏτη','Î Îμπτη','ΠαÏασκευή','Σάββατο'],
+ dayNamesShort: ['ΚυÏ','Δευ','ΤÏι','Τετ','Πεμ','ΠαÏ','Σαβ'],
+ dayNamesMin: ['Κυ','Δε','ΤÏ','Τε','Πε','Πα','Σα'],
+ weekHeader: 'Εβδ',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['el']);
+});/* English/UK initialisation for the jQuery UI date picker plugin. */
+/* Written by Stuart. */
+jQuery(function($){
+ $.datepicker.regional['en-GB'] = {
+ closeText: 'Done',
+ prevText: 'Prev',
+ nextText: 'Next',
+ currentText: 'Today',
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'],
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun',
+ 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['en-GB']);
+});
+/* Esperanto initialisation for the jQuery UI date picker plugin. */
+/* Written by Olivier M. (olivierweb@ifrance.com). */
+jQuery(function($){
+ $.datepicker.regional['eo'] = {
+ closeText: 'Fermi',
+ prevText: '<Anta',
+ nextText: 'Sekv>',
+ currentText: 'Nuna',
+ monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio',
+ 'Julio','AÅgusto','Septembro','Oktobro','Novembro','Decembro'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','AÅg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ä´aÅdo','Vendredo','Sabato'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Ä´aÅ','Ven','Sab'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Ä´a','Ve','Sa'],
+ weekHeader: 'Sb',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['eo']);
+});
+/* Inicialización en español para la extensión 'UI date picker' para jQuery. */
+/* Traducido por Vester (xvester@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['es'] = {
+ closeText: 'Cerrar',
+ prevText: '<Ant',
+ nextText: 'Sig>',
+ currentText: 'Hoy',
+ monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio',
+ 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'],
+ monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun',
+ 'Jul','Ago','Sep','Oct','Nov','Dic'],
+ dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'],
+ dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'],
+ dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['es']);
+});/* Estonian initialisation for the jQuery UI date picker plugin. */
+/* Written by Mart Sõmermaa (mrts.pydev at gmail com). */
+jQuery(function($){
+ $.datepicker.regional['et'] = {
+ closeText: 'Sulge',
+ prevText: 'Eelnev',
+ nextText: 'Järgnev',
+ currentText: 'Täna',
+ monthNames: ['Jaanuar','Veebruar','Märts','Aprill','Mai','Juuni',
+ 'Juuli','August','September','Oktoober','November','Detsember'],
+ monthNamesShort: ['Jaan', 'Veebr', 'Märts', 'Apr', 'Mai', 'Juuni',
+ 'Juuli', 'Aug', 'Sept', 'Okt', 'Nov', 'Dets'],
+ dayNames: ['Pühapäev', 'Esmaspäev', 'Teisipäev', 'Kolmapäev', 'Neljapäev', 'Reede', 'Laupäev'],
+ dayNamesShort: ['Pühap', 'Esmasp', 'Teisip', 'Kolmap', 'Neljap', 'Reede', 'Laup'],
+ dayNamesMin: ['P','E','T','K','N','R','L'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['et']);
+}); /* Euskarako oinarria 'UI date picker' jquery-ko extentsioarentzat */
+/* Karrikas-ek itzulia (karrikas@karrikas.com) */
+jQuery(function($){
+ $.datepicker.regional['eu'] = {
+ closeText: 'Egina',
+ prevText: '<Aur',
+ nextText: 'Hur>',
+ currentText: 'Gaur',
+ monthNames: ['Urtarrila','Otsaila','Martxoa','Apirila','Maiatza','Ekaina',
+ 'Uztaila','Abuztua','Iraila','Urria','Azaroa','Abendua'],
+ monthNamesShort: ['Urt','Ots','Mar','Api','Mai','Eka',
+ 'Uzt','Abu','Ira','Urr','Aza','Abe'],
+ dayNames: ['Igandea','Astelehena','Asteartea','Asteazkena','Osteguna','Ostirala','Larunbata'],
+ dayNamesShort: ['Iga','Ast','Ast','Ast','Ost','Ost','Lar'],
+ dayNamesMin: ['Ig','As','As','As','Os','Os','La'],
+ weekHeader: 'Wk',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['eu']);
+});/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */
+/* Javad Mowlanezhad -- jmowla@gmail.com */
+/* Jalali calendar should supported soon! (Its implemented but I have to test it) */
+jQuery(function($) {
+ $.datepicker.regional['fa'] = {
+ closeText: 'بستن',
+ prevText: '<قبلي',
+ nextText: 'بعدي>',
+ currentText: 'امروز',
+ monthNames: ['Ùروردين','ارديبهشت','خرداد','تير','مرداد','شهريور',
+ 'مهر','آبان','آذر','دي','بهمن','اسÙند'],
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
+ dayNames: ['يکشنبه','دوشنبه','سه‌شنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'],
+ dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'],
+ dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'],
+ weekHeader: 'Ù‡Ù',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 6,
+ isRTL: true,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fa']);
+});/* Finnish initialisation for the jQuery UI date picker plugin. */
+/* Written by Harri Kilpi� (harrikilpio@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['fi'] = {
+ closeText: 'Sulje',
+ prevText: '«Edellinen',
+ nextText: 'Seuraava»',
+ currentText: 'Tänään',
+ monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu',
+ 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'],
+ monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä',
+ 'Heinä','Elo','Syys','Loka','Marras','Joulu'],
+ dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'],
+ dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'],
+ dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'],
+ weekHeader: 'Vk',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fi']);
+});
+/* Faroese initialisation for the jQuery UI date picker plugin */
+/* Written by Sverri Mohr Olsen, sverrimo@gmail.com */
+jQuery(function($){
+ $.datepicker.regional['fo'] = {
+ closeText: 'Lat aftur',
+ prevText: '<Fyrra',
+ nextText: 'Næsta>',
+ currentText: 'Ã dag',
+ monthNames: ['Januar','Februar','Mars','AprÃl','Mei','Juni',
+ 'Juli','August','September','Oktober','November','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Des'],
+ dayNames: ['Sunnudagur','Mánadagur','Týsdagur','Mikudagur','Hósdagur','FrÃggjadagur','Leyardagur'],
+ dayNamesShort: ['Sun','Mán','Týs','Mik','Hós','FrÃ','Ley'],
+ dayNamesMin: ['Su','Má','Tý','Mi','Hó','Fr','Le'],
+ weekHeader: 'Vk',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fo']);
+});
+/* Swiss-French initialisation for the jQuery UI date picker plugin. */
+/* Written Martin Voelkle (martin.voelkle@e-tc.ch). */
+jQuery(function($){
+ $.datepicker.regional['fr-CH'] = {
+ closeText: 'Fermer',
+ prevText: '<Préc',
+ nextText: 'Suiv>',
+ currentText: 'Courant',
+ monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
+ 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
+ monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
+ 'Jul','Aoû','Sep','Oct','Nov','Déc'],
+ dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fr-CH']);
+});/* French initialisation for the jQuery UI date picker plugin. */
+/* Written by Keith Wood (kbwood{at}iinet.com.au) and Stéphane Nahmani (sholby@sholby.net). */
+jQuery(function($){
+ $.datepicker.regional['fr'] = {
+ closeText: 'Fermer',
+ prevText: '<Préc',
+ nextText: 'Suiv>',
+ currentText: 'Courant',
+ monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
+ 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
+ monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
+ 'Jul','Aoû','Sep','Oct','Nov','Déc'],
+ dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fr']);
+});/* Hebrew initialisation for the UI Datepicker extension. */
+/* Written by Amir Hardon (ahardon at gmail dot com). */
+jQuery(function($){
+ $.datepicker.regional['he'] = {
+ closeText: 'סגור',
+ prevText: '<הקוד×',
+ nextText: 'הב×>',
+ currentText: 'היו×',
+ monthNames: ['×™× ×•×ר','פברו×ר','מרץ','×פריל','מ××™','×™×•× ×™',
+ 'יולי','×וגוסט','ספטמבר','×וקטובר','× ×•×‘×ž×‘×¨','דצמבר'],
+ monthNamesShort: ['1','2','3','4','5','6',
+ '7','8','9','10','11','12'],
+ dayNames: ['ר×שון','×©× ×™','שלישי','רביעי','חמישי','שישי','שבת'],
+ dayNamesShort: ['×\'','ב\'','×’\'','ד\'','×”\'','ו\'','שבת'],
+ dayNamesMin: ['×\'','ב\'','×’\'','ד\'','×”\'','ו\'','שבת'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: true,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['he']);
+});
+/* Croatian i18n for the jQuery UI date picker plugin. */
+/* Written by Vjekoslav Nesek. */
+jQuery(function($){
+ $.datepicker.regional['hr'] = {
+ closeText: 'Zatvori',
+ prevText: '<',
+ nextText: '>',
+ currentText: 'Danas',
+ monthNames: ['SijeÄanj','VeljaÄa','Ožujak','Travanj','Svibanj','Lipanj',
+ 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'],
+ monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip',
+ 'Srp','Kol','Ruj','Lis','Stu','Pro'],
+ dayNames: ['Nedjelja','Ponedjeljak','Utorak','Srijeda','ÄŒetvrtak','Petak','Subota'],
+ dayNamesShort: ['Ned','Pon','Uto','Sri','ÄŒet','Pet','Sub'],
+ dayNamesMin: ['Ne','Po','Ut','Sr','ÄŒe','Pe','Su'],
+ weekHeader: 'Tje',
+ dateFormat: 'dd.mm.yy.',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['hr']);
+});/* Hungarian initialisation for the jQuery UI date picker plugin. */
+/* Written by Istvan Karaszi (jquery@spam.raszi.hu). */
+jQuery(function($){
+ $.datepicker.regional['hu'] = {
+ closeText: 'bezárás',
+ prevText: '« vissza',
+ nextText: 'elÅ‘re »',
+ currentText: 'ma',
+ monthNames: ['Január', 'Február', 'Március', 'Ãprilis', 'Május', 'Június',
+ 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'],
+ monthNamesShort: ['Jan', 'Feb', 'Már', 'Ãpr', 'Máj', 'Jún',
+ 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'],
+ dayNames: ['Vasárnap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'],
+ dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'],
+ dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'],
+ weekHeader: 'Hé',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['hu']);
+});
+/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/
+jQuery(function($){
+ $.datepicker.regional['hy'] = {
+ closeText: 'Õ“Õ¡Õ¯Õ¥Õ¬',
+ prevText: '<Õ†Õ¡Õ.',
+ nextText: 'Õ€Õ¡Õ».>',
+ currentText: 'Ô±ÕµÕ½Ö…Ö€',
+ monthNames: ['Õ€Õ¸Ö‚Õ¶Õ¾Õ¡Ö€','Õ“Õ¥Õ¿Ö€Õ¾Õ¡Ö€','Õ„Õ¡Ö€Õ¿','Ô±ÕºÖ€Õ«Õ¬','Õ„Õ¡ÕµÕ«Õ½','Õ€Õ¸Ö‚Õ¶Õ«Õ½',
+ 'Õ€Õ¸Ö‚Õ¬Õ«Õ½','Õ•Õ£Õ¸Õ½Õ¿Õ¸Õ½','ÕÕ¥ÕºÕ¿Õ¥Õ´Õ¢Õ¥Ö€','Õ€Õ¸Õ¯Õ¿Õ¥Õ´Õ¢Õ¥Ö€','Õ†Õ¸ÕµÕ¥Õ´Õ¢Õ¥Ö€','Ô´Õ¥Õ¯Õ¿Õ¥Õ´Õ¢Õ¥Ö€'],
+ monthNamesShort: ['Õ€Õ¸Ö‚Õ¶Õ¾','Õ“Õ¥Õ¿Ö€','Õ„Õ¡Ö€Õ¿','Ô±ÕºÖ€','Õ„Õ¡ÕµÕ«Õ½','Õ€Õ¸Ö‚Õ¶Õ«Õ½',
+ 'Õ€Õ¸Ö‚Õ¬','Õ•Õ£Õ½','ÕÕ¥Õº','Õ€Õ¸Õ¯','Õ†Õ¸Õµ','Ô´Õ¥Õ¯'],
+ dayNames: ['Õ¯Õ«Ö€Õ¡Õ¯Õ«','Õ¥Õ¯Õ¸Ö‚Õ·Õ¡Õ¢Õ©Õ«','Õ¥Ö€Õ¥Ö„Õ·Õ¡Õ¢Õ©Õ«','Õ¹Õ¸Ö€Õ¥Ö„Õ·Õ¡Õ¢Õ©Õ«','Õ°Õ«Õ¶Õ£Õ·Õ¡Õ¢Õ©Õ«','Õ¸Ö‚Ö€Õ¢Õ¡Õ©','Õ·Õ¡Õ¢Õ¡Õ©'],
+ dayNamesShort: ['Õ¯Õ«Ö€','Õ¥Ö€Õ¯','Õ¥Ö€Ö„','Õ¹Ö€Ö„','Õ°Õ¶Õ£','Õ¸Ö‚Ö€Õ¢','Õ·Õ¢Õ©'],
+ dayNamesMin: ['Õ¯Õ«Ö€','Õ¥Ö€Õ¯','Õ¥Ö€Ö„','Õ¹Ö€Ö„','Õ°Õ¶Õ£','Õ¸Ö‚Ö€Õ¢','Õ·Õ¢Õ©'],
+ weekHeader: 'Õ‡Ô²Õ',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['hy']);
+});/* Indonesian initialisation for the jQuery UI date picker plugin. */
+/* Written by Deden Fathurahman (dedenf@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['id'] = {
+ closeText: 'Tutup',
+ prevText: '<mundur',
+ nextText: 'maju>',
+ currentText: 'hari ini',
+ monthNames: ['Januari','Februari','Maret','April','Mei','Juni',
+ 'Juli','Agustus','September','Oktober','Nopember','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',
+ 'Jul','Agus','Sep','Okt','Nop','Des'],
+ dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'],
+ dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'],
+ dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'],
+ weekHeader: 'Mg',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['id']);
+});/* Icelandic initialisation for the jQuery UI date picker plugin. */
+/* Written by Haukur H. Thorsson (haukur@eskill.is). */
+jQuery(function($){
+ $.datepicker.regional['is'] = {
+ closeText: 'Loka',
+ prevText: '< Fyrri',
+ nextText: 'Næsti >',
+ currentText: 'Í dag',
+ monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní',
+ 'Júlí','Ágúst','September','Október','Nóvember','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún',
+ 'Júl','Ágú','Sep','Okt','Nóv','Des'],
+ dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'],
+ dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'],
+ dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'],
+ weekHeader: 'Vika',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['is']);
+});/* Italian initialisation for the jQuery UI date picker plugin. */
+/* Written by Antonello Pasella (antonello.pasella@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['it'] = {
+ closeText: 'Chiudi',
+ prevText: '<Prec',
+ nextText: 'Succ>',
+ currentText: 'Oggi',
+ monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno',
+ 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'],
+ monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu',
+ 'Lug','Ago','Set','Ott','Nov','Dic'],
+ dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'],
+ dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'],
+ dayNamesMin: ['Do','Lu','Ma','Me','Gi','Ve','Sa'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['it']);
+});
+/* Japanese initialisation for the jQuery UI date picker plugin. */
+/* Written by Kentaro SATO (kentaro@ranvis.com). */
+jQuery(function($){
+ $.datepicker.regional['ja'] = {
+ closeText: 'é–‰ã˜ã‚‹',
+ prevText: '<å‰',
+ nextText: '次>',
+ currentText: '今日',
+ monthNames: ['1月','2月','3月','4月','5月','6月',
+ '7月','8月','9月','10月','11月','12月'],
+ monthNamesShort: ['1月','2月','3月','4月','5月','6月',
+ '7月','8月','9月','10月','11月','12月'],
+ dayNames: ['日曜日','月曜日','ç«æ›œæ—¥','水曜日','木曜日','金曜日','土曜日'],
+ dayNamesShort: ['æ—¥','月','ç«','æ°´','木','金','土'],
+ dayNamesMin: ['æ—¥','月','ç«','æ°´','木','金','土'],
+ weekHeader: '週',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: 'å¹´'};
+ $.datepicker.setDefaults($.datepicker.regional['ja']);
+});/* Korean initialisation for the jQuery calendar extension. */
+/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ko'] = {
+ closeText: '닫기',
+ prevText: 'ì´ì „달',
+ nextText: '다ìŒë‹¬',
+ currentText: '오늘',
+ monthNames: ['1ì›”(JAN)','2ì›”(FEB)','3ì›”(MAR)','4ì›”(APR)','5ì›”(MAY)','6ì›”(JUN)',
+ '7ì›”(JUL)','8ì›”(AUG)','9ì›”(SEP)','10ì›”(OCT)','11ì›”(NOV)','12ì›”(DEC)'],
+ monthNamesShort: ['1ì›”(JAN)','2ì›”(FEB)','3ì›”(MAR)','4ì›”(APR)','5ì›”(MAY)','6ì›”(JUN)',
+ '7ì›”(JUL)','8ì›”(AUG)','9ì›”(SEP)','10ì›”(OCT)','11ì›”(NOV)','12ì›”(DEC)'],
+ dayNames: ['ì¼','ì›”','í™”','수','목','금','í† '],
+ dayNamesShort: ['ì¼','ì›”','í™”','수','목','금','í† '],
+ dayNamesMin: ['ì¼','ì›”','í™”','수','목','금','í† '],
+ weekHeader: 'Wk',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: 'ë…„'};
+ $.datepicker.setDefaults($.datepicker.regional['ko']);
+});/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* @author Arturas Paleicikas <arturas@avalon.lt> */
+jQuery(function($){
+ $.datepicker.regional['lt'] = {
+ closeText: 'Uždaryti',
+ prevText: '<Atgal',
+ nextText: 'Pirmyn>',
+ currentText: 'Å iandien',
+ monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis',
+ 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'],
+ monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir',
+ 'Lie','Rugp','Rugs','Spa','Lap','Gru'],
+ dayNames: ['sekmadienis','pirmadienis','antradienis','treÄiadienis','ketvirtadienis','penktadienis','Å¡eÅ¡tadienis'],
+ dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'],
+ dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Å e'],
+ weekHeader: 'Wk',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['lt']);
+});/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */
+jQuery(function($){
+ $.datepicker.regional['lv'] = {
+ closeText: 'Aizvērt',
+ prevText: 'Iepr',
+ nextText: 'NÄka',
+ currentText: 'Å odien',
+ monthNames: ['JanvÄris','FebruÄris','Marts','AprÄ«lis','Maijs','JÅ«nijs',
+ 'JÅ«lijs','Augusts','Septembris','Oktobris','Novembris','Decembris'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','JÅ«n',
+ 'JÅ«l','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'],
+ dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'],
+ dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'],
+ weekHeader: 'Nav',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['lv']);
+});/* Malaysian initialisation for the jQuery UI date picker plugin. */
+/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */
+jQuery(function($){
+ $.datepicker.regional['ms'] = {
+ closeText: 'Tutup',
+ prevText: '<Sebelum',
+ nextText: 'Selepas>',
+ currentText: 'hari ini',
+ monthNames: ['Januari','Februari','Mac','April','Mei','Jun',
+ 'Julai','Ogos','September','Oktober','November','Disember'],
+ monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun',
+ 'Jul','Ogo','Sep','Okt','Nov','Dis'],
+ dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'],
+ dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'],
+ dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'],
+ weekHeader: 'Mg',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ms']);
+});/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Mathias Bynens <http://mathiasbynens.be/> */
+jQuery(function($){
+ $.datepicker.regional.nl = {
+ closeText: 'Sluiten',
+ prevText: 'â†',
+ nextText: '→',
+ currentText: 'Vandaag',
+ monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni',
+ 'juli', 'augustus', 'september', 'oktober', 'november', 'december'],
+ monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun',
+ 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'],
+ dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'],
+ dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'],
+ dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional.nl);
+});/* Norwegian initialisation for the jQuery UI date picker plugin. */
+/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['no'] = {
+ closeText: 'Lukk',
+ prevText: '«Forrige',
+ nextText: 'Neste»',
+ currentText: 'I dag',
+ monthNames: ['Januar','Februar','Mars','April','Mai','Juni',
+ 'Juli','August','September','Oktober','November','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Des'],
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
+ weekHeader: 'Uke',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['no']);
+});
+/* Polish initialisation for the jQuery UI date picker plugin. */
+/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['pl'] = {
+ closeText: 'Zamknij',
+ prevText: '<Poprzedni',
+ nextText: 'Następny>',
+ currentText: 'DziÅ›',
+ monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec',
+ 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'],
+ monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze',
+ 'Lip','Sie','Wrz','Pa','Lis','Gru'],
+ dayNames: ['Niedziela','Poniedziałek','Wtorek','Środa','Czwartek','Piątek','Sobota'],
+ dayNamesShort: ['Nie','Pn','Wt','Åšr','Czw','Pt','So'],
+ dayNamesMin: ['N','Pn','Wt','Åšr','Cz','Pt','So'],
+ weekHeader: 'Tydz',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['pl']);
+});
+/* Brazilian initialisation for the jQuery UI date picker plugin. */
+/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['pt-BR'] = {
+ closeText: 'Fechar',
+ prevText: '<Anterior',
+ nextText: 'Próximo>',
+ currentText: 'Hoje',
+ monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho',
+ 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'],
+ monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun',
+ 'Jul','Ago','Set','Out','Nov','Dez'],
+ dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sabado'],
+ dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],
+ dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['pt-BR']);
+});/* Romanian initialisation for the jQuery UI date picker plugin.
+ *
+ * Written by Edmond L. (ll_edmond@walla.com)
+ * and Ionut G. Stan (ionut.g.stan@gmail.com)
+ */
+jQuery(function($){
+ $.datepicker.regional['ro'] = {
+ closeText: 'ÃŽnchide',
+ prevText: '« Luna precedentă',
+ nextText: 'Luna următoare »',
+ currentText: 'Azi',
+ monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie',
+ 'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'],
+ monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun',
+ 'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
+ dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'],
+ dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'],
+ dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'],
+ weekHeader: 'Săpt',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ro']);
+});
+/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Andrew Stromnov (stromnov@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ru'] = {
+ closeText: 'Закрыть',
+ prevText: '<Пред',
+ nextText: 'След>',
+ currentText: 'СегоднÑ',
+ monthNames: ['Январь','Февраль','Март','Ðпрель','Май','Июнь',
+ 'Июль','ÐвгуÑÑ‚','СентÑбрь','ОктÑбрь','ÐоÑбрь','Декабрь'],
+ monthNamesShort: ['Янв','Фев','Мар','Ðпр','Май','Июн',
+ 'Июл','Ðвг','Сен','Окт','ÐоÑ','Дек'],
+ dayNames: ['воÑкреÑенье','понедельник','вторник','Ñреда','четверг','пÑтница','Ñуббота'],
+ dayNamesShort: ['вÑк','пнд','втр','Ñрд','чтв','птн','Ñбт'],
+ dayNamesMin: ['Ð’Ñ','Пн','Ð’Ñ‚','Ср','Чт','Пт','Сб'],
+ weekHeader: 'Ðе',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ru']);
+});/* Slovak initialisation for the jQuery UI date picker plugin. */
+/* Written by Vojtech Rinik (vojto@hmm.sk). */
+jQuery(function($){
+ $.datepicker.regional['sk'] = {
+ closeText: 'Zavrieť',
+ prevText: '<Predchádzajúci',
+ nextText: 'Nasledujúci>',
+ currentText: 'Dnes',
+ monthNames: ['Január','Február','Marec','AprÃl','Máj','Jún',
+ 'Júl','August','September','Október','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún',
+ 'Júl','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Å tvrtok','Piatok','Sobota'],
+ dayNamesShort: ['Ned','Pon','Uto','Str','Å tv','Pia','Sob'],
+ dayNamesMin: ['Ne','Po','Ut','St','Å t','Pia','So'],
+ weekHeader: 'Ty',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sk']);
+});
+/* Slovenian initialisation for the jQuery UI date picker plugin. */
+/* Written by Jaka Jancar (jaka@kubje.org). */
+/* c = č, s = š z = ž C = Č S = Š Z = Ž */
+jQuery(function($){
+ $.datepicker.regional['sl'] = {
+ closeText: 'Zapri',
+ prevText: '<Prejšnji',
+ nextText: 'Naslednji>',
+ currentText: 'Trenutni',
+ monthNames: ['Januar','Februar','Marec','April','Maj','Junij',
+ 'Julij','Avgust','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Avg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','Četrtek','Petek','Sobota'],
+ dayNamesShort: ['Ned','Pon','Tor','Sre','Čet','Pet','Sob'],
+ dayNamesMin: ['Ne','Po','To','Sr','Če','Pe','So'],
+ weekHeader: 'Teden',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sl']);
+});
+/* Albanian initialisation for the jQuery UI date picker plugin. */
+/* Written by Flakron Bytyqi (flakron@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['sq'] = {
+ closeText: 'mbylle',
+ prevText: '<mbrapa',
+ nextText: 'Përpara>',
+ currentText: 'sot',
+ monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor',
+ 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'],
+ monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer',
+ 'Kor','Gus','Sht','Tet','Nën','Dhj'],
+ dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'],
+ dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'],
+ dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'],
+ weekHeader: 'Ja',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sq']);
+});
+/* Serbian i18n for the jQuery UI date picker plugin. */
+/* Written by Dejan Dimić. */
+jQuery(function($){
+ $.datepicker.regional['sr-SR'] = {
+ closeText: 'Zatvori',
+ prevText: '<',
+ nextText: '>',
+ currentText: 'Danas',
+ monthNames: ['Januar','Februar','Mart','April','Maj','Jun',
+ 'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Avg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','ÄŒetvrtak','Petak','Subota'],
+ dayNamesShort: ['Ned','Pon','Uto','Sre','ÄŒet','Pet','Sub'],
+ dayNamesMin: ['Ne','Po','Ut','Sr','ÄŒe','Pe','Su'],
+ weekHeader: 'Sed',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sr-SR']);
+});
+/* Serbian i18n for the jQuery UI date picker plugin. */
+/* Written by Dejan Dimić. */
+jQuery(function($){
+ $.datepicker.regional['sr'] = {
+ closeText: 'Затвори',
+ prevText: '<',
+ nextText: '>',
+ currentText: 'ДанаÑ',
+ monthNames: ['Јануар','Фебруар','Март','Ðприл','Мај','Јун',
+ 'Јул','ÐвгуÑÑ‚','Септембар','Октобар','Ðовембар','Децембар'],
+ monthNamesShort: ['Јан','Феб','Мар','Ðпр','Мај','Јун',
+ 'Јул','Ðвг','Сеп','Окт','Ðов','Дец'],
+ dayNames: ['Ðедеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'],
+ dayNamesShort: ['Ðед','Пон','Уто','Сре','Чет','Пет','Суб'],
+ dayNamesMin: ['Ðе','По','Ут','Ср','Че','Пе','Су'],
+ weekHeader: 'Сед',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sr']);
+});
+/* Swedish initialisation for the jQuery UI date picker plugin. */
+/* Written by Anders Ekdahl ( anders@nomadiz.se). */
+jQuery(function($){
+ $.datepicker.regional['sv'] = {
+ closeText: 'Stäng',
+ prevText: '«Förra',
+ nextText: 'Nästa»',
+ currentText: 'Idag',
+ monthNames: ['Januari','Februari','Mars','April','Maj','Juni',
+ 'Juli','Augusti','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'],
+ dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'],
+ dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'],
+ weekHeader: 'Ve',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sv']);
+});
+/* Tamil (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by S A Sureshkumar (saskumar@live.com). */
+jQuery(function($){
+ $.datepicker.regional['ta'] = {
+ closeText: 'மூடà¯',
+ prevText: 'à®®à¯à®©à¯à®©à¯ˆà®¯à®¤à¯',
+ nextText: 'அடà¯à®¤à¯à®¤à®¤à¯',
+ currentText: 'இனà¯à®±à¯',
+ monthNames: ['தை','மாசி','பஙà¯à®•à¯à®©à®¿','சிதà¯à®¤à®¿à®°à¯ˆ','வைகாசி','ஆனி',
+ 'ஆடி','ஆவணி','பà¯à®°à®Ÿà¯à®Ÿà®¾à®šà®¿','à®à®ªà¯à®ªà®šà®¿','காரà¯à®¤à¯à®¤à®¿à®•à¯ˆ','மாரà¯à®•à®´à®¿'],
+ monthNamesShort: ['தை','மாசி','பஙà¯','சிதà¯','வைகா','ஆனி',
+ 'ஆடி','ஆவ','பà¯à®°','à®à®ªà¯','காரà¯','மாரà¯'],
+ dayNames: ['ஞாயிறà¯à®±à¯à®•à¯à®•à®¿à®´à®®à¯ˆ','திஙà¯à®•à®Ÿà¯à®•à®¿à®´à®®à¯ˆ','செவà¯à®µà®¾à®¯à¯à®•à¯à®•à®¿à®´à®®à¯ˆ','பà¯à®¤à®©à¯à®•à®¿à®´à®®à¯ˆ','வியாழகà¯à®•à®¿à®´à®®à¯ˆ','வெளà¯à®³à®¿à®•à¯à®•à®¿à®´à®®à¯ˆ','சனிகà¯à®•à®¿à®´à®®à¯ˆ'],
+ dayNamesShort: ['ஞாயிறà¯','திஙà¯à®•à®³à¯','செவà¯à®µà®¾à®¯à¯','பà¯à®¤à®©à¯','வியாழனà¯','வெளà¯à®³à®¿','சனி'],
+ dayNamesMin: ['ஞா','தி','செ','பà¯','வி','வெ','ச'],
+ weekHeader: 'Ðе',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ta']);
+});
+/* Thai initialisation for the jQuery UI date picker plugin. */
+/* Written by pipo (pipo@sixhead.com). */
+jQuery(function($){
+ $.datepicker.regional['th'] = {
+ closeText: 'ปิด',
+ prevText: '« ย้à¸à¸™',
+ nextText: 'ถัดไป »',
+ currentText: 'วันนี้',
+ monthNames: ['มà¸à¸£à¸²à¸„ม','à¸à¸¸à¸¡à¸ าพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน',
+ 'à¸à¸£à¸à¸à¸²à¸„ม','สิงหาคม','à¸à¸±à¸™à¸¢à¸²à¸¢à¸™','ตุลาคม','พฤศจิà¸à¸²à¸¢à¸™','ธันวาคม'],
+ monthNamesShort: ['ม.ค.','à¸.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.',
+ 'à¸.ค.','ส.ค.','à¸.ย.','ต.ค.','พ.ย.','ธ.ค.'],
+ dayNames: ['à¸à¸²à¸—ิตย์','จันทร์','à¸à¸±à¸‡à¸„าร','พุธ','พฤหัสบดี','ศุà¸à¸£à¹Œ','เสาร์'],
+ dayNamesShort: ['à¸à¸².','จ.','à¸.','พ.','พฤ.','ศ.','ส.'],
+ dayNamesMin: ['à¸à¸².','จ.','à¸.','พ.','พฤ.','ศ.','ส.'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['th']);
+});/* Turkish initialisation for the jQuery UI date picker plugin. */
+/* Written by Izzet Emre Erkan (kara@karalamalar.net). */
+jQuery(function($){
+ $.datepicker.regional['tr'] = {
+ closeText: 'kapat',
+ prevText: '<geri',
+ nextText: 'ileri>',
+ currentText: 'bugün',
+ monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran',
+ 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'],
+ monthNamesShort: ['Oca','Åžub','Mar','Nis','May','Haz',
+ 'Tem','AÄŸu','Eyl','Eki','Kas','Ara'],
+ dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'],
+ dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
+ dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
+ weekHeader: 'Hf',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['tr']);
+});/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['uk'] = {
+ closeText: 'Закрити',
+ prevText: '<',
+ nextText: '>',
+ currentText: 'Сьогодні',
+ monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень',
+ 'Липень','Серпень','ВереÑень','Жовтень','ЛиÑтопад','Грудень'],
+ monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер',
+ 'Лип','Сер','Вер','Жов','ЛиÑ','Гру'],
+ dayNames: ['неділÑ','понеділок','вівторок','Ñереда','четвер','п’ÑтницÑ','Ñубота'],
+ dayNamesShort: ['нед','пнд','вів','Ñрд','чтв','птн','Ñбт'],
+ dayNamesMin: ['Ðд','Пн','Ð’Ñ‚','Ср','Чт','Пт','Сб'],
+ weekHeader: 'Ðе',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['uk']);
+});/* Vietnamese initialisation for the jQuery UI date picker plugin. */
+/* Translated by Le Thanh Huy (lthanhhuy@cit.ctu.edu.vn). */
+jQuery(function($){
+ $.datepicker.regional['vi'] = {
+ closeText: 'Äóng',
+ prevText: '<TrÆ°á»›c',
+ nextText: 'Tiếp>',
+ currentText: 'Hôm nay',
+ monthNames: ['Tháng Một', 'Tháng Hai', 'Tháng Ba', 'Tháng Tư', 'Tháng Năm', 'Tháng Sáu',
+ 'Tháng Bảy', 'Tháng Tám', 'Tháng ChÃn', 'Tháng MÆ°á»i', 'Tháng MÆ°á»i Má»™t', 'Tháng MÆ°á»i Hai'],
+ monthNamesShort: ['Tháng 1', 'Tháng 2', 'Tháng 3', 'Tháng 4', 'Tháng 5', 'Tháng 6',
+ 'Tháng 7', 'Tháng 8', 'Tháng 9', 'Tháng 10', 'Tháng 11', 'Tháng 12'],
+ dayNames: ['Chủ Nháºt', 'Thứ Hai', 'Thứ Ba', 'Thứ TÆ°', 'Thứ Năm', 'Thứ Sáu', 'Thứ Bảy'],
+ dayNamesShort: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'],
+ dayNamesMin: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'],
+ weekHeader: 'Tu',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['vi']);
+});
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by Cloudream (cloudream@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-CN'] = {
+ closeText: 'å…³é—',
+ prevText: '<上月',
+ nextText: '下月>',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','å…月',
+ '七月','八月','ä¹æœˆ','å月','å一月','å二月'],
+ monthNamesShort: ['一','二','三','å››','五','å…',
+ '七','å…«','ä¹','å','å一','å二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期å…'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周å…'],
+ dayNamesMin: ['æ—¥','一','二','三','å››','五','å…'],
+ weekHeader: '周',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: 'å¹´'};
+ $.datepicker.setDefaults($.datepicker.regional['zh-CN']);
+});
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by SCCY (samuelcychan@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-HK'] = {
+ closeText: '關閉',
+ prevText: '<上月',
+ nextText: '下月>',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','å…月',
+ '七月','八月','ä¹æœˆ','å月','å一月','å二月'],
+ monthNamesShort: ['一','二','三','å››','五','å…',
+ '七','å…«','ä¹','å','å一','å二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期å…'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周å…'],
+ dayNamesMin: ['æ—¥','一','二','三','å››','五','å…'],
+ weekHeader: '周',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: 'å¹´'};
+ $.datepicker.setDefaults($.datepicker.regional['zh-HK']);
+});
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by Ressol (ressol@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-TW'] = {
+ closeText: '關閉',
+ prevText: '<上月',
+ nextText: '下月>',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','å…月',
+ '七月','八月','ä¹æœˆ','å月','å一月','å二月'],
+ monthNamesShort: ['一','二','三','å››','五','å…',
+ '七','å…«','ä¹','å','å一','å二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期å…'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周å…'],
+ dayNamesMin: ['æ—¥','一','二','三','å››','五','å…'],
+ weekHeader: '周',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: 'å¹´'};
+ $.datepicker.setDefaults($.datepicker.regional['zh-TW']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-af.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Afrikaans initialisation for the jQuery UI date picker plugin. */
+/* Written by Renier Pretorius. */
+jQuery(function($){
+ $.datepicker.regional['af'] = {
+ closeText: 'Selekteer',
+ prevText: 'Vorige',
+ nextText: 'Volgende',
+ currentText: 'Vandag',
+ monthNames: ['Januarie','Februarie','Maart','April','Mei','Junie',
+ 'Julie','Augustus','September','Oktober','November','Desember'],
+ monthNamesShort: ['Jan', 'Feb', 'Mrt', 'Apr', 'Mei', 'Jun',
+ 'Jul', 'Aug', 'Sep', 'Okt', 'Nov', 'Des'],
+ dayNames: ['Sondag', 'Maandag', 'Dinsdag', 'Woensdag', 'Donderdag', 'Vrydag', 'Saterdag'],
+ dayNamesShort: ['Son', 'Maa', 'Din', 'Woe', 'Don', 'Vry', 'Sat'],
+ dayNamesMin: ['So','Ma','Di','Wo','Do','Vr','Sa'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['af']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-ar.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,24 @@
+/* Arabic Translation for jQuery UI date picker plugin. */
+/* Khaled Al Horani -- koko.dw@gmail.com */
+/* خالد الØوراني -- koko.dw@gmail.com */
+/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name Ùبراير - يناير and there isn't any Arabic roots for these months */
+jQuery(function($){
+ $.datepicker.regional['ar'] = {
+ closeText: 'إغلاق',
+ prevText: '<السابق',
+ nextText: 'التالي>',
+ currentText: 'اليوم',
+ monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'Øزيران',
+ 'تموز', 'آب', 'أيلول', 'تشرين الأول', 'تشرين الثاني', 'كانون الأول'],
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
+ dayNames: ['السبت', 'الأØد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'],
+ dayNamesShort: ['سبت', 'Ø£Øد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
+ dayNamesMin: ['سبت', 'Ø£Øد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
+ weekHeader: 'أسبوع',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: true,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ar']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-az.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Azerbaijani (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Jamil Najafov (necefov33@gmail.com). */
+jQuery(function($) {
+ $.datepicker.regional['az'] = {
+ closeText: 'BaÄŸla',
+ prevText: '<Geri',
+ nextText: 'İrəli>',
+ currentText: 'Bugün',
+ monthNames: ['Yanvar','Fevral','Mart','Aprel','May','Ä°yun',
+ 'Ä°yul','Avqust','Sentyabr','Oktyabr','Noyabr','Dekabr'],
+ monthNamesShort: ['Yan','Fev','Mar','Apr','May','Ä°yun',
+ 'Ä°yul','Avq','Sen','Okt','Noy','Dek'],
+ dayNames: ['Bazar','Bazar ertəsi','Çərşənbə axşamı','Çərşənbə','Cümə axşamı','Cümə','Şənbə'],
+ dayNamesShort: ['B','Be','Ça','Ç','Ca','C','Ş'],
+ dayNamesMin: ['B','B','Ç','С','Ç','C','Ş'],
+ weekHeader: 'Hf',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['az']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-bg.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,24 @@
+/* Bulgarian initialisation for the jQuery UI date picker plugin. */
+/* Written by Stoyan Kyosev (http://svest.org). */
+jQuery(function($){
+ $.datepicker.regional['bg'] = {
+ closeText: 'затвори',
+ prevText: '<назад',
+ nextText: 'напред>',
+ nextBigText: '>>',
+ currentText: 'днеÑ',
+ monthNames: ['Януари','Февруари','Март','Ðприл','Май','Юни',
+ 'Юли','ÐвгуÑÑ‚','Септември','Октомври','Ðоември','Декември'],
+ monthNamesShort: ['Яну','Фев','Мар','Ðпр','Май','Юни',
+ 'Юли','Ðвг','Сеп','Окт','Ðов','Дек'],
+ dayNames: ['ÐеделÑ','Понеделник','Вторник','СрÑда','Четвъртък','Петък','Събота'],
+ dayNamesShort: ['Ðед','Пон','Вто','СрÑ','Чет','Пет','Съб'],
+ dayNamesMin: ['Ðе','По','Ð’Ñ‚','Ср','Че','Пе','Съ'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['bg']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-bs.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Bosnian i18n for the jQuery UI date picker plugin. */
+/* Written by Kenan Konjo. */
+jQuery(function($){
+ $.datepicker.regional['bs'] = {
+ closeText: 'Zatvori',
+ prevText: '<',
+ nextText: '>',
+ currentText: 'Danas',
+ monthNames: ['Januar','Februar','Mart','April','Maj','Juni',
+ 'Juli','August','Septembar','Oktobar','Novembar','Decembar'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedelja','Ponedeljak','Utorak','Srijeda','ÄŒetvrtak','Petak','Subota'],
+ dayNamesShort: ['Ned','Pon','Uto','Sri','ÄŒet','Pet','Sub'],
+ dayNamesMin: ['Ne','Po','Ut','Sr','ÄŒe','Pe','Su'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['bs']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-ca.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Inicialització en català per a l'extenció 'calendar' per jQuery. */
+/* Writers: (joan.leon@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ca'] = {
+ closeText: 'Tancar',
+ prevText: '<Ant',
+ nextText: 'Seg>',
+ currentText: 'Avui',
+ monthNames: ['Gener','Febrer','Març','Abril','Maig','Juny',
+ 'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'],
+ monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun',
+ 'Jul','Ago','Set','Oct','Nov','Des'],
+ dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'],
+ dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'],
+ dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ca']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-cs.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Czech initialisation for the jQuery UI date picker plugin. */
+/* Written by Tomas Muller (tomas@tomas-muller.net). */
+jQuery(function($){
+ $.datepicker.regional['cs'] = {
+ closeText: 'ZavÅ™Ãt',
+ prevText: '<DÅ™Ãve',
+ nextText: 'Později>',
+ currentText: 'NynÃ',
+ monthNames: ['leden','únor','bÅ™ezen','duben','kvÄ›ten','Äerven',
+ 'Äervenec','srpen','zářÃ','Å™Ãjen','listopad','prosinec'],
+ monthNamesShort: ['led','úno','bÅ™e','dub','kvÄ›','Äer',
+ 'Ävc','srp','zář','Å™Ãj','lis','pro'],
+ dayNames: ['nedÄ›le', 'pondÄ›lÃ', 'úterý', 'stÅ™eda', 'Ätvrtek', 'pátek', 'sobota'],
+ dayNamesShort: ['ne', 'po', 'út', 'st', 'Ät', 'pá', 'so'],
+ dayNamesMin: ['ne','po','út','st','Ät','pá','so'],
+ weekHeader: 'Týd',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['cs']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-da.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Danish initialisation for the jQuery UI date picker plugin. */
+/* Written by Jan Christensen ( deletestuff@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['da'] = {
+ closeText: 'Luk',
+ prevText: '<Forrige',
+ nextText: 'Næste>',
+ currentText: 'Idag',
+ monthNames: ['Januar','Februar','Marts','April','Maj','Juni',
+ 'Juli','August','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
+ weekHeader: 'Uge',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['da']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-de.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* German initialisation for the jQuery UI date picker plugin. */
+/* Written by Milian Wolff (mail@milianw.de). */
+jQuery(function($){
+ $.datepicker.regional['de'] = {
+ closeText: 'schließen',
+ prevText: '<zurück',
+ nextText: 'Vor>',
+ currentText: 'heute',
+ monthNames: ['Januar','Februar','März','April','Mai','Juni',
+ 'Juli','August','September','Oktober','November','Dezember'],
+ monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dez'],
+ dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'],
+ dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+ dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+ weekHeader: 'Wo',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['de']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-el.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Greek (el) initialisation for the jQuery UI date picker plugin. */
+/* Written by Alex Cicovic (http://www.alexcicovic.com) */
+jQuery(function($){
+ $.datepicker.regional['el'] = {
+ closeText: 'Κλείσιμο',
+ prevText: 'Î ÏοηγοÏμενος',
+ nextText: 'Επόμενος',
+ currentText: 'ΤÏÎχων Μήνας',
+ monthNames: ['ΙανουάÏιος','ΦεβÏουάÏιος','ΜάÏτιος','ΑπÏίλιος','Μάιος','ΙοÏνιος',
+ 'ΙοÏλιος','ΑÏγουστος','ΣεπτÎμβÏιος','ΟκτώβÏιος','ÎοÎμβÏιος','ΔεκÎμβÏιος'],
+ monthNamesShort: ['Ιαν','Φεβ','ΜαÏ','ΑπÏ','Μαι','Ιουν',
+ 'Ιουλ','Αυγ','Σεπ','Οκτ','Îοε','Δεκ'],
+ dayNames: ['ΚυÏιακή','ΔευτÎÏα','ΤÏίτη','ΤετάÏτη','Î Îμπτη','ΠαÏασκευή','Σάββατο'],
+ dayNamesShort: ['ΚυÏ','Δευ','ΤÏι','Τετ','Πεμ','ΠαÏ','Σαβ'],
+ dayNamesMin: ['Κυ','Δε','ΤÏ','Τε','Πε','Πα','Σα'],
+ weekHeader: 'Εβδ',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['el']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-en-GB.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* English/UK initialisation for the jQuery UI date picker plugin. */
+/* Written by Stuart. */
+jQuery(function($){
+ $.datepicker.regional['en-GB'] = {
+ closeText: 'Done',
+ prevText: 'Prev',
+ nextText: 'Next',
+ currentText: 'Today',
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'],
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun',
+ 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'],
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'],
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['en-GB']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-eo.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Esperanto initialisation for the jQuery UI date picker plugin. */
+/* Written by Olivier M. (olivierweb@ifrance.com). */
+jQuery(function($){
+ $.datepicker.regional['eo'] = {
+ closeText: 'Fermi',
+ prevText: '<Anta',
+ nextText: 'Sekv>',
+ currentText: 'Nuna',
+ monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio',
+ 'Julio','AÅgusto','Septembro','Oktobro','Novembro','Decembro'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','AÅg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ä´aÅdo','Vendredo','Sabato'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Ä´aÅ','Ven','Sab'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Ä´a','Ve','Sa'],
+ weekHeader: 'Sb',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['eo']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-es.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Inicialización en español para la extensión 'UI date picker' para jQuery. */
+/* Traducido por Vester (xvester@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['es'] = {
+ closeText: 'Cerrar',
+ prevText: '<Ant',
+ nextText: 'Sig>',
+ currentText: 'Hoy',
+ monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio',
+ 'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'],
+ monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun',
+ 'Jul','Ago','Sep','Oct','Nov','Dic'],
+ dayNames: ['Domingo','Lunes','Martes','Miércoles','Jueves','Viernes','Sábado'],
+ dayNamesShort: ['Dom','Lun','Mar','Mié','Juv','Vie','Sáb'],
+ dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','Sá'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['es']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-et.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Estonian initialisation for the jQuery UI date picker plugin. */
+/* Written by Mart Sõmermaa (mrts.pydev at gmail com). */
+jQuery(function($){
+ $.datepicker.regional['et'] = {
+ closeText: 'Sulge',
+ prevText: 'Eelnev',
+ nextText: 'Järgnev',
+ currentText: 'Täna',
+ monthNames: ['Jaanuar','Veebruar','Märts','Aprill','Mai','Juuni',
+ 'Juuli','August','September','Oktoober','November','Detsember'],
+ monthNamesShort: ['Jaan', 'Veebr', 'Märts', 'Apr', 'Mai', 'Juuni',
+ 'Juuli', 'Aug', 'Sept', 'Okt', 'Nov', 'Dets'],
+ dayNames: ['Pühapäev', 'Esmaspäev', 'Teisipäev', 'Kolmapäev', 'Neljapäev', 'Reede', 'Laupäev'],
+ dayNamesShort: ['Pühap', 'Esmasp', 'Teisip', 'Kolmap', 'Neljap', 'Reede', 'Laup'],
+ dayNamesMin: ['P','E','T','K','N','R','L'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['et']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-eu.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Euskarako oinarria 'UI date picker' jquery-ko extentsioarentzat */
+/* Karrikas-ek itzulia (karrikas@karrikas.com) */
+jQuery(function($){
+ $.datepicker.regional['eu'] = {
+ closeText: 'Egina',
+ prevText: '<Aur',
+ nextText: 'Hur>',
+ currentText: 'Gaur',
+ monthNames: ['Urtarrila','Otsaila','Martxoa','Apirila','Maiatza','Ekaina',
+ 'Uztaila','Abuztua','Iraila','Urria','Azaroa','Abendua'],
+ monthNamesShort: ['Urt','Ots','Mar','Api','Mai','Eka',
+ 'Uzt','Abu','Ira','Urr','Aza','Abe'],
+ dayNames: ['Igandea','Astelehena','Asteartea','Asteazkena','Osteguna','Ostirala','Larunbata'],
+ dayNamesShort: ['Iga','Ast','Ast','Ast','Ost','Ost','Lar'],
+ dayNamesMin: ['Ig','As','As','As','Os','Os','La'],
+ weekHeader: 'Wk',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['eu']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-fa.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */
+/* Javad Mowlanezhad -- jmowla@gmail.com */
+/* Jalali calendar should supported soon! (Its implemented but I have to test it) */
+jQuery(function($) {
+ $.datepicker.regional['fa'] = {
+ closeText: 'بستن',
+ prevText: '<قبلي',
+ nextText: 'بعدي>',
+ currentText: 'امروز',
+ monthNames: ['Ùروردين','ارديبهشت','خرداد','تير','مرداد','شهريور',
+ 'مهر','آبان','آذر','دي','بهمن','اسÙند'],
+ monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
+ dayNames: ['يکشنبه','دوشنبه','سه‌شنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'],
+ dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'],
+ dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'],
+ weekHeader: 'Ù‡Ù',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 6,
+ isRTL: true,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fa']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-fi.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Finnish initialisation for the jQuery UI date picker plugin. */
+/* Written by Harri Kilpi� (harrikilpio@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['fi'] = {
+ closeText: 'Sulje',
+ prevText: '«Edellinen',
+ nextText: 'Seuraava»',
+ currentText: 'Tänään',
+ monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kesäkuu',
+ 'Heinäkuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'],
+ monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kesä',
+ 'Heinä','Elo','Syys','Loka','Marras','Joulu'],
+ dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'],
+ dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'],
+ dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'],
+ weekHeader: 'Vk',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fi']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-fo.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Faroese initialisation for the jQuery UI date picker plugin */
+/* Written by Sverri Mohr Olsen, sverrimo@gmail.com */
+jQuery(function($){
+ $.datepicker.regional['fo'] = {
+ closeText: 'Lat aftur',
+ prevText: '<Fyrra',
+ nextText: 'Næsta>',
+ currentText: 'Ã dag',
+ monthNames: ['Januar','Februar','Mars','AprÃl','Mei','Juni',
+ 'Juli','August','September','Oktober','November','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Des'],
+ dayNames: ['Sunnudagur','Mánadagur','Týsdagur','Mikudagur','Hósdagur','FrÃggjadagur','Leyardagur'],
+ dayNamesShort: ['Sun','Mán','Týs','Mik','Hós','FrÃ','Ley'],
+ dayNamesMin: ['Su','Má','Tý','Mi','Hó','Fr','Le'],
+ weekHeader: 'Vk',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fo']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-fr-CH.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Swiss-French initialisation for the jQuery UI date picker plugin. */
+/* Written Martin Voelkle (martin.voelkle@e-tc.ch). */
+jQuery(function($){
+ $.datepicker.regional['fr-CH'] = {
+ closeText: 'Fermer',
+ prevText: '<Préc',
+ nextText: 'Suiv>',
+ currentText: 'Courant',
+ monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
+ 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
+ monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
+ 'Jul','Aoû','Sep','Oct','Nov','Déc'],
+ dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fr-CH']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-fr.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* French initialisation for the jQuery UI date picker plugin. */
+/* Written by Keith Wood (kbwood{at}iinet.com.au) and Stéphane Nahmani (sholby@sholby.net). */
+jQuery(function($){
+ $.datepicker.regional['fr'] = {
+ closeText: 'Fermer',
+ prevText: '<Préc',
+ nextText: 'Suiv>',
+ currentText: 'Courant',
+ monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
+ 'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
+ monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
+ 'Jul','Aoû','Sep','Oct','Nov','Déc'],
+ dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
+ dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
+ dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['fr']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-he.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Hebrew initialisation for the UI Datepicker extension. */
+/* Written by Amir Hardon (ahardon at gmail dot com). */
+jQuery(function($){
+ $.datepicker.regional['he'] = {
+ closeText: 'סגור',
+ prevText: '<הקוד×',
+ nextText: 'הב×>',
+ currentText: 'היו×',
+ monthNames: ['×™× ×•×ר','פברו×ר','מרץ','×פריל','מ××™','×™×•× ×™',
+ 'יולי','×וגוסט','ספטמבר','×וקטובר','× ×•×‘×ž×‘×¨','דצמבר'],
+ monthNamesShort: ['1','2','3','4','5','6',
+ '7','8','9','10','11','12'],
+ dayNames: ['ר×שון','×©× ×™','שלישי','רביעי','חמישי','שישי','שבת'],
+ dayNamesShort: ['×\'','ב\'','×’\'','ד\'','×”\'','ו\'','שבת'],
+ dayNamesMin: ['×\'','ב\'','×’\'','ד\'','×”\'','ו\'','שבת'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: true,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['he']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-hr.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Croatian i18n for the jQuery UI date picker plugin. */
+/* Written by Vjekoslav Nesek. */
+jQuery(function($){
+ $.datepicker.regional['hr'] = {
+ closeText: 'Zatvori',
+ prevText: '<',
+ nextText: '>',
+ currentText: 'Danas',
+ monthNames: ['SijeÄanj','VeljaÄa','Ožujak','Travanj','Svibanj','Lipanj',
+ 'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'],
+ monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip',
+ 'Srp','Kol','Ruj','Lis','Stu','Pro'],
+ dayNames: ['Nedjelja','Ponedjeljak','Utorak','Srijeda','ÄŒetvrtak','Petak','Subota'],
+ dayNamesShort: ['Ned','Pon','Uto','Sri','ÄŒet','Pet','Sub'],
+ dayNamesMin: ['Ne','Po','Ut','Sr','ÄŒe','Pe','Su'],
+ weekHeader: 'Tje',
+ dateFormat: 'dd.mm.yy.',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['hr']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-hu.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Hungarian initialisation for the jQuery UI date picker plugin. */
+/* Written by Istvan Karaszi (jquery@spam.raszi.hu). */
+jQuery(function($){
+ $.datepicker.regional['hu'] = {
+ closeText: 'bezárás',
+ prevText: '« vissza',
+ nextText: 'elÅ‘re »',
+ currentText: 'ma',
+ monthNames: ['Január', 'Február', 'Március', 'Ãprilis', 'Május', 'Június',
+ 'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'],
+ monthNamesShort: ['Jan', 'Feb', 'Már', 'Ãpr', 'Máj', 'Jún',
+ 'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'],
+ dayNames: ['Vasárnap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'],
+ dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'],
+ dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'],
+ weekHeader: 'Hé',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['hu']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-hy.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/
+jQuery(function($){
+ $.datepicker.regional['hy'] = {
+ closeText: 'Õ“Õ¡Õ¯Õ¥Õ¬',
+ prevText: '<Õ†Õ¡Õ.',
+ nextText: 'Õ€Õ¡Õ».>',
+ currentText: 'Ô±ÕµÕ½Ö…Ö€',
+ monthNames: ['Õ€Õ¸Ö‚Õ¶Õ¾Õ¡Ö€','Õ“Õ¥Õ¿Ö€Õ¾Õ¡Ö€','Õ„Õ¡Ö€Õ¿','Ô±ÕºÖ€Õ«Õ¬','Õ„Õ¡ÕµÕ«Õ½','Õ€Õ¸Ö‚Õ¶Õ«Õ½',
+ 'Õ€Õ¸Ö‚Õ¬Õ«Õ½','Õ•Õ£Õ¸Õ½Õ¿Õ¸Õ½','ÕÕ¥ÕºÕ¿Õ¥Õ´Õ¢Õ¥Ö€','Õ€Õ¸Õ¯Õ¿Õ¥Õ´Õ¢Õ¥Ö€','Õ†Õ¸ÕµÕ¥Õ´Õ¢Õ¥Ö€','Ô´Õ¥Õ¯Õ¿Õ¥Õ´Õ¢Õ¥Ö€'],
+ monthNamesShort: ['Õ€Õ¸Ö‚Õ¶Õ¾','Õ“Õ¥Õ¿Ö€','Õ„Õ¡Ö€Õ¿','Ô±ÕºÖ€','Õ„Õ¡ÕµÕ«Õ½','Õ€Õ¸Ö‚Õ¶Õ«Õ½',
+ 'Õ€Õ¸Ö‚Õ¬','Õ•Õ£Õ½','ÕÕ¥Õº','Õ€Õ¸Õ¯','Õ†Õ¸Õµ','Ô´Õ¥Õ¯'],
+ dayNames: ['Õ¯Õ«Ö€Õ¡Õ¯Õ«','Õ¥Õ¯Õ¸Ö‚Õ·Õ¡Õ¢Õ©Õ«','Õ¥Ö€Õ¥Ö„Õ·Õ¡Õ¢Õ©Õ«','Õ¹Õ¸Ö€Õ¥Ö„Õ·Õ¡Õ¢Õ©Õ«','Õ°Õ«Õ¶Õ£Õ·Õ¡Õ¢Õ©Õ«','Õ¸Ö‚Ö€Õ¢Õ¡Õ©','Õ·Õ¡Õ¢Õ¡Õ©'],
+ dayNamesShort: ['Õ¯Õ«Ö€','Õ¥Ö€Õ¯','Õ¥Ö€Ö„','Õ¹Ö€Ö„','Õ°Õ¶Õ£','Õ¸Ö‚Ö€Õ¢','Õ·Õ¢Õ©'],
+ dayNamesMin: ['Õ¯Õ«Ö€','Õ¥Ö€Õ¯','Õ¥Ö€Ö„','Õ¹Ö€Ö„','Õ°Õ¶Õ£','Õ¸Ö‚Ö€Õ¢','Õ·Õ¢Õ©'],
+ weekHeader: 'Õ‡Ô²Õ',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['hy']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-id.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Indonesian initialisation for the jQuery UI date picker plugin. */
+/* Written by Deden Fathurahman (dedenf@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['id'] = {
+ closeText: 'Tutup',
+ prevText: '<mundur',
+ nextText: 'maju>',
+ currentText: 'hari ini',
+ monthNames: ['Januari','Februari','Maret','April','Mei','Juni',
+ 'Juli','Agustus','September','Oktober','Nopember','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',
+ 'Jul','Agus','Sep','Okt','Nop','Des'],
+ dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'],
+ dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'],
+ dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'],
+ weekHeader: 'Mg',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['id']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-is.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Icelandic initialisation for the jQuery UI date picker plugin. */
+/* Written by Haukur H. Thorsson (haukur@eskill.is). */
+jQuery(function($){
+ $.datepicker.regional['is'] = {
+ closeText: 'Loka',
+ prevText: '< Fyrri',
+ nextText: 'Næsti >',
+ currentText: 'Í dag',
+ monthNames: ['Janúar','Febrúar','Mars','Apríl','Maí','Júní',
+ 'Júlí','Ágúst','September','Október','Nóvember','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maí','Jún',
+ 'Júl','Ágú','Sep','Okt','Nóv','Des'],
+ dayNames: ['Sunnudagur','Mánudagur','Þriðjudagur','Miðvikudagur','Fimmtudagur','Föstudagur','Laugardagur'],
+ dayNamesShort: ['Sun','Mán','Þri','Mið','Fim','Fös','Lau'],
+ dayNamesMin: ['Su','Má','Þr','Mi','Fi','Fö','La'],
+ weekHeader: 'Vika',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['is']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-it.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Italian initialisation for the jQuery UI date picker plugin. */
+/* Written by Antonello Pasella (antonello.pasella@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['it'] = {
+ closeText: 'Chiudi',
+ prevText: '<Prec',
+ nextText: 'Succ>',
+ currentText: 'Oggi',
+ monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno',
+ 'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'],
+ monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu',
+ 'Lug','Ago','Set','Ott','Nov','Dic'],
+ dayNames: ['Domenica','Lunedì','Martedì','Mercoledì','Giovedì','Venerdì','Sabato'],
+ dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'],
+ dayNamesMin: ['Do','Lu','Ma','Me','Gi','Ve','Sa'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['it']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-ja.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Japanese initialisation for the jQuery UI date picker plugin. */
+/* Written by Kentaro SATO (kentaro@ranvis.com). */
+jQuery(function($){
+ $.datepicker.regional['ja'] = {
+ closeText: 'é–‰ã˜ã‚‹',
+ prevText: '<å‰',
+ nextText: '次>',
+ currentText: '今日',
+ monthNames: ['1月','2月','3月','4月','5月','6月',
+ '7月','8月','9月','10月','11月','12月'],
+ monthNamesShort: ['1月','2月','3月','4月','5月','6月',
+ '7月','8月','9月','10月','11月','12月'],
+ dayNames: ['日曜日','月曜日','ç«æ›œæ—¥','水曜日','木曜日','金曜日','土曜日'],
+ dayNamesShort: ['æ—¥','月','ç«','æ°´','木','金','土'],
+ dayNamesMin: ['æ—¥','月','ç«','æ°´','木','金','土'],
+ weekHeader: '週',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: 'å¹´'};
+ $.datepicker.setDefaults($.datepicker.regional['ja']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-ko.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Korean initialisation for the jQuery calendar extension. */
+/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ko'] = {
+ closeText: '닫기',
+ prevText: 'ì´ì „달',
+ nextText: '다ìŒë‹¬',
+ currentText: '오늘',
+ monthNames: ['1ì›”(JAN)','2ì›”(FEB)','3ì›”(MAR)','4ì›”(APR)','5ì›”(MAY)','6ì›”(JUN)',
+ '7ì›”(JUL)','8ì›”(AUG)','9ì›”(SEP)','10ì›”(OCT)','11ì›”(NOV)','12ì›”(DEC)'],
+ monthNamesShort: ['1ì›”(JAN)','2ì›”(FEB)','3ì›”(MAR)','4ì›”(APR)','5ì›”(MAY)','6ì›”(JUN)',
+ '7ì›”(JUL)','8ì›”(AUG)','9ì›”(SEP)','10ì›”(OCT)','11ì›”(NOV)','12ì›”(DEC)'],
+ dayNames: ['ì¼','ì›”','í™”','수','목','금','í† '],
+ dayNamesShort: ['ì¼','ì›”','í™”','수','목','금','í† '],
+ dayNamesMin: ['ì¼','ì›”','í™”','수','목','금','í† '],
+ weekHeader: 'Wk',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: 'ë…„'};
+ $.datepicker.setDefaults($.datepicker.regional['ko']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-lt.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* @author Arturas Paleicikas <arturas@avalon.lt> */
+jQuery(function($){
+ $.datepicker.regional['lt'] = {
+ closeText: 'Uždaryti',
+ prevText: '<Atgal',
+ nextText: 'Pirmyn>',
+ currentText: 'Å iandien',
+ monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis',
+ 'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'],
+ monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir',
+ 'Lie','Rugp','Rugs','Spa','Lap','Gru'],
+ dayNames: ['sekmadienis','pirmadienis','antradienis','treÄiadienis','ketvirtadienis','penktadienis','Å¡eÅ¡tadienis'],
+ dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'],
+ dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Å e'],
+ weekHeader: 'Wk',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['lt']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-lv.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */
+jQuery(function($){
+ $.datepicker.regional['lv'] = {
+ closeText: 'Aizvērt',
+ prevText: 'Iepr',
+ nextText: 'NÄka',
+ currentText: 'Å odien',
+ monthNames: ['JanvÄris','FebruÄris','Marts','AprÄ«lis','Maijs','JÅ«nijs',
+ 'JÅ«lijs','Augusts','Septembris','Oktobris','Novembris','Decembris'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','JÅ«n',
+ 'JÅ«l','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'],
+ dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'],
+ dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'],
+ weekHeader: 'Nav',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['lv']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-ms.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Malaysian initialisation for the jQuery UI date picker plugin. */
+/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */
+jQuery(function($){
+ $.datepicker.regional['ms'] = {
+ closeText: 'Tutup',
+ prevText: '<Sebelum',
+ nextText: 'Selepas>',
+ currentText: 'hari ini',
+ monthNames: ['Januari','Februari','Mac','April','Mei','Jun',
+ 'Julai','Ogos','September','Oktober','November','Disember'],
+ monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun',
+ 'Jul','Ogo','Sep','Okt','Nov','Dis'],
+ dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'],
+ dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'],
+ dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'],
+ weekHeader: 'Mg',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ms']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-nl.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Mathias Bynens <http://mathiasbynens.be/> */
+jQuery(function($){
+ $.datepicker.regional.nl = {
+ closeText: 'Sluiten',
+ prevText: 'â†',
+ nextText: '→',
+ currentText: 'Vandaag',
+ monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni',
+ 'juli', 'augustus', 'september', 'oktober', 'november', 'december'],
+ monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun',
+ 'jul', 'aug', 'sep', 'okt', 'nov', 'dec'],
+ dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'],
+ dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'],
+ dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional.nl);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-no.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Norwegian initialisation for the jQuery UI date picker plugin. */
+/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['no'] = {
+ closeText: 'Lukk',
+ prevText: '«Forrige',
+ nextText: 'Neste»',
+ currentText: 'I dag',
+ monthNames: ['Januar','Februar','Mars','April','Mai','Juni',
+ 'Juli','August','September','Oktober','November','Desember'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Des'],
+ dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
+ dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
+ dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
+ weekHeader: 'Uke',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['no']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-pl.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Polish initialisation for the jQuery UI date picker plugin. */
+/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['pl'] = {
+ closeText: 'Zamknij',
+ prevText: '<Poprzedni',
+ nextText: 'Następny>',
+ currentText: 'DziÅ›',
+ monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec',
+ 'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'],
+ monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze',
+ 'Lip','Sie','Wrz','Pa','Lis','Gru'],
+ dayNames: ['Niedziela','Poniedziałek','Wtorek','Środa','Czwartek','Piątek','Sobota'],
+ dayNamesShort: ['Nie','Pn','Wt','Åšr','Czw','Pt','So'],
+ dayNamesMin: ['N','Pn','Wt','Åšr','Cz','Pt','So'],
+ weekHeader: 'Tydz',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['pl']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-pt-BR.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Brazilian initialisation for the jQuery UI date picker plugin. */
+/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['pt-BR'] = {
+ closeText: 'Fechar',
+ prevText: '<Anterior',
+ nextText: 'Próximo>',
+ currentText: 'Hoje',
+ monthNames: ['Janeiro','Fevereiro','Março','Abril','Maio','Junho',
+ 'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'],
+ monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun',
+ 'Jul','Ago','Set','Out','Nov','Dez'],
+ dayNames: ['Domingo','Segunda-feira','Terça-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sabado'],
+ dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],
+ dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],
+ weekHeader: 'Sm',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['pt-BR']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-ro.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,26 @@
+/* Romanian initialisation for the jQuery UI date picker plugin.
+ *
+ * Written by Edmond L. (ll_edmond@walla.com)
+ * and Ionut G. Stan (ionut.g.stan@gmail.com)
+ */
+jQuery(function($){
+ $.datepicker.regional['ro'] = {
+ closeText: 'ÃŽnchide',
+ prevText: '« Luna precedentă',
+ nextText: 'Luna următoare »',
+ currentText: 'Azi',
+ monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie',
+ 'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'],
+ monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun',
+ 'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
+ dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'],
+ dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'],
+ dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'],
+ weekHeader: 'Săpt',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ro']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-ru.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Andrew Stromnov (stromnov@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['ru'] = {
+ closeText: 'Закрыть',
+ prevText: '<Пред',
+ nextText: 'След>',
+ currentText: 'СегоднÑ',
+ monthNames: ['Январь','Февраль','Март','Ðпрель','Май','Июнь',
+ 'Июль','ÐвгуÑÑ‚','СентÑбрь','ОктÑбрь','ÐоÑбрь','Декабрь'],
+ monthNamesShort: ['Янв','Фев','Мар','Ðпр','Май','Июн',
+ 'Июл','Ðвг','Сен','Окт','ÐоÑ','Дек'],
+ dayNames: ['воÑкреÑенье','понедельник','вторник','Ñреда','четверг','пÑтница','Ñуббота'],
+ dayNamesShort: ['вÑк','пнд','втр','Ñрд','чтв','птн','Ñбт'],
+ dayNamesMin: ['Ð’Ñ','Пн','Ð’Ñ‚','Ср','Чт','Пт','Сб'],
+ weekHeader: 'Ðе',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ru']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-sk.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Slovak initialisation for the jQuery UI date picker plugin. */
+/* Written by Vojtech Rinik (vojto@hmm.sk). */
+jQuery(function($){
+ $.datepicker.regional['sk'] = {
+ closeText: 'Zavrieť',
+ prevText: '<Predchádzajúci',
+ nextText: 'Nasledujúci>',
+ currentText: 'Dnes',
+ monthNames: ['Január','Február','Marec','AprÃl','Máj','Jún',
+ 'Júl','August','September','Október','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún',
+ 'Júl','Aug','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Å tvrtok','Piatok','Sobota'],
+ dayNamesShort: ['Ned','Pon','Uto','Str','Å tv','Pia','Sob'],
+ dayNamesMin: ['Ne','Po','Ut','St','Å t','Pia','So'],
+ weekHeader: 'Ty',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sk']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-sl.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,24 @@
+/* Slovenian initialisation for the jQuery UI date picker plugin. */
+/* Written by Jaka Jancar (jaka@kubje.org). */
+/* c = č, s = š z = ž C = Č S = Š Z = Ž */
+jQuery(function($){
+ $.datepicker.regional['sl'] = {
+ closeText: 'Zapri',
+ prevText: '<Prejšnji',
+ nextText: 'Naslednji>',
+ currentText: 'Trenutni',
+ monthNames: ['Januar','Februar','Marec','April','Maj','Junij',
+ 'Julij','Avgust','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Avg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','Četrtek','Petek','Sobota'],
+ dayNamesShort: ['Ned','Pon','Tor','Sre','Čet','Pet','Sob'],
+ dayNamesMin: ['Ne','Po','To','Sr','Če','Pe','So'],
+ weekHeader: 'Teden',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sl']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-sq.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Albanian initialisation for the jQuery UI date picker plugin. */
+/* Written by Flakron Bytyqi (flakron@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['sq'] = {
+ closeText: 'mbylle',
+ prevText: '<mbrapa',
+ nextText: 'Përpara>',
+ currentText: 'sot',
+ monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor',
+ 'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'],
+ monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer',
+ 'Kor','Gus','Sht','Tet','Nën','Dhj'],
+ dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'],
+ dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'],
+ dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'],
+ weekHeader: 'Ja',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sq']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-sr-SR.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Serbian i18n for the jQuery UI date picker plugin. */
+/* Written by Dejan Dimić. */
+jQuery(function($){
+ $.datepicker.regional['sr-SR'] = {
+ closeText: 'Zatvori',
+ prevText: '<',
+ nextText: '>',
+ currentText: 'Danas',
+ monthNames: ['Januar','Februar','Mart','April','Maj','Jun',
+ 'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Avg','Sep','Okt','Nov','Dec'],
+ dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','ÄŒetvrtak','Petak','Subota'],
+ dayNamesShort: ['Ned','Pon','Uto','Sre','ÄŒet','Pet','Sub'],
+ dayNamesMin: ['Ne','Po','Ut','Sr','ÄŒe','Pe','Su'],
+ weekHeader: 'Sed',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sr-SR']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-sr.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Serbian i18n for the jQuery UI date picker plugin. */
+/* Written by Dejan Dimić. */
+jQuery(function($){
+ $.datepicker.regional['sr'] = {
+ closeText: 'Затвори',
+ prevText: '<',
+ nextText: '>',
+ currentText: 'ДанаÑ',
+ monthNames: ['Јануар','Фебруар','Март','Ðприл','Мај','Јун',
+ 'Јул','ÐвгуÑÑ‚','Септембар','Октобар','Ðовембар','Децембар'],
+ monthNamesShort: ['Јан','Феб','Мар','Ðпр','Мај','Јун',
+ 'Јул','Ðвг','Сеп','Окт','Ðов','Дец'],
+ dayNames: ['Ðедеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'],
+ dayNamesShort: ['Ðед','Пон','Уто','Сре','Чет','Пет','Суб'],
+ dayNamesMin: ['Ðе','По','Ут','Ср','Че','Пе','Су'],
+ weekHeader: 'Сед',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sr']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-sv.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Swedish initialisation for the jQuery UI date picker plugin. */
+/* Written by Anders Ekdahl ( anders@nomadiz.se). */
+jQuery(function($){
+ $.datepicker.regional['sv'] = {
+ closeText: 'Stäng',
+ prevText: '«Förra',
+ nextText: 'Nästa»',
+ currentText: 'Idag',
+ monthNames: ['Januari','Februari','Mars','April','Maj','Juni',
+ 'Juli','Augusti','September','Oktober','November','December'],
+ monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+ 'Jul','Aug','Sep','Okt','Nov','Dec'],
+ dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'],
+ dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'],
+ dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'],
+ weekHeader: 'Ve',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['sv']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-ta.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Tamil (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by S A Sureshkumar (saskumar@live.com). */
+jQuery(function($){
+ $.datepicker.regional['ta'] = {
+ closeText: 'மூடà¯',
+ prevText: 'à®®à¯à®©à¯à®©à¯ˆà®¯à®¤à¯',
+ nextText: 'அடà¯à®¤à¯à®¤à®¤à¯',
+ currentText: 'இனà¯à®±à¯',
+ monthNames: ['தை','மாசி','பஙà¯à®•à¯à®©à®¿','சிதà¯à®¤à®¿à®°à¯ˆ','வைகாசி','ஆனி',
+ 'ஆடி','ஆவணி','பà¯à®°à®Ÿà¯à®Ÿà®¾à®šà®¿','à®à®ªà¯à®ªà®šà®¿','காரà¯à®¤à¯à®¤à®¿à®•à¯ˆ','மாரà¯à®•à®´à®¿'],
+ monthNamesShort: ['தை','மாசி','பஙà¯','சிதà¯','வைகா','ஆனி',
+ 'ஆடி','ஆவ','பà¯à®°','à®à®ªà¯','காரà¯','மாரà¯'],
+ dayNames: ['ஞாயிறà¯à®±à¯à®•à¯à®•à®¿à®´à®®à¯ˆ','திஙà¯à®•à®Ÿà¯à®•à®¿à®´à®®à¯ˆ','செவà¯à®µà®¾à®¯à¯à®•à¯à®•à®¿à®´à®®à¯ˆ','பà¯à®¤à®©à¯à®•à®¿à®´à®®à¯ˆ','வியாழகà¯à®•à®¿à®´à®®à¯ˆ','வெளà¯à®³à®¿à®•à¯à®•à®¿à®´à®®à¯ˆ','சனிகà¯à®•à®¿à®´à®®à¯ˆ'],
+ dayNamesShort: ['ஞாயிறà¯','திஙà¯à®•à®³à¯','செவà¯à®µà®¾à®¯à¯','பà¯à®¤à®©à¯','வியாழனà¯','வெளà¯à®³à®¿','சனி'],
+ dayNamesMin: ['ஞா','தி','செ','பà¯','வி','வெ','ச'],
+ weekHeader: 'Ðе',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['ta']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-th.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Thai initialisation for the jQuery UI date picker plugin. */
+/* Written by pipo (pipo@sixhead.com). */
+jQuery(function($){
+ $.datepicker.regional['th'] = {
+ closeText: 'ปิด',
+ prevText: '« ย้à¸à¸™',
+ nextText: 'ถัดไป »',
+ currentText: 'วันนี้',
+ monthNames: ['มà¸à¸£à¸²à¸„ม','à¸à¸¸à¸¡à¸ าพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน',
+ 'à¸à¸£à¸à¸à¸²à¸„ม','สิงหาคม','à¸à¸±à¸™à¸¢à¸²à¸¢à¸™','ตุลาคม','พฤศจิà¸à¸²à¸¢à¸™','ธันวาคม'],
+ monthNamesShort: ['ม.ค.','à¸.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.',
+ 'à¸.ค.','ส.ค.','à¸.ย.','ต.ค.','พ.ย.','ธ.ค.'],
+ dayNames: ['à¸à¸²à¸—ิตย์','จันทร์','à¸à¸±à¸‡à¸„าร','พุธ','พฤหัสบดี','ศุà¸à¸£à¹Œ','เสาร์'],
+ dayNamesShort: ['à¸à¸².','จ.','à¸.','พ.','พฤ.','ศ.','ส.'],
+ dayNamesMin: ['à¸à¸².','จ.','à¸.','พ.','พฤ.','ศ.','ส.'],
+ weekHeader: 'Wk',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['th']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-tr.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Turkish initialisation for the jQuery UI date picker plugin. */
+/* Written by Izzet Emre Erkan (kara@karalamalar.net). */
+jQuery(function($){
+ $.datepicker.regional['tr'] = {
+ closeText: 'kapat',
+ prevText: '<geri',
+ nextText: 'ileri>',
+ currentText: 'bugün',
+ monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran',
+ 'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'],
+ monthNamesShort: ['Oca','Åžub','Mar','Nis','May','Haz',
+ 'Tem','AÄŸu','Eyl','Eki','Kas','Ara'],
+ dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'],
+ dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
+ dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
+ weekHeader: 'Hf',
+ dateFormat: 'dd.mm.yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['tr']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-uk.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['uk'] = {
+ closeText: 'Закрити',
+ prevText: '<',
+ nextText: '>',
+ currentText: 'Сьогодні',
+ monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень',
+ 'Липень','Серпень','ВереÑень','Жовтень','ЛиÑтопад','Грудень'],
+ monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер',
+ 'Лип','Сер','Вер','Жов','ЛиÑ','Гру'],
+ dayNames: ['неділÑ','понеділок','вівторок','Ñереда','четвер','п’ÑтницÑ','Ñубота'],
+ dayNamesShort: ['нед','пнд','вів','Ñрд','чтв','птн','Ñбт'],
+ dayNamesMin: ['Ðд','Пн','Ð’Ñ‚','Ср','Чт','Пт','Сб'],
+ weekHeader: 'Ðе',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['uk']);
+});
\ No newline at end of file
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-vi.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Vietnamese initialisation for the jQuery UI date picker plugin. */
+/* Translated by Le Thanh Huy (lthanhhuy@cit.ctu.edu.vn). */
+jQuery(function($){
+ $.datepicker.regional['vi'] = {
+ closeText: 'Äóng',
+ prevText: '<TrÆ°á»›c',
+ nextText: 'Tiếp>',
+ currentText: 'Hôm nay',
+ monthNames: ['Tháng Một', 'Tháng Hai', 'Tháng Ba', 'Tháng Tư', 'Tháng Năm', 'Tháng Sáu',
+ 'Tháng Bảy', 'Tháng Tám', 'Tháng ChÃn', 'Tháng MÆ°á»i', 'Tháng MÆ°á»i Má»™t', 'Tháng MÆ°á»i Hai'],
+ monthNamesShort: ['Tháng 1', 'Tháng 2', 'Tháng 3', 'Tháng 4', 'Tháng 5', 'Tháng 6',
+ 'Tháng 7', 'Tháng 8', 'Tháng 9', 'Tháng 10', 'Tháng 11', 'Tháng 12'],
+ dayNames: ['Chủ Nháºt', 'Thứ Hai', 'Thứ Ba', 'Thứ TÆ°', 'Thứ Năm', 'Thứ Sáu', 'Thứ Bảy'],
+ dayNamesShort: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'],
+ dayNamesMin: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'],
+ weekHeader: 'Tu',
+ dateFormat: 'dd/mm/yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: false,
+ yearSuffix: ''};
+ $.datepicker.setDefaults($.datepicker.regional['vi']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-zh-CN.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by Cloudream (cloudream@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-CN'] = {
+ closeText: 'å…³é—',
+ prevText: '<上月',
+ nextText: '下月>',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','å…月',
+ '七月','八月','ä¹æœˆ','å月','å一月','å二月'],
+ monthNamesShort: ['一','二','三','å››','五','å…',
+ '七','å…«','ä¹','å','å一','å二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期å…'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周å…'],
+ dayNamesMin: ['æ—¥','一','二','三','å››','五','å…'],
+ weekHeader: '周',
+ dateFormat: 'yy-mm-dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: 'å¹´'};
+ $.datepicker.setDefaults($.datepicker.regional['zh-CN']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-zh-HK.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by SCCY (samuelcychan@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-HK'] = {
+ closeText: '關閉',
+ prevText: '<上月',
+ nextText: '下月>',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','å…月',
+ '七月','八月','ä¹æœˆ','å月','å一月','å二月'],
+ monthNamesShort: ['一','二','三','å››','五','å…',
+ '七','å…«','ä¹','å','å一','å二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期å…'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周å…'],
+ dayNamesMin: ['æ—¥','一','二','三','å››','五','å…'],
+ weekHeader: '周',
+ dateFormat: 'dd-mm-yy',
+ firstDay: 0,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: 'å¹´'};
+ $.datepicker.setDefaults($.datepicker.regional['zh-HK']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/i18n/jquery.ui.datepicker-zh-TW.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,23 @@
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by Ressol (ressol@gmail.com). */
+jQuery(function($){
+ $.datepicker.regional['zh-TW'] = {
+ closeText: '關閉',
+ prevText: '<上月',
+ nextText: '下月>',
+ currentText: '今天',
+ monthNames: ['一月','二月','三月','四月','五月','å…月',
+ '七月','八月','ä¹æœˆ','å月','å一月','å二月'],
+ monthNamesShort: ['一','二','三','å››','五','å…',
+ '七','å…«','ä¹','å','å一','å二'],
+ dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期å…'],
+ dayNamesShort: ['周日','周一','周二','周三','周四','周五','周å…'],
+ dayNamesMin: ['æ—¥','一','二','三','å››','五','å…'],
+ weekHeader: '周',
+ dateFormat: 'yy/mm/dd',
+ firstDay: 1,
+ isRTL: false,
+ showMonthAfterYear: true,
+ yearSuffix: 'å¹´'};
+ $.datepicker.setDefaults($.datepicker.regional['zh-TW']);
+});
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery-ui-1.8.1.custom.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,10971 @@
+/*!
+ * jQuery UI 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI
+ */
+;jQuery.ui || (function($) {
+
+//Helper functions and ui object
+$.ui = {
+ version: "1.8.1",
+
+ // $.ui.plugin is deprecated. Use the proxy pattern instead.
+ plugin: {
+ add: function(module, option, set) {
+ var proto = $.ui[module].prototype;
+ for(var i in set) {
+ proto.plugins[i] = proto.plugins[i] || [];
+ proto.plugins[i].push([option, set[i]]);
+ }
+ },
+ call: function(instance, name, args) {
+ var set = instance.plugins[name];
+ if(!set || !instance.element[0].parentNode) { return; }
+
+ for (var i = 0; i < set.length; i++) {
+ if (instance.options[set[i][0]]) {
+ set[i][1].apply(instance.element, args);
+ }
+ }
+ }
+ },
+
+ contains: function(a, b) {
+ return document.compareDocumentPosition
+ ? a.compareDocumentPosition(b) & 16
+ : a !== b && a.contains(b);
+ },
+
+ hasScroll: function(el, a) {
+
+ //If overflow is hidden, the element might have extra content, but the user wants to hide it
+ if ($(el).css('overflow') == 'hidden') { return false; }
+
+ var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop',
+ has = false;
+
+ if (el[scroll] > 0) { return true; }
+
+ // TODO: determine which cases actually cause this to happen
+ // if the element doesn't have the scroll set, see if it's possible to
+ // set the scroll
+ el[scroll] = 1;
+ has = (el[scroll] > 0);
+ el[scroll] = 0;
+ return has;
+ },
+
+ isOverAxis: function(x, reference, size) {
+ //Determines when x coordinate is over "b" element axis
+ return (x > reference) && (x < (reference + size));
+ },
+
+ isOver: function(y, x, top, left, height, width) {
+ //Determines when x, y coordinates is over "b" element
+ return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width);
+ },
+
+ keyCode: {
+ ALT: 18,
+ BACKSPACE: 8,
+ CAPS_LOCK: 20,
+ COMMA: 188,
+ CONTROL: 17,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ INSERT: 45,
+ LEFT: 37,
+ NUMPAD_ADD: 107,
+ NUMPAD_DECIMAL: 110,
+ NUMPAD_DIVIDE: 111,
+ NUMPAD_ENTER: 108,
+ NUMPAD_MULTIPLY: 106,
+ NUMPAD_SUBTRACT: 109,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SHIFT: 16,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38
+ }
+};
+
+//jQuery plugins
+$.fn.extend({
+ _focus: $.fn.focus,
+ focus: function(delay, fn) {
+ return typeof delay === 'number'
+ ? this.each(function() {
+ var elem = this;
+ setTimeout(function() {
+ $(elem).focus();
+ (fn && fn.call(elem));
+ }, delay);
+ })
+ : this._focus.apply(this, arguments);
+ },
+
+ enableSelection: function() {
+ return this
+ .attr('unselectable', 'off')
+ .css('MozUserSelect', '');
+ },
+
+ disableSelection: function() {
+ return this
+ .attr('unselectable', 'on')
+ .css('MozUserSelect', 'none');
+ },
+
+ scrollParent: function() {
+ var scrollParent;
+ if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+ scrollParent = this.parents().filter(function() {
+ return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ } else {
+ scrollParent = this.parents().filter(function() {
+ return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ }
+
+ return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+ },
+
+ zIndex: function(zIndex) {
+ if (zIndex !== undefined) {
+ return this.css('zIndex', zIndex);
+ }
+
+ if (this.length) {
+ var elem = $(this[0]), position, value;
+ while (elem.length && elem[0] !== document) {
+ // Ignore z-index if position is set to a value where z-index is ignored by the browser
+ // This makes behavior of this function consistent across browsers
+ // WebKit always returns auto if the element is positioned
+ position = elem.css('position');
+ if (position == 'absolute' || position == 'relative' || position == 'fixed')
+ {
+ // IE returns 0 when zIndex is not specified
+ // other browsers return a string
+ // we ignore the case of nested elements with an explicit value of 0
+ // <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+ value = parseInt(elem.css('zIndex'));
+ if (!isNaN(value) && value != 0) {
+ return value;
+ }
+ }
+ elem = elem.parent();
+ }
+ }
+
+ return 0;
+ }
+});
+
+
+//Additional selectors
+$.extend($.expr[':'], {
+ data: function(elem, i, match) {
+ return !!$.data(elem, match[3]);
+ },
+
+ focusable: function(element) {
+ var nodeName = element.nodeName.toLowerCase(),
+ tabIndex = $.attr(element, 'tabindex');
+ return (/input|select|textarea|button|object/.test(nodeName)
+ ? !element.disabled
+ : 'a' == nodeName || 'area' == nodeName
+ ? element.href || !isNaN(tabIndex)
+ : !isNaN(tabIndex))
+ // the element and all of its ancestors must be visible
+ // the browser may report that the area is hidden
+ && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length;
+ },
+
+ tabbable: function(element) {
+ var tabIndex = $.attr(element, 'tabindex');
+ return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable');
+ }
+});
+
+})(jQuery);
+/*!
+ * jQuery UI Widget 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function( $ ) {
+
+var _remove = $.fn.remove;
+
+$.fn.remove = function( selector, keepData ) {
+ return this.each(function() {
+ if ( !keepData ) {
+ if ( !selector || $.filter( selector, [ this ] ).length ) {
+ $( "*", this ).add( this ).each(function() {
+ $( this ).triggerHandler( "remove" );
+ });
+ }
+ }
+ return _remove.call( $(this), selector, keepData );
+ });
+};
+
+$.widget = function( name, base, prototype ) {
+ var namespace = name.split( "." )[ 0 ],
+ fullName;
+ name = name.split( "." )[ 1 ];
+ fullName = namespace + "-" + name;
+
+ if ( !prototype ) {
+ prototype = base;
+ base = $.Widget;
+ }
+
+ // create selector for plugin
+ $.expr[ ":" ][ fullName ] = function( elem ) {
+ return !!$.data( elem, name );
+ };
+
+ $[ namespace ] = $[ namespace ] || {};
+ $[ namespace ][ name ] = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+ };
+
+ var basePrototype = new base();
+ // we need to make the options hash a property directly on the new instance
+ // otherwise we'll modify the options hash on the prototype that we're
+ // inheriting from
+// $.each( basePrototype, function( key, val ) {
+// if ( $.isPlainObject(val) ) {
+// basePrototype[ key ] = $.extend( {}, val );
+// }
+// });
+ basePrototype.options = $.extend( {}, basePrototype.options );
+ $[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
+ namespace: namespace,
+ widgetName: name,
+ widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
+ widgetBaseClass: fullName
+ }, prototype );
+
+ $.widget.bridge( name, $[ namespace ][ name ] );
+};
+
+$.widget.bridge = function( name, object ) {
+ $.fn[ name ] = function( options ) {
+ var isMethodCall = typeof options === "string",
+ args = Array.prototype.slice.call( arguments, 1 ),
+ returnValue = this;
+
+ // allow multiple hashes to be passed on init
+ options = !isMethodCall && args.length ?
+ $.extend.apply( null, [ true, options ].concat(args) ) :
+ options;
+
+ // prevent calls to internal methods
+ if ( isMethodCall && options.substring( 0, 1 ) === "_" ) {
+ return returnValue;
+ }
+
+ if ( isMethodCall ) {
+ this.each(function() {
+ var instance = $.data( this, name ),
+ methodValue = instance && $.isFunction( instance[options] ) ?
+ instance[ options ].apply( instance, args ) :
+ instance;
+ if ( methodValue !== instance && methodValue !== undefined ) {
+ returnValue = methodValue;
+ return false;
+ }
+ });
+ } else {
+ this.each(function() {
+ var instance = $.data( this, name );
+ if ( instance ) {
+ if ( options ) {
+ instance.option( options );
+ }
+ instance._init();
+ } else {
+ $.data( this, name, new object( options, this ) );
+ }
+ });
+ }
+
+ return returnValue;
+ };
+};
+
+$.Widget = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+};
+
+$.Widget.prototype = {
+ widgetName: "widget",
+ widgetEventPrefix: "",
+ options: {
+ disabled: false
+ },
+ _createWidget: function( options, element ) {
+ // $.widget.bridge stores the plugin instance, but we do it anyway
+ // so that it's stored even before the _create function runs
+ this.element = $( element ).data( this.widgetName, this );
+ this.options = $.extend( true, {},
+ this.options,
+ $.metadata && $.metadata.get( element )[ this.widgetName ],
+ options );
+
+ var self = this;
+ this.element.bind( "remove." + this.widgetName, function() {
+ self.destroy();
+ });
+
+ this._create();
+ this._init();
+ },
+ _create: function() {},
+ _init: function() {},
+
+ destroy: function() {
+ this.element
+ .unbind( "." + this.widgetName )
+ .removeData( this.widgetName );
+ this.widget()
+ .unbind( "." + this.widgetName )
+ .removeAttr( "aria-disabled" )
+ .removeClass(
+ this.widgetBaseClass + "-disabled " +
+ "ui-state-disabled" );
+ },
+
+ widget: function() {
+ return this.element;
+ },
+
+ option: function( key, value ) {
+ var options = key,
+ self = this;
+
+ if ( arguments.length === 0 ) {
+ // don't return a reference to the internal hash
+ return $.extend( {}, self.options );
+ }
+
+ if (typeof key === "string" ) {
+ if ( value === undefined ) {
+ return this.options[ key ];
+ }
+ options = {};
+ options[ key ] = value;
+ }
+
+ $.each( options, function( key, value ) {
+ self._setOption( key, value );
+ });
+
+ return self;
+ },
+ _setOption: function( key, value ) {
+ this.options[ key ] = value;
+
+ if ( key === "disabled" ) {
+ this.widget()
+ [ value ? "addClass" : "removeClass"](
+ this.widgetBaseClass + "-disabled" + " " +
+ "ui-state-disabled" )
+ .attr( "aria-disabled", value );
+ }
+
+ return this;
+ },
+
+ enable: function() {
+ return this._setOption( "disabled", false );
+ },
+ disable: function() {
+ return this._setOption( "disabled", true );
+ },
+
+ _trigger: function( type, event, data ) {
+ var callback = this.options[ type ];
+
+ event = $.Event( event );
+ event.type = ( type === this.widgetEventPrefix ?
+ type :
+ this.widgetEventPrefix + type ).toLowerCase();
+ data = data || {};
+
+ // copy original event properties over to the new event
+ // this would happen if we could call $.event.fix instead of $.Event
+ // but we don't have a way to force an event to be fixed multiple times
+ if ( event.originalEvent ) {
+ for ( var i = $.event.props.length, prop; i; ) {
+ prop = $.event.props[ --i ];
+ event[ prop ] = event.originalEvent[ prop ];
+ }
+ }
+
+ this.element.trigger( event, data );
+
+ return !( $.isFunction(callback) &&
+ callback.call( this.element[0], event, data ) === false ||
+ event.isDefaultPrevented() );
+ }
+};
+
+})( jQuery );
+/*!
+ * jQuery UI Mouse 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.mouse", {
+ options: {
+ cancel: ':input,option',
+ distance: 1,
+ delay: 0
+ },
+ _mouseInit: function() {
+ var self = this;
+
+ this.element
+ .bind('mousedown.'+this.widgetName, function(event) {
+ return self._mouseDown(event);
+ })
+ .bind('click.'+this.widgetName, function(event) {
+ if(self._preventClickEvent) {
+ self._preventClickEvent = false;
+ event.stopImmediatePropagation();
+ return false;
+ }
+ });
+
+ this.started = false;
+ },
+
+ // TODO: make sure destroying one instance of mouse doesn't mess with
+ // other instances of mouse
+ _mouseDestroy: function() {
+ this.element.unbind('.'+this.widgetName);
+ },
+
+ _mouseDown: function(event) {
+ // don't let more than one widget handle mouseStart
+ // TODO: figure out why we have to use originalEvent
+ event.originalEvent = event.originalEvent || {};
+ if (event.originalEvent.mouseHandled) { return; }
+
+ // we may have missed mouseup (out of window)
+ (this._mouseStarted && this._mouseUp(event));
+
+ this._mouseDownEvent = event;
+
+ var self = this,
+ btnIsLeft = (event.which == 1),
+ elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
+ if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+ return true;
+ }
+
+ this.mouseDelayMet = !this.options.delay;
+ if (!this.mouseDelayMet) {
+ this._mouseDelayTimer = setTimeout(function() {
+ self.mouseDelayMet = true;
+ }, this.options.delay);
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted = (this._mouseStart(event) !== false);
+ if (!this._mouseStarted) {
+ event.preventDefault();
+ return true;
+ }
+ }
+
+ // these delegates are required to keep context
+ this._mouseMoveDelegate = function(event) {
+ return self._mouseMove(event);
+ };
+ this._mouseUpDelegate = function(event) {
+ return self._mouseUp(event);
+ };
+ $(document)
+ .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ // preventDefault() is used to prevent the selection of text here -
+ // however, in Safari, this causes select boxes not to be selectable
+ // anymore, so this fix is needed
+ ($.browser.safari || event.preventDefault());
+
+ event.originalEvent.mouseHandled = true;
+ return true;
+ },
+
+ _mouseMove: function(event) {
+ // IE mouseup check - mouseup happened when mouse was out of window
+ if ($.browser.msie && !event.button) {
+ return this._mouseUp(event);
+ }
+
+ if (this._mouseStarted) {
+ this._mouseDrag(event);
+ return event.preventDefault();
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted =
+ (this._mouseStart(this._mouseDownEvent, event) !== false);
+ (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+ }
+
+ return !this._mouseStarted;
+ },
+
+ _mouseUp: function(event) {
+ $(document)
+ .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ if (this._mouseStarted) {
+ this._mouseStarted = false;
+ this._preventClickEvent = (event.target == this._mouseDownEvent.target);
+ this._mouseStop(event);
+ }
+
+ return false;
+ },
+
+ _mouseDistanceMet: function(event) {
+ return (Math.max(
+ Math.abs(this._mouseDownEvent.pageX - event.pageX),
+ Math.abs(this._mouseDownEvent.pageY - event.pageY)
+ ) >= this.options.distance
+ );
+ },
+
+ _mouseDelayMet: function(event) {
+ return this.mouseDelayMet;
+ },
+
+ // These are placeholder methods, to be overriden by extending plugin
+ _mouseStart: function(event) {},
+ _mouseDrag: function(event) {},
+ _mouseStop: function(event) {},
+ _mouseCapture: function(event) { return true; }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Position 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function( $ ) {
+
+$.ui = $.ui || {};
+
+var horizontalPositions = /left|center|right/,
+ horizontalDefault = "center",
+ verticalPositions = /top|center|bottom/,
+ verticalDefault = "center",
+ _position = $.fn.position,
+ _offset = $.fn.offset;
+
+$.fn.position = function( options ) {
+ if ( !options || !options.of ) {
+ return _position.apply( this, arguments );
+ }
+
+ // make a copy, we don't want to modify arguments
+ options = $.extend( {}, options );
+
+ var target = $( options.of ),
+ collision = ( options.collision || "flip" ).split( " " ),
+ offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
+ targetWidth,
+ targetHeight,
+ basePosition;
+
+ if ( options.of.nodeType === 9 ) {
+ targetWidth = target.width();
+ targetHeight = target.height();
+ basePosition = { top: 0, left: 0 };
+ } else if ( options.of.scrollTo && options.of.document ) {
+ targetWidth = target.width();
+ targetHeight = target.height();
+ basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
+ } else if ( options.of.preventDefault ) {
+ // force left top to allow flipping
+ options.at = "left top";
+ targetWidth = targetHeight = 0;
+ basePosition = { top: options.of.pageY, left: options.of.pageX };
+ } else {
+ targetWidth = target.outerWidth();
+ targetHeight = target.outerHeight();
+ basePosition = target.offset();
+ }
+
+ // force my and at to have valid horizontal and veritcal positions
+ // if a value is missing or invalid, it will be converted to center
+ $.each( [ "my", "at" ], function() {
+ var pos = ( options[this] || "" ).split( " " );
+ if ( pos.length === 1) {
+ pos = horizontalPositions.test( pos[0] ) ?
+ pos.concat( [verticalDefault] ) :
+ verticalPositions.test( pos[0] ) ?
+ [ horizontalDefault ].concat( pos ) :
+ [ horizontalDefault, verticalDefault ];
+ }
+ pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : horizontalDefault;
+ pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : verticalDefault;
+ options[ this ] = pos;
+ });
+
+ // normalize collision option
+ if ( collision.length === 1 ) {
+ collision[ 1 ] = collision[ 0 ];
+ }
+
+ // normalize offset option
+ offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
+ if ( offset.length === 1 ) {
+ offset[ 1 ] = offset[ 0 ];
+ }
+ offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
+
+ if ( options.at[0] === "right" ) {
+ basePosition.left += targetWidth;
+ } else if (options.at[0] === horizontalDefault ) {
+ basePosition.left += targetWidth / 2;
+ }
+
+ if ( options.at[1] === "bottom" ) {
+ basePosition.top += targetHeight;
+ } else if ( options.at[1] === verticalDefault ) {
+ basePosition.top += targetHeight / 2;
+ }
+
+ basePosition.left += offset[ 0 ];
+ basePosition.top += offset[ 1 ];
+
+ return this.each(function() {
+ var elem = $( this ),
+ elemWidth = elem.outerWidth(),
+ elemHeight = elem.outerHeight(),
+ position = $.extend( {}, basePosition );
+
+ if ( options.my[0] === "right" ) {
+ position.left -= elemWidth;
+ } else if ( options.my[0] === horizontalDefault ) {
+ position.left -= elemWidth / 2;
+ }
+
+ if ( options.my[1] === "bottom" ) {
+ position.top -= elemHeight;
+ } else if ( options.my[1] === verticalDefault ) {
+ position.top -= elemHeight / 2;
+ }
+
+ // prevent fractions (see #5280)
+ position.left = parseInt( position.left );
+ position.top = parseInt( position.top );
+
+ $.each( [ "left", "top" ], function( i, dir ) {
+ if ( $.ui.position[ collision[i] ] ) {
+ $.ui.position[ collision[i] ][ dir ]( position, {
+ targetWidth: targetWidth,
+ targetHeight: targetHeight,
+ elemWidth: elemWidth,
+ elemHeight: elemHeight,
+ offset: offset,
+ my: options.my,
+ at: options.at
+ });
+ }
+ });
+
+ if ( $.fn.bgiframe ) {
+ elem.bgiframe();
+ }
+ elem.offset( $.extend( position, { using: options.using } ) );
+ });
+};
+
+$.ui.position = {
+ fit: {
+ left: function( position, data ) {
+ var win = $( window ),
+ over = position.left + data.elemWidth - win.width() - win.scrollLeft();
+ position.left = over > 0 ? position.left - over : Math.max( 0, position.left );
+ },
+ top: function( position, data ) {
+ var win = $( window ),
+ over = position.top + data.elemHeight - win.height() - win.scrollTop();
+ position.top = over > 0 ? position.top - over : Math.max( 0, position.top );
+ }
+ },
+
+ flip: {
+ left: function( position, data ) {
+ if ( data.at[0] === "center" ) {
+ return;
+ }
+ var win = $( window ),
+ over = position.left + data.elemWidth - win.width() - win.scrollLeft(),
+ myOffset = data.my[ 0 ] === "left" ?
+ -data.elemWidth :
+ data.my[ 0 ] === "right" ?
+ data.elemWidth :
+ 0,
+ offset = -2 * data.offset[ 0 ];
+ position.left += position.left < 0 ?
+ myOffset + data.targetWidth + offset :
+ over > 0 ?
+ myOffset - data.targetWidth + offset :
+ 0;
+ },
+ top: function( position, data ) {
+ if ( data.at[1] === "center" ) {
+ return;
+ }
+ var win = $( window ),
+ over = position.top + data.elemHeight - win.height() - win.scrollTop(),
+ myOffset = data.my[ 1 ] === "top" ?
+ -data.elemHeight :
+ data.my[ 1 ] === "bottom" ?
+ data.elemHeight :
+ 0,
+ atOffset = data.at[ 1 ] === "top" ?
+ data.targetHeight :
+ -data.targetHeight,
+ offset = -2 * data.offset[ 1 ];
+ position.top += position.top < 0 ?
+ myOffset + data.targetHeight + offset :
+ over > 0 ?
+ myOffset + atOffset + offset :
+ 0;
+ }
+ }
+};
+
+// offset setter from jQuery 1.4
+if ( !$.offset.setOffset ) {
+ $.offset.setOffset = function( elem, options ) {
+ // set position first, in-case top/left are set even on static elem
+ if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
+ elem.style.position = "relative";
+ }
+ var curElem = $( elem ),
+ curOffset = curElem.offset(),
+ curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0,
+ curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0,
+ props = {
+ top: (options.top - curOffset.top) + curTop,
+ left: (options.left - curOffset.left) + curLeft
+ };
+
+ if ( 'using' in options ) {
+ options.using.call( elem, props );
+ } else {
+ curElem.css( props );
+ }
+ };
+
+ $.fn.offset = function( options ) {
+ var elem = this[ 0 ];
+ if ( !elem || !elem.ownerDocument ) { return null; }
+ if ( options ) {
+ return this.each(function() {
+ $.offset.setOffset( this, options );
+ });
+ }
+ return _offset.call( this );
+ };
+}
+
+}( jQuery ));
+/*
+ * jQuery UI Draggable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.draggable", $.ui.mouse, {
+ widgetEventPrefix: "drag",
+ options: {
+ addClasses: true,
+ appendTo: "parent",
+ axis: false,
+ connectToSortable: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false
+ },
+ _create: function() {
+
+ if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+ this.element[0].style.position = 'relative';
+
+ (this.options.addClasses && this.element.addClass("ui-draggable"));
+ (this.options.disabled && this.element.addClass("ui-draggable-disabled"));
+
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ if(!this.element.data('draggable')) return;
+ this.element
+ .removeData("draggable")
+ .unbind(".draggable")
+ .removeClass("ui-draggable"
+ + " ui-draggable-dragging"
+ + " ui-draggable-disabled");
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ // among others, prevent a drag on a resizable-handle
+ if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
+ return false;
+
+ //Quit if we're not on a valid handle
+ this.handle = this._getHandle(event);
+ if (!this.handle)
+ return false;
+
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options;
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ //If ddmanager is used for droppables, set the global draggable
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Store the helper's css position
+ this.cssPosition = this.helper.css("position");
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.positionAbs = this.element.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this.position = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ //Trigger event + callbacks
+ if(this._trigger("start", event) === false) {
+ this._clear();
+ return false;
+ }
+
+ //Recache the helper size
+ this._cacheHelperProportions();
+
+ //Prepare the droppable offsets
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.helper.addClass("ui-draggable-dragging");
+ this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+ },
+
+ _mouseDrag: function(event, noPropagation) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Call plugins and callbacks and use the resulting position if something is returned
+ if (!noPropagation) {
+ var ui = this._uiHash();
+ if(this._trigger('drag', event, ui) === false) {
+ this._mouseUp({});
+ return false;
+ }
+ this.position = ui.position;
+ }
+
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ //If we are using droppables, inform the manager about the drop
+ var dropped = false;
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ dropped = $.ui.ddmanager.drop(this, event);
+
+ //if a drop comes from outside (a sortable)
+ if(this.dropped) {
+ dropped = this.dropped;
+ this.dropped = false;
+ }
+
+ //if the original element is removed, don't bother to continue
+ if(!this.element[0] || !this.element[0].parentNode)
+ return false;
+
+ if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+ var self = this;
+ $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+ if(self._trigger("stop", event) !== false) {
+ self._clear();
+ }
+ });
+ } else {
+ if(this._trigger("stop", event) !== false) {
+ this._clear();
+ }
+ }
+
+ return false;
+ },
+
+ cancel: function() {
+
+ if(this.helper.is(".ui-draggable-dragging")) {
+ this._mouseUp({});
+ } else {
+ this._clear();
+ }
+
+ return this;
+
+ },
+
+ _getHandle: function(event) {
+
+ var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+ $(this.options.handle, this.element)
+ .find("*")
+ .andSelf()
+ .each(function() {
+ if(this == event.target) handle = true;
+ });
+
+ return handle;
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
+
+ if(!helper.parents('body').length)
+ helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+ if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+ helper.css("position", "absolute");
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if (typeof obj == 'string') {
+ obj = obj.split(' ');
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ('left' in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ('right' in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ('top' in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ('bottom' in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function() {
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.element.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.element.css("marginLeft"),10) || 0),
+ top: (parseInt(this.element.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+ var ce = $(o.containment)[0]; if(!ce) return;
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ } else if(o.containment.constructor == Array) {
+ this.containment = o.containment;
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _clear: function() {
+ this.helper.removeClass("ui-draggable-dragging");
+ if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+ //if($.ui.ddmanager) $.ui.ddmanager.current = null;
+ this.helper = null;
+ this.cancelHelperRemoval = false;
+ },
+
+ // From now on bulk stuff - mainly helpers
+
+ _trigger: function(type, event, ui) {
+ ui = ui || this._uiHash();
+ $.ui.plugin.call(this, type, [event, ui]);
+ if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+ return $.Widget.prototype._trigger.call(this, type, event, ui);
+ },
+
+ plugins: {},
+
+ _uiHash: function(event) {
+ return {
+ helper: this.helper,
+ position: this.position,
+ originalPosition: this.originalPosition,
+ offset: this.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.draggable, {
+ version: "1.8.1"
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+ start: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options,
+ uiSortable = $.extend({}, ui, { item: inst.element });
+ inst.sortables = [];
+ $(o.connectToSortable).each(function() {
+ var sortable = $.data(this, 'sortable');
+ if (sortable && !sortable.options.disabled) {
+ inst.sortables.push({
+ instance: sortable,
+ shouldRevert: sortable.options.revert
+ });
+ sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache
+ sortable._trigger("activate", event, uiSortable);
+ }
+ });
+
+ },
+ stop: function(event, ui) {
+
+ //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+ var inst = $(this).data("draggable"),
+ uiSortable = $.extend({}, ui, { item: inst.element });
+
+ $.each(inst.sortables, function() {
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+
+ inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+ this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+ //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+ if(this.shouldRevert) this.instance.options.revert = true;
+
+ //Trigger the stop of the sortable
+ this.instance._mouseStop(event);
+
+ this.instance.options.helper = this.instance.options._helper;
+
+ //If the helper has been the original item, restore properties in the sortable
+ if(inst.options.helper == 'original')
+ this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+ } else {
+ this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+ this.instance._trigger("deactivate", event, uiSortable);
+ }
+
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), self = this;
+
+ var checkPos = function(o) {
+ var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+ var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+ var itemHeight = o.height, itemWidth = o.width;
+ var itemTop = o.top, itemLeft = o.left;
+
+ return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+ };
+
+ $.each(inst.sortables, function(i) {
+
+ //Copy over some variables to allow calling the sortable's native _intersectsWith
+ this.instance.positionAbs = inst.positionAbs;
+ this.instance.helperProportions = inst.helperProportions;
+ this.instance.offset.click = inst.offset.click;
+
+ if(this.instance._intersectsWith(this.instance.containerCache)) {
+
+ //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+ if(!this.instance.isOver) {
+
+ this.instance.isOver = 1;
+ //Now we fake the start of dragging for the sortable instance,
+ //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+ //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+ this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
+ this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+ this.instance.options.helper = function() { return ui.helper[0]; };
+
+ event.target = this.instance.currentItem[0];
+ this.instance._mouseCapture(event, true);
+ this.instance._mouseStart(event, true, true);
+
+ //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+ this.instance.offset.click.top = inst.offset.click.top;
+ this.instance.offset.click.left = inst.offset.click.left;
+ this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+ this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+ inst._trigger("toSortable", event);
+ inst.dropped = this.instance.element; //draggable revert needs that
+ //hack so receive/update callbacks work (mostly)
+ inst.currentItem = inst.element;
+ this.instance.fromOutside = inst;
+
+ }
+
+ //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+ if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+ } else {
+
+ //If it doesn't intersect with the sortable, and it intersected before,
+ //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+ this.instance.cancelHelperRemoval = true;
+
+ //Prevent reverting on this forced stop
+ this.instance.options.revert = false;
+
+ // The out event needs to be triggered independently
+ this.instance._trigger('out', event, this.instance._uiHash(this.instance));
+
+ this.instance._mouseStop(event, true);
+ this.instance.options.helper = this.instance.options._helper;
+
+ //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+ this.instance.currentItem.remove();
+ if(this.instance.placeholder) this.instance.placeholder.remove();
+
+ inst._trigger("fromSortable", event);
+ inst.dropped = false; //draggable revert needs that
+ }
+
+ };
+
+ });
+
+ }
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+ start: function(event, ui) {
+ var t = $('body'), o = $(this).data('draggable').options;
+ if (t.css("cursor")) o._cursor = t.css("cursor");
+ t.css("cursor", o.cursor);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if (o._cursor) $('body').css("cursor", o._cursor);
+ }
+});
+
+$.ui.plugin.add("draggable", "iframeFix", {
+ start: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+ $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+ .css({
+ width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+ position: "absolute", opacity: "0.001", zIndex: 1000
+ })
+ .css($(this).offset())
+ .appendTo("body");
+ });
+ },
+ stop: function(event, ui) {
+ $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
+ }
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data('draggable').options;
+ if(t.css("opacity")) o._opacity = t.css("opacity");
+ t.css('opacity', o.opacity);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+ }
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+ start: function(event, ui) {
+ var i = $(this).data("draggable");
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+ },
+ drag: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+ if(!o.axis || o.axis != 'x') {
+ if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+ }
+
+ } else {
+
+ if(!o.axis || o.axis != 'x') {
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+ }
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(i, event);
+
+ }
+});
+
+$.ui.plugin.add("draggable", "snap", {
+ start: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options;
+ i.snapElements = [];
+
+ $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+ var $t = $(this); var $o = $t.offset();
+ if(this != i.element[0]) i.snapElements.push({
+ item: this,
+ width: $t.outerWidth(), height: $t.outerHeight(),
+ top: $o.top, left: $o.left
+ });
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options;
+ var d = o.snapTolerance;
+
+ var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+ y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+ for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+ var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+ t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+ //Yes, I know, this is insane ;)
+ if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+ if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = false;
+ continue;
+ }
+
+ if(o.snapMode != 'inner') {
+ var ts = Math.abs(t - y2) <= d;
+ var bs = Math.abs(b - y1) <= d;
+ var ls = Math.abs(l - x2) <= d;
+ var rs = Math.abs(r - x1) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+ }
+
+ var first = (ts || bs || ls || rs);
+
+ if(o.snapMode != 'outer') {
+ var ts = Math.abs(t - y1) <= d;
+ var bs = Math.abs(b - y2) <= d;
+ var ls = Math.abs(l - x1) <= d;
+ var rs = Math.abs(r - x2) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+ }
+
+ if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+ (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+ };
+
+ }
+});
+
+$.ui.plugin.add("draggable", "stack", {
+ start: function(event, ui) {
+
+ var o = $(this).data("draggable").options;
+
+ var group = $.makeArray($(o.stack)).sort(function(a,b) {
+ return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
+ });
+ if (!group.length) { return; }
+
+ var min = parseInt(group[0].style.zIndex) || 0;
+ $(group).each(function(i) {
+ this.style.zIndex = min + i;
+ });
+
+ this[0].style.zIndex = min + group.length;
+
+ }
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data("draggable").options;
+ if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+ t.css('zIndex', o.zIndex);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data("draggable").options;
+ if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Droppable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.mouse.js
+ * jquery.ui.draggable.js
+ */
+(function($) {
+
+$.widget("ui.droppable", {
+ widgetEventPrefix: "drop",
+ options: {
+ accept: '*',
+ activeClass: false,
+ addClasses: true,
+ greedy: false,
+ hoverClass: false,
+ scope: 'default',
+ tolerance: 'intersect'
+ },
+ _create: function() {
+
+ var o = this.options, accept = o.accept;
+ this.isover = 0; this.isout = 1;
+
+ this.accept = $.isFunction(accept) ? accept : function(d) {
+ return d.is(accept);
+ };
+
+ //Store the droppable's proportions
+ this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+
+ // Add the reference and positions to the manager
+ $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
+ $.ui.ddmanager.droppables[o.scope].push(this);
+
+ (o.addClasses && this.element.addClass("ui-droppable"));
+
+ },
+
+ destroy: function() {
+ var drop = $.ui.ddmanager.droppables[this.options.scope];
+ for ( var i = 0; i < drop.length; i++ )
+ if ( drop[i] == this )
+ drop.splice(i, 1);
+
+ this.element
+ .removeClass("ui-droppable ui-droppable-disabled")
+ .removeData("droppable")
+ .unbind(".droppable");
+
+ return this;
+ },
+
+ _setOption: function(key, value) {
+
+ if(key == 'accept') {
+ this.accept = $.isFunction(value) ? value : function(d) {
+ return d.is(value);
+ };
+ }
+ $.Widget.prototype._setOption.apply(this, arguments);
+ },
+
+ _activate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.addClass(this.options.activeClass);
+ (draggable && this._trigger('activate', event, this.ui(draggable)));
+ },
+
+ _deactivate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ (draggable && this._trigger('deactivate', event, this.ui(draggable)));
+ },
+
+ _over: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
+ this._trigger('over', event, this.ui(draggable));
+ }
+
+ },
+
+ _out: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('out', event, this.ui(draggable));
+ }
+
+ },
+
+ _drop: function(event,custom) {
+
+ var draggable = custom || $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
+
+ var childrenIntersection = false;
+ this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
+ var inst = $.data(this, 'droppable');
+ if(
+ inst.options.greedy
+ && !inst.options.disabled
+ && inst.options.scope == draggable.options.scope
+ && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
+ && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
+ ) { childrenIntersection = true; return false; }
+ });
+ if(childrenIntersection) return false;
+
+ if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('drop', event, this.ui(draggable));
+ return this.element;
+ }
+
+ return false;
+
+ },
+
+ ui: function(c) {
+ return {
+ draggable: (c.currentItem || c.element),
+ helper: c.helper,
+ position: c.position,
+ offset: c.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.droppable, {
+ version: "1.8.1"
+});
+
+$.ui.intersect = function(draggable, droppable, toleranceMode) {
+
+ if (!droppable.offset) return false;
+
+ var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
+ y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
+ var l = droppable.offset.left, r = l + droppable.proportions.width,
+ t = droppable.offset.top, b = t + droppable.proportions.height;
+
+ switch (toleranceMode) {
+ case 'fit':
+ return (l < x1 && x2 < r
+ && t < y1 && y2 < b);
+ break;
+ case 'intersect':
+ return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
+ && x2 - (draggable.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
+ && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
+ break;
+ case 'pointer':
+ var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
+ draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
+ isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
+ return isOver;
+ break;
+ case 'touch':
+ return (
+ (y1 >= t && y1 <= b) || // Top edge touching
+ (y2 >= t && y2 <= b) || // Bottom edge touching
+ (y1 < t && y2 > b) // Surrounded vertically
+ ) && (
+ (x1 >= l && x1 <= r) || // Left edge touching
+ (x2 >= l && x2 <= r) || // Right edge touching
+ (x1 < l && x2 > r) // Surrounded horizontally
+ );
+ break;
+ default:
+ return false;
+ break;
+ }
+
+};
+
+/*
+ This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+ current: null,
+ droppables: { 'default': [] },
+ prepareOffsets: function(t, event) {
+
+ var m = $.ui.ddmanager.droppables[t.options.scope] || [];
+ var type = event ? event.type : null; // workaround for #2317
+ var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
+
+ droppablesLoop: for (var i = 0; i < m.length; i++) {
+
+ if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
+ for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
+ m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
+
+ m[i].offset = m[i].element.offset();
+ m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+
+ if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
+
+ }
+
+ },
+ drop: function(draggable, event) {
+
+ var dropped = false;
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+ if(!this.options) return;
+ if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
+ dropped = dropped || this._drop.call(this, event);
+
+ if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ this.isout = 1; this.isover = 0;
+ this._deactivate.call(this, event);
+ }
+
+ });
+ return dropped;
+
+ },
+ drag: function(draggable, event) {
+
+ //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+ if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
+
+ //Run through all droppables and check their positions based on specific tolerance options
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+ if(this.options.disabled || this.greedyChild || !this.visible) return;
+ var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
+
+ var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
+ if(!c) return;
+
+ var parentInstance;
+ if (this.options.greedy) {
+ var parent = this.element.parents(':data(droppable):eq(0)');
+ if (parent.length) {
+ parentInstance = $.data(parent[0], 'droppable');
+ parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+ }
+ }
+
+ // we just moved into a greedy child
+ if (parentInstance && c == 'isover') {
+ parentInstance['isover'] = 0;
+ parentInstance['isout'] = 1;
+ parentInstance._out.call(parentInstance, event);
+ }
+
+ this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
+ this[c == "isover" ? "_over" : "_out"].call(this, event);
+
+ // we just moved out of a greedy child
+ if (parentInstance && c == 'isout') {
+ parentInstance['isout'] = 0;
+ parentInstance['isover'] = 1;
+ parentInstance._over.call(parentInstance, event);
+ }
+ });
+
+ }
+};
+
+})(jQuery);
+/*
+ * jQuery UI Resizable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.resizable", $.ui.mouse, {
+ widgetEventPrefix: "resize",
+ options: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ containment: false,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ zIndex: 1000
+ },
+ _create: function() {
+
+ var self = this, o = this.options;
+ this.element.addClass("ui-resizable");
+
+ $.extend(this, {
+ _aspectRatio: !!(o.aspectRatio),
+ aspectRatio: o.aspectRatio,
+ originalElement: this.element,
+ _proportionallyResizeElements: [],
+ _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+ });
+
+ //Wrap the element if it cannot hold child nodes
+ if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+ //Opera fix for relative positioning
+ if (/relative/.test(this.element.css('position')) && $.browser.opera)
+ this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ //Create a wrapper element and set the wrapper to the new current internal element
+ this.element.wrap(
+ $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+ position: this.element.css('position'),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css('top'),
+ left: this.element.css('left')
+ })
+ );
+
+ //Overwrite the original this.element
+ this.element = this.element.parent().data(
+ "resizable", this.element.data('resizable')
+ );
+
+ this.elementIsWrapper = true;
+
+ //Move margins to the wrapper
+ this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+ this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+ //Prevent Safari textarea resize
+ this.originalResizeStyle = this.originalElement.css('resize');
+ this.originalElement.css('resize', 'none');
+
+ //Push the actual element to our proportionallyResize internal array
+ this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+ // avoid IE jump (hard set the margin)
+ this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+ // fix handlers offset
+ this._proportionallyResize();
+
+ }
+
+ this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+ if(this.handles.constructor == String) {
+
+ if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+ var n = this.handles.split(","); this.handles = {};
+
+ for(var i = 0; i < n.length; i++) {
+
+ var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+ var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+ // increase zIndex of sw, se, ne, nw axis
+ //TODO : this modifies original option
+ if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+
+ //TODO : What's going on here?
+ if ('se' == handle) {
+ axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+ };
+
+ //Insert into internal handles object and append to element
+ this.handles[handle] = '.ui-resizable-'+handle;
+ this.element.append(axis);
+ }
+
+ }
+
+ this._renderAxis = function(target) {
+
+ target = target || this.element;
+
+ for(var i in this.handles) {
+
+ if(this.handles[i].constructor == String)
+ this.handles[i] = $(this.handles[i], this.element).show();
+
+ //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+ if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+ var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+ //Checking the correct pad and border
+ padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+ //The padding type i have to apply...
+ var padPos = [ 'padding',
+ /ne|nw|n/.test(i) ? 'Top' :
+ /se|sw|s/.test(i) ? 'Bottom' :
+ /^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+ target.css(padPos, padWrapper);
+
+ this._proportionallyResize();
+
+ }
+
+ //TODO: What's that good for? There's not anything to be executed left
+ if(!$(this.handles[i]).length)
+ continue;
+
+ }
+ };
+
+ //TODO: make renderAxis a prototype function
+ this._renderAxis(this.element);
+
+ this._handles = $('.ui-resizable-handle', this.element)
+ .disableSelection();
+
+ //Matching axis name
+ this._handles.mouseover(function() {
+ if (!self.resizing) {
+ if (this.className)
+ var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+ //Axis, default = se
+ self.axis = axis && axis[1] ? axis[1] : 'se';
+ }
+ });
+
+ //If we want to auto hide the elements
+ if (o.autoHide) {
+ this._handles.hide();
+ $(this.element)
+ .addClass("ui-resizable-autohide")
+ .hover(function() {
+ $(this).removeClass("ui-resizable-autohide");
+ self._handles.show();
+ },
+ function(){
+ if (!self.resizing) {
+ $(this).addClass("ui-resizable-autohide");
+ self._handles.hide();
+ }
+ });
+ }
+
+ //Initialize the mouse interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+
+ this._mouseDestroy();
+
+ var _destroy = function(exp) {
+ $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+ .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+ };
+
+ //TODO: Unwrap at same DOM position
+ if (this.elementIsWrapper) {
+ _destroy(this.element);
+ var wrapper = this.element;
+ wrapper.after(
+ this.originalElement.css({
+ position: wrapper.css('position'),
+ width: wrapper.outerWidth(),
+ height: wrapper.outerHeight(),
+ top: wrapper.css('top'),
+ left: wrapper.css('left')
+ })
+ ).remove();
+ }
+
+ this.originalElement.css('resize', this.originalResizeStyle);
+ _destroy(this.originalElement);
+
+ return this;
+ },
+
+ _mouseCapture: function(event) {
+ var handle = false;
+ for (var i in this.handles) {
+ if ($(this.handles[i])[0] == event.target) {
+ handle = true;
+ }
+ }
+
+ return !this.options.disabled && handle;
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options, iniPos = this.element.position(), el = this.element;
+
+ this.resizing = true;
+ this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+ // bugfix for http://dev.jquery.com/ticket/1749
+ if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+ el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+ }
+
+ //Opera fixing relative position
+ if ($.browser.opera && (/relative/).test(el.css('position')))
+ el.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ this._renderProxy();
+
+ var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+ if (o.containment) {
+ curleft += $(o.containment).scrollLeft() || 0;
+ curtop += $(o.containment).scrollTop() || 0;
+ }
+
+ //Store needed variables
+ this.offset = this.helper.offset();
+ this.position = { left: curleft, top: curtop };
+ this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalPosition = { left: curleft, top: curtop };
+ this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+ this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+ //Aspect Ratio
+ this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+ var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+ $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+
+ el.addClass("ui-resizable-resizing");
+ this._propagate("start", event);
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ //Increase performance, avoid regex
+ var el = this.helper, o = this.options, props = {},
+ self = this, smp = this.originalMousePosition, a = this.axis;
+
+ var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+ var trigger = this._change[a];
+ if (!trigger) return false;
+
+ // Calculate the attrs that will be change
+ var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+ if (this._aspectRatio || event.shiftKey)
+ data = this._updateRatio(data, event);
+
+ data = this._respectSize(data, event);
+
+ // plugins callbacks need to be called first
+ this._propagate("resize", event);
+
+ el.css({
+ top: this.position.top + "px", left: this.position.left + "px",
+ width: this.size.width + "px", height: this.size.height + "px"
+ });
+
+ if (!this._helper && this._proportionallyResizeElements.length)
+ this._proportionallyResize();
+
+ this._updateCache(data);
+
+ // calling the user callback at the end
+ this._trigger('resize', event, this.ui());
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ this.resizing = false;
+ var o = this.options, self = this;
+
+ if(this._helper) {
+ var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ if (!o.animate)
+ this.element.css($.extend(s, { top: top, left: left }));
+
+ self.helper.height(self.size.height);
+ self.helper.width(self.size.width);
+
+ if (this._helper && !o.animate) this._proportionallyResize();
+ }
+
+ $('body').css('cursor', 'auto');
+
+ this.element.removeClass("ui-resizable-resizing");
+
+ this._propagate("stop", event);
+
+ if (this._helper) this.helper.remove();
+ return false;
+
+ },
+
+ _updateCache: function(data) {
+ var o = this.options;
+ this.offset = this.helper.offset();
+ if (isNumber(data.left)) this.position.left = data.left;
+ if (isNumber(data.top)) this.position.top = data.top;
+ if (isNumber(data.height)) this.size.height = data.height;
+ if (isNumber(data.width)) this.size.width = data.width;
+ },
+
+ _updateRatio: function(data, event) {
+
+ var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+ if (data.height) data.width = (csize.height * this.aspectRatio);
+ else if (data.width) data.height = (csize.width / this.aspectRatio);
+
+ if (a == 'sw') {
+ data.left = cpos.left + (csize.width - data.width);
+ data.top = null;
+ }
+ if (a == 'nw') {
+ data.top = cpos.top + (csize.height - data.height);
+ data.left = cpos.left + (csize.width - data.width);
+ }
+
+ return data;
+ },
+
+ _respectSize: function(data, event) {
+
+ var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+ ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+ isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+ if (isminw) data.width = o.minWidth;
+ if (isminh) data.height = o.minHeight;
+ if (ismaxw) data.width = o.maxWidth;
+ if (ismaxh) data.height = o.maxHeight;
+
+ var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+ var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+ if (isminw && cw) data.left = dw - o.minWidth;
+ if (ismaxw && cw) data.left = dw - o.maxWidth;
+ if (isminh && ch) data.top = dh - o.minHeight;
+ if (ismaxh && ch) data.top = dh - o.maxHeight;
+
+ // fixing jump error on top/left - bug #2330
+ var isNotwh = !data.width && !data.height;
+ if (isNotwh && !data.left && data.top) data.top = null;
+ else if (isNotwh && !data.top && data.left) data.left = null;
+
+ return data;
+ },
+
+ _proportionallyResize: function() {
+
+ var o = this.options;
+ if (!this._proportionallyResizeElements.length) return;
+ var element = this.helper || this.element;
+
+ for (var i=0; i < this._proportionallyResizeElements.length; i++) {
+
+ var prel = this._proportionallyResizeElements[i];
+
+ if (!this.borderDif) {
+ var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+ p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+ this.borderDif = $.map(b, function(v, i) {
+ var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+ return border + padding;
+ });
+ }
+
+ if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+ continue;
+
+ prel.css({
+ height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+ width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+ });
+
+ };
+
+ },
+
+ _renderProxy: function() {
+
+ var el = this.element, o = this.options;
+ this.elementOffset = el.offset();
+
+ if(this._helper) {
+
+ this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+ // fix ie6 offset TODO: This seems broken
+ var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+ pxyoffset = ( ie6 ? 2 : -1 );
+
+ this.helper.addClass(this._helper).css({
+ width: this.element.outerWidth() + pxyoffset,
+ height: this.element.outerHeight() + pxyoffset,
+ position: 'absolute',
+ left: this.elementOffset.left - ie6offset +'px',
+ top: this.elementOffset.top - ie6offset +'px',
+ zIndex: ++o.zIndex //TODO: Don't modify option
+ });
+
+ this.helper
+ .appendTo("body")
+ .disableSelection();
+
+ } else {
+ this.helper = this.element;
+ }
+
+ },
+
+ _change: {
+ e: function(event, dx, dy) {
+ return { width: this.originalSize.width + dx };
+ },
+ w: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { left: sp.left + dx, width: cs.width - dx };
+ },
+ n: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { top: sp.top + dy, height: cs.height - dy };
+ },
+ s: function(event, dx, dy) {
+ return { height: this.originalSize.height + dy };
+ },
+ se: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ sw: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ },
+ ne: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ nw: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ }
+ },
+
+ _propagate: function(n, event) {
+ $.ui.plugin.call(this, n, [event, this.ui()]);
+ (n != "resize" && this._trigger(n, event, this.ui()));
+ },
+
+ plugins: {},
+
+ ui: function() {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ };
+ }
+
+});
+
+$.extend($.ui.resizable, {
+ version: "1.8.1"
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options;
+
+ var _store = function(exp) {
+ $(exp).each(function() {
+ $(this).data("resizable-alsoresize", {
+ width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
+ left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10)
+ });
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+ if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+ else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); }
+ }else{
+ _store(o.alsoResize);
+ }
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+ var delta = {
+ height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+ top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+ },
+
+ _alsoResize = function(exp, c) {
+ $(exp).each(function() {
+ var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left'];
+
+ $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) {
+ var sum = (start[prop]||0) + (delta[prop]||0);
+ if (sum && sum >= 0)
+ style[prop] = sum || null;
+ });
+
+ //Opera fixing relative position
+ if (/relative/.test(el.css('position')) && $.browser.opera) {
+ self._revertToRelativePosition = true;
+ el.css({ position: 'absolute', top: 'auto', left: 'auto' });
+ }
+
+ el.css(style);
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+ $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); });
+ }else{
+ _alsoResize(o.alsoResize);
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable");
+
+ //Opera fixing relative position
+ if (self._revertToRelativePosition && $.browser.opera) {
+ self._revertToRelativePosition = false;
+ el.css({ position: 'relative' });
+ }
+
+ $(this).removeData("resizable-alsoresize-start");
+ }
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+ stop: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ self.element.animate(
+ $.extend(style, top && left ? { top: top, left: left } : {}), {
+ duration: o.animateDuration,
+ easing: o.animateEasing,
+ step: function() {
+
+ var data = {
+ width: parseInt(self.element.css('width'), 10),
+ height: parseInt(self.element.css('height'), 10),
+ top: parseInt(self.element.css('top'), 10),
+ left: parseInt(self.element.css('left'), 10)
+ };
+
+ if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
+
+ // propagating resize, and updating values for each animation step
+ self._updateCache(data);
+ self._propagate("resize", event);
+
+ }
+ }
+ );
+ }
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+ start: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, el = self.element;
+ var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+ if (!ce) return;
+
+ self.containerElement = $(ce);
+
+ if (/document/.test(oc) || oc == document) {
+ self.containerOffset = { left: 0, top: 0 };
+ self.containerPosition = { left: 0, top: 0 };
+
+ self.parentData = {
+ element: $(document), left: 0, top: 0,
+ width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+ };
+ }
+
+ // i'm a node, so compute top, left, right, bottom
+ else {
+ var element = $(ce), p = [];
+ $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+ self.containerOffset = element.offset();
+ self.containerPosition = element.position();
+ self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+ var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
+ width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+ self.parentData = {
+ element: ce, left: co.left, top: co.top, width: width, height: height
+ };
+ }
+ },
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options,
+ ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+ pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+ if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+ if (cp.left < (self._helper ? co.left : 0)) {
+ self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+ if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+ self.position.left = o.helper ? co.left : 0;
+ }
+
+ if (cp.top < (self._helper ? co.top : 0)) {
+ self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+ if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+ self.position.top = self._helper ? co.top : 0;
+ }
+
+ self.offset.left = self.parentData.left+self.position.left;
+ self.offset.top = self.parentData.top+self.position.top;
+
+ var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+ hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+ var isParent = self.containerElement.get(0) == self.element.parent().get(0),
+ isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+
+ if(isParent && isOffsetRelative) woset -= self.parentData.left;
+
+ if (woset + self.size.width >= self.parentData.width) {
+ self.size.width = self.parentData.width - woset;
+ if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+ }
+
+ if (hoset + self.size.height >= self.parentData.height) {
+ self.size.height = self.parentData.height - hoset;
+ if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, cp = self.position,
+ co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+ var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+ if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ }
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options, cs = self.size;
+
+ self.ghost = self.originalElement.clone();
+ self.ghost
+ .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+ .addClass('ui-resizable-ghost')
+ .addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+ self.ghost.appendTo(self.helper);
+
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+ }
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+ o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+ var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+ if (/^(se|s|e)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ }
+ else if (/^(ne)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ }
+ else if (/^(sw)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.left = op.left - ox;
+ }
+ else {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ self.position.left = op.left - ox;
+ }
+ }
+
+});
+
+var num = function(v) {
+ return parseInt(v, 10) || 0;
+};
+
+var isNumber = function(value) {
+ return !isNaN(parseInt(value, 10));
+};
+
+})(jQuery);
+/*
+ * jQuery UI Selectable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.selectable", $.ui.mouse, {
+ options: {
+ appendTo: 'body',
+ autoRefresh: true,
+ distance: 0,
+ filter: '*',
+ tolerance: 'touch'
+ },
+ _create: function() {
+ var self = this;
+
+ this.element.addClass("ui-selectable");
+
+ this.dragged = false;
+
+ // cache selectee children based on filter
+ var selectees;
+ this.refresh = function() {
+ selectees = $(self.options.filter, self.element[0]);
+ selectees.each(function() {
+ var $this = $(this);
+ var pos = $this.offset();
+ $.data(this, "selectable-item", {
+ element: this,
+ $element: $this,
+ left: pos.left,
+ top: pos.top,
+ right: pos.left + $this.outerWidth(),
+ bottom: pos.top + $this.outerHeight(),
+ startselected: false,
+ selected: $this.hasClass('ui-selected'),
+ selecting: $this.hasClass('ui-selecting'),
+ unselecting: $this.hasClass('ui-unselecting')
+ });
+ });
+ };
+ this.refresh();
+
+ this.selectees = selectees.addClass("ui-selectee");
+
+ this._mouseInit();
+
+ this.helper = $(document.createElement('div'))
+ .css({border:'1px dotted black'})
+ .addClass("ui-selectable-helper");
+ },
+
+ destroy: function() {
+ this.selectees
+ .removeClass("ui-selectee")
+ .removeData("selectable-item");
+ this.element
+ .removeClass("ui-selectable ui-selectable-disabled")
+ .removeData("selectable")
+ .unbind(".selectable");
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseStart: function(event) {
+ var self = this;
+
+ this.opos = [event.pageX, event.pageY];
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ this.selectees = $(options.filter, this.element[0]);
+
+ this._trigger("start", event);
+
+ $(options.appendTo).append(this.helper);
+ // position helper (lasso)
+ this.helper.css({
+ "z-index": 100,
+ "position": "absolute",
+ "left": event.clientX,
+ "top": event.clientY,
+ "width": 0,
+ "height": 0
+ });
+
+ if (options.autoRefresh) {
+ this.refresh();
+ }
+
+ this.selectees.filter('.ui-selected').each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.startselected = true;
+ if (!event.metaKey) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ });
+
+ $(event.target).parents().andSelf().each(function() {
+ var selectee = $.data(this, "selectable-item");
+ if (selectee) {
+ selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting');
+ selectee.unselecting = false;
+ selectee.selecting = true;
+ selectee.selected = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ return false;
+ }
+ });
+
+ },
+
+ _mouseDrag: function(event) {
+ var self = this;
+ this.dragged = true;
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
+ if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
+ if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
+ this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
+
+ this.selectees.each(function() {
+ var selectee = $.data(this, "selectable-item");
+ //prevent helper from being selected if appendTo: selectable
+ if (!selectee || selectee.element == self.element[0])
+ return;
+ var hit = false;
+ if (options.tolerance == 'touch') {
+ hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+ } else if (options.tolerance == 'fit') {
+ hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+ }
+
+ if (hit) {
+ // SELECT
+ if (selectee.selected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ }
+ if (selectee.unselecting) {
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ }
+ if (!selectee.selecting) {
+ selectee.$element.addClass('ui-selecting');
+ selectee.selecting = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ }
+ } else {
+ // UNSELECT
+ if (selectee.selecting) {
+ if (event.metaKey && selectee.startselected) {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ selectee.$element.addClass('ui-selected');
+ selectee.selected = true;
+ } else {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ if (selectee.startselected) {
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ }
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ if (selectee.selected) {
+ if (!event.metaKey && !selectee.startselected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ }
+ });
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+ var self = this;
+
+ this.dragged = false;
+
+ var options = this.options;
+
+ $('.ui-unselecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ selectee.startselected = false;
+ self._trigger("unselected", event, {
+ unselected: selectee.element
+ });
+ });
+ $('.ui-selecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
+ selectee.selecting = false;
+ selectee.selected = true;
+ selectee.startselected = true;
+ self._trigger("selected", event, {
+ selected: selectee.element
+ });
+ });
+ this._trigger("stop", event);
+
+ this.helper.remove();
+
+ return false;
+ }
+
+});
+
+$.extend($.ui.selectable, {
+ version: "1.8.1"
+});
+
+})(jQuery);
+/*
+ * jQuery UI Sortable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.sortable", $.ui.mouse, {
+ widgetEventPrefix: "sort",
+ options: {
+ appendTo: "parent",
+ axis: false,
+ connectWith: false,
+ containment: false,
+ cursor: 'auto',
+ cursorAt: false,
+ dropOnEmpty: true,
+ forcePlaceholderSize: false,
+ forceHelperSize: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ items: '> *',
+ opacity: false,
+ placeholder: false,
+ revert: false,
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ scope: "default",
+ tolerance: "intersect",
+ zIndex: 1000
+ },
+ _create: function() {
+
+ var o = this.options;
+ this.containerCache = {};
+ this.element.addClass("ui-sortable");
+
+ //Get the items
+ this.refresh();
+
+ //Let's determine if the items are floating
+ this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false;
+
+ //Let's determine the parent's offset
+ this.offset = this.element.offset();
+
+ //Initialize mouse events for interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass("ui-sortable ui-sortable-disabled")
+ .removeData("sortable")
+ .unbind(".sortable");
+ this._mouseDestroy();
+
+ for ( var i = this.items.length - 1; i >= 0; i-- )
+ this.items[i].item.removeData("sortable-item");
+
+ return this;
+ },
+
+ _setOption: function(key, value){
+ if ( key === "disabled" ) {
+ this.options[ key ] = value;
+
+ this.widget()
+ [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" );
+ } else {
+ // Don't call widget base _setOption for disable as it adds ui-state-disabled class
+ $.Widget.prototype._setOption.apply(self, arguments);
+ }
+ },
+
+ _mouseCapture: function(event, overrideHandle) {
+
+ if (this.reverting) {
+ return false;
+ }
+
+ if(this.options.disabled || this.options.type == 'static') return false;
+
+ //We have to refresh the items data once first
+ this._refreshItems(event);
+
+ //Find out if the clicked node (or one of its parents) is a actual item in this.items
+ var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
+ if($.data(this, 'sortable-item') == self) {
+ currentItem = $(this);
+ return false;
+ }
+ });
+ if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
+
+ if(!currentItem) return false;
+ if(this.options.handle && !overrideHandle) {
+ var validHandle = false;
+
+ $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
+ if(!validHandle) return false;
+ }
+
+ this.currentItem = currentItem;
+ this._removeCurrentsFromItems();
+ return true;
+
+ },
+
+ _mouseStart: function(event, overrideHandle, noActivation) {
+
+ var o = this.options, self = this;
+ this.currentContainer = this;
+
+ //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
+ this.refreshPositions();
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Get the next scrolling parent
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.currentItem.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ // Only after we got the offset, we can change the helper's position to absolute
+ // TODO: Still need to figure out a way to make relative sorting possible
+ this.helper.css("position", "absolute");
+ this.cssPosition = this.helper.css("position");
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Cache the former DOM position
+ this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
+
+ //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
+ if(this.helper[0] != this.currentItem[0]) {
+ this.currentItem.hide();
+ }
+
+ //Create the placeholder
+ this._createPlaceholder();
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ if(o.cursor) { // cursor option
+ if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
+ $('body').css("cursor", o.cursor);
+ }
+
+ if(o.opacity) { // opacity option
+ if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
+ this.helper.css("opacity", o.opacity);
+ }
+
+ if(o.zIndex) { // zIndex option
+ if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
+ this.helper.css("zIndex", o.zIndex);
+ }
+
+ //Prepare scrolling
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
+ this.overflowOffset = this.scrollParent.offset();
+
+ //Call callbacks
+ this._trigger("start", event, this._uiHash());
+
+ //Recache the helper size
+ if(!this._preserveHelperProportions)
+ this._cacheHelperProportions();
+
+
+ //Post 'activate' events to possible containers
+ if(!noActivation) {
+ for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
+ }
+
+ //Prepare possible droppables
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.dragging = true;
+
+ this.helper.addClass("ui-sortable-helper");
+ this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+
+ },
+
+ _mouseDrag: function(event) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ if (!this.lastPositionAbs) {
+ this.lastPositionAbs = this.positionAbs;
+ }
+
+ //Do scrolling
+ if(this.options.scroll) {
+ var o = this.options, scrolled = false;
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
+
+ if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
+
+ if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+
+ } else {
+
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+
+ //Regenerate the absolute position used for position checks
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Set the helper position
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+
+ //Rearrange
+ for (var i = this.items.length - 1; i >= 0; i--) {
+
+ //Cache variables and intersection, continue if no intersection
+ var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
+ if (!intersection) continue;
+
+ if(itemElement != this.currentItem[0] //cannot intersect with itself
+ && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
+ && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
+ && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
+ //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
+ ) {
+
+ this.direction = intersection == 1 ? "down" : "up";
+
+ if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
+ this._rearrange(event, item);
+ } else {
+ break;
+ }
+
+ this._trigger("change", event, this._uiHash());
+ break;
+ }
+ }
+
+ //Post events to containers
+ this._contactContainers(event);
+
+ //Interconnect with droppables
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ //Call callbacks
+ this._trigger('sort', event, this._uiHash());
+
+ this.lastPositionAbs = this.positionAbs;
+ return false;
+
+ },
+
+ _mouseStop: function(event, noPropagation) {
+
+ if(!event) return;
+
+ //If we are using droppables, inform the manager about the drop
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ $.ui.ddmanager.drop(this, event);
+
+ if(this.options.revert) {
+ var self = this;
+ var cur = self.placeholder.offset();
+
+ self.reverting = true;
+
+ $(this.helper).animate({
+ left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
+ top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
+ }, parseInt(this.options.revert, 10) || 500, function() {
+ self._clear(event);
+ });
+ } else {
+ this._clear(event, noPropagation);
+ }
+
+ return false;
+
+ },
+
+ cancel: function() {
+
+ var self = this;
+
+ if(this.dragging) {
+
+ this._mouseUp();
+
+ if(this.options.helper == "original")
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ else
+ this.currentItem.show();
+
+ //Post deactivating events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ this.containers[i]._trigger("deactivate", null, self._uiHash(this));
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", null, self._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+ if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
+
+ $.extend(this, {
+ helper: null,
+ dragging: false,
+ reverting: false,
+ _noFinalSort: null
+ });
+
+ if(this.domPosition.prev) {
+ $(this.domPosition.prev).after(this.currentItem);
+ } else {
+ $(this.domPosition.parent).prepend(this.currentItem);
+ }
+
+ return this;
+
+ },
+
+ serialize: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var str = []; o = o || {};
+
+ $(items).each(function() {
+ var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
+ if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
+ });
+
+ return str.join('&');
+
+ },
+
+ toArray: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var ret = []; o = o || {};
+
+ items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
+ return ret;
+
+ },
+
+ /* Be careful with the following core functions */
+ _intersectsWith: function(item) {
+
+ var x1 = this.positionAbs.left,
+ x2 = x1 + this.helperProportions.width,
+ y1 = this.positionAbs.top,
+ y2 = y1 + this.helperProportions.height;
+
+ var l = item.left,
+ r = l + item.width,
+ t = item.top,
+ b = t + item.height;
+
+ var dyClick = this.offset.click.top,
+ dxClick = this.offset.click.left;
+
+ var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
+
+ if( this.options.tolerance == "pointer"
+ || this.options.forcePointerForContainers
+ || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
+ ) {
+ return isOverElement;
+ } else {
+
+ return (l < x1 + (this.helperProportions.width / 2) // Right Half
+ && x2 - (this.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (this.helperProportions.height / 2) // Bottom Half
+ && y2 - (this.helperProportions.height / 2) < b ); // Top Half
+
+ }
+ },
+
+ _intersectsWithPointer: function(item) {
+
+ var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+ isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+ isOverElement = isOverElementHeight && isOverElementWidth,
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (!isOverElement)
+ return false;
+
+ return this.floating ?
+ ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
+ : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
+
+ },
+
+ _intersectsWithSides: function(item) {
+
+ var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
+ isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (this.floating && horizontalDirection) {
+ return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
+ } else {
+ return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
+ }
+
+ },
+
+ _getDragVerticalDirection: function() {
+ var delta = this.positionAbs.top - this.lastPositionAbs.top;
+ return delta != 0 && (delta > 0 ? "down" : "up");
+ },
+
+ _getDragHorizontalDirection: function() {
+ var delta = this.positionAbs.left - this.lastPositionAbs.left;
+ return delta != 0 && (delta > 0 ? "right" : "left");
+ },
+
+ refresh: function(event) {
+ this._refreshItems(event);
+ this.refreshPositions();
+ return this;
+ },
+
+ _connectWith: function() {
+ var options = this.options;
+ return options.connectWith.constructor == String
+ ? [options.connectWith]
+ : options.connectWith;
+ },
+
+ _getItemsAsjQuery: function(connected) {
+
+ var self = this;
+ var items = [];
+ var queries = [];
+ var connectWith = this._connectWith();
+
+ if(connectWith && connected) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
+ }
+ };
+ };
+ }
+
+ queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]);
+
+ for (var i = queries.length - 1; i >= 0; i--){
+ queries[i][0].each(function() {
+ items.push(this);
+ });
+ };
+
+ return $(items);
+
+ },
+
+ _removeCurrentsFromItems: function() {
+
+ var list = this.currentItem.find(":data(sortable-item)");
+
+ for (var i=0; i < this.items.length; i++) {
+
+ for (var j=0; j < list.length; j++) {
+ if(list[j] == this.items[i].item[0])
+ this.items.splice(i,1);
+ };
+
+ };
+
+ },
+
+ _refreshItems: function(event) {
+
+ this.items = [];
+ this.containers = [this];
+ var items = this.items;
+ var self = this;
+ var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
+ var connectWith = this._connectWith();
+
+ if(connectWith) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
+ this.containers.push(inst);
+ }
+ };
+ };
+ }
+
+ for (var i = queries.length - 1; i >= 0; i--) {
+ var targetData = queries[i][1];
+ var _queries = queries[i][0];
+
+ for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
+ var item = $(_queries[j]);
+
+ item.data('sortable-item', targetData); // Data for target checking (mouse manager)
+
+ items.push({
+ item: item,
+ instance: targetData,
+ width: 0, height: 0,
+ left: 0, top: 0
+ });
+ };
+ };
+
+ },
+
+ refreshPositions: function(fast) {
+
+ //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
+ if(this.offsetParent && this.helper) {
+ this.offset.parent = this._getParentOffset();
+ }
+
+ for (var i = this.items.length - 1; i >= 0; i--){
+ var item = this.items[i];
+
+ var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+
+ if (!fast) {
+ item.width = t.outerWidth();
+ item.height = t.outerHeight();
+ }
+
+ var p = t.offset();
+ item.left = p.left;
+ item.top = p.top;
+ };
+
+ if(this.options.custom && this.options.custom.refreshContainers) {
+ this.options.custom.refreshContainers.call(this);
+ } else {
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ var p = this.containers[i].element.offset();
+ this.containers[i].containerCache.left = p.left;
+ this.containers[i].containerCache.top = p.top;
+ this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
+ this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+ };
+ }
+
+ return this;
+ },
+
+ _createPlaceholder: function(that) {
+
+ var self = that || this, o = self.options;
+
+ if(!o.placeholder || o.placeholder.constructor == String) {
+ var className = o.placeholder;
+ o.placeholder = {
+ element: function() {
+
+ var el = $(document.createElement(self.currentItem[0].nodeName))
+ .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
+ .removeClass("ui-sortable-helper")[0];
+
+ if(!className)
+ el.style.visibility = "hidden";
+
+ return el;
+ },
+ update: function(container, p) {
+
+ // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
+ // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
+ if(className && !o.forcePlaceholderSize) return;
+
+ //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
+ if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
+ if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
+ }
+ };
+ }
+
+ //Create the placeholder
+ self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
+
+ //Append it after the actual current item
+ self.currentItem.after(self.placeholder);
+
+ //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+ o.placeholder.update(self, self.placeholder);
+
+ },
+
+ _contactContainers: function(event) {
+
+ // get innermost container that intersects with item
+ var innermostContainer = null, innermostIndex = null;
+
+
+ for (var i = this.containers.length - 1; i >= 0; i--){
+
+ // never consider a container that's located within the item itself
+ if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
+ continue;
+
+ if(this._intersectsWith(this.containers[i].containerCache)) {
+
+ // if we've already found a container and it's more "inner" than this, then continue
+ if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
+ continue;
+
+ innermostContainer = this.containers[i];
+ innermostIndex = i;
+
+ } else {
+ // container doesn't intersect. trigger "out" event if necessary
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", event, this._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ // if no intersecting containers found, return
+ if(!innermostContainer) return;
+
+ // move the item into the container if it's not there already
+ if(this.containers.length === 1) {
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ } else if(this.currentContainer != this.containers[innermostIndex]) {
+
+ //When entering a new container, we will find the item with the least distance and append our item near it
+ var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top'];
+ for (var j = this.items.length - 1; j >= 0; j--) {
+ if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue;
+ var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top'];
+ if(Math.abs(cur - base) < dist) {
+ dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
+ }
+ }
+
+ if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
+ return;
+
+ this.currentContainer = this.containers[innermostIndex];
+ itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
+ this._trigger("change", event, this._uiHash());
+ this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
+
+ //Update the placeholder
+ this.options.placeholder.update(this.currentContainer, this.placeholder);
+
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ }
+
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
+
+ if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
+ $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+
+ if(helper[0] == this.currentItem[0])
+ this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
+
+ if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
+ if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if (typeof obj == 'string') {
+ obj = obj.split(' ');
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ('left' in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ('right' in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ('top' in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ('bottom' in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function() {
+
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.currentItem.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
+ top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment)) {
+ var ce = $(o.containment)[0];
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _rearrange: function(event, i, a, hardRefresh) {
+
+ a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
+
+ //Various things done here to improve the performance:
+ // 1. we create a setTimeout, that calls refreshPositions
+ // 2. on the instance, we have a counter variable, that get's higher after every append
+ // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
+ // 4. this lets only the last addition to the timeout stack through
+ this.counter = this.counter ? ++this.counter : 1;
+ var self = this, counter = this.counter;
+
+ window.setTimeout(function() {
+ if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+ },0);
+
+ },
+
+ _clear: function(event, noPropagation) {
+
+ this.reverting = false;
+ // We delay all events that have to be triggered to after the point where the placeholder has been removed and
+ // everything else normalized again
+ var delayedTriggers = [], self = this;
+
+ // We first have to update the dom position of the actual currentItem
+ // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
+ if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem);
+ this._noFinalSort = null;
+
+ if(this.helper[0] == this.currentItem[0]) {
+ for(var i in this._storedCSS) {
+ if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
+ }
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ } else {
+ this.currentItem.show();
+ }
+
+ if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
+ if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
+ if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
+ if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ }
+ };
+ };
+
+ //Post events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ if(this.containers[i].containerCache.over) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ //Do what was originally in plugins
+ if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
+ if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity
+ if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
+
+ this.dragging = false;
+ if(this.cancelHelperRemoval) {
+ if(!noPropagation) {
+ this._trigger("beforeStop", event, this._uiHash());
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+ return false;
+ }
+
+ if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+
+ if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
+
+ if(!noPropagation) {
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+
+ this.fromOutside = false;
+ return true;
+
+ },
+
+ _trigger: function() {
+ if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
+ this.cancel();
+ }
+ },
+
+ _uiHash: function(inst) {
+ var self = inst || this;
+ return {
+ helper: self.helper,
+ placeholder: self.placeholder || $([]),
+ position: self.position,
+ originalPosition: self.originalPosition,
+ offset: self.positionAbs,
+ item: self.currentItem,
+ sender: inst ? inst.element : null
+ };
+ }
+
+});
+
+$.extend($.ui.sortable, {
+ version: "1.8.1"
+});
+
+})(jQuery);
+/*
+ * jQuery UI Accordion 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.accordion", {
+ options: {
+ active: 0,
+ animated: 'slide',
+ autoHeight: true,
+ clearStyle: false,
+ collapsible: false,
+ event: "click",
+ fillSpace: false,
+ header: "> li > :first-child,> :not(li):even",
+ icons: {
+ header: "ui-icon-triangle-1-e",
+ headerSelected: "ui-icon-triangle-1-s"
+ },
+ navigation: false,
+ navigationFilter: function() {
+ return this.href.toLowerCase() == location.href.toLowerCase();
+ }
+ },
+ _create: function() {
+
+ var o = this.options, self = this;
+ this.running = 0;
+
+ this.element.addClass("ui-accordion ui-widget ui-helper-reset");
+
+ // in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix
+ if (this.element[0].nodeName == "UL") {
+ this.element.children("li").addClass("ui-accordion-li-fix");
+ }
+
+ this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all")
+ .bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); })
+ .bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); })
+ .bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); })
+ .bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); });
+
+ this.headers
+ .next()
+ .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+
+ if ( o.navigation ) {
+ var current = this.element.find("a").filter(o.navigationFilter);
+ if ( current.length ) {
+ var header = current.closest(".ui-accordion-header");
+ if ( header.length ) {
+ // anchor within header
+ this.active = header;
+ } else {
+ // anchor within content
+ this.active = current.closest(".ui-accordion-content").prev();
+ }
+ }
+ }
+
+ this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");
+ this.active.next().addClass('ui-accordion-content-active');
+
+ //Append icon elements
+ this._createIcons();
+
+ this.resize();
+
+ //ARIA
+ this.element.attr('role','tablist');
+
+ this.headers
+ .attr('role','tab')
+ .bind('keydown', function(event) { return self._keydown(event); })
+ .next()
+ .attr('role','tabpanel');
+
+ this.headers
+ .not(this.active || "")
+ .attr('aria-expanded','false')
+ .attr("tabIndex", "-1")
+ .next()
+ .hide();
+
+ // make sure at least one header is in the tab order
+ if (!this.active.length) {
+ this.headers.eq(0).attr('tabIndex','0');
+ } else {
+ this.active
+ .attr('aria-expanded','true')
+ .attr('tabIndex', '0');
+ }
+
+ // only need links in taborder for Safari
+ if (!$.browser.safari)
+ this.headers.find('a').attr('tabIndex','-1');
+
+ if (o.event) {
+ this.headers.bind((o.event) + ".accordion", function(event) {
+ self._clickHandler.call(self, event, this);
+ event.preventDefault();
+ });
+ }
+
+ },
+
+ _createIcons: function() {
+ var o = this.options;
+ if (o.icons) {
+ $("<span/>").addClass("ui-icon " + o.icons.header).prependTo(this.headers);
+ this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected);
+ this.element.addClass("ui-accordion-icons");
+ }
+ },
+
+ _destroyIcons: function() {
+ this.headers.children(".ui-icon").remove();
+ this.element.removeClass("ui-accordion-icons");
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.element
+ .removeClass("ui-accordion ui-widget ui-helper-reset")
+ .removeAttr("role")
+ .unbind('.accordion')
+ .removeData('accordion');
+
+ this.headers
+ .unbind(".accordion")
+ .removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top")
+ .removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex");
+
+ this.headers.find("a").removeAttr("tabIndex");
+ this._destroyIcons();
+ var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");
+ if (o.autoHeight || o.fillHeight) {
+ contents.css("height", "");
+ }
+
+ return this;
+ },
+
+ _setOption: function(key, value) {
+ $.Widget.prototype._setOption.apply(this, arguments);
+
+ if (key == "active") {
+ this.activate(value);
+ }
+ if (key == "icons") {
+ this._destroyIcons();
+ if (value) {
+ this._createIcons();
+ }
+ }
+
+ },
+
+ _keydown: function(event) {
+
+ var o = this.options, keyCode = $.ui.keyCode;
+
+ if (o.disabled || event.altKey || event.ctrlKey)
+ return;
+
+ var length = this.headers.length;
+ var currentIndex = this.headers.index(event.target);
+ var toFocus = false;
+
+ switch(event.keyCode) {
+ case keyCode.RIGHT:
+ case keyCode.DOWN:
+ toFocus = this.headers[(currentIndex + 1) % length];
+ break;
+ case keyCode.LEFT:
+ case keyCode.UP:
+ toFocus = this.headers[(currentIndex - 1 + length) % length];
+ break;
+ case keyCode.SPACE:
+ case keyCode.ENTER:
+ this._clickHandler({ target: event.target }, event.target);
+ event.preventDefault();
+ }
+
+ if (toFocus) {
+ $(event.target).attr('tabIndex','-1');
+ $(toFocus).attr('tabIndex','0');
+ toFocus.focus();
+ return false;
+ }
+
+ return true;
+
+ },
+
+ resize: function() {
+
+ var o = this.options, maxHeight;
+
+ if (o.fillSpace) {
+
+ if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); }
+ maxHeight = this.element.parent().height();
+ if($.browser.msie) { this.element.parent().css('overflow', defOverflow); }
+
+ this.headers.each(function() {
+ maxHeight -= $(this).outerHeight(true);
+ });
+
+ this.headers.next().each(function() {
+ $(this).height(Math.max(0, maxHeight - $(this).innerHeight() + $(this).height()));
+ }).css('overflow', 'auto');
+
+ } else if ( o.autoHeight ) {
+ maxHeight = 0;
+ this.headers.next().each(function() {
+ maxHeight = Math.max(maxHeight, $(this).height());
+ }).height(maxHeight);
+ }
+
+ return this;
+ },
+
+ activate: function(index) {
+ // TODO this gets called on init, changing the option without an explicit call for that
+ this.options.active = index;
+ // call clickHandler with custom event
+ var active = this._findActive(index)[0];
+ this._clickHandler({ target: active }, active);
+
+ return this;
+ },
+
+ _findActive: function(selector) {
+ return selector
+ ? typeof selector == "number"
+ ? this.headers.filter(":eq(" + selector + ")")
+ : this.headers.not(this.headers.not(selector))
+ : selector === false
+ ? $([])
+ : this.headers.filter(":eq(0)");
+ },
+
+ // TODO isn't event.target enough? why the seperate target argument?
+ _clickHandler: function(event, target) {
+
+ var o = this.options;
+ if (o.disabled)
+ return;
+
+ // called only when using activate(false) to close all parts programmatically
+ if (!event.target) {
+ if (!o.collapsible)
+ return;
+ this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+ .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+ this.active.next().addClass('ui-accordion-content-active');
+ var toHide = this.active.next(),
+ data = {
+ options: o,
+ newHeader: $([]),
+ oldHeader: o.active,
+ newContent: $([]),
+ oldContent: toHide
+ },
+ toShow = (this.active = $([]));
+ this._toggle(toShow, toHide, data);
+ return;
+ }
+
+ // get the click target
+ var clicked = $(event.currentTarget || target);
+ var clickedIsActive = clicked[0] == this.active[0];
+
+ // TODO the option is changed, is that correct?
+ // TODO if it is correct, shouldn't that happen after determining that the click is valid?
+ o.active = o.collapsible && clickedIsActive ? false : $('.ui-accordion-header', this.element).index(clicked);
+
+ // if animations are still active, or the active header is the target, ignore click
+ if (this.running || (!o.collapsible && clickedIsActive)) {
+ return;
+ }
+
+ // switch classes
+ this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+ .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+ if (!clickedIsActive) {
+ clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top")
+ .find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected);
+ clicked.next().addClass('ui-accordion-content-active');
+ }
+
+ // find elements to show and hide
+ var toShow = clicked.next(),
+ toHide = this.active.next(),
+ data = {
+ options: o,
+ newHeader: clickedIsActive && o.collapsible ? $([]) : clicked,
+ oldHeader: this.active,
+ newContent: clickedIsActive && o.collapsible ? $([]) : toShow,
+ oldContent: toHide
+ },
+ down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+
+ this.active = clickedIsActive ? $([]) : clicked;
+ this._toggle(toShow, toHide, data, clickedIsActive, down);
+
+ return;
+
+ },
+
+ _toggle: function(toShow, toHide, data, clickedIsActive, down) {
+
+ var o = this.options, self = this;
+
+ this.toShow = toShow;
+ this.toHide = toHide;
+ this.data = data;
+
+ var complete = function() { if(!self) return; return self._completed.apply(self, arguments); };
+
+ // trigger changestart event
+ this._trigger("changestart", null, this.data);
+
+ // count elements to animate
+ this.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+
+ if (o.animated) {
+
+ var animOptions = {};
+
+ if ( o.collapsible && clickedIsActive ) {
+ animOptions = {
+ toShow: $([]),
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: o.autoHeight || o.fillSpace
+ };
+ } else {
+ animOptions = {
+ toShow: toShow,
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: o.autoHeight || o.fillSpace
+ };
+ }
+
+ if (!o.proxied) {
+ o.proxied = o.animated;
+ }
+
+ if (!o.proxiedDuration) {
+ o.proxiedDuration = o.duration;
+ }
+
+ o.animated = $.isFunction(o.proxied) ?
+ o.proxied(animOptions) : o.proxied;
+
+ o.duration = $.isFunction(o.proxiedDuration) ?
+ o.proxiedDuration(animOptions) : o.proxiedDuration;
+
+ var animations = $.ui.accordion.animations,
+ duration = o.duration,
+ easing = o.animated;
+
+ if (easing && !animations[easing] && !$.easing[easing]) {
+ easing = 'slide';
+ }
+ if (!animations[easing]) {
+ animations[easing] = function(options) {
+ this.slide(options, {
+ easing: easing,
+ duration: duration || 700
+ });
+ };
+ }
+
+ animations[easing](animOptions);
+
+ } else {
+
+ if (o.collapsible && clickedIsActive) {
+ toShow.toggle();
+ } else {
+ toHide.hide();
+ toShow.show();
+ }
+
+ complete(true);
+
+ }
+
+ // TODO assert that the blur and focus triggers are really necessary, remove otherwise
+ toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur();
+ toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus();
+
+ },
+
+ _completed: function(cancel) {
+
+ var o = this.options;
+
+ this.running = cancel ? 0 : --this.running;
+ if (this.running) return;
+
+ if (o.clearStyle) {
+ this.toShow.add(this.toHide).css({
+ height: "",
+ overflow: ""
+ });
+ }
+
+ // other classes are removed before the animation; this one needs to stay until completed
+ this.toHide.removeClass("ui-accordion-content-active");
+
+ this._trigger('change', null, this.data);
+ }
+
+});
+
+
+$.extend($.ui.accordion, {
+ version: "1.8.1",
+ animations: {
+ slide: function(options, additions) {
+ options = $.extend({
+ easing: "swing",
+ duration: 300
+ }, options, additions);
+ if ( !options.toHide.size() ) {
+ options.toShow.animate({height: "show"}, options);
+ return;
+ }
+ if ( !options.toShow.size() ) {
+ options.toHide.animate({height: "hide"}, options);
+ return;
+ }
+ var overflow = options.toShow.css('overflow'),
+ percentDone = 0,
+ showProps = {},
+ hideProps = {},
+ fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
+ originalWidth;
+ // fix width before calculating height of hidden element
+ var s = options.toShow;
+ originalWidth = s[0].style.width;
+ s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) );
+
+ $.each(fxAttrs, function(i, prop) {
+ hideProps[prop] = 'hide';
+
+ var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/);
+ showProps[prop] = {
+ value: parts[1],
+ unit: parts[2] || 'px'
+ };
+ });
+ options.toShow.css({ height: 0, overflow: 'hidden' }).show();
+ options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{
+ step: function(now, settings) {
+ // only calculate the percent when animating height
+ // IE gets very inconsistent results when animating elements
+ // with small values, which is common for padding
+ if (settings.prop == 'height') {
+ percentDone = ( settings.end - settings.start === 0 ) ? 0 :
+ (settings.now - settings.start) / (settings.end - settings.start);
+ }
+
+ options.toShow[0].style[settings.prop] =
+ (percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit;
+ },
+ duration: options.duration,
+ easing: options.easing,
+ complete: function() {
+ if ( !options.autoHeight ) {
+ options.toShow.css("height", "");
+ }
+ options.toShow.css("width", originalWidth);
+ options.toShow.css({overflow: overflow});
+ options.complete();
+ }
+ });
+ },
+ bounceslide: function(options) {
+ this.slide(options, {
+ easing: options.down ? "easeOutBounce" : "swing",
+ duration: options.down ? 1000 : 200
+ });
+ }
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Autocomplete 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function( $ ) {
+
+$.widget( "ui.autocomplete", {
+ options: {
+ minLength: 1,
+ delay: 300
+ },
+ _create: function() {
+ var self = this,
+ doc = this.element[ 0 ].ownerDocument;
+ this.element
+ .addClass( "ui-autocomplete-input" )
+ .attr( "autocomplete", "off" )
+ // TODO verify these actually work as intended
+ .attr({
+ role: "textbox",
+ "aria-autocomplete": "list",
+ "aria-haspopup": "true"
+ })
+ .bind( "keydown.autocomplete", function( event ) {
+ var keyCode = $.ui.keyCode;
+ switch( event.keyCode ) {
+ case keyCode.PAGE_UP:
+ self._move( "previousPage", event );
+ break;
+ case keyCode.PAGE_DOWN:
+ self._move( "nextPage", event );
+ break;
+ case keyCode.UP:
+ self._move( "previous", event );
+ // prevent moving cursor to beginning of text field in some browsers
+ event.preventDefault();
+ break;
+ case keyCode.DOWN:
+ self._move( "next", event );
+ // prevent moving cursor to end of text field in some browsers
+ event.preventDefault();
+ break;
+ case keyCode.ENTER:
+ // when menu is open or has focus
+ if ( self.menu.active ) {
+ event.preventDefault();
+ }
+ //passthrough - ENTER and TAB both select the current element
+ case keyCode.TAB:
+ if ( !self.menu.active ) {
+ return;
+ }
+ self.menu.select( event );
+ break;
+ case keyCode.ESCAPE:
+ self.element.val( self.term );
+ self.close( event );
+ break;
+ case keyCode.LEFT:
+ case keyCode.RIGHT:
+ case keyCode.SHIFT:
+ case keyCode.CONTROL:
+ case keyCode.ALT:
+ // ignore metakeys (shift, ctrl, alt)
+ break;
+ default:
+ // keypress is triggered before the input value is changed
+ clearTimeout( self.searching );
+ self.searching = setTimeout(function() {
+ self.search( null, event );
+ }, self.options.delay );
+ break;
+ }
+ })
+ .bind( "focus.autocomplete", function() {
+ self.selectedItem = null;
+ self.previous = self.element.val();
+ })
+ .bind( "blur.autocomplete", function( event ) {
+ clearTimeout( self.searching );
+ // clicks on the menu (or a button to trigger a search) will cause a blur event
+ // TODO try to implement this without a timeout, see clearTimeout in search()
+ self.closing = setTimeout(function() {
+ self.close( event );
+ self._change( event );
+ }, 150 );
+ });
+ this._initSource();
+ this.response = function() {
+ return self._response.apply( self, arguments );
+ };
+ this.menu = $( "<ul></ul>" )
+ .addClass( "ui-autocomplete" )
+ .appendTo( "body", doc )
+ .menu({
+ focus: function( event, ui ) {
+ var item = ui.item.data( "item.autocomplete" );
+ if ( false !== self._trigger( "focus", null, { item: item } ) ) {
+ // use value to match what will end up in the input, if it was a key event
+ if ( /^key/.test(event.originalEvent.type) ) {
+ self.element.val( item.value );
+ }
+ }
+ },
+ selected: function( event, ui ) {
+ var item = ui.item.data( "item.autocomplete" );
+ if ( false !== self._trigger( "select", event, { item: item } ) ) {
+ self.element.val( item.value );
+ }
+ self.close( event );
+ // only trigger when focus was lost (click on menu)
+ var previous = self.previous;
+ if ( self.element[0] !== doc.activeElement ) {
+ self.element.focus();
+ self.previous = previous;
+ }
+ self.selectedItem = item;
+ },
+ blur: function( event, ui ) {
+ if ( self.menu.element.is(":visible") ) {
+ self.element.val( self.term );
+ }
+ }
+ })
+ .zIndex( this.element.zIndex() + 1 )
+ // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+ .css({ top: 0, left: 0 })
+ .hide()
+ .data( "menu" );
+ if ( $.fn.bgiframe ) {
+ this.menu.element.bgiframe();
+ }
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-autocomplete-input" )
+ .removeAttr( "autocomplete" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-autocomplete" )
+ .removeAttr( "aria-haspopup" );
+ this.menu.element.remove();
+ $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "source" ) {
+ this._initSource();
+ }
+ },
+
+ _initSource: function() {
+ var array,
+ url;
+ if ( $.isArray(this.options.source) ) {
+ array = this.options.source;
+ this.source = function( request, response ) {
+ response( $.ui.autocomplete.filter(array, request.term) );
+ };
+ } else if ( typeof this.options.source === "string" ) {
+ url = this.options.source;
+ this.source = function( request, response ) {
+ $.getJSON( url, request, response );
+ };
+ } else {
+ this.source = this.options.source;
+ }
+ },
+
+ search: function( value, event ) {
+ value = value != null ? value : this.element.val();
+ if ( value.length < this.options.minLength ) {
+ return this.close( event );
+ }
+
+ clearTimeout( this.closing );
+ if ( this._trigger("search") === false ) {
+ return;
+ }
+
+ return this._search( value );
+ },
+
+ _search: function( value ) {
+ this.term = this.element
+ .addClass( "ui-autocomplete-loading" )
+ // always save the actual value, not the one passed as an argument
+ .val();
+
+ this.source( { term: value }, this.response );
+ },
+
+ _response: function( content ) {
+ if ( content.length ) {
+ content = this._normalize( content );
+ this._suggest( content );
+ this._trigger( "open" );
+ } else {
+ this.close();
+ }
+ this.element.removeClass( "ui-autocomplete-loading" );
+ },
+
+ close: function( event ) {
+ clearTimeout( this.closing );
+ if ( this.menu.element.is(":visible") ) {
+ this._trigger( "close", event );
+ this.menu.element.hide();
+ this.menu.deactivate();
+ }
+ },
+
+ _change: function( event ) {
+ if ( this.previous !== this.element.val() ) {
+ this._trigger( "change", event, { item: this.selectedItem } );
+ }
+ },
+
+ _normalize: function( items ) {
+ // assume all items have the right format when the first item is complete
+ if ( items.length && items[0].label && items[0].value ) {
+ return items;
+ }
+ return $.map( items, function(item) {
+ if ( typeof item === "string" ) {
+ return {
+ label: item,
+ value: item
+ };
+ }
+ return $.extend({
+ label: item.label || item.value,
+ value: item.value || item.label
+ }, item );
+ });
+ },
+
+ _suggest: function( items ) {
+ var ul = this.menu.element
+ .empty()
+ .zIndex( this.element.zIndex() + 1 ),
+ menuWidth,
+ textWidth;
+ this._renderMenu( ul, items );
+ // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
+ this.menu.deactivate();
+ this.menu.refresh();
+ this.menu.element.show().position({
+ my: "left top",
+ at: "left bottom",
+ of: this.element,
+ collision: "none"
+ });
+
+ menuWidth = ul.width( "" ).width();
+ textWidth = this.element.width();
+ ul.width( Math.max( menuWidth, textWidth ) );
+ },
+
+ _renderMenu: function( ul, items ) {
+ var self = this;
+ $.each( items, function( index, item ) {
+ self._renderItem( ul, item );
+ });
+ },
+
+ _renderItem: function( ul, item) {
+ return $( "<li></li>" )
+ .data( "item.autocomplete", item )
+ .append( "<a>" + item.label + "</a>" )
+ .appendTo( ul );
+ },
+
+ _move: function( direction, event ) {
+ if ( !this.menu.element.is(":visible") ) {
+ this.search( null, event );
+ return;
+ }
+ if ( this.menu.first() && /^previous/.test(direction) ||
+ this.menu.last() && /^next/.test(direction) ) {
+ this.element.val( this.term );
+ this.menu.deactivate();
+ return;
+ }
+ this.menu[ direction ]( event );
+ },
+
+ widget: function() {
+ return this.menu.element;
+ }
+});
+
+$.extend( $.ui.autocomplete, {
+ escapeRegex: function( value ) {
+ return value.replace( /([\^\$\(\)\[\]\{\}\*\.\+\?\|\\])/gi, "\\$1" );
+ },
+ filter: function(array, term) {
+ var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
+ return $.grep( array, function(value) {
+ return matcher.test( value.label || value.value || value );
+ });
+ }
+});
+
+}( jQuery ));
+
+/*
+ * jQuery UI Menu (not officially released)
+ *
+ * This widget isn't yet finished and the API is subject to change. We plan to finish
+ * it for the next release. You're welcome to give it a try anyway and give us feedback,
+ * as long as you're okay with migrating your code later on. We can help with that, too.
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Menu
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.menu", {
+ _create: function() {
+ var self = this;
+ this.element
+ .addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
+ .attr({
+ role: "listbox",
+ "aria-activedescendant": "ui-active-menuitem"
+ })
+ .click(function( event ) {
+ if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) {
+ return;
+ }
+ // temporary
+ event.preventDefault();
+ self.select( event );
+ });
+ this.refresh();
+ },
+
+ refresh: function() {
+ var self = this;
+
+ // don't refresh list items that are already adapted
+ var items = this.element.children("li:not(.ui-menu-item):has(a)")
+ .addClass("ui-menu-item")
+ .attr("role", "menuitem");
+
+ items.children("a")
+ .addClass("ui-corner-all")
+ .attr("tabindex", -1)
+ // mouseenter doesn't work with event delegation
+ .mouseenter(function( event ) {
+ self.activate( event, $(this).parent() );
+ })
+ .mouseleave(function() {
+ self.deactivate();
+ });
+ },
+
+ activate: function( event, item ) {
+ this.deactivate();
+ if (this.hasScroll()) {
+ var offset = item.offset().top - this.element.offset().top,
+ scroll = this.element.attr("scrollTop"),
+ elementHeight = this.element.height();
+ if (offset < 0) {
+ this.element.attr("scrollTop", scroll + offset);
+ } else if (offset > elementHeight) {
+ this.element.attr("scrollTop", scroll + offset - elementHeight + item.height());
+ }
+ }
+ this.active = item.eq(0)
+ .children("a")
+ .addClass("ui-state-hover")
+ .attr("id", "ui-active-menuitem")
+ .end();
+ this._trigger("focus", event, { item: item });
+ },
+
+ deactivate: function() {
+ if (!this.active) { return; }
+
+ this.active.children("a")
+ .removeClass("ui-state-hover")
+ .removeAttr("id");
+ this._trigger("blur");
+ this.active = null;
+ },
+
+ next: function(event) {
+ this.move("next", ".ui-menu-item:first", event);
+ },
+
+ previous: function(event) {
+ this.move("prev", ".ui-menu-item:last", event);
+ },
+
+ first: function() {
+ return this.active && !this.active.prev().length;
+ },
+
+ last: function() {
+ return this.active && !this.active.next().length;
+ },
+
+ move: function(direction, edge, event) {
+ if (!this.active) {
+ this.activate(event, this.element.children(edge));
+ return;
+ }
+ var next = this.active[direction + "All"](".ui-menu-item").eq(0);
+ if (next.length) {
+ this.activate(event, next);
+ } else {
+ this.activate(event, this.element.children(edge));
+ }
+ },
+
+ // TODO merge with previousPage
+ nextPage: function(event) {
+ if (this.hasScroll()) {
+ // TODO merge with no-scroll-else
+ if (!this.active || this.last()) {
+ this.activate(event, this.element.children(":first"));
+ return;
+ }
+ var base = this.active.offset().top,
+ height = this.element.height(),
+ result = this.element.children("li").filter(function() {
+ var close = $(this).offset().top - base - height + $(this).height();
+ // TODO improve approximation
+ return close < 10 && close > -10;
+ });
+
+ // TODO try to catch this earlier when scrollTop indicates the last page anyway
+ if (!result.length) {
+ result = this.element.children(":last");
+ }
+ this.activate(event, result);
+ } else {
+ this.activate(event, this.element.children(!this.active || this.last() ? ":first" : ":last"));
+ }
+ },
+
+ // TODO merge with nextPage
+ previousPage: function(event) {
+ if (this.hasScroll()) {
+ // TODO merge with no-scroll-else
+ if (!this.active || this.first()) {
+ this.activate(event, this.element.children(":last"));
+ return;
+ }
+
+ var base = this.active.offset().top,
+ height = this.element.height();
+ result = this.element.children("li").filter(function() {
+ var close = $(this).offset().top - base + height - $(this).height();
+ // TODO improve approximation
+ return close < 10 && close > -10;
+ });
+
+ // TODO try to catch this earlier when scrollTop indicates the last page anyway
+ if (!result.length) {
+ result = this.element.children(":first");
+ }
+ this.activate(event, result);
+ } else {
+ this.activate(event, this.element.children(!this.active || this.first() ? ":last" : ":first"));
+ }
+ },
+
+ hasScroll: function() {
+ return this.element.height() < this.element.attr("scrollHeight");
+ },
+
+ select: function( event ) {
+ this._trigger("selected", event, { item: this.active });
+ }
+});
+
+}(jQuery));
+/*
+ * jQuery UI Button 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $ ) {
+
+var lastActive,
+ baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
+ otherClasses = "ui-state-hover ui-state-active " +
+ "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon ui-button-text-only",
+ formResetHandler = function( event ) {
+ $( ":ui-button", event.target.form ).each(function() {
+ var inst = $( this ).data( "button" );
+ setTimeout(function() {
+ inst.refresh();
+ }, 1 );
+ });
+ },
+ radioGroup = function( radio ) {
+ var name = radio.name,
+ form = radio.form,
+ radios = $( [] );
+ if ( name ) {
+ if ( form ) {
+ radios = $( form ).find( "[name='" + name + "']" );
+ } else {
+ radios = $( "[name='" + name + "']", radio.ownerDocument )
+ .filter(function() {
+ return !this.form;
+ });
+ }
+ }
+ return radios;
+ };
+
+$.widget( "ui.button", {
+ options: {
+ text: true,
+ label: null,
+ icons: {
+ primary: null,
+ secondary: null
+ }
+ },
+ _create: function() {
+ this.element.closest( "form" )
+ .unbind( "reset.button" )
+ .bind( "reset.button", formResetHandler );
+
+ this._determineButtonType();
+ this.hasTitle = !!this.buttonElement.attr( "title" );
+
+ var self = this,
+ options = this.options,
+ toggleButton = this.type === "checkbox" || this.type === "radio",
+ hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ),
+ focusClass = "ui-state-focus";
+
+ if ( options.label === null ) {
+ options.label = this.buttonElement.html();
+ }
+
+ if ( this.element.is( ":disabled" ) ) {
+ options.disabled = true;
+ }
+
+ this.buttonElement
+ .addClass( baseClasses )
+ .attr( "role", "button" )
+ .bind( "mouseenter.button", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).addClass( "ui-state-hover" );
+ if ( this === lastActive ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "mouseleave.button", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).removeClass( hoverClass );
+ })
+ .bind( "focus.button", function() {
+ // no need to check disabled, focus won't be triggered anyway
+ $( this ).addClass( focusClass );
+ })
+ .bind( "blur.button", function() {
+ $( this ).removeClass( focusClass );
+ });
+
+ if ( toggleButton ) {
+ this.element.bind( "change.button", function() {
+ self.refresh();
+ });
+ }
+
+ if ( this.type === "checkbox" ) {
+ this.buttonElement.bind( "click.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).toggleClass( "ui-state-active" );
+ self.buttonElement.attr( "aria-pressed", self.element[0].checked );
+ });
+ } else if ( this.type === "radio" ) {
+ this.buttonElement.bind( "click.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ self.buttonElement.attr( "aria-pressed", true );
+
+ var radio = self.element[ 0 ];
+ radioGroup( radio )
+ .not( radio )
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ });
+ } else {
+ this.buttonElement
+ .bind( "mousedown.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ lastActive = this;
+ $( document ).one( "mouseup", function() {
+ lastActive = null;
+ });
+ })
+ .bind( "mouseup.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).removeClass( "ui-state-active" );
+ })
+ .bind( "keydown.button", function(event) {
+ if ( options.disabled ) {
+ return false;
+ }
+ if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "keyup.button", function() {
+ $( this ).removeClass( "ui-state-active" );
+ });
+
+ if ( this.buttonElement.is("a") ) {
+ this.buttonElement.keyup(function(event) {
+ if ( event.keyCode === $.ui.keyCode.SPACE ) {
+ // TODO pass through original event correctly (just as 2nd argument doesn't work)
+ $( this ).click();
+ }
+ });
+ }
+ }
+
+ // TODO: pull out $.Widget's handling for the disabled option into
+ // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
+ // be overridden by individual plugins
+ this._setOption( "disabled", options.disabled );
+ },
+
+ _determineButtonType: function() {
+
+ if ( this.element.is(":checkbox") ) {
+ this.type = "checkbox";
+ } else {
+ if ( this.element.is(":radio") ) {
+ this.type = "radio";
+ } else {
+ if ( this.element.is("input") ) {
+ this.type = "input";
+ } else {
+ this.type = "button";
+ }
+ }
+ }
+
+ if ( this.type === "checkbox" || this.type === "radio" ) {
+ // we don't search against the document in case the element
+ // is disconnected from the DOM
+ this.buttonElement = this.element.parents().last()
+ .find( "[for=" + this.element.attr("id") + "]" );
+ this.element.addClass( "ui-helper-hidden-accessible" );
+
+ var checked = this.element.is( ":checked" );
+ if ( checked ) {
+ this.buttonElement.addClass( "ui-state-active" );
+ }
+ this.buttonElement.attr( "aria-pressed", checked );
+ } else {
+ this.buttonElement = this.element;
+ }
+ },
+
+ widget: function() {
+ return this.buttonElement;
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-helper-hidden-accessible" );
+ this.buttonElement
+ .removeClass( baseClasses + " " + otherClasses )
+ .removeAttr( "role" )
+ .removeAttr( "aria-pressed" )
+ .html( this.buttonElement.find(".ui-button-text").html() );
+
+ if ( !this.hasTitle ) {
+ this.buttonElement.removeAttr( "title" );
+ }
+
+ $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key, value ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "disabled" ) {
+ if ( value ) {
+ this.element.attr( "disabled", true );
+ } else {
+ this.element.removeAttr( "disabled" );
+ }
+ }
+ this._resetButton();
+ },
+
+ refresh: function() {
+ var isDisabled = this.element.is( ":disabled" );
+ if ( isDisabled !== this.options.disabled ) {
+ this._setOption( "disabled", isDisabled );
+ }
+ if ( this.type === "radio" ) {
+ radioGroup( this.element[0] ).each(function() {
+ if ( $( this ).is( ":checked" ) ) {
+ $( this ).button( "widget" )
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", true );
+ } else {
+ $( this ).button( "widget" )
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ }
+ });
+ } else if ( this.type === "checkbox" ) {
+ if ( this.element.is( ":checked" ) ) {
+ this.buttonElement
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", true );
+ } else {
+ this.buttonElement
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ }
+ }
+ },
+
+ _resetButton: function() {
+ if ( this.type === "input" ) {
+ if ( this.options.label ) {
+ this.element.val( this.options.label );
+ }
+ return;
+ }
+ var buttonElement = this.buttonElement,
+ buttonText = $( "<span></span>" )
+ .addClass( "ui-button-text" )
+ .html( this.options.label )
+ .appendTo( buttonElement.empty() )
+ .text(),
+ icons = this.options.icons,
+ multipleIcons = icons.primary && icons.secondary;
+ if ( icons.primary || icons.secondary ) {
+ buttonElement.addClass( "ui-button-text-icon" +
+ ( multipleIcons ? "s" : "" ) );
+ if ( icons.primary ) {
+ buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
+ }
+ if ( icons.secondary ) {
+ buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );
+ }
+ if ( !this.options.text ) {
+ buttonElement
+ .addClass( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" )
+ .removeClass( "ui-button-text-icons ui-button-text-icon" );
+ if ( !this.hasTitle ) {
+ buttonElement.attr( "title", buttonText );
+ }
+ }
+ } else {
+ buttonElement.addClass( "ui-button-text-only" );
+ }
+ }
+});
+
+$.widget( "ui.buttonset", {
+ _create: function() {
+ this.element.addClass( "ui-buttonset" );
+ this._init();
+ },
+
+ _init: function() {
+ this.refresh();
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "disabled" ) {
+ this.buttons.button( "option", key, value );
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+ },
+
+ refresh: function() {
+ this.buttons = this.element.find( ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" )
+ .filter( ":ui-button" )
+ .button( "refresh" )
+ .end()
+ .not( ":ui-button" )
+ .button()
+ .end()
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
+ .filter( ":first" )
+ .addClass( "ui-corner-left" )
+ .end()
+ .filter( ":last" )
+ .addClass( "ui-corner-right" )
+ .end()
+ .end();
+ },
+
+ destroy: function() {
+ this.element.removeClass( "ui-buttonset" );
+ this.buttons
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-left ui-corner-right" )
+ .end()
+ .button( "destroy" )
+
+ $.Widget.prototype.destroy.call( this );
+ }
+});
+
+}( jQuery ) );
+/*
+ * jQuery UI Dialog 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.button.js
+ * jquery.ui.draggable.js
+ * jquery.ui.mouse.js
+ * jquery.ui.position.js
+ * jquery.ui.resizable.js
+ */
+(function($) {
+
+var uiDialogClasses =
+ 'ui-dialog ' +
+ 'ui-widget ' +
+ 'ui-widget-content ' +
+ 'ui-corner-all ';
+
+$.widget("ui.dialog", {
+ options: {
+ autoOpen: true,
+ buttons: {},
+ closeOnEscape: true,
+ closeText: 'close',
+ dialogClass: '',
+ draggable: true,
+ hide: null,
+ height: 'auto',
+ maxHeight: false,
+ maxWidth: false,
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: 'center',
+ resizable: true,
+ show: null,
+ stack: true,
+ title: '',
+ width: 300,
+ zIndex: 1000
+ },
+ _create: function() {
+ this.originalTitle = this.element.attr('title');
+
+ var self = this,
+ options = self.options,
+
+ title = options.title || self.originalTitle || ' ',
+ titleId = $.ui.dialog.getTitleId(self.element),
+
+ uiDialog = (self.uiDialog = $('<div></div>'))
+ .appendTo(document.body)
+ .hide()
+ .addClass(uiDialogClasses + options.dialogClass)
+ .css({
+ zIndex: options.zIndex
+ })
+ // setting tabIndex makes the div focusable
+ // setting outline to 0 prevents a border on focus in Mozilla
+ .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+ if (options.closeOnEscape && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+
+ self.close(event);
+ event.preventDefault();
+ }
+ })
+ .attr({
+ role: 'dialog',
+ 'aria-labelledby': titleId
+ })
+ .mousedown(function(event) {
+ self.moveToTop(false, event);
+ }),
+
+ uiDialogContent = self.element
+ .show()
+ .removeAttr('title')
+ .addClass(
+ 'ui-dialog-content ' +
+ 'ui-widget-content')
+ .appendTo(uiDialog),
+
+ uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
+ .addClass(
+ 'ui-dialog-titlebar ' +
+ 'ui-widget-header ' +
+ 'ui-corner-all ' +
+ 'ui-helper-clearfix'
+ )
+ .prependTo(uiDialog),
+
+ uiDialogTitlebarClose = $('<a href="#"></a>')
+ .addClass(
+ 'ui-dialog-titlebar-close ' +
+ 'ui-corner-all'
+ )
+ .attr('role', 'button')
+ .hover(
+ function() {
+ uiDialogTitlebarClose.addClass('ui-state-hover');
+ },
+ function() {
+ uiDialogTitlebarClose.removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ uiDialogTitlebarClose.addClass('ui-state-focus');
+ })
+ .blur(function() {
+ uiDialogTitlebarClose.removeClass('ui-state-focus');
+ })
+ .click(function(event) {
+ self.close(event);
+ return false;
+ })
+ .appendTo(uiDialogTitlebar),
+
+ uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
+ .addClass(
+ 'ui-icon ' +
+ 'ui-icon-closethick'
+ )
+ .text(options.closeText)
+ .appendTo(uiDialogTitlebarClose),
+
+ uiDialogTitle = $('<span></span>')
+ .addClass('ui-dialog-title')
+ .attr('id', titleId)
+ .html(title)
+ .prependTo(uiDialogTitlebar);
+
+ //handling of deprecated beforeclose (vs beforeClose) option
+ //Ticket #4669 http://dev.jqueryui.com/ticket/4669
+ //TODO: remove in 1.9pre
+ if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) {
+ options.beforeClose = options.beforeclose;
+ }
+
+ uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+ if (options.draggable && $.fn.draggable) {
+ self._makeDraggable();
+ }
+ if (options.resizable && $.fn.resizable) {
+ self._makeResizable();
+ }
+
+ self._createButtons(options.buttons);
+ self._isOpen = false;
+
+ if ($.fn.bgiframe) {
+ uiDialog.bgiframe();
+ }
+ },
+ _init: function() {
+ if ( this.options.autoOpen ) {
+ this.open();
+ }
+ },
+
+ destroy: function() {
+ var self = this;
+
+ if (self.overlay) {
+ self.overlay.destroy();
+ }
+ self.uiDialog.hide();
+ self.element
+ .unbind('.dialog')
+ .removeData('dialog')
+ .removeClass('ui-dialog-content ui-widget-content')
+ .hide().appendTo('body');
+ self.uiDialog.remove();
+
+ if (self.originalTitle) {
+ self.element.attr('title', self.originalTitle);
+ }
+
+ return self;
+ },
+
+ widget: function() {
+ return this.uiDialog;
+ },
+
+ close: function(event) {
+ var self = this,
+ maxZ;
+
+ if (false === self._trigger('beforeClose', event)) {
+ return;
+ }
+
+ if (self.overlay) {
+ self.overlay.destroy();
+ }
+ self.uiDialog.unbind('keypress.ui-dialog');
+
+ self._isOpen = false;
+
+ if (self.options.hide) {
+ self.uiDialog.hide(self.options.hide, function() {
+ self._trigger('close', event);
+ });
+ } else {
+ self.uiDialog.hide();
+ self._trigger('close', event);
+ }
+
+ $.ui.dialog.overlay.resize();
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ if (self.options.modal) {
+ maxZ = 0;
+ $('.ui-dialog').each(function() {
+ if (this !== self.uiDialog[0]) {
+ maxZ = Math.max(maxZ, $(this).css('z-index'));
+ }
+ });
+ $.ui.dialog.maxZ = maxZ;
+ }
+
+ return self;
+ },
+
+ isOpen: function() {
+ return this._isOpen;
+ },
+
+ // the force parameter allows us to move modal dialogs to their correct
+ // position on open
+ moveToTop: function(force, event) {
+ var self = this,
+ options = self.options,
+ saveScroll;
+
+ if ((options.modal && !force) ||
+ (!options.stack && !options.modal)) {
+ return self._trigger('focus', event);
+ }
+
+ if (options.zIndex > $.ui.dialog.maxZ) {
+ $.ui.dialog.maxZ = options.zIndex;
+ }
+ if (self.overlay) {
+ $.ui.dialog.maxZ += 1;
+ self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ);
+ }
+
+ //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+ // http://ui.jquery.com/bugs/ticket/3193
+ saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') };
+ $.ui.dialog.maxZ += 1;
+ self.uiDialog.css('z-index', $.ui.dialog.maxZ);
+ self.element.attr(saveScroll);
+ self._trigger('focus', event);
+
+ return self;
+ },
+
+ open: function() {
+ if (this._isOpen) { return; }
+
+ var self = this,
+ options = self.options,
+ uiDialog = self.uiDialog;
+
+ self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
+ if (uiDialog.next().length) {
+ uiDialog.appendTo('body');
+ }
+ self._size();
+ self._position(options.position);
+ uiDialog.show(options.show);
+ self.moveToTop(true);
+
+ // prevent tabbing out of modal dialogs
+ if (options.modal) {
+ uiDialog.bind('keypress.ui-dialog', function(event) {
+ if (event.keyCode !== $.ui.keyCode.TAB) {
+ return;
+ }
+
+ var tabbables = $(':tabbable', this),
+ first = tabbables.filter(':first'),
+ last = tabbables.filter(':last');
+
+ if (event.target === last[0] && !event.shiftKey) {
+ first.focus(1);
+ return false;
+ } else if (event.target === first[0] && event.shiftKey) {
+ last.focus(1);
+ return false;
+ }
+ });
+ }
+
+ // set focus to the first tabbable element in the content area or the first button
+ // if there are no tabbable elements, set focus on the dialog itself
+ $([])
+ .add(uiDialog.find('.ui-dialog-content :tabbable:first'))
+ .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
+ .add(uiDialog)
+ .filter(':first')
+ .focus();
+
+ self._trigger('open');
+ self._isOpen = true;
+
+ return self;
+ },
+
+ _createButtons: function(buttons) {
+ var self = this,
+ hasButtons = false,
+ uiDialogButtonPane = $('<div></div>')
+ .addClass(
+ 'ui-dialog-buttonpane ' +
+ 'ui-widget-content ' +
+ 'ui-helper-clearfix'
+ );
+
+ // if we already have a button pane, remove it
+ self.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+ if (typeof buttons === 'object' && buttons !== null) {
+ $.each(buttons, function() {
+ return !(hasButtons = true);
+ });
+ }
+ if (hasButtons) {
+ $.each(buttons, function(name, fn) {
+ var button = $('<button type="button"></button>')
+ .text(name)
+ .click(function() { fn.apply(self.element[0], arguments); })
+ .appendTo(uiDialogButtonPane);
+ if ($.fn.button) {
+ button.button();
+ }
+ });
+ uiDialogButtonPane.appendTo(self.uiDialog);
+ }
+ },
+
+ _makeDraggable: function() {
+ var self = this,
+ options = self.options,
+ doc = $(document),
+ heightBeforeDrag;
+
+ function filteredUi(ui) {
+ return {
+ position: ui.position,
+ offset: ui.offset
+ };
+ }
+
+ self.uiDialog.draggable({
+ cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
+ handle: '.ui-dialog-titlebar',
+ containment: 'document',
+ start: function(event, ui) {
+ heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height();
+ $(this).height($(this).height()).addClass("ui-dialog-dragging");
+ self._trigger('dragStart', event, filteredUi(ui));
+ },
+ drag: function(event, ui) {
+ self._trigger('drag', event, filteredUi(ui));
+ },
+ stop: function(event, ui) {
+ options.position = [ui.position.left - doc.scrollLeft(),
+ ui.position.top - doc.scrollTop()];
+ $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
+ self._trigger('dragStop', event, filteredUi(ui));
+ $.ui.dialog.overlay.resize();
+ }
+ });
+ },
+
+ _makeResizable: function(handles) {
+ handles = (handles === undefined ? this.options.resizable : handles);
+ var self = this,
+ options = self.options,
+ // .ui-resizable has position: relative defined in the stylesheet
+ // but dialogs have to use absolute or fixed positioning
+ position = self.uiDialog.css('position'),
+ resizeHandles = (typeof handles === 'string' ?
+ handles :
+ 'n,e,s,w,se,sw,ne,nw'
+ );
+
+ function filteredUi(ui) {
+ return {
+ originalPosition: ui.originalPosition,
+ originalSize: ui.originalSize,
+ position: ui.position,
+ size: ui.size
+ };
+ }
+
+ self.uiDialog.resizable({
+ cancel: '.ui-dialog-content',
+ containment: 'document',
+ alsoResize: self.element,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: self._minHeight(),
+ handles: resizeHandles,
+ start: function(event, ui) {
+ $(this).addClass("ui-dialog-resizing");
+ self._trigger('resizeStart', event, filteredUi(ui));
+ },
+ resize: function(event, ui) {
+ self._trigger('resize', event, filteredUi(ui));
+ },
+ stop: function(event, ui) {
+ $(this).removeClass("ui-dialog-resizing");
+ options.height = $(this).height();
+ options.width = $(this).width();
+ self._trigger('resizeStop', event, filteredUi(ui));
+ $.ui.dialog.overlay.resize();
+ }
+ })
+ .css('position', position)
+ .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+ },
+
+ _minHeight: function() {
+ var options = this.options;
+
+ if (options.height === 'auto') {
+ return options.minHeight;
+ } else {
+ return Math.min(options.minHeight, options.height);
+ }
+ },
+
+ _position: function(position) {
+ var myAt = [],
+ offset = [0, 0],
+ isVisible;
+
+ position = position || $.ui.dialog.prototype.options.position;
+
+ // deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
+// if (typeof position == 'string' || $.isArray(position)) {
+// myAt = $.isArray(position) ? position : position.split(' ');
+
+ if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) {
+ myAt = position.split ? position.split(' ') : [position[0], position[1]];
+ if (myAt.length === 1) {
+ myAt[1] = myAt[0];
+ }
+
+ $.each(['left', 'top'], function(i, offsetPosition) {
+ if (+myAt[i] === myAt[i]) {
+ offset[i] = myAt[i];
+ myAt[i] = offsetPosition;
+ }
+ });
+ } else if (typeof position === 'object') {
+ if ('left' in position) {
+ myAt[0] = 'left';
+ offset[0] = position.left;
+ } else if ('right' in position) {
+ myAt[0] = 'right';
+ offset[0] = -position.right;
+ }
+
+ if ('top' in position) {
+ myAt[1] = 'top';
+ offset[1] = position.top;
+ } else if ('bottom' in position) {
+ myAt[1] = 'bottom';
+ offset[1] = -position.bottom;
+ }
+ }
+
+ // need to show the dialog to get the actual offset in the position plugin
+ isVisible = this.uiDialog.is(':visible');
+ if (!isVisible) {
+ this.uiDialog.show();
+ }
+ this.uiDialog
+ // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+ .css({ top: 0, left: 0 })
+ .position({
+ my: myAt.join(' '),
+ at: myAt.join(' '),
+ offset: offset.join(' '),
+ of: window,
+ collision: 'fit',
+ // ensure that the titlebar is never outside the document
+ using: function(pos) {
+ var topOffset = $(this).css(pos).offset().top;
+ if (topOffset < 0) {
+ $(this).css('top', pos.top - topOffset);
+ }
+ }
+ });
+ if (!isVisible) {
+ this.uiDialog.hide();
+ }
+ },
+
+ _setOption: function(key, value){
+ var self = this,
+ uiDialog = self.uiDialog,
+ isResizable = uiDialog.is(':data(resizable)'),
+ resize = false;
+
+ switch (key) {
+ //handling of deprecated beforeclose (vs beforeClose) option
+ //Ticket #4669 http://dev.jqueryui.com/ticket/4669
+ //TODO: remove in 1.9pre
+ case "beforeclose":
+ key = "beforeClose";
+ break;
+ case "buttons":
+ self._createButtons(value);
+ break;
+ case "closeText":
+ // convert whatever was passed in to a string, for text() to not throw up
+ self.uiDialogTitlebarCloseText.text("" + value);
+ break;
+ case "dialogClass":
+ uiDialog
+ .removeClass(self.options.dialogClass)
+ .addClass(uiDialogClasses + value);
+ break;
+ case "disabled":
+ if (value) {
+ uiDialog.addClass('ui-dialog-disabled');
+ } else {
+ uiDialog.removeClass('ui-dialog-disabled');
+ }
+ break;
+ case "draggable":
+ if (value) {
+ self._makeDraggable();
+ } else {
+ uiDialog.draggable('destroy');
+ }
+ break;
+ case "height":
+ resize = true;
+ break;
+ case "maxHeight":
+ if (isResizable) {
+ uiDialog.resizable('option', 'maxHeight', value);
+ }
+ resize = true;
+ break;
+ case "maxWidth":
+ if (isResizable) {
+ uiDialog.resizable('option', 'maxWidth', value);
+ }
+ resize = true;
+ break;
+ case "minHeight":
+ if (isResizable) {
+ uiDialog.resizable('option', 'minHeight', value);
+ }
+ resize = true;
+ break;
+ case "minWidth":
+ if (isResizable) {
+ uiDialog.resizable('option', 'minWidth', value);
+ }
+ resize = true;
+ break;
+ case "position":
+ self._position(value);
+ break;
+ case "resizable":
+ // currently resizable, becoming non-resizable
+ if (isResizable && !value) {
+ uiDialog.resizable('destroy');
+ }
+
+ // currently resizable, changing handles
+ if (isResizable && typeof value === 'string') {
+ uiDialog.resizable('option', 'handles', value);
+ }
+
+ // currently non-resizable, becoming resizable
+ if (!isResizable && value !== false) {
+ self._makeResizable(value);
+ }
+ break;
+ case "title":
+ // convert whatever was passed in o a string, for html() to not throw up
+ $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' '));
+ break;
+ case "width":
+ resize = true;
+ break;
+ }
+
+ $.Widget.prototype._setOption.apply(self, arguments);
+ if (resize) {
+ self._size();
+ }
+ },
+
+ _size: function() {
+ /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ * divs will both have width and height set, so we need to reset them
+ */
+ var options = this.options,
+ nonContentHeight;
+
+ // reset content sizing
+ // hide for non content measurement because height: 0 doesn't work in IE quirks mode (see #4350)
+ this.element.css({
+ width: 'auto',
+ minHeight: 0,
+ height: 0
+ });
+
+ // reset wrapper sizing
+ // determine the height of all the non-content elements
+ nonContentHeight = this.uiDialog.css({
+ height: 'auto',
+ width: options.width
+ })
+ .height();
+
+ this.element
+ .css(options.height === 'auto' ? {
+ minHeight: Math.max(options.minHeight - nonContentHeight, 0),
+ height: 'auto'
+ } : {
+ minHeight: 0,
+ height: Math.max(options.height - nonContentHeight, 0)
+ })
+ .show();
+
+ if (this.uiDialog.is(':data(resizable)')) {
+ this.uiDialog.resizable('option', 'minHeight', this._minHeight());
+ }
+ }
+});
+
+$.extend($.ui.dialog, {
+ version: "1.8.1",
+
+ uuid: 0,
+ maxZ: 0,
+
+ getTitleId: function($el) {
+ var id = $el.attr('id');
+ if (!id) {
+ this.uuid += 1;
+ id = this.uuid;
+ }
+ return 'ui-dialog-title-' + id;
+ },
+
+ overlay: function(dialog) {
+ this.$el = $.ui.dialog.overlay.create(dialog);
+ }
+});
+
+$.extend($.ui.dialog.overlay, {
+ instances: [],
+ // reuse old instances due to IE memory leak with alpha transparency (see #5185)
+ oldInstances: [],
+ maxZ: 0,
+ events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+ function(event) { return event + '.dialog-overlay'; }).join(' '),
+ create: function(dialog) {
+ if (this.instances.length === 0) {
+ // prevent use of anchors and inputs
+ // we use a setTimeout in case the overlay is created from an
+ // event that we're going to be cancelling (see #2804)
+ setTimeout(function() {
+ // handle $(el).dialog().dialog('close') (see #4065)
+ if ($.ui.dialog.overlay.instances.length) {
+ $(document).bind($.ui.dialog.overlay.events, function(event) {
+ // stop events if the z-index of the target is < the z-index of the overlay
+ return ($(event.target).zIndex() >= $.ui.dialog.overlay.maxZ);
+ });
+ }
+ }, 1);
+
+ // allow closing by pressing the escape key
+ $(document).bind('keydown.dialog-overlay', function(event) {
+ if (dialog.options.closeOnEscape && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+
+ dialog.close(event);
+ event.preventDefault();
+ }
+ });
+
+ // handle window resize
+ $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+ }
+
+ var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay'))
+ .appendTo(document.body)
+ .css({
+ width: this.width(),
+ height: this.height()
+ });
+
+ if ($.fn.bgiframe) {
+ $el.bgiframe();
+ }
+
+ this.instances.push($el);
+ return $el;
+ },
+
+ destroy: function($el) {
+ this.oldInstances.push(this.instances.splice($.inArray($el, this.instances), 1)[0]);
+
+ if (this.instances.length === 0) {
+ $([document, window]).unbind('.dialog-overlay');
+ }
+
+ $el.remove();
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ var maxZ = 0;
+ $.each(this.instances, function() {
+ maxZ = Math.max(maxZ, this.css('z-index'));
+ });
+ this.maxZ = maxZ;
+ },
+
+ height: function() {
+ var scrollHeight,
+ offsetHeight;
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ scrollHeight = Math.max(
+ document.documentElement.scrollHeight,
+ document.body.scrollHeight
+ );
+ offsetHeight = Math.max(
+ document.documentElement.offsetHeight,
+ document.body.offsetHeight
+ );
+
+ if (scrollHeight < offsetHeight) {
+ return $(window).height() + 'px';
+ } else {
+ return scrollHeight + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).height() + 'px';
+ }
+ },
+
+ width: function() {
+ var scrollWidth,
+ offsetWidth;
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ scrollWidth = Math.max(
+ document.documentElement.scrollWidth,
+ document.body.scrollWidth
+ );
+ offsetWidth = Math.max(
+ document.documentElement.offsetWidth,
+ document.body.offsetWidth
+ );
+
+ if (scrollWidth < offsetWidth) {
+ return $(window).width() + 'px';
+ } else {
+ return scrollWidth + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).width() + 'px';
+ }
+ },
+
+ resize: function() {
+ /* If the dialog is draggable and the user drags it past the
+ * right edge of the window, the document becomes wider so we
+ * need to stretch the overlay. If the user then drags the
+ * dialog back to the left, the document will become narrower,
+ * so we need to shrink the overlay to the appropriate size.
+ * This is handled by shrinking the overlay before setting it
+ * to the full document size.
+ */
+ var $overlays = $([]);
+ $.each($.ui.dialog.overlay.instances, function() {
+ $overlays = $overlays.add(this);
+ });
+
+ $overlays.css({
+ width: 0,
+ height: 0
+ }).css({
+ width: $.ui.dialog.overlay.width(),
+ height: $.ui.dialog.overlay.height()
+ });
+ }
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+ destroy: function() {
+ $.ui.dialog.overlay.destroy(this.$el);
+ }
+});
+
+}(jQuery));
+/*
+ * jQuery UI Slider 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+
+(function( $ ) {
+
+// number of pages in a slider
+// (how many times can you page up/down to go through the whole range)
+var numPages = 5;
+
+$.widget( "ui.slider", $.ui.mouse, {
+
+ widgetEventPrefix: "slide",
+
+ options: {
+ animate: false,
+ distance: 0,
+ max: 100,
+ min: 0,
+ orientation: "horizontal",
+ range: false,
+ step: 1,
+ value: 0,
+ values: null
+ },
+
+ _create: function() {
+ var self = this,
+ o = this.options;
+
+ this._keySliding = false;
+ this._mouseSliding = false;
+ this._animateOff = true;
+ this._handleIndex = null;
+ this._detectOrientation();
+ this._mouseInit();
+
+ this.element
+ .addClass( "ui-slider" +
+ " ui-slider-" + this.orientation +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all" );
+
+ if ( o.disabled ) {
+ this.element.addClass( "ui-slider-disabled ui-disabled" );
+ }
+
+ this.range = $([]);
+
+ if ( o.range ) {
+ if ( o.range === true ) {
+ this.range = $( "<div></div>" );
+ if ( !o.values ) {
+ o.values = [ this._valueMin(), this._valueMin() ];
+ }
+ if ( o.values.length && o.values.length !== 2 ) {
+ o.values = [ o.values[0], o.values[0] ];
+ }
+ } else {
+ this.range = $( "<div></div>" );
+ }
+
+ this.range
+ .appendTo( this.element )
+ .addClass( "ui-slider-range" );
+
+ if ( o.range === "min" || o.range === "max" ) {
+ this.range.addClass( "ui-slider-range-" + o.range );
+ }
+
+ // note: this isn't the most fittingly semantic framework class for this element,
+ // but worked best visually with a variety of themes
+ this.range.addClass( "ui-widget-header" );
+ }
+
+ if ( $( ".ui-slider-handle", this.element ).length === 0 ) {
+ $( "<a href='#'></a>" )
+ .appendTo( this.element )
+ .addClass( "ui-slider-handle" );
+ }
+
+ if ( o.values && o.values.length ) {
+ while ( $(".ui-slider-handle", this.element).length < o.values.length ) {
+ $( "<a href='#'></a>" )
+ .appendTo( this.element )
+ .addClass( "ui-slider-handle" );
+ }
+ }
+
+ this.handles = $( ".ui-slider-handle", this.element )
+ .addClass( "ui-state-default" +
+ " ui-corner-all" );
+
+ this.handle = this.handles.eq( 0 );
+
+ this.handles.add( this.range ).filter( "a" )
+ .click(function( event ) {
+ event.preventDefault();
+ })
+ .hover(function() {
+ if ( !o.disabled ) {
+ $( this ).addClass( "ui-state-hover" );
+ }
+ }, function() {
+ $( this ).removeClass( "ui-state-hover" );
+ })
+ .focus(function() {
+ if ( !o.disabled ) {
+ $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" );
+ $( this ).addClass( "ui-state-focus" );
+ } else {
+ $( this ).blur();
+ }
+ })
+ .blur(function() {
+ $( this ).removeClass( "ui-state-focus" );
+ });
+
+ this.handles.each(function( i ) {
+ $( this ).data( "index.ui-slider-handle", i );
+ });
+
+ this.handles
+ .keydown(function( event ) {
+ var ret = true,
+ index = $( this ).data( "index.ui-slider-handle" ),
+ allowed,
+ curVal,
+ newVal,
+ step;
+
+ if ( self.options.disabled ) {
+ return;
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.PAGE_UP:
+ case $.ui.keyCode.PAGE_DOWN:
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ ret = false;
+ if ( !self._keySliding ) {
+ self._keySliding = true;
+ $( this ).addClass( "ui-state-active" );
+ allowed = self._start( event, index );
+ if ( allowed === false ) {
+ return;
+ }
+ }
+ break;
+ }
+
+ step = self.options.step;
+ if ( self.options.values && self.options.values.length ) {
+ curVal = newVal = self.values( index );
+ } else {
+ curVal = newVal = self.value();
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ newVal = self._valueMin();
+ break;
+ case $.ui.keyCode.END:
+ newVal = self._valueMax();
+ break;
+ case $.ui.keyCode.PAGE_UP:
+ newVal = curVal + ( (self._valueMax() - self._valueMin()) / numPages );
+ break;
+ case $.ui.keyCode.PAGE_DOWN:
+ newVal = curVal - ( (self._valueMax() - self._valueMin()) / numPages );
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ if ( curVal === self._valueMax() ) {
+ return;
+ }
+ newVal = curVal + step;
+ break;
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ if ( curVal === self._valueMin() ) {
+ return;
+ }
+ newVal = curVal - step;
+ break;
+ }
+
+ self._slide( event, index, newVal );
+
+ return ret;
+
+ })
+ .keyup(function( event ) {
+ var index = $( this ).data( "index.ui-slider-handle" );
+
+ if ( self._keySliding ) {
+ self._keySliding = false;
+ self._stop( event, index );
+ self._change( event, index );
+ $( this ).removeClass( "ui-state-active" );
+ }
+
+ });
+
+ this._refreshValue();
+
+ this._animateOff = false;
+ },
+
+ destroy: function() {
+ this.handles.remove();
+ this.range.remove();
+
+ this.element
+ .removeClass( "ui-slider" +
+ " ui-slider-horizontal" +
+ " ui-slider-vertical" +
+ " ui-slider-disabled" +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all" )
+ .removeData( "slider" )
+ .unbind( ".slider" );
+
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseCapture: function( event ) {
+ var o = this.options,
+ position,
+ normValue,
+ distance,
+ closestHandle,
+ self,
+ index,
+ allowed,
+ offset,
+ mouseOverHandle;
+
+ if ( o.disabled ) {
+ return false;
+ }
+
+ this.elementSize = {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight()
+ };
+ this.elementOffset = this.element.offset();
+
+ position = { x: event.pageX, y: event.pageY };
+ normValue = this._normValueFromMouse( position );
+ distance = this._valueMax() - this._valueMin() + 1;
+ self = this;
+ this.handles.each(function( i ) {
+ var thisDistance = Math.abs( normValue - self.values(i) );
+ if ( distance > thisDistance ) {
+ distance = thisDistance;
+ closestHandle = $( this );
+ index = i;
+ }
+ });
+
+ // workaround for bug #3736 (if both handles of a range are at 0,
+ // the first is always used as the one with least distance,
+ // and moving it is obviously prevented by preventing negative ranges)
+ if( o.range === true && this.values(1) === o.min ) {
+ index += 1;
+ closestHandle = $( this.handles[index] );
+ }
+
+ allowed = this._start( event, index );
+ if ( allowed === false ) {
+ return false;
+ }
+ this._mouseSliding = true;
+
+ self._handleIndex = index;
+
+ closestHandle
+ .addClass( "ui-state-active" )
+ .focus();
+
+ offset = closestHandle.offset();
+ mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" );
+ this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+ left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
+ top: event.pageY - offset.top -
+ ( closestHandle.height() / 2 ) -
+ ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) -
+ ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) +
+ ( parseInt( closestHandle.css("marginTop"), 10 ) || 0)
+ };
+
+ normValue = this._normValueFromMouse( position );
+ this._slide( event, index, normValue );
+ this._animateOff = true;
+ return true;
+ },
+
+ _mouseStart: function( event ) {
+ return true;
+ },
+
+ _mouseDrag: function( event ) {
+ var position = { x: event.pageX, y: event.pageY },
+ normValue = this._normValueFromMouse( position );
+
+ this._slide( event, this._handleIndex, normValue );
+
+ return false;
+ },
+
+ _mouseStop: function( event ) {
+ this.handles.removeClass( "ui-state-active" );
+ this._mouseSliding = false;
+
+ this._stop( event, this._handleIndex );
+ this._change( event, this._handleIndex );
+
+ this._handleIndex = null;
+ this._clickOffset = null;
+ this._animateOff = false;
+
+ return false;
+ },
+
+ _detectOrientation: function() {
+ this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
+ },
+
+ _normValueFromMouse: function( position ) {
+ var pixelTotal,
+ pixelMouse,
+ percentMouse,
+ valueTotal,
+ valueMouse;
+
+ if ( this.orientation === "horizontal" ) {
+ pixelTotal = this.elementSize.width;
+ pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 );
+ } else {
+ pixelTotal = this.elementSize.height;
+ pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 );
+ }
+
+ percentMouse = ( pixelMouse / pixelTotal );
+ if ( percentMouse > 1 ) {
+ percentMouse = 1;
+ }
+ if ( percentMouse < 0 ) {
+ percentMouse = 0;
+ }
+ if ( this.orientation === "vertical" ) {
+ percentMouse = 1 - percentMouse;
+ }
+
+ valueTotal = this._valueMax() - this._valueMin();
+ valueMouse = this._valueMin() + percentMouse * valueTotal;
+
+ return this._trimAlignValue( valueMouse );
+ },
+
+ _start: function( event, index ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+ return this._trigger( "start", event, uiHash );
+ },
+
+ _slide: function( event, index, newVal ) {
+ var otherVal,
+ newValues,
+ allowed;
+
+ if ( this.options.values && this.options.values.length ) {
+ otherVal = this.values( index ? 0 : 1 );
+
+ if ( ( this.options.values.length === 2 && this.options.range === true ) &&
+ ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) )
+ ) {
+ newVal = otherVal;
+ }
+
+ if ( newVal !== this.values( index ) ) {
+ newValues = this.values();
+ newValues[ index ] = newVal;
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger( "slide", event, {
+ handle: this.handles[ index ],
+ value: newVal,
+ values: newValues
+ } );
+ otherVal = this.values( index ? 0 : 1 );
+ if ( allowed !== false ) {
+ this.values( index, newVal, true );
+ }
+ }
+ } else {
+ if ( newVal !== this.value() ) {
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger( "slide", event, {
+ handle: this.handles[ index ],
+ value: newVal
+ } );
+ if ( allowed !== false ) {
+ this.value( newVal );
+ }
+ }
+ }
+ },
+
+ _stop: function( event, index ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+
+ this._trigger( "stop", event, uiHash );
+ },
+
+ _change: function( event, index ) {
+ if ( !this._keySliding && !this._mouseSliding ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+
+ this._trigger( "change", event, uiHash );
+ }
+ },
+
+ value: function( newValue ) {
+ if ( arguments.length ) {
+ this.options.value = this._trimAlignValue( newValue );
+ this._refreshValue();
+ this._change( null, 0 );
+ }
+
+ return this._value();
+ },
+
+ values: function( index, newValue ) {
+ var vals,
+ newValues,
+ i;
+
+ if ( arguments.length > 1 ) {
+ this.options.values[ index ] = this._trimAlignValue( newValue );
+ this._refreshValue();
+ this._change( null, index );
+ }
+
+ if ( arguments.length ) {
+ if ( $.isArray( arguments[ 0 ] ) ) {
+ vals = this.options.values;
+ newValues = arguments[ 0 ];
+ for ( i = 0; i < vals.length; i += 1 ) {
+ vals[ i ] = this._trimAlignValue( newValues[ i ] );
+ this._change( null, i );
+ }
+ this._refreshValue();
+ } else {
+ if ( this.options.values && this.options.values.length ) {
+ return this._values( index );
+ } else {
+ return this.value();
+ }
+ }
+ } else {
+ return this._values();
+ }
+ },
+
+ _setOption: function( key, value ) {
+ var i,
+ valsLength = 0;
+
+ if ( $.isArray( this.options.values ) ) {
+ valsLength = this.options.values.length;
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+
+ switch ( key ) {
+ case "disabled":
+ if ( value ) {
+ this.handles.filter( ".ui-state-focus" ).blur();
+ this.handles.removeClass( "ui-state-hover" );
+ this.handles.attr( "disabled", "disabled" );
+ this.element.addClass( "ui-disabled" );
+ } else {
+ this.handles.removeAttr( "disabled" );
+ this.element.removeClass( "ui-disabled" );
+ }
+ break;
+ case "orientation":
+ this._detectOrientation();
+ this.element
+ .removeClass( "ui-slider-horizontal ui-slider-vertical" )
+ .addClass( "ui-slider-" + this.orientation );
+ this._refreshValue();
+ break;
+ case "value":
+ this._animateOff = true;
+ this._refreshValue();
+ this._change( null, 0 );
+ this._animateOff = false;
+ break;
+ case "values":
+ this._animateOff = true;
+ this._refreshValue();
+ for ( i = 0; i < valsLength; i += 1 ) {
+ this._change( null, i );
+ }
+ this._animateOff = false;
+ break;
+ }
+ },
+
+ //internal value getter
+ // _value() returns value trimmed by min and max, aligned by step
+ _value: function() {
+ var val = this.options.value;
+ val = this._trimAlignValue( val );
+
+ return val;
+ },
+
+ //internal values getter
+ // _values() returns array of values trimmed by min and max, aligned by step
+ // _values( index ) returns single value trimmed by min and max, aligned by step
+ _values: function( index ) {
+ var val,
+ vals,
+ i;
+
+ if ( arguments.length ) {
+ val = this.options.values[ index ];
+ val = this._trimAlignValue( val );
+
+ return val;
+ } else {
+ // .slice() creates a copy of the array
+ // this copy gets trimmed by min and max and then returned
+ vals = this.options.values.slice();
+ for ( i = 0; i < vals.length; i+= 1) {
+ vals[ i ] = this._trimAlignValue( vals[ i ] );
+ }
+
+ return vals;
+ }
+ },
+
+ // returns the step-aligned value that val is closest to, between (inclusive) min and max
+ _trimAlignValue: function( val ) {
+ if ( val < this._valueMin() ) {
+ return this._valueMin();
+ }
+ if ( val > this._valueMax() ) {
+ return this._valueMax();
+ }
+ var step = this.options.step,
+ valModStep = val % step,
+ alignValue = val - valModStep;
+
+ if ( valModStep >= ( step / 2 ) ) {
+ alignValue += step;
+ }
+
+ // Since JavaScript has problems with large floats, round
+ // the final value to 5 digits after the decimal point (see #4124)
+ return parseFloat( alignValue.toFixed(5) );
+ },
+
+ _valueMin: function() {
+ return this.options.min;
+ },
+
+ _valueMax: function() {
+ return this.options.max;
+ },
+
+ _refreshValue: function() {
+ var oRange = this.options.range,
+ o = this.options,
+ self = this,
+ animate = ( !this._animateOff ) ? o.animate : false,
+ valPercent,
+ _set = {},
+ lastValPercent,
+ value,
+ valueMin,
+ valueMax;
+
+ if ( this.options.values && this.options.values.length ) {
+ this.handles.each(function( i, j ) {
+ valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100;
+ _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+ if ( self.options.range === true ) {
+ if ( self.orientation === "horizontal" ) {
+ if ( i === 0 ) {
+ self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
+ }
+ if ( i === 1 ) {
+ self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ } else {
+ if ( i === 0 ) {
+ self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
+ }
+ if ( i === 1 ) {
+ self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ }
+ }
+ lastValPercent = valPercent;
+ });
+ } else {
+ value = this.value();
+ valueMin = this._valueMin();
+ valueMax = this._valueMax();
+ valPercent = ( valueMax !== valueMin ) ?
+ ( value - valueMin ) / ( valueMax - valueMin ) * 100 :
+ 0;
+ _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+
+ if ( oRange === "min" && this.orientation === "horizontal" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "horizontal" ) {
+ this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ if ( oRange === "min" && this.orientation === "vertical" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "vertical" ) {
+ this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ }
+ }
+
+});
+
+$.extend( $.ui.slider, {
+ version: "1.8.1"
+});
+
+}(jQuery));
+/*
+ * jQuery UI Tabs 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+var tabId = 0,
+ listId = 0;
+
+$.widget("ui.tabs", {
+ options: {
+ add: null,
+ ajaxOptions: null,
+ cache: false,
+ cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+ collapsible: false,
+ disable: null,
+ disabled: [],
+ enable: null,
+ event: 'click',
+ fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
+ idPrefix: 'ui-tabs-',
+ load: null,
+ panelTemplate: '<div></div>',
+ remove: null,
+ select: null,
+ show: null,
+ spinner: '<em>Loading…</em>',
+ tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
+ },
+ _create: function() {
+ this._tabify(true);
+ },
+
+ _setOption: function(key, value) {
+ if (key == 'selected') {
+ if (this.options.collapsible && value == this.options.selected) {
+ return;
+ }
+ this.select(value);
+ }
+ else {
+ this.options[key] = value;
+ this._tabify();
+ }
+ },
+
+ _tabId: function(a) {
+ return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') ||
+ this.options.idPrefix + (++tabId);
+ },
+
+ _sanitizeSelector: function(hash) {
+ return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
+ },
+
+ _cookie: function() {
+ var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + (++listId));
+ return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
+ },
+
+ _ui: function(tab, panel) {
+ return {
+ tab: tab,
+ panel: panel,
+ index: this.anchors.index(tab)
+ };
+ },
+
+ _cleanup: function() {
+ // restore all former loading tabs labels
+ this.lis.filter('.ui-state-processing').removeClass('ui-state-processing')
+ .find('span:data(label.tabs)')
+ .each(function() {
+ var el = $(this);
+ el.html(el.data('label.tabs')).removeData('label.tabs');
+ });
+ },
+
+ _tabify: function(init) {
+
+ this.list = this.element.find('ol,ul').eq(0);
+ this.lis = $('li:has(a[href])', this.list);
+ this.anchors = this.lis.map(function() { return $('a', this)[0]; });
+ this.panels = $([]);
+
+ var self = this, o = this.options;
+
+ var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+ this.anchors.each(function(i, a) {
+ var href = $(a).attr('href');
+
+ // For dynamically created HTML that contains a hash as href IE < 8 expands
+ // such href to the full page url with hash and then misinterprets tab as ajax.
+ // Same consideration applies for an added tab with a fragment identifier
+ // since a[href=#fragment-identifier] does unexpectedly not match.
+ // Thus normalize href attribute...
+ var hrefBase = href.split('#')[0], baseEl;
+ if (hrefBase && (hrefBase === location.toString().split('#')[0] ||
+ (baseEl = $('base')[0]) && hrefBase === baseEl.href)) {
+ href = a.hash;
+ a.href = href;
+ }
+
+ // inline tab
+ if (fragmentId.test(href)) {
+ self.panels = self.panels.add(self._sanitizeSelector(href));
+ }
+
+ // remote tab
+ else if (href != '#') { // prevent loading the page itself if href is just "#"
+ $.data(a, 'href.tabs', href); // required for restore on destroy
+
+ // TODO until #3808 is fixed strip fragment identifier from url
+ // (IE fails to load from such url)
+ $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data
+
+ var id = self._tabId(a);
+ a.href = '#' + id;
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
+ .insertAfter(self.panels[i - 1] || self.list);
+ $panel.data('destroy.tabs', true);
+ }
+ self.panels = self.panels.add($panel);
+ }
+
+ // invalid tab href
+ else {
+ o.disabled.push(i);
+ }
+ });
+
+ // initialization from scratch
+ if (init) {
+
+ // attach necessary classes for styling
+ this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
+ this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+ this.lis.addClass('ui-state-default ui-corner-top');
+ this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');
+
+ // Selected tab
+ // use "selected" option or try to retrieve:
+ // 1. from fragment identifier in url
+ // 2. from cookie
+ // 3. from selected class attribute on <li>
+ if (o.selected === undefined) {
+ if (location.hash) {
+ this.anchors.each(function(i, a) {
+ if (a.hash == location.hash) {
+ o.selected = i;
+ return false; // break
+ }
+ });
+ }
+ if (typeof o.selected != 'number' && o.cookie) {
+ o.selected = parseInt(self._cookie(), 10);
+ }
+ if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) {
+ o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+ }
+ o.selected = o.selected || (this.lis.length ? 0 : -1);
+ }
+ else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release
+ o.selected = -1;
+ }
+
+ // sanity check - default to first tab...
+ o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0;
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ // A selected tab cannot become disabled.
+ o.disabled = $.unique(o.disabled.concat(
+ $.map(this.lis.filter('.ui-state-disabled'),
+ function(n, i) { return self.lis.index(n); } )
+ )).sort();
+
+ if ($.inArray(o.selected, o.disabled) != -1) {
+ o.disabled.splice($.inArray(o.selected, o.disabled), 1);
+ }
+
+ // highlight selected tab
+ this.panels.addClass('ui-tabs-hide');
+ this.lis.removeClass('ui-tabs-selected ui-state-active');
+ if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list
+ this.panels.eq(o.selected).removeClass('ui-tabs-hide');
+ this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');
+
+ // seems to be expected behavior that the show callback is fired
+ self.element.queue("tabs", function() {
+ self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected]));
+ });
+
+ this.load(o.selected);
+ }
+
+ // clean up to avoid memory leaks in certain versions of IE 6
+ $(window).bind('unload', function() {
+ self.lis.add(self.anchors).unbind('.tabs');
+ self.lis = self.anchors = self.panels = null;
+ });
+
+ }
+ // update selected after add/remove
+ else {
+ o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+ }
+
+ // update collapsible
+ this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible');
+
+ // set or update cookie after init and add/remove respectively
+ if (o.cookie) {
+ this._cookie(o.selected, o.cookie);
+ }
+
+ // disable tabs
+ for (var i = 0, li; (li = this.lis[i]); i++) {
+ $(li)[$.inArray(i, o.disabled) != -1 &&
+ !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
+ }
+
+ // reset cache if switching from cached to not cached
+ if (o.cache === false) {
+ this.anchors.removeData('cache.tabs');
+ }
+
+ // remove all handlers before, tabify may run on existing tabs after add or option change
+ this.lis.add(this.anchors).unbind('.tabs');
+
+ if (o.event != 'mouseover') {
+ var addState = function(state, el) {
+ if (el.is(':not(.ui-state-disabled)')) {
+ el.addClass('ui-state-' + state);
+ }
+ };
+ var removeState = function(state, el) {
+ el.removeClass('ui-state-' + state);
+ };
+ this.lis.bind('mouseover.tabs', function() {
+ addState('hover', $(this));
+ });
+ this.lis.bind('mouseout.tabs', function() {
+ removeState('hover', $(this));
+ });
+ this.anchors.bind('focus.tabs', function() {
+ addState('focus', $(this).closest('li'));
+ });
+ this.anchors.bind('blur.tabs', function() {
+ removeState('focus', $(this).closest('li'));
+ });
+ }
+
+ // set up animations
+ var hideFx, showFx;
+ if (o.fx) {
+ if ($.isArray(o.fx)) {
+ hideFx = o.fx[0];
+ showFx = o.fx[1];
+ }
+ else {
+ hideFx = showFx = o.fx;
+ }
+ }
+
+ // Reset certain styles left over from animation
+ // and prevent IE's ClearType bug...
+ function resetStyle($el, fx) {
+ $el.css({ display: '' });
+ if (!$.support.opacity && fx.opacity) {
+ $el[0].style.removeAttribute('filter');
+ }
+ }
+
+ // Show a tab...
+ var showTab = showFx ?
+ function(clicked, $show) {
+ $(clicked).closest('li').addClass('ui-tabs-selected ui-state-active');
+ $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
+ .animate(showFx, showFx.duration || 'normal', function() {
+ resetStyle($show, showFx);
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ });
+ } :
+ function(clicked, $show) {
+ $(clicked).closest('li').addClass('ui-tabs-selected ui-state-active');
+ $show.removeClass('ui-tabs-hide');
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ };
+
+ // Hide a tab, $show is optional...
+ var hideTab = hideFx ?
+ function(clicked, $hide) {
+ $hide.animate(hideFx, hideFx.duration || 'normal', function() {
+ self.lis.removeClass('ui-tabs-selected ui-state-active');
+ $hide.addClass('ui-tabs-hide');
+ resetStyle($hide, hideFx);
+ self.element.dequeue("tabs");
+ });
+ } :
+ function(clicked, $hide, $show) {
+ self.lis.removeClass('ui-tabs-selected ui-state-active');
+ $hide.addClass('ui-tabs-hide');
+ self.element.dequeue("tabs");
+ };
+
+ // attach tab event handler, unbind to avoid duplicates from former tabifying...
+ this.anchors.bind(o.event + '.tabs', function() {
+ var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'),
+ $show = $(self._sanitizeSelector(this.hash));
+
+ // If tab is already selected and not collapsible or tab disabled or
+ // or is already loading or click callback returns false stop here.
+ // Check if click handler returns false last so that it is not executed
+ // for a disabled or loading tab!
+ if (($li.hasClass('ui-tabs-selected') && !o.collapsible) ||
+ $li.hasClass('ui-state-disabled') ||
+ $li.hasClass('ui-state-processing') ||
+ self._trigger('select', null, self._ui(this, $show[0])) === false) {
+ this.blur();
+ return false;
+ }
+
+ o.selected = self.anchors.index(this);
+
+ self.abort();
+
+ // if tab may be closed
+ if (o.collapsible) {
+ if ($li.hasClass('ui-tabs-selected')) {
+ o.selected = -1;
+
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ self.element.queue("tabs", function() {
+ hideTab(el, $hide);
+ }).dequeue("tabs");
+
+ this.blur();
+ return false;
+ }
+ else if (!$hide.length) {
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ self.element.queue("tabs", function() {
+ showTab(el, $show);
+ });
+
+ self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
+
+ this.blur();
+ return false;
+ }
+ }
+
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ // show new tab
+ if ($show.length) {
+ if ($hide.length) {
+ self.element.queue("tabs", function() {
+ hideTab(el, $hide);
+ });
+ }
+ self.element.queue("tabs", function() {
+ showTab(el, $show);
+ });
+
+ self.load(self.anchors.index(this));
+ }
+ else {
+ throw 'jQuery UI Tabs: Mismatching fragment identifier.';
+ }
+
+ // Prevent IE from keeping other link focussed when using the back button
+ // and remove dotted border from clicked link. This is controlled via CSS
+ // in modern browsers; blur() removes focus from address bar in Firefox
+ // which can become a usability and annoying problem with tabs('rotate').
+ if ($.browser.msie) {
+ this.blur();
+ }
+
+ });
+
+ // disable click in any case
+ this.anchors.bind('click.tabs', function(){return false;});
+
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.abort();
+
+ this.element.unbind('.tabs')
+ .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible')
+ .removeData('tabs');
+
+ this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+
+ this.anchors.each(function() {
+ var href = $.data(this, 'href.tabs');
+ if (href) {
+ this.href = href;
+ }
+ var $this = $(this).unbind('.tabs');
+ $.each(['href', 'load', 'cache'], function(i, prefix) {
+ $this.removeData(prefix + '.tabs');
+ });
+ });
+
+ this.lis.unbind('.tabs').add(this.panels).each(function() {
+ if ($.data(this, 'destroy.tabs')) {
+ $(this).remove();
+ }
+ else {
+ $(this).removeClass([
+ 'ui-state-default',
+ 'ui-corner-top',
+ 'ui-tabs-selected',
+ 'ui-state-active',
+ 'ui-state-hover',
+ 'ui-state-focus',
+ 'ui-state-disabled',
+ 'ui-tabs-panel',
+ 'ui-widget-content',
+ 'ui-corner-bottom',
+ 'ui-tabs-hide'
+ ].join(' '));
+ }
+ });
+
+ if (o.cookie) {
+ this._cookie(null, o.cookie);
+ }
+
+ return this;
+ },
+
+ add: function(url, label, index) {
+ if (index === undefined) {
+ index = this.anchors.length; // append by default
+ }
+
+ var self = this, o = this.options,
+ $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)),
+ id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]);
+
+ $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);
+
+ // try to find an existing element before creating a new one
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
+ }
+ $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');
+
+ if (index >= this.lis.length) {
+ $li.appendTo(this.list);
+ $panel.appendTo(this.list[0].parentNode);
+ }
+ else {
+ $li.insertBefore(this.lis[index]);
+ $panel.insertBefore(this.panels[index]);
+ }
+
+ o.disabled = $.map(o.disabled,
+ function(n, i) { return n >= index ? ++n : n; });
+
+ this._tabify();
+
+ if (this.anchors.length == 1) { // after tabify
+ o.selected = 0;
+ $li.addClass('ui-tabs-selected ui-state-active');
+ $panel.removeClass('ui-tabs-hide');
+ this.element.queue("tabs", function() {
+ self._trigger('show', null, self._ui(self.anchors[0], self.panels[0]));
+ });
+
+ this.load(0);
+ }
+
+ // callback
+ this._trigger('add', null, this._ui(this.anchors[index], this.panels[index]));
+ return this;
+ },
+
+ remove: function(index) {
+ var o = this.options, $li = this.lis.eq(index).remove(),
+ $panel = this.panels.eq(index).remove();
+
+ // If selected tab was removed focus tab to the right or
+ // in case the last tab was removed the tab to the left.
+ if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) {
+ this.select(index + (index + 1 < this.anchors.length ? 1 : -1));
+ }
+
+ o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
+ function(n, i) { return n >= index ? --n : n; });
+
+ this._tabify();
+
+ // callback
+ this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
+ return this;
+ },
+
+ enable: function(index) {
+ var o = this.options;
+ if ($.inArray(index, o.disabled) == -1) {
+ return;
+ }
+
+ this.lis.eq(index).removeClass('ui-state-disabled');
+ o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });
+
+ // callback
+ this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index]));
+ return this;
+ },
+
+ disable: function(index) {
+ var self = this, o = this.options;
+ if (index != o.selected) { // cannot disable already selected tab
+ this.lis.eq(index).addClass('ui-state-disabled');
+
+ o.disabled.push(index);
+ o.disabled.sort();
+
+ // callback
+ this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index]));
+ }
+
+ return this;
+ },
+
+ select: function(index) {
+ if (typeof index == 'string') {
+ index = this.anchors.index(this.anchors.filter('[href$=' + index + ']'));
+ }
+ else if (index === null) { // usage of null is deprecated, TODO remove in next release
+ index = -1;
+ }
+ if (index == -1 && this.options.collapsible) {
+ index = this.options.selected;
+ }
+
+ this.anchors.eq(index).trigger(this.options.event + '.tabs');
+ return this;
+ },
+
+ load: function(index) {
+ var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs');
+
+ this.abort();
+
+ // not remote or from cache
+ if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) {
+ this.element.dequeue("tabs");
+ return;
+ }
+
+ // load remote from here on
+ this.lis.eq(index).addClass('ui-state-processing');
+
+ if (o.spinner) {
+ var span = $('span', a);
+ span.data('label.tabs', span.html()).html(o.spinner);
+ }
+
+ this.xhr = $.ajax($.extend({}, o.ajaxOptions, {
+ url: url,
+ success: function(r, s) {
+ $(self._sanitizeSelector(a.hash)).html(r);
+
+ // take care of tab labels
+ self._cleanup();
+
+ if (o.cache) {
+ $.data(a, 'cache.tabs', true); // if loaded once do not load them again
+ }
+
+ // callbacks
+ self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
+ try {
+ o.ajaxOptions.success(r, s);
+ }
+ catch (e) {}
+ },
+ error: function(xhr, s, e) {
+ // take care of tab labels
+ self._cleanup();
+
+ // callbacks
+ self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
+ try {
+ // Passing index avoid a race condition when this method is
+ // called after the user has selected another tab.
+ // Pass the anchor that initiated this request allows
+ // loadError to manipulate the tab content panel via $(a.hash)
+ o.ajaxOptions.error(xhr, s, index, a);
+ }
+ catch (e) {}
+ }
+ }));
+
+ // last, so that load event is fired before show...
+ self.element.dequeue("tabs");
+
+ return this;
+ },
+
+ abort: function() {
+ // stop possibly running animations
+ this.element.queue([]);
+ this.panels.stop(false, true);
+
+ // "tabs" queue must not contain more than two elements,
+ // which are the callbacks for the latest clicked tab...
+ this.element.queue("tabs", this.element.queue("tabs").splice(-2, 2));
+
+ // terminate pending requests from other tabs
+ if (this.xhr) {
+ this.xhr.abort();
+ delete this.xhr;
+ }
+
+ // take care of tab labels
+ this._cleanup();
+ return this;
+ },
+
+ url: function(index, url) {
+ this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url);
+ return this;
+ },
+
+ length: function() {
+ return this.anchors.length;
+ }
+
+});
+
+$.extend($.ui.tabs, {
+ version: '1.8.1'
+});
+
+/*
+ * Tabs Extensions
+ */
+
+/*
+ * Rotate
+ */
+$.extend($.ui.tabs.prototype, {
+ rotation: null,
+ rotate: function(ms, continuing) {
+
+ var self = this, o = this.options;
+
+ var rotate = self._rotate || (self._rotate = function(e) {
+ clearTimeout(self.rotation);
+ self.rotation = setTimeout(function() {
+ var t = o.selected;
+ self.select( ++t < self.anchors.length ? t : 0 );
+ }, ms);
+
+ if (e) {
+ e.stopPropagation();
+ }
+ });
+
+ var stop = self._unrotate || (self._unrotate = !continuing ?
+ function(e) {
+ if (e.clientX) { // in case of a true click
+ self.rotate(null);
+ }
+ } :
+ function(e) {
+ t = o.selected;
+ rotate();
+ });
+
+ // start rotation
+ if (ms) {
+ this.element.bind('tabsshow', rotate);
+ this.anchors.bind(o.event + '.tabs', stop);
+ rotate();
+ }
+ // stop rotation
+ else {
+ clearTimeout(self.rotation);
+ this.element.unbind('tabsshow', rotate);
+ this.anchors.unbind(o.event + '.tabs', stop);
+ delete this._rotate;
+ delete this._unrotate;
+ }
+
+ return this;
+ }
+});
+
+})(jQuery);
+/*
+ * jQuery UI Datepicker 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * jquery.ui.core.js
+ */
+
+(function($) { // hide the namespace
+
+$.extend($.ui, { datepicker: { version: "1.8.1" } });
+
+var PROP_NAME = 'datepicker';
+var dpuuid = new Date().getTime();
+
+/* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+function Datepicker() {
+ this.debug = false; // Change this to true to start debugging
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
+ this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
+ this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
+ this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
+ this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
+ this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
+ this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
+ this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
+ this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[''] = { // Default regional settings
+ closeText: 'Done', // Display text for close link
+ prevText: 'Prev', // Display text for previous month link
+ nextText: 'Next', // Display text for next month link
+ currentText: 'Today', // Display text for current month link
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
+ weekHeader: 'Wk', // Column header for week of the year
+ dateFormat: 'mm/dd/yy', // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false, // True if right-to-left language, false if left-to-right
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearSuffix: '' // Additional text to append to the year in the month headers
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: 'focus', // 'focus' for popup on focus,
+ // 'button' for trigger button, or 'both' for either
+ showAnim: 'show', // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: '', // Display text following the input box, e.g. showing the format
+ buttonText: '...', // Text for trigger button
+ buttonImage: '', // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ yearRange: 'c-10:c+10', // Range of years to display in drop-down,
+ // either relative to today's year (-nn:+nn), relative to currently displayed year
+ // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
+ showWeek: false, // True to show week of the year, false to not show it
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: '+10', // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with '+' for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: '_default', // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: '', // Selector for an alternate field to store selected dates into
+ altFormat: '', // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false, // True to show button panel, false to not show it
+ autoSize: false // True to size the input for the date format, false to leave as is
+ };
+ $.extend(this._defaults, this.regional['']);
+ this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
+}
+
+$.extend(Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: 'hasDatepicker',
+
+ /* Debug logging (if enabled). */
+ log: function () {
+ if (this.debug)
+ console.log.apply('', arguments);
+ },
+
+ // TODO rename to "widget" when switching to widget factory
+ _widgetDatepicker: function() {
+ return this.dpDiv;
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ @param settings object - the new settings to use as defaults (anonymous object)
+ @return the manager object */
+ setDefaults: function(settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ @param target element - the target input field or division or span
+ @param settings object - the new settings to use for this date picker instance (anonymous) */
+ _attachDatepicker: function(target, settings) {
+ // check for settings on the control itself - in namespace 'date:'
+ var inlineSettings = null;
+ for (var attrName in this._defaults) {
+ var attrValue = target.getAttribute('date:' + attrName);
+ if (attrValue) {
+ inlineSettings = inlineSettings || {};
+ try {
+ inlineSettings[attrName] = eval(attrValue);
+ } catch (err) {
+ inlineSettings[attrName] = attrValue;
+ }
+ }
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ var inline = (nodeName == 'div' || nodeName == 'span');
+ if (!target.id)
+ target.id = 'dp' + (++this.uuid);
+ var inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+ if (nodeName == 'input') {
+ this._connectDatepicker(target, inst);
+ } else if (inline) {
+ this._inlineDatepicker(target, inst);
+ }
+ },
+
+ /* Create a new instance object. */
+ _newInst: function(target, inline) {
+ var id = target[0].id.replace(/([^A-Za-z0-9_])/g, '\\\\$1'); // escape jQuery meta chars
+ return {id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: (!inline ? this.dpDiv : // presentation div
+ $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function(target, inst) {
+ var input = $(target);
+ inst.append = $([]);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName))
+ return;
+ this._attachments(input, inst);
+ input.addClass(this.markerClassName).keydown(this._doKeyDown).
+ keypress(this._doKeyPress).keyup(this._doKeyUp).
+ bind("setData.datepicker", function(event, key, value) {
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key) {
+ return this._get(inst, key);
+ });
+ this._autoSize(inst);
+ $.data(target, PROP_NAME, inst);
+ },
+
+ /* Make attachments based on settings. */
+ _attachments: function(input, inst) {
+ var appendText = this._get(inst, 'appendText');
+ var isRTL = this._get(inst, 'isRTL');
+ if (inst.append)
+ inst.append.remove();
+ if (appendText) {
+ inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
+ input[isRTL ? 'before' : 'after'](inst.append);
+ }
+ input.unbind('focus', this._showDatepicker);
+ if (inst.trigger)
+ inst.trigger.remove();
+ var showOn = this._get(inst, 'showOn');
+ if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
+ input.focus(this._showDatepicker);
+ if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
+ var buttonText = this._get(inst, 'buttonText');
+ var buttonImage = this._get(inst, 'buttonImage');
+ inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
+ $('<img/>').addClass(this._triggerClass).
+ attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
+ $('<button type="button"></button>').addClass(this._triggerClass).
+ html(buttonImage == '' ? buttonText : $('<img/>').attr(
+ { src:buttonImage, alt:buttonText, title:buttonText })));
+ input[isRTL ? 'before' : 'after'](inst.trigger);
+ inst.trigger.click(function() {
+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0])
+ $.datepicker._hideDatepicker();
+ else
+ $.datepicker._showDatepicker(input[0]);
+ return false;
+ });
+ }
+ },
+
+ /* Apply the maximum length for the date format. */
+ _autoSize: function(inst) {
+ if (this._get(inst, 'autoSize') && !inst.inline) {
+ var date = new Date(2009, 12 - 1, 20); // Ensure double digits
+ var dateFormat = this._get(inst, 'dateFormat');
+ if (dateFormat.match(/[DM]/)) {
+ var findMax = function(names) {
+ var max = 0;
+ var maxI = 0;
+ for (var i = 0; i < names.length; i++) {
+ if (names[i].length > max) {
+ max = names[i].length;
+ maxI = i;
+ }
+ }
+ return maxI;
+ };
+ date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
+ 'monthNames' : 'monthNamesShort'))));
+ date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
+ 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay());
+ }
+ inst.input.attr('size', this._formatDate(inst, date).length);
+ }
+ },
+
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName))
+ return;
+ divSpan.addClass(this.markerClassName).append(inst.dpDiv).
+ bind("setData.datepicker", function(event, key, value){
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key){
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ this._setDate(inst, this._getDefaultDate(inst), true);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ },
+
+ /* Pop-up the date picker in a "dialog" box.
+ @param input element - ignored
+ @param date string or Date - the initial date to display
+ @param onSelect function - the function to call when a date is selected
+ @param settings object - update the dialog date picker instance's settings (anonymous object)
+ @param pos int[2] - coordinates for the dialog's position within the screen or
+ event - with x/y coordinates or
+ leave empty for default (screen centre)
+ @return the manager object */
+ _dialogDatepicker: function(input, date, onSelect, settings, pos) {
+ var inst = this._dialogInst; // internal instance
+ if (!inst) {
+ var id = 'dp' + (++this.uuid);
+ this._dialogInput = $('<input type="text" id="' + id +
+ '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');
+ this._dialogInput.keydown(this._doKeyDown);
+ $('body').append(this._dialogInput);
+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
+ inst.settings = {};
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ }
+ extendRemove(inst.settings, settings || {});
+ date = (date && date.constructor == Date ? this._formatDate(inst, date) : date);
+ this._dialogInput.val(date);
+
+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+ if (!this._pos) {
+ var browserWidth = document.documentElement.clientWidth;
+ var browserHeight = document.documentElement.clientHeight;
+ var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ }
+
+ // move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px');
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass(this._dialogClass);
+ this._showDatepicker(this._dialogInput[0]);
+ if ($.blockUI)
+ $.blockUI(this.dpDiv);
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ return this;
+ },
+
+ /* Detach a datepicker from its control.
+ @param target element - the target input field or division or span */
+ _destroyDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ $.removeData(target, PROP_NAME);
+ if (nodeName == 'input') {
+ inst.append.remove();
+ inst.trigger.remove();
+ $target.removeClass(this.markerClassName).
+ unbind('focus', this._showDatepicker).
+ unbind('keydown', this._doKeyDown).
+ unbind('keypress', this._doKeyPress).
+ unbind('keyup', this._doKeyUp);
+ } else if (nodeName == 'div' || nodeName == 'span')
+ $target.removeClass(this.markerClassName).empty();
+ },
+
+ /* Enable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _enableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = false;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = false; }).end().
+ filter('img').css({opacity: '1.0', cursor: ''});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().removeClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ },
+
+ /* Disable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _disableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = true;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = true; }).end().
+ filter('img').css({opacity: '0.5', cursor: 'default'});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().addClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = target;
+ },
+
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ @param target element - the target input field or division or span
+ @return boolean - true if disabled, false if enabled */
+ _isDisabledDatepicker: function(target) {
+ if (!target) {
+ return false;
+ }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] == target)
+ return true;
+ }
+ return false;
+ },
+
+ /* Retrieve the instance data for the target control.
+ @param target element - the target input field or division or span
+ @return object - the associated instance data
+ @throws error if a jQuery problem getting data */
+ _getInst: function(target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw 'Missing instance data for this datepicker';
+ }
+ },
+
+ /* Update or retrieve the settings for a date picker attached to an input field or division.
+ @param target element - the target input field or division or span
+ @param name object - the new settings to update or
+ string - the name of the setting to change or retrieve,
+ when retrieving also 'all' for all instance settings or
+ 'defaults' for all global defaults
+ @param value any - the new value for the setting
+ (omit if above is an object or to retrieve a value) */
+ _optionDatepicker: function(target, name, value) {
+ var inst = this._getInst(target);
+ if (arguments.length == 2 && typeof name == 'string') {
+ return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
+ (inst ? (name == 'all' ? $.extend({}, inst.settings) :
+ this._get(inst, name)) : null));
+ }
+ var settings = name || {};
+ if (typeof name == 'string') {
+ settings = {};
+ settings[name] = value;
+ }
+ if (inst) {
+ if (this._curInst == inst) {
+ this._hideDatepicker();
+ }
+ var date = this._getDateDatepicker(target, true);
+ extendRemove(inst.settings, settings);
+ this._attachments($(target), inst);
+ this._autoSize(inst);
+ this._setDateDatepicker(target, date);
+ this._updateDatepicker(inst);
+ }
+ },
+
+ // change method deprecated
+ _changeDatepicker: function(target, name, value) {
+ this._optionDatepicker(target, name, value);
+ },
+
+ /* Redraw the date picker attached to an input field or division.
+ @param target element - the target input field or division or span */
+ _refreshDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Set the dates for a jQuery selection.
+ @param target element - the target input field or division or span
+ @param date Date - the new date */
+ _setDateDatepicker: function(target, date) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setDate(inst, date);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ }
+ },
+
+ /* Get the date(s) for the first entry in a jQuery selection.
+ @param target element - the target input field or division or span
+ @param noDefault boolean - true if no default date is to be used
+ @return Date - the current date */
+ _getDateDatepicker: function(target, noDefault) {
+ var inst = this._getInst(target);
+ if (inst && !inst.inline)
+ this._setDateFromField(inst, noDefault);
+ return (inst ? this._getDate(inst) : null);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ var handled = true;
+ var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
+ inst._keyEvent = true;
+ if ($.datepicker._datepickerShowing)
+ switch (event.keyCode) {
+ case 9: $.datepicker._hideDatepicker();
+ handled = false;
+ break; // hide on tab out
+ case 13: var sel = $('td.' + $.datepicker._dayOverClass, inst.dpDiv).
+ add($('td.' + $.datepicker._currentClass, inst.dpDiv));
+ if (sel[0])
+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+ else
+ $.datepicker._hideDatepicker();
+ return false; // don't submit the form
+ break; // select the value on enter
+ case 27: $.datepicker._hideDatepicker();
+ break; // hide on escape
+ case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // previous month/year on page up/+ ctrl
+ case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // next month/year on page down/+ ctrl
+ case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // -1 day on ctrl or command +left
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +left on Mac
+ break;
+ case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // +1 day on ctrl or command +right
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +right
+ break;
+ case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default: handled = false;
+ }
+ else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
+ $.datepicker._showDatepicker(this);
+ else {
+ handled = false;
+ }
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if ($.datepicker._get(inst, 'constrainInput')) {
+ var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
+ var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
+ return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
+ }
+ },
+
+ /* Synchronise manual entry and field/alternate field. */
+ _doKeyUp: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if (inst.input.val() != inst.lastVal) {
+ try {
+ var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+ (inst.input ? inst.input.val() : null),
+ $.datepicker._getFormatConfig(inst));
+ if (date) { // only if valid
+ $.datepicker._setDateFromField(inst);
+ $.datepicker._updateAlternate(inst);
+ $.datepicker._updateDatepicker(inst);
+ }
+ }
+ catch (event) {
+ $.datepicker.log(event);
+ }
+ }
+ return true;
+ },
+
+ /* Pop-up the date picker for a given input field.
+ @param input element - the input field attached to the date picker or
+ event - if triggered by focus */
+ _showDatepicker: function(input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
+ input = $('input', input.parentNode)[0];
+ if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
+ return;
+ var inst = $.datepicker._getInst(input);
+ if ($.datepicker._curInst && $.datepicker._curInst != inst) {
+ $.datepicker._curInst.dpDiv.stop(true, true);
+ }
+ var beforeShow = $.datepicker._get(inst, 'beforeShow');
+ extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
+ inst.lastVal = null;
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField(inst);
+ if ($.datepicker._inDialog) // hide cursor
+ input.value = '';
+ if (!$.datepicker._pos) { // position below input
+ $.datepicker._pos = $.datepicker._findPos(input);
+ $.datepicker._pos[1] += input.offsetHeight; // add the height
+ }
+ var isFixed = false;
+ $(input).parents().each(function() {
+ isFixed |= $(this).css('position') == 'fixed';
+ return !isFixed;
+ });
+ if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+ $.datepicker._pos[0] -= document.documentElement.scrollLeft;
+ $.datepicker._pos[1] -= document.documentElement.scrollTop;
+ }
+ var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+ $.datepicker._pos = null;
+ // determine sizing offscreen
+ inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
+ $.datepicker._updateDatepicker(inst);
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
+ inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
+ 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+ left: offset.left + 'px', top: offset.top + 'px'});
+ if (!inst.inline) {
+ var showAnim = $.datepicker._get(inst, 'showAnim');
+ var duration = $.datepicker._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._datepickerShowing = true;
+ var borders = $.datepicker._getBorders(inst.dpDiv);
+ inst.dpDiv.find('iframe.ui-datepicker-cover'). // IE6- only
+ css({left: -borders[0], top: -borders[1],
+ width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()});
+ };
+ inst.dpDiv.zIndex($(input).zIndex()+1);
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess);
+ if (!showAnim || !duration)
+ postProcess();
+ if (inst.input.is(':visible') && !inst.input.is(':disabled'))
+ inst.input.focus();
+ $.datepicker._curInst = inst;
+ }
+ },
+
+ /* Generate the date picker content. */
+ _updateDatepicker: function(inst) {
+ var self = this;
+ var borders = $.datepicker._getBorders(inst.dpDiv);
+ inst.dpDiv.empty().append(this._generateHTML(inst))
+ .find('iframe.ui-datepicker-cover') // IE6- only
+ .css({left: -borders[0], top: -borders[1],
+ width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()})
+ .end()
+ .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
+ .bind('mouseout', function(){
+ $(this).removeClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
+ })
+ .bind('mouseover', function(){
+ if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
+ $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
+ $(this).addClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
+ }
+ })
+ .end()
+ .find('.' + this._dayOverClass + ' a')
+ .trigger('mouseover')
+ .end();
+ var numMonths = this._getNumberOfMonths(inst);
+ var cols = numMonths[1];
+ var width = 17;
+ if (cols > 1)
+ inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
+ else
+ inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
+ inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-multi');
+ inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-rtl');
+ if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input &&
+ inst.input.is(':visible') && !inst.input.is(':disabled'))
+ inst.input.focus();
+ },
+
+ /* Retrieve the size of left and top borders for an element.
+ @param elem (jQuery object) the element of interest
+ @return (number[2]) the left and top borders */
+ _getBorders: function(elem) {
+ var convert = function(value) {
+ return {thin: 1, medium: 2, thick: 3}[value] || value;
+ };
+ return [parseFloat(convert(elem.css('border-left-width'))),
+ parseFloat(convert(elem.css('border-top-width')))];
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function(inst, offset, isFixed) {
+ var dpWidth = inst.dpDiv.outerWidth();
+ var dpHeight = inst.dpDiv.outerHeight();
+ var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+ var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+ var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft();
+ var viewHeight = document.documentElement.clientHeight + $(document).scrollTop();
+
+ offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
+ Math.abs(offset.left + dpWidth - viewWidth) : 0);
+ offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
+ Math.abs(dpHeight + inputHeight) : 0);
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function(obj) {
+ var inst = this._getInst(obj);
+ var isRTL = this._get(inst, 'isRTL');
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
+ obj = obj[isRTL ? 'previousSibling' : 'nextSibling'];
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Hide the date picker from view.
+ @param input element - the input field attached to the date picker */
+ _hideDatepicker: function(input) {
+ var inst = this._curInst;
+ if (!inst || (input && inst != $.data(input, PROP_NAME)))
+ return;
+ if (this._datepickerShowing) {
+ var showAnim = this._get(inst, 'showAnim');
+ var duration = this._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._tidyDialog(inst);
+ this._curInst = null;
+ };
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' :
+ (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess);
+ if (!showAnim)
+ postProcess();
+ var onClose = this._get(inst, 'onClose');
+ if (onClose)
+ onClose.apply((inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
+ this._datepickerShowing = false;
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+ if ($.blockUI) {
+ $.unblockUI();
+ $('body').append(this.dpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ },
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function(inst) {
+ inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
+ },
+
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function(event) {
+ if (!$.datepicker._curInst)
+ return;
+ var $target = $(event.target);
+ if ($target[0].id != $.datepicker._mainDivId &&
+ $target.parents('#' + $.datepicker._mainDivId).length == 0 &&
+ !$target.hasClass($.datepicker.markerClassName) &&
+ !$target.hasClass($.datepicker._triggerClass) &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
+ $.datepicker._hideDatepicker();
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function(id, offset, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ this._adjustInstDate(inst, offset +
+ (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
+ period);
+ this._updateDatepicker(inst);
+ },
+
+ /* Action for current link. */
+ _gotoToday: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ }
+ else {
+ var date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function(id, select, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst._selectingMonthYear = false;
+ inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
+ inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
+ parseInt(select.options[select.selectedIndex].value,10);
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Restore input focus after not changing month/year. */
+ _clickMonthYear: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (inst.input && inst._selectingMonthYear && !$.browser.msie)
+ inst.input.focus();
+ inst._selectingMonthYear = !inst._selectingMonthYear;
+ },
+
+ /* Action for selecting a day. */
+ _selectDay: function(id, month, year, td) {
+ var target = $(id);
+ if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ var inst = this._getInst(target[0]);
+ inst.selectedDay = inst.currentDay = $('a', td).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ this._selectDate(id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ },
+
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ this._selectDate(target, '');
+ },
+
+ /* Update the input field with the selected date. */
+ _selectDate: function(id, dateStr) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+ if (inst.input)
+ inst.input.val(dateStr);
+ this._updateAlternate(inst);
+ var onSelect = this._get(inst, 'onSelect');
+ if (onSelect)
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
+ else if (inst.input)
+ inst.input.trigger('change'); // fire the change event
+ if (inst.inline)
+ this._updateDatepicker(inst);
+ else {
+ this._hideDatepicker();
+ this._lastInput = inst.input[0];
+ if (typeof(inst.input[0]) != 'object')
+ inst.input.focus(); // restore focus
+ this._lastInput = null;
+ }
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst) {
+ var altField = this._get(inst, 'altField');
+ if (altField) { // update alternate field too
+ var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
+ var date = this._getDate(inst);
+ var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+ $(altField).each(function() { $(this).val(dateStr); });
+ }
+ },
+
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ @param date Date - the date to customise
+ @return [boolean, string] - is this date selectable?, what is its CSS class? */
+ noWeekends: function(date) {
+ var day = date.getDay();
+ return [(day > 0 && day < 6), ''];
+ },
+
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ @param date Date - the date to get the week for
+ @return number - the number of the week within the year that contains this date */
+ iso8601Week: function(date) {
+ var checkDate = new Date(date.getTime());
+ // Find Thursday of this week starting on Monday
+ checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
+ var time = checkDate.getTime();
+ checkDate.setMonth(0); // Compare with Jan 1
+ checkDate.setDate(1);
+ return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
+ },
+
+ /* Parse a string value into a date object.
+ See formatDate below for the possible formats.
+
+ @param format string - the expected format of the date
+ @param value string - the date in the above format
+ @param settings Object - attributes include:
+ shortYearCutoff number - the cutoff year for determining the century (optional)
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return Date - the extracted date value or null if value is blank */
+ parseDate: function (format, value, settings) {
+ if (format == null || value == null)
+ throw 'Invalid arguments';
+ value = (typeof value == 'object' ? value.toString() : value + '');
+ if (value == '')
+ return null;
+ var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ var year = -1;
+ var month = -1;
+ var day = -1;
+ var doy = -1;
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Extract a number from the string value
+ var getNumber = function(match) {
+ lookAhead(match);
+ var size = (match == '@' ? 14 : (match == '!' ? 20 :
+ (match == 'y' ? 4 : (match == 'o' ? 3 : 2))));
+ var digits = new RegExp('^\\d{1,' + size + '}');
+ var num = value.substring(iValue).match(digits);
+ if (!num)
+ throw 'Missing number at position ' + iValue;
+ iValue += num[0].length;
+ return parseInt(num[0], 10);
+ };
+ // Extract a name from the string value and convert to an index
+ var getName = function(match, shortNames, longNames) {
+ var names = (lookAhead(match) ? longNames : shortNames);
+ for (var i = 0; i < names.length; i++) {
+ if (value.substr(iValue, names[i].length) == names[i]) {
+ iValue += names[i].length;
+ return i + 1;
+ }
+ }
+ throw 'Unknown name at position ' + iValue;
+ };
+ // Confirm that a literal character matches the string value
+ var checkLiteral = function() {
+ if (value.charAt(iValue) != format.charAt(iFormat))
+ throw 'Unexpected literal at position ' + iValue;
+ iValue++;
+ };
+ var iValue = 0;
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ checkLiteral();
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ day = getNumber('d');
+ break;
+ case 'D':
+ getName('D', dayNamesShort, dayNames);
+ break;
+ case 'o':
+ doy = getNumber('o');
+ break;
+ case 'm':
+ month = getNumber('m');
+ break;
+ case 'M':
+ month = getName('M', monthNamesShort, monthNames);
+ break;
+ case 'y':
+ year = getNumber('y');
+ break;
+ case '@':
+ var date = new Date(getNumber('@'));
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case '!':
+ var date = new Date((getNumber('!') - this._ticksTo1970) / 10000);
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ checkLiteral();
+ else
+ literal = true;
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ if (year == -1)
+ year = new Date().getFullYear();
+ else if (year < 100)
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ (year <= shortYearCutoff ? 0 : -100);
+ if (doy > -1) {
+ month = 1;
+ day = doy;
+ do {
+ var dim = this._getDaysInMonth(year, month - 1);
+ if (day <= dim)
+ break;
+ month++;
+ day -= dim;
+ } while (true);
+ }
+ var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+ if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
+ throw 'Invalid date'; // E.g. 31/02/*
+ return date;
+ },
+
+ /* Standard date formats. */
+ ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
+ COOKIE: 'D, dd M yy',
+ ISO_8601: 'yy-mm-dd',
+ RFC_822: 'D, d M y',
+ RFC_850: 'DD, dd-M-y',
+ RFC_1036: 'D, d M y',
+ RFC_1123: 'D, d M yy',
+ RFC_2822: 'D, d M yy',
+ RSS: 'D, d M y', // RFC 822
+ TICKS: '!',
+ TIMESTAMP: '@',
+ W3C: 'yy-mm-dd', // ISO 8601
+
+ _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
+ Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
+
+ /* Format a date object into a string value.
+ The format can be combinations of the following:
+ d - day of month (no leading zero)
+ dd - day of month (two digit)
+ o - day of year (no leading zeros)
+ oo - day of year (three digit)
+ D - day name short
+ DD - day name long
+ m - month of year (no leading zero)
+ mm - month of year (two digit)
+ M - month name short
+ MM - month name long
+ y - year (two digit)
+ yy - year (four digit)
+ @ - Unix timestamp (ms since 01/01/1970)
+ ! - Windows ticks (100ns since 01/01/0001)
+ '...' - literal text
+ '' - single quote
+
+ @param format string - the desired format of the date
+ @param date Date - the date value to format
+ @param settings Object - attributes include:
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return string - the date in the above format */
+ formatDate: function (format, date, settings) {
+ if (!date)
+ return '';
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Format a number, with leading zero if necessary
+ var formatNumber = function(match, value, len) {
+ var num = '' + value;
+ if (lookAhead(match))
+ while (num.length < len)
+ num = '0' + num;
+ return num;
+ };
+ // Format a name, short or long as requested
+ var formatName = function(match, value, shortNames, longNames) {
+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
+ };
+ var output = '';
+ var literal = false;
+ if (date)
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ output += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ output += formatNumber('d', date.getDate(), 2);
+ break;
+ case 'D':
+ output += formatName('D', date.getDay(), dayNamesShort, dayNames);
+ break;
+ case 'o':
+ output += formatNumber('o',
+ (date.getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000, 3);
+ break;
+ case 'm':
+ output += formatNumber('m', date.getMonth() + 1, 2);
+ break;
+ case 'M':
+ output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
+ break;
+ case 'y':
+ output += (lookAhead('y') ? date.getFullYear() :
+ (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
+ break;
+ case '@':
+ output += date.getTime();
+ break;
+ case '!':
+ output += date.getTime() * 10000 + this._ticksTo1970;
+ break;
+ case "'":
+ if (lookAhead("'"))
+ output += "'";
+ else
+ literal = true;
+ break;
+ default:
+ output += format.charAt(iFormat);
+ }
+ }
+ return output;
+ },
+
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function (format) {
+ var chars = '';
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ for (var iFormat = 0; iFormat < format.length; iFormat++)
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ chars += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd': case 'm': case 'y': case '@':
+ chars += '0123456789';
+ break;
+ case 'D': case 'M':
+ return null; // Accept anything
+ case "'":
+ if (lookAhead("'"))
+ chars += "'";
+ else
+ literal = true;
+ break;
+ default:
+ chars += format.charAt(iFormat);
+ }
+ return chars;
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function(inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function(inst, noDefault) {
+ if (inst.input.val() == inst.lastVal) {
+ return;
+ }
+ var dateFormat = this._get(inst, 'dateFormat');
+ var dates = inst.lastVal = inst.input ? inst.input.val() : null;
+ var date, defaultDate;
+ date = defaultDate = this._getDefaultDate(inst);
+ var settings = this._getFormatConfig(inst);
+ try {
+ date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+ } catch (event) {
+ this.log(event);
+ dates = (noDefault ? '' : dates);
+ }
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = (dates ? date.getDate() : 0);
+ inst.currentMonth = (dates ? date.getMonth() : 0);
+ inst.currentYear = (dates ? date.getFullYear() : 0);
+ this._adjustInstDate(inst);
+ },
+
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function(inst) {
+ return this._restrictMinMax(inst,
+ this._determineDate(inst, this._get(inst, 'defaultDate'), new Date()));
+ },
+
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function(inst, date, defaultDate) {
+ var offsetNumeric = function(offset) {
+ var date = new Date();
+ date.setDate(date.getDate() + offset);
+ return date;
+ };
+ var offsetString = function(offset) {
+ try {
+ return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+ offset, $.datepicker._getFormatConfig(inst));
+ }
+ catch (e) {
+ // Ignore
+ }
+ var date = (offset.toLowerCase().match(/^c/) ?
+ $.datepicker._getDate(inst) : null) || new Date();
+ var year = date.getFullYear();
+ var month = date.getMonth();
+ var day = date.getDate();
+ var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
+ var matches = pattern.exec(offset);
+ while (matches) {
+ switch (matches[2] || 'd') {
+ case 'd' : case 'D' :
+ day += parseInt(matches[1],10); break;
+ case 'w' : case 'W' :
+ day += parseInt(matches[1],10) * 7; break;
+ case 'm' : case 'M' :
+ month += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ case 'y': case 'Y' :
+ year += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ }
+ matches = pattern.exec(offset);
+ }
+ return new Date(year, month, day);
+ };
+ date = (date == null ? defaultDate : (typeof date == 'string' ? offsetString(date) :
+ (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
+ date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
+ if (date) {
+ date.setHours(0);
+ date.setMinutes(0);
+ date.setSeconds(0);
+ date.setMilliseconds(0);
+ }
+ return this._daylightSavingAdjust(date);
+ },
+
+ /* Handle switch to/from daylight saving.
+ Hours may be non-zero on daylight saving cut-over:
+ > 12 when midnight changeover, but then cannot generate
+ midnight datetime, so jump to 1AM, otherwise reset.
+ @param date (Date) the date to check
+ @return (Date) the corrected date */
+ _daylightSavingAdjust: function(date) {
+ if (!date) return null;
+ date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+ return date;
+ },
+
+ /* Set the date(s) directly. */
+ _setDate: function(inst, date, noChange) {
+ var clear = !(date);
+ var origMonth = inst.selectedMonth;
+ var origYear = inst.selectedYear;
+ date = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));
+ inst.selectedDay = inst.currentDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
+ if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange)
+ this._notifyChange(inst);
+ this._adjustInstDate(inst);
+ if (inst.input) {
+ inst.input.val(clear ? '' : this._formatDate(inst));
+ }
+ },
+
+ /* Retrieve the date(s) directly. */
+ _getDate: function(inst) {
+ var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
+ this._daylightSavingAdjust(new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return startDate;
+ },
+
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function(inst) {
+ var today = new Date();
+ today = this._daylightSavingAdjust(
+ new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
+ var isRTL = this._get(inst, 'isRTL');
+ var showButtonPanel = this._get(inst, 'showButtonPanel');
+ var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
+ var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
+ var numMonths = this._getNumberOfMonths(inst);
+ var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
+ var stepMonths = this._get(inst, 'stepMonths');
+ var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
+ var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var drawMonth = inst.drawMonth - showCurrentAtPos;
+ var drawYear = inst.drawYear;
+ if (drawMonth < 0) {
+ drawMonth += 12;
+ drawYear--;
+ }
+ if (maxDate) {
+ var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+ maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
+ maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+ while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+ drawMonth--;
+ if (drawMonth < 0) {
+ drawMonth = 11;
+ drawYear--;
+ }
+ }
+ }
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+ var prevText = this._get(inst, 'prevText');
+ prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
+ ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
+ var nextText = this._get(inst, 'nextText');
+ nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
+ ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
+ var currentText = this._get(inst, 'currentText');
+ var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
+ currentText = (!navigationAsDateFormat ? currentText :
+ this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+ var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
+ var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
+ (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._gotoToday(\'#' + inst.id + '\');"' +
+ '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
+ var firstDay = parseInt(this._get(inst, 'firstDay'),10);
+ firstDay = (isNaN(firstDay) ? 0 : firstDay);
+ var showWeek = this._get(inst, 'showWeek');
+ var dayNames = this._get(inst, 'dayNames');
+ var dayNamesShort = this._get(inst, 'dayNamesShort');
+ var dayNamesMin = this._get(inst, 'dayNamesMin');
+ var monthNames = this._get(inst, 'monthNames');
+ var monthNamesShort = this._get(inst, 'monthNamesShort');
+ var beforeShowDay = this._get(inst, 'beforeShowDay');
+ var showOtherMonths = this._get(inst, 'showOtherMonths');
+ var selectOtherMonths = this._get(inst, 'selectOtherMonths');
+ var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
+ var defaultDate = this._getDefaultDate(inst);
+ var html = '';
+ for (var row = 0; row < numMonths[0]; row++) {
+ var group = '';
+ for (var col = 0; col < numMonths[1]; col++) {
+ var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+ var cornerClass = ' ui-corner-all';
+ var calender = '';
+ if (isMultiMonth) {
+ calender += '<div class="ui-datepicker-group';
+ if (numMonths[1] > 1)
+ switch (col) {
+ case 0: calender += ' ui-datepicker-group-first';
+ cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
+ case numMonths[1]-1: calender += ' ui-datepicker-group-last';
+ cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
+ default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break;
+ }
+ calender += '">';
+ }
+ calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
+ (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
+ (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
+ this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+ row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+ '</div><table class="ui-datepicker-calendar"><thead>' +
+ '<tr>';
+ var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : '');
+ for (var dow = 0; dow < 7; dow++) { // days of the week
+ var day = (dow + firstDay) % 7;
+ thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
+ '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
+ }
+ calender += thead + '</tr></thead><tbody>';
+ var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+ if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
+ inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+ var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+ var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
+ var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+ for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+ calender += '<tr>';
+ var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' +
+ this._get(inst, 'calculateWeek')(printDate) + '</td>');
+ for (var dow = 0; dow < 7; dow++) { // create date picker days
+ var daySettings = (beforeShowDay ?
+ beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
+ var otherMonth = (printDate.getMonth() != drawMonth);
+ var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
+ (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+ tbody += '<td class="' +
+ ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
+ (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
+ ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
+ (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ ' ' + this._dayOverClass : '') + // highlight selected day
+ (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
+ (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
+ (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day
+ (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
+ ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
+ (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' +
+ inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions
+ (otherMonth && !showOtherMonths ? ' ' : // display for other months
+ (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
+ (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
+ (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day
+ (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months
+ '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date
+ printDate.setDate(printDate.getDate() + 1);
+ printDate = this._daylightSavingAdjust(printDate);
+ }
+ calender += tbody + '</tr>';
+ }
+ drawMonth++;
+ if (drawMonth > 11) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
+ ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
+ group += calender;
+ }
+ html += group;
+ }
+ html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
+ inst._keyEvent = false;
+ return html;
+ },
+
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
+ secondary, monthNames, monthNamesShort) {
+ var changeMonth = this._get(inst, 'changeMonth');
+ var changeYear = this._get(inst, 'changeYear');
+ var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
+ var html = '<div class="ui-datepicker-title">';
+ var monthHtml = '';
+ // month selection
+ if (secondary || !changeMonth)
+ monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>';
+ else {
+ var inMinYear = (minDate && minDate.getFullYear() == drawYear);
+ var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
+ monthHtml += '<select class="ui-datepicker-month" ' +
+ 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
+ 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (var month = 0; month < 12; month++) {
+ if ((!inMinYear || month >= minDate.getMonth()) &&
+ (!inMaxYear || month <= maxDate.getMonth()))
+ monthHtml += '<option value="' + month + '"' +
+ (month == drawMonth ? ' selected="selected"' : '') +
+ '>' + monthNamesShort[month] + '</option>';
+ }
+ monthHtml += '</select>';
+ }
+ if (!showMonthAfterYear)
+ html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : '');
+ // year selection
+ if (secondary || !changeYear)
+ html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
+ else {
+ // determine range of years to display
+ var years = this._get(inst, 'yearRange').split(':');
+ var thisYear = new Date().getFullYear();
+ var determineYear = function(value) {
+ var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) :
+ (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) :
+ parseInt(value, 10)));
+ return (isNaN(year) ? thisYear : year);
+ };
+ var year = determineYear(years[0]);
+ var endYear = Math.max(year, determineYear(years[1] || ''));
+ year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+ endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+ html += '<select class="ui-datepicker-year" ' +
+ 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
+ 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (; year <= endYear; year++) {
+ html += '<option value="' + year + '"' +
+ (year == drawYear ? ' selected="selected"' : '') +
+ '>' + year + '</option>';
+ }
+ html += '</select>';
+ }
+ html += this._get(inst, 'yearSuffix');
+ if (showMonthAfterYear)
+ html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml;
+ html += '</div>'; // Close datepicker_header
+ return html;
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function(inst, offset, period) {
+ var year = inst.drawYear + (period == 'Y' ? offset : 0);
+ var month = inst.drawMonth + (period == 'M' ? offset : 0);
+ var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
+ (period == 'D' ? offset : 0);
+ var date = this._restrictMinMax(inst,
+ this._daylightSavingAdjust(new Date(year, month, day)));
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if (period == 'M' || period == 'Y')
+ this._notifyChange(inst);
+ },
+
+ /* Ensure a date is within any min/max bounds. */
+ _restrictMinMax: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ date = (minDate && date < minDate ? minDate : date);
+ date = (maxDate && date > maxDate ? maxDate : date);
+ return date;
+ },
+
+ /* Notify change of month/year. */
+ _notifyChange: function(inst) {
+ var onChange = this._get(inst, 'onChangeMonthYear');
+ if (onChange)
+ onChange.apply((inst.input ? inst.input[0] : null),
+ [inst.selectedYear, inst.selectedMonth + 1, inst]);
+ },
+
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function(inst) {
+ var numMonths = this._get(inst, 'numberOfMonths');
+ return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+ },
+
+ /* Determine the current maximum date - ensure no time components are set. */
+ _getMinMaxDate: function(inst, minMax) {
+ return this._determineDate(inst, this._get(inst, minMax + 'Date'), null);
+ },
+
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function(year, month) {
+ return 32 - new Date(year, month, 32).getDate();
+ },
+
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function(year, month) {
+ return new Date(year, month, 1).getDay();
+ },
+
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function(inst, offset, curYear, curMonth) {
+ var numMonths = this._getNumberOfMonths(inst);
+ var date = this._daylightSavingAdjust(new Date(curYear,
+ curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
+ if (offset < 0)
+ date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+ return this._isInRange(inst, date);
+ },
+
+ /* Is the given date in the accepted range? */
+ _isInRange: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ return ((!minDate || date.getTime() >= minDate.getTime()) &&
+ (!maxDate || date.getTime() <= maxDate.getTime()));
+ },
+
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function(inst) {
+ var shortYearCutoff = this._get(inst, 'shortYearCutoff');
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ return {shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
+ monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+ },
+
+ /* Format the given date for display. */
+ _formatDate: function(inst, day, month, year) {
+ if (!day) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = (day ? (typeof day == 'object' ? day :
+ this._daylightSavingAdjust(new Date(year, month, day))) :
+ this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
+ }
+});
+
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props)
+ if (props[name] == null || props[name] == undefined)
+ target[name] = props[name];
+ return target;
+};
+
+/* Determine whether an object is an array. */
+function isArray(a) {
+ return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
+ (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
+};
+
+/* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+$.fn.datepicker = function(options){
+
+ /* Initialise the date picker. */
+ if (!$.datepicker.initialized) {
+ $(document).mousedown($.datepicker._checkExternalClick).
+ find('body').append($.datepicker.dpDiv);
+ $.datepicker.initialized = true;
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget'))
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ return this.each(function() {
+ typeof options == 'string' ?
+ $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this].concat(otherArgs)) :
+ $.datepicker._attachDatepicker(this, options);
+ });
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.8.1";
+
+// Workaround for #4055
+// Add another global to avoid noConflict issues with inline event handlers
+window['DP_jQuery_' + dpuuid] = $;
+
+})(jQuery);
+/*
+ * jQuery UI Progressbar 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $ ) {
+
+$.widget( "ui.progressbar", {
+ options: {
+ value: 0
+ },
+ _create: function() {
+ this.element
+ .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .attr({
+ role: "progressbar",
+ "aria-valuemin": this._valueMin(),
+ "aria-valuemax": this._valueMax(),
+ "aria-valuenow": this._value()
+ });
+
+ this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" )
+ .appendTo( this.element );
+
+ this._refreshValue();
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-valuemin" )
+ .removeAttr( "aria-valuemax" )
+ .removeAttr( "aria-valuenow" );
+
+ this.valueDiv.remove();
+
+ $.Widget.prototype.destroy.apply( this, arguments );
+ },
+
+ value: function( newValue ) {
+ if ( newValue === undefined ) {
+ return this._value();
+ }
+
+ this._setOption( "value", newValue );
+ return this;
+ },
+
+ _setOption: function( key, value ) {
+ switch ( key ) {
+ case "value":
+ this.options.value = value;
+ this._refreshValue();
+ this._trigger( "change" );
+ break;
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+ },
+
+ _value: function() {
+ var val = this.options.value;
+ // normalize invalid value
+ if ( typeof val !== "number" ) {
+ val = 0;
+ }
+ if ( val < this._valueMin() ) {
+ val = this._valueMin();
+ }
+ if ( val > this._valueMax() ) {
+ val = this._valueMax();
+ }
+
+ return val;
+ },
+
+ _valueMin: function() {
+ return 0;
+ },
+
+ _valueMax: function() {
+ return 100;
+ },
+
+ _refreshValue: function() {
+ var value = this.value();
+ this.valueDiv
+ [ value === this._valueMax() ? "addClass" : "removeClass"]( "ui-corner-right" )
+ .width( value + "%" );
+ this.element.attr( "aria-valuenow", value );
+ }
+});
+
+$.extend( $.ui.progressbar, {
+ version: "1.8.1"
+});
+
+})( jQuery );
+/*
+ * jQuery UI Effects 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+;jQuery.effects || (function($) {
+
+$.effects = {};
+
+
+
+/******************************************************************************/
+/****************************** COLOR ANIMATIONS ******************************/
+/******************************************************************************/
+
+// override the animation for color styles
+$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor',
+ 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'],
+function(i, attr) {
+ $.fx.step[attr] = function(fx) {
+ if (!fx.colorInit) {
+ fx.start = getColor(fx.elem, attr);
+ fx.end = getRGB(fx.end);
+ fx.colorInit = true;
+ }
+
+ fx.elem.style[attr] = 'rgb(' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')';
+ };
+});
+
+// Color Conversion functions from highlightFade
+// By Blair Mitchelmore
+// http://jquery.offput.ca/highlightFade/
+
+// Parse strings looking for color tuples [255,255,255]
+function getRGB(color) {
+ var result;
+
+ // Check if we're already dealing with an array of colors
+ if ( color && color.constructor == Array && color.length == 3 )
+ return color;
+
+ // Look for rgb(num,num,num)
+ if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
+ return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
+
+ // Look for rgb(num%,num%,num%)
+ if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
+ return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
+
+ // Look for #a0b1c2
+ if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
+ return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
+
+ // Look for #fff
+ if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
+ return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
+
+ // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
+ if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
+ return colors['transparent'];
+
+ // Otherwise, we're most likely dealing with a named color
+ return colors[$.trim(color).toLowerCase()];
+}
+
+function getColor(elem, attr) {
+ var color;
+
+ do {
+ color = $.curCSS(elem, attr);
+
+ // Keep going until we find an element that has color, or we hit the body
+ if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
+ break;
+
+ attr = "backgroundColor";
+ } while ( elem = elem.parentNode );
+
+ return getRGB(color);
+};
+
+// Some named colors to work with
+// From Interface by Stefan Petre
+// http://interface.eyecon.ro/
+
+var colors = {
+ aqua:[0,255,255],
+ azure:[240,255,255],
+ beige:[245,245,220],
+ black:[0,0,0],
+ blue:[0,0,255],
+ brown:[165,42,42],
+ cyan:[0,255,255],
+ darkblue:[0,0,139],
+ darkcyan:[0,139,139],
+ darkgrey:[169,169,169],
+ darkgreen:[0,100,0],
+ darkkhaki:[189,183,107],
+ darkmagenta:[139,0,139],
+ darkolivegreen:[85,107,47],
+ darkorange:[255,140,0],
+ darkorchid:[153,50,204],
+ darkred:[139,0,0],
+ darksalmon:[233,150,122],
+ darkviolet:[148,0,211],
+ fuchsia:[255,0,255],
+ gold:[255,215,0],
+ green:[0,128,0],
+ indigo:[75,0,130],
+ khaki:[240,230,140],
+ lightblue:[173,216,230],
+ lightcyan:[224,255,255],
+ lightgreen:[144,238,144],
+ lightgrey:[211,211,211],
+ lightpink:[255,182,193],
+ lightyellow:[255,255,224],
+ lime:[0,255,0],
+ magenta:[255,0,255],
+ maroon:[128,0,0],
+ navy:[0,0,128],
+ olive:[128,128,0],
+ orange:[255,165,0],
+ pink:[255,192,203],
+ purple:[128,0,128],
+ violet:[128,0,128],
+ red:[255,0,0],
+ silver:[192,192,192],
+ white:[255,255,255],
+ yellow:[255,255,0],
+ transparent: [255,255,255]
+};
+
+
+
+/******************************************************************************/
+/****************************** CLASS ANIMATIONS ******************************/
+/******************************************************************************/
+
+var classAnimationActions = ['add', 'remove', 'toggle'],
+ shorthandStyles = {
+ border: 1,
+ borderBottom: 1,
+ borderColor: 1,
+ borderLeft: 1,
+ borderRight: 1,
+ borderTop: 1,
+ borderWidth: 1,
+ margin: 1,
+ padding: 1
+ };
+
+function getElementStyles() {
+ var style = document.defaultView
+ ? document.defaultView.getComputedStyle(this, null)
+ : this.currentStyle,
+ newStyle = {},
+ key,
+ camelCase;
+
+ // webkit enumerates style porperties
+ if (style && style.length && style[0] && style[style[0]]) {
+ var len = style.length;
+ while (len--) {
+ key = style[len];
+ if (typeof style[key] == 'string') {
+ camelCase = key.replace(/\-(\w)/g, function(all, letter){
+ return letter.toUpperCase();
+ });
+ newStyle[camelCase] = style[key];
+ }
+ }
+ } else {
+ for (key in style) {
+ if (typeof style[key] === 'string') {
+ newStyle[key] = style[key];
+ }
+ }
+ }
+
+ return newStyle;
+}
+
+function filterStyles(styles) {
+ var name, value;
+ for (name in styles) {
+ value = styles[name];
+ if (
+ // ignore null and undefined values
+ value == null ||
+ // ignore functions (when does this occur?)
+ $.isFunction(value) ||
+ // shorthand styles that need to be expanded
+ name in shorthandStyles ||
+ // ignore scrollbars (break in IE)
+ (/scrollbar/).test(name) ||
+
+ // only colors or values that can be converted to numbers
+ (!(/color/i).test(name) && isNaN(parseFloat(value)))
+ ) {
+ delete styles[name];
+ }
+ }
+
+ return styles;
+}
+
+function styleDifference(oldStyle, newStyle) {
+ var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459
+ name;
+
+ for (name in newStyle) {
+ if (oldStyle[name] != newStyle[name]) {
+ diff[name] = newStyle[name];
+ }
+ }
+
+ return diff;
+}
+
+$.effects.animateClass = function(value, duration, easing, callback) {
+ if ($.isFunction(easing)) {
+ callback = easing;
+ easing = null;
+ }
+
+ return this.each(function() {
+
+ var that = $(this),
+ originalStyleAttr = that.attr('style') || ' ',
+ originalStyle = filterStyles(getElementStyles.call(this)),
+ newStyle,
+ className = that.attr('className');
+
+ $.each(classAnimationActions, function(i, action) {
+ if (value[action]) {
+ that[action + 'Class'](value[action]);
+ }
+ });
+ newStyle = filterStyles(getElementStyles.call(this));
+ that.attr('className', className);
+
+ that.animate(styleDifference(originalStyle, newStyle), duration, easing, function() {
+ $.each(classAnimationActions, function(i, action) {
+ if (value[action]) { that[action + 'Class'](value[action]); }
+ });
+ // work around bug in IE by clearing the cssText before setting it
+ if (typeof that.attr('style') == 'object') {
+ that.attr('style').cssText = '';
+ that.attr('style').cssText = originalStyleAttr;
+ } else {
+ that.attr('style', originalStyleAttr);
+ }
+ if (callback) { callback.apply(this, arguments); }
+ });
+ });
+};
+
+$.fn.extend({
+ _addClass: $.fn.addClass,
+ addClass: function(classNames, speed, easing, callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
+ },
+
+ _removeClass: $.fn.removeClass,
+ removeClass: function(classNames,speed,easing,callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
+ },
+
+ _toggleClass: $.fn.toggleClass,
+ toggleClass: function(classNames, force, speed, easing, callback) {
+ if ( typeof force == "boolean" || force === undefined ) {
+ if ( !speed ) {
+ // without speed parameter;
+ return this._toggleClass(classNames, force);
+ } else {
+ return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]);
+ }
+ } else {
+ // without switch parameter;
+ return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]);
+ }
+ },
+
+ switchClass: function(remove,add,speed,easing,callback) {
+ return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
+ }
+});
+
+
+
+/******************************************************************************/
+/*********************************** EFFECTS **********************************/
+/******************************************************************************/
+
+$.extend($.effects, {
+ version: "1.8.1",
+
+ // Saves a set of properties in a data storage
+ save: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+ }
+ },
+
+ // Restores a set of previously saved properties from a data storage
+ restore: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+ }
+ },
+
+ setMode: function(el, mode) {
+ if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
+ return mode;
+ },
+
+ getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
+ // this should be a little more flexible in the future to handle a string & hash
+ var y, x;
+ switch (origin[0]) {
+ case 'top': y = 0; break;
+ case 'middle': y = 0.5; break;
+ case 'bottom': y = 1; break;
+ default: y = origin[0] / original.height;
+ };
+ switch (origin[1]) {
+ case 'left': x = 0; break;
+ case 'center': x = 0.5; break;
+ case 'right': x = 1; break;
+ default: x = origin[1] / original.width;
+ };
+ return {x: x, y: y};
+ },
+
+ // Wraps the element around a wrapper that copies position properties
+ createWrapper: function(element) {
+
+ // if the element is already wrapped, return it
+ if (element.parent().is('.ui-effects-wrapper')) {
+ return element.parent();
+ }
+
+ // wrap the element
+ var props = {
+ width: element.outerWidth(true),
+ height: element.outerHeight(true),
+ 'float': element.css('float')
+ },
+ wrapper = $('<div></div>')
+ .addClass('ui-effects-wrapper')
+ .css({
+ fontSize: '100%',
+ background: 'transparent',
+ border: 'none',
+ margin: 0,
+ padding: 0
+ });
+
+ element.wrap(wrapper);
+ wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element
+
+ // transfer positioning properties to the wrapper
+ if (element.css('position') == 'static') {
+ wrapper.css({ position: 'relative' });
+ element.css({ position: 'relative' });
+ } else {
+ $.extend(props, {
+ position: element.css('position'),
+ zIndex: element.css('z-index')
+ });
+ $.each(['top', 'left', 'bottom', 'right'], function(i, pos) {
+ props[pos] = element.css(pos);
+ if (isNaN(parseInt(props[pos], 10))) {
+ props[pos] = 'auto';
+ }
+ });
+ element.css({position: 'relative', top: 0, left: 0 });
+ }
+
+ return wrapper.css(props).show();
+ },
+
+ removeWrapper: function(element) {
+ if (element.parent().is('.ui-effects-wrapper'))
+ return element.parent().replaceWith(element);
+ return element;
+ },
+
+ setTransition: function(element, list, factor, value) {
+ value = value || {};
+ $.each(list, function(i, x){
+ unit = element.cssUnit(x);
+ if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
+ });
+ return value;
+ }
+});
+
+
+function _normalizeArguments(effect, options, speed, callback) {
+ // shift params for method overloading
+ if (typeof effect == 'object') {
+ callback = options;
+ speed = null;
+ options = effect;
+ effect = options.effect;
+ }
+ if ($.isFunction(options)) {
+ callback = options;
+ speed = null;
+ options = {};
+ }
+ if ($.isFunction(speed)) {
+ callback = speed;
+ speed = null;
+ }
+ if (typeof options == 'number' || $.fx.speeds[options]) {
+ callback = speed;
+ speed = options;
+ options = {};
+ }
+
+ options = options || {};
+
+ speed = speed || options.duration;
+ speed = $.fx.off ? 0 : typeof speed == 'number'
+ ? speed : $.fx.speeds[speed] || $.fx.speeds._default;
+
+ callback = callback || options.complete;
+
+ return [effect, options, speed, callback];
+}
+
+$.fn.extend({
+ effect: function(effect, options, speed, callback) {
+ var args = _normalizeArguments.apply(this, arguments),
+ // TODO: make effects takes actual parameters instead of a hash
+ args2 = {
+ options: args[1],
+ duration: args[2],
+ callback: args[3]
+ },
+ effectMethod = $.effects[effect];
+
+ return effectMethod && !$.fx.off ? effectMethod.call(this, args2) : this;
+ },
+
+ _show: $.fn.show,
+ show: function(speed) {
+ if (!speed || typeof speed == 'number' || $.fx.speeds[speed]) {
+ return this._show.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'show';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ _hide: $.fn.hide,
+ hide: function(speed) {
+ if (!speed || typeof speed == 'number' || $.fx.speeds[speed]) {
+ return this._hide.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'hide';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ // jQuery core overloads toggle and create _toggle
+ __toggle: $.fn.toggle,
+ toggle: function(speed) {
+ if (!speed || typeof speed == 'number' || $.fx.speeds[speed] ||
+ typeof speed == 'boolean' || $.isFunction(speed)) {
+ return this.__toggle.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'toggle';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ // helper functions
+ cssUnit: function(key) {
+ var style = this.css(key), val = [];
+ $.each( ['em','px','%','pt'], function(i, unit){
+ if(style.indexOf(unit) > 0)
+ val = [parseFloat(style), unit];
+ });
+ return val;
+ }
+});
+
+
+
+/******************************************************************************/
+/*********************************** EASING ***********************************/
+/******************************************************************************/
+
+/*
+ * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
+ *
+ * Uses the built in easing capabilities added In jQuery 1.1
+ * to offer multiple easing options
+ *
+ * TERMS OF USE - jQuery Easing
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2008 George McGinley Smith
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+*/
+
+// t: current time, b: begInnIng value, c: change In value, d: duration
+$.easing.jswing = $.easing.swing;
+
+$.extend($.easing,
+{
+ def: 'easeOutQuad',
+ swing: function (x, t, b, c, d) {
+ //alert($.easing.default);
+ return $.easing[$.easing.def](x, t, b, c, d);
+ },
+ easeInQuad: function (x, t, b, c, d) {
+ return c*(t/=d)*t + b;
+ },
+ easeOutQuad: function (x, t, b, c, d) {
+ return -c *(t/=d)*(t-2) + b;
+ },
+ easeInOutQuad: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t + b;
+ return -c/2 * ((--t)*(t-2) - 1) + b;
+ },
+ easeInCubic: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t + b;
+ },
+ easeOutCubic: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t + 1) + b;
+ },
+ easeInOutCubic: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t + b;
+ return c/2*((t-=2)*t*t + 2) + b;
+ },
+ easeInQuart: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t + b;
+ },
+ easeOutQuart: function (x, t, b, c, d) {
+ return -c * ((t=t/d-1)*t*t*t - 1) + b;
+ },
+ easeInOutQuart: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
+ return -c/2 * ((t-=2)*t*t*t - 2) + b;
+ },
+ easeInQuint: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t*t + b;
+ },
+ easeOutQuint: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t*t*t + 1) + b;
+ },
+ easeInOutQuint: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
+ return c/2*((t-=2)*t*t*t*t + 2) + b;
+ },
+ easeInSine: function (x, t, b, c, d) {
+ return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
+ },
+ easeOutSine: function (x, t, b, c, d) {
+ return c * Math.sin(t/d * (Math.PI/2)) + b;
+ },
+ easeInOutSine: function (x, t, b, c, d) {
+ return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
+ },
+ easeInExpo: function (x, t, b, c, d) {
+ return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
+ },
+ easeOutExpo: function (x, t, b, c, d) {
+ return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
+ },
+ easeInOutExpo: function (x, t, b, c, d) {
+ if (t==0) return b;
+ if (t==d) return b+c;
+ if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
+ return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
+ },
+ easeInCirc: function (x, t, b, c, d) {
+ return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
+ },
+ easeOutCirc: function (x, t, b, c, d) {
+ return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
+ },
+ easeInOutCirc: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
+ return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
+ },
+ easeInElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ },
+ easeOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
+ },
+ easeInOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
+ },
+ easeInBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*(t/=d)*t*((s+1)*t - s) + b;
+ },
+ easeOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
+ },
+ easeInOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
+ return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+ },
+ easeInBounce: function (x, t, b, c, d) {
+ return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
+ },
+ easeOutBounce: function (x, t, b, c, d) {
+ if ((t/=d) < (1/2.75)) {
+ return c*(7.5625*t*t) + b;
+ } else if (t < (2/2.75)) {
+ return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
+ } else if (t < (2.5/2.75)) {
+ return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
+ } else {
+ return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
+ }
+ },
+ easeInOutBounce: function (x, t, b, c, d) {
+ if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
+ return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
+ }
+});
+
+/*
+ *
+ * TERMS OF USE - EASING EQUATIONS
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2001 Robert Penner
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ */
+
+})(jQuery);
+/*
+ * jQuery UI Effects Blind 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.blind = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'vertical') ? 'height' : 'width';
+ var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
+ if(mode == 'show') wrapper.css(ref, 0); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = mode == 'show' ? distance : 0;
+
+ // Animate
+ wrapper.animate(animation, o.duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Bounce 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.bounce = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'up'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 5; // Default # of times
+ var speed = o.duration || 250; // Default speed per bounce
+ if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+ if (mode == 'hide') distance = distance / (times * 2);
+ if (mode != 'hide') times--;
+
+ // Animate
+ if (mode == 'show') { // Show Bounce
+ var animation = {opacity: 1};
+ animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation, speed / 2, o.options.easing);
+ distance = distance / 2;
+ times--;
+ };
+ for (var i = 0; i < times; i++) { // Bounces
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
+ distance = (mode == 'hide') ? distance * 2 : distance / 2;
+ };
+ if (mode == 'hide') { // Last Bounce
+ var animation = {opacity: 0};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ el.animate(animation, speed / 2, o.options.easing, function(){
+ el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Clip 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.clip = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','height','width'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var animate = el[0].tagName == 'IMG' ? wrapper : el;
+ var ref = {
+ size: (direction == 'vertical') ? 'height' : 'width',
+ position: (direction == 'vertical') ? 'top' : 'left'
+ };
+ var distance = (direction == 'vertical') ? animate.height() : animate.width();
+ if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref.size] = mode == 'show' ? distance : 0;
+ animation[ref.position] = mode == 'show' ? 0 : distance / 2;
+
+ // Animate
+ animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Drop 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.drop = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','opacity'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {opacity: mode == 'show' ? 1 : 0};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Explode 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.explode = function(o) {
+
+ return this.queue(function() {
+
+ var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+ var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+
+ o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
+ var el = $(this).show().css('visibility', 'hidden');
+ var offset = el.offset();
+
+ //Substract the margins - not fixing the problem yet.
+ offset.top -= parseInt(el.css("marginTop"),10) || 0;
+ offset.left -= parseInt(el.css("marginLeft"),10) || 0;
+
+ var width = el.outerWidth(true);
+ var height = el.outerHeight(true);
+
+ for(var i=0;i<rows;i++) { // =
+ for(var j=0;j<cells;j++) { // ||
+ el
+ .clone()
+ .appendTo('body')
+ .wrap('<div></div>')
+ .css({
+ position: 'absolute',
+ visibility: 'visible',
+ left: -j*(width/cells),
+ top: -i*(height/rows)
+ })
+ .parent()
+ .addClass('ui-effects-explode')
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ width: width/cells,
+ height: height/rows,
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
+ opacity: o.options.mode == 'show' ? 0 : 1
+ }).animate({
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
+ opacity: o.options.mode == 'show' ? 1 : 0
+ }, o.duration || 500);
+ }
+ }
+
+ // Set a timeout, to call the callback approx. when the other animations have finished
+ setTimeout(function() {
+
+ o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
+ if(o.callback) o.callback.apply(el[0]); // Callback
+ el.dequeue();
+
+ $('div.ui-effects-explode').remove();
+
+ }, o.duration || 500);
+
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Fold 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.fold = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var size = o.options.size || 15; // Default fold size
+ var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var widthFirst = ((mode == 'show') != horizFirst);
+ var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
+ var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
+ var percent = /([0-9]+)%/.exec(size);
+ if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
+ if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
+
+ // Animation
+ var animation1 = {}, animation2 = {};
+ animation1[ref[0]] = mode == 'show' ? distance[0] : size;
+ animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
+
+ // Animate
+ wrapper.animate(animation1, duration, o.options.easing)
+ .animate(animation2, duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Highlight 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.highlight = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ props = ['backgroundImage', 'backgroundColor', 'opacity'],
+ mode = $.effects.setMode(elem, o.options.mode || 'show'),
+ animation = {
+ backgroundColor: elem.css('backgroundColor')
+ };
+
+ if (mode == 'hide') {
+ animation.opacity = 0;
+ }
+
+ $.effects.save(elem, props);
+ elem
+ .show()
+ .css({
+ backgroundImage: 'none',
+ backgroundColor: o.options.color || '#ffff99'
+ })
+ .animate(animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.options.easing,
+ complete: function() {
+ (mode == 'hide' && elem.hide());
+ $.effects.restore(elem, props);
+ (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter'));
+ (o.callback && o.callback.apply(this, arguments));
+ elem.dequeue();
+ }
+ });
+ });
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Pulsate 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.pulsate = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'show');
+ times = ((o.options.times || 5) * 2) - 1;
+ duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2,
+ isVisible = elem.is(':visible'),
+ animateTo = 0;
+
+ if (!isVisible) {
+ elem.css('opacity', 0).show();
+ animateTo = 1;
+ }
+
+ if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) {
+ times--;
+ }
+
+ for (var i = 0; i < times; i++) {
+ elem.animate({ opacity: animateTo }, duration, o.options.easing);
+ animateTo = (animateTo + 1) % 2;
+ }
+
+ elem.animate({ opacity: animateTo }, duration, o.options.easing, function() {
+ if (animateTo == 0) {
+ elem.hide();
+ }
+ (o.callback && o.callback.apply(this, arguments));
+ });
+
+ elem
+ .queue('fx', function() { elem.dequeue(); })
+ .dequeue();
+ });
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Scale 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.puff = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'hide'),
+ percent = parseInt(o.options.percent, 10) || 150,
+ factor = percent / 100,
+ original = { height: elem.height(), width: elem.width() };
+
+ $.extend(o.options, {
+ fade: true,
+ mode: mode,
+ percent: mode == 'hide' ? percent : 100,
+ from: mode == 'hide'
+ ? original
+ : {
+ height: original.height * factor,
+ width: original.width * factor
+ }
+ });
+
+ elem.effect('scale', o.options, o.duration, o.callback);
+ elem.dequeue();
+ });
+};
+
+$.effects.scale = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
+ var direction = o.options.direction || 'both'; // Set default axis
+ var origin = o.options.origin; // The origin of the scaling
+ if (mode != 'effect') { // Set default origin and restore for show/hide
+ options.origin = origin || ['middle','center'];
+ options.restore = true;
+ }
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
+
+ // Adjust
+ var factor = { // Set scaling factor
+ y: direction != 'horizontal' ? (percent / 100) : 1,
+ x: direction != 'vertical' ? (percent / 100) : 1
+ };
+ el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
+
+ if (o.options.fade) { // Fade option to support puff
+ if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
+ if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
+ };
+
+ // Animation
+ options.from = el.from; options.to = el.to; options.mode = mode;
+
+ // Animate
+ el.effect('size', options, o.duration, o.callback);
+ el.dequeue();
+ });
+
+};
+
+$.effects.size = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','width','height','overflow','opacity'];
+ var props1 = ['position','top','left','overflow','opacity']; // Always restore
+ var props2 = ['width','height','overflow']; // Copy for children
+ var cProps = ['fontSize'];
+ var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
+ var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var restore = o.options.restore || false; // Default restore
+ var scale = o.options.scale || 'both'; // Default scale mode
+ var origin = o.options.origin; // The origin of the sizing
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || original; // Default from state
+ el.to = o.options.to || original; // Default to state
+ // Adjust
+ if (origin) { // Calculate baseline shifts
+ var baseline = $.effects.getBaseline(origin, original);
+ el.from.top = (original.height - el.from.height) * baseline.y;
+ el.from.left = (original.width - el.from.width) * baseline.x;
+ el.to.top = (original.height - el.to.height) * baseline.y;
+ el.to.left = (original.width - el.to.width) * baseline.x;
+ };
+ var factor = { // Set scaling factor
+ from: {y: el.from.height / original.height, x: el.from.width / original.width},
+ to: {y: el.to.height / original.height, x: el.to.width / original.width}
+ };
+ if (scale == 'box' || scale == 'both') { // Scale the css box
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(vProps);
+ el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ props = props.concat(hProps);
+ el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
+ el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
+ };
+ };
+ if (scale == 'content' || scale == 'both') { // Scale the content
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(cProps);
+ el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
+ };
+ };
+ $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ el.css('overflow','hidden').css(el.from); // Shift
+
+ // Animate
+ if (scale == 'content' || scale == 'both') { // Scale the children
+ vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
+ hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
+ props2 = props.concat(vProps).concat(hProps); // Concat
+ el.find("*[width]").each(function(){
+ child = $(this);
+ if (restore) $.effects.save(child, props2);
+ var c_original = {height: child.height(), width: child.width()}; // Save original
+ child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
+ child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
+ child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
+ child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
+ };
+ child.css(child.from); // Shift children
+ child.animate(child.to, o.duration, o.options.easing, function(){
+ if (restore) $.effects.restore(child, props2); // Restore children
+ }); // Animate children
+ });
+ };
+
+ // Animate
+ el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if (el.to.opacity === 0) {
+ el.css('opacity', el.from.opacity);
+ }
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Shake 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.shake = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 3; // Default # of times
+ var speed = o.duration || o.options.duration || 140; // Default speed per shake
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+
+ // Animation
+ var animation = {}, animation1 = {}, animation2 = {};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
+ animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
+
+ // Animate
+ el.animate(animation, speed, o.options.easing);
+ for (var i = 1; i < times; i++) { // Shakes
+ el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
+ };
+ el.animate(animation1, speed, o.options.easing).
+ animate(animation, speed / 2, o.options.easing, function(){ // Last shake
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Slide 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.slide = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
+ if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
+/*
+ * jQuery UI Effects Transfer 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.transfer = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ target = $(o.options.to),
+ endPosition = target.offset(),
+ animation = {
+ top: endPosition.top,
+ left: endPosition.left,
+ height: target.innerHeight(),
+ width: target.innerWidth()
+ },
+ startPosition = elem.offset(),
+ transfer = $('<div class="ui-effects-transfer"></div>')
+ .appendTo(document.body)
+ .addClass(o.options.className)
+ .css({
+ top: startPosition.top,
+ left: startPosition.left,
+ height: elem.innerHeight(),
+ width: elem.innerWidth(),
+ position: 'absolute'
+ })
+ .animate(animation, o.duration, o.options.easing, function() {
+ transfer.remove();
+ (o.callback && o.callback.apply(elem[0], arguments));
+ elem.dequeue();
+ });
+ });
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.effects.blind.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,49 @@
+/*
+ * jQuery UI Effects Blind 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.blind = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'vertical') ? 'height' : 'width';
+ var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
+ if(mode == 'show') wrapper.css(ref, 0); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = mode == 'show' ? distance : 0;
+
+ // Animate
+ wrapper.animate(animation, o.duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.effects.bounce.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,78 @@
+/*
+ * jQuery UI Effects Bounce 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.bounce = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'up'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 5; // Default # of times
+ var speed = o.duration || 250; // Default speed per bounce
+ if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+ if (mode == 'hide') distance = distance / (times * 2);
+ if (mode != 'hide') times--;
+
+ // Animate
+ if (mode == 'show') { // Show Bounce
+ var animation = {opacity: 1};
+ animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation, speed / 2, o.options.easing);
+ distance = distance / 2;
+ times--;
+ };
+ for (var i = 0; i < times; i++) { // Bounces
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
+ distance = (mode == 'hide') ? distance * 2 : distance / 2;
+ };
+ if (mode == 'hide') { // Last Bounce
+ var animation = {opacity: 0};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ el.animate(animation, speed / 2, o.options.easing, function(){
+ el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ } else {
+ var animation1 = {}, animation2 = {};
+ animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+ el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ };
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.effects.clip.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,54 @@
+/*
+ * jQuery UI Effects Clip 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.clip = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','height','width'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'vertical'; // Default direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var animate = el[0].tagName == 'IMG' ? wrapper : el;
+ var ref = {
+ size: (direction == 'vertical') ? 'height' : 'width',
+ position: (direction == 'vertical') ? 'top' : 'left'
+ };
+ var distance = (direction == 'vertical') ? animate.height() : animate.width();
+ if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref.size] = mode == 'show' ? distance : 0;
+ animation[ref.position] = mode == 'show' ? 0 : distance / 2;
+
+ // Animate
+ animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.effects.core.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,714 @@
+/*
+ * jQuery UI Effects 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+;jQuery.effects || (function($) {
+
+$.effects = {};
+
+
+
+/******************************************************************************/
+/****************************** COLOR ANIMATIONS ******************************/
+/******************************************************************************/
+
+// override the animation for color styles
+$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor',
+ 'borderRightColor', 'borderTopColor', 'color', 'outlineColor'],
+function(i, attr) {
+ $.fx.step[attr] = function(fx) {
+ if (!fx.colorInit) {
+ fx.start = getColor(fx.elem, attr);
+ fx.end = getRGB(fx.end);
+ fx.colorInit = true;
+ }
+
+ fx.elem.style[attr] = 'rgb(' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' +
+ Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')';
+ };
+});
+
+// Color Conversion functions from highlightFade
+// By Blair Mitchelmore
+// http://jquery.offput.ca/highlightFade/
+
+// Parse strings looking for color tuples [255,255,255]
+function getRGB(color) {
+ var result;
+
+ // Check if we're already dealing with an array of colors
+ if ( color && color.constructor == Array && color.length == 3 )
+ return color;
+
+ // Look for rgb(num,num,num)
+ if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
+ return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
+
+ // Look for rgb(num%,num%,num%)
+ if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
+ return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
+
+ // Look for #a0b1c2
+ if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
+ return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
+
+ // Look for #fff
+ if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
+ return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
+
+ // Look for rgba(0, 0, 0, 0) == transparent in Safari 3
+ if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
+ return colors['transparent'];
+
+ // Otherwise, we're most likely dealing with a named color
+ return colors[$.trim(color).toLowerCase()];
+}
+
+function getColor(elem, attr) {
+ var color;
+
+ do {
+ color = $.curCSS(elem, attr);
+
+ // Keep going until we find an element that has color, or we hit the body
+ if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
+ break;
+
+ attr = "backgroundColor";
+ } while ( elem = elem.parentNode );
+
+ return getRGB(color);
+};
+
+// Some named colors to work with
+// From Interface by Stefan Petre
+// http://interface.eyecon.ro/
+
+var colors = {
+ aqua:[0,255,255],
+ azure:[240,255,255],
+ beige:[245,245,220],
+ black:[0,0,0],
+ blue:[0,0,255],
+ brown:[165,42,42],
+ cyan:[0,255,255],
+ darkblue:[0,0,139],
+ darkcyan:[0,139,139],
+ darkgrey:[169,169,169],
+ darkgreen:[0,100,0],
+ darkkhaki:[189,183,107],
+ darkmagenta:[139,0,139],
+ darkolivegreen:[85,107,47],
+ darkorange:[255,140,0],
+ darkorchid:[153,50,204],
+ darkred:[139,0,0],
+ darksalmon:[233,150,122],
+ darkviolet:[148,0,211],
+ fuchsia:[255,0,255],
+ gold:[255,215,0],
+ green:[0,128,0],
+ indigo:[75,0,130],
+ khaki:[240,230,140],
+ lightblue:[173,216,230],
+ lightcyan:[224,255,255],
+ lightgreen:[144,238,144],
+ lightgrey:[211,211,211],
+ lightpink:[255,182,193],
+ lightyellow:[255,255,224],
+ lime:[0,255,0],
+ magenta:[255,0,255],
+ maroon:[128,0,0],
+ navy:[0,0,128],
+ olive:[128,128,0],
+ orange:[255,165,0],
+ pink:[255,192,203],
+ purple:[128,0,128],
+ violet:[128,0,128],
+ red:[255,0,0],
+ silver:[192,192,192],
+ white:[255,255,255],
+ yellow:[255,255,0],
+ transparent: [255,255,255]
+};
+
+
+
+/******************************************************************************/
+/****************************** CLASS ANIMATIONS ******************************/
+/******************************************************************************/
+
+var classAnimationActions = ['add', 'remove', 'toggle'],
+ shorthandStyles = {
+ border: 1,
+ borderBottom: 1,
+ borderColor: 1,
+ borderLeft: 1,
+ borderRight: 1,
+ borderTop: 1,
+ borderWidth: 1,
+ margin: 1,
+ padding: 1
+ };
+
+function getElementStyles() {
+ var style = document.defaultView
+ ? document.defaultView.getComputedStyle(this, null)
+ : this.currentStyle,
+ newStyle = {},
+ key,
+ camelCase;
+
+ // webkit enumerates style porperties
+ if (style && style.length && style[0] && style[style[0]]) {
+ var len = style.length;
+ while (len--) {
+ key = style[len];
+ if (typeof style[key] == 'string') {
+ camelCase = key.replace(/\-(\w)/g, function(all, letter){
+ return letter.toUpperCase();
+ });
+ newStyle[camelCase] = style[key];
+ }
+ }
+ } else {
+ for (key in style) {
+ if (typeof style[key] === 'string') {
+ newStyle[key] = style[key];
+ }
+ }
+ }
+
+ return newStyle;
+}
+
+function filterStyles(styles) {
+ var name, value;
+ for (name in styles) {
+ value = styles[name];
+ if (
+ // ignore null and undefined values
+ value == null ||
+ // ignore functions (when does this occur?)
+ $.isFunction(value) ||
+ // shorthand styles that need to be expanded
+ name in shorthandStyles ||
+ // ignore scrollbars (break in IE)
+ (/scrollbar/).test(name) ||
+
+ // only colors or values that can be converted to numbers
+ (!(/color/i).test(name) && isNaN(parseFloat(value)))
+ ) {
+ delete styles[name];
+ }
+ }
+
+ return styles;
+}
+
+function styleDifference(oldStyle, newStyle) {
+ var diff = { _: 0 }, // http://dev.jquery.com/ticket/5459
+ name;
+
+ for (name in newStyle) {
+ if (oldStyle[name] != newStyle[name]) {
+ diff[name] = newStyle[name];
+ }
+ }
+
+ return diff;
+}
+
+$.effects.animateClass = function(value, duration, easing, callback) {
+ if ($.isFunction(easing)) {
+ callback = easing;
+ easing = null;
+ }
+
+ return this.each(function() {
+
+ var that = $(this),
+ originalStyleAttr = that.attr('style') || ' ',
+ originalStyle = filterStyles(getElementStyles.call(this)),
+ newStyle,
+ className = that.attr('className');
+
+ $.each(classAnimationActions, function(i, action) {
+ if (value[action]) {
+ that[action + 'Class'](value[action]);
+ }
+ });
+ newStyle = filterStyles(getElementStyles.call(this));
+ that.attr('className', className);
+
+ that.animate(styleDifference(originalStyle, newStyle), duration, easing, function() {
+ $.each(classAnimationActions, function(i, action) {
+ if (value[action]) { that[action + 'Class'](value[action]); }
+ });
+ // work around bug in IE by clearing the cssText before setting it
+ if (typeof that.attr('style') == 'object') {
+ that.attr('style').cssText = '';
+ that.attr('style').cssText = originalStyleAttr;
+ } else {
+ that.attr('style', originalStyleAttr);
+ }
+ if (callback) { callback.apply(this, arguments); }
+ });
+ });
+};
+
+$.fn.extend({
+ _addClass: $.fn.addClass,
+ addClass: function(classNames, speed, easing, callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
+ },
+
+ _removeClass: $.fn.removeClass,
+ removeClass: function(classNames,speed,easing,callback) {
+ return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
+ },
+
+ _toggleClass: $.fn.toggleClass,
+ toggleClass: function(classNames, force, speed, easing, callback) {
+ if ( typeof force == "boolean" || force === undefined ) {
+ if ( !speed ) {
+ // without speed parameter;
+ return this._toggleClass(classNames, force);
+ } else {
+ return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]);
+ }
+ } else {
+ // without switch parameter;
+ return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]);
+ }
+ },
+
+ switchClass: function(remove,add,speed,easing,callback) {
+ return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
+ }
+});
+
+
+
+/******************************************************************************/
+/*********************************** EFFECTS **********************************/
+/******************************************************************************/
+
+$.extend($.effects, {
+ version: "1.8.1",
+
+ // Saves a set of properties in a data storage
+ save: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+ }
+ },
+
+ // Restores a set of previously saved properties from a data storage
+ restore: function(element, set) {
+ for(var i=0; i < set.length; i++) {
+ if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+ }
+ },
+
+ setMode: function(el, mode) {
+ if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
+ return mode;
+ },
+
+ getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
+ // this should be a little more flexible in the future to handle a string & hash
+ var y, x;
+ switch (origin[0]) {
+ case 'top': y = 0; break;
+ case 'middle': y = 0.5; break;
+ case 'bottom': y = 1; break;
+ default: y = origin[0] / original.height;
+ };
+ switch (origin[1]) {
+ case 'left': x = 0; break;
+ case 'center': x = 0.5; break;
+ case 'right': x = 1; break;
+ default: x = origin[1] / original.width;
+ };
+ return {x: x, y: y};
+ },
+
+ // Wraps the element around a wrapper that copies position properties
+ createWrapper: function(element) {
+
+ // if the element is already wrapped, return it
+ if (element.parent().is('.ui-effects-wrapper')) {
+ return element.parent();
+ }
+
+ // wrap the element
+ var props = {
+ width: element.outerWidth(true),
+ height: element.outerHeight(true),
+ 'float': element.css('float')
+ },
+ wrapper = $('<div></div>')
+ .addClass('ui-effects-wrapper')
+ .css({
+ fontSize: '100%',
+ background: 'transparent',
+ border: 'none',
+ margin: 0,
+ padding: 0
+ });
+
+ element.wrap(wrapper);
+ wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually loose the reference to the wrapped element
+
+ // transfer positioning properties to the wrapper
+ if (element.css('position') == 'static') {
+ wrapper.css({ position: 'relative' });
+ element.css({ position: 'relative' });
+ } else {
+ $.extend(props, {
+ position: element.css('position'),
+ zIndex: element.css('z-index')
+ });
+ $.each(['top', 'left', 'bottom', 'right'], function(i, pos) {
+ props[pos] = element.css(pos);
+ if (isNaN(parseInt(props[pos], 10))) {
+ props[pos] = 'auto';
+ }
+ });
+ element.css({position: 'relative', top: 0, left: 0 });
+ }
+
+ return wrapper.css(props).show();
+ },
+
+ removeWrapper: function(element) {
+ if (element.parent().is('.ui-effects-wrapper'))
+ return element.parent().replaceWith(element);
+ return element;
+ },
+
+ setTransition: function(element, list, factor, value) {
+ value = value || {};
+ $.each(list, function(i, x){
+ unit = element.cssUnit(x);
+ if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
+ });
+ return value;
+ }
+});
+
+
+function _normalizeArguments(effect, options, speed, callback) {
+ // shift params for method overloading
+ if (typeof effect == 'object') {
+ callback = options;
+ speed = null;
+ options = effect;
+ effect = options.effect;
+ }
+ if ($.isFunction(options)) {
+ callback = options;
+ speed = null;
+ options = {};
+ }
+ if ($.isFunction(speed)) {
+ callback = speed;
+ speed = null;
+ }
+ if (typeof options == 'number' || $.fx.speeds[options]) {
+ callback = speed;
+ speed = options;
+ options = {};
+ }
+
+ options = options || {};
+
+ speed = speed || options.duration;
+ speed = $.fx.off ? 0 : typeof speed == 'number'
+ ? speed : $.fx.speeds[speed] || $.fx.speeds._default;
+
+ callback = callback || options.complete;
+
+ return [effect, options, speed, callback];
+}
+
+$.fn.extend({
+ effect: function(effect, options, speed, callback) {
+ var args = _normalizeArguments.apply(this, arguments),
+ // TODO: make effects takes actual parameters instead of a hash
+ args2 = {
+ options: args[1],
+ duration: args[2],
+ callback: args[3]
+ },
+ effectMethod = $.effects[effect];
+
+ return effectMethod && !$.fx.off ? effectMethod.call(this, args2) : this;
+ },
+
+ _show: $.fn.show,
+ show: function(speed) {
+ if (!speed || typeof speed == 'number' || $.fx.speeds[speed]) {
+ return this._show.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'show';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ _hide: $.fn.hide,
+ hide: function(speed) {
+ if (!speed || typeof speed == 'number' || $.fx.speeds[speed]) {
+ return this._hide.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'hide';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ // jQuery core overloads toggle and create _toggle
+ __toggle: $.fn.toggle,
+ toggle: function(speed) {
+ if (!speed || typeof speed == 'number' || $.fx.speeds[speed] ||
+ typeof speed == 'boolean' || $.isFunction(speed)) {
+ return this.__toggle.apply(this, arguments);
+ } else {
+ var args = _normalizeArguments.apply(this, arguments);
+ args[1].mode = 'toggle';
+ return this.effect.apply(this, args);
+ }
+ },
+
+ // helper functions
+ cssUnit: function(key) {
+ var style = this.css(key), val = [];
+ $.each( ['em','px','%','pt'], function(i, unit){
+ if(style.indexOf(unit) > 0)
+ val = [parseFloat(style), unit];
+ });
+ return val;
+ }
+});
+
+
+
+/******************************************************************************/
+/*********************************** EASING ***********************************/
+/******************************************************************************/
+
+/*
+ * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
+ *
+ * Uses the built in easing capabilities added In jQuery 1.1
+ * to offer multiple easing options
+ *
+ * TERMS OF USE - jQuery Easing
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2008 George McGinley Smith
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+*/
+
+// t: current time, b: begInnIng value, c: change In value, d: duration
+$.easing.jswing = $.easing.swing;
+
+$.extend($.easing,
+{
+ def: 'easeOutQuad',
+ swing: function (x, t, b, c, d) {
+ //alert($.easing.default);
+ return $.easing[$.easing.def](x, t, b, c, d);
+ },
+ easeInQuad: function (x, t, b, c, d) {
+ return c*(t/=d)*t + b;
+ },
+ easeOutQuad: function (x, t, b, c, d) {
+ return -c *(t/=d)*(t-2) + b;
+ },
+ easeInOutQuad: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t + b;
+ return -c/2 * ((--t)*(t-2) - 1) + b;
+ },
+ easeInCubic: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t + b;
+ },
+ easeOutCubic: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t + 1) + b;
+ },
+ easeInOutCubic: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t + b;
+ return c/2*((t-=2)*t*t + 2) + b;
+ },
+ easeInQuart: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t + b;
+ },
+ easeOutQuart: function (x, t, b, c, d) {
+ return -c * ((t=t/d-1)*t*t*t - 1) + b;
+ },
+ easeInOutQuart: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
+ return -c/2 * ((t-=2)*t*t*t - 2) + b;
+ },
+ easeInQuint: function (x, t, b, c, d) {
+ return c*(t/=d)*t*t*t*t + b;
+ },
+ easeOutQuint: function (x, t, b, c, d) {
+ return c*((t=t/d-1)*t*t*t*t + 1) + b;
+ },
+ easeInOutQuint: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
+ return c/2*((t-=2)*t*t*t*t + 2) + b;
+ },
+ easeInSine: function (x, t, b, c, d) {
+ return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
+ },
+ easeOutSine: function (x, t, b, c, d) {
+ return c * Math.sin(t/d * (Math.PI/2)) + b;
+ },
+ easeInOutSine: function (x, t, b, c, d) {
+ return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
+ },
+ easeInExpo: function (x, t, b, c, d) {
+ return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
+ },
+ easeOutExpo: function (x, t, b, c, d) {
+ return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
+ },
+ easeInOutExpo: function (x, t, b, c, d) {
+ if (t==0) return b;
+ if (t==d) return b+c;
+ if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
+ return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
+ },
+ easeInCirc: function (x, t, b, c, d) {
+ return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
+ },
+ easeOutCirc: function (x, t, b, c, d) {
+ return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
+ },
+ easeInOutCirc: function (x, t, b, c, d) {
+ if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
+ return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
+ },
+ easeInElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ },
+ easeOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
+ },
+ easeInOutElastic: function (x, t, b, c, d) {
+ var s=1.70158;var p=0;var a=c;
+ if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
+ if (a < Math.abs(c)) { a=c; var s=p/4; }
+ else var s = p/(2*Math.PI) * Math.asin (c/a);
+ if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+ return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
+ },
+ easeInBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*(t/=d)*t*((s+1)*t - s) + b;
+ },
+ easeOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
+ },
+ easeInOutBack: function (x, t, b, c, d, s) {
+ if (s == undefined) s = 1.70158;
+ if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
+ return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+ },
+ easeInBounce: function (x, t, b, c, d) {
+ return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
+ },
+ easeOutBounce: function (x, t, b, c, d) {
+ if ((t/=d) < (1/2.75)) {
+ return c*(7.5625*t*t) + b;
+ } else if (t < (2/2.75)) {
+ return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
+ } else if (t < (2.5/2.75)) {
+ return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
+ } else {
+ return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
+ }
+ },
+ easeInOutBounce: function (x, t, b, c, d) {
+ if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
+ return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
+ }
+});
+
+/*
+ *
+ * TERMS OF USE - EASING EQUATIONS
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2001 Robert Penner
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ */
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.effects.drop.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,50 @@
+/*
+ * jQuery UI Effects Drop 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.drop = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','opacity'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
+ if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {opacity: mode == 'show' ? 1 : 0};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.effects.explode.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,79 @@
+/*
+ * jQuery UI Effects Explode 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.explode = function(o) {
+
+ return this.queue(function() {
+
+ var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+ var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+
+ o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
+ var el = $(this).show().css('visibility', 'hidden');
+ var offset = el.offset();
+
+ //Substract the margins - not fixing the problem yet.
+ offset.top -= parseInt(el.css("marginTop"),10) || 0;
+ offset.left -= parseInt(el.css("marginLeft"),10) || 0;
+
+ var width = el.outerWidth(true);
+ var height = el.outerHeight(true);
+
+ for(var i=0;i<rows;i++) { // =
+ for(var j=0;j<cells;j++) { // ||
+ el
+ .clone()
+ .appendTo('body')
+ .wrap('<div></div>')
+ .css({
+ position: 'absolute',
+ visibility: 'visible',
+ left: -j*(width/cells),
+ top: -i*(height/rows)
+ })
+ .parent()
+ .addClass('ui-effects-explode')
+ .css({
+ position: 'absolute',
+ overflow: 'hidden',
+ width: width/cells,
+ height: height/rows,
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
+ opacity: o.options.mode == 'show' ? 0 : 1
+ }).animate({
+ left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
+ top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
+ opacity: o.options.mode == 'show' ? 1 : 0
+ }, o.duration || 500);
+ }
+ }
+
+ // Set a timeout, to call the callback approx. when the other animations have finished
+ setTimeout(function() {
+
+ o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
+ if(o.callback) o.callback.apply(el[0]); // Callback
+ el.dequeue();
+
+ $('div.ui-effects-explode').remove();
+
+ }, o.duration || 500);
+
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.effects.fold.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,56 @@
+/*
+ * jQuery UI Effects Fold 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.fold = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+ var size = o.options.size || 15; // Default fold size
+ var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
+ var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var widthFirst = ((mode == 'show') != horizFirst);
+ var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
+ var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
+ var percent = /([0-9]+)%/.exec(size);
+ if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
+ if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
+
+ // Animation
+ var animation1 = {}, animation2 = {};
+ animation1[ref[0]] = mode == 'show' ? distance[0] : size;
+ animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
+
+ // Animate
+ wrapper.animate(animation1, duration, o.options.easing)
+ .animate(animation2, duration, o.options.easing, function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(el[0], arguments); // Callback
+ el.dequeue();
+ });
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.effects.highlight.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,50 @@
+/*
+ * jQuery UI Effects Highlight 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.highlight = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ props = ['backgroundImage', 'backgroundColor', 'opacity'],
+ mode = $.effects.setMode(elem, o.options.mode || 'show'),
+ animation = {
+ backgroundColor: elem.css('backgroundColor')
+ };
+
+ if (mode == 'hide') {
+ animation.opacity = 0;
+ }
+
+ $.effects.save(elem, props);
+ elem
+ .show()
+ .css({
+ backgroundImage: 'none',
+ backgroundColor: o.options.color || '#ffff99'
+ })
+ .animate(animation, {
+ queue: false,
+ duration: o.duration,
+ easing: o.options.easing,
+ complete: function() {
+ (mode == 'hide' && elem.hide());
+ $.effects.restore(elem, props);
+ (mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter'));
+ (o.callback && o.callback.apply(this, arguments));
+ elem.dequeue();
+ }
+ });
+ });
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.effects.pulsate.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,51 @@
+/*
+ * jQuery UI Effects Pulsate 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.pulsate = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'show');
+ times = ((o.options.times || 5) * 2) - 1;
+ duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2,
+ isVisible = elem.is(':visible'),
+ animateTo = 0;
+
+ if (!isVisible) {
+ elem.css('opacity', 0).show();
+ animateTo = 1;
+ }
+
+ if ((mode == 'hide' && isVisible) || (mode == 'show' && !isVisible)) {
+ times--;
+ }
+
+ for (var i = 0; i < times; i++) {
+ elem.animate({ opacity: animateTo }, duration, o.options.easing);
+ animateTo = (animateTo + 1) % 2;
+ }
+
+ elem.animate({ opacity: animateTo }, duration, o.options.easing, function() {
+ if (animateTo == 0) {
+ elem.hide();
+ }
+ (o.callback && o.callback.apply(this, arguments));
+ });
+
+ elem
+ .queue('fx', function() { elem.dequeue(); })
+ .dequeue();
+ });
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.effects.scale.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,178 @@
+/*
+ * jQuery UI Effects Scale 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.puff = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ mode = $.effects.setMode(elem, o.options.mode || 'hide'),
+ percent = parseInt(o.options.percent, 10) || 150,
+ factor = percent / 100,
+ original = { height: elem.height(), width: elem.width() };
+
+ $.extend(o.options, {
+ fade: true,
+ mode: mode,
+ percent: mode == 'hide' ? percent : 100,
+ from: mode == 'hide'
+ ? original
+ : {
+ height: original.height * factor,
+ width: original.width * factor
+ }
+ });
+
+ elem.effect('scale', o.options, o.duration, o.callback);
+ elem.dequeue();
+ });
+};
+
+$.effects.scale = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this);
+
+ // Set options
+ var options = $.extend(true, {}, o.options);
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
+ var direction = o.options.direction || 'both'; // Set default axis
+ var origin = o.options.origin; // The origin of the scaling
+ if (mode != 'effect') { // Set default origin and restore for show/hide
+ options.origin = origin || ['middle','center'];
+ options.restore = true;
+ }
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
+
+ // Adjust
+ var factor = { // Set scaling factor
+ y: direction != 'horizontal' ? (percent / 100) : 1,
+ x: direction != 'vertical' ? (percent / 100) : 1
+ };
+ el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
+
+ if (o.options.fade) { // Fade option to support puff
+ if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
+ if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
+ };
+
+ // Animation
+ options.from = el.from; options.to = el.to; options.mode = mode;
+
+ // Animate
+ el.effect('size', options, o.duration, o.callback);
+ el.dequeue();
+ });
+
+};
+
+$.effects.size = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left','width','height','overflow','opacity'];
+ var props1 = ['position','top','left','overflow','opacity']; // Always restore
+ var props2 = ['width','height','overflow']; // Copy for children
+ var cProps = ['fontSize'];
+ var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
+ var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var restore = o.options.restore || false; // Default restore
+ var scale = o.options.scale || 'both'; // Default scale mode
+ var origin = o.options.origin; // The origin of the sizing
+ var original = {height: el.height(), width: el.width()}; // Save original
+ el.from = o.options.from || original; // Default from state
+ el.to = o.options.to || original; // Default to state
+ // Adjust
+ if (origin) { // Calculate baseline shifts
+ var baseline = $.effects.getBaseline(origin, original);
+ el.from.top = (original.height - el.from.height) * baseline.y;
+ el.from.left = (original.width - el.from.width) * baseline.x;
+ el.to.top = (original.height - el.to.height) * baseline.y;
+ el.to.left = (original.width - el.to.width) * baseline.x;
+ };
+ var factor = { // Set scaling factor
+ from: {y: el.from.height / original.height, x: el.from.width / original.width},
+ to: {y: el.to.height / original.height, x: el.to.width / original.width}
+ };
+ if (scale == 'box' || scale == 'both') { // Scale the css box
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(vProps);
+ el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ props = props.concat(hProps);
+ el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
+ el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
+ };
+ };
+ if (scale == 'content' || scale == 'both') { // Scale the content
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ props = props.concat(cProps);
+ el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
+ el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
+ };
+ };
+ $.effects.save(el, restore ? props : props1); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ el.css('overflow','hidden').css(el.from); // Shift
+
+ // Animate
+ if (scale == 'content' || scale == 'both') { // Scale the children
+ vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
+ hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
+ props2 = props.concat(vProps).concat(hProps); // Concat
+ el.find("*[width]").each(function(){
+ child = $(this);
+ if (restore) $.effects.save(child, props2);
+ var c_original = {height: child.height(), width: child.width()}; // Save original
+ child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
+ child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
+ if (factor.from.y != factor.to.y) { // Vertical props scaling
+ child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
+ child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
+ };
+ if (factor.from.x != factor.to.x) { // Horizontal props scaling
+ child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
+ child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
+ };
+ child.css(child.from); // Shift children
+ child.animate(child.to, o.duration, o.options.easing, function(){
+ if (restore) $.effects.restore(child, props2); // Restore children
+ }); // Animate children
+ });
+ };
+
+ // Animate
+ el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if (el.to.opacity === 0) {
+ el.css('opacity', el.from.opacity);
+ }
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.effects.shake.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,57 @@
+/*
+ * jQuery UI Effects Shake 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.shake = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default direction
+ var distance = o.options.distance || 20; // Default distance
+ var times = o.options.times || 3; // Default # of times
+ var speed = o.duration || o.options.duration || 140; // Default speed per shake
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+
+ // Animation
+ var animation = {}, animation1 = {}, animation2 = {};
+ animation[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+ animation1[ref] = (motion == 'pos' ? '+=' : '-=') + distance * 2;
+ animation2[ref] = (motion == 'pos' ? '-=' : '+=') + distance * 2;
+
+ // Animate
+ el.animate(animation, speed, o.options.easing);
+ for (var i = 1; i < times; i++) { // Shakes
+ el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
+ };
+ el.animate(animation1, speed, o.options.easing).
+ animate(animation, speed / 2, o.options.easing, function(){ // Last shake
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ });
+ el.queue('fx', function() { el.dequeue(); });
+ el.dequeue();
+ });
+
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.effects.slide.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,50 @@
+/*
+ * jQuery UI Effects Slide 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.slide = function(o) {
+
+ return this.queue(function() {
+
+ // Create element
+ var el = $(this), props = ['position','top','left'];
+
+ // Set options
+ var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+ var direction = o.options.direction || 'left'; // Default Direction
+
+ // Adjust
+ $.effects.save(el, props); el.show(); // Save & Show
+ $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+ var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+ var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+ var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
+ if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+ // Animation
+ var animation = {};
+ animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+ // Animate
+ el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+ if(mode == 'hide') el.hide(); // Hide
+ $.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+ if(o.callback) o.callback.apply(this, arguments); // Callback
+ el.dequeue();
+ }});
+
+ });
+
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.effects.transfer.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,45 @@
+/*
+ * jQuery UI Effects Transfer 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.transfer = function(o) {
+ return this.queue(function() {
+ var elem = $(this),
+ target = $(o.options.to),
+ endPosition = target.offset(),
+ animation = {
+ top: endPosition.top,
+ left: endPosition.left,
+ height: target.innerHeight(),
+ width: target.innerWidth()
+ },
+ startPosition = elem.offset(),
+ transfer = $('<div class="ui-effects-transfer"></div>')
+ .appendTo(document.body)
+ .addClass(o.options.className)
+ .css({
+ top: startPosition.top,
+ left: startPosition.left,
+ height: elem.innerHeight(),
+ width: elem.innerWidth(),
+ position: 'absolute'
+ })
+ .animate(animation, o.duration, o.options.easing, function() {
+ transfer.remove();
+ (o.callback && o.callback.apply(elem[0], arguments));
+ elem.dequeue();
+ });
+ });
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.accordion.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,506 @@
+/*
+ * jQuery UI Accordion 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.accordion", {
+ options: {
+ active: 0,
+ animated: 'slide',
+ autoHeight: true,
+ clearStyle: false,
+ collapsible: false,
+ event: "click",
+ fillSpace: false,
+ header: "> li > :first-child,> :not(li):even",
+ icons: {
+ header: "ui-icon-triangle-1-e",
+ headerSelected: "ui-icon-triangle-1-s"
+ },
+ navigation: false,
+ navigationFilter: function() {
+ return this.href.toLowerCase() == location.href.toLowerCase();
+ }
+ },
+ _create: function() {
+
+ var o = this.options, self = this;
+ this.running = 0;
+
+ this.element.addClass("ui-accordion ui-widget ui-helper-reset");
+
+ // in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix
+ if (this.element[0].nodeName == "UL") {
+ this.element.children("li").addClass("ui-accordion-li-fix");
+ }
+
+ this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all")
+ .bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); })
+ .bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); })
+ .bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); })
+ .bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); });
+
+ this.headers
+ .next()
+ .addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+
+ if ( o.navigation ) {
+ var current = this.element.find("a").filter(o.navigationFilter);
+ if ( current.length ) {
+ var header = current.closest(".ui-accordion-header");
+ if ( header.length ) {
+ // anchor within header
+ this.active = header;
+ } else {
+ // anchor within content
+ this.active = current.closest(".ui-accordion-content").prev();
+ }
+ }
+ }
+
+ this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");
+ this.active.next().addClass('ui-accordion-content-active');
+
+ //Append icon elements
+ this._createIcons();
+
+ this.resize();
+
+ //ARIA
+ this.element.attr('role','tablist');
+
+ this.headers
+ .attr('role','tab')
+ .bind('keydown', function(event) { return self._keydown(event); })
+ .next()
+ .attr('role','tabpanel');
+
+ this.headers
+ .not(this.active || "")
+ .attr('aria-expanded','false')
+ .attr("tabIndex", "-1")
+ .next()
+ .hide();
+
+ // make sure at least one header is in the tab order
+ if (!this.active.length) {
+ this.headers.eq(0).attr('tabIndex','0');
+ } else {
+ this.active
+ .attr('aria-expanded','true')
+ .attr('tabIndex', '0');
+ }
+
+ // only need links in taborder for Safari
+ if (!$.browser.safari)
+ this.headers.find('a').attr('tabIndex','-1');
+
+ if (o.event) {
+ this.headers.bind((o.event) + ".accordion", function(event) {
+ self._clickHandler.call(self, event, this);
+ event.preventDefault();
+ });
+ }
+
+ },
+
+ _createIcons: function() {
+ var o = this.options;
+ if (o.icons) {
+ $("<span/>").addClass("ui-icon " + o.icons.header).prependTo(this.headers);
+ this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected);
+ this.element.addClass("ui-accordion-icons");
+ }
+ },
+
+ _destroyIcons: function() {
+ this.headers.children(".ui-icon").remove();
+ this.element.removeClass("ui-accordion-icons");
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.element
+ .removeClass("ui-accordion ui-widget ui-helper-reset")
+ .removeAttr("role")
+ .unbind('.accordion')
+ .removeData('accordion');
+
+ this.headers
+ .unbind(".accordion")
+ .removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top")
+ .removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex");
+
+ this.headers.find("a").removeAttr("tabIndex");
+ this._destroyIcons();
+ var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");
+ if (o.autoHeight || o.fillHeight) {
+ contents.css("height", "");
+ }
+
+ return this;
+ },
+
+ _setOption: function(key, value) {
+ $.Widget.prototype._setOption.apply(this, arguments);
+
+ if (key == "active") {
+ this.activate(value);
+ }
+ if (key == "icons") {
+ this._destroyIcons();
+ if (value) {
+ this._createIcons();
+ }
+ }
+
+ },
+
+ _keydown: function(event) {
+
+ var o = this.options, keyCode = $.ui.keyCode;
+
+ if (o.disabled || event.altKey || event.ctrlKey)
+ return;
+
+ var length = this.headers.length;
+ var currentIndex = this.headers.index(event.target);
+ var toFocus = false;
+
+ switch(event.keyCode) {
+ case keyCode.RIGHT:
+ case keyCode.DOWN:
+ toFocus = this.headers[(currentIndex + 1) % length];
+ break;
+ case keyCode.LEFT:
+ case keyCode.UP:
+ toFocus = this.headers[(currentIndex - 1 + length) % length];
+ break;
+ case keyCode.SPACE:
+ case keyCode.ENTER:
+ this._clickHandler({ target: event.target }, event.target);
+ event.preventDefault();
+ }
+
+ if (toFocus) {
+ $(event.target).attr('tabIndex','-1');
+ $(toFocus).attr('tabIndex','0');
+ toFocus.focus();
+ return false;
+ }
+
+ return true;
+
+ },
+
+ resize: function() {
+
+ var o = this.options, maxHeight;
+
+ if (o.fillSpace) {
+
+ if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); }
+ maxHeight = this.element.parent().height();
+ if($.browser.msie) { this.element.parent().css('overflow', defOverflow); }
+
+ this.headers.each(function() {
+ maxHeight -= $(this).outerHeight(true);
+ });
+
+ this.headers.next().each(function() {
+ $(this).height(Math.max(0, maxHeight - $(this).innerHeight() + $(this).height()));
+ }).css('overflow', 'auto');
+
+ } else if ( o.autoHeight ) {
+ maxHeight = 0;
+ this.headers.next().each(function() {
+ maxHeight = Math.max(maxHeight, $(this).height());
+ }).height(maxHeight);
+ }
+
+ return this;
+ },
+
+ activate: function(index) {
+ // TODO this gets called on init, changing the option without an explicit call for that
+ this.options.active = index;
+ // call clickHandler with custom event
+ var active = this._findActive(index)[0];
+ this._clickHandler({ target: active }, active);
+
+ return this;
+ },
+
+ _findActive: function(selector) {
+ return selector
+ ? typeof selector == "number"
+ ? this.headers.filter(":eq(" + selector + ")")
+ : this.headers.not(this.headers.not(selector))
+ : selector === false
+ ? $([])
+ : this.headers.filter(":eq(0)");
+ },
+
+ // TODO isn't event.target enough? why the seperate target argument?
+ _clickHandler: function(event, target) {
+
+ var o = this.options;
+ if (o.disabled)
+ return;
+
+ // called only when using activate(false) to close all parts programmatically
+ if (!event.target) {
+ if (!o.collapsible)
+ return;
+ this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+ .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+ this.active.next().addClass('ui-accordion-content-active');
+ var toHide = this.active.next(),
+ data = {
+ options: o,
+ newHeader: $([]),
+ oldHeader: o.active,
+ newContent: $([]),
+ oldContent: toHide
+ },
+ toShow = (this.active = $([]));
+ this._toggle(toShow, toHide, data);
+ return;
+ }
+
+ // get the click target
+ var clicked = $(event.currentTarget || target);
+ var clickedIsActive = clicked[0] == this.active[0];
+
+ // TODO the option is changed, is that correct?
+ // TODO if it is correct, shouldn't that happen after determining that the click is valid?
+ o.active = o.collapsible && clickedIsActive ? false : $('.ui-accordion-header', this.element).index(clicked);
+
+ // if animations are still active, or the active header is the target, ignore click
+ if (this.running || (!o.collapsible && clickedIsActive)) {
+ return;
+ }
+
+ // switch classes
+ this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+ .find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+ if (!clickedIsActive) {
+ clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top")
+ .find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected);
+ clicked.next().addClass('ui-accordion-content-active');
+ }
+
+ // find elements to show and hide
+ var toShow = clicked.next(),
+ toHide = this.active.next(),
+ data = {
+ options: o,
+ newHeader: clickedIsActive && o.collapsible ? $([]) : clicked,
+ oldHeader: this.active,
+ newContent: clickedIsActive && o.collapsible ? $([]) : toShow,
+ oldContent: toHide
+ },
+ down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+
+ this.active = clickedIsActive ? $([]) : clicked;
+ this._toggle(toShow, toHide, data, clickedIsActive, down);
+
+ return;
+
+ },
+
+ _toggle: function(toShow, toHide, data, clickedIsActive, down) {
+
+ var o = this.options, self = this;
+
+ this.toShow = toShow;
+ this.toHide = toHide;
+ this.data = data;
+
+ var complete = function() { if(!self) return; return self._completed.apply(self, arguments); };
+
+ // trigger changestart event
+ this._trigger("changestart", null, this.data);
+
+ // count elements to animate
+ this.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+
+ if (o.animated) {
+
+ var animOptions = {};
+
+ if ( o.collapsible && clickedIsActive ) {
+ animOptions = {
+ toShow: $([]),
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: o.autoHeight || o.fillSpace
+ };
+ } else {
+ animOptions = {
+ toShow: toShow,
+ toHide: toHide,
+ complete: complete,
+ down: down,
+ autoHeight: o.autoHeight || o.fillSpace
+ };
+ }
+
+ if (!o.proxied) {
+ o.proxied = o.animated;
+ }
+
+ if (!o.proxiedDuration) {
+ o.proxiedDuration = o.duration;
+ }
+
+ o.animated = $.isFunction(o.proxied) ?
+ o.proxied(animOptions) : o.proxied;
+
+ o.duration = $.isFunction(o.proxiedDuration) ?
+ o.proxiedDuration(animOptions) : o.proxiedDuration;
+
+ var animations = $.ui.accordion.animations,
+ duration = o.duration,
+ easing = o.animated;
+
+ if (easing && !animations[easing] && !$.easing[easing]) {
+ easing = 'slide';
+ }
+ if (!animations[easing]) {
+ animations[easing] = function(options) {
+ this.slide(options, {
+ easing: easing,
+ duration: duration || 700
+ });
+ };
+ }
+
+ animations[easing](animOptions);
+
+ } else {
+
+ if (o.collapsible && clickedIsActive) {
+ toShow.toggle();
+ } else {
+ toHide.hide();
+ toShow.show();
+ }
+
+ complete(true);
+
+ }
+
+ // TODO assert that the blur and focus triggers are really necessary, remove otherwise
+ toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur();
+ toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus();
+
+ },
+
+ _completed: function(cancel) {
+
+ var o = this.options;
+
+ this.running = cancel ? 0 : --this.running;
+ if (this.running) return;
+
+ if (o.clearStyle) {
+ this.toShow.add(this.toHide).css({
+ height: "",
+ overflow: ""
+ });
+ }
+
+ // other classes are removed before the animation; this one needs to stay until completed
+ this.toHide.removeClass("ui-accordion-content-active");
+
+ this._trigger('change', null, this.data);
+ }
+
+});
+
+
+$.extend($.ui.accordion, {
+ version: "1.8.1",
+ animations: {
+ slide: function(options, additions) {
+ options = $.extend({
+ easing: "swing",
+ duration: 300
+ }, options, additions);
+ if ( !options.toHide.size() ) {
+ options.toShow.animate({height: "show"}, options);
+ return;
+ }
+ if ( !options.toShow.size() ) {
+ options.toHide.animate({height: "hide"}, options);
+ return;
+ }
+ var overflow = options.toShow.css('overflow'),
+ percentDone = 0,
+ showProps = {},
+ hideProps = {},
+ fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
+ originalWidth;
+ // fix width before calculating height of hidden element
+ var s = options.toShow;
+ originalWidth = s[0].style.width;
+ s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) );
+
+ $.each(fxAttrs, function(i, prop) {
+ hideProps[prop] = 'hide';
+
+ var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/);
+ showProps[prop] = {
+ value: parts[1],
+ unit: parts[2] || 'px'
+ };
+ });
+ options.toShow.css({ height: 0, overflow: 'hidden' }).show();
+ options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{
+ step: function(now, settings) {
+ // only calculate the percent when animating height
+ // IE gets very inconsistent results when animating elements
+ // with small values, which is common for padding
+ if (settings.prop == 'height') {
+ percentDone = ( settings.end - settings.start === 0 ) ? 0 :
+ (settings.now - settings.start) / (settings.end - settings.start);
+ }
+
+ options.toShow[0].style[settings.prop] =
+ (percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit;
+ },
+ duration: options.duration,
+ easing: options.easing,
+ complete: function() {
+ if ( !options.autoHeight ) {
+ options.toShow.css("height", "");
+ }
+ options.toShow.css("width", originalWidth);
+ options.toShow.css({overflow: overflow});
+ options.complete();
+ }
+ });
+ },
+ bounceslide: function(options) {
+ this.slide(options, {
+ easing: options.down ? "easeOutBounce" : "swing",
+ duration: options.down ? 1000 : 200
+ });
+ }
+ }
+});
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.autocomplete.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,498 @@
+/*
+ * jQuery UI Autocomplete 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function( $ ) {
+
+$.widget( "ui.autocomplete", {
+ options: {
+ minLength: 1,
+ delay: 300
+ },
+ _create: function() {
+ var self = this,
+ doc = this.element[ 0 ].ownerDocument;
+ this.element
+ .addClass( "ui-autocomplete-input" )
+ .attr( "autocomplete", "off" )
+ // TODO verify these actually work as intended
+ .attr({
+ role: "textbox",
+ "aria-autocomplete": "list",
+ "aria-haspopup": "true"
+ })
+ .bind( "keydown.autocomplete", function( event ) {
+ var keyCode = $.ui.keyCode;
+ switch( event.keyCode ) {
+ case keyCode.PAGE_UP:
+ self._move( "previousPage", event );
+ break;
+ case keyCode.PAGE_DOWN:
+ self._move( "nextPage", event );
+ break;
+ case keyCode.UP:
+ self._move( "previous", event );
+ // prevent moving cursor to beginning of text field in some browsers
+ event.preventDefault();
+ break;
+ case keyCode.DOWN:
+ self._move( "next", event );
+ // prevent moving cursor to end of text field in some browsers
+ event.preventDefault();
+ break;
+ case keyCode.ENTER:
+ // when menu is open or has focus
+ if ( self.menu.active ) {
+ event.preventDefault();
+ }
+ //passthrough - ENTER and TAB both select the current element
+ case keyCode.TAB:
+ if ( !self.menu.active ) {
+ return;
+ }
+ self.menu.select( event );
+ break;
+ case keyCode.ESCAPE:
+ self.element.val( self.term );
+ self.close( event );
+ break;
+ case keyCode.LEFT:
+ case keyCode.RIGHT:
+ case keyCode.SHIFT:
+ case keyCode.CONTROL:
+ case keyCode.ALT:
+ // ignore metakeys (shift, ctrl, alt)
+ break;
+ default:
+ // keypress is triggered before the input value is changed
+ clearTimeout( self.searching );
+ self.searching = setTimeout(function() {
+ self.search( null, event );
+ }, self.options.delay );
+ break;
+ }
+ })
+ .bind( "focus.autocomplete", function() {
+ self.selectedItem = null;
+ self.previous = self.element.val();
+ })
+ .bind( "blur.autocomplete", function( event ) {
+ clearTimeout( self.searching );
+ // clicks on the menu (or a button to trigger a search) will cause a blur event
+ // TODO try to implement this without a timeout, see clearTimeout in search()
+ self.closing = setTimeout(function() {
+ self.close( event );
+ self._change( event );
+ }, 150 );
+ });
+ this._initSource();
+ this.response = function() {
+ return self._response.apply( self, arguments );
+ };
+ this.menu = $( "<ul></ul>" )
+ .addClass( "ui-autocomplete" )
+ .appendTo( "body", doc )
+ .menu({
+ focus: function( event, ui ) {
+ var item = ui.item.data( "item.autocomplete" );
+ if ( false !== self._trigger( "focus", null, { item: item } ) ) {
+ // use value to match what will end up in the input, if it was a key event
+ if ( /^key/.test(event.originalEvent.type) ) {
+ self.element.val( item.value );
+ }
+ }
+ },
+ selected: function( event, ui ) {
+ var item = ui.item.data( "item.autocomplete" );
+ if ( false !== self._trigger( "select", event, { item: item } ) ) {
+ self.element.val( item.value );
+ }
+ self.close( event );
+ // only trigger when focus was lost (click on menu)
+ var previous = self.previous;
+ if ( self.element[0] !== doc.activeElement ) {
+ self.element.focus();
+ self.previous = previous;
+ }
+ self.selectedItem = item;
+ },
+ blur: function( event, ui ) {
+ if ( self.menu.element.is(":visible") ) {
+ self.element.val( self.term );
+ }
+ }
+ })
+ .zIndex( this.element.zIndex() + 1 )
+ // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+ .css({ top: 0, left: 0 })
+ .hide()
+ .data( "menu" );
+ if ( $.fn.bgiframe ) {
+ this.menu.element.bgiframe();
+ }
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-autocomplete-input" )
+ .removeAttr( "autocomplete" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-autocomplete" )
+ .removeAttr( "aria-haspopup" );
+ this.menu.element.remove();
+ $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "source" ) {
+ this._initSource();
+ }
+ },
+
+ _initSource: function() {
+ var array,
+ url;
+ if ( $.isArray(this.options.source) ) {
+ array = this.options.source;
+ this.source = function( request, response ) {
+ response( $.ui.autocomplete.filter(array, request.term) );
+ };
+ } else if ( typeof this.options.source === "string" ) {
+ url = this.options.source;
+ this.source = function( request, response ) {
+ $.getJSON( url, request, response );
+ };
+ } else {
+ this.source = this.options.source;
+ }
+ },
+
+ search: function( value, event ) {
+ value = value != null ? value : this.element.val();
+ if ( value.length < this.options.minLength ) {
+ return this.close( event );
+ }
+
+ clearTimeout( this.closing );
+ if ( this._trigger("search") === false ) {
+ return;
+ }
+
+ return this._search( value );
+ },
+
+ _search: function( value ) {
+ this.term = this.element
+ .addClass( "ui-autocomplete-loading" )
+ // always save the actual value, not the one passed as an argument
+ .val();
+
+ this.source( { term: value }, this.response );
+ },
+
+ _response: function( content ) {
+ if ( content.length ) {
+ content = this._normalize( content );
+ this._suggest( content );
+ this._trigger( "open" );
+ } else {
+ this.close();
+ }
+ this.element.removeClass( "ui-autocomplete-loading" );
+ },
+
+ close: function( event ) {
+ clearTimeout( this.closing );
+ if ( this.menu.element.is(":visible") ) {
+ this._trigger( "close", event );
+ this.menu.element.hide();
+ this.menu.deactivate();
+ }
+ },
+
+ _change: function( event ) {
+ if ( this.previous !== this.element.val() ) {
+ this._trigger( "change", event, { item: this.selectedItem } );
+ }
+ },
+
+ _normalize: function( items ) {
+ // assume all items have the right format when the first item is complete
+ if ( items.length && items[0].label && items[0].value ) {
+ return items;
+ }
+ return $.map( items, function(item) {
+ if ( typeof item === "string" ) {
+ return {
+ label: item,
+ value: item
+ };
+ }
+ return $.extend({
+ label: item.label || item.value,
+ value: item.value || item.label
+ }, item );
+ });
+ },
+
+ _suggest: function( items ) {
+ var ul = this.menu.element
+ .empty()
+ .zIndex( this.element.zIndex() + 1 ),
+ menuWidth,
+ textWidth;
+ this._renderMenu( ul, items );
+ // TODO refresh should check if the active item is still in the dom, removing the need for a manual deactivate
+ this.menu.deactivate();
+ this.menu.refresh();
+ this.menu.element.show().position({
+ my: "left top",
+ at: "left bottom",
+ of: this.element,
+ collision: "none"
+ });
+
+ menuWidth = ul.width( "" ).width();
+ textWidth = this.element.width();
+ ul.width( Math.max( menuWidth, textWidth ) );
+ },
+
+ _renderMenu: function( ul, items ) {
+ var self = this;
+ $.each( items, function( index, item ) {
+ self._renderItem( ul, item );
+ });
+ },
+
+ _renderItem: function( ul, item) {
+ return $( "<li></li>" )
+ .data( "item.autocomplete", item )
+ .append( "<a>" + item.label + "</a>" )
+ .appendTo( ul );
+ },
+
+ _move: function( direction, event ) {
+ if ( !this.menu.element.is(":visible") ) {
+ this.search( null, event );
+ return;
+ }
+ if ( this.menu.first() && /^previous/.test(direction) ||
+ this.menu.last() && /^next/.test(direction) ) {
+ this.element.val( this.term );
+ this.menu.deactivate();
+ return;
+ }
+ this.menu[ direction ]( event );
+ },
+
+ widget: function() {
+ return this.menu.element;
+ }
+});
+
+$.extend( $.ui.autocomplete, {
+ escapeRegex: function( value ) {
+ return value.replace( /([\^\$\(\)\[\]\{\}\*\.\+\?\|\\])/gi, "\\$1" );
+ },
+ filter: function(array, term) {
+ var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" );
+ return $.grep( array, function(value) {
+ return matcher.test( value.label || value.value || value );
+ });
+ }
+});
+
+}( jQuery ));
+
+/*
+ * jQuery UI Menu (not officially released)
+ *
+ * This widget isn't yet finished and the API is subject to change. We plan to finish
+ * it for the next release. You're welcome to give it a try anyway and give us feedback,
+ * as long as you're okay with migrating your code later on. We can help with that, too.
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Menu
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.menu", {
+ _create: function() {
+ var self = this;
+ this.element
+ .addClass("ui-menu ui-widget ui-widget-content ui-corner-all")
+ .attr({
+ role: "listbox",
+ "aria-activedescendant": "ui-active-menuitem"
+ })
+ .click(function( event ) {
+ if ( !$( event.target ).closest( ".ui-menu-item a" ).length ) {
+ return;
+ }
+ // temporary
+ event.preventDefault();
+ self.select( event );
+ });
+ this.refresh();
+ },
+
+ refresh: function() {
+ var self = this;
+
+ // don't refresh list items that are already adapted
+ var items = this.element.children("li:not(.ui-menu-item):has(a)")
+ .addClass("ui-menu-item")
+ .attr("role", "menuitem");
+
+ items.children("a")
+ .addClass("ui-corner-all")
+ .attr("tabindex", -1)
+ // mouseenter doesn't work with event delegation
+ .mouseenter(function( event ) {
+ self.activate( event, $(this).parent() );
+ })
+ .mouseleave(function() {
+ self.deactivate();
+ });
+ },
+
+ activate: function( event, item ) {
+ this.deactivate();
+ if (this.hasScroll()) {
+ var offset = item.offset().top - this.element.offset().top,
+ scroll = this.element.attr("scrollTop"),
+ elementHeight = this.element.height();
+ if (offset < 0) {
+ this.element.attr("scrollTop", scroll + offset);
+ } else if (offset > elementHeight) {
+ this.element.attr("scrollTop", scroll + offset - elementHeight + item.height());
+ }
+ }
+ this.active = item.eq(0)
+ .children("a")
+ .addClass("ui-state-hover")
+ .attr("id", "ui-active-menuitem")
+ .end();
+ this._trigger("focus", event, { item: item });
+ },
+
+ deactivate: function() {
+ if (!this.active) { return; }
+
+ this.active.children("a")
+ .removeClass("ui-state-hover")
+ .removeAttr("id");
+ this._trigger("blur");
+ this.active = null;
+ },
+
+ next: function(event) {
+ this.move("next", ".ui-menu-item:first", event);
+ },
+
+ previous: function(event) {
+ this.move("prev", ".ui-menu-item:last", event);
+ },
+
+ first: function() {
+ return this.active && !this.active.prev().length;
+ },
+
+ last: function() {
+ return this.active && !this.active.next().length;
+ },
+
+ move: function(direction, edge, event) {
+ if (!this.active) {
+ this.activate(event, this.element.children(edge));
+ return;
+ }
+ var next = this.active[direction + "All"](".ui-menu-item").eq(0);
+ if (next.length) {
+ this.activate(event, next);
+ } else {
+ this.activate(event, this.element.children(edge));
+ }
+ },
+
+ // TODO merge with previousPage
+ nextPage: function(event) {
+ if (this.hasScroll()) {
+ // TODO merge with no-scroll-else
+ if (!this.active || this.last()) {
+ this.activate(event, this.element.children(":first"));
+ return;
+ }
+ var base = this.active.offset().top,
+ height = this.element.height(),
+ result = this.element.children("li").filter(function() {
+ var close = $(this).offset().top - base - height + $(this).height();
+ // TODO improve approximation
+ return close < 10 && close > -10;
+ });
+
+ // TODO try to catch this earlier when scrollTop indicates the last page anyway
+ if (!result.length) {
+ result = this.element.children(":last");
+ }
+ this.activate(event, result);
+ } else {
+ this.activate(event, this.element.children(!this.active || this.last() ? ":first" : ":last"));
+ }
+ },
+
+ // TODO merge with nextPage
+ previousPage: function(event) {
+ if (this.hasScroll()) {
+ // TODO merge with no-scroll-else
+ if (!this.active || this.first()) {
+ this.activate(event, this.element.children(":last"));
+ return;
+ }
+
+ var base = this.active.offset().top,
+ height = this.element.height();
+ result = this.element.children("li").filter(function() {
+ var close = $(this).offset().top - base + height - $(this).height();
+ // TODO improve approximation
+ return close < 10 && close > -10;
+ });
+
+ // TODO try to catch this earlier when scrollTop indicates the last page anyway
+ if (!result.length) {
+ result = this.element.children(":first");
+ }
+ this.activate(event, result);
+ } else {
+ this.activate(event, this.element.children(!this.active || this.first() ? ":last" : ":first"));
+ }
+ },
+
+ hasScroll: function() {
+ return this.element.height() < this.element.attr("scrollHeight");
+ },
+
+ select: function( event ) {
+ this._trigger("selected", event, { item: this.active });
+ }
+});
+
+}(jQuery));
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.button.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,365 @@
+/*
+ * jQuery UI Button 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $ ) {
+
+var lastActive,
+ baseClasses = "ui-button ui-widget ui-state-default ui-corner-all",
+ otherClasses = "ui-state-hover ui-state-active " +
+ "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon ui-button-text-only",
+ formResetHandler = function( event ) {
+ $( ":ui-button", event.target.form ).each(function() {
+ var inst = $( this ).data( "button" );
+ setTimeout(function() {
+ inst.refresh();
+ }, 1 );
+ });
+ },
+ radioGroup = function( radio ) {
+ var name = radio.name,
+ form = radio.form,
+ radios = $( [] );
+ if ( name ) {
+ if ( form ) {
+ radios = $( form ).find( "[name='" + name + "']" );
+ } else {
+ radios = $( "[name='" + name + "']", radio.ownerDocument )
+ .filter(function() {
+ return !this.form;
+ });
+ }
+ }
+ return radios;
+ };
+
+$.widget( "ui.button", {
+ options: {
+ text: true,
+ label: null,
+ icons: {
+ primary: null,
+ secondary: null
+ }
+ },
+ _create: function() {
+ this.element.closest( "form" )
+ .unbind( "reset.button" )
+ .bind( "reset.button", formResetHandler );
+
+ this._determineButtonType();
+ this.hasTitle = !!this.buttonElement.attr( "title" );
+
+ var self = this,
+ options = this.options,
+ toggleButton = this.type === "checkbox" || this.type === "radio",
+ hoverClass = "ui-state-hover" + ( !toggleButton ? " ui-state-active" : "" ),
+ focusClass = "ui-state-focus";
+
+ if ( options.label === null ) {
+ options.label = this.buttonElement.html();
+ }
+
+ if ( this.element.is( ":disabled" ) ) {
+ options.disabled = true;
+ }
+
+ this.buttonElement
+ .addClass( baseClasses )
+ .attr( "role", "button" )
+ .bind( "mouseenter.button", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).addClass( "ui-state-hover" );
+ if ( this === lastActive ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "mouseleave.button", function() {
+ if ( options.disabled ) {
+ return;
+ }
+ $( this ).removeClass( hoverClass );
+ })
+ .bind( "focus.button", function() {
+ // no need to check disabled, focus won't be triggered anyway
+ $( this ).addClass( focusClass );
+ })
+ .bind( "blur.button", function() {
+ $( this ).removeClass( focusClass );
+ });
+
+ if ( toggleButton ) {
+ this.element.bind( "change.button", function() {
+ self.refresh();
+ });
+ }
+
+ if ( this.type === "checkbox" ) {
+ this.buttonElement.bind( "click.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).toggleClass( "ui-state-active" );
+ self.buttonElement.attr( "aria-pressed", self.element[0].checked );
+ });
+ } else if ( this.type === "radio" ) {
+ this.buttonElement.bind( "click.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ self.buttonElement.attr( "aria-pressed", true );
+
+ var radio = self.element[ 0 ];
+ radioGroup( radio )
+ .not( radio )
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ });
+ } else {
+ this.buttonElement
+ .bind( "mousedown.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).addClass( "ui-state-active" );
+ lastActive = this;
+ $( document ).one( "mouseup", function() {
+ lastActive = null;
+ });
+ })
+ .bind( "mouseup.button", function() {
+ if ( options.disabled ) {
+ return false;
+ }
+ $( this ).removeClass( "ui-state-active" );
+ })
+ .bind( "keydown.button", function(event) {
+ if ( options.disabled ) {
+ return false;
+ }
+ if ( event.keyCode == $.ui.keyCode.SPACE || event.keyCode == $.ui.keyCode.ENTER ) {
+ $( this ).addClass( "ui-state-active" );
+ }
+ })
+ .bind( "keyup.button", function() {
+ $( this ).removeClass( "ui-state-active" );
+ });
+
+ if ( this.buttonElement.is("a") ) {
+ this.buttonElement.keyup(function(event) {
+ if ( event.keyCode === $.ui.keyCode.SPACE ) {
+ // TODO pass through original event correctly (just as 2nd argument doesn't work)
+ $( this ).click();
+ }
+ });
+ }
+ }
+
+ // TODO: pull out $.Widget's handling for the disabled option into
+ // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can
+ // be overridden by individual plugins
+ this._setOption( "disabled", options.disabled );
+ },
+
+ _determineButtonType: function() {
+
+ if ( this.element.is(":checkbox") ) {
+ this.type = "checkbox";
+ } else {
+ if ( this.element.is(":radio") ) {
+ this.type = "radio";
+ } else {
+ if ( this.element.is("input") ) {
+ this.type = "input";
+ } else {
+ this.type = "button";
+ }
+ }
+ }
+
+ if ( this.type === "checkbox" || this.type === "radio" ) {
+ // we don't search against the document in case the element
+ // is disconnected from the DOM
+ this.buttonElement = this.element.parents().last()
+ .find( "[for=" + this.element.attr("id") + "]" );
+ this.element.addClass( "ui-helper-hidden-accessible" );
+
+ var checked = this.element.is( ":checked" );
+ if ( checked ) {
+ this.buttonElement.addClass( "ui-state-active" );
+ }
+ this.buttonElement.attr( "aria-pressed", checked );
+ } else {
+ this.buttonElement = this.element;
+ }
+ },
+
+ widget: function() {
+ return this.buttonElement;
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-helper-hidden-accessible" );
+ this.buttonElement
+ .removeClass( baseClasses + " " + otherClasses )
+ .removeAttr( "role" )
+ .removeAttr( "aria-pressed" )
+ .html( this.buttonElement.find(".ui-button-text").html() );
+
+ if ( !this.hasTitle ) {
+ this.buttonElement.removeAttr( "title" );
+ }
+
+ $.Widget.prototype.destroy.call( this );
+ },
+
+ _setOption: function( key, value ) {
+ $.Widget.prototype._setOption.apply( this, arguments );
+ if ( key === "disabled" ) {
+ if ( value ) {
+ this.element.attr( "disabled", true );
+ } else {
+ this.element.removeAttr( "disabled" );
+ }
+ }
+ this._resetButton();
+ },
+
+ refresh: function() {
+ var isDisabled = this.element.is( ":disabled" );
+ if ( isDisabled !== this.options.disabled ) {
+ this._setOption( "disabled", isDisabled );
+ }
+ if ( this.type === "radio" ) {
+ radioGroup( this.element[0] ).each(function() {
+ if ( $( this ).is( ":checked" ) ) {
+ $( this ).button( "widget" )
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", true );
+ } else {
+ $( this ).button( "widget" )
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ }
+ });
+ } else if ( this.type === "checkbox" ) {
+ if ( this.element.is( ":checked" ) ) {
+ this.buttonElement
+ .addClass( "ui-state-active" )
+ .attr( "aria-pressed", true );
+ } else {
+ this.buttonElement
+ .removeClass( "ui-state-active" )
+ .attr( "aria-pressed", false );
+ }
+ }
+ },
+
+ _resetButton: function() {
+ if ( this.type === "input" ) {
+ if ( this.options.label ) {
+ this.element.val( this.options.label );
+ }
+ return;
+ }
+ var buttonElement = this.buttonElement,
+ buttonText = $( "<span></span>" )
+ .addClass( "ui-button-text" )
+ .html( this.options.label )
+ .appendTo( buttonElement.empty() )
+ .text(),
+ icons = this.options.icons,
+ multipleIcons = icons.primary && icons.secondary;
+ if ( icons.primary || icons.secondary ) {
+ buttonElement.addClass( "ui-button-text-icon" +
+ ( multipleIcons ? "s" : "" ) );
+ if ( icons.primary ) {
+ buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" );
+ }
+ if ( icons.secondary ) {
+ buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" );
+ }
+ if ( !this.options.text ) {
+ buttonElement
+ .addClass( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" )
+ .removeClass( "ui-button-text-icons ui-button-text-icon" );
+ if ( !this.hasTitle ) {
+ buttonElement.attr( "title", buttonText );
+ }
+ }
+ } else {
+ buttonElement.addClass( "ui-button-text-only" );
+ }
+ }
+});
+
+$.widget( "ui.buttonset", {
+ _create: function() {
+ this.element.addClass( "ui-buttonset" );
+ this._init();
+ },
+
+ _init: function() {
+ this.refresh();
+ },
+
+ _setOption: function( key, value ) {
+ if ( key === "disabled" ) {
+ this.buttons.button( "option", key, value );
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+ },
+
+ refresh: function() {
+ this.buttons = this.element.find( ":button, :submit, :reset, :checkbox, :radio, a, :data(button)" )
+ .filter( ":ui-button" )
+ .button( "refresh" )
+ .end()
+ .not( ":ui-button" )
+ .button()
+ .end()
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-all ui-corner-left ui-corner-right" )
+ .filter( ":first" )
+ .addClass( "ui-corner-left" )
+ .end()
+ .filter( ":last" )
+ .addClass( "ui-corner-right" )
+ .end()
+ .end();
+ },
+
+ destroy: function() {
+ this.element.removeClass( "ui-buttonset" );
+ this.buttons
+ .map(function() {
+ return $( this ).button( "widget" )[ 0 ];
+ })
+ .removeClass( "ui-corner-left ui-corner-right" )
+ .end()
+ .button( "destroy" )
+
+ $.Widget.prototype.destroy.call( this );
+ }
+});
+
+}( jQuery ) );
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.core.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,202 @@
+/*!
+ * jQuery UI 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI
+ */
+;jQuery.ui || (function($) {
+
+//Helper functions and ui object
+$.ui = {
+ version: "1.8.1",
+
+ // $.ui.plugin is deprecated. Use the proxy pattern instead.
+ plugin: {
+ add: function(module, option, set) {
+ var proto = $.ui[module].prototype;
+ for(var i in set) {
+ proto.plugins[i] = proto.plugins[i] || [];
+ proto.plugins[i].push([option, set[i]]);
+ }
+ },
+ call: function(instance, name, args) {
+ var set = instance.plugins[name];
+ if(!set || !instance.element[0].parentNode) { return; }
+
+ for (var i = 0; i < set.length; i++) {
+ if (instance.options[set[i][0]]) {
+ set[i][1].apply(instance.element, args);
+ }
+ }
+ }
+ },
+
+ contains: function(a, b) {
+ return document.compareDocumentPosition
+ ? a.compareDocumentPosition(b) & 16
+ : a !== b && a.contains(b);
+ },
+
+ hasScroll: function(el, a) {
+
+ //If overflow is hidden, the element might have extra content, but the user wants to hide it
+ if ($(el).css('overflow') == 'hidden') { return false; }
+
+ var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop',
+ has = false;
+
+ if (el[scroll] > 0) { return true; }
+
+ // TODO: determine which cases actually cause this to happen
+ // if the element doesn't have the scroll set, see if it's possible to
+ // set the scroll
+ el[scroll] = 1;
+ has = (el[scroll] > 0);
+ el[scroll] = 0;
+ return has;
+ },
+
+ isOverAxis: function(x, reference, size) {
+ //Determines when x coordinate is over "b" element axis
+ return (x > reference) && (x < (reference + size));
+ },
+
+ isOver: function(y, x, top, left, height, width) {
+ //Determines when x, y coordinates is over "b" element
+ return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width);
+ },
+
+ keyCode: {
+ ALT: 18,
+ BACKSPACE: 8,
+ CAPS_LOCK: 20,
+ COMMA: 188,
+ CONTROL: 17,
+ DELETE: 46,
+ DOWN: 40,
+ END: 35,
+ ENTER: 13,
+ ESCAPE: 27,
+ HOME: 36,
+ INSERT: 45,
+ LEFT: 37,
+ NUMPAD_ADD: 107,
+ NUMPAD_DECIMAL: 110,
+ NUMPAD_DIVIDE: 111,
+ NUMPAD_ENTER: 108,
+ NUMPAD_MULTIPLY: 106,
+ NUMPAD_SUBTRACT: 109,
+ PAGE_DOWN: 34,
+ PAGE_UP: 33,
+ PERIOD: 190,
+ RIGHT: 39,
+ SHIFT: 16,
+ SPACE: 32,
+ TAB: 9,
+ UP: 38
+ }
+};
+
+//jQuery plugins
+$.fn.extend({
+ _focus: $.fn.focus,
+ focus: function(delay, fn) {
+ return typeof delay === 'number'
+ ? this.each(function() {
+ var elem = this;
+ setTimeout(function() {
+ $(elem).focus();
+ (fn && fn.call(elem));
+ }, delay);
+ })
+ : this._focus.apply(this, arguments);
+ },
+
+ enableSelection: function() {
+ return this
+ .attr('unselectable', 'off')
+ .css('MozUserSelect', '');
+ },
+
+ disableSelection: function() {
+ return this
+ .attr('unselectable', 'on')
+ .css('MozUserSelect', 'none');
+ },
+
+ scrollParent: function() {
+ var scrollParent;
+ if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+ scrollParent = this.parents().filter(function() {
+ return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ } else {
+ scrollParent = this.parents().filter(function() {
+ return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+ }).eq(0);
+ }
+
+ return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+ },
+
+ zIndex: function(zIndex) {
+ if (zIndex !== undefined) {
+ return this.css('zIndex', zIndex);
+ }
+
+ if (this.length) {
+ var elem = $(this[0]), position, value;
+ while (elem.length && elem[0] !== document) {
+ // Ignore z-index if position is set to a value where z-index is ignored by the browser
+ // This makes behavior of this function consistent across browsers
+ // WebKit always returns auto if the element is positioned
+ position = elem.css('position');
+ if (position == 'absolute' || position == 'relative' || position == 'fixed')
+ {
+ // IE returns 0 when zIndex is not specified
+ // other browsers return a string
+ // we ignore the case of nested elements with an explicit value of 0
+ // <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+ value = parseInt(elem.css('zIndex'));
+ if (!isNaN(value) && value != 0) {
+ return value;
+ }
+ }
+ elem = elem.parent();
+ }
+ }
+
+ return 0;
+ }
+});
+
+
+//Additional selectors
+$.extend($.expr[':'], {
+ data: function(elem, i, match) {
+ return !!$.data(elem, match[3]);
+ },
+
+ focusable: function(element) {
+ var nodeName = element.nodeName.toLowerCase(),
+ tabIndex = $.attr(element, 'tabindex');
+ return (/input|select|textarea|button|object/.test(nodeName)
+ ? !element.disabled
+ : 'a' == nodeName || 'area' == nodeName
+ ? element.href || !isNaN(tabIndex)
+ : !isNaN(tabIndex))
+ // the element and all of its ancestors must be visible
+ // the browser may report that the area is hidden
+ && !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length;
+ },
+
+ tabbable: function(element) {
+ var tabIndex = $.attr(element, 'tabindex');
+ return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable');
+ }
+});
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.datepicker.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,1727 @@
+/*
+ * jQuery UI Datepicker 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * jquery.ui.core.js
+ */
+
+(function($) { // hide the namespace
+
+$.extend($.ui, { datepicker: { version: "1.8.1" } });
+
+var PROP_NAME = 'datepicker';
+var dpuuid = new Date().getTime();
+
+/* Date picker manager.
+ Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+ Settings for (groups of) date pickers are maintained in an instance object,
+ allowing multiple different settings on the same page. */
+
+function Datepicker() {
+ this.debug = false; // Change this to true to start debugging
+ this._curInst = null; // The current instance in use
+ this._keyEvent = false; // If the last event was a key event
+ this._disabledInputs = []; // List of date picker inputs that have been disabled
+ this._datepickerShowing = false; // True if the popup picker is showing , false if not
+ this._inDialog = false; // True if showing within a "dialog", false if not
+ this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
+ this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
+ this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
+ this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
+ this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
+ this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
+ this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
+ this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
+ this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
+ this.regional = []; // Available regional settings, indexed by language code
+ this.regional[''] = { // Default regional settings
+ closeText: 'Done', // Display text for close link
+ prevText: 'Prev', // Display text for previous month link
+ nextText: 'Next', // Display text for next month link
+ currentText: 'Today', // Display text for current month link
+ monthNames: ['January','February','March','April','May','June',
+ 'July','August','September','October','November','December'], // Names of months for drop-down and formatting
+ monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
+ dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
+ dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
+ dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
+ weekHeader: 'Wk', // Column header for week of the year
+ dateFormat: 'mm/dd/yy', // See format options on parseDate
+ firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+ isRTL: false, // True if right-to-left language, false if left-to-right
+ showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+ yearSuffix: '' // Additional text to append to the year in the month headers
+ };
+ this._defaults = { // Global defaults for all the date picker instances
+ showOn: 'focus', // 'focus' for popup on focus,
+ // 'button' for trigger button, or 'both' for either
+ showAnim: 'show', // Name of jQuery animation for popup
+ showOptions: {}, // Options for enhanced animations
+ defaultDate: null, // Used when field is blank: actual date,
+ // +/-number for offset from today, null for today
+ appendText: '', // Display text following the input box, e.g. showing the format
+ buttonText: '...', // Text for trigger button
+ buttonImage: '', // URL for trigger button image
+ buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+ hideIfNoPrevNext: false, // True to hide next/previous month links
+ // if not applicable, false to just disable them
+ navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+ gotoCurrent: false, // True if today link goes back to current selection instead
+ changeMonth: false, // True if month can be selected directly, false if only prev/next
+ changeYear: false, // True if year can be selected directly, false if only prev/next
+ yearRange: 'c-10:c+10', // Range of years to display in drop-down,
+ // either relative to today's year (-nn:+nn), relative to currently displayed year
+ // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
+ showOtherMonths: false, // True to show dates in other months, false to leave blank
+ selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
+ showWeek: false, // True to show week of the year, false to not show it
+ calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+ // takes a Date and returns the number of the week for it
+ shortYearCutoff: '+10', // Short year values < this are in the current century,
+ // > this are in the previous century,
+ // string value starting with '+' for current year + value
+ minDate: null, // The earliest selectable date, or null for no limit
+ maxDate: null, // The latest selectable date, or null for no limit
+ duration: '_default', // Duration of display/closure
+ beforeShowDay: null, // Function that takes a date and returns an array with
+ // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
+ // [2] = cell title (optional), e.g. $.datepicker.noWeekends
+ beforeShow: null, // Function that takes an input field and
+ // returns a set of custom settings for the date picker
+ onSelect: null, // Define a callback function when a date is selected
+ onChangeMonthYear: null, // Define a callback function when the month or year is changed
+ onClose: null, // Define a callback function when the datepicker is closed
+ numberOfMonths: 1, // Number of months to show at a time
+ showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+ stepMonths: 1, // Number of months to step back/forward
+ stepBigMonths: 12, // Number of months to step back/forward for the big links
+ altField: '', // Selector for an alternate field to store selected dates into
+ altFormat: '', // The date format to use for the alternate field
+ constrainInput: true, // The input is constrained by the current date format
+ showButtonPanel: false, // True to show button panel, false to not show it
+ autoSize: false // True to size the input for the date format, false to leave as is
+ };
+ $.extend(this._defaults, this.regional['']);
+ this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
+}
+
+$.extend(Datepicker.prototype, {
+ /* Class name added to elements to indicate already configured with a date picker. */
+ markerClassName: 'hasDatepicker',
+
+ /* Debug logging (if enabled). */
+ log: function () {
+ if (this.debug)
+ console.log.apply('', arguments);
+ },
+
+ // TODO rename to "widget" when switching to widget factory
+ _widgetDatepicker: function() {
+ return this.dpDiv;
+ },
+
+ /* Override the default settings for all instances of the date picker.
+ @param settings object - the new settings to use as defaults (anonymous object)
+ @return the manager object */
+ setDefaults: function(settings) {
+ extendRemove(this._defaults, settings || {});
+ return this;
+ },
+
+ /* Attach the date picker to a jQuery selection.
+ @param target element - the target input field or division or span
+ @param settings object - the new settings to use for this date picker instance (anonymous) */
+ _attachDatepicker: function(target, settings) {
+ // check for settings on the control itself - in namespace 'date:'
+ var inlineSettings = null;
+ for (var attrName in this._defaults) {
+ var attrValue = target.getAttribute('date:' + attrName);
+ if (attrValue) {
+ inlineSettings = inlineSettings || {};
+ try {
+ inlineSettings[attrName] = eval(attrValue);
+ } catch (err) {
+ inlineSettings[attrName] = attrValue;
+ }
+ }
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ var inline = (nodeName == 'div' || nodeName == 'span');
+ if (!target.id)
+ target.id = 'dp' + (++this.uuid);
+ var inst = this._newInst($(target), inline);
+ inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+ if (nodeName == 'input') {
+ this._connectDatepicker(target, inst);
+ } else if (inline) {
+ this._inlineDatepicker(target, inst);
+ }
+ },
+
+ /* Create a new instance object. */
+ _newInst: function(target, inline) {
+ var id = target[0].id.replace(/([^A-Za-z0-9_])/g, '\\\\$1'); // escape jQuery meta chars
+ return {id: id, input: target, // associated target
+ selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+ drawMonth: 0, drawYear: 0, // month being drawn
+ inline: inline, // is datepicker inline or not
+ dpDiv: (!inline ? this.dpDiv : // presentation div
+ $('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
+ },
+
+ /* Attach the date picker to an input field. */
+ _connectDatepicker: function(target, inst) {
+ var input = $(target);
+ inst.append = $([]);
+ inst.trigger = $([]);
+ if (input.hasClass(this.markerClassName))
+ return;
+ this._attachments(input, inst);
+ input.addClass(this.markerClassName).keydown(this._doKeyDown).
+ keypress(this._doKeyPress).keyup(this._doKeyUp).
+ bind("setData.datepicker", function(event, key, value) {
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key) {
+ return this._get(inst, key);
+ });
+ this._autoSize(inst);
+ $.data(target, PROP_NAME, inst);
+ },
+
+ /* Make attachments based on settings. */
+ _attachments: function(input, inst) {
+ var appendText = this._get(inst, 'appendText');
+ var isRTL = this._get(inst, 'isRTL');
+ if (inst.append)
+ inst.append.remove();
+ if (appendText) {
+ inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
+ input[isRTL ? 'before' : 'after'](inst.append);
+ }
+ input.unbind('focus', this._showDatepicker);
+ if (inst.trigger)
+ inst.trigger.remove();
+ var showOn = this._get(inst, 'showOn');
+ if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
+ input.focus(this._showDatepicker);
+ if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
+ var buttonText = this._get(inst, 'buttonText');
+ var buttonImage = this._get(inst, 'buttonImage');
+ inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
+ $('<img/>').addClass(this._triggerClass).
+ attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
+ $('<button type="button"></button>').addClass(this._triggerClass).
+ html(buttonImage == '' ? buttonText : $('<img/>').attr(
+ { src:buttonImage, alt:buttonText, title:buttonText })));
+ input[isRTL ? 'before' : 'after'](inst.trigger);
+ inst.trigger.click(function() {
+ if ($.datepicker._datepickerShowing && $.datepicker._lastInput == input[0])
+ $.datepicker._hideDatepicker();
+ else
+ $.datepicker._showDatepicker(input[0]);
+ return false;
+ });
+ }
+ },
+
+ /* Apply the maximum length for the date format. */
+ _autoSize: function(inst) {
+ if (this._get(inst, 'autoSize') && !inst.inline) {
+ var date = new Date(2009, 12 - 1, 20); // Ensure double digits
+ var dateFormat = this._get(inst, 'dateFormat');
+ if (dateFormat.match(/[DM]/)) {
+ var findMax = function(names) {
+ var max = 0;
+ var maxI = 0;
+ for (var i = 0; i < names.length; i++) {
+ if (names[i].length > max) {
+ max = names[i].length;
+ maxI = i;
+ }
+ }
+ return maxI;
+ };
+ date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
+ 'monthNames' : 'monthNamesShort'))));
+ date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
+ 'dayNames' : 'dayNamesShort'))) + 20 - date.getDay());
+ }
+ inst.input.attr('size', this._formatDate(inst, date).length);
+ }
+ },
+
+ /* Attach an inline date picker to a div. */
+ _inlineDatepicker: function(target, inst) {
+ var divSpan = $(target);
+ if (divSpan.hasClass(this.markerClassName))
+ return;
+ divSpan.addClass(this.markerClassName).append(inst.dpDiv).
+ bind("setData.datepicker", function(event, key, value){
+ inst.settings[key] = value;
+ }).bind("getData.datepicker", function(event, key){
+ return this._get(inst, key);
+ });
+ $.data(target, PROP_NAME, inst);
+ this._setDate(inst, this._getDefaultDate(inst), true);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ },
+
+ /* Pop-up the date picker in a "dialog" box.
+ @param input element - ignored
+ @param date string or Date - the initial date to display
+ @param onSelect function - the function to call when a date is selected
+ @param settings object - update the dialog date picker instance's settings (anonymous object)
+ @param pos int[2] - coordinates for the dialog's position within the screen or
+ event - with x/y coordinates or
+ leave empty for default (screen centre)
+ @return the manager object */
+ _dialogDatepicker: function(input, date, onSelect, settings, pos) {
+ var inst = this._dialogInst; // internal instance
+ if (!inst) {
+ var id = 'dp' + (++this.uuid);
+ this._dialogInput = $('<input type="text" id="' + id +
+ '" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');
+ this._dialogInput.keydown(this._doKeyDown);
+ $('body').append(this._dialogInput);
+ inst = this._dialogInst = this._newInst(this._dialogInput, false);
+ inst.settings = {};
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ }
+ extendRemove(inst.settings, settings || {});
+ date = (date && date.constructor == Date ? this._formatDate(inst, date) : date);
+ this._dialogInput.val(date);
+
+ this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+ if (!this._pos) {
+ var browserWidth = document.documentElement.clientWidth;
+ var browserHeight = document.documentElement.clientHeight;
+ var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+ var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+ this._pos = // should use actual width/height below
+ [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+ }
+
+ // move input on screen for focus, but hidden behind dialog
+ this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px');
+ inst.settings.onSelect = onSelect;
+ this._inDialog = true;
+ this.dpDiv.addClass(this._dialogClass);
+ this._showDatepicker(this._dialogInput[0]);
+ if ($.blockUI)
+ $.blockUI(this.dpDiv);
+ $.data(this._dialogInput[0], PROP_NAME, inst);
+ return this;
+ },
+
+ /* Detach a datepicker from its control.
+ @param target element - the target input field or division or span */
+ _destroyDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ $.removeData(target, PROP_NAME);
+ if (nodeName == 'input') {
+ inst.append.remove();
+ inst.trigger.remove();
+ $target.removeClass(this.markerClassName).
+ unbind('focus', this._showDatepicker).
+ unbind('keydown', this._doKeyDown).
+ unbind('keypress', this._doKeyPress).
+ unbind('keyup', this._doKeyUp);
+ } else if (nodeName == 'div' || nodeName == 'span')
+ $target.removeClass(this.markerClassName).empty();
+ },
+
+ /* Enable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _enableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = false;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = false; }).end().
+ filter('img').css({opacity: '1.0', cursor: ''});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().removeClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ },
+
+ /* Disable the date picker to a jQuery selection.
+ @param target element - the target input field or division or span */
+ _disableDatepicker: function(target) {
+ var $target = $(target);
+ var inst = $.data(target, PROP_NAME);
+ if (!$target.hasClass(this.markerClassName)) {
+ return;
+ }
+ var nodeName = target.nodeName.toLowerCase();
+ if (nodeName == 'input') {
+ target.disabled = true;
+ inst.trigger.filter('button').
+ each(function() { this.disabled = true; }).end().
+ filter('img').css({opacity: '0.5', cursor: 'default'});
+ }
+ else if (nodeName == 'div' || nodeName == 'span') {
+ var inline = $target.children('.' + this._inlineClass);
+ inline.children().addClass('ui-state-disabled');
+ }
+ this._disabledInputs = $.map(this._disabledInputs,
+ function(value) { return (value == target ? null : value); }); // delete entry
+ this._disabledInputs[this._disabledInputs.length] = target;
+ },
+
+ /* Is the first field in a jQuery collection disabled as a datepicker?
+ @param target element - the target input field or division or span
+ @return boolean - true if disabled, false if enabled */
+ _isDisabledDatepicker: function(target) {
+ if (!target) {
+ return false;
+ }
+ for (var i = 0; i < this._disabledInputs.length; i++) {
+ if (this._disabledInputs[i] == target)
+ return true;
+ }
+ return false;
+ },
+
+ /* Retrieve the instance data for the target control.
+ @param target element - the target input field or division or span
+ @return object - the associated instance data
+ @throws error if a jQuery problem getting data */
+ _getInst: function(target) {
+ try {
+ return $.data(target, PROP_NAME);
+ }
+ catch (err) {
+ throw 'Missing instance data for this datepicker';
+ }
+ },
+
+ /* Update or retrieve the settings for a date picker attached to an input field or division.
+ @param target element - the target input field or division or span
+ @param name object - the new settings to update or
+ string - the name of the setting to change or retrieve,
+ when retrieving also 'all' for all instance settings or
+ 'defaults' for all global defaults
+ @param value any - the new value for the setting
+ (omit if above is an object or to retrieve a value) */
+ _optionDatepicker: function(target, name, value) {
+ var inst = this._getInst(target);
+ if (arguments.length == 2 && typeof name == 'string') {
+ return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
+ (inst ? (name == 'all' ? $.extend({}, inst.settings) :
+ this._get(inst, name)) : null));
+ }
+ var settings = name || {};
+ if (typeof name == 'string') {
+ settings = {};
+ settings[name] = value;
+ }
+ if (inst) {
+ if (this._curInst == inst) {
+ this._hideDatepicker();
+ }
+ var date = this._getDateDatepicker(target, true);
+ extendRemove(inst.settings, settings);
+ this._attachments($(target), inst);
+ this._autoSize(inst);
+ this._setDateDatepicker(target, date);
+ this._updateDatepicker(inst);
+ }
+ },
+
+ // change method deprecated
+ _changeDatepicker: function(target, name, value) {
+ this._optionDatepicker(target, name, value);
+ },
+
+ /* Redraw the date picker attached to an input field or division.
+ @param target element - the target input field or division or span */
+ _refreshDatepicker: function(target) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._updateDatepicker(inst);
+ }
+ },
+
+ /* Set the dates for a jQuery selection.
+ @param target element - the target input field or division or span
+ @param date Date - the new date */
+ _setDateDatepicker: function(target, date) {
+ var inst = this._getInst(target);
+ if (inst) {
+ this._setDate(inst, date);
+ this._updateDatepicker(inst);
+ this._updateAlternate(inst);
+ }
+ },
+
+ /* Get the date(s) for the first entry in a jQuery selection.
+ @param target element - the target input field or division or span
+ @param noDefault boolean - true if no default date is to be used
+ @return Date - the current date */
+ _getDateDatepicker: function(target, noDefault) {
+ var inst = this._getInst(target);
+ if (inst && !inst.inline)
+ this._setDateFromField(inst, noDefault);
+ return (inst ? this._getDate(inst) : null);
+ },
+
+ /* Handle keystrokes. */
+ _doKeyDown: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ var handled = true;
+ var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
+ inst._keyEvent = true;
+ if ($.datepicker._datepickerShowing)
+ switch (event.keyCode) {
+ case 9: $.datepicker._hideDatepicker();
+ handled = false;
+ break; // hide on tab out
+ case 13: var sel = $('td.' + $.datepicker._dayOverClass, inst.dpDiv).
+ add($('td.' + $.datepicker._currentClass, inst.dpDiv));
+ if (sel[0])
+ $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+ else
+ $.datepicker._hideDatepicker();
+ return false; // don't submit the form
+ break; // select the value on enter
+ case 27: $.datepicker._hideDatepicker();
+ break; // hide on escape
+ case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // previous month/year on page up/+ ctrl
+ case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ break; // next month/year on page down/+ ctrl
+ case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // clear on ctrl or command +end
+ case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
+ handled = event.ctrlKey || event.metaKey;
+ break; // current on ctrl or command +home
+ case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // -1 day on ctrl or command +left
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ -$.datepicker._get(inst, 'stepBigMonths') :
+ -$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +left on Mac
+ break;
+ case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // -1 week on ctrl or command +up
+ case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
+ handled = event.ctrlKey || event.metaKey;
+ // +1 day on ctrl or command +right
+ if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+ +$.datepicker._get(inst, 'stepBigMonths') :
+ +$.datepicker._get(inst, 'stepMonths')), 'M');
+ // next month/year on alt +right
+ break;
+ case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
+ handled = event.ctrlKey || event.metaKey;
+ break; // +1 week on ctrl or command +down
+ default: handled = false;
+ }
+ else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
+ $.datepicker._showDatepicker(this);
+ else {
+ handled = false;
+ }
+ if (handled) {
+ event.preventDefault();
+ event.stopPropagation();
+ }
+ },
+
+ /* Filter entered characters - based on date format. */
+ _doKeyPress: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if ($.datepicker._get(inst, 'constrainInput')) {
+ var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
+ var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
+ return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
+ }
+ },
+
+ /* Synchronise manual entry and field/alternate field. */
+ _doKeyUp: function(event) {
+ var inst = $.datepicker._getInst(event.target);
+ if (inst.input.val() != inst.lastVal) {
+ try {
+ var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+ (inst.input ? inst.input.val() : null),
+ $.datepicker._getFormatConfig(inst));
+ if (date) { // only if valid
+ $.datepicker._setDateFromField(inst);
+ $.datepicker._updateAlternate(inst);
+ $.datepicker._updateDatepicker(inst);
+ }
+ }
+ catch (event) {
+ $.datepicker.log(event);
+ }
+ }
+ return true;
+ },
+
+ /* Pop-up the date picker for a given input field.
+ @param input element - the input field attached to the date picker or
+ event - if triggered by focus */
+ _showDatepicker: function(input) {
+ input = input.target || input;
+ if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
+ input = $('input', input.parentNode)[0];
+ if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
+ return;
+ var inst = $.datepicker._getInst(input);
+ if ($.datepicker._curInst && $.datepicker._curInst != inst) {
+ $.datepicker._curInst.dpDiv.stop(true, true);
+ }
+ var beforeShow = $.datepicker._get(inst, 'beforeShow');
+ extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
+ inst.lastVal = null;
+ $.datepicker._lastInput = input;
+ $.datepicker._setDateFromField(inst);
+ if ($.datepicker._inDialog) // hide cursor
+ input.value = '';
+ if (!$.datepicker._pos) { // position below input
+ $.datepicker._pos = $.datepicker._findPos(input);
+ $.datepicker._pos[1] += input.offsetHeight; // add the height
+ }
+ var isFixed = false;
+ $(input).parents().each(function() {
+ isFixed |= $(this).css('position') == 'fixed';
+ return !isFixed;
+ });
+ if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+ $.datepicker._pos[0] -= document.documentElement.scrollLeft;
+ $.datepicker._pos[1] -= document.documentElement.scrollTop;
+ }
+ var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+ $.datepicker._pos = null;
+ // determine sizing offscreen
+ inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
+ $.datepicker._updateDatepicker(inst);
+ // fix width for dynamic number of date pickers
+ // and adjust position before showing
+ offset = $.datepicker._checkOffset(inst, offset, isFixed);
+ inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
+ 'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+ left: offset.left + 'px', top: offset.top + 'px'});
+ if (!inst.inline) {
+ var showAnim = $.datepicker._get(inst, 'showAnim');
+ var duration = $.datepicker._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._datepickerShowing = true;
+ var borders = $.datepicker._getBorders(inst.dpDiv);
+ inst.dpDiv.find('iframe.ui-datepicker-cover'). // IE6- only
+ css({left: -borders[0], top: -borders[1],
+ width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()});
+ };
+ inst.dpDiv.zIndex($(input).zIndex()+1);
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[showAnim || 'show']((showAnim ? duration : null), postProcess);
+ if (!showAnim || !duration)
+ postProcess();
+ if (inst.input.is(':visible') && !inst.input.is(':disabled'))
+ inst.input.focus();
+ $.datepicker._curInst = inst;
+ }
+ },
+
+ /* Generate the date picker content. */
+ _updateDatepicker: function(inst) {
+ var self = this;
+ var borders = $.datepicker._getBorders(inst.dpDiv);
+ inst.dpDiv.empty().append(this._generateHTML(inst))
+ .find('iframe.ui-datepicker-cover') // IE6- only
+ .css({left: -borders[0], top: -borders[1],
+ width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()})
+ .end()
+ .find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
+ .bind('mouseout', function(){
+ $(this).removeClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
+ })
+ .bind('mouseover', function(){
+ if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
+ $(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
+ $(this).addClass('ui-state-hover');
+ if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
+ if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
+ }
+ })
+ .end()
+ .find('.' + this._dayOverClass + ' a')
+ .trigger('mouseover')
+ .end();
+ var numMonths = this._getNumberOfMonths(inst);
+ var cols = numMonths[1];
+ var width = 17;
+ if (cols > 1)
+ inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
+ else
+ inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
+ inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-multi');
+ inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
+ 'Class']('ui-datepicker-rtl');
+ if (inst == $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input &&
+ inst.input.is(':visible') && !inst.input.is(':disabled'))
+ inst.input.focus();
+ },
+
+ /* Retrieve the size of left and top borders for an element.
+ @param elem (jQuery object) the element of interest
+ @return (number[2]) the left and top borders */
+ _getBorders: function(elem) {
+ var convert = function(value) {
+ return {thin: 1, medium: 2, thick: 3}[value] || value;
+ };
+ return [parseFloat(convert(elem.css('border-left-width'))),
+ parseFloat(convert(elem.css('border-top-width')))];
+ },
+
+ /* Check positioning to remain on screen. */
+ _checkOffset: function(inst, offset, isFixed) {
+ var dpWidth = inst.dpDiv.outerWidth();
+ var dpHeight = inst.dpDiv.outerHeight();
+ var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+ var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+ var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft();
+ var viewHeight = document.documentElement.clientHeight + $(document).scrollTop();
+
+ offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
+ offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+ offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+ // now check if datepicker is showing outside window viewport - move to a better place if so.
+ offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
+ Math.abs(offset.left + dpWidth - viewWidth) : 0);
+ offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
+ Math.abs(dpHeight + inputHeight) : 0);
+
+ return offset;
+ },
+
+ /* Find an object's position on the screen. */
+ _findPos: function(obj) {
+ var inst = this._getInst(obj);
+ var isRTL = this._get(inst, 'isRTL');
+ while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
+ obj = obj[isRTL ? 'previousSibling' : 'nextSibling'];
+ }
+ var position = $(obj).offset();
+ return [position.left, position.top];
+ },
+
+ /* Hide the date picker from view.
+ @param input element - the input field attached to the date picker */
+ _hideDatepicker: function(input) {
+ var inst = this._curInst;
+ if (!inst || (input && inst != $.data(input, PROP_NAME)))
+ return;
+ if (this._datepickerShowing) {
+ var showAnim = this._get(inst, 'showAnim');
+ var duration = this._get(inst, 'duration');
+ var postProcess = function() {
+ $.datepicker._tidyDialog(inst);
+ this._curInst = null;
+ };
+ if ($.effects && $.effects[showAnim])
+ inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+ else
+ inst.dpDiv[(showAnim == 'slideDown' ? 'slideUp' :
+ (showAnim == 'fadeIn' ? 'fadeOut' : 'hide'))]((showAnim ? duration : null), postProcess);
+ if (!showAnim)
+ postProcess();
+ var onClose = this._get(inst, 'onClose');
+ if (onClose)
+ onClose.apply((inst.input ? inst.input[0] : null),
+ [(inst.input ? inst.input.val() : ''), inst]); // trigger custom callback
+ this._datepickerShowing = false;
+ this._lastInput = null;
+ if (this._inDialog) {
+ this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+ if ($.blockUI) {
+ $.unblockUI();
+ $('body').append(this.dpDiv);
+ }
+ }
+ this._inDialog = false;
+ }
+ },
+
+ /* Tidy up after a dialog display. */
+ _tidyDialog: function(inst) {
+ inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
+ },
+
+ /* Close date picker if clicked elsewhere. */
+ _checkExternalClick: function(event) {
+ if (!$.datepicker._curInst)
+ return;
+ var $target = $(event.target);
+ if ($target[0].id != $.datepicker._mainDivId &&
+ $target.parents('#' + $.datepicker._mainDivId).length == 0 &&
+ !$target.hasClass($.datepicker.markerClassName) &&
+ !$target.hasClass($.datepicker._triggerClass) &&
+ $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
+ $.datepicker._hideDatepicker();
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustDate: function(id, offset, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ this._adjustInstDate(inst, offset +
+ (period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
+ period);
+ this._updateDatepicker(inst);
+ },
+
+ /* Action for current link. */
+ _gotoToday: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
+ inst.selectedDay = inst.currentDay;
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+ inst.drawYear = inst.selectedYear = inst.currentYear;
+ }
+ else {
+ var date = new Date();
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ }
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Action for selecting a new month/year. */
+ _selectMonthYear: function(id, select, period) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ inst._selectingMonthYear = false;
+ inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
+ inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
+ parseInt(select.options[select.selectedIndex].value,10);
+ this._notifyChange(inst);
+ this._adjustDate(target);
+ },
+
+ /* Restore input focus after not changing month/year. */
+ _clickMonthYear: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ if (inst.input && inst._selectingMonthYear && !$.browser.msie)
+ inst.input.focus();
+ inst._selectingMonthYear = !inst._selectingMonthYear;
+ },
+
+ /* Action for selecting a day. */
+ _selectDay: function(id, month, year, td) {
+ var target = $(id);
+ if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
+ return;
+ }
+ var inst = this._getInst(target[0]);
+ inst.selectedDay = inst.currentDay = $('a', td).html();
+ inst.selectedMonth = inst.currentMonth = month;
+ inst.selectedYear = inst.currentYear = year;
+ this._selectDate(id, this._formatDate(inst,
+ inst.currentDay, inst.currentMonth, inst.currentYear));
+ },
+
+ /* Erase the input field and hide the date picker. */
+ _clearDate: function(id) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ this._selectDate(target, '');
+ },
+
+ /* Update the input field with the selected date. */
+ _selectDate: function(id, dateStr) {
+ var target = $(id);
+ var inst = this._getInst(target[0]);
+ dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+ if (inst.input)
+ inst.input.val(dateStr);
+ this._updateAlternate(inst);
+ var onSelect = this._get(inst, 'onSelect');
+ if (onSelect)
+ onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback
+ else if (inst.input)
+ inst.input.trigger('change'); // fire the change event
+ if (inst.inline)
+ this._updateDatepicker(inst);
+ else {
+ this._hideDatepicker();
+ this._lastInput = inst.input[0];
+ if (typeof(inst.input[0]) != 'object')
+ inst.input.focus(); // restore focus
+ this._lastInput = null;
+ }
+ },
+
+ /* Update any alternate field to synchronise with the main field. */
+ _updateAlternate: function(inst) {
+ var altField = this._get(inst, 'altField');
+ if (altField) { // update alternate field too
+ var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
+ var date = this._getDate(inst);
+ var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+ $(altField).each(function() { $(this).val(dateStr); });
+ }
+ },
+
+ /* Set as beforeShowDay function to prevent selection of weekends.
+ @param date Date - the date to customise
+ @return [boolean, string] - is this date selectable?, what is its CSS class? */
+ noWeekends: function(date) {
+ var day = date.getDay();
+ return [(day > 0 && day < 6), ''];
+ },
+
+ /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+ @param date Date - the date to get the week for
+ @return number - the number of the week within the year that contains this date */
+ iso8601Week: function(date) {
+ var checkDate = new Date(date.getTime());
+ // Find Thursday of this week starting on Monday
+ checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
+ var time = checkDate.getTime();
+ checkDate.setMonth(0); // Compare with Jan 1
+ checkDate.setDate(1);
+ return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
+ },
+
+ /* Parse a string value into a date object.
+ See formatDate below for the possible formats.
+
+ @param format string - the expected format of the date
+ @param value string - the date in the above format
+ @param settings Object - attributes include:
+ shortYearCutoff number - the cutoff year for determining the century (optional)
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return Date - the extracted date value or null if value is blank */
+ parseDate: function (format, value, settings) {
+ if (format == null || value == null)
+ throw 'Invalid arguments';
+ value = (typeof value == 'object' ? value.toString() : value + '');
+ if (value == '')
+ return null;
+ var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ var year = -1;
+ var month = -1;
+ var day = -1;
+ var doy = -1;
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Extract a number from the string value
+ var getNumber = function(match) {
+ lookAhead(match);
+ var size = (match == '@' ? 14 : (match == '!' ? 20 :
+ (match == 'y' ? 4 : (match == 'o' ? 3 : 2))));
+ var digits = new RegExp('^\\d{1,' + size + '}');
+ var num = value.substring(iValue).match(digits);
+ if (!num)
+ throw 'Missing number at position ' + iValue;
+ iValue += num[0].length;
+ return parseInt(num[0], 10);
+ };
+ // Extract a name from the string value and convert to an index
+ var getName = function(match, shortNames, longNames) {
+ var names = (lookAhead(match) ? longNames : shortNames);
+ for (var i = 0; i < names.length; i++) {
+ if (value.substr(iValue, names[i].length) == names[i]) {
+ iValue += names[i].length;
+ return i + 1;
+ }
+ }
+ throw 'Unknown name at position ' + iValue;
+ };
+ // Confirm that a literal character matches the string value
+ var checkLiteral = function() {
+ if (value.charAt(iValue) != format.charAt(iFormat))
+ throw 'Unexpected literal at position ' + iValue;
+ iValue++;
+ };
+ var iValue = 0;
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ checkLiteral();
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ day = getNumber('d');
+ break;
+ case 'D':
+ getName('D', dayNamesShort, dayNames);
+ break;
+ case 'o':
+ doy = getNumber('o');
+ break;
+ case 'm':
+ month = getNumber('m');
+ break;
+ case 'M':
+ month = getName('M', monthNamesShort, monthNames);
+ break;
+ case 'y':
+ year = getNumber('y');
+ break;
+ case '@':
+ var date = new Date(getNumber('@'));
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case '!':
+ var date = new Date((getNumber('!') - this._ticksTo1970) / 10000);
+ year = date.getFullYear();
+ month = date.getMonth() + 1;
+ day = date.getDate();
+ break;
+ case "'":
+ if (lookAhead("'"))
+ checkLiteral();
+ else
+ literal = true;
+ break;
+ default:
+ checkLiteral();
+ }
+ }
+ if (year == -1)
+ year = new Date().getFullYear();
+ else if (year < 100)
+ year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+ (year <= shortYearCutoff ? 0 : -100);
+ if (doy > -1) {
+ month = 1;
+ day = doy;
+ do {
+ var dim = this._getDaysInMonth(year, month - 1);
+ if (day <= dim)
+ break;
+ month++;
+ day -= dim;
+ } while (true);
+ }
+ var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+ if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
+ throw 'Invalid date'; // E.g. 31/02/*
+ return date;
+ },
+
+ /* Standard date formats. */
+ ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
+ COOKIE: 'D, dd M yy',
+ ISO_8601: 'yy-mm-dd',
+ RFC_822: 'D, d M y',
+ RFC_850: 'DD, dd-M-y',
+ RFC_1036: 'D, d M y',
+ RFC_1123: 'D, d M yy',
+ RFC_2822: 'D, d M yy',
+ RSS: 'D, d M y', // RFC 822
+ TICKS: '!',
+ TIMESTAMP: '@',
+ W3C: 'yy-mm-dd', // ISO 8601
+
+ _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
+ Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
+
+ /* Format a date object into a string value.
+ The format can be combinations of the following:
+ d - day of month (no leading zero)
+ dd - day of month (two digit)
+ o - day of year (no leading zeros)
+ oo - day of year (three digit)
+ D - day name short
+ DD - day name long
+ m - month of year (no leading zero)
+ mm - month of year (two digit)
+ M - month name short
+ MM - month name long
+ y - year (two digit)
+ yy - year (four digit)
+ @ - Unix timestamp (ms since 01/01/1970)
+ ! - Windows ticks (100ns since 01/01/0001)
+ '...' - literal text
+ '' - single quote
+
+ @param format string - the desired format of the date
+ @param date Date - the date value to format
+ @param settings Object - attributes include:
+ dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
+ dayNames string[7] - names of the days from Sunday (optional)
+ monthNamesShort string[12] - abbreviated names of the months (optional)
+ monthNames string[12] - names of the months (optional)
+ @return string - the date in the above format */
+ formatDate: function (format, date, settings) {
+ if (!date)
+ return '';
+ var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+ var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+ var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+ var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ // Format a number, with leading zero if necessary
+ var formatNumber = function(match, value, len) {
+ var num = '' + value;
+ if (lookAhead(match))
+ while (num.length < len)
+ num = '0' + num;
+ return num;
+ };
+ // Format a name, short or long as requested
+ var formatName = function(match, value, shortNames, longNames) {
+ return (lookAhead(match) ? longNames[value] : shortNames[value]);
+ };
+ var output = '';
+ var literal = false;
+ if (date)
+ for (var iFormat = 0; iFormat < format.length; iFormat++) {
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ output += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd':
+ output += formatNumber('d', date.getDate(), 2);
+ break;
+ case 'D':
+ output += formatName('D', date.getDay(), dayNamesShort, dayNames);
+ break;
+ case 'o':
+ output += formatNumber('o',
+ (date.getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000, 3);
+ break;
+ case 'm':
+ output += formatNumber('m', date.getMonth() + 1, 2);
+ break;
+ case 'M':
+ output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
+ break;
+ case 'y':
+ output += (lookAhead('y') ? date.getFullYear() :
+ (date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
+ break;
+ case '@':
+ output += date.getTime();
+ break;
+ case '!':
+ output += date.getTime() * 10000 + this._ticksTo1970;
+ break;
+ case "'":
+ if (lookAhead("'"))
+ output += "'";
+ else
+ literal = true;
+ break;
+ default:
+ output += format.charAt(iFormat);
+ }
+ }
+ return output;
+ },
+
+ /* Extract all possible characters from the date format. */
+ _possibleChars: function (format) {
+ var chars = '';
+ var literal = false;
+ // Check whether a format character is doubled
+ var lookAhead = function(match) {
+ var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+ if (matches)
+ iFormat++;
+ return matches;
+ };
+ for (var iFormat = 0; iFormat < format.length; iFormat++)
+ if (literal)
+ if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+ literal = false;
+ else
+ chars += format.charAt(iFormat);
+ else
+ switch (format.charAt(iFormat)) {
+ case 'd': case 'm': case 'y': case '@':
+ chars += '0123456789';
+ break;
+ case 'D': case 'M':
+ return null; // Accept anything
+ case "'":
+ if (lookAhead("'"))
+ chars += "'";
+ else
+ literal = true;
+ break;
+ default:
+ chars += format.charAt(iFormat);
+ }
+ return chars;
+ },
+
+ /* Get a setting value, defaulting if necessary. */
+ _get: function(inst, name) {
+ return inst.settings[name] !== undefined ?
+ inst.settings[name] : this._defaults[name];
+ },
+
+ /* Parse existing date and initialise date picker. */
+ _setDateFromField: function(inst, noDefault) {
+ if (inst.input.val() == inst.lastVal) {
+ return;
+ }
+ var dateFormat = this._get(inst, 'dateFormat');
+ var dates = inst.lastVal = inst.input ? inst.input.val() : null;
+ var date, defaultDate;
+ date = defaultDate = this._getDefaultDate(inst);
+ var settings = this._getFormatConfig(inst);
+ try {
+ date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+ } catch (event) {
+ this.log(event);
+ dates = (noDefault ? '' : dates);
+ }
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ inst.currentDay = (dates ? date.getDate() : 0);
+ inst.currentMonth = (dates ? date.getMonth() : 0);
+ inst.currentYear = (dates ? date.getFullYear() : 0);
+ this._adjustInstDate(inst);
+ },
+
+ /* Retrieve the default date shown on opening. */
+ _getDefaultDate: function(inst) {
+ return this._restrictMinMax(inst,
+ this._determineDate(inst, this._get(inst, 'defaultDate'), new Date()));
+ },
+
+ /* A date may be specified as an exact value or a relative one. */
+ _determineDate: function(inst, date, defaultDate) {
+ var offsetNumeric = function(offset) {
+ var date = new Date();
+ date.setDate(date.getDate() + offset);
+ return date;
+ };
+ var offsetString = function(offset) {
+ try {
+ return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+ offset, $.datepicker._getFormatConfig(inst));
+ }
+ catch (e) {
+ // Ignore
+ }
+ var date = (offset.toLowerCase().match(/^c/) ?
+ $.datepicker._getDate(inst) : null) || new Date();
+ var year = date.getFullYear();
+ var month = date.getMonth();
+ var day = date.getDate();
+ var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
+ var matches = pattern.exec(offset);
+ while (matches) {
+ switch (matches[2] || 'd') {
+ case 'd' : case 'D' :
+ day += parseInt(matches[1],10); break;
+ case 'w' : case 'W' :
+ day += parseInt(matches[1],10) * 7; break;
+ case 'm' : case 'M' :
+ month += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ case 'y': case 'Y' :
+ year += parseInt(matches[1],10);
+ day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+ break;
+ }
+ matches = pattern.exec(offset);
+ }
+ return new Date(year, month, day);
+ };
+ date = (date == null ? defaultDate : (typeof date == 'string' ? offsetString(date) :
+ (typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
+ date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
+ if (date) {
+ date.setHours(0);
+ date.setMinutes(0);
+ date.setSeconds(0);
+ date.setMilliseconds(0);
+ }
+ return this._daylightSavingAdjust(date);
+ },
+
+ /* Handle switch to/from daylight saving.
+ Hours may be non-zero on daylight saving cut-over:
+ > 12 when midnight changeover, but then cannot generate
+ midnight datetime, so jump to 1AM, otherwise reset.
+ @param date (Date) the date to check
+ @return (Date) the corrected date */
+ _daylightSavingAdjust: function(date) {
+ if (!date) return null;
+ date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+ return date;
+ },
+
+ /* Set the date(s) directly. */
+ _setDate: function(inst, date, noChange) {
+ var clear = !(date);
+ var origMonth = inst.selectedMonth;
+ var origYear = inst.selectedYear;
+ date = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));
+ inst.selectedDay = inst.currentDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
+ if ((origMonth != inst.selectedMonth || origYear != inst.selectedYear) && !noChange)
+ this._notifyChange(inst);
+ this._adjustInstDate(inst);
+ if (inst.input) {
+ inst.input.val(clear ? '' : this._formatDate(inst));
+ }
+ },
+
+ /* Retrieve the date(s) directly. */
+ _getDate: function(inst) {
+ var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
+ this._daylightSavingAdjust(new Date(
+ inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return startDate;
+ },
+
+ /* Generate the HTML for the current state of the date picker. */
+ _generateHTML: function(inst) {
+ var today = new Date();
+ today = this._daylightSavingAdjust(
+ new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
+ var isRTL = this._get(inst, 'isRTL');
+ var showButtonPanel = this._get(inst, 'showButtonPanel');
+ var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
+ var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
+ var numMonths = this._getNumberOfMonths(inst);
+ var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
+ var stepMonths = this._get(inst, 'stepMonths');
+ var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
+ var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+ new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ var drawMonth = inst.drawMonth - showCurrentAtPos;
+ var drawYear = inst.drawYear;
+ if (drawMonth < 0) {
+ drawMonth += 12;
+ drawYear--;
+ }
+ if (maxDate) {
+ var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+ maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
+ maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+ while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+ drawMonth--;
+ if (drawMonth < 0) {
+ drawMonth = 11;
+ drawYear--;
+ }
+ }
+ }
+ inst.drawMonth = drawMonth;
+ inst.drawYear = drawYear;
+ var prevText = this._get(inst, 'prevText');
+ prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
+ ' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
+ var nextText = this._get(inst, 'nextText');
+ nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+ this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+ this._getFormatConfig(inst)));
+ var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+ '<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
+ ' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
+ (hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
+ var currentText = this._get(inst, 'currentText');
+ var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
+ currentText = (!navigationAsDateFormat ? currentText :
+ this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+ var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
+ var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
+ (this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_' + dpuuid +
+ '.datepicker._gotoToday(\'#' + inst.id + '\');"' +
+ '>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
+ var firstDay = parseInt(this._get(inst, 'firstDay'),10);
+ firstDay = (isNaN(firstDay) ? 0 : firstDay);
+ var showWeek = this._get(inst, 'showWeek');
+ var dayNames = this._get(inst, 'dayNames');
+ var dayNamesShort = this._get(inst, 'dayNamesShort');
+ var dayNamesMin = this._get(inst, 'dayNamesMin');
+ var monthNames = this._get(inst, 'monthNames');
+ var monthNamesShort = this._get(inst, 'monthNamesShort');
+ var beforeShowDay = this._get(inst, 'beforeShowDay');
+ var showOtherMonths = this._get(inst, 'showOtherMonths');
+ var selectOtherMonths = this._get(inst, 'selectOtherMonths');
+ var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
+ var defaultDate = this._getDefaultDate(inst);
+ var html = '';
+ for (var row = 0; row < numMonths[0]; row++) {
+ var group = '';
+ for (var col = 0; col < numMonths[1]; col++) {
+ var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+ var cornerClass = ' ui-corner-all';
+ var calender = '';
+ if (isMultiMonth) {
+ calender += '<div class="ui-datepicker-group';
+ if (numMonths[1] > 1)
+ switch (col) {
+ case 0: calender += ' ui-datepicker-group-first';
+ cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
+ case numMonths[1]-1: calender += ' ui-datepicker-group-last';
+ cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
+ default: calender += ' ui-datepicker-group-middle'; cornerClass = ''; break;
+ }
+ calender += '">';
+ }
+ calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
+ (/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
+ (/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
+ this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+ row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+ '</div><table class="ui-datepicker-calendar"><thead>' +
+ '<tr>';
+ var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : '');
+ for (var dow = 0; dow < 7; dow++) { // days of the week
+ var day = (dow + firstDay) % 7;
+ thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
+ '<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
+ }
+ calender += thead + '</tr></thead><tbody>';
+ var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+ if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
+ inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+ var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+ var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
+ var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+ for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+ calender += '<tr>';
+ var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' +
+ this._get(inst, 'calculateWeek')(printDate) + '</td>');
+ for (var dow = 0; dow < 7; dow++) { // create date picker days
+ var daySettings = (beforeShowDay ?
+ beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
+ var otherMonth = (printDate.getMonth() != drawMonth);
+ var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
+ (minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+ tbody += '<td class="' +
+ ((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
+ (otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
+ ((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
+ (defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
+ // or defaultDate is current printedDate and defaultDate is selectedDate
+ ' ' + this._dayOverClass : '') + // highlight selected day
+ (unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') + // highlight unselectable days
+ (otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
+ (printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day
+ (printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
+ ((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
+ (unselectable ? '' : ' onclick="DP_jQuery_' + dpuuid + '.datepicker._selectDay(\'#' +
+ inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions
+ (otherMonth && !showOtherMonths ? ' ' : // display for other months
+ (unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
+ (printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
+ (printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day
+ (otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months
+ '" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date
+ printDate.setDate(printDate.getDate() + 1);
+ printDate = this._daylightSavingAdjust(printDate);
+ }
+ calender += tbody + '</tr>';
+ }
+ drawMonth++;
+ if (drawMonth > 11) {
+ drawMonth = 0;
+ drawYear++;
+ }
+ calender += '</tbody></table>' + (isMultiMonth ? '</div>' +
+ ((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
+ group += calender;
+ }
+ html += group;
+ }
+ html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+ '<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
+ inst._keyEvent = false;
+ return html;
+ },
+
+ /* Generate the month and year header. */
+ _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
+ secondary, monthNames, monthNamesShort) {
+ var changeMonth = this._get(inst, 'changeMonth');
+ var changeYear = this._get(inst, 'changeYear');
+ var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
+ var html = '<div class="ui-datepicker-title">';
+ var monthHtml = '';
+ // month selection
+ if (secondary || !changeMonth)
+ monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span>';
+ else {
+ var inMinYear = (minDate && minDate.getFullYear() == drawYear);
+ var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
+ monthHtml += '<select class="ui-datepicker-month" ' +
+ 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
+ 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (var month = 0; month < 12; month++) {
+ if ((!inMinYear || month >= minDate.getMonth()) &&
+ (!inMaxYear || month <= maxDate.getMonth()))
+ monthHtml += '<option value="' + month + '"' +
+ (month == drawMonth ? ' selected="selected"' : '') +
+ '>' + monthNamesShort[month] + '</option>';
+ }
+ monthHtml += '</select>';
+ }
+ if (!showMonthAfterYear)
+ html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : '');
+ // year selection
+ if (secondary || !changeYear)
+ html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
+ else {
+ // determine range of years to display
+ var years = this._get(inst, 'yearRange').split(':');
+ var thisYear = new Date().getFullYear();
+ var determineYear = function(value) {
+ var year = (value.match(/c[+-].*/) ? drawYear + parseInt(value.substring(1), 10) :
+ (value.match(/[+-].*/) ? thisYear + parseInt(value, 10) :
+ parseInt(value, 10)));
+ return (isNaN(year) ? thisYear : year);
+ };
+ var year = determineYear(years[0]);
+ var endYear = Math.max(year, determineYear(years[1] || ''));
+ year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+ endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+ html += '<select class="ui-datepicker-year" ' +
+ 'onchange="DP_jQuery_' + dpuuid + '.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
+ 'onclick="DP_jQuery_' + dpuuid + '.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+ '>';
+ for (; year <= endYear; year++) {
+ html += '<option value="' + year + '"' +
+ (year == drawYear ? ' selected="selected"' : '') +
+ '>' + year + '</option>';
+ }
+ html += '</select>';
+ }
+ html += this._get(inst, 'yearSuffix');
+ if (showMonthAfterYear)
+ html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml;
+ html += '</div>'; // Close datepicker_header
+ return html;
+ },
+
+ /* Adjust one of the date sub-fields. */
+ _adjustInstDate: function(inst, offset, period) {
+ var year = inst.drawYear + (period == 'Y' ? offset : 0);
+ var month = inst.drawMonth + (period == 'M' ? offset : 0);
+ var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
+ (period == 'D' ? offset : 0);
+ var date = this._restrictMinMax(inst,
+ this._daylightSavingAdjust(new Date(year, month, day)));
+ inst.selectedDay = date.getDate();
+ inst.drawMonth = inst.selectedMonth = date.getMonth();
+ inst.drawYear = inst.selectedYear = date.getFullYear();
+ if (period == 'M' || period == 'Y')
+ this._notifyChange(inst);
+ },
+
+ /* Ensure a date is within any min/max bounds. */
+ _restrictMinMax: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ date = (minDate && date < minDate ? minDate : date);
+ date = (maxDate && date > maxDate ? maxDate : date);
+ return date;
+ },
+
+ /* Notify change of month/year. */
+ _notifyChange: function(inst) {
+ var onChange = this._get(inst, 'onChangeMonthYear');
+ if (onChange)
+ onChange.apply((inst.input ? inst.input[0] : null),
+ [inst.selectedYear, inst.selectedMonth + 1, inst]);
+ },
+
+ /* Determine the number of months to show. */
+ _getNumberOfMonths: function(inst) {
+ var numMonths = this._get(inst, 'numberOfMonths');
+ return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+ },
+
+ /* Determine the current maximum date - ensure no time components are set. */
+ _getMinMaxDate: function(inst, minMax) {
+ return this._determineDate(inst, this._get(inst, minMax + 'Date'), null);
+ },
+
+ /* Find the number of days in a given month. */
+ _getDaysInMonth: function(year, month) {
+ return 32 - new Date(year, month, 32).getDate();
+ },
+
+ /* Find the day of the week of the first of a month. */
+ _getFirstDayOfMonth: function(year, month) {
+ return new Date(year, month, 1).getDay();
+ },
+
+ /* Determines if we should allow a "next/prev" month display change. */
+ _canAdjustMonth: function(inst, offset, curYear, curMonth) {
+ var numMonths = this._getNumberOfMonths(inst);
+ var date = this._daylightSavingAdjust(new Date(curYear,
+ curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
+ if (offset < 0)
+ date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+ return this._isInRange(inst, date);
+ },
+
+ /* Is the given date in the accepted range? */
+ _isInRange: function(inst, date) {
+ var minDate = this._getMinMaxDate(inst, 'min');
+ var maxDate = this._getMinMaxDate(inst, 'max');
+ return ((!minDate || date.getTime() >= minDate.getTime()) &&
+ (!maxDate || date.getTime() <= maxDate.getTime()));
+ },
+
+ /* Provide the configuration settings for formatting/parsing. */
+ _getFormatConfig: function(inst) {
+ var shortYearCutoff = this._get(inst, 'shortYearCutoff');
+ shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+ new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+ return {shortYearCutoff: shortYearCutoff,
+ dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
+ monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+ },
+
+ /* Format the given date for display. */
+ _formatDate: function(inst, day, month, year) {
+ if (!day) {
+ inst.currentDay = inst.selectedDay;
+ inst.currentMonth = inst.selectedMonth;
+ inst.currentYear = inst.selectedYear;
+ }
+ var date = (day ? (typeof day == 'object' ? day :
+ this._daylightSavingAdjust(new Date(year, month, day))) :
+ this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+ return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
+ }
+});
+
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+ $.extend(target, props);
+ for (var name in props)
+ if (props[name] == null || props[name] == undefined)
+ target[name] = props[name];
+ return target;
+};
+
+/* Determine whether an object is an array. */
+function isArray(a) {
+ return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
+ (a.constructor && a.constructor.toString().match(/\Array\(\)/))));
+};
+
+/* Invoke the datepicker functionality.
+ @param options string - a command, optionally followed by additional parameters or
+ Object - settings for attaching new datepicker functionality
+ @return jQuery object */
+$.fn.datepicker = function(options){
+
+ /* Initialise the date picker. */
+ if (!$.datepicker.initialized) {
+ $(document).mousedown($.datepicker._checkExternalClick).
+ find('body').append($.datepicker.dpDiv);
+ $.datepicker.initialized = true;
+ }
+
+ var otherArgs = Array.prototype.slice.call(arguments, 1);
+ if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate' || options == 'widget'))
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
+ return $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this[0]].concat(otherArgs));
+ return this.each(function() {
+ typeof options == 'string' ?
+ $.datepicker['_' + options + 'Datepicker'].
+ apply($.datepicker, [this].concat(otherArgs)) :
+ $.datepicker._attachDatepicker(this, options);
+ });
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.8.1";
+
+// Workaround for #4055
+// Add another global to avoid noConflict issues with inline event handlers
+window['DP_jQuery_' + dpuuid] = $;
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.dialog.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,823 @@
+/*
+ * jQuery UI Dialog 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.button.js
+ * jquery.ui.draggable.js
+ * jquery.ui.mouse.js
+ * jquery.ui.position.js
+ * jquery.ui.resizable.js
+ */
+(function($) {
+
+var uiDialogClasses =
+ 'ui-dialog ' +
+ 'ui-widget ' +
+ 'ui-widget-content ' +
+ 'ui-corner-all ';
+
+$.widget("ui.dialog", {
+ options: {
+ autoOpen: true,
+ buttons: {},
+ closeOnEscape: true,
+ closeText: 'close',
+ dialogClass: '',
+ draggable: true,
+ hide: null,
+ height: 'auto',
+ maxHeight: false,
+ maxWidth: false,
+ minHeight: 150,
+ minWidth: 150,
+ modal: false,
+ position: 'center',
+ resizable: true,
+ show: null,
+ stack: true,
+ title: '',
+ width: 300,
+ zIndex: 1000
+ },
+ _create: function() {
+ this.originalTitle = this.element.attr('title');
+
+ var self = this,
+ options = self.options,
+
+ title = options.title || self.originalTitle || ' ',
+ titleId = $.ui.dialog.getTitleId(self.element),
+
+ uiDialog = (self.uiDialog = $('<div></div>'))
+ .appendTo(document.body)
+ .hide()
+ .addClass(uiDialogClasses + options.dialogClass)
+ .css({
+ zIndex: options.zIndex
+ })
+ // setting tabIndex makes the div focusable
+ // setting outline to 0 prevents a border on focus in Mozilla
+ .attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+ if (options.closeOnEscape && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+
+ self.close(event);
+ event.preventDefault();
+ }
+ })
+ .attr({
+ role: 'dialog',
+ 'aria-labelledby': titleId
+ })
+ .mousedown(function(event) {
+ self.moveToTop(false, event);
+ }),
+
+ uiDialogContent = self.element
+ .show()
+ .removeAttr('title')
+ .addClass(
+ 'ui-dialog-content ' +
+ 'ui-widget-content')
+ .appendTo(uiDialog),
+
+ uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
+ .addClass(
+ 'ui-dialog-titlebar ' +
+ 'ui-widget-header ' +
+ 'ui-corner-all ' +
+ 'ui-helper-clearfix'
+ )
+ .prependTo(uiDialog),
+
+ uiDialogTitlebarClose = $('<a href="#"></a>')
+ .addClass(
+ 'ui-dialog-titlebar-close ' +
+ 'ui-corner-all'
+ )
+ .attr('role', 'button')
+ .hover(
+ function() {
+ uiDialogTitlebarClose.addClass('ui-state-hover');
+ },
+ function() {
+ uiDialogTitlebarClose.removeClass('ui-state-hover');
+ }
+ )
+ .focus(function() {
+ uiDialogTitlebarClose.addClass('ui-state-focus');
+ })
+ .blur(function() {
+ uiDialogTitlebarClose.removeClass('ui-state-focus');
+ })
+ .click(function(event) {
+ self.close(event);
+ return false;
+ })
+ .appendTo(uiDialogTitlebar),
+
+ uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
+ .addClass(
+ 'ui-icon ' +
+ 'ui-icon-closethick'
+ )
+ .text(options.closeText)
+ .appendTo(uiDialogTitlebarClose),
+
+ uiDialogTitle = $('<span></span>')
+ .addClass('ui-dialog-title')
+ .attr('id', titleId)
+ .html(title)
+ .prependTo(uiDialogTitlebar);
+
+ //handling of deprecated beforeclose (vs beforeClose) option
+ //Ticket #4669 http://dev.jqueryui.com/ticket/4669
+ //TODO: remove in 1.9pre
+ if ($.isFunction(options.beforeclose) && !$.isFunction(options.beforeClose)) {
+ options.beforeClose = options.beforeclose;
+ }
+
+ uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+ if (options.draggable && $.fn.draggable) {
+ self._makeDraggable();
+ }
+ if (options.resizable && $.fn.resizable) {
+ self._makeResizable();
+ }
+
+ self._createButtons(options.buttons);
+ self._isOpen = false;
+
+ if ($.fn.bgiframe) {
+ uiDialog.bgiframe();
+ }
+ },
+ _init: function() {
+ if ( this.options.autoOpen ) {
+ this.open();
+ }
+ },
+
+ destroy: function() {
+ var self = this;
+
+ if (self.overlay) {
+ self.overlay.destroy();
+ }
+ self.uiDialog.hide();
+ self.element
+ .unbind('.dialog')
+ .removeData('dialog')
+ .removeClass('ui-dialog-content ui-widget-content')
+ .hide().appendTo('body');
+ self.uiDialog.remove();
+
+ if (self.originalTitle) {
+ self.element.attr('title', self.originalTitle);
+ }
+
+ return self;
+ },
+
+ widget: function() {
+ return this.uiDialog;
+ },
+
+ close: function(event) {
+ var self = this,
+ maxZ;
+
+ if (false === self._trigger('beforeClose', event)) {
+ return;
+ }
+
+ if (self.overlay) {
+ self.overlay.destroy();
+ }
+ self.uiDialog.unbind('keypress.ui-dialog');
+
+ self._isOpen = false;
+
+ if (self.options.hide) {
+ self.uiDialog.hide(self.options.hide, function() {
+ self._trigger('close', event);
+ });
+ } else {
+ self.uiDialog.hide();
+ self._trigger('close', event);
+ }
+
+ $.ui.dialog.overlay.resize();
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ if (self.options.modal) {
+ maxZ = 0;
+ $('.ui-dialog').each(function() {
+ if (this !== self.uiDialog[0]) {
+ maxZ = Math.max(maxZ, $(this).css('z-index'));
+ }
+ });
+ $.ui.dialog.maxZ = maxZ;
+ }
+
+ return self;
+ },
+
+ isOpen: function() {
+ return this._isOpen;
+ },
+
+ // the force parameter allows us to move modal dialogs to their correct
+ // position on open
+ moveToTop: function(force, event) {
+ var self = this,
+ options = self.options,
+ saveScroll;
+
+ if ((options.modal && !force) ||
+ (!options.stack && !options.modal)) {
+ return self._trigger('focus', event);
+ }
+
+ if (options.zIndex > $.ui.dialog.maxZ) {
+ $.ui.dialog.maxZ = options.zIndex;
+ }
+ if (self.overlay) {
+ $.ui.dialog.maxZ += 1;
+ self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = $.ui.dialog.maxZ);
+ }
+
+ //Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+ // http://ui.jquery.com/bugs/ticket/3193
+ saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') };
+ $.ui.dialog.maxZ += 1;
+ self.uiDialog.css('z-index', $.ui.dialog.maxZ);
+ self.element.attr(saveScroll);
+ self._trigger('focus', event);
+
+ return self;
+ },
+
+ open: function() {
+ if (this._isOpen) { return; }
+
+ var self = this,
+ options = self.options,
+ uiDialog = self.uiDialog;
+
+ self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
+ if (uiDialog.next().length) {
+ uiDialog.appendTo('body');
+ }
+ self._size();
+ self._position(options.position);
+ uiDialog.show(options.show);
+ self.moveToTop(true);
+
+ // prevent tabbing out of modal dialogs
+ if (options.modal) {
+ uiDialog.bind('keypress.ui-dialog', function(event) {
+ if (event.keyCode !== $.ui.keyCode.TAB) {
+ return;
+ }
+
+ var tabbables = $(':tabbable', this),
+ first = tabbables.filter(':first'),
+ last = tabbables.filter(':last');
+
+ if (event.target === last[0] && !event.shiftKey) {
+ first.focus(1);
+ return false;
+ } else if (event.target === first[0] && event.shiftKey) {
+ last.focus(1);
+ return false;
+ }
+ });
+ }
+
+ // set focus to the first tabbable element in the content area or the first button
+ // if there are no tabbable elements, set focus on the dialog itself
+ $([])
+ .add(uiDialog.find('.ui-dialog-content :tabbable:first'))
+ .add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
+ .add(uiDialog)
+ .filter(':first')
+ .focus();
+
+ self._trigger('open');
+ self._isOpen = true;
+
+ return self;
+ },
+
+ _createButtons: function(buttons) {
+ var self = this,
+ hasButtons = false,
+ uiDialogButtonPane = $('<div></div>')
+ .addClass(
+ 'ui-dialog-buttonpane ' +
+ 'ui-widget-content ' +
+ 'ui-helper-clearfix'
+ );
+
+ // if we already have a button pane, remove it
+ self.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+ if (typeof buttons === 'object' && buttons !== null) {
+ $.each(buttons, function() {
+ return !(hasButtons = true);
+ });
+ }
+ if (hasButtons) {
+ $.each(buttons, function(name, fn) {
+ var button = $('<button type="button"></button>')
+ .text(name)
+ .click(function() { fn.apply(self.element[0], arguments); })
+ .appendTo(uiDialogButtonPane);
+ if ($.fn.button) {
+ button.button();
+ }
+ });
+ uiDialogButtonPane.appendTo(self.uiDialog);
+ }
+ },
+
+ _makeDraggable: function() {
+ var self = this,
+ options = self.options,
+ doc = $(document),
+ heightBeforeDrag;
+
+ function filteredUi(ui) {
+ return {
+ position: ui.position,
+ offset: ui.offset
+ };
+ }
+
+ self.uiDialog.draggable({
+ cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
+ handle: '.ui-dialog-titlebar',
+ containment: 'document',
+ start: function(event, ui) {
+ heightBeforeDrag = options.height === "auto" ? "auto" : $(this).height();
+ $(this).height($(this).height()).addClass("ui-dialog-dragging");
+ self._trigger('dragStart', event, filteredUi(ui));
+ },
+ drag: function(event, ui) {
+ self._trigger('drag', event, filteredUi(ui));
+ },
+ stop: function(event, ui) {
+ options.position = [ui.position.left - doc.scrollLeft(),
+ ui.position.top - doc.scrollTop()];
+ $(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
+ self._trigger('dragStop', event, filteredUi(ui));
+ $.ui.dialog.overlay.resize();
+ }
+ });
+ },
+
+ _makeResizable: function(handles) {
+ handles = (handles === undefined ? this.options.resizable : handles);
+ var self = this,
+ options = self.options,
+ // .ui-resizable has position: relative defined in the stylesheet
+ // but dialogs have to use absolute or fixed positioning
+ position = self.uiDialog.css('position'),
+ resizeHandles = (typeof handles === 'string' ?
+ handles :
+ 'n,e,s,w,se,sw,ne,nw'
+ );
+
+ function filteredUi(ui) {
+ return {
+ originalPosition: ui.originalPosition,
+ originalSize: ui.originalSize,
+ position: ui.position,
+ size: ui.size
+ };
+ }
+
+ self.uiDialog.resizable({
+ cancel: '.ui-dialog-content',
+ containment: 'document',
+ alsoResize: self.element,
+ maxWidth: options.maxWidth,
+ maxHeight: options.maxHeight,
+ minWidth: options.minWidth,
+ minHeight: self._minHeight(),
+ handles: resizeHandles,
+ start: function(event, ui) {
+ $(this).addClass("ui-dialog-resizing");
+ self._trigger('resizeStart', event, filteredUi(ui));
+ },
+ resize: function(event, ui) {
+ self._trigger('resize', event, filteredUi(ui));
+ },
+ stop: function(event, ui) {
+ $(this).removeClass("ui-dialog-resizing");
+ options.height = $(this).height();
+ options.width = $(this).width();
+ self._trigger('resizeStop', event, filteredUi(ui));
+ $.ui.dialog.overlay.resize();
+ }
+ })
+ .css('position', position)
+ .find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+ },
+
+ _minHeight: function() {
+ var options = this.options;
+
+ if (options.height === 'auto') {
+ return options.minHeight;
+ } else {
+ return Math.min(options.minHeight, options.height);
+ }
+ },
+
+ _position: function(position) {
+ var myAt = [],
+ offset = [0, 0],
+ isVisible;
+
+ position = position || $.ui.dialog.prototype.options.position;
+
+ // deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
+// if (typeof position == 'string' || $.isArray(position)) {
+// myAt = $.isArray(position) ? position : position.split(' ');
+
+ if (typeof position === 'string' || (typeof position === 'object' && '0' in position)) {
+ myAt = position.split ? position.split(' ') : [position[0], position[1]];
+ if (myAt.length === 1) {
+ myAt[1] = myAt[0];
+ }
+
+ $.each(['left', 'top'], function(i, offsetPosition) {
+ if (+myAt[i] === myAt[i]) {
+ offset[i] = myAt[i];
+ myAt[i] = offsetPosition;
+ }
+ });
+ } else if (typeof position === 'object') {
+ if ('left' in position) {
+ myAt[0] = 'left';
+ offset[0] = position.left;
+ } else if ('right' in position) {
+ myAt[0] = 'right';
+ offset[0] = -position.right;
+ }
+
+ if ('top' in position) {
+ myAt[1] = 'top';
+ offset[1] = position.top;
+ } else if ('bottom' in position) {
+ myAt[1] = 'bottom';
+ offset[1] = -position.bottom;
+ }
+ }
+
+ // need to show the dialog to get the actual offset in the position plugin
+ isVisible = this.uiDialog.is(':visible');
+ if (!isVisible) {
+ this.uiDialog.show();
+ }
+ this.uiDialog
+ // workaround for jQuery bug #5781 http://dev.jquery.com/ticket/5781
+ .css({ top: 0, left: 0 })
+ .position({
+ my: myAt.join(' '),
+ at: myAt.join(' '),
+ offset: offset.join(' '),
+ of: window,
+ collision: 'fit',
+ // ensure that the titlebar is never outside the document
+ using: function(pos) {
+ var topOffset = $(this).css(pos).offset().top;
+ if (topOffset < 0) {
+ $(this).css('top', pos.top - topOffset);
+ }
+ }
+ });
+ if (!isVisible) {
+ this.uiDialog.hide();
+ }
+ },
+
+ _setOption: function(key, value){
+ var self = this,
+ uiDialog = self.uiDialog,
+ isResizable = uiDialog.is(':data(resizable)'),
+ resize = false;
+
+ switch (key) {
+ //handling of deprecated beforeclose (vs beforeClose) option
+ //Ticket #4669 http://dev.jqueryui.com/ticket/4669
+ //TODO: remove in 1.9pre
+ case "beforeclose":
+ key = "beforeClose";
+ break;
+ case "buttons":
+ self._createButtons(value);
+ break;
+ case "closeText":
+ // convert whatever was passed in to a string, for text() to not throw up
+ self.uiDialogTitlebarCloseText.text("" + value);
+ break;
+ case "dialogClass":
+ uiDialog
+ .removeClass(self.options.dialogClass)
+ .addClass(uiDialogClasses + value);
+ break;
+ case "disabled":
+ if (value) {
+ uiDialog.addClass('ui-dialog-disabled');
+ } else {
+ uiDialog.removeClass('ui-dialog-disabled');
+ }
+ break;
+ case "draggable":
+ if (value) {
+ self._makeDraggable();
+ } else {
+ uiDialog.draggable('destroy');
+ }
+ break;
+ case "height":
+ resize = true;
+ break;
+ case "maxHeight":
+ if (isResizable) {
+ uiDialog.resizable('option', 'maxHeight', value);
+ }
+ resize = true;
+ break;
+ case "maxWidth":
+ if (isResizable) {
+ uiDialog.resizable('option', 'maxWidth', value);
+ }
+ resize = true;
+ break;
+ case "minHeight":
+ if (isResizable) {
+ uiDialog.resizable('option', 'minHeight', value);
+ }
+ resize = true;
+ break;
+ case "minWidth":
+ if (isResizable) {
+ uiDialog.resizable('option', 'minWidth', value);
+ }
+ resize = true;
+ break;
+ case "position":
+ self._position(value);
+ break;
+ case "resizable":
+ // currently resizable, becoming non-resizable
+ if (isResizable && !value) {
+ uiDialog.resizable('destroy');
+ }
+
+ // currently resizable, changing handles
+ if (isResizable && typeof value === 'string') {
+ uiDialog.resizable('option', 'handles', value);
+ }
+
+ // currently non-resizable, becoming resizable
+ if (!isResizable && value !== false) {
+ self._makeResizable(value);
+ }
+ break;
+ case "title":
+ // convert whatever was passed in o a string, for html() to not throw up
+ $(".ui-dialog-title", self.uiDialogTitlebar).html("" + (value || ' '));
+ break;
+ case "width":
+ resize = true;
+ break;
+ }
+
+ $.Widget.prototype._setOption.apply(self, arguments);
+ if (resize) {
+ self._size();
+ }
+ },
+
+ _size: function() {
+ /* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+ * divs will both have width and height set, so we need to reset them
+ */
+ var options = this.options,
+ nonContentHeight;
+
+ // reset content sizing
+ // hide for non content measurement because height: 0 doesn't work in IE quirks mode (see #4350)
+ this.element.css({
+ width: 'auto',
+ minHeight: 0,
+ height: 0
+ });
+
+ // reset wrapper sizing
+ // determine the height of all the non-content elements
+ nonContentHeight = this.uiDialog.css({
+ height: 'auto',
+ width: options.width
+ })
+ .height();
+
+ this.element
+ .css(options.height === 'auto' ? {
+ minHeight: Math.max(options.minHeight - nonContentHeight, 0),
+ height: 'auto'
+ } : {
+ minHeight: 0,
+ height: Math.max(options.height - nonContentHeight, 0)
+ })
+ .show();
+
+ if (this.uiDialog.is(':data(resizable)')) {
+ this.uiDialog.resizable('option', 'minHeight', this._minHeight());
+ }
+ }
+});
+
+$.extend($.ui.dialog, {
+ version: "1.8.1",
+
+ uuid: 0,
+ maxZ: 0,
+
+ getTitleId: function($el) {
+ var id = $el.attr('id');
+ if (!id) {
+ this.uuid += 1;
+ id = this.uuid;
+ }
+ return 'ui-dialog-title-' + id;
+ },
+
+ overlay: function(dialog) {
+ this.$el = $.ui.dialog.overlay.create(dialog);
+ }
+});
+
+$.extend($.ui.dialog.overlay, {
+ instances: [],
+ // reuse old instances due to IE memory leak with alpha transparency (see #5185)
+ oldInstances: [],
+ maxZ: 0,
+ events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+ function(event) { return event + '.dialog-overlay'; }).join(' '),
+ create: function(dialog) {
+ if (this.instances.length === 0) {
+ // prevent use of anchors and inputs
+ // we use a setTimeout in case the overlay is created from an
+ // event that we're going to be cancelling (see #2804)
+ setTimeout(function() {
+ // handle $(el).dialog().dialog('close') (see #4065)
+ if ($.ui.dialog.overlay.instances.length) {
+ $(document).bind($.ui.dialog.overlay.events, function(event) {
+ // stop events if the z-index of the target is < the z-index of the overlay
+ return ($(event.target).zIndex() >= $.ui.dialog.overlay.maxZ);
+ });
+ }
+ }, 1);
+
+ // allow closing by pressing the escape key
+ $(document).bind('keydown.dialog-overlay', function(event) {
+ if (dialog.options.closeOnEscape && event.keyCode &&
+ event.keyCode === $.ui.keyCode.ESCAPE) {
+
+ dialog.close(event);
+ event.preventDefault();
+ }
+ });
+
+ // handle window resize
+ $(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+ }
+
+ var $el = (this.oldInstances.pop() || $('<div></div>').addClass('ui-widget-overlay'))
+ .appendTo(document.body)
+ .css({
+ width: this.width(),
+ height: this.height()
+ });
+
+ if ($.fn.bgiframe) {
+ $el.bgiframe();
+ }
+
+ this.instances.push($el);
+ return $el;
+ },
+
+ destroy: function($el) {
+ this.oldInstances.push(this.instances.splice($.inArray($el, this.instances), 1)[0]);
+
+ if (this.instances.length === 0) {
+ $([document, window]).unbind('.dialog-overlay');
+ }
+
+ $el.remove();
+
+ // adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+ var maxZ = 0;
+ $.each(this.instances, function() {
+ maxZ = Math.max(maxZ, this.css('z-index'));
+ });
+ this.maxZ = maxZ;
+ },
+
+ height: function() {
+ var scrollHeight,
+ offsetHeight;
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ scrollHeight = Math.max(
+ document.documentElement.scrollHeight,
+ document.body.scrollHeight
+ );
+ offsetHeight = Math.max(
+ document.documentElement.offsetHeight,
+ document.body.offsetHeight
+ );
+
+ if (scrollHeight < offsetHeight) {
+ return $(window).height() + 'px';
+ } else {
+ return scrollHeight + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).height() + 'px';
+ }
+ },
+
+ width: function() {
+ var scrollWidth,
+ offsetWidth;
+ // handle IE 6
+ if ($.browser.msie && $.browser.version < 7) {
+ scrollWidth = Math.max(
+ document.documentElement.scrollWidth,
+ document.body.scrollWidth
+ );
+ offsetWidth = Math.max(
+ document.documentElement.offsetWidth,
+ document.body.offsetWidth
+ );
+
+ if (scrollWidth < offsetWidth) {
+ return $(window).width() + 'px';
+ } else {
+ return scrollWidth + 'px';
+ }
+ // handle "good" browsers
+ } else {
+ return $(document).width() + 'px';
+ }
+ },
+
+ resize: function() {
+ /* If the dialog is draggable and the user drags it past the
+ * right edge of the window, the document becomes wider so we
+ * need to stretch the overlay. If the user then drags the
+ * dialog back to the left, the document will become narrower,
+ * so we need to shrink the overlay to the appropriate size.
+ * This is handled by shrinking the overlay before setting it
+ * to the full document size.
+ */
+ var $overlays = $([]);
+ $.each($.ui.dialog.overlay.instances, function() {
+ $overlays = $overlays.add(this);
+ });
+
+ $overlays.css({
+ width: 0,
+ height: 0
+ }).css({
+ width: $.ui.dialog.overlay.width(),
+ height: $.ui.dialog.overlay.height()
+ });
+ }
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+ destroy: function() {
+ $.ui.dialog.overlay.destroy(this.$el);
+ }
+});
+
+}(jQuery));
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.draggable.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,797 @@
+/*
+ * jQuery UI Draggable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.draggable", $.ui.mouse, {
+ widgetEventPrefix: "drag",
+ options: {
+ addClasses: true,
+ appendTo: "parent",
+ axis: false,
+ connectToSortable: false,
+ containment: false,
+ cursor: "auto",
+ cursorAt: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ iframeFix: false,
+ opacity: false,
+ refreshPositions: false,
+ revert: false,
+ revertDuration: 500,
+ scope: "default",
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ snap: false,
+ snapMode: "both",
+ snapTolerance: 20,
+ stack: false,
+ zIndex: false
+ },
+ _create: function() {
+
+ if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+ this.element[0].style.position = 'relative';
+
+ (this.options.addClasses && this.element.addClass("ui-draggable"));
+ (this.options.disabled && this.element.addClass("ui-draggable-disabled"));
+
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ if(!this.element.data('draggable')) return;
+ this.element
+ .removeData("draggable")
+ .unbind(".draggable")
+ .removeClass("ui-draggable"
+ + " ui-draggable-dragging"
+ + " ui-draggable-disabled");
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseCapture: function(event) {
+
+ var o = this.options;
+
+ // among others, prevent a drag on a resizable-handle
+ if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
+ return false;
+
+ //Quit if we're not on a valid handle
+ this.handle = this._getHandle(event);
+ if (!this.handle)
+ return false;
+
+ return true;
+
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options;
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ //If ddmanager is used for droppables, set the global draggable
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Store the helper's css position
+ this.cssPosition = this.helper.css("position");
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.positionAbs = this.element.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this.position = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ //Trigger event + callbacks
+ if(this._trigger("start", event) === false) {
+ this._clear();
+ return false;
+ }
+
+ //Recache the helper size
+ this._cacheHelperProportions();
+
+ //Prepare the droppable offsets
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.helper.addClass("ui-draggable-dragging");
+ this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+ },
+
+ _mouseDrag: function(event, noPropagation) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Call plugins and callbacks and use the resulting position if something is returned
+ if (!noPropagation) {
+ var ui = this._uiHash();
+ if(this._trigger('drag', event, ui) === false) {
+ this._mouseUp({});
+ return false;
+ }
+ this.position = ui.position;
+ }
+
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ //If we are using droppables, inform the manager about the drop
+ var dropped = false;
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ dropped = $.ui.ddmanager.drop(this, event);
+
+ //if a drop comes from outside (a sortable)
+ if(this.dropped) {
+ dropped = this.dropped;
+ this.dropped = false;
+ }
+
+ //if the original element is removed, don't bother to continue
+ if(!this.element[0] || !this.element[0].parentNode)
+ return false;
+
+ if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+ var self = this;
+ $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+ if(self._trigger("stop", event) !== false) {
+ self._clear();
+ }
+ });
+ } else {
+ if(this._trigger("stop", event) !== false) {
+ this._clear();
+ }
+ }
+
+ return false;
+ },
+
+ cancel: function() {
+
+ if(this.helper.is(".ui-draggable-dragging")) {
+ this._mouseUp({});
+ } else {
+ this._clear();
+ }
+
+ return this;
+
+ },
+
+ _getHandle: function(event) {
+
+ var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+ $(this.options.handle, this.element)
+ .find("*")
+ .andSelf()
+ .each(function() {
+ if(this == event.target) handle = true;
+ });
+
+ return handle;
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
+
+ if(!helper.parents('body').length)
+ helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+ if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+ helper.css("position", "absolute");
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if (typeof obj == 'string') {
+ obj = obj.split(' ');
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ('left' in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ('right' in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ('top' in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ('bottom' in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function() {
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.element.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.element.css("marginLeft"),10) || 0),
+ top: (parseInt(this.element.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+ var ce = $(o.containment)[0]; if(!ce) return;
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ } else if(o.containment.constructor == Array) {
+ this.containment = o.containment;
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && $.browser.version < 526 && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _clear: function() {
+ this.helper.removeClass("ui-draggable-dragging");
+ if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+ //if($.ui.ddmanager) $.ui.ddmanager.current = null;
+ this.helper = null;
+ this.cancelHelperRemoval = false;
+ },
+
+ // From now on bulk stuff - mainly helpers
+
+ _trigger: function(type, event, ui) {
+ ui = ui || this._uiHash();
+ $.ui.plugin.call(this, type, [event, ui]);
+ if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+ return $.Widget.prototype._trigger.call(this, type, event, ui);
+ },
+
+ plugins: {},
+
+ _uiHash: function(event) {
+ return {
+ helper: this.helper,
+ position: this.position,
+ originalPosition: this.originalPosition,
+ offset: this.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.draggable, {
+ version: "1.8.1"
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+ start: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options,
+ uiSortable = $.extend({}, ui, { item: inst.element });
+ inst.sortables = [];
+ $(o.connectToSortable).each(function() {
+ var sortable = $.data(this, 'sortable');
+ if (sortable && !sortable.options.disabled) {
+ inst.sortables.push({
+ instance: sortable,
+ shouldRevert: sortable.options.revert
+ });
+ sortable._refreshItems(); //Do a one-time refresh at start to refresh the containerCache
+ sortable._trigger("activate", event, uiSortable);
+ }
+ });
+
+ },
+ stop: function(event, ui) {
+
+ //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+ var inst = $(this).data("draggable"),
+ uiSortable = $.extend({}, ui, { item: inst.element });
+
+ $.each(inst.sortables, function() {
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+
+ inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+ this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+ //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+ if(this.shouldRevert) this.instance.options.revert = true;
+
+ //Trigger the stop of the sortable
+ this.instance._mouseStop(event);
+
+ this.instance.options.helper = this.instance.options._helper;
+
+ //If the helper has been the original item, restore properties in the sortable
+ if(inst.options.helper == 'original')
+ this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+ } else {
+ this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+ this.instance._trigger("deactivate", event, uiSortable);
+ }
+
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), self = this;
+
+ var checkPos = function(o) {
+ var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+ var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+ var itemHeight = o.height, itemWidth = o.width;
+ var itemTop = o.top, itemLeft = o.left;
+
+ return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+ };
+
+ $.each(inst.sortables, function(i) {
+
+ //Copy over some variables to allow calling the sortable's native _intersectsWith
+ this.instance.positionAbs = inst.positionAbs;
+ this.instance.helperProportions = inst.helperProportions;
+ this.instance.offset.click = inst.offset.click;
+
+ if(this.instance._intersectsWith(this.instance.containerCache)) {
+
+ //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+ if(!this.instance.isOver) {
+
+ this.instance.isOver = 1;
+ //Now we fake the start of dragging for the sortable instance,
+ //by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+ //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+ this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
+ this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+ this.instance.options.helper = function() { return ui.helper[0]; };
+
+ event.target = this.instance.currentItem[0];
+ this.instance._mouseCapture(event, true);
+ this.instance._mouseStart(event, true, true);
+
+ //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+ this.instance.offset.click.top = inst.offset.click.top;
+ this.instance.offset.click.left = inst.offset.click.left;
+ this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+ this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+ inst._trigger("toSortable", event);
+ inst.dropped = this.instance.element; //draggable revert needs that
+ //hack so receive/update callbacks work (mostly)
+ inst.currentItem = inst.element;
+ this.instance.fromOutside = inst;
+
+ }
+
+ //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+ if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+ } else {
+
+ //If it doesn't intersect with the sortable, and it intersected before,
+ //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+ if(this.instance.isOver) {
+
+ this.instance.isOver = 0;
+ this.instance.cancelHelperRemoval = true;
+
+ //Prevent reverting on this forced stop
+ this.instance.options.revert = false;
+
+ // The out event needs to be triggered independently
+ this.instance._trigger('out', event, this.instance._uiHash(this.instance));
+
+ this.instance._mouseStop(event, true);
+ this.instance.options.helper = this.instance.options._helper;
+
+ //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+ this.instance.currentItem.remove();
+ if(this.instance.placeholder) this.instance.placeholder.remove();
+
+ inst._trigger("fromSortable", event);
+ inst.dropped = false; //draggable revert needs that
+ }
+
+ };
+
+ });
+
+ }
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+ start: function(event, ui) {
+ var t = $('body'), o = $(this).data('draggable').options;
+ if (t.css("cursor")) o._cursor = t.css("cursor");
+ t.css("cursor", o.cursor);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if (o._cursor) $('body').css("cursor", o._cursor);
+ }
+});
+
+$.ui.plugin.add("draggable", "iframeFix", {
+ start: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+ $('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+ .css({
+ width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+ position: "absolute", opacity: "0.001", zIndex: 1000
+ })
+ .css($(this).offset())
+ .appendTo("body");
+ });
+ },
+ stop: function(event, ui) {
+ $("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
+ }
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data('draggable').options;
+ if(t.css("opacity")) o._opacity = t.css("opacity");
+ t.css('opacity', o.opacity);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data('draggable').options;
+ if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+ }
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+ start: function(event, ui) {
+ var i = $(this).data("draggable");
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+ },
+ drag: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+ if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+ if(!o.axis || o.axis != 'x') {
+ if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+ i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+ i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+ }
+
+ } else {
+
+ if(!o.axis || o.axis != 'x') {
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+ }
+
+ if(!o.axis || o.axis != 'y') {
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+ }
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(i, event);
+
+ }
+});
+
+$.ui.plugin.add("draggable", "snap", {
+ start: function(event, ui) {
+
+ var i = $(this).data("draggable"), o = i.options;
+ i.snapElements = [];
+
+ $(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+ var $t = $(this); var $o = $t.offset();
+ if(this != i.element[0]) i.snapElements.push({
+ item: this,
+ width: $t.outerWidth(), height: $t.outerHeight(),
+ top: $o.top, left: $o.left
+ });
+ });
+
+ },
+ drag: function(event, ui) {
+
+ var inst = $(this).data("draggable"), o = inst.options;
+ var d = o.snapTolerance;
+
+ var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+ y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+ for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+ var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+ t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+ //Yes, I know, this is insane ;)
+ if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+ if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = false;
+ continue;
+ }
+
+ if(o.snapMode != 'inner') {
+ var ts = Math.abs(t - y2) <= d;
+ var bs = Math.abs(b - y1) <= d;
+ var ls = Math.abs(l - x2) <= d;
+ var rs = Math.abs(r - x1) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+ }
+
+ var first = (ts || bs || ls || rs);
+
+ if(o.snapMode != 'outer') {
+ var ts = Math.abs(t - y1) <= d;
+ var bs = Math.abs(b - y2) <= d;
+ var ls = Math.abs(l - x1) <= d;
+ var rs = Math.abs(r - x2) <= d;
+ if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+ if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+ if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+ if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+ }
+
+ if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+ (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+ inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+ };
+
+ }
+});
+
+$.ui.plugin.add("draggable", "stack", {
+ start: function(event, ui) {
+
+ var o = $(this).data("draggable").options;
+
+ var group = $.makeArray($(o.stack)).sort(function(a,b) {
+ return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
+ });
+ if (!group.length) { return; }
+
+ var min = parseInt(group[0].style.zIndex) || 0;
+ $(group).each(function(i) {
+ this.style.zIndex = min + i;
+ });
+
+ this[0].style.zIndex = min + group.length;
+
+ }
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+ start: function(event, ui) {
+ var t = $(ui.helper), o = $(this).data("draggable").options;
+ if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+ t.css('zIndex', o.zIndex);
+ },
+ stop: function(event, ui) {
+ var o = $(this).data("draggable").options;
+ if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+ }
+});
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.droppable.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,285 @@
+/*
+ * jQuery UI Droppable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.mouse.js
+ * jquery.ui.draggable.js
+ */
+(function($) {
+
+$.widget("ui.droppable", {
+ widgetEventPrefix: "drop",
+ options: {
+ accept: '*',
+ activeClass: false,
+ addClasses: true,
+ greedy: false,
+ hoverClass: false,
+ scope: 'default',
+ tolerance: 'intersect'
+ },
+ _create: function() {
+
+ var o = this.options, accept = o.accept;
+ this.isover = 0; this.isout = 1;
+
+ this.accept = $.isFunction(accept) ? accept : function(d) {
+ return d.is(accept);
+ };
+
+ //Store the droppable's proportions
+ this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+
+ // Add the reference and positions to the manager
+ $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
+ $.ui.ddmanager.droppables[o.scope].push(this);
+
+ (o.addClasses && this.element.addClass("ui-droppable"));
+
+ },
+
+ destroy: function() {
+ var drop = $.ui.ddmanager.droppables[this.options.scope];
+ for ( var i = 0; i < drop.length; i++ )
+ if ( drop[i] == this )
+ drop.splice(i, 1);
+
+ this.element
+ .removeClass("ui-droppable ui-droppable-disabled")
+ .removeData("droppable")
+ .unbind(".droppable");
+
+ return this;
+ },
+
+ _setOption: function(key, value) {
+
+ if(key == 'accept') {
+ this.accept = $.isFunction(value) ? value : function(d) {
+ return d.is(value);
+ };
+ }
+ $.Widget.prototype._setOption.apply(this, arguments);
+ },
+
+ _activate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.addClass(this.options.activeClass);
+ (draggable && this._trigger('activate', event, this.ui(draggable)));
+ },
+
+ _deactivate: function(event) {
+ var draggable = $.ui.ddmanager.current;
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ (draggable && this._trigger('deactivate', event, this.ui(draggable)));
+ },
+
+ _over: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
+ this._trigger('over', event, this.ui(draggable));
+ }
+
+ },
+
+ _out: function(event) {
+
+ var draggable = $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+ if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('out', event, this.ui(draggable));
+ }
+
+ },
+
+ _drop: function(event,custom) {
+
+ var draggable = custom || $.ui.ddmanager.current;
+ if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
+
+ var childrenIntersection = false;
+ this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
+ var inst = $.data(this, 'droppable');
+ if(
+ inst.options.greedy
+ && !inst.options.disabled
+ && inst.options.scope == draggable.options.scope
+ && inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
+ && $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
+ ) { childrenIntersection = true; return false; }
+ });
+ if(childrenIntersection) return false;
+
+ if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+ if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+ this._trigger('drop', event, this.ui(draggable));
+ return this.element;
+ }
+
+ return false;
+
+ },
+
+ ui: function(c) {
+ return {
+ draggable: (c.currentItem || c.element),
+ helper: c.helper,
+ position: c.position,
+ offset: c.positionAbs
+ };
+ }
+
+});
+
+$.extend($.ui.droppable, {
+ version: "1.8.1"
+});
+
+$.ui.intersect = function(draggable, droppable, toleranceMode) {
+
+ if (!droppable.offset) return false;
+
+ var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
+ y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
+ var l = droppable.offset.left, r = l + droppable.proportions.width,
+ t = droppable.offset.top, b = t + droppable.proportions.height;
+
+ switch (toleranceMode) {
+ case 'fit':
+ return (l < x1 && x2 < r
+ && t < y1 && y2 < b);
+ break;
+ case 'intersect':
+ return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
+ && x2 - (draggable.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
+ && y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
+ break;
+ case 'pointer':
+ var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
+ draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
+ isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
+ return isOver;
+ break;
+ case 'touch':
+ return (
+ (y1 >= t && y1 <= b) || // Top edge touching
+ (y2 >= t && y2 <= b) || // Bottom edge touching
+ (y1 < t && y2 > b) // Surrounded vertically
+ ) && (
+ (x1 >= l && x1 <= r) || // Left edge touching
+ (x2 >= l && x2 <= r) || // Right edge touching
+ (x1 < l && x2 > r) // Surrounded horizontally
+ );
+ break;
+ default:
+ return false;
+ break;
+ }
+
+};
+
+/*
+ This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+ current: null,
+ droppables: { 'default': [] },
+ prepareOffsets: function(t, event) {
+
+ var m = $.ui.ddmanager.droppables[t.options.scope] || [];
+ var type = event ? event.type : null; // workaround for #2317
+ var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
+
+ droppablesLoop: for (var i = 0; i < m.length; i++) {
+
+ if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue; //No disabled and non-accepted
+ for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
+ m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; //If the element is not visible, continue
+
+ m[i].offset = m[i].element.offset();
+ m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+
+ if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
+
+ }
+
+ },
+ drop: function(draggable, event) {
+
+ var dropped = false;
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+ if(!this.options) return;
+ if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
+ dropped = dropped || this._drop.call(this, event);
+
+ if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+ this.isout = 1; this.isover = 0;
+ this._deactivate.call(this, event);
+ }
+
+ });
+ return dropped;
+
+ },
+ drag: function(draggable, event) {
+
+ //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+ if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
+
+ //Run through all droppables and check their positions based on specific tolerance options
+ $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+ if(this.options.disabled || this.greedyChild || !this.visible) return;
+ var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
+
+ var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
+ if(!c) return;
+
+ var parentInstance;
+ if (this.options.greedy) {
+ var parent = this.element.parents(':data(droppable):eq(0)');
+ if (parent.length) {
+ parentInstance = $.data(parent[0], 'droppable');
+ parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+ }
+ }
+
+ // we just moved into a greedy child
+ if (parentInstance && c == 'isover') {
+ parentInstance['isover'] = 0;
+ parentInstance['isout'] = 1;
+ parentInstance._out.call(parentInstance, event);
+ }
+
+ this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
+ this[c == "isover" ? "_over" : "_out"].call(this, event);
+
+ // we just moved out of a greedy child
+ if (parentInstance && c == 'isout') {
+ parentInstance['isout'] = 0;
+ parentInstance['isover'] = 1;
+ parentInstance._over.call(parentInstance, event);
+ }
+ });
+
+ }
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.mouse.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,151 @@
+/*!
+ * jQuery UI Mouse 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.mouse", {
+ options: {
+ cancel: ':input,option',
+ distance: 1,
+ delay: 0
+ },
+ _mouseInit: function() {
+ var self = this;
+
+ this.element
+ .bind('mousedown.'+this.widgetName, function(event) {
+ return self._mouseDown(event);
+ })
+ .bind('click.'+this.widgetName, function(event) {
+ if(self._preventClickEvent) {
+ self._preventClickEvent = false;
+ event.stopImmediatePropagation();
+ return false;
+ }
+ });
+
+ this.started = false;
+ },
+
+ // TODO: make sure destroying one instance of mouse doesn't mess with
+ // other instances of mouse
+ _mouseDestroy: function() {
+ this.element.unbind('.'+this.widgetName);
+ },
+
+ _mouseDown: function(event) {
+ // don't let more than one widget handle mouseStart
+ // TODO: figure out why we have to use originalEvent
+ event.originalEvent = event.originalEvent || {};
+ if (event.originalEvent.mouseHandled) { return; }
+
+ // we may have missed mouseup (out of window)
+ (this._mouseStarted && this._mouseUp(event));
+
+ this._mouseDownEvent = event;
+
+ var self = this,
+ btnIsLeft = (event.which == 1),
+ elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
+ if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+ return true;
+ }
+
+ this.mouseDelayMet = !this.options.delay;
+ if (!this.mouseDelayMet) {
+ this._mouseDelayTimer = setTimeout(function() {
+ self.mouseDelayMet = true;
+ }, this.options.delay);
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted = (this._mouseStart(event) !== false);
+ if (!this._mouseStarted) {
+ event.preventDefault();
+ return true;
+ }
+ }
+
+ // these delegates are required to keep context
+ this._mouseMoveDelegate = function(event) {
+ return self._mouseMove(event);
+ };
+ this._mouseUpDelegate = function(event) {
+ return self._mouseUp(event);
+ };
+ $(document)
+ .bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ // preventDefault() is used to prevent the selection of text here -
+ // however, in Safari, this causes select boxes not to be selectable
+ // anymore, so this fix is needed
+ ($.browser.safari || event.preventDefault());
+
+ event.originalEvent.mouseHandled = true;
+ return true;
+ },
+
+ _mouseMove: function(event) {
+ // IE mouseup check - mouseup happened when mouse was out of window
+ if ($.browser.msie && !event.button) {
+ return this._mouseUp(event);
+ }
+
+ if (this._mouseStarted) {
+ this._mouseDrag(event);
+ return event.preventDefault();
+ }
+
+ if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+ this._mouseStarted =
+ (this._mouseStart(this._mouseDownEvent, event) !== false);
+ (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+ }
+
+ return !this._mouseStarted;
+ },
+
+ _mouseUp: function(event) {
+ $(document)
+ .unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+ .unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+ if (this._mouseStarted) {
+ this._mouseStarted = false;
+ this._preventClickEvent = (event.target == this._mouseDownEvent.target);
+ this._mouseStop(event);
+ }
+
+ return false;
+ },
+
+ _mouseDistanceMet: function(event) {
+ return (Math.max(
+ Math.abs(this._mouseDownEvent.pageX - event.pageX),
+ Math.abs(this._mouseDownEvent.pageY - event.pageY)
+ ) >= this.options.distance
+ );
+ },
+
+ _mouseDelayMet: function(event) {
+ return this.mouseDelayMet;
+ },
+
+ // These are placeholder methods, to be overriden by extending plugin
+ _mouseStart: function(event) {},
+ _mouseDrag: function(event) {},
+ _mouseStop: function(event) {},
+ _mouseCapture: function(event) { return true; }
+});
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.position.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,233 @@
+/*
+ * jQuery UI Position 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function( $ ) {
+
+$.ui = $.ui || {};
+
+var horizontalPositions = /left|center|right/,
+ horizontalDefault = "center",
+ verticalPositions = /top|center|bottom/,
+ verticalDefault = "center",
+ _position = $.fn.position,
+ _offset = $.fn.offset;
+
+$.fn.position = function( options ) {
+ if ( !options || !options.of ) {
+ return _position.apply( this, arguments );
+ }
+
+ // make a copy, we don't want to modify arguments
+ options = $.extend( {}, options );
+
+ var target = $( options.of ),
+ collision = ( options.collision || "flip" ).split( " " ),
+ offset = options.offset ? options.offset.split( " " ) : [ 0, 0 ],
+ targetWidth,
+ targetHeight,
+ basePosition;
+
+ if ( options.of.nodeType === 9 ) {
+ targetWidth = target.width();
+ targetHeight = target.height();
+ basePosition = { top: 0, left: 0 };
+ } else if ( options.of.scrollTo && options.of.document ) {
+ targetWidth = target.width();
+ targetHeight = target.height();
+ basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
+ } else if ( options.of.preventDefault ) {
+ // force left top to allow flipping
+ options.at = "left top";
+ targetWidth = targetHeight = 0;
+ basePosition = { top: options.of.pageY, left: options.of.pageX };
+ } else {
+ targetWidth = target.outerWidth();
+ targetHeight = target.outerHeight();
+ basePosition = target.offset();
+ }
+
+ // force my and at to have valid horizontal and veritcal positions
+ // if a value is missing or invalid, it will be converted to center
+ $.each( [ "my", "at" ], function() {
+ var pos = ( options[this] || "" ).split( " " );
+ if ( pos.length === 1) {
+ pos = horizontalPositions.test( pos[0] ) ?
+ pos.concat( [verticalDefault] ) :
+ verticalPositions.test( pos[0] ) ?
+ [ horizontalDefault ].concat( pos ) :
+ [ horizontalDefault, verticalDefault ];
+ }
+ pos[ 0 ] = horizontalPositions.test( pos[0] ) ? pos[ 0 ] : horizontalDefault;
+ pos[ 1 ] = verticalPositions.test( pos[1] ) ? pos[ 1 ] : verticalDefault;
+ options[ this ] = pos;
+ });
+
+ // normalize collision option
+ if ( collision.length === 1 ) {
+ collision[ 1 ] = collision[ 0 ];
+ }
+
+ // normalize offset option
+ offset[ 0 ] = parseInt( offset[0], 10 ) || 0;
+ if ( offset.length === 1 ) {
+ offset[ 1 ] = offset[ 0 ];
+ }
+ offset[ 1 ] = parseInt( offset[1], 10 ) || 0;
+
+ if ( options.at[0] === "right" ) {
+ basePosition.left += targetWidth;
+ } else if (options.at[0] === horizontalDefault ) {
+ basePosition.left += targetWidth / 2;
+ }
+
+ if ( options.at[1] === "bottom" ) {
+ basePosition.top += targetHeight;
+ } else if ( options.at[1] === verticalDefault ) {
+ basePosition.top += targetHeight / 2;
+ }
+
+ basePosition.left += offset[ 0 ];
+ basePosition.top += offset[ 1 ];
+
+ return this.each(function() {
+ var elem = $( this ),
+ elemWidth = elem.outerWidth(),
+ elemHeight = elem.outerHeight(),
+ position = $.extend( {}, basePosition );
+
+ if ( options.my[0] === "right" ) {
+ position.left -= elemWidth;
+ } else if ( options.my[0] === horizontalDefault ) {
+ position.left -= elemWidth / 2;
+ }
+
+ if ( options.my[1] === "bottom" ) {
+ position.top -= elemHeight;
+ } else if ( options.my[1] === verticalDefault ) {
+ position.top -= elemHeight / 2;
+ }
+
+ // prevent fractions (see #5280)
+ position.left = parseInt( position.left );
+ position.top = parseInt( position.top );
+
+ $.each( [ "left", "top" ], function( i, dir ) {
+ if ( $.ui.position[ collision[i] ] ) {
+ $.ui.position[ collision[i] ][ dir ]( position, {
+ targetWidth: targetWidth,
+ targetHeight: targetHeight,
+ elemWidth: elemWidth,
+ elemHeight: elemHeight,
+ offset: offset,
+ my: options.my,
+ at: options.at
+ });
+ }
+ });
+
+ if ( $.fn.bgiframe ) {
+ elem.bgiframe();
+ }
+ elem.offset( $.extend( position, { using: options.using } ) );
+ });
+};
+
+$.ui.position = {
+ fit: {
+ left: function( position, data ) {
+ var win = $( window ),
+ over = position.left + data.elemWidth - win.width() - win.scrollLeft();
+ position.left = over > 0 ? position.left - over : Math.max( 0, position.left );
+ },
+ top: function( position, data ) {
+ var win = $( window ),
+ over = position.top + data.elemHeight - win.height() - win.scrollTop();
+ position.top = over > 0 ? position.top - over : Math.max( 0, position.top );
+ }
+ },
+
+ flip: {
+ left: function( position, data ) {
+ if ( data.at[0] === "center" ) {
+ return;
+ }
+ var win = $( window ),
+ over = position.left + data.elemWidth - win.width() - win.scrollLeft(),
+ myOffset = data.my[ 0 ] === "left" ?
+ -data.elemWidth :
+ data.my[ 0 ] === "right" ?
+ data.elemWidth :
+ 0,
+ offset = -2 * data.offset[ 0 ];
+ position.left += position.left < 0 ?
+ myOffset + data.targetWidth + offset :
+ over > 0 ?
+ myOffset - data.targetWidth + offset :
+ 0;
+ },
+ top: function( position, data ) {
+ if ( data.at[1] === "center" ) {
+ return;
+ }
+ var win = $( window ),
+ over = position.top + data.elemHeight - win.height() - win.scrollTop(),
+ myOffset = data.my[ 1 ] === "top" ?
+ -data.elemHeight :
+ data.my[ 1 ] === "bottom" ?
+ data.elemHeight :
+ 0,
+ atOffset = data.at[ 1 ] === "top" ?
+ data.targetHeight :
+ -data.targetHeight,
+ offset = -2 * data.offset[ 1 ];
+ position.top += position.top < 0 ?
+ myOffset + data.targetHeight + offset :
+ over > 0 ?
+ myOffset + atOffset + offset :
+ 0;
+ }
+ }
+};
+
+// offset setter from jQuery 1.4
+if ( !$.offset.setOffset ) {
+ $.offset.setOffset = function( elem, options ) {
+ // set position first, in-case top/left are set even on static elem
+ if ( /static/.test( $.curCSS( elem, "position" ) ) ) {
+ elem.style.position = "relative";
+ }
+ var curElem = $( elem ),
+ curOffset = curElem.offset(),
+ curTop = parseInt( $.curCSS( elem, "top", true ), 10 ) || 0,
+ curLeft = parseInt( $.curCSS( elem, "left", true ), 10) || 0,
+ props = {
+ top: (options.top - curOffset.top) + curTop,
+ left: (options.left - curOffset.left) + curLeft
+ };
+
+ if ( 'using' in options ) {
+ options.using.call( elem, props );
+ } else {
+ curElem.css( props );
+ }
+ };
+
+ $.fn.offset = function( options ) {
+ var elem = this[ 0 ];
+ if ( !elem || !elem.ownerDocument ) { return null; }
+ if ( options ) {
+ return this.each(function() {
+ $.offset.setOffset( this, options );
+ });
+ }
+ return _offset.call( this );
+ };
+}
+
+}( jQuery ));
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.progressbar.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,107 @@
+/*
+ * jQuery UI Progressbar 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function( $ ) {
+
+$.widget( "ui.progressbar", {
+ options: {
+ value: 0
+ },
+ _create: function() {
+ this.element
+ .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .attr({
+ role: "progressbar",
+ "aria-valuemin": this._valueMin(),
+ "aria-valuemax": this._valueMax(),
+ "aria-valuenow": this._value()
+ });
+
+ this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" )
+ .appendTo( this.element );
+
+ this._refreshValue();
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" )
+ .removeAttr( "role" )
+ .removeAttr( "aria-valuemin" )
+ .removeAttr( "aria-valuemax" )
+ .removeAttr( "aria-valuenow" );
+
+ this.valueDiv.remove();
+
+ $.Widget.prototype.destroy.apply( this, arguments );
+ },
+
+ value: function( newValue ) {
+ if ( newValue === undefined ) {
+ return this._value();
+ }
+
+ this._setOption( "value", newValue );
+ return this;
+ },
+
+ _setOption: function( key, value ) {
+ switch ( key ) {
+ case "value":
+ this.options.value = value;
+ this._refreshValue();
+ this._trigger( "change" );
+ break;
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+ },
+
+ _value: function() {
+ var val = this.options.value;
+ // normalize invalid value
+ if ( typeof val !== "number" ) {
+ val = 0;
+ }
+ if ( val < this._valueMin() ) {
+ val = this._valueMin();
+ }
+ if ( val > this._valueMax() ) {
+ val = this._valueMax();
+ }
+
+ return val;
+ },
+
+ _valueMin: function() {
+ return 0;
+ },
+
+ _valueMax: function() {
+ return 100;
+ },
+
+ _refreshValue: function() {
+ var value = this.value();
+ this.valueDiv
+ [ value === this._valueMax() ? "addClass" : "removeClass"]( "ui-corner-right" )
+ .width( value + "%" );
+ this.element.attr( "aria-valuenow", value );
+ }
+});
+
+$.extend( $.ui.progressbar, {
+ version: "1.8.1"
+});
+
+})( jQuery );
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.resizable.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,799 @@
+/*
+ * jQuery UI Resizable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.resizable", $.ui.mouse, {
+ widgetEventPrefix: "resize",
+ options: {
+ alsoResize: false,
+ animate: false,
+ animateDuration: "slow",
+ animateEasing: "swing",
+ aspectRatio: false,
+ autoHide: false,
+ containment: false,
+ ghost: false,
+ grid: false,
+ handles: "e,s,se",
+ helper: false,
+ maxHeight: null,
+ maxWidth: null,
+ minHeight: 10,
+ minWidth: 10,
+ zIndex: 1000
+ },
+ _create: function() {
+
+ var self = this, o = this.options;
+ this.element.addClass("ui-resizable");
+
+ $.extend(this, {
+ _aspectRatio: !!(o.aspectRatio),
+ aspectRatio: o.aspectRatio,
+ originalElement: this.element,
+ _proportionallyResizeElements: [],
+ _helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+ });
+
+ //Wrap the element if it cannot hold child nodes
+ if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+ //Opera fix for relative positioning
+ if (/relative/.test(this.element.css('position')) && $.browser.opera)
+ this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ //Create a wrapper element and set the wrapper to the new current internal element
+ this.element.wrap(
+ $('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+ position: this.element.css('position'),
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight(),
+ top: this.element.css('top'),
+ left: this.element.css('left')
+ })
+ );
+
+ //Overwrite the original this.element
+ this.element = this.element.parent().data(
+ "resizable", this.element.data('resizable')
+ );
+
+ this.elementIsWrapper = true;
+
+ //Move margins to the wrapper
+ this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+ this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+ //Prevent Safari textarea resize
+ this.originalResizeStyle = this.originalElement.css('resize');
+ this.originalElement.css('resize', 'none');
+
+ //Push the actual element to our proportionallyResize internal array
+ this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+ // avoid IE jump (hard set the margin)
+ this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+ // fix handlers offset
+ this._proportionallyResize();
+
+ }
+
+ this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+ if(this.handles.constructor == String) {
+
+ if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+ var n = this.handles.split(","); this.handles = {};
+
+ for(var i = 0; i < n.length; i++) {
+
+ var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+ var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+ // increase zIndex of sw, se, ne, nw axis
+ //TODO : this modifies original option
+ if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+
+ //TODO : What's going on here?
+ if ('se' == handle) {
+ axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+ };
+
+ //Insert into internal handles object and append to element
+ this.handles[handle] = '.ui-resizable-'+handle;
+ this.element.append(axis);
+ }
+
+ }
+
+ this._renderAxis = function(target) {
+
+ target = target || this.element;
+
+ for(var i in this.handles) {
+
+ if(this.handles[i].constructor == String)
+ this.handles[i] = $(this.handles[i], this.element).show();
+
+ //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+ if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+ var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+ //Checking the correct pad and border
+ padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+ //The padding type i have to apply...
+ var padPos = [ 'padding',
+ /ne|nw|n/.test(i) ? 'Top' :
+ /se|sw|s/.test(i) ? 'Bottom' :
+ /^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+ target.css(padPos, padWrapper);
+
+ this._proportionallyResize();
+
+ }
+
+ //TODO: What's that good for? There's not anything to be executed left
+ if(!$(this.handles[i]).length)
+ continue;
+
+ }
+ };
+
+ //TODO: make renderAxis a prototype function
+ this._renderAxis(this.element);
+
+ this._handles = $('.ui-resizable-handle', this.element)
+ .disableSelection();
+
+ //Matching axis name
+ this._handles.mouseover(function() {
+ if (!self.resizing) {
+ if (this.className)
+ var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+ //Axis, default = se
+ self.axis = axis && axis[1] ? axis[1] : 'se';
+ }
+ });
+
+ //If we want to auto hide the elements
+ if (o.autoHide) {
+ this._handles.hide();
+ $(this.element)
+ .addClass("ui-resizable-autohide")
+ .hover(function() {
+ $(this).removeClass("ui-resizable-autohide");
+ self._handles.show();
+ },
+ function(){
+ if (!self.resizing) {
+ $(this).addClass("ui-resizable-autohide");
+ self._handles.hide();
+ }
+ });
+ }
+
+ //Initialize the mouse interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+
+ this._mouseDestroy();
+
+ var _destroy = function(exp) {
+ $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+ .removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+ };
+
+ //TODO: Unwrap at same DOM position
+ if (this.elementIsWrapper) {
+ _destroy(this.element);
+ var wrapper = this.element;
+ wrapper.after(
+ this.originalElement.css({
+ position: wrapper.css('position'),
+ width: wrapper.outerWidth(),
+ height: wrapper.outerHeight(),
+ top: wrapper.css('top'),
+ left: wrapper.css('left')
+ })
+ ).remove();
+ }
+
+ this.originalElement.css('resize', this.originalResizeStyle);
+ _destroy(this.originalElement);
+
+ return this;
+ },
+
+ _mouseCapture: function(event) {
+ var handle = false;
+ for (var i in this.handles) {
+ if ($(this.handles[i])[0] == event.target) {
+ handle = true;
+ }
+ }
+
+ return !this.options.disabled && handle;
+ },
+
+ _mouseStart: function(event) {
+
+ var o = this.options, iniPos = this.element.position(), el = this.element;
+
+ this.resizing = true;
+ this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+ // bugfix for http://dev.jquery.com/ticket/1749
+ if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+ el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+ }
+
+ //Opera fixing relative position
+ if ($.browser.opera && (/relative/).test(el.css('position')))
+ el.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+ this._renderProxy();
+
+ var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+ if (o.containment) {
+ curleft += $(o.containment).scrollLeft() || 0;
+ curtop += $(o.containment).scrollTop() || 0;
+ }
+
+ //Store needed variables
+ this.offset = this.helper.offset();
+ this.position = { left: curleft, top: curtop };
+ this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+ this.originalPosition = { left: curleft, top: curtop };
+ this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+ this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+ //Aspect Ratio
+ this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+ var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+ $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+
+ el.addClass("ui-resizable-resizing");
+ this._propagate("start", event);
+ return true;
+ },
+
+ _mouseDrag: function(event) {
+
+ //Increase performance, avoid regex
+ var el = this.helper, o = this.options, props = {},
+ self = this, smp = this.originalMousePosition, a = this.axis;
+
+ var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+ var trigger = this._change[a];
+ if (!trigger) return false;
+
+ // Calculate the attrs that will be change
+ var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+ if (this._aspectRatio || event.shiftKey)
+ data = this._updateRatio(data, event);
+
+ data = this._respectSize(data, event);
+
+ // plugins callbacks need to be called first
+ this._propagate("resize", event);
+
+ el.css({
+ top: this.position.top + "px", left: this.position.left + "px",
+ width: this.size.width + "px", height: this.size.height + "px"
+ });
+
+ if (!this._helper && this._proportionallyResizeElements.length)
+ this._proportionallyResize();
+
+ this._updateCache(data);
+
+ // calling the user callback at the end
+ this._trigger('resize', event, this.ui());
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+
+ this.resizing = false;
+ var o = this.options, self = this;
+
+ if(this._helper) {
+ var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ if (!o.animate)
+ this.element.css($.extend(s, { top: top, left: left }));
+
+ self.helper.height(self.size.height);
+ self.helper.width(self.size.width);
+
+ if (this._helper && !o.animate) this._proportionallyResize();
+ }
+
+ $('body').css('cursor', 'auto');
+
+ this.element.removeClass("ui-resizable-resizing");
+
+ this._propagate("stop", event);
+
+ if (this._helper) this.helper.remove();
+ return false;
+
+ },
+
+ _updateCache: function(data) {
+ var o = this.options;
+ this.offset = this.helper.offset();
+ if (isNumber(data.left)) this.position.left = data.left;
+ if (isNumber(data.top)) this.position.top = data.top;
+ if (isNumber(data.height)) this.size.height = data.height;
+ if (isNumber(data.width)) this.size.width = data.width;
+ },
+
+ _updateRatio: function(data, event) {
+
+ var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+ if (data.height) data.width = (csize.height * this.aspectRatio);
+ else if (data.width) data.height = (csize.width / this.aspectRatio);
+
+ if (a == 'sw') {
+ data.left = cpos.left + (csize.width - data.width);
+ data.top = null;
+ }
+ if (a == 'nw') {
+ data.top = cpos.top + (csize.height - data.height);
+ data.left = cpos.left + (csize.width - data.width);
+ }
+
+ return data;
+ },
+
+ _respectSize: function(data, event) {
+
+ var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+ ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+ isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+ if (isminw) data.width = o.minWidth;
+ if (isminh) data.height = o.minHeight;
+ if (ismaxw) data.width = o.maxWidth;
+ if (ismaxh) data.height = o.maxHeight;
+
+ var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+ var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+ if (isminw && cw) data.left = dw - o.minWidth;
+ if (ismaxw && cw) data.left = dw - o.maxWidth;
+ if (isminh && ch) data.top = dh - o.minHeight;
+ if (ismaxh && ch) data.top = dh - o.maxHeight;
+
+ // fixing jump error on top/left - bug #2330
+ var isNotwh = !data.width && !data.height;
+ if (isNotwh && !data.left && data.top) data.top = null;
+ else if (isNotwh && !data.top && data.left) data.left = null;
+
+ return data;
+ },
+
+ _proportionallyResize: function() {
+
+ var o = this.options;
+ if (!this._proportionallyResizeElements.length) return;
+ var element = this.helper || this.element;
+
+ for (var i=0; i < this._proportionallyResizeElements.length; i++) {
+
+ var prel = this._proportionallyResizeElements[i];
+
+ if (!this.borderDif) {
+ var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+ p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+ this.borderDif = $.map(b, function(v, i) {
+ var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+ return border + padding;
+ });
+ }
+
+ if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+ continue;
+
+ prel.css({
+ height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+ width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+ });
+
+ };
+
+ },
+
+ _renderProxy: function() {
+
+ var el = this.element, o = this.options;
+ this.elementOffset = el.offset();
+
+ if(this._helper) {
+
+ this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+ // fix ie6 offset TODO: This seems broken
+ var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+ pxyoffset = ( ie6 ? 2 : -1 );
+
+ this.helper.addClass(this._helper).css({
+ width: this.element.outerWidth() + pxyoffset,
+ height: this.element.outerHeight() + pxyoffset,
+ position: 'absolute',
+ left: this.elementOffset.left - ie6offset +'px',
+ top: this.elementOffset.top - ie6offset +'px',
+ zIndex: ++o.zIndex //TODO: Don't modify option
+ });
+
+ this.helper
+ .appendTo("body")
+ .disableSelection();
+
+ } else {
+ this.helper = this.element;
+ }
+
+ },
+
+ _change: {
+ e: function(event, dx, dy) {
+ return { width: this.originalSize.width + dx };
+ },
+ w: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { left: sp.left + dx, width: cs.width - dx };
+ },
+ n: function(event, dx, dy) {
+ var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+ return { top: sp.top + dy, height: cs.height - dy };
+ },
+ s: function(event, dx, dy) {
+ return { height: this.originalSize.height + dy };
+ },
+ se: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ sw: function(event, dx, dy) {
+ return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ },
+ ne: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+ },
+ nw: function(event, dx, dy) {
+ return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+ }
+ },
+
+ _propagate: function(n, event) {
+ $.ui.plugin.call(this, n, [event, this.ui()]);
+ (n != "resize" && this._trigger(n, event, this.ui()));
+ },
+
+ plugins: {},
+
+ ui: function() {
+ return {
+ originalElement: this.originalElement,
+ element: this.element,
+ helper: this.helper,
+ position: this.position,
+ size: this.size,
+ originalSize: this.originalSize,
+ originalPosition: this.originalPosition
+ };
+ }
+
+});
+
+$.extend($.ui.resizable, {
+ version: "1.8.1"
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options;
+
+ var _store = function(exp) {
+ $(exp).each(function() {
+ $(this).data("resizable-alsoresize", {
+ width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
+ left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10)
+ });
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+ if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); }
+ else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); }
+ }else{
+ _store(o.alsoResize);
+ }
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+ var delta = {
+ height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+ top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+ },
+
+ _alsoResize = function(exp, c) {
+ $(exp).each(function() {
+ var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left'];
+
+ $.each(css || ['width', 'height', 'top', 'left'], function(i, prop) {
+ var sum = (start[prop]||0) + (delta[prop]||0);
+ if (sum && sum >= 0)
+ style[prop] = sum || null;
+ });
+
+ //Opera fixing relative position
+ if (/relative/.test(el.css('position')) && $.browser.opera) {
+ self._revertToRelativePosition = true;
+ el.css({ position: 'absolute', top: 'auto', left: 'auto' });
+ }
+
+ el.css(style);
+ });
+ };
+
+ if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+ $.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); });
+ }else{
+ _alsoResize(o.alsoResize);
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable");
+
+ //Opera fixing relative position
+ if (self._revertToRelativePosition && $.browser.opera) {
+ self._revertToRelativePosition = false;
+ el.css({ position: 'relative' });
+ }
+
+ $(this).removeData("resizable-alsoresize-start");
+ }
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+ stop: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options;
+
+ var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+ soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+ soffsetw = ista ? 0 : self.sizeDiff.width;
+
+ var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+ left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+ top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+ self.element.animate(
+ $.extend(style, top && left ? { top: top, left: left } : {}), {
+ duration: o.animateDuration,
+ easing: o.animateEasing,
+ step: function() {
+
+ var data = {
+ width: parseInt(self.element.css('width'), 10),
+ height: parseInt(self.element.css('height'), 10),
+ top: parseInt(self.element.css('top'), 10),
+ left: parseInt(self.element.css('left'), 10)
+ };
+
+ if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
+
+ // propagating resize, and updating values for each animation step
+ self._updateCache(data);
+ self._propagate("resize", event);
+
+ }
+ }
+ );
+ }
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+ start: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, el = self.element;
+ var oc = o.containment, ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+ if (!ce) return;
+
+ self.containerElement = $(ce);
+
+ if (/document/.test(oc) || oc == document) {
+ self.containerOffset = { left: 0, top: 0 };
+ self.containerPosition = { left: 0, top: 0 };
+
+ self.parentData = {
+ element: $(document), left: 0, top: 0,
+ width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+ };
+ }
+
+ // i'm a node, so compute top, left, right, bottom
+ else {
+ var element = $(ce), p = [];
+ $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+ self.containerOffset = element.offset();
+ self.containerPosition = element.position();
+ self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+ var co = self.containerOffset, ch = self.containerSize.height, cw = self.containerSize.width,
+ width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+ self.parentData = {
+ element: ce, left: co.left, top: co.top, width: width, height: height
+ };
+ }
+ },
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options,
+ ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+ pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+ if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+ if (cp.left < (self._helper ? co.left : 0)) {
+ self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+ if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+ self.position.left = o.helper ? co.left : 0;
+ }
+
+ if (cp.top < (self._helper ? co.top : 0)) {
+ self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+ if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+ self.position.top = self._helper ? co.top : 0;
+ }
+
+ self.offset.left = self.parentData.left+self.position.left;
+ self.offset.top = self.parentData.top+self.position.top;
+
+ var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+ hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+ var isParent = self.containerElement.get(0) == self.element.parent().get(0),
+ isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+
+ if(isParent && isOffsetRelative) woset -= self.parentData.left;
+
+ if (woset + self.size.width >= self.parentData.width) {
+ self.size.width = self.parentData.width - woset;
+ if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+ }
+
+ if (hoset + self.size.height >= self.parentData.height) {
+ self.size.height = self.parentData.height - hoset;
+ if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+ }
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options, cp = self.position,
+ co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+ var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+ if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+ $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+ }
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+ start: function(event, ui) {
+
+ var self = $(this).data("resizable"), o = self.options, cs = self.size;
+
+ self.ghost = self.originalElement.clone();
+ self.ghost
+ .css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+ .addClass('ui-resizable-ghost')
+ .addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+ self.ghost.appendTo(self.helper);
+
+ },
+
+ resize: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+ },
+
+ stop: function(event, ui){
+ var self = $(this).data("resizable"), o = self.options;
+ if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+ }
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+ resize: function(event, ui) {
+ var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+ o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+ var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+ if (/^(se|s|e)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ }
+ else if (/^(ne)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ }
+ else if (/^(sw)$/.test(a)) {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.left = op.left - ox;
+ }
+ else {
+ self.size.width = os.width + ox;
+ self.size.height = os.height + oy;
+ self.position.top = op.top - oy;
+ self.position.left = op.left - ox;
+ }
+ }
+
+});
+
+var num = function(v) {
+ return parseInt(v, 10) || 0;
+};
+
+var isNumber = function(value) {
+ return !isNaN(parseInt(value, 10));
+};
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.selectable.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,261 @@
+/*
+ * jQuery UI Selectable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.selectable", $.ui.mouse, {
+ options: {
+ appendTo: 'body',
+ autoRefresh: true,
+ distance: 0,
+ filter: '*',
+ tolerance: 'touch'
+ },
+ _create: function() {
+ var self = this;
+
+ this.element.addClass("ui-selectable");
+
+ this.dragged = false;
+
+ // cache selectee children based on filter
+ var selectees;
+ this.refresh = function() {
+ selectees = $(self.options.filter, self.element[0]);
+ selectees.each(function() {
+ var $this = $(this);
+ var pos = $this.offset();
+ $.data(this, "selectable-item", {
+ element: this,
+ $element: $this,
+ left: pos.left,
+ top: pos.top,
+ right: pos.left + $this.outerWidth(),
+ bottom: pos.top + $this.outerHeight(),
+ startselected: false,
+ selected: $this.hasClass('ui-selected'),
+ selecting: $this.hasClass('ui-selecting'),
+ unselecting: $this.hasClass('ui-unselecting')
+ });
+ });
+ };
+ this.refresh();
+
+ this.selectees = selectees.addClass("ui-selectee");
+
+ this._mouseInit();
+
+ this.helper = $(document.createElement('div'))
+ .css({border:'1px dotted black'})
+ .addClass("ui-selectable-helper");
+ },
+
+ destroy: function() {
+ this.selectees
+ .removeClass("ui-selectee")
+ .removeData("selectable-item");
+ this.element
+ .removeClass("ui-selectable ui-selectable-disabled")
+ .removeData("selectable")
+ .unbind(".selectable");
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseStart: function(event) {
+ var self = this;
+
+ this.opos = [event.pageX, event.pageY];
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ this.selectees = $(options.filter, this.element[0]);
+
+ this._trigger("start", event);
+
+ $(options.appendTo).append(this.helper);
+ // position helper (lasso)
+ this.helper.css({
+ "z-index": 100,
+ "position": "absolute",
+ "left": event.clientX,
+ "top": event.clientY,
+ "width": 0,
+ "height": 0
+ });
+
+ if (options.autoRefresh) {
+ this.refresh();
+ }
+
+ this.selectees.filter('.ui-selected').each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.startselected = true;
+ if (!event.metaKey) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ });
+
+ $(event.target).parents().andSelf().each(function() {
+ var selectee = $.data(this, "selectable-item");
+ if (selectee) {
+ selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting');
+ selectee.unselecting = false;
+ selectee.selecting = true;
+ selectee.selected = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ return false;
+ }
+ });
+
+ },
+
+ _mouseDrag: function(event) {
+ var self = this;
+ this.dragged = true;
+
+ if (this.options.disabled)
+ return;
+
+ var options = this.options;
+
+ var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
+ if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
+ if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
+ this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
+
+ this.selectees.each(function() {
+ var selectee = $.data(this, "selectable-item");
+ //prevent helper from being selected if appendTo: selectable
+ if (!selectee || selectee.element == self.element[0])
+ return;
+ var hit = false;
+ if (options.tolerance == 'touch') {
+ hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+ } else if (options.tolerance == 'fit') {
+ hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+ }
+
+ if (hit) {
+ // SELECT
+ if (selectee.selected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+ }
+ if (selectee.unselecting) {
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ }
+ if (!selectee.selecting) {
+ selectee.$element.addClass('ui-selecting');
+ selectee.selecting = true;
+ // selectable SELECTING callback
+ self._trigger("selecting", event, {
+ selecting: selectee.element
+ });
+ }
+ } else {
+ // UNSELECT
+ if (selectee.selecting) {
+ if (event.metaKey && selectee.startselected) {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ selectee.$element.addClass('ui-selected');
+ selectee.selected = true;
+ } else {
+ selectee.$element.removeClass('ui-selecting');
+ selectee.selecting = false;
+ if (selectee.startselected) {
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ }
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ if (selectee.selected) {
+ if (!event.metaKey && !selectee.startselected) {
+ selectee.$element.removeClass('ui-selected');
+ selectee.selected = false;
+
+ selectee.$element.addClass('ui-unselecting');
+ selectee.unselecting = true;
+ // selectable UNSELECTING callback
+ self._trigger("unselecting", event, {
+ unselecting: selectee.element
+ });
+ }
+ }
+ }
+ });
+
+ return false;
+ },
+
+ _mouseStop: function(event) {
+ var self = this;
+
+ this.dragged = false;
+
+ var options = this.options;
+
+ $('.ui-unselecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-unselecting');
+ selectee.unselecting = false;
+ selectee.startselected = false;
+ self._trigger("unselected", event, {
+ unselected: selectee.element
+ });
+ });
+ $('.ui-selecting', this.element[0]).each(function() {
+ var selectee = $.data(this, "selectable-item");
+ selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
+ selectee.selecting = false;
+ selectee.selected = true;
+ selectee.startselected = true;
+ self._trigger("selected", event, {
+ selected: selectee.element
+ });
+ });
+ this._trigger("stop", event);
+
+ this.helper.remove();
+
+ return false;
+ }
+
+});
+
+$.extend($.ui.selectable, {
+ version: "1.8.1"
+});
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.slider.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,682 @@
+/*
+ * jQuery UI Slider 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+
+(function( $ ) {
+
+// number of pages in a slider
+// (how many times can you page up/down to go through the whole range)
+var numPages = 5;
+
+$.widget( "ui.slider", $.ui.mouse, {
+
+ widgetEventPrefix: "slide",
+
+ options: {
+ animate: false,
+ distance: 0,
+ max: 100,
+ min: 0,
+ orientation: "horizontal",
+ range: false,
+ step: 1,
+ value: 0,
+ values: null
+ },
+
+ _create: function() {
+ var self = this,
+ o = this.options;
+
+ this._keySliding = false;
+ this._mouseSliding = false;
+ this._animateOff = true;
+ this._handleIndex = null;
+ this._detectOrientation();
+ this._mouseInit();
+
+ this.element
+ .addClass( "ui-slider" +
+ " ui-slider-" + this.orientation +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all" );
+
+ if ( o.disabled ) {
+ this.element.addClass( "ui-slider-disabled ui-disabled" );
+ }
+
+ this.range = $([]);
+
+ if ( o.range ) {
+ if ( o.range === true ) {
+ this.range = $( "<div></div>" );
+ if ( !o.values ) {
+ o.values = [ this._valueMin(), this._valueMin() ];
+ }
+ if ( o.values.length && o.values.length !== 2 ) {
+ o.values = [ o.values[0], o.values[0] ];
+ }
+ } else {
+ this.range = $( "<div></div>" );
+ }
+
+ this.range
+ .appendTo( this.element )
+ .addClass( "ui-slider-range" );
+
+ if ( o.range === "min" || o.range === "max" ) {
+ this.range.addClass( "ui-slider-range-" + o.range );
+ }
+
+ // note: this isn't the most fittingly semantic framework class for this element,
+ // but worked best visually with a variety of themes
+ this.range.addClass( "ui-widget-header" );
+ }
+
+ if ( $( ".ui-slider-handle", this.element ).length === 0 ) {
+ $( "<a href='#'></a>" )
+ .appendTo( this.element )
+ .addClass( "ui-slider-handle" );
+ }
+
+ if ( o.values && o.values.length ) {
+ while ( $(".ui-slider-handle", this.element).length < o.values.length ) {
+ $( "<a href='#'></a>" )
+ .appendTo( this.element )
+ .addClass( "ui-slider-handle" );
+ }
+ }
+
+ this.handles = $( ".ui-slider-handle", this.element )
+ .addClass( "ui-state-default" +
+ " ui-corner-all" );
+
+ this.handle = this.handles.eq( 0 );
+
+ this.handles.add( this.range ).filter( "a" )
+ .click(function( event ) {
+ event.preventDefault();
+ })
+ .hover(function() {
+ if ( !o.disabled ) {
+ $( this ).addClass( "ui-state-hover" );
+ }
+ }, function() {
+ $( this ).removeClass( "ui-state-hover" );
+ })
+ .focus(function() {
+ if ( !o.disabled ) {
+ $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" );
+ $( this ).addClass( "ui-state-focus" );
+ } else {
+ $( this ).blur();
+ }
+ })
+ .blur(function() {
+ $( this ).removeClass( "ui-state-focus" );
+ });
+
+ this.handles.each(function( i ) {
+ $( this ).data( "index.ui-slider-handle", i );
+ });
+
+ this.handles
+ .keydown(function( event ) {
+ var ret = true,
+ index = $( this ).data( "index.ui-slider-handle" ),
+ allowed,
+ curVal,
+ newVal,
+ step;
+
+ if ( self.options.disabled ) {
+ return;
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ case $.ui.keyCode.END:
+ case $.ui.keyCode.PAGE_UP:
+ case $.ui.keyCode.PAGE_DOWN:
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ ret = false;
+ if ( !self._keySliding ) {
+ self._keySliding = true;
+ $( this ).addClass( "ui-state-active" );
+ allowed = self._start( event, index );
+ if ( allowed === false ) {
+ return;
+ }
+ }
+ break;
+ }
+
+ step = self.options.step;
+ if ( self.options.values && self.options.values.length ) {
+ curVal = newVal = self.values( index );
+ } else {
+ curVal = newVal = self.value();
+ }
+
+ switch ( event.keyCode ) {
+ case $.ui.keyCode.HOME:
+ newVal = self._valueMin();
+ break;
+ case $.ui.keyCode.END:
+ newVal = self._valueMax();
+ break;
+ case $.ui.keyCode.PAGE_UP:
+ newVal = curVal + ( (self._valueMax() - self._valueMin()) / numPages );
+ break;
+ case $.ui.keyCode.PAGE_DOWN:
+ newVal = curVal - ( (self._valueMax() - self._valueMin()) / numPages );
+ break;
+ case $.ui.keyCode.UP:
+ case $.ui.keyCode.RIGHT:
+ if ( curVal === self._valueMax() ) {
+ return;
+ }
+ newVal = curVal + step;
+ break;
+ case $.ui.keyCode.DOWN:
+ case $.ui.keyCode.LEFT:
+ if ( curVal === self._valueMin() ) {
+ return;
+ }
+ newVal = curVal - step;
+ break;
+ }
+
+ self._slide( event, index, newVal );
+
+ return ret;
+
+ })
+ .keyup(function( event ) {
+ var index = $( this ).data( "index.ui-slider-handle" );
+
+ if ( self._keySliding ) {
+ self._keySliding = false;
+ self._stop( event, index );
+ self._change( event, index );
+ $( this ).removeClass( "ui-state-active" );
+ }
+
+ });
+
+ this._refreshValue();
+
+ this._animateOff = false;
+ },
+
+ destroy: function() {
+ this.handles.remove();
+ this.range.remove();
+
+ this.element
+ .removeClass( "ui-slider" +
+ " ui-slider-horizontal" +
+ " ui-slider-vertical" +
+ " ui-slider-disabled" +
+ " ui-widget" +
+ " ui-widget-content" +
+ " ui-corner-all" )
+ .removeData( "slider" )
+ .unbind( ".slider" );
+
+ this._mouseDestroy();
+
+ return this;
+ },
+
+ _mouseCapture: function( event ) {
+ var o = this.options,
+ position,
+ normValue,
+ distance,
+ closestHandle,
+ self,
+ index,
+ allowed,
+ offset,
+ mouseOverHandle;
+
+ if ( o.disabled ) {
+ return false;
+ }
+
+ this.elementSize = {
+ width: this.element.outerWidth(),
+ height: this.element.outerHeight()
+ };
+ this.elementOffset = this.element.offset();
+
+ position = { x: event.pageX, y: event.pageY };
+ normValue = this._normValueFromMouse( position );
+ distance = this._valueMax() - this._valueMin() + 1;
+ self = this;
+ this.handles.each(function( i ) {
+ var thisDistance = Math.abs( normValue - self.values(i) );
+ if ( distance > thisDistance ) {
+ distance = thisDistance;
+ closestHandle = $( this );
+ index = i;
+ }
+ });
+
+ // workaround for bug #3736 (if both handles of a range are at 0,
+ // the first is always used as the one with least distance,
+ // and moving it is obviously prevented by preventing negative ranges)
+ if( o.range === true && this.values(1) === o.min ) {
+ index += 1;
+ closestHandle = $( this.handles[index] );
+ }
+
+ allowed = this._start( event, index );
+ if ( allowed === false ) {
+ return false;
+ }
+ this._mouseSliding = true;
+
+ self._handleIndex = index;
+
+ closestHandle
+ .addClass( "ui-state-active" )
+ .focus();
+
+ offset = closestHandle.offset();
+ mouseOverHandle = !$( event.target ).parents().andSelf().is( ".ui-slider-handle" );
+ this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+ left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
+ top: event.pageY - offset.top -
+ ( closestHandle.height() / 2 ) -
+ ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) -
+ ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) +
+ ( parseInt( closestHandle.css("marginTop"), 10 ) || 0)
+ };
+
+ normValue = this._normValueFromMouse( position );
+ this._slide( event, index, normValue );
+ this._animateOff = true;
+ return true;
+ },
+
+ _mouseStart: function( event ) {
+ return true;
+ },
+
+ _mouseDrag: function( event ) {
+ var position = { x: event.pageX, y: event.pageY },
+ normValue = this._normValueFromMouse( position );
+
+ this._slide( event, this._handleIndex, normValue );
+
+ return false;
+ },
+
+ _mouseStop: function( event ) {
+ this.handles.removeClass( "ui-state-active" );
+ this._mouseSliding = false;
+
+ this._stop( event, this._handleIndex );
+ this._change( event, this._handleIndex );
+
+ this._handleIndex = null;
+ this._clickOffset = null;
+ this._animateOff = false;
+
+ return false;
+ },
+
+ _detectOrientation: function() {
+ this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
+ },
+
+ _normValueFromMouse: function( position ) {
+ var pixelTotal,
+ pixelMouse,
+ percentMouse,
+ valueTotal,
+ valueMouse;
+
+ if ( this.orientation === "horizontal" ) {
+ pixelTotal = this.elementSize.width;
+ pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 );
+ } else {
+ pixelTotal = this.elementSize.height;
+ pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 );
+ }
+
+ percentMouse = ( pixelMouse / pixelTotal );
+ if ( percentMouse > 1 ) {
+ percentMouse = 1;
+ }
+ if ( percentMouse < 0 ) {
+ percentMouse = 0;
+ }
+ if ( this.orientation === "vertical" ) {
+ percentMouse = 1 - percentMouse;
+ }
+
+ valueTotal = this._valueMax() - this._valueMin();
+ valueMouse = this._valueMin() + percentMouse * valueTotal;
+
+ return this._trimAlignValue( valueMouse );
+ },
+
+ _start: function( event, index ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+ return this._trigger( "start", event, uiHash );
+ },
+
+ _slide: function( event, index, newVal ) {
+ var otherVal,
+ newValues,
+ allowed;
+
+ if ( this.options.values && this.options.values.length ) {
+ otherVal = this.values( index ? 0 : 1 );
+
+ if ( ( this.options.values.length === 2 && this.options.range === true ) &&
+ ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) )
+ ) {
+ newVal = otherVal;
+ }
+
+ if ( newVal !== this.values( index ) ) {
+ newValues = this.values();
+ newValues[ index ] = newVal;
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger( "slide", event, {
+ handle: this.handles[ index ],
+ value: newVal,
+ values: newValues
+ } );
+ otherVal = this.values( index ? 0 : 1 );
+ if ( allowed !== false ) {
+ this.values( index, newVal, true );
+ }
+ }
+ } else {
+ if ( newVal !== this.value() ) {
+ // A slide can be canceled by returning false from the slide callback
+ allowed = this._trigger( "slide", event, {
+ handle: this.handles[ index ],
+ value: newVal
+ } );
+ if ( allowed !== false ) {
+ this.value( newVal );
+ }
+ }
+ }
+ },
+
+ _stop: function( event, index ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+
+ this._trigger( "stop", event, uiHash );
+ },
+
+ _change: function( event, index ) {
+ if ( !this._keySliding && !this._mouseSliding ) {
+ var uiHash = {
+ handle: this.handles[ index ],
+ value: this.value()
+ };
+ if ( this.options.values && this.options.values.length ) {
+ uiHash.value = this.values( index );
+ uiHash.values = this.values();
+ }
+
+ this._trigger( "change", event, uiHash );
+ }
+ },
+
+ value: function( newValue ) {
+ if ( arguments.length ) {
+ this.options.value = this._trimAlignValue( newValue );
+ this._refreshValue();
+ this._change( null, 0 );
+ }
+
+ return this._value();
+ },
+
+ values: function( index, newValue ) {
+ var vals,
+ newValues,
+ i;
+
+ if ( arguments.length > 1 ) {
+ this.options.values[ index ] = this._trimAlignValue( newValue );
+ this._refreshValue();
+ this._change( null, index );
+ }
+
+ if ( arguments.length ) {
+ if ( $.isArray( arguments[ 0 ] ) ) {
+ vals = this.options.values;
+ newValues = arguments[ 0 ];
+ for ( i = 0; i < vals.length; i += 1 ) {
+ vals[ i ] = this._trimAlignValue( newValues[ i ] );
+ this._change( null, i );
+ }
+ this._refreshValue();
+ } else {
+ if ( this.options.values && this.options.values.length ) {
+ return this._values( index );
+ } else {
+ return this.value();
+ }
+ }
+ } else {
+ return this._values();
+ }
+ },
+
+ _setOption: function( key, value ) {
+ var i,
+ valsLength = 0;
+
+ if ( $.isArray( this.options.values ) ) {
+ valsLength = this.options.values.length;
+ }
+
+ $.Widget.prototype._setOption.apply( this, arguments );
+
+ switch ( key ) {
+ case "disabled":
+ if ( value ) {
+ this.handles.filter( ".ui-state-focus" ).blur();
+ this.handles.removeClass( "ui-state-hover" );
+ this.handles.attr( "disabled", "disabled" );
+ this.element.addClass( "ui-disabled" );
+ } else {
+ this.handles.removeAttr( "disabled" );
+ this.element.removeClass( "ui-disabled" );
+ }
+ break;
+ case "orientation":
+ this._detectOrientation();
+ this.element
+ .removeClass( "ui-slider-horizontal ui-slider-vertical" )
+ .addClass( "ui-slider-" + this.orientation );
+ this._refreshValue();
+ break;
+ case "value":
+ this._animateOff = true;
+ this._refreshValue();
+ this._change( null, 0 );
+ this._animateOff = false;
+ break;
+ case "values":
+ this._animateOff = true;
+ this._refreshValue();
+ for ( i = 0; i < valsLength; i += 1 ) {
+ this._change( null, i );
+ }
+ this._animateOff = false;
+ break;
+ }
+ },
+
+ //internal value getter
+ // _value() returns value trimmed by min and max, aligned by step
+ _value: function() {
+ var val = this.options.value;
+ val = this._trimAlignValue( val );
+
+ return val;
+ },
+
+ //internal values getter
+ // _values() returns array of values trimmed by min and max, aligned by step
+ // _values( index ) returns single value trimmed by min and max, aligned by step
+ _values: function( index ) {
+ var val,
+ vals,
+ i;
+
+ if ( arguments.length ) {
+ val = this.options.values[ index ];
+ val = this._trimAlignValue( val );
+
+ return val;
+ } else {
+ // .slice() creates a copy of the array
+ // this copy gets trimmed by min and max and then returned
+ vals = this.options.values.slice();
+ for ( i = 0; i < vals.length; i+= 1) {
+ vals[ i ] = this._trimAlignValue( vals[ i ] );
+ }
+
+ return vals;
+ }
+ },
+
+ // returns the step-aligned value that val is closest to, between (inclusive) min and max
+ _trimAlignValue: function( val ) {
+ if ( val < this._valueMin() ) {
+ return this._valueMin();
+ }
+ if ( val > this._valueMax() ) {
+ return this._valueMax();
+ }
+ var step = this.options.step,
+ valModStep = val % step,
+ alignValue = val - valModStep;
+
+ if ( valModStep >= ( step / 2 ) ) {
+ alignValue += step;
+ }
+
+ // Since JavaScript has problems with large floats, round
+ // the final value to 5 digits after the decimal point (see #4124)
+ return parseFloat( alignValue.toFixed(5) );
+ },
+
+ _valueMin: function() {
+ return this.options.min;
+ },
+
+ _valueMax: function() {
+ return this.options.max;
+ },
+
+ _refreshValue: function() {
+ var oRange = this.options.range,
+ o = this.options,
+ self = this,
+ animate = ( !this._animateOff ) ? o.animate : false,
+ valPercent,
+ _set = {},
+ lastValPercent,
+ value,
+ valueMin,
+ valueMax;
+
+ if ( this.options.values && this.options.values.length ) {
+ this.handles.each(function( i, j ) {
+ valPercent = ( self.values(i) - self._valueMin() ) / ( self._valueMax() - self._valueMin() ) * 100;
+ _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+ if ( self.options.range === true ) {
+ if ( self.orientation === "horizontal" ) {
+ if ( i === 0 ) {
+ self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate );
+ }
+ if ( i === 1 ) {
+ self.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ } else {
+ if ( i === 0 ) {
+ self.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate );
+ }
+ if ( i === 1 ) {
+ self.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ }
+ }
+ lastValPercent = valPercent;
+ });
+ } else {
+ value = this.value();
+ valueMin = this._valueMin();
+ valueMax = this._valueMax();
+ valPercent = ( valueMax !== valueMin ) ?
+ ( value - valueMin ) / ( valueMax - valueMin ) * 100 :
+ 0;
+ _set[ self.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+ this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+
+ if ( oRange === "min" && this.orientation === "horizontal" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "horizontal" ) {
+ this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ if ( oRange === "min" && this.orientation === "vertical" ) {
+ this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate );
+ }
+ if ( oRange === "max" && this.orientation === "vertical" ) {
+ this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } );
+ }
+ }
+ }
+
+});
+
+$.extend( $.ui.slider, {
+ version: "1.8.1"
+});
+
+}(jQuery));
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.sortable.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,1067 @@
+/*
+ * jQuery UI Sortable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+$.widget("ui.sortable", $.ui.mouse, {
+ widgetEventPrefix: "sort",
+ options: {
+ appendTo: "parent",
+ axis: false,
+ connectWith: false,
+ containment: false,
+ cursor: 'auto',
+ cursorAt: false,
+ dropOnEmpty: true,
+ forcePlaceholderSize: false,
+ forceHelperSize: false,
+ grid: false,
+ handle: false,
+ helper: "original",
+ items: '> *',
+ opacity: false,
+ placeholder: false,
+ revert: false,
+ scroll: true,
+ scrollSensitivity: 20,
+ scrollSpeed: 20,
+ scope: "default",
+ tolerance: "intersect",
+ zIndex: 1000
+ },
+ _create: function() {
+
+ var o = this.options;
+ this.containerCache = {};
+ this.element.addClass("ui-sortable");
+
+ //Get the items
+ this.refresh();
+
+ //Let's determine if the items are floating
+ this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false;
+
+ //Let's determine the parent's offset
+ this.offset = this.element.offset();
+
+ //Initialize mouse events for interaction
+ this._mouseInit();
+
+ },
+
+ destroy: function() {
+ this.element
+ .removeClass("ui-sortable ui-sortable-disabled")
+ .removeData("sortable")
+ .unbind(".sortable");
+ this._mouseDestroy();
+
+ for ( var i = this.items.length - 1; i >= 0; i-- )
+ this.items[i].item.removeData("sortable-item");
+
+ return this;
+ },
+
+ _setOption: function(key, value){
+ if ( key === "disabled" ) {
+ this.options[ key ] = value;
+
+ this.widget()
+ [ value ? "addClass" : "removeClass"]( "ui-sortable-disabled" );
+ } else {
+ // Don't call widget base _setOption for disable as it adds ui-state-disabled class
+ $.Widget.prototype._setOption.apply(self, arguments);
+ }
+ },
+
+ _mouseCapture: function(event, overrideHandle) {
+
+ if (this.reverting) {
+ return false;
+ }
+
+ if(this.options.disabled || this.options.type == 'static') return false;
+
+ //We have to refresh the items data once first
+ this._refreshItems(event);
+
+ //Find out if the clicked node (or one of its parents) is a actual item in this.items
+ var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
+ if($.data(this, 'sortable-item') == self) {
+ currentItem = $(this);
+ return false;
+ }
+ });
+ if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
+
+ if(!currentItem) return false;
+ if(this.options.handle && !overrideHandle) {
+ var validHandle = false;
+
+ $(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
+ if(!validHandle) return false;
+ }
+
+ this.currentItem = currentItem;
+ this._removeCurrentsFromItems();
+ return true;
+
+ },
+
+ _mouseStart: function(event, overrideHandle, noActivation) {
+
+ var o = this.options, self = this;
+ this.currentContainer = this;
+
+ //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
+ this.refreshPositions();
+
+ //Create and append the visible helper
+ this.helper = this._createHelper(event);
+
+ //Cache the helper size
+ this._cacheHelperProportions();
+
+ /*
+ * - Position generation -
+ * This block generates everything position related - it's the core of draggables.
+ */
+
+ //Cache the margins of the original element
+ this._cacheMargins();
+
+ //Get the next scrolling parent
+ this.scrollParent = this.helper.scrollParent();
+
+ //The element's absolute position on the page minus margins
+ this.offset = this.currentItem.offset();
+ this.offset = {
+ top: this.offset.top - this.margins.top,
+ left: this.offset.left - this.margins.left
+ };
+
+ // Only after we got the offset, we can change the helper's position to absolute
+ // TODO: Still need to figure out a way to make relative sorting possible
+ this.helper.css("position", "absolute");
+ this.cssPosition = this.helper.css("position");
+
+ $.extend(this.offset, {
+ click: { //Where the click happened, relative to the element
+ left: event.pageX - this.offset.left,
+ top: event.pageY - this.offset.top
+ },
+ parent: this._getParentOffset(),
+ relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+ });
+
+ //Generate the original position
+ this.originalPosition = this._generatePosition(event);
+ this.originalPageX = event.pageX;
+ this.originalPageY = event.pageY;
+
+ //Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+ (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+ //Cache the former DOM position
+ this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
+
+ //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
+ if(this.helper[0] != this.currentItem[0]) {
+ this.currentItem.hide();
+ }
+
+ //Create the placeholder
+ this._createPlaceholder();
+
+ //Set a containment if given in the options
+ if(o.containment)
+ this._setContainment();
+
+ if(o.cursor) { // cursor option
+ if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
+ $('body').css("cursor", o.cursor);
+ }
+
+ if(o.opacity) { // opacity option
+ if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
+ this.helper.css("opacity", o.opacity);
+ }
+
+ if(o.zIndex) { // zIndex option
+ if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
+ this.helper.css("zIndex", o.zIndex);
+ }
+
+ //Prepare scrolling
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
+ this.overflowOffset = this.scrollParent.offset();
+
+ //Call callbacks
+ this._trigger("start", event, this._uiHash());
+
+ //Recache the helper size
+ if(!this._preserveHelperProportions)
+ this._cacheHelperProportions();
+
+
+ //Post 'activate' events to possible containers
+ if(!noActivation) {
+ for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
+ }
+
+ //Prepare possible droppables
+ if($.ui.ddmanager)
+ $.ui.ddmanager.current = this;
+
+ if ($.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+
+ this.dragging = true;
+
+ this.helper.addClass("ui-sortable-helper");
+ this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+ return true;
+
+ },
+
+ _mouseDrag: function(event) {
+
+ //Compute the helpers position
+ this.position = this._generatePosition(event);
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ if (!this.lastPositionAbs) {
+ this.lastPositionAbs = this.positionAbs;
+ }
+
+ //Do scrolling
+ if(this.options.scroll) {
+ var o = this.options, scrolled = false;
+ if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
+
+ if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
+ else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
+ this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
+
+ if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
+ else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
+ this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+
+ } else {
+
+ if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+ else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+ scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+
+ if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+ else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+ scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+
+ }
+
+ if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+ $.ui.ddmanager.prepareOffsets(this, event);
+ }
+
+ //Regenerate the absolute position used for position checks
+ this.positionAbs = this._convertPositionTo("absolute");
+
+ //Set the helper position
+ if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+ if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+
+ //Rearrange
+ for (var i = this.items.length - 1; i >= 0; i--) {
+
+ //Cache variables and intersection, continue if no intersection
+ var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
+ if (!intersection) continue;
+
+ if(itemElement != this.currentItem[0] //cannot intersect with itself
+ && this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
+ && !$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
+ && (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
+ //&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
+ ) {
+
+ this.direction = intersection == 1 ? "down" : "up";
+
+ if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
+ this._rearrange(event, item);
+ } else {
+ break;
+ }
+
+ this._trigger("change", event, this._uiHash());
+ break;
+ }
+ }
+
+ //Post events to containers
+ this._contactContainers(event);
+
+ //Interconnect with droppables
+ if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+ //Call callbacks
+ this._trigger('sort', event, this._uiHash());
+
+ this.lastPositionAbs = this.positionAbs;
+ return false;
+
+ },
+
+ _mouseStop: function(event, noPropagation) {
+
+ if(!event) return;
+
+ //If we are using droppables, inform the manager about the drop
+ if ($.ui.ddmanager && !this.options.dropBehaviour)
+ $.ui.ddmanager.drop(this, event);
+
+ if(this.options.revert) {
+ var self = this;
+ var cur = self.placeholder.offset();
+
+ self.reverting = true;
+
+ $(this.helper).animate({
+ left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
+ top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
+ }, parseInt(this.options.revert, 10) || 500, function() {
+ self._clear(event);
+ });
+ } else {
+ this._clear(event, noPropagation);
+ }
+
+ return false;
+
+ },
+
+ cancel: function() {
+
+ var self = this;
+
+ if(this.dragging) {
+
+ this._mouseUp();
+
+ if(this.options.helper == "original")
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ else
+ this.currentItem.show();
+
+ //Post deactivating events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ this.containers[i]._trigger("deactivate", null, self._uiHash(this));
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", null, self._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+ if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
+
+ $.extend(this, {
+ helper: null,
+ dragging: false,
+ reverting: false,
+ _noFinalSort: null
+ });
+
+ if(this.domPosition.prev) {
+ $(this.domPosition.prev).after(this.currentItem);
+ } else {
+ $(this.domPosition.parent).prepend(this.currentItem);
+ }
+
+ return this;
+
+ },
+
+ serialize: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var str = []; o = o || {};
+
+ $(items).each(function() {
+ var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
+ if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
+ });
+
+ return str.join('&');
+
+ },
+
+ toArray: function(o) {
+
+ var items = this._getItemsAsjQuery(o && o.connected);
+ var ret = []; o = o || {};
+
+ items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
+ return ret;
+
+ },
+
+ /* Be careful with the following core functions */
+ _intersectsWith: function(item) {
+
+ var x1 = this.positionAbs.left,
+ x2 = x1 + this.helperProportions.width,
+ y1 = this.positionAbs.top,
+ y2 = y1 + this.helperProportions.height;
+
+ var l = item.left,
+ r = l + item.width,
+ t = item.top,
+ b = t + item.height;
+
+ var dyClick = this.offset.click.top,
+ dxClick = this.offset.click.left;
+
+ var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
+
+ if( this.options.tolerance == "pointer"
+ || this.options.forcePointerForContainers
+ || (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
+ ) {
+ return isOverElement;
+ } else {
+
+ return (l < x1 + (this.helperProportions.width / 2) // Right Half
+ && x2 - (this.helperProportions.width / 2) < r // Left Half
+ && t < y1 + (this.helperProportions.height / 2) // Bottom Half
+ && y2 - (this.helperProportions.height / 2) < b ); // Top Half
+
+ }
+ },
+
+ _intersectsWithPointer: function(item) {
+
+ var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+ isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+ isOverElement = isOverElementHeight && isOverElementWidth,
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (!isOverElement)
+ return false;
+
+ return this.floating ?
+ ( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
+ : ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
+
+ },
+
+ _intersectsWithSides: function(item) {
+
+ var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
+ isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
+ verticalDirection = this._getDragVerticalDirection(),
+ horizontalDirection = this._getDragHorizontalDirection();
+
+ if (this.floating && horizontalDirection) {
+ return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
+ } else {
+ return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
+ }
+
+ },
+
+ _getDragVerticalDirection: function() {
+ var delta = this.positionAbs.top - this.lastPositionAbs.top;
+ return delta != 0 && (delta > 0 ? "down" : "up");
+ },
+
+ _getDragHorizontalDirection: function() {
+ var delta = this.positionAbs.left - this.lastPositionAbs.left;
+ return delta != 0 && (delta > 0 ? "right" : "left");
+ },
+
+ refresh: function(event) {
+ this._refreshItems(event);
+ this.refreshPositions();
+ return this;
+ },
+
+ _connectWith: function() {
+ var options = this.options;
+ return options.connectWith.constructor == String
+ ? [options.connectWith]
+ : options.connectWith;
+ },
+
+ _getItemsAsjQuery: function(connected) {
+
+ var self = this;
+ var items = [];
+ var queries = [];
+ var connectWith = this._connectWith();
+
+ if(connectWith && connected) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
+ }
+ };
+ };
+ }
+
+ queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]);
+
+ for (var i = queries.length - 1; i >= 0; i--){
+ queries[i][0].each(function() {
+ items.push(this);
+ });
+ };
+
+ return $(items);
+
+ },
+
+ _removeCurrentsFromItems: function() {
+
+ var list = this.currentItem.find(":data(sortable-item)");
+
+ for (var i=0; i < this.items.length; i++) {
+
+ for (var j=0; j < list.length; j++) {
+ if(list[j] == this.items[i].item[0])
+ this.items.splice(i,1);
+ };
+
+ };
+
+ },
+
+ _refreshItems: function(event) {
+
+ this.items = [];
+ this.containers = [this];
+ var items = this.items;
+ var self = this;
+ var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
+ var connectWith = this._connectWith();
+
+ if(connectWith) {
+ for (var i = connectWith.length - 1; i >= 0; i--){
+ var cur = $(connectWith[i]);
+ for (var j = cur.length - 1; j >= 0; j--){
+ var inst = $.data(cur[j], 'sortable');
+ if(inst && inst != this && !inst.options.disabled) {
+ queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
+ this.containers.push(inst);
+ }
+ };
+ };
+ }
+
+ for (var i = queries.length - 1; i >= 0; i--) {
+ var targetData = queries[i][1];
+ var _queries = queries[i][0];
+
+ for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
+ var item = $(_queries[j]);
+
+ item.data('sortable-item', targetData); // Data for target checking (mouse manager)
+
+ items.push({
+ item: item,
+ instance: targetData,
+ width: 0, height: 0,
+ left: 0, top: 0
+ });
+ };
+ };
+
+ },
+
+ refreshPositions: function(fast) {
+
+ //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
+ if(this.offsetParent && this.helper) {
+ this.offset.parent = this._getParentOffset();
+ }
+
+ for (var i = this.items.length - 1; i >= 0; i--){
+ var item = this.items[i];
+
+ var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+
+ if (!fast) {
+ item.width = t.outerWidth();
+ item.height = t.outerHeight();
+ }
+
+ var p = t.offset();
+ item.left = p.left;
+ item.top = p.top;
+ };
+
+ if(this.options.custom && this.options.custom.refreshContainers) {
+ this.options.custom.refreshContainers.call(this);
+ } else {
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ var p = this.containers[i].element.offset();
+ this.containers[i].containerCache.left = p.left;
+ this.containers[i].containerCache.top = p.top;
+ this.containers[i].containerCache.width = this.containers[i].element.outerWidth();
+ this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+ };
+ }
+
+ return this;
+ },
+
+ _createPlaceholder: function(that) {
+
+ var self = that || this, o = self.options;
+
+ if(!o.placeholder || o.placeholder.constructor == String) {
+ var className = o.placeholder;
+ o.placeholder = {
+ element: function() {
+
+ var el = $(document.createElement(self.currentItem[0].nodeName))
+ .addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
+ .removeClass("ui-sortable-helper")[0];
+
+ if(!className)
+ el.style.visibility = "hidden";
+
+ return el;
+ },
+ update: function(container, p) {
+
+ // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
+ // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
+ if(className && !o.forcePlaceholderSize) return;
+
+ //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
+ if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
+ if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
+ }
+ };
+ }
+
+ //Create the placeholder
+ self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
+
+ //Append it after the actual current item
+ self.currentItem.after(self.placeholder);
+
+ //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+ o.placeholder.update(self, self.placeholder);
+
+ },
+
+ _contactContainers: function(event) {
+
+ // get innermost container that intersects with item
+ var innermostContainer = null, innermostIndex = null;
+
+
+ for (var i = this.containers.length - 1; i >= 0; i--){
+
+ // never consider a container that's located within the item itself
+ if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
+ continue;
+
+ if(this._intersectsWith(this.containers[i].containerCache)) {
+
+ // if we've already found a container and it's more "inner" than this, then continue
+ if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
+ continue;
+
+ innermostContainer = this.containers[i];
+ innermostIndex = i;
+
+ } else {
+ // container doesn't intersect. trigger "out" event if necessary
+ if(this.containers[i].containerCache.over) {
+ this.containers[i]._trigger("out", event, this._uiHash(this));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ }
+
+ // if no intersecting containers found, return
+ if(!innermostContainer) return;
+
+ // move the item into the container if it's not there already
+ if(this.containers.length === 1) {
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ } else if(this.currentContainer != this.containers[innermostIndex]) {
+
+ //When entering a new container, we will find the item with the least distance and append our item near it
+ var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top'];
+ for (var j = this.items.length - 1; j >= 0; j--) {
+ if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue;
+ var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top'];
+ if(Math.abs(cur - base) < dist) {
+ dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j];
+ }
+ }
+
+ if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled
+ return;
+
+ this.currentContainer = this.containers[innermostIndex];
+ itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true);
+ this._trigger("change", event, this._uiHash());
+ this.containers[innermostIndex]._trigger("change", event, this._uiHash(this));
+
+ //Update the placeholder
+ this.options.placeholder.update(this.currentContainer, this.placeholder);
+
+ this.containers[innermostIndex]._trigger("over", event, this._uiHash(this));
+ this.containers[innermostIndex].containerCache.over = 1;
+ }
+
+
+ },
+
+ _createHelper: function(event) {
+
+ var o = this.options;
+ var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
+
+ if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
+ $(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+
+ if(helper[0] == this.currentItem[0])
+ this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
+
+ if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
+ if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
+
+ return helper;
+
+ },
+
+ _adjustOffsetFromHelper: function(obj) {
+ if (typeof obj == 'string') {
+ obj = obj.split(' ');
+ }
+ if ($.isArray(obj)) {
+ obj = {left: +obj[0], top: +obj[1] || 0};
+ }
+ if ('left' in obj) {
+ this.offset.click.left = obj.left + this.margins.left;
+ }
+ if ('right' in obj) {
+ this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+ }
+ if ('top' in obj) {
+ this.offset.click.top = obj.top + this.margins.top;
+ }
+ if ('bottom' in obj) {
+ this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+ }
+ },
+
+ _getParentOffset: function() {
+
+
+ //Get the offsetParent and cache its position
+ this.offsetParent = this.helper.offsetParent();
+ var po = this.offsetParent.offset();
+
+ // This is a special case where we need to modify a offset calculated on start, since the following happened:
+ // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+ // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+ // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+ if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+ po.left += this.scrollParent.scrollLeft();
+ po.top += this.scrollParent.scrollTop();
+ }
+
+ if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+ || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+ po = { top: 0, left: 0 };
+
+ return {
+ top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+ left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+ };
+
+ },
+
+ _getRelativeOffset: function() {
+
+ if(this.cssPosition == "relative") {
+ var p = this.currentItem.position();
+ return {
+ top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+ left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+ };
+ } else {
+ return { top: 0, left: 0 };
+ }
+
+ },
+
+ _cacheMargins: function() {
+ this.margins = {
+ left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
+ top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
+ };
+ },
+
+ _cacheHelperProportions: function() {
+ this.helperProportions = {
+ width: this.helper.outerWidth(),
+ height: this.helper.outerHeight()
+ };
+ },
+
+ _setContainment: function() {
+
+ var o = this.options;
+ if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+ if(o.containment == 'document' || o.containment == 'window') this.containment = [
+ 0 - this.offset.relative.left - this.offset.parent.left,
+ 0 - this.offset.relative.top - this.offset.parent.top,
+ $(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+ ($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+ ];
+
+ if(!(/^(document|window|parent)$/).test(o.containment)) {
+ var ce = $(o.containment)[0];
+ var co = $(o.containment).offset();
+ var over = ($(ce).css("overflow") != 'hidden');
+
+ this.containment = [
+ co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+ co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+ co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+ co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+ ];
+ }
+
+ },
+
+ _convertPositionTo: function(d, pos) {
+
+ if(!pos) pos = this.position;
+ var mod = d == "absolute" ? 1 : -1;
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ return {
+ top: (
+ pos.top // The absolute mouse position
+ + this.offset.relative.top * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.top * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+ ),
+ left: (
+ pos.left // The absolute mouse position
+ + this.offset.relative.left * mod // Only for relative positioned nodes: Relative offset from element to offset parent
+ + this.offset.parent.left * mod // The offsetParent's offset without borders (offset + border)
+ - ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+ )
+ };
+
+ },
+
+ _generatePosition: function(event) {
+
+ var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+ // This is another very weird special case that only happens for relative elements:
+ // 1. If the css position is relative
+ // 2. and the scroll parent is the document or similar to the offset parent
+ // we have to refresh the relative offset during the scroll so there are no jumps
+ if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+ this.offset.relative = this._getRelativeOffset();
+ }
+
+ var pageX = event.pageX;
+ var pageY = event.pageY;
+
+ /*
+ * - Position constraining -
+ * Constrain the position to a mix of grid, containment.
+ */
+
+ if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+ if(this.containment) {
+ if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+ if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+ if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+ }
+
+ if(o.grid) {
+ var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+ pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+ var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+ pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+ }
+
+ }
+
+ return {
+ top: (
+ pageY // The absolute mouse position
+ - this.offset.click.top // Click offset (relative to the element)
+ - this.offset.relative.top // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.top // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+ ),
+ left: (
+ pageX // The absolute mouse position
+ - this.offset.click.left // Click offset (relative to the element)
+ - this.offset.relative.left // Only for relative positioned nodes: Relative offset from element to offset parent
+ - this.offset.parent.left // The offsetParent's offset without borders (offset + border)
+ + ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+ )
+ };
+
+ },
+
+ _rearrange: function(event, i, a, hardRefresh) {
+
+ a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
+
+ //Various things done here to improve the performance:
+ // 1. we create a setTimeout, that calls refreshPositions
+ // 2. on the instance, we have a counter variable, that get's higher after every append
+ // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
+ // 4. this lets only the last addition to the timeout stack through
+ this.counter = this.counter ? ++this.counter : 1;
+ var self = this, counter = this.counter;
+
+ window.setTimeout(function() {
+ if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+ },0);
+
+ },
+
+ _clear: function(event, noPropagation) {
+
+ this.reverting = false;
+ // We delay all events that have to be triggered to after the point where the placeholder has been removed and
+ // everything else normalized again
+ var delayedTriggers = [], self = this;
+
+ // We first have to update the dom position of the actual currentItem
+ // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
+ if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem);
+ this._noFinalSort = null;
+
+ if(this.helper[0] == this.currentItem[0]) {
+ for(var i in this._storedCSS) {
+ if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
+ }
+ this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+ } else {
+ this.currentItem.show();
+ }
+
+ if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
+ if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
+ if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
+ if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ }
+ };
+ };
+
+ //Post events to containers
+ for (var i = this.containers.length - 1; i >= 0; i--){
+ if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ if(this.containers[i].containerCache.over) {
+ delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i]));
+ this.containers[i].containerCache.over = 0;
+ }
+ }
+
+ //Do what was originally in plugins
+ if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
+ if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity
+ if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
+
+ this.dragging = false;
+ if(this.cancelHelperRemoval) {
+ if(!noPropagation) {
+ this._trigger("beforeStop", event, this._uiHash());
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+ return false;
+ }
+
+ if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
+
+ //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+ this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+
+ if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
+
+ if(!noPropagation) {
+ for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+ this._trigger("stop", event, this._uiHash());
+ }
+
+ this.fromOutside = false;
+ return true;
+
+ },
+
+ _trigger: function() {
+ if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
+ this.cancel();
+ }
+ },
+
+ _uiHash: function(inst) {
+ var self = inst || this;
+ return {
+ helper: self.helper,
+ placeholder: self.placeholder || $([]),
+ position: self.position,
+ originalPosition: self.originalPosition,
+ offset: self.positionAbs,
+ item: self.currentItem,
+ sender: inst ? inst.element : null
+ };
+ }
+
+});
+
+$.extend($.ui.sortable, {
+ version: "1.8.1"
+});
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.tabs.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,721 @@
+/*
+ * jQuery UI Tabs 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function($) {
+
+var tabId = 0,
+ listId = 0;
+
+$.widget("ui.tabs", {
+ options: {
+ add: null,
+ ajaxOptions: null,
+ cache: false,
+ cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+ collapsible: false,
+ disable: null,
+ disabled: [],
+ enable: null,
+ event: 'click',
+ fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
+ idPrefix: 'ui-tabs-',
+ load: null,
+ panelTemplate: '<div></div>',
+ remove: null,
+ select: null,
+ show: null,
+ spinner: '<em>Loading…</em>',
+ tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
+ },
+ _create: function() {
+ this._tabify(true);
+ },
+
+ _setOption: function(key, value) {
+ if (key == 'selected') {
+ if (this.options.collapsible && value == this.options.selected) {
+ return;
+ }
+ this.select(value);
+ }
+ else {
+ this.options[key] = value;
+ this._tabify();
+ }
+ },
+
+ _tabId: function(a) {
+ return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') ||
+ this.options.idPrefix + (++tabId);
+ },
+
+ _sanitizeSelector: function(hash) {
+ return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
+ },
+
+ _cookie: function() {
+ var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + (++listId));
+ return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
+ },
+
+ _ui: function(tab, panel) {
+ return {
+ tab: tab,
+ panel: panel,
+ index: this.anchors.index(tab)
+ };
+ },
+
+ _cleanup: function() {
+ // restore all former loading tabs labels
+ this.lis.filter('.ui-state-processing').removeClass('ui-state-processing')
+ .find('span:data(label.tabs)')
+ .each(function() {
+ var el = $(this);
+ el.html(el.data('label.tabs')).removeData('label.tabs');
+ });
+ },
+
+ _tabify: function(init) {
+
+ this.list = this.element.find('ol,ul').eq(0);
+ this.lis = $('li:has(a[href])', this.list);
+ this.anchors = this.lis.map(function() { return $('a', this)[0]; });
+ this.panels = $([]);
+
+ var self = this, o = this.options;
+
+ var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+ this.anchors.each(function(i, a) {
+ var href = $(a).attr('href');
+
+ // For dynamically created HTML that contains a hash as href IE < 8 expands
+ // such href to the full page url with hash and then misinterprets tab as ajax.
+ // Same consideration applies for an added tab with a fragment identifier
+ // since a[href=#fragment-identifier] does unexpectedly not match.
+ // Thus normalize href attribute...
+ var hrefBase = href.split('#')[0], baseEl;
+ if (hrefBase && (hrefBase === location.toString().split('#')[0] ||
+ (baseEl = $('base')[0]) && hrefBase === baseEl.href)) {
+ href = a.hash;
+ a.href = href;
+ }
+
+ // inline tab
+ if (fragmentId.test(href)) {
+ self.panels = self.panels.add(self._sanitizeSelector(href));
+ }
+
+ // remote tab
+ else if (href != '#') { // prevent loading the page itself if href is just "#"
+ $.data(a, 'href.tabs', href); // required for restore on destroy
+
+ // TODO until #3808 is fixed strip fragment identifier from url
+ // (IE fails to load from such url)
+ $.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data
+
+ var id = self._tabId(a);
+ a.href = '#' + id;
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
+ .insertAfter(self.panels[i - 1] || self.list);
+ $panel.data('destroy.tabs', true);
+ }
+ self.panels = self.panels.add($panel);
+ }
+
+ // invalid tab href
+ else {
+ o.disabled.push(i);
+ }
+ });
+
+ // initialization from scratch
+ if (init) {
+
+ // attach necessary classes for styling
+ this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
+ this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+ this.lis.addClass('ui-state-default ui-corner-top');
+ this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');
+
+ // Selected tab
+ // use "selected" option or try to retrieve:
+ // 1. from fragment identifier in url
+ // 2. from cookie
+ // 3. from selected class attribute on <li>
+ if (o.selected === undefined) {
+ if (location.hash) {
+ this.anchors.each(function(i, a) {
+ if (a.hash == location.hash) {
+ o.selected = i;
+ return false; // break
+ }
+ });
+ }
+ if (typeof o.selected != 'number' && o.cookie) {
+ o.selected = parseInt(self._cookie(), 10);
+ }
+ if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) {
+ o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+ }
+ o.selected = o.selected || (this.lis.length ? 0 : -1);
+ }
+ else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release
+ o.selected = -1;
+ }
+
+ // sanity check - default to first tab...
+ o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0;
+
+ // Take disabling tabs via class attribute from HTML
+ // into account and update option properly.
+ // A selected tab cannot become disabled.
+ o.disabled = $.unique(o.disabled.concat(
+ $.map(this.lis.filter('.ui-state-disabled'),
+ function(n, i) { return self.lis.index(n); } )
+ )).sort();
+
+ if ($.inArray(o.selected, o.disabled) != -1) {
+ o.disabled.splice($.inArray(o.selected, o.disabled), 1);
+ }
+
+ // highlight selected tab
+ this.panels.addClass('ui-tabs-hide');
+ this.lis.removeClass('ui-tabs-selected ui-state-active');
+ if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list
+ this.panels.eq(o.selected).removeClass('ui-tabs-hide');
+ this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');
+
+ // seems to be expected behavior that the show callback is fired
+ self.element.queue("tabs", function() {
+ self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected]));
+ });
+
+ this.load(o.selected);
+ }
+
+ // clean up to avoid memory leaks in certain versions of IE 6
+ $(window).bind('unload', function() {
+ self.lis.add(self.anchors).unbind('.tabs');
+ self.lis = self.anchors = self.panels = null;
+ });
+
+ }
+ // update selected after add/remove
+ else {
+ o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+ }
+
+ // update collapsible
+ this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible');
+
+ // set or update cookie after init and add/remove respectively
+ if (o.cookie) {
+ this._cookie(o.selected, o.cookie);
+ }
+
+ // disable tabs
+ for (var i = 0, li; (li = this.lis[i]); i++) {
+ $(li)[$.inArray(i, o.disabled) != -1 &&
+ !$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
+ }
+
+ // reset cache if switching from cached to not cached
+ if (o.cache === false) {
+ this.anchors.removeData('cache.tabs');
+ }
+
+ // remove all handlers before, tabify may run on existing tabs after add or option change
+ this.lis.add(this.anchors).unbind('.tabs');
+
+ if (o.event != 'mouseover') {
+ var addState = function(state, el) {
+ if (el.is(':not(.ui-state-disabled)')) {
+ el.addClass('ui-state-' + state);
+ }
+ };
+ var removeState = function(state, el) {
+ el.removeClass('ui-state-' + state);
+ };
+ this.lis.bind('mouseover.tabs', function() {
+ addState('hover', $(this));
+ });
+ this.lis.bind('mouseout.tabs', function() {
+ removeState('hover', $(this));
+ });
+ this.anchors.bind('focus.tabs', function() {
+ addState('focus', $(this).closest('li'));
+ });
+ this.anchors.bind('blur.tabs', function() {
+ removeState('focus', $(this).closest('li'));
+ });
+ }
+
+ // set up animations
+ var hideFx, showFx;
+ if (o.fx) {
+ if ($.isArray(o.fx)) {
+ hideFx = o.fx[0];
+ showFx = o.fx[1];
+ }
+ else {
+ hideFx = showFx = o.fx;
+ }
+ }
+
+ // Reset certain styles left over from animation
+ // and prevent IE's ClearType bug...
+ function resetStyle($el, fx) {
+ $el.css({ display: '' });
+ if (!$.support.opacity && fx.opacity) {
+ $el[0].style.removeAttribute('filter');
+ }
+ }
+
+ // Show a tab...
+ var showTab = showFx ?
+ function(clicked, $show) {
+ $(clicked).closest('li').addClass('ui-tabs-selected ui-state-active');
+ $show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
+ .animate(showFx, showFx.duration || 'normal', function() {
+ resetStyle($show, showFx);
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ });
+ } :
+ function(clicked, $show) {
+ $(clicked).closest('li').addClass('ui-tabs-selected ui-state-active');
+ $show.removeClass('ui-tabs-hide');
+ self._trigger('show', null, self._ui(clicked, $show[0]));
+ };
+
+ // Hide a tab, $show is optional...
+ var hideTab = hideFx ?
+ function(clicked, $hide) {
+ $hide.animate(hideFx, hideFx.duration || 'normal', function() {
+ self.lis.removeClass('ui-tabs-selected ui-state-active');
+ $hide.addClass('ui-tabs-hide');
+ resetStyle($hide, hideFx);
+ self.element.dequeue("tabs");
+ });
+ } :
+ function(clicked, $hide, $show) {
+ self.lis.removeClass('ui-tabs-selected ui-state-active');
+ $hide.addClass('ui-tabs-hide');
+ self.element.dequeue("tabs");
+ };
+
+ // attach tab event handler, unbind to avoid duplicates from former tabifying...
+ this.anchors.bind(o.event + '.tabs', function() {
+ var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'),
+ $show = $(self._sanitizeSelector(this.hash));
+
+ // If tab is already selected and not collapsible or tab disabled or
+ // or is already loading or click callback returns false stop here.
+ // Check if click handler returns false last so that it is not executed
+ // for a disabled or loading tab!
+ if (($li.hasClass('ui-tabs-selected') && !o.collapsible) ||
+ $li.hasClass('ui-state-disabled') ||
+ $li.hasClass('ui-state-processing') ||
+ self._trigger('select', null, self._ui(this, $show[0])) === false) {
+ this.blur();
+ return false;
+ }
+
+ o.selected = self.anchors.index(this);
+
+ self.abort();
+
+ // if tab may be closed
+ if (o.collapsible) {
+ if ($li.hasClass('ui-tabs-selected')) {
+ o.selected = -1;
+
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ self.element.queue("tabs", function() {
+ hideTab(el, $hide);
+ }).dequeue("tabs");
+
+ this.blur();
+ return false;
+ }
+ else if (!$hide.length) {
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ self.element.queue("tabs", function() {
+ showTab(el, $show);
+ });
+
+ self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
+
+ this.blur();
+ return false;
+ }
+ }
+
+ if (o.cookie) {
+ self._cookie(o.selected, o.cookie);
+ }
+
+ // show new tab
+ if ($show.length) {
+ if ($hide.length) {
+ self.element.queue("tabs", function() {
+ hideTab(el, $hide);
+ });
+ }
+ self.element.queue("tabs", function() {
+ showTab(el, $show);
+ });
+
+ self.load(self.anchors.index(this));
+ }
+ else {
+ throw 'jQuery UI Tabs: Mismatching fragment identifier.';
+ }
+
+ // Prevent IE from keeping other link focussed when using the back button
+ // and remove dotted border from clicked link. This is controlled via CSS
+ // in modern browsers; blur() removes focus from address bar in Firefox
+ // which can become a usability and annoying problem with tabs('rotate').
+ if ($.browser.msie) {
+ this.blur();
+ }
+
+ });
+
+ // disable click in any case
+ this.anchors.bind('click.tabs', function(){return false;});
+
+ },
+
+ destroy: function() {
+ var o = this.options;
+
+ this.abort();
+
+ this.element.unbind('.tabs')
+ .removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible')
+ .removeData('tabs');
+
+ this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+
+ this.anchors.each(function() {
+ var href = $.data(this, 'href.tabs');
+ if (href) {
+ this.href = href;
+ }
+ var $this = $(this).unbind('.tabs');
+ $.each(['href', 'load', 'cache'], function(i, prefix) {
+ $this.removeData(prefix + '.tabs');
+ });
+ });
+
+ this.lis.unbind('.tabs').add(this.panels).each(function() {
+ if ($.data(this, 'destroy.tabs')) {
+ $(this).remove();
+ }
+ else {
+ $(this).removeClass([
+ 'ui-state-default',
+ 'ui-corner-top',
+ 'ui-tabs-selected',
+ 'ui-state-active',
+ 'ui-state-hover',
+ 'ui-state-focus',
+ 'ui-state-disabled',
+ 'ui-tabs-panel',
+ 'ui-widget-content',
+ 'ui-corner-bottom',
+ 'ui-tabs-hide'
+ ].join(' '));
+ }
+ });
+
+ if (o.cookie) {
+ this._cookie(null, o.cookie);
+ }
+
+ return this;
+ },
+
+ add: function(url, label, index) {
+ if (index === undefined) {
+ index = this.anchors.length; // append by default
+ }
+
+ var self = this, o = this.options,
+ $li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)),
+ id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]);
+
+ $li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);
+
+ // try to find an existing element before creating a new one
+ var $panel = $('#' + id);
+ if (!$panel.length) {
+ $panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
+ }
+ $panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');
+
+ if (index >= this.lis.length) {
+ $li.appendTo(this.list);
+ $panel.appendTo(this.list[0].parentNode);
+ }
+ else {
+ $li.insertBefore(this.lis[index]);
+ $panel.insertBefore(this.panels[index]);
+ }
+
+ o.disabled = $.map(o.disabled,
+ function(n, i) { return n >= index ? ++n : n; });
+
+ this._tabify();
+
+ if (this.anchors.length == 1) { // after tabify
+ o.selected = 0;
+ $li.addClass('ui-tabs-selected ui-state-active');
+ $panel.removeClass('ui-tabs-hide');
+ this.element.queue("tabs", function() {
+ self._trigger('show', null, self._ui(self.anchors[0], self.panels[0]));
+ });
+
+ this.load(0);
+ }
+
+ // callback
+ this._trigger('add', null, this._ui(this.anchors[index], this.panels[index]));
+ return this;
+ },
+
+ remove: function(index) {
+ var o = this.options, $li = this.lis.eq(index).remove(),
+ $panel = this.panels.eq(index).remove();
+
+ // If selected tab was removed focus tab to the right or
+ // in case the last tab was removed the tab to the left.
+ if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) {
+ this.select(index + (index + 1 < this.anchors.length ? 1 : -1));
+ }
+
+ o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
+ function(n, i) { return n >= index ? --n : n; });
+
+ this._tabify();
+
+ // callback
+ this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
+ return this;
+ },
+
+ enable: function(index) {
+ var o = this.options;
+ if ($.inArray(index, o.disabled) == -1) {
+ return;
+ }
+
+ this.lis.eq(index).removeClass('ui-state-disabled');
+ o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });
+
+ // callback
+ this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index]));
+ return this;
+ },
+
+ disable: function(index) {
+ var self = this, o = this.options;
+ if (index != o.selected) { // cannot disable already selected tab
+ this.lis.eq(index).addClass('ui-state-disabled');
+
+ o.disabled.push(index);
+ o.disabled.sort();
+
+ // callback
+ this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index]));
+ }
+
+ return this;
+ },
+
+ select: function(index) {
+ if (typeof index == 'string') {
+ index = this.anchors.index(this.anchors.filter('[href$=' + index + ']'));
+ }
+ else if (index === null) { // usage of null is deprecated, TODO remove in next release
+ index = -1;
+ }
+ if (index == -1 && this.options.collapsible) {
+ index = this.options.selected;
+ }
+
+ this.anchors.eq(index).trigger(this.options.event + '.tabs');
+ return this;
+ },
+
+ load: function(index) {
+ var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs');
+
+ this.abort();
+
+ // not remote or from cache
+ if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) {
+ this.element.dequeue("tabs");
+ return;
+ }
+
+ // load remote from here on
+ this.lis.eq(index).addClass('ui-state-processing');
+
+ if (o.spinner) {
+ var span = $('span', a);
+ span.data('label.tabs', span.html()).html(o.spinner);
+ }
+
+ this.xhr = $.ajax($.extend({}, o.ajaxOptions, {
+ url: url,
+ success: function(r, s) {
+ $(self._sanitizeSelector(a.hash)).html(r);
+
+ // take care of tab labels
+ self._cleanup();
+
+ if (o.cache) {
+ $.data(a, 'cache.tabs', true); // if loaded once do not load them again
+ }
+
+ // callbacks
+ self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
+ try {
+ o.ajaxOptions.success(r, s);
+ }
+ catch (e) {}
+ },
+ error: function(xhr, s, e) {
+ // take care of tab labels
+ self._cleanup();
+
+ // callbacks
+ self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
+ try {
+ // Passing index avoid a race condition when this method is
+ // called after the user has selected another tab.
+ // Pass the anchor that initiated this request allows
+ // loadError to manipulate the tab content panel via $(a.hash)
+ o.ajaxOptions.error(xhr, s, index, a);
+ }
+ catch (e) {}
+ }
+ }));
+
+ // last, so that load event is fired before show...
+ self.element.dequeue("tabs");
+
+ return this;
+ },
+
+ abort: function() {
+ // stop possibly running animations
+ this.element.queue([]);
+ this.panels.stop(false, true);
+
+ // "tabs" queue must not contain more than two elements,
+ // which are the callbacks for the latest clicked tab...
+ this.element.queue("tabs", this.element.queue("tabs").splice(-2, 2));
+
+ // terminate pending requests from other tabs
+ if (this.xhr) {
+ this.xhr.abort();
+ delete this.xhr;
+ }
+
+ // take care of tab labels
+ this._cleanup();
+ return this;
+ },
+
+ url: function(index, url) {
+ this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url);
+ return this;
+ },
+
+ length: function() {
+ return this.anchors.length;
+ }
+
+});
+
+$.extend($.ui.tabs, {
+ version: '1.8.1'
+});
+
+/*
+ * Tabs Extensions
+ */
+
+/*
+ * Rotate
+ */
+$.extend($.ui.tabs.prototype, {
+ rotation: null,
+ rotate: function(ms, continuing) {
+
+ var self = this, o = this.options;
+
+ var rotate = self._rotate || (self._rotate = function(e) {
+ clearTimeout(self.rotation);
+ self.rotation = setTimeout(function() {
+ var t = o.selected;
+ self.select( ++t < self.anchors.length ? t : 0 );
+ }, ms);
+
+ if (e) {
+ e.stopPropagation();
+ }
+ });
+
+ var stop = self._unrotate || (self._unrotate = !continuing ?
+ function(e) {
+ if (e.clientX) { // in case of a true click
+ self.rotate(null);
+ }
+ } :
+ function(e) {
+ t = o.selected;
+ rotate();
+ });
+
+ // start rotation
+ if (ms) {
+ this.element.bind('tabsshow', rotate);
+ this.anchors.bind(o.event + '.tabs', stop);
+ rotate();
+ }
+ // stop rotation
+ else {
+ clearTimeout(self.rotation);
+ this.element.unbind('tabsshow', rotate);
+ this.anchors.unbind(o.event + '.tabs', stop);
+ delete this._rotate;
+ delete this._unrotate;
+ }
+
+ return this;
+ }
+});
+
+})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/jquery.ui.widget.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,236 @@
+/*!
+ * jQuery UI Widget 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function( $ ) {
+
+var _remove = $.fn.remove;
+
+$.fn.remove = function( selector, keepData ) {
+ return this.each(function() {
+ if ( !keepData ) {
+ if ( !selector || $.filter( selector, [ this ] ).length ) {
+ $( "*", this ).add( this ).each(function() {
+ $( this ).triggerHandler( "remove" );
+ });
+ }
+ }
+ return _remove.call( $(this), selector, keepData );
+ });
+};
+
+$.widget = function( name, base, prototype ) {
+ var namespace = name.split( "." )[ 0 ],
+ fullName;
+ name = name.split( "." )[ 1 ];
+ fullName = namespace + "-" + name;
+
+ if ( !prototype ) {
+ prototype = base;
+ base = $.Widget;
+ }
+
+ // create selector for plugin
+ $.expr[ ":" ][ fullName ] = function( elem ) {
+ return !!$.data( elem, name );
+ };
+
+ $[ namespace ] = $[ namespace ] || {};
+ $[ namespace ][ name ] = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+ };
+
+ var basePrototype = new base();
+ // we need to make the options hash a property directly on the new instance
+ // otherwise we'll modify the options hash on the prototype that we're
+ // inheriting from
+// $.each( basePrototype, function( key, val ) {
+// if ( $.isPlainObject(val) ) {
+// basePrototype[ key ] = $.extend( {}, val );
+// }
+// });
+ basePrototype.options = $.extend( {}, basePrototype.options );
+ $[ namespace ][ name ].prototype = $.extend( true, basePrototype, {
+ namespace: namespace,
+ widgetName: name,
+ widgetEventPrefix: $[ namespace ][ name ].prototype.widgetEventPrefix || name,
+ widgetBaseClass: fullName
+ }, prototype );
+
+ $.widget.bridge( name, $[ namespace ][ name ] );
+};
+
+$.widget.bridge = function( name, object ) {
+ $.fn[ name ] = function( options ) {
+ var isMethodCall = typeof options === "string",
+ args = Array.prototype.slice.call( arguments, 1 ),
+ returnValue = this;
+
+ // allow multiple hashes to be passed on init
+ options = !isMethodCall && args.length ?
+ $.extend.apply( null, [ true, options ].concat(args) ) :
+ options;
+
+ // prevent calls to internal methods
+ if ( isMethodCall && options.substring( 0, 1 ) === "_" ) {
+ return returnValue;
+ }
+
+ if ( isMethodCall ) {
+ this.each(function() {
+ var instance = $.data( this, name ),
+ methodValue = instance && $.isFunction( instance[options] ) ?
+ instance[ options ].apply( instance, args ) :
+ instance;
+ if ( methodValue !== instance && methodValue !== undefined ) {
+ returnValue = methodValue;
+ return false;
+ }
+ });
+ } else {
+ this.each(function() {
+ var instance = $.data( this, name );
+ if ( instance ) {
+ if ( options ) {
+ instance.option( options );
+ }
+ instance._init();
+ } else {
+ $.data( this, name, new object( options, this ) );
+ }
+ });
+ }
+
+ return returnValue;
+ };
+};
+
+$.Widget = function( options, element ) {
+ // allow instantiation without initializing for simple inheritance
+ if ( arguments.length ) {
+ this._createWidget( options, element );
+ }
+};
+
+$.Widget.prototype = {
+ widgetName: "widget",
+ widgetEventPrefix: "",
+ options: {
+ disabled: false
+ },
+ _createWidget: function( options, element ) {
+ // $.widget.bridge stores the plugin instance, but we do it anyway
+ // so that it's stored even before the _create function runs
+ this.element = $( element ).data( this.widgetName, this );
+ this.options = $.extend( true, {},
+ this.options,
+ $.metadata && $.metadata.get( element )[ this.widgetName ],
+ options );
+
+ var self = this;
+ this.element.bind( "remove." + this.widgetName, function() {
+ self.destroy();
+ });
+
+ this._create();
+ this._init();
+ },
+ _create: function() {},
+ _init: function() {},
+
+ destroy: function() {
+ this.element
+ .unbind( "." + this.widgetName )
+ .removeData( this.widgetName );
+ this.widget()
+ .unbind( "." + this.widgetName )
+ .removeAttr( "aria-disabled" )
+ .removeClass(
+ this.widgetBaseClass + "-disabled " +
+ "ui-state-disabled" );
+ },
+
+ widget: function() {
+ return this.element;
+ },
+
+ option: function( key, value ) {
+ var options = key,
+ self = this;
+
+ if ( arguments.length === 0 ) {
+ // don't return a reference to the internal hash
+ return $.extend( {}, self.options );
+ }
+
+ if (typeof key === "string" ) {
+ if ( value === undefined ) {
+ return this.options[ key ];
+ }
+ options = {};
+ options[ key ] = value;
+ }
+
+ $.each( options, function( key, value ) {
+ self._setOption( key, value );
+ });
+
+ return self;
+ },
+ _setOption: function( key, value ) {
+ this.options[ key ] = value;
+
+ if ( key === "disabled" ) {
+ this.widget()
+ [ value ? "addClass" : "removeClass"](
+ this.widgetBaseClass + "-disabled" + " " +
+ "ui-state-disabled" )
+ .attr( "aria-disabled", value );
+ }
+
+ return this;
+ },
+
+ enable: function() {
+ return this._setOption( "disabled", false );
+ },
+ disable: function() {
+ return this._setOption( "disabled", true );
+ },
+
+ _trigger: function( type, event, data ) {
+ var callback = this.options[ type ];
+
+ event = $.Event( event );
+ event.type = ( type === this.widgetEventPrefix ?
+ type :
+ this.widgetEventPrefix + type ).toLowerCase();
+ data = data || {};
+
+ // copy original event properties over to the new event
+ // this would happen if we could call $.event.fix instead of $.Event
+ // but we don't have a way to force an event to be fixed multiple times
+ if ( event.originalEvent ) {
+ for ( var i = $.event.props.length, prop; i; ) {
+ prop = $.event.props[ --i ];
+ event[ prop ] = event.originalEvent[ prop ];
+ }
+ }
+
+ this.element.trigger( event, data );
+
+ return !( $.isFunction(callback) &&
+ callback.call( this.element[0], event, data ) === false ||
+ event.isDefaultPrevented() );
+ }
+};
+
+})( jQuery );
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.effects.blind.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,14 @@
+/*
+ * jQuery UI Effects Blind 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","left"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a,g);b.effects.removeWrapper(a);
+c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.effects.bounce.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,15 @@
+/*
+ * jQuery UI Effects Bounce 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","left"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/
+3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a);
+b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.effects.clip.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,14 @@
+/*
+ * jQuery UI Effects Clip 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","left","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position,c/2)}var h={};h[g.size]=
+f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.effects.core.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,30 @@
+/*
+ * jQuery UI Effects 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+jQuery.effects||function(f){function k(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1],
+16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return l.transparent;return l[f.trim(c).toLowerCase()]}function q(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return k(b)}function m(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle,
+a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function n(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in r||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function s(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function j(c,a,b,d){if(typeof c=="object"){d=
+a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(f.isFunction(b)){d=b;b=null}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:f.fx.speeds[b]||f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor","borderTopColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=q(b.elem,a);b.end=k(b.end);b.colorInit=
+true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var l={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0,0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,
+183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211,211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,
+165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},o=["add","remove","toggle"],r={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b,d){if(f.isFunction(b)){d=b;b=null}return this.each(function(){var e=f(this),g=e.attr("style")||" ",h=n(m.call(this)),p,t=e.attr("className");f.each(o,function(u,
+i){c[i]&&e[i+"Class"](c[i])});p=n(m.call(this));e.attr("className",t);e.animate(s(h,p),a,b,function(){f.each(o,function(u,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments)})})};f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?
+f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===undefined?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this,[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.1",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==
+null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,a){var b;switch(c[0]){case "top":b=0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();
+var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0});c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});
+c.css({position:"relative",top:0,left:0})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=j.apply(this,arguments);a={options:a[1],duration:a[2],callback:a[3]};var b=f.effects[c];return b&&!f.fx.off?b.call(this,a):this},_show:f.fn.show,show:function(c){if(!c||
+typeof c=="number"||f.fx.speeds[c])return this._show.apply(this,arguments);else{var a=j.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(!c||typeof c=="number"||f.fx.speeds[c])return this._hide.apply(this,arguments);else{var a=j.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(!c||typeof c=="number"||f.fx.speeds[c]||typeof c=="boolean"||f.isFunction(c))return this.__toggle.apply(this,
+arguments);else{var a=j.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,
+a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+
+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,
+10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*
+a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,
+a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);if(a<1)return-0.5*h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==undefined)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==undefined)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,
+a,b,d,e,g){if(g==undefined)g=1.70158;if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c,a,b,d,e){return d-f.easing.easeOutBounce(c,e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,
+d,e)*0.5+b;return f.easing.easeOutBounce(c,a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.effects.drop.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,14 @@
+/*
+ * jQuery UI Effects Drop 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","left","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e=="show"?1:
+0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.effects.explode.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,15 @@
+/*
+ * jQuery UI Effects Explode 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f=
+0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+
+e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.effects.fold.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,14 @@
+/*
+ * jQuery UI Effects Fold 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","left"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1],10)/100*
+f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.effects.highlight.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,14 @@
+/*
+ * jQuery UI Effects Highlight 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&&
+this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.effects.pulsate.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,14 @@
+/*
+ * jQuery UI Effects Pulsate 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration,
+a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.effects.scale.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,20 @@
+/*
+ * jQuery UI Effects Scale 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a,
+b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity=
+1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","left","width","height","overflow","opacity"],g=["position","top","left","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],p=c.effects.setMode(a,
+b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}};if(m=="box"||m=="both"){if(d.from.y!=
+d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a);a.css("overflow","hidden").css(a.from);
+if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from);child.to=c.effects.setTransition(child,
+f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a,n?e:g);c.effects.removeWrapper(a);b.callback&&
+b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.effects.shake.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,14 @@
+/*
+ * jQuery UI Effects Shake 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","left"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]=(h=="pos"?"-=":"+=")+
+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.effects.slide.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,14 @@
+/*
+ * jQuery UI Effects Slide 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","left"],e=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(e=="show")a.css(f,b=="pos"?-g:g);var i={};i[f]=(e=="show"?b=="pos"?
+"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.effects.transfer.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,14 @@
+/*
+ * jQuery UI Effects Transfer 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ * jquery.effects.core.js
+ */
+(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments);
+b.dequeue()})})}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.accordion.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,30 @@
+/*
+ * jQuery UI Accordion 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()==location.href.toLowerCase()}},_create:function(){var a=this.options,b=this;this.running=0;this.element.addClass("ui-accordion ui-widget ui-helper-reset");
+this.element[0].nodeName=="UL"&&this.element.children("li").addClass("ui-accordion-li-fix");this.headers=this.element.find(a.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){c(this).removeClass("ui-state-focus")});
+this.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");if(a.navigation){var d=this.element.find("a").filter(a.navigationFilter);if(d.length){var f=d.closest(".ui-accordion-header");this.active=f.length?f:d.closest(".ui-accordion-content").prev()}}this.active=this._findActive(this.active||a.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");this.active.next().addClass("ui-accordion-content-active");
+this._createIcons();this.resize();this.element.attr("role","tablist");this.headers.attr("role","tab").bind("keydown",function(g){return b._keydown(g)}).next().attr("role","tabpanel");this.headers.not(this.active||"").attr("aria-expanded","false").attr("tabIndex","-1").next().hide();this.active.length?this.active.attr("aria-expanded","true").attr("tabIndex","0"):this.headers.eq(0).attr("tabIndex","0");c.browser.safari||this.headers.find("a").attr("tabIndex","-1");a.event&&this.headers.bind(a.event+
+".accordion",function(g){b._clickHandler.call(b,g,this);g.preventDefault()})},_createIcons:function(){var a=this.options;if(a.icons){c("<span/>").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.find(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role").unbind(".accordion").removeData("accordion");
+this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex");this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");if(a.autoHeight||a.fillHeight)b.css("height",
+"");return this},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons();b&&this._createIcons()}},_keydown:function(a){var b=c.ui.keyCode;if(!(this.options.disabled||a.altKey||a.ctrlKey)){var d=this.headers.length,f=this.headers.index(a.target),g=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:g=this.headers[(f+1)%d];break;case b.LEFT:case b.UP:g=this.headers[(f-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},
+a.target);a.preventDefault()}if(g){c(a.target).attr("tabIndex","-1");c(g).attr("tabIndex","0");g.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,
+b-c(this).innerHeight()+c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a=="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=
+this.options;if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]==this.active[0];d.active=d.collapsible&&b?false:c(".ui-accordion-header",this.element).index(a);if(!(this.running||!d.collapsible&&b)){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").find(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").find(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);
+a.next().addClass("ui-accordion-content-active")}e=a.next();f=this.active.next();g={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):e,oldContent:f};d=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(e,f,g,b,d)}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").find(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);
+this.active.next().addClass("ui-accordion-content-active");var f=this.active.next(),g={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:f},e=this.active=c([]);this._toggle(e,f,g)}},_toggle:function(a,b,d,f,g){var e=this.options,k=this;this.toShow=a;this.toHide=b;this.data=d;var i=function(){if(k)return k._completed.apply(k,arguments)};this._trigger("changestart",null,this.data);this.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&f?{toShow:c([]),
+toHide:b,complete:i,down:g,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:i,down:g,autoHeight:e.autoHeight||e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;f=c.ui.accordion.animations;var h=e.duration,j=e.animated;if(j&&!f[j]&&!c.easing[j])j="slide";f[j]||(f[j]=function(l){this.slide(l,{easing:j,
+duration:h||700})});f[j](d)}else{if(e.collapsible&&f)a.toggle();else{b.hide();a.show()}i(true)}b.prev().attr("aria-expanded","false").attr("tabIndex","-1").blur();a.prev().attr("aria-expanded","true").attr("tabIndex","0").focus()},_completed:function(a){var b=this.options;this.running=a?0:--this.running;if(!this.running){b.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,
+{version:"1.8.1",animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),f=0,g={},e={},k;b=a.toShow;k=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(i,h){e[h]="hide";i=(""+c.css(a.toShow[0],
+h)).match(/^([\d+-.]+)(.*)$/);g[h]={value:i[1],unit:i[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(e,{step:function(i,h){if(h.prop=="height")f=h.end-h.start===0?0:(h.now-h.start)/(h.end-h.start);a.toShow[0].style[h.prop]=f*g[h.prop].value+g[h.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css("width",k);a.toShow.css({overflow:d});a.complete()}})}else a.toHide.animate({height:"hide"},
+a);else a.toShow.animate({height:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.autocomplete.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,28 @@
+/*
+ * jQuery UI Autocomplete 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function(e){e.widget("ui.autocomplete",{options:{minLength:1,delay:300},_create:function(){var a=this,b=this.element[0].ownerDocument;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){var d=e.ui.keyCode;switch(c.keyCode){case d.PAGE_UP:a._move("previousPage",c);break;case d.PAGE_DOWN:a._move("nextPage",c);break;case d.UP:a._move("previous",c);c.preventDefault();
+break;case d.DOWN:a._move("next",c);c.preventDefault();break;case d.ENTER:a.menu.active&&c.preventDefault();case d.TAB:if(!a.menu.active)return;a.menu.select(c);break;case d.ESCAPE:a.element.val(a.term);a.close(c);break;case d.LEFT:case d.RIGHT:case d.SHIFT:case d.CONTROL:case d.ALT:break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){a.search(null,c)},a.options.delay);break}}).bind("focus.autocomplete",function(){a.selectedItem=null;a.previous=a.element.val()}).bind("blur.autocomplete",
+function(c){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)});this._initSource();this.response=function(){return a._response.apply(a,arguments)};this.menu=e("<ul></ul>").addClass("ui-autocomplete").appendTo("body",b).menu({focus:function(c,d){d=d.item.data("item.autocomplete");false!==a._trigger("focus",null,{item:d})&&/^key/.test(c.originalEvent.type)&&a.element.val(d.value)},selected:function(c,d){d=d.item.data("item.autocomplete");false!==a._trigger("select",
+c,{item:d})&&a.element.val(d.value);a.close(c);c=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=c}a.selectedItem=d},blur:function(){a.menu.element.is(":visible")&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");e.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");
+this.menu.element.remove();e.Widget.prototype.destroy.call(this)},_setOption:function(a){e.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource()},_initSource:function(){var a,b;if(e.isArray(this.options.source)){a=this.options.source;this.source=function(c,d){d(e.ui.autocomplete.filter(a,c.term))}}else if(typeof this.options.source==="string"){b=this.options.source;this.source=function(c,d){e.getJSON(b,c,d)}}else this.source=this.options.source},search:function(a,b){a=
+a!=null?a:this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search")!==false)return this._search(a)},_search:function(a){this.term=this.element.addClass("ui-autocomplete-loading").val();this.source({term:a},this.response)},_response:function(a){if(a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);
+if(this.menu.element.is(":visible")){this._trigger("close",a);this.menu.element.hide();this.menu.deactivate()}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return e.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return e.extend({label:b.label||b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+
+1),c;this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();this.menu.element.show().position({my:"left top",at:"left bottom",of:this.element,collision:"none"});a=b.width("").width();c=this.element.width();b.width(Math.max(a,c))},_renderMenu:function(a,b){var c=this;e.each(b,function(d,f){c._renderItem(a,f)})},_renderItem:function(a,b){return e("<li></li>").data("item.autocomplete",b).append("<a>"+b.label+"</a>").appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&
+/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});e.extend(e.ui.autocomplete,{escapeRegex:function(a){return a.replace(/([\^\$\(\)\[\]\{\}\*\.\+\?\|\\])/gi,"\\$1")},filter:function(a,b){var c=new RegExp(e.ui.autocomplete.escapeRegex(b),"i");return e.grep(a,function(d){return c.test(d.label||d.value||d)})}})})(jQuery);
+(function(e){e.widget("ui.menu",{_create:function(){var a=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(b){if(e(b.target).closest(".ui-menu-item a").length){b.preventDefault();a.select(b)}});this.refresh()},refresh:function(){var a=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
+-1).mouseenter(function(b){a.activate(b,e(this).parent())}).mouseleave(function(){a.deactivate()})},activate:function(a,b){this.deactivate();if(this.hasScroll()){var c=b.offset().top-this.element.offset().top,d=this.element.attr("scrollTop"),f=this.element.height();if(c<0)this.element.attr("scrollTop",d+c);else c>f&&this.element.attr("scrollTop",d+c-f+b.height())}this.active=b.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",a,{item:b})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");
+this._trigger("blur");this.active=null}},next:function(a){this.move("next",".ui-menu-item:first",a)},previous:function(a){this.move("prev",".ui-menu-item:last",a)},first:function(){return this.active&&!this.active.prev().length},last:function(){return this.active&&!this.active.next().length},move:function(a,b,c){if(this.active){a=this.active[a+"All"](".ui-menu-item").eq(0);a.length?this.activate(c,a):this.activate(c,this.element.children(b))}else this.activate(c,this.element.children(b))},nextPage:function(a){if(this.hasScroll())if(!this.active||
+this.last())this.activate(a,this.element.children(":first"));else{var b=this.active.offset().top,c=this.element.height(),d=this.element.children("li").filter(function(){var f=e(this).offset().top-b-c+e(this).height();return f<10&&f>-10});d.length||(d=this.element.children(":last"));this.activate(a,d)}else this.activate(a,this.element.children(!this.active||this.last()?":first":":last"))},previousPage:function(a){if(this.hasScroll())if(!this.active||this.first())this.activate(a,this.element.children(":last"));
+else{var b=this.active.offset().top,c=this.element.height();result=this.element.children("li").filter(function(){var d=e(this).offset().top-b+c-e(this).height();return d<10&&d>-10});result.length||(result=this.element.children(":first"));this.activate(a,result)}else this.activate(a,this.element.children(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(a){this._trigger("selected",a,{item:this.active})}})})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.button.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,24 @@
+/*
+ * jQuery UI Button 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Button
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(a){var g,i=function(b){a(":ui-button",b.target.form).each(function(){var c=a(this).data("button");setTimeout(function(){c.refresh()},1)})},h=function(b){var c=b.name,d=b.form,e=a([]);if(c)e=d?a(d).find("[name='"+c+"']"):a("[name='"+c+"']",b.ownerDocument).filter(function(){return!this.form});return e};a.widget("ui.button",{options:{text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",i);this._determineButtonType();
+this.hasTitle=!!this.buttonElement.attr("title");var b=this,c=this.options,d=this.type==="checkbox"||this.type==="radio",e="ui-state-hover"+(!d?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",function(){if(!c.disabled){a(this).addClass("ui-state-hover");this===g&&a(this).addClass("ui-state-active")}}).bind("mouseleave.button",
+function(){c.disabled||a(this).removeClass(e)}).bind("focus.button",function(){a(this).addClass("ui-state-focus")}).bind("blur.button",function(){a(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){b.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).toggleClass("ui-state-active");b.buttonElement.attr("aria-pressed",b.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",
+function(){if(c.disabled)return false;a(this).addClass("ui-state-active");b.buttonElement.attr("aria-pressed",true);var f=b.element[0];h(f).not(f).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");g=this;a(document).one("mouseup",function(){g=null})}).bind("mouseup.button",function(){if(c.disabled)return false;a(this).removeClass("ui-state-active")}).bind("keydown.button",
+function(f){if(c.disabled)return false;if(f.keyCode==a.ui.keyCode.SPACE||f.keyCode==a.ui.keyCode.ENTER)a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(f){f.keyCode===a.ui.keyCode.SPACE&&a(this).click()})}this._setOption("disabled",c.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?
+"input":"button";if(this.type==="checkbox"||this.type==="radio"){this.buttonElement=this.element.parents().last().find("[for="+this.element.attr("id")+"]");this.element.addClass("ui-helper-hidden-accessible");var b=this.element.is(":checked");b&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",b)}else this.buttonElement=this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());
+this.hasTitle||this.buttonElement.removeAttr("title");a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments);if(b==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var b=this.element.is(":disabled");b!==this.options.disabled&&this._setOption("disabled",b);if(this.type==="radio")h(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed",
+true):a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var b=this.buttonElement,c=a("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),
+d=this.options.icons,e=d.primary&&d.secondary;if(d.primary||d.secondary){b.addClass("ui-button-text-icon"+(e?"s":""));d.primary&&b.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&b.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){b.addClass(e?"ui-button-icons-only":"ui-button-icon-only").removeClass("ui-button-text-icons ui-button-text-icon");this.hasTitle||b.attr("title",c)}}else b.addClass("ui-button-text-only")}}});
+a.widget("ui.buttonset",{_create:function(){this.element.addClass("ui-buttonset");this._init()},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(":button, :submit, :reset, :checkbox, :radio, a, :data(button)").filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()},
+destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.core.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,15 @@
+/*!
+ * jQuery UI 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI
+ */
+jQuery.ui||function(c){c.ui={version:"1.8.1",plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")=="hidden")return false;
+b=b&&b=="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,f,g){return c.ui.isOverAxis(a,d,f)&&c.ui.isOverAxis(b,e,g)},keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,
+PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38}};c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},enableSelection:function(){return this.attr("unselectable","off").css("MozUserSelect","")},disableSelection:function(){return this.attr("unselectable","on").css("MozUserSelect","none")},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||
+/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==
+undefined)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b=="absolute"||b=="relative"||b=="fixed"){b=parseInt(a.css("zIndex"));if(!isNaN(b)&&b!=0)return b}a=a.parent()}}return 0}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b||"area"==b?a.href||!isNaN(d):!isNaN(d))&&
+!c(a)["area"==b?"parents":"closest"](":hidden").length},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}})}(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.datepicker.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,80 @@
+/*
+ * jQuery UI Datepicker 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ * jquery.ui.core.js
+ */
+(function(d){function J(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass=
+"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su",
+"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"show",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",
+minDate:null,maxDate:null,duration:"_default",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>')}function E(a,b){d.extend(a,
+b);for(var c in b)if(b[c]==null||b[c]==undefined)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.1"}});var y=(new Date).getTime();d.extend(J.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){E(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=
+f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id)a.id="dp"+ ++this.uuid;var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}},
+_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&
+b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==
+""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,
+c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),
+true);this._updateDatepicker(b);this._updateAlternate(b)}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){a="dp"+ ++this.uuid;this._dialogInput=d('<input type="text" id="'+a+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}E(a.settings,e||{});b=b&&b.constructor==Date?
+this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);
+d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},
+_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=
+d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;
+for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({},e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&
+this._hideDatepicker();var h=this._getDateDatepicker(a,true);E(e.settings,f);this._attachments(d(a),e);this._autoSize(e);this._setDateDatepicker(a,h);this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,b);this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&
+!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass,b.dpDiv).add(d("td."+d.datepicker._currentClass,b.dpDiv));c[0]?d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();
+return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target);c=a.ctrlKey||a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||
+a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,
+a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=d.datepicker._getInst(a.target);if(d.datepicker._get(b,"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));
+var c=String.fromCharCode(a.charCode==undefined?a.keyCode:a.charCode);return a.ctrlKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||
+a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");E(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);
+d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&
+d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){d.datepicker._datepickerShowing=true;var i=d.datepicker._getBorders(b.dpDiv);b.dpDiv.find("iframe.ui-datepicker-cover").css({left:-i[0],top:-i[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})};b.dpDiv.zIndex(d(a).zIndex()+1);d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,
+h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){var b=this,c=d.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a)).find("iframe.ui-datepicker-cover").css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}).end().find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout",function(){d(this).removeClass("ui-state-hover");
+this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!b._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).addClass("ui-datepicker-prev-hover");
+this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();c=this._getNumberOfMonths(a);var e=c[1];e>1?a.dpDiv.addClass("ui-datepicker-multi-"+e).css("width",17*e+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(c[0]!=1||c[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");
+a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input.focus()},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),
+k=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>k&&k>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1);)a=a[b?"previousSibling":"nextSibling"];
+a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():
+"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&
+!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;
+b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){a=this._getInst(d(a)[0]);
+a.input&&a._selectingMonthYear&&!d.browser.msie&&a.input.focus();a._selectingMonthYear=!a._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,
+"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||
+this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;
+for(var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff,f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,k=c=-1,l=-1,u=-1,j=false,o=function(p){(p=z+1<a.length&&a.charAt(z+1)==p)&&z++;return p},m=function(p){o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"?4:p=="o"?3:2)+"}");p=b.substring(s).match(p);if(!p)throw"Missing number at position "+
+s;s+=p[0].length;return parseInt(p[0],10)},n=function(p,w,G){p=o(p)?G:w;for(w=0;w<p.length;w++)if(b.substr(s,p[w].length)==p[w]){s+=p[w].length;return w+1}throw"Unknown name at position "+s;},r=function(){if(b.charAt(s)!=a.charAt(z))throw"Unexpected literal at position "+s;s++},s=0,z=0;z<a.length;z++)if(j)if(a.charAt(z)=="'"&&!o("'"))j=false;else r();else switch(a.charAt(z)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":k=m("m");break;case "M":k=n("M",i,g);break;
+case "y":c=m("y");break;case "@":var v=new Date(m("@"));c=v.getFullYear();k=v.getMonth()+1;l=v.getDate();break;case "!":v=new Date((m("!")-this._ticksTo1970)/1E4);c=v.getFullYear();k=v.getMonth()+1;l=v.getDate();break;case "'":if(o("'"))r();else j=true;break;default:r()}if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){k=1;l=u;do{e=this._getDaysInMonth(c,k-1);if(l<=e)break;k++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,
+k-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=k||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?
+c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=j+1<a.length&&a.charAt(j+1)==o)&&j++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<n;)m="0"+m;return m},k=function(o,m,n,r){return i(o)?r[m]:n[m]},l="",u=false;if(b)for(var j=0;j<a.length;j++)if(u)if(a.charAt(j)=="'"&&!i("'"))u=false;else l+=a.charAt(j);else switch(a.charAt(j)){case "d":l+=g("d",b.getDate(),2);break;
+case "D":l+=k("D",b.getDay(),e,f);break;case "o":l+=g("o",(b.getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=k("M",b.getMonth(),h,c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(j)}return l},_possibleChars:function(a){for(var b="",c=false,
+e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+="0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==undefined?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),
+e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth=f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},
+_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g=(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,k=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,j=u.exec(h);j;){switch(j[2]||"d"){case "d":case "D":g+=parseInt(j[1],10);break;case "w":case "W":g+=parseInt(j[1],
+10)*7;break;case "m":case "M":l+=parseInt(j[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(k,l));break;case "y":case "Y":k+=parseInt(j[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(k,l));break}j=u.exec(h)}return new Date(k,l,g)};if(b=(b=b==null?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):b)&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;
+a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||
+a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),k=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?
+new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),j=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=j&&n<j?j:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-k,1)),this._getFormatConfig(a));
+n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', -"+k+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m,
+g+k,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', +"+k+", 'M');\" title=\""+r+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+r+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+r+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+r+"</span></a>";k=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&&
+a.currentDay?u:b;k=!h?k:this.formatDate(k,r,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+y+'.datepicker._hideDatepicker();">'+this._get(a,"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,r)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+
+y+".datepicker._gotoToday('#"+a.id+"');\">"+k+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;k=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),w=this._get(a,"showOtherMonths"),G=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var K=this._getDefaultDate(a),H="",C=0;C<i[0];C++){for(var L=
+"",D=0;D<i[1];D++){var M=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",x="";if(l){x+='<div class="ui-datepicker-group';if(i[1]>1)switch(D){case 0:x+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-1:x+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:x+=" ui-datepicker-group-middle";t="";break}x+='">'}x+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&C==0?c?
+f:n:"")+(/all|right/.test(t)&&C==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,j,o,C>0||D>0,z,v)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var A=k?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(t=0;t<7;t++){var q=(t+h)%7;A+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+r[q]+'">'+s[q]+"</span></th>"}x+=A+"</tr></thead><tbody>";A=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,
+A);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;A=l?6:Math.ceil((t+A)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var N=0;N<A;N++){x+="<tr>";var O=!k?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(q)+"</td>";for(t=0;t<7;t++){var F=p?p.apply(a.input?a.input[0]:null,[q]):[true,""],B=q.getMonth()!=g,I=B&&!G||!F[0]||j&&q<j||o&&q>o;O+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(B?" ui-datepicker-other-month":"")+(q.getTime()==M.getTime()&&g==a.selectedMonth&&
+a._keyEvent||K.getTime()==q.getTime()&&K.getTime()==M.getTime()?" "+this._dayOverClass:"")+(I?" "+this._unselectableClass+" ui-state-disabled":"")+(B&&!w?"":" "+F[1]+(q.getTime()==u.getTime()?" "+this._currentClass:"")+(q.getTime()==b.getTime()?" ui-datepicker-today":""))+'"'+((!B||w)&&F[2]?' title="'+F[2]+'"':"")+(I?"":' onclick="DP_jQuery_'+y+".datepicker._selectDay('#"+a.id+"',"+q.getMonth()+","+q.getFullYear()+', this);return false;"')+">"+(B&&!w?" ":I?'<span class="ui-state-default">'+q.getDate()+
+"</span>":'<a class="ui-state-default'+(q.getTime()==b.getTime()?" ui-state-highlight":"")+(q.getTime()==u.getTime()?" ui-state-active":"")+(B?" ui-priority-secondary":"")+'" href="#">'+q.getDate()+"</a>")+"</td>";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+=O+"</tr>"}g++;if(g>11){g=0;m++}x+="</tbody></table>"+(l?"</div>"+(i[0]>0&&D==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");L+=x}H+=L}H+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':
+"");a._keyEvent=false;return H},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var k=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),j='<div class="ui-datepicker-title">',o="";if(h||!k)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+
+a.id+"');\">";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='<option value="'+n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(j+=o+(h||!(k&&l)?" ":""));if(h||!l)j+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,
+i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(j+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)j+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";j+="</select>"}j+=this._get(a,"yearSuffix");if(u)j+=(h||!(k&&l)?" ":"")+o;j+="</div>";return j},_adjustInstDate:function(a,b,c){var e=
+a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,
+"onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);
+c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,
+"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=
+function(a){if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));
+return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new J;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.1";window["DP_jQuery_"+y]=d})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.dialog.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,39 @@
+/*
+ * jQuery UI Dialog 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.button.js
+ * jquery.ui.draggable.js
+ * jquery.ui.mouse.js
+ * jquery.ui.position.js
+ * jquery.ui.resizable.js
+ */
+(function(c){c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:"center",resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");var a=this,b=a.options,d=b.title||a.originalTitle||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+
+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),
+h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",
+e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");
+a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==
+b.uiDialog[0])d=Math.max(d,c(this).css("z-index"))});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",
+c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;d.next().length&&d.appendTo("body");a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===
+f[0]&&e.shiftKey){g.focus(1);return false}}});c([]).add(d.find(".ui-dialog-content :tabbable:first")).add(d.find(".ui-dialog-buttonpane :tabbable:first")).add(d).filter(":first").focus();a._trigger("open");a._isOpen=true;return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix");b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,
+function(g,f){g=c('<button type="button"></button>').text(g).click(function(){f.apply(b.element[0],arguments)}).appendTo(e);c.fn.button&&g.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");
+b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,originalSize:f.originalSize,position:f.position,size:f.size}}a=a===undefined?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");
+a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",
+f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0];a=a||c.ui.dialog.prototype.options.position;if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(e,g){if(+b[e]===b[e]){d[e]=b[e];b[e]=
+g}})}else if(typeof a==="object"){if("left"in a){b[0]="left";d[0]=a.left}else if("right"in a){b[0]="right";d[0]=-a.right}if("top"in a){b[1]="top";d[1]=a.top}else if("bottom"in a){b[1]="bottom";d[1]=-a.bottom}}(a=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position({my:b.join(" "),at:b.join(" "),offset:d.join(" "),of:window,collision:"fit",using:function(e){var g=c(this).css(e).offset().top;g<0&&c(this).css("top",e.top-g)}});a||this.uiDialog.hide()},_setOption:function(a,
+b){var d=this,e=d.uiDialog,g=e.is(":data(resizable)"),f=false;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):e.removeClass("ui-dialog-disabled");break;case "draggable":b?d._makeDraggable():e.draggable("destroy");break;
+case "height":f=true;break;case "maxHeight":g&&e.resizable("option","maxHeight",b);f=true;break;case "maxWidth":g&&e.resizable("option","maxWidth",b);f=true;break;case "minHeight":g&&e.resizable("option","minHeight",b);f=true;break;case "minWidth":g&&e.resizable("option","minWidth",b);f=true;break;case "position":d._position(b);break;case "resizable":g&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",
+d.uiDialogTitlebar).html(""+(b||" "));break;case "width":f=true;break}c.Widget.prototype._setOption.apply(d,arguments);f&&d._size()},_size:function(){var a=this.options,b;this.element.css({width:"auto",minHeight:0,height:0});b=this.uiDialog.css({height:"auto",width:a.width}).height();this.element.css(a.height==="auto"?{minHeight:Math.max(a.minHeight-b,0),height:"auto"}:{minHeight:0,height:Math.max(a.height-b,0)}).show();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",
+this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.1",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&
+c(document).bind(c.ui.dialog.overlay.events,function(d){return c(d.target).zIndex()>=c.ui.dialog.overlay.maxZ})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});c.fn.bgiframe&&
+b.bgiframe();this.instances.push(b);return b},destroy:function(a){this.oldInstances.push(this.instances.splice(c.inArray(a,this.instances),1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var b=0;c.each(this.instances,function(){b=Math.max(b,this.css("z-index"))});this.maxZ=b},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);b=Math.max(document.documentElement.offsetHeight,
+document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,function(){a=a.add(this)});a.css({width:0,
+height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.draggable.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,49 @@
+/*
+ * jQuery UI Draggable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
+"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
+this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-
+this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();
+d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||
+this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if(!this.element[0]||!this.element[0].parentNode)return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,
+b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
+a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||
+0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-
+(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment==
+"parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&
+a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),
+10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():
+f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])e=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+
+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;e=this.originalPageX+
+Math.round((e-this.originalPageX)/b.grid[0])*b.grid[0];e=this.containment?!(e-this.offset.click.left<this.containment[0]||e-this.offset.click.left>this.containment[2])?e:!(e-this.offset.click.left<this.containment[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-
+this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=
+this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.1"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var g=d.data(this,"sortable");
+if(g&&!g.options.disabled){c.sortables.push({instance:g,shouldRevert:g.options.revert});g._refreshItems();g._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;
+c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=
+1;this.instance.currentItem=d(f).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;
+this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=
+this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","iframeFix",{start:function(){var a=
+d(this).data("draggable").options;d(a.iframeFix===true?"iframe":a.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;
+if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!=
+"HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-
+b.overflowOffset.left<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-
+c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,
+width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,g=b.offset.left,n=g+c.helperProportions.width,m=b.offset.top,o=m+c.helperProportions.height,h=c.snapElements.length-1;h>=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e<g&&g<k+e&&j-e<m&&m<l+e||i-e<g&&g<k+e&&j-e<o&&o<l+e||i-e<n&&n<k+e&&j-e<m&&m<l+e||i-e<n&&n<k+e&&j-e<o&&
+o<l+e){if(f.snapMode!="inner"){var p=Math.abs(j-o)<=e,q=Math.abs(l-m)<=e,r=Math.abs(i-n)<=e,s=Math.abs(k-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k}).left-c.margins.left}var t=
+p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(j-m)<=e;q=Math.abs(l-o)<=e;r=Math.abs(i-g)<=e;s=Math.abs(k-n)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[h].snapping&&
+(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=p||q||r||s||t}else{c.snapElements[h].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),
+10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.droppable.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,26 @@
+/*
+ * jQuery UI Droppable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.mouse.js
+ * jquery.ui.draggable.js
+ */
+(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this);
+a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&
+this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass);
+this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g=
+d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop",
+a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.1"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height;
+switch(c){case "fit":return i<e&&g<k&&j<f&&h<l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>=i&&
+e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!=
+"none";if(c[f].visible){c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight};e=="mousedown"&&c[f]._activate.call(c[f],b)}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem||
+a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=
+d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})}}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.mouse.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,17 @@
+/*!
+ * jQuery UI Mouse 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ */
+(function(c){c.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(b){return a._mouseDown(b)}).bind("click."+this.widgetName,function(b){if(a._preventClickEvent){a._preventClickEvent=false;b.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(a){a.originalEvent=a.originalEvent||{};if(!a.originalEvent.mouseHandled){this._mouseStarted&&
+this._mouseUp(a);this._mouseDownEvent=a;var b=this,e=a.which==1,f=typeof this.options.cancel=="string"?c(a.target).parents().add(a.target).filter(this.options.cancel).length:false;if(!e||f||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){b.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted=this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();
+return true}}this._mouseMoveDelegate=function(d){return b._mouseMove(d)};this._mouseUpDelegate=function(d){return b._mouseUp(d)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);c.browser.safari||a.preventDefault();return a.originalEvent.mouseHandled=true}},_mouseMove:function(a){if(c.browser.msie&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&
+this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;this._preventClickEvent=a.target==this._mouseDownEvent.target;this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-
+a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.position.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,15 @@
+/*
+ * jQuery UI Position 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var m=/left|center|right/,n=/top|center|bottom/,p=c.fn.position,q=c.fn.offset;c.fn.position=function(a){if(!a||!a.of)return p.apply(this,arguments);a=c.extend({},a);var b=c(a.of),d=(a.collision||"flip").split(" "),e=a.offset?a.offset.split(" "):[0,0],g,h,i;if(a.of.nodeType===9){g=b.width();h=b.height();i={top:0,left:0}}else if(a.of.scrollTo&&a.of.document){g=b.width();h=b.height();i={top:b.scrollTop(),left:b.scrollLeft()}}else if(a.of.preventDefault){a.at="left top";g=h=
+0;i={top:a.of.pageY,left:a.of.pageX}}else{g=b.outerWidth();h=b.outerHeight();i=b.offset()}c.each(["my","at"],function(){var f=(a[this]||"").split(" ");if(f.length===1)f=m.test(f[0])?f.concat(["center"]):n.test(f[0])?["center"].concat(f):["center","center"];f[0]=m.test(f[0])?f[0]:"center";f[1]=n.test(f[1])?f[1]:"center";a[this]=f});if(d.length===1)d[1]=d[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(a.at[0]==="right")i.left+=g;else if(a.at[0]==="center")i.left+=
+g/2;if(a.at[1]==="bottom")i.top+=h;else if(a.at[1]==="center")i.top+=h/2;i.left+=e[0];i.top+=e[1];return this.each(function(){var f=c(this),k=f.outerWidth(),l=f.outerHeight(),j=c.extend({},i);if(a.my[0]==="right")j.left-=k;else if(a.my[0]==="center")j.left-=k/2;if(a.my[1]==="bottom")j.top-=l;else if(a.my[1]==="center")j.top-=l/2;j.left=parseInt(j.left);j.top=parseInt(j.top);c.each(["left","top"],function(o,r){c.ui.position[d[o]]&&c.ui.position[d[o]][r](j,{targetWidth:g,targetHeight:h,elemWidth:k,
+elemHeight:l,offset:e,my:a.my,at:a.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(j,{using:a.using}))})};c.ui.position={fit:{left:function(a,b){var d=c(window);b=a.left+b.elemWidth-d.width()-d.scrollLeft();a.left=b>0?a.left-b:Math.max(0,a.left)},top:function(a,b){var d=c(window);b=a.top+b.elemHeight-d.height()-d.scrollTop();a.top=b>0?a.top-b:Math.max(0,a.top)}},flip:{left:function(a,b){if(b.at[0]!=="center"){var d=c(window);d=a.left+b.elemWidth-d.width()-d.scrollLeft();var e=b.my[0]==="left"?
+-b.elemWidth:b.my[0]==="right"?b.elemWidth:0,g=-2*b.offset[0];a.left+=a.left<0?e+b.targetWidth+g:d>0?e-b.targetWidth+g:0}},top:function(a,b){if(b.at[1]!=="center"){var d=c(window);d=a.top+b.elemHeight-d.height()-d.scrollTop();var e=b.my[1]==="top"?-b.elemHeight:b.my[1]==="bottom"?b.elemHeight:0,g=b.at[1]==="top"?b.targetHeight:-b.targetHeight,h=-2*b.offset[1];a.top+=a.top<0?e+b.targetHeight+h:d>0?e+g+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(a,b){if(/static/.test(c.curCSS(a,"position")))a.style.position=
+"relative";var d=c(a),e=d.offset(),g=parseInt(c.curCSS(a,"top",true),10)||0,h=parseInt(c.curCSS(a,"left",true),10)||0;e={top:b.top-e.top+g,left:b.left-e.left+h};"using"in b?b.using.call(a,e):d.css(e)};c.fn.offset=function(a){var b=this[0];if(!b||!b.ownerDocument)return null;if(a)return this.each(function(){c.offset.setOffset(this,a)});return q.call(this)}}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.progressbar.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,16 @@
+/*
+ * jQuery UI Progressbar 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(b){b.widget("ui.progressbar",{options:{value:0},_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this._valueMin(),"aria-valuemax":this._valueMax(),"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow");
+this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===undefined)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){switch(a){case "value":this.options.value=c;this._refreshValue();this._trigger("change");break}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;if(a<this._valueMin())a=this._valueMin();if(a>this._valueMax())a=this._valueMax();return a},
+_valueMin:function(){return 0},_valueMax:function(){return 100},_refreshValue:function(){var a=this.value();this.valueDiv[a===this._valueMax()?"addClass":"removeClass"]("ui-corner-right").width(a+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.1"})})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.resizable.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,47 @@
+/*
+ * jQuery UI Resizable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.resizable",d.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");d.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element,
+_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&d.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(d('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
+top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
+this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!d(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
+nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var e=0;e<c.length;e++){var g=d.trim(c[e]),f=d('<div class="ui-resizable-handle '+("ui-resizable-"+g)+'"></div>');/sw|se|ne|nw/.test(g)&&f.css({zIndex:++a.zIndex});"se"==g&&f.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[g]=".ui-resizable-"+g;this.element.append(f)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
+String)this.handles[i]=d(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=d(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}d(this.handles[i])}};this._renderAxis(this.element);this._handles=d(".ui-resizable-handle",this.element).disableSelection();
+this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();d(this.element).addClass("ui-resizable-autohide").hover(function(){d(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){d(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){d(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};
+if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(d(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),
+e=this.element;this.resizing=true;this.documentScroll={top:d(document).scrollTop(),left:d(document).scrollLeft()};if(e.is(".ui-draggable")||/absolute/.test(e.css("position")))e.css({position:"absolute",top:c.top,left:c.left});d.browser.opera&&/relative/.test(e.css("position"))&&e.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var g=m(this.helper.css("top"));if(a.containment){c+=d(a.containment).scrollLeft()||0;g+=d(a.containment).scrollTop()||0}this.offset=
+this.helper.offset();this.position={left:c,top:g};this.size=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalSize=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalPosition={left:c,top:g};this.sizeDiff={width:e.outerWidth()-e.width(),height:e.outerHeight()-e.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:
+this.originalSize.width/this.originalSize.height||1;a=d(".ui-resizable-"+this.axis).css("cursor");d("body").css("cursor",a=="auto"?this.axis+"-resize":a);e.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,e=this._change[this.axis];if(!e)return false;c=e.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",
+b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var e=this._proportionallyResizeElements,g=e.length&&/textarea/i.test(e[0].nodeName);e=g&&d.ui.hasScroll(e[0],"left")?0:c.sizeDiff.height;
+g={width:c.size.width-(g?0:c.sizeDiff.width),height:c.size.height-e};e=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var f=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(d.extend(g,{top:f,left:e}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}d("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",
+b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(k(b.left))this.position.left=b.left;if(k(b.top))this.position.top=b.top;if(k(b.height))this.size.height=b.height;if(k(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,e=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(e=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(e=="nw"){b.top=
+a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,e=k(b.width)&&a.maxWidth&&a.maxWidth<b.width,g=k(b.height)&&a.maxHeight&&a.maxHeight<b.height,f=k(b.width)&&a.minWidth&&a.minWidth>b.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(f)b.width=a.minWidth;if(h)b.height=a.minHeight;if(e)b.width=a.maxWidth;if(g)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,
+l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(f&&l)b.left=i-a.minWidth;if(e&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(g&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var e=[c.css("borderTopWidth"),
+c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],g=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=d.map(e,function(f,h){f=parseInt(f,10)||0;h=parseInt(g[h],10)||0;return f+h})}d.browser.msie&&(d(b).is(":hidden")||d(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=
+this.element.offset();if(this._helper){this.helper=this.helper||d('<div style="overflow:hidden;"></div>');var a=d.browser.msie&&d.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+
+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return d.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return d.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return d.extend(this._change.n.apply(this,
+arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return d.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){d.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});d.extend(d.ui.resizable,
+{version:"1.8.1"});d.ui.plugin.add("resizable","alsoResize",{start:function(){var b=d(this).data("resizable").options,a=function(c){d(c).each(function(){d(this).data("resizable-alsoresize",{width:parseInt(d(this).width(),10),height:parseInt(d(this).height(),10),left:parseInt(d(this).css("left"),10),top:parseInt(d(this).css("top"),10)})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else d.each(b.alsoResize,function(c){a(c)});
+else a(b.alsoResize)},resize:function(){var b=d(this).data("resizable"),a=b.options,c=b.originalSize,e=b.originalPosition,g={height:b.size.height-c.height||0,width:b.size.width-c.width||0,top:b.position.top-e.top||0,left:b.position.left-e.left||0},f=function(h,i){d(h).each(function(){var j=d(this),l=d(this).data("resizable-alsoresize"),p={};d.each((i&&i.length?i:["width","height","top","left"])||["width","height","top","left"],function(n,o){if((n=(l[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(/relative/.test(j.css("position"))&&
+d.browser.opera){b._revertToRelativePosition=true;j.css({position:"absolute",top:"auto",left:"auto"})}j.css(p)})};typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?d.each(a.alsoResize,function(h,i){f(h,i)}):f(a.alsoResize)},stop:function(){var b=d(this).data("resizable");if(b._revertToRelativePosition&&d.browser.opera){b._revertToRelativePosition=false;el.css({position:"relative"})}d(this).removeData("resizable-alsoresize-start")}});d.ui.plugin.add("resizable","animate",{stop:function(b){var a=
+d(this).data("resizable"),c=a.options,e=a._proportionallyResizeElements,g=e.length&&/textarea/i.test(e[0].nodeName),f=g&&d.ui.hasScroll(e[0],"left")?0:a.sizeDiff.height;g={width:a.size.width-(g?0:a.sizeDiff.width),height:a.size.height-f};f=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(d.extend(g,h&&f?{top:h,left:f}:{}),{duration:c.animateDuration,easing:c.animateEasing,
+step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};e&&e.length&&d(e[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});d.ui.plugin.add("resizable","containment",{start:function(){var b=d(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof d?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=
+d(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:d(document),left:0,top:0,width:d(document).width(),height:d(document).height()||document.body.parentNode.scrollHeight}}else{var e=d(a),g=[];d(["Top","Right","Left","Bottom"]).each(function(i,j){g[i]=m(e.css("padding"+j))});b.containerOffset=e.offset();b.containerPosition=e.position();b.containerSize={height:e.innerHeight()-g[3],width:e.innerWidth()-g[1]};c=b.containerOffset;
+var f=b.containerSize.height,h=b.containerSize.width;h=d.ui.hasScroll(a,"left")?a.scrollWidth:h;f=d.ui.hasScroll(a)?a.scrollHeight:f;b.parentData={element:a,left:c.left,top:c.top,width:h,height:f}}}},resize:function(b){var a=d(this).data("resizable"),c=a.options,e=a.containerOffset,g=a.position;b=a._aspectRatio||b.shiftKey;var f={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))f=e;if(g.left<(a._helper?e.left:0)){a.size.width+=a._helper?a.position.left-e.left:
+a.position.left-f.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?e.left:0}if(g.top<(a._helper?e.top:0)){a.size.height+=a._helper?a.position.top-e.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?e.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-f.left:a.offset.left-f.left)+a.sizeDiff.width);e=Math.abs((a._helper?a.offset.top-f.top:a.offset.top-
+e.top)+a.sizeDiff.height);g=a.containerElement.get(0)==a.element.parent().get(0);f=/relative|absolute/.test(a.containerElement.css("position"));if(g&&f)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(e+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-e;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=d(this).data("resizable"),a=b.options,c=b.containerOffset,e=b.containerPosition,
+g=b.containerElement,f=d(b.helper),h=f.offset(),i=f.outerWidth()-b.sizeDiff.width;f=f.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(g.css("position"))&&d(this).css({left:h.left-e.left-c.left,width:i,height:f});b._helper&&!a.animate&&/static/.test(g.css("position"))&&d(this).css({left:h.left-e.left-c.left,width:i,height:f})}});d.ui.plugin.add("resizable","ghost",{start:function(){var b=d(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,
+display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=d(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=d(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});d.ui.plugin.add("resizable","grid",{resize:function(){var b=
+d(this).data("resizable"),a=b.options,c=b.size,e=b.originalSize,g=b.originalPosition,f=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-e.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-e.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(f)){b.size.width=e.width+h;b.size.height=e.height+a}else if(/^(ne)$/.test(f)){b.size.width=e.width+h;b.size.height=e.height+a;b.position.top=g.top-a}else{if(/^(sw)$/.test(f)){b.size.width=e.width+h;b.size.height=
+e.height+a}else{b.size.width=e.width+h;b.size.height=e.height+a;b.position.top=g.top-a}b.position.left=g.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.selectable.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,22 @@
+/*
+ * jQuery UI Selectable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var d=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(d.options.filter,d.element[0]);f.each(function(){var c=e(this),b=c.offset();e.data(this,"selectable-item",{element:this,$element:c,left:b.left,top:b.top,right:b.left+c.outerWidth(),bottom:b.top+c.outerHeight(),startselected:false,selected:c.hasClass("ui-selected"),
+selecting:c.hasClass("ui-selecting"),unselecting:c.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e(document.createElement("div")).css({border:"1px dotted black"}).addClass("ui-selectable-helper")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},
+_mouseStart:function(d){var f=this;this.opos=[d.pageX,d.pageY];if(!this.options.disabled){var c=this.options;this.selectees=e(c.filter,this.element[0]);this._trigger("start",d);e(c.appendTo).append(this.helper);this.helper.css({"z-index":100,position:"absolute",left:d.clientX,top:d.clientY,width:0,height:0});c.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!d.metaKey){b.$element.removeClass("ui-selected");
+b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",d,{unselecting:b.element})}});e(d.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){b.$element.removeClass("ui-unselecting").addClass("ui-selecting");b.unselecting=false;b.selecting=true;b.selected=true;f._trigger("selecting",d,{selecting:b.element});return false}})}},_mouseDrag:function(d){var f=this;this.dragged=true;if(!this.options.disabled){var c=this.options,
+b=this.opos[0],g=this.opos[1],h=d.pageX,i=d.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(c.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(c.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting");
+a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",d,{selecting:a.element})}}else{if(a.selecting)if(d.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",d,{unselecting:a.element})}if(a.selected)if(!d.metaKey&&
+!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",d,{unselecting:a.element})}}}});return false}},_mouseStop:function(d){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var c=e.data(this,"selectable-item");c.$element.removeClass("ui-unselecting");c.unselecting=false;c.startselected=false;f._trigger("unselected",d,{unselected:c.element})});e(".ui-selecting",this.element[0]).each(function(){var c=
+e.data(this,"selectable-item");c.$element.removeClass("ui-selecting").addClass("ui-selected");c.selecting=false;c.selected=true;c.startselected=true;f._trigger("selected",d,{selected:c.element})});this._trigger("stop",d);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.1"})})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.slider.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,33 @@
+/*
+ * jQuery UI Slider 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var b=this,a=this.options;this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");a.disabled&&this.element.addClass("ui-slider-disabled ui-disabled");
+this.range=d([]);if(a.range){if(a.range===true){this.range=d("<div></div>");if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}else this.range=d("<div></div>");this.range.appendTo(this.element).addClass("ui-slider-range");if(a.range==="min"||a.range==="max")this.range.addClass("ui-slider-range-"+a.range);this.range.addClass("ui-widget-header")}d(".ui-slider-handle",this.element).length===0&&d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");
+if(a.values&&a.values.length)for(;d(".ui-slider-handle",this.element).length<a.values.length;)d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");this.handles=d(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(c){c.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();
+else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(c){d(this).data("index.ui-slider-handle",c)});this.handles.keydown(function(c){var e=true,f=d(this).data("index.ui-slider-handle"),g,h,i;if(!b.options.disabled){switch(c.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:e=
+false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");g=b._start(c,f);if(g===false)return}break}i=b.options.step;g=b.options.values&&b.options.values.length?(h=b.values(f)):(h=b.value());switch(c.keyCode){case d.ui.keyCode.HOME:h=b._valueMin();break;case d.ui.keyCode.END:h=b._valueMax();break;case d.ui.keyCode.PAGE_UP:h=g+(b._valueMax()-b._valueMin())/5;break;case d.ui.keyCode.PAGE_DOWN:h=g-(b._valueMax()-b._valueMin())/5;break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(g===
+b._valueMax())return;h=g+i;break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(g===b._valueMin())return;h=g-i;break}b._slide(c,f,h);return e}}).keyup(function(c){var e=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(c,e);b._change(c,e);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");
+this._mouseDestroy();return this},_mouseCapture:function(b){var a=this.options,c,e,f,g,h,i;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c={x:b.pageX,y:b.pageY};e=this._normValueFromMouse(c);f=this._valueMax()-this._valueMin()+1;h=this;this.handles.each(function(j){var k=Math.abs(e-h.values(j));if(f>k){f=k;g=d(this);i=j}});if(a.range===true&&this.values(1)===a.min){i+=1;g=d(this.handles[i])}if(this._start(b,
+i)===false)return false;this._mouseSliding=true;h._handleIndex=i;g.addClass("ui-state-active").focus();a=g.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-g.width()/2,top:b.pageY-a.top-g.height()/2-(parseInt(g.css("borderTopWidth"),10)||0)-(parseInt(g.css("borderBottomWidth"),10)||0)+(parseInt(g.css("marginTop"),10)||0)};e=this._normValueFromMouse(c);this._slide(b,i,e);return this._animateOff=true},_mouseStart:function(){return true},
+_mouseDrag:function(b){var a=this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;
+if(this.orientation==="horizontal"){a=this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=
+this.values(a);c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var e;if(this.options.values&&this.options.values.length){e=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>e||a===1&&c<e))c=e;if(c!==this.values(a)){e=this.values();e[a]=c;b=this._trigger("slide",b,{handle:this.handles[a],value:c,values:e});this.values(a?0:1);b!==false&&this.values(a,c,true)}}else if(c!==this.value()){b=this._trigger("slide",b,{handle:this.handles[a],
+value:c});b!==false&&this.value(c)}},_stop:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("stop",b,c)},_change:function(b,a){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("change",b,c)}},value:function(b){if(arguments.length){this.options.value=
+this._trimAlignValue(b);this._refreshValue();this._change(null,0)}return this._value()},values:function(b,a){var c,e,f;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;e=arguments[0];for(f=0;f<c.length;f+=1){c[f]=this._trimAlignValue(e[f]);this._change(null,f)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(b):this.value();
+else return this._values()},_setOption:function(b,a){var c,e=0;if(d.isArray(this.options.values))e=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(b){case "disabled":if(a){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation();
+this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<e;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var b=this.options.value;return b=this._trimAlignValue(b)},_values:function(b){var a,c;if(arguments.length){a=this.options.values[b];
+return a=this._trimAlignValue(a)}else{a=this.options.values.slice();for(c=0;c<a.length;c+=1)a[c]=this._trimAlignValue(a[c]);return a}},_trimAlignValue:function(b){if(b<this._valueMin())return this._valueMin();if(b>this._valueMax())return this._valueMax();var a=this.options.step,c=b%a;b=b-c;if(c>=a/2)b+=a;return parseFloat(b.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var b=this.options.range,a=this.options,c=this,
+e=!this._animateOff?a.animate:false,f,g={},h,i,j,k;if(this.options.values&&this.options.values.length)this.handles.each(function(l){f=(c.values(l)-c._valueMin())/(c._valueMax()-c._valueMin())*100;g[c.orientation==="horizontal"?"left":"bottom"]=f+"%";d(this).stop(1,1)[e?"animate":"css"](g,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(l===0)c.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},a.animate);if(l===1)c.range[e?"animate":"css"]({width:f-h+"%"},{queue:false,duration:a.animate})}else{if(l===
+0)c.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},a.animate);if(l===1)c.range[e?"animate":"css"]({height:f-h+"%"},{queue:false,duration:a.animate})}h=f});else{i=this.value();j=this._valueMin();k=this._valueMax();f=k!==j?(i-j)/(k-j)*100:0;g[c.orientation==="horizontal"?"left":"bottom"]=f+"%";this.handle.stop(1,1)[e?"animate":"css"](g,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[e?"animate":"css"]({width:f+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[e?
+"animate":"css"]({width:100-f+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-f+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.1"})})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.sortable.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,59 @@
+/*
+ * jQuery UI Sortable 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable");
+this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(self,
+arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=
+c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,
+{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();
+if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",
+a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");
+if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+
+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()-b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+
+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+
+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,
+c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==
+document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp();this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",
+null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):
+d(this.domPosition.parent).prepend(this.currentItem);return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});return c.join("&")},toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},
+_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/
+2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection();var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=
+d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)},_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=
+this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?
+h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),
+b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element),this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?
+i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&&this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b],e=this.options.toleranceElement?d(this.options.toleranceElement,
+c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=
+this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-
+parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],
+this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=
+1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",
+a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==
+this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||
+0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-
+(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;
+if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=
+d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-
+this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+
+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;
+if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-
+this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+
+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&
+this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||
+this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove",f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",
+g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",
+this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=
+0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.1"})})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.tabs.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,34 @@
+/*
+ * jQuery UI Tabs 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(d){var s=0,u=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:'<li><a href="#{href}"><span>#{label}</span></a></li>'},_create:function(){this._tabify(true)},_setOption:function(c,e){if(c=="selected")this.options.collapsible&&e==this.options.selected||
+this.select(e);else{this.options[c]=e;this._tabify()}},_tabId:function(c){return c.title&&c.title.replace(/\s/g,"_").replace(/[^A-Za-z0-9\-_:\.]/g,"")||this.options.idPrefix+ ++s},_sanitizeSelector:function(c){return c.replace(/:/g,"\\:")},_cookie:function(){var c=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+ ++u);return d.cookie.apply(null,[c].concat(d.makeArray(arguments)))},_ui:function(c,e){return{tab:c,panel:e,index:this.anchors.index(c)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var c=
+d(this);c.html(c.data("label.tabs")).removeData("label.tabs")})},_tabify:function(c){function e(g,f){g.css({display:""});!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}this.list=this.element.find("ol,ul").eq(0);this.lis=d("li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);var a=this,b=this.options,h=/^#.+/;this.anchors.each(function(g,f){var j=d(f).attr("href"),l=j.split("#")[0],p;if(l&&(l===location.toString().split("#")[0]||
+(p=d("base")[0])&&l===p.href)){j=f.hash;f.href=j}if(h.test(j))a.panels=a.panels.add(a._sanitizeSelector(j));else if(j!="#"){d.data(f,"href.tabs",j);d.data(f,"load.tabs",j.replace(/#.*$/,""));j=a._tabId(f);f.href="#"+j;f=d("#"+j);if(!f.length){f=d(b.panelTemplate).attr("id",j).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else b.disabled.push(g)});if(c){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");
+this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(b.selected===undefined){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){b.selected=g;return false}});if(typeof b.selected!="number"&&b.cookie)b.selected=parseInt(a._cookie(),10);if(typeof b.selected!="number"&&this.lis.filter(".ui-tabs-selected").length)b.selected=
+this.lis.index(this.lis.filter(".ui-tabs-selected"));b.selected=b.selected||(this.lis.length?0:-1)}else if(b.selected===null)b.selected=-1;b.selected=b.selected>=0&&this.anchors[b.selected]||b.selected<0?b.selected:0;b.disabled=d.unique(b.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(b.selected,b.disabled)!=-1&&b.disabled.splice(d.inArray(b.selected,b.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");
+if(b.selected>=0&&this.anchors.length){this.panels.eq(b.selected).removeClass("ui-tabs-hide");this.lis.eq(b.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[b.selected],a.panels[b.selected]))});this.load(b.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else b.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"));this.element[b.collapsible?"addClass":
+"removeClass"]("ui-tabs-collapsible");b.cookie&&this._cookie(b.selected,b.cookie);c=0;for(var i;i=this.lis[c];c++)d(i)[d.inArray(c,b.disabled)!=-1&&!d(i).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");b.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(b.event!="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+g)};this.lis.bind("mouseover.tabs",
+function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(b.fx)if(d.isArray(b.fx)){m=b.fx[0];o=b.fx[1]}else m=o=b.fx;var q=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal",function(){e(f,o);a._trigger("show",
+null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},r=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")};this.anchors.bind(b.event+".tabs",
+function(){var g=this,f=d(this).closest("li"),j=a.panels.filter(":not(.ui-tabs-hide)"),l=d(a._sanitizeSelector(this.hash));if(f.hasClass("ui-tabs-selected")&&!b.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}b.selected=a.anchors.index(this);a.abort();if(b.collapsible)if(f.hasClass("ui-tabs-selected")){b.selected=-1;b.cookie&&a._cookie(b.selected,b.cookie);a.element.queue("tabs",function(){r(g,
+j)}).dequeue("tabs");this.blur();return false}else if(!j.length){b.cookie&&a._cookie(b.selected,b.cookie);a.element.queue("tabs",function(){q(g,l)});a.load(a.anchors.index(this));this.blur();return false}b.cookie&&a._cookie(b.selected,b.cookie);if(l.length){j.length&&a.element.queue("tabs",function(){r(g,j)});a.element.queue("tabs",function(){q(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier.";d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",
+function(){return false})},destroy:function(){var c=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e=d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(b,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,
+"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});c.cookie&&this._cookie(null,c.cookie);return this},add:function(c,e,a){if(a===undefined)a=this.anchors.length;var b=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,c).replace(/#\{label\}/g,e));c=!c.indexOf("#")?c.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",
+true);var i=d("#"+c);i.length||(i=d(h.panelTemplate).attr("id",c).data("destroy.tabs",true));i.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);i.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]);i.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");i.removeClass("ui-tabs-hide");
+this.element.queue("tabs",function(){b._trigger("show",null,b._ui(b.anchors[0],b.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(c){var e=this.options,a=this.lis.eq(c).remove(),b=this.panels.eq(c).remove();if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(c+(c+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=c}),function(h){return h>=c?--h:h});this._tabify();this._trigger("remove",
+null,this._ui(a.find("a")[0],b[0]));return this},enable:function(c){var e=this.options;if(d.inArray(c,e.disabled)!=-1){this.lis.eq(c).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=c});this._trigger("enable",null,this._ui(this.anchors[c],this.panels[c]));return this}},disable:function(c){var e=this.options;if(c!=e.selected){this.lis.eq(c).addClass("ui-state-disabled");e.disabled.push(c);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[c],this.panels[c]))}return this},
+select:function(c){if(typeof c=="string")c=this.anchors.index(this.anchors.filter("[href$="+c+"]"));else if(c===null)c=-1;if(c==-1&&this.options.collapsible)c=this.options.selected;this.anchors.eq(c).trigger(this.options.event+".tabs");return this},load:function(c){var e=this,a=this.options,b=this.anchors.eq(c)[0],h=d.data(b,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(b,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(c).addClass("ui-state-processing");
+if(a.spinner){var i=d("span",b);i.data("label.tabs",i.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){d(e._sanitizeSelector(b.hash)).html(k);e._cleanup();a.cache&&d.data(b,"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[c],e.panels[c]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[c],e.panels[c]));try{a.ajaxOptions.error(k,n,c,b)}catch(m){}}}));e.element.dequeue("tabs");return this}},
+abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},url:function(c,e){this.anchors.eq(c).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.1"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(c,e){var a=this,b=this.options,h=a._rotate||(a._rotate=
+function(i){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=b.selected;a.select(++k<a.anchors.length?k:0)},c);i&&i.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(i){i.clientX&&a.rotate(null)}:function(){t=b.selected;h()});if(c){this.element.bind("tabsshow",h);this.anchors.bind(b.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(b.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery);
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/web/static/js/ui/minified/jquery.ui.widget.min.js Sat Jun 12 00:33:37 2010 +0200
@@ -0,0 +1,15 @@
+/*!
+ * jQuery UI Widget 1.8.1
+ *
+ * Copyright (c) 2010 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function(b){var j=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add(this).each(function(){b(this).triggerHandler("remove")});return j.call(b(this),a,c)})};b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend({},c.options);b[e][a].prototype=
+b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.substring(0,1)==="_")return h;e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==undefined){h=i;return false}}):this.each(function(){var g=
+b.data(this,a);if(g){d&&g.option(d);g._init()}else b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){this.element=b(c).data(this.widgetName,this);this.options=b.extend(true,{},this.options,b.metadata&&b.metadata.get(c)[this.widgetName],a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();
+this._init()},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(a,c){var d=a,e=this;if(arguments.length===0)return b.extend({},e.options);if(typeof a==="string"){if(c===undefined)return this.options[a];d={};d[a]=c}b.each(d,function(f,
+h){e._setOption(f,h)});return e},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=
+b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
Binary file web/static/swf/player.swf has changed
