File Index
+ + +
+
+ LdtPlayer-release.js
+ +-
+
+
+
+
+
+ + +
'+(c?h:"")+(this._isInRange(a,s)?'":"")+(c?"":h)+"
":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),A=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x'+(/all|left/.test(t)&&
+x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,A,v)+'
| '+this._get(a,"weekHeader")+" | ":"";for(t=0;t<7;t++){var r=(t+h)%7;z+="'+this._get(a,"calculateWeek")(r)+" | ";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&r"+(F&&!D?" ":L?''+ +r.getDate()+"":''+r.getDate()+"")+" | ";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+""}g++;if(g>11){g=0;m++}y+="
|---|
',o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,
+e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="
";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c=="Y"?b:0),f=a.drawMonth+
+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b'+(c?h:"")+(this._isInRange(a,r)?'":"")+(c?"":h)+"
":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;k=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),w=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var M=this._getDefaultDate(a),I="",C=0;C'+(/all|left/.test(t)&&C==0?c?
-f:n:"")+(/all|right/.test(t)&&C==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,j,o,C>0||D>0,z,v)+'
| '+this._get(a,"weekHeader")+" | ":"";for(t=0;t<7;t++){var q=(t+h)%7;A+="'+this._get(a,"calculateWeek")(q)+" | ";for(t=0;t<7;t++){var F=p?p.apply(a.input?a.input[0]:null,[q]):[true,""],B=q.getMonth()!=g,K=B&&!H||!F[0]||j&&q"+(B&&!w?" ":K?''+q.getDate()+ -"":''+q.getDate()+"")+" | ";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+=P+""}g++;if(g>11){g=0;m++}x+="
|---|
',o="";if(h||!k)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(j+=o+(h||!(k&&l)?" ":""));if(h||!l)j+=''+c+"";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,
-i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(j+='"}j+=this._get(a,"yearSuffix");if(u)j+=(h||!(k&&l)?" ":"")+o;j+="
";return j},_adjustInstDate:function(a,b,c){var e=
-a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b
/
{{title}}
{{begin}} : {{end}}
{{description}}
";
+IriSP.tweetWidget_template = "{{! template for the tweet widget }}";/* wrapper that simulates popcorn.js because
+ popcorn is a bit unstable at the time */
+
+IriSP.PopcornReplacement = {
+ msgPump : {} /* used by jquery to receive and send messages */
+};
+
+IriSP.PopcornReplacement.media = {
+ "paused": true,
+ "muted": false
+};
+
+IriSP.PopcornReplacement.listen = function(msg, callback) {
+// IriSP.jQuery(IriSP.PopcornReplacement.msgPump).bind(msg, function(event, rest) { callback(rest); });
+ if (!IriSP.PopcornReplacement.msgPump.hasOwnProperty(msg))
+ IriSP.PopcornReplacement.msgPump[msg] = [];
+
+ IriSP.PopcornReplacement.msgPump[msg].push(callback);
+};
+
+IriSP.PopcornReplacement.trigger = function(msg, params) {
+// IriSP.jQuery(IriSP.PopcornReplacement.msgPump).trigger(msg, params);
+
+ if (!IriSP.PopcornReplacement.msgPump.hasOwnProperty(msg))
+ return;
+
+ var d = IriSP.PopcornReplacement.msgPump[msg];
+ for(var entry in d) {
+ d[entry].call(window, params);
+ }
+
+};
+
+IriSP.PopcornReplacement.guid = function(prefix) {
+ var str = 'xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g, function(c) {
+ var r = Math.random()*16|0, v = c == 'x' ? r : (r&0x3|0x8);
+ return v.toString(16);
+ });
+
+ return prefix + str;
+};
+
+IriSP.PopcornReplacement.__initApi = function() {
+ IriSP.PopcornReplacement.trigger("loadedmetadata"); // we've done more than loading metadata of course,
+ // but popcorn doesn't need to know more.
+ IriSP.PopcornReplacement.media.muted = jwplayer(IriSP.PopcornReplacement._container).getMute();
+};
+
+IriSP.PopcornReplacement.jwplayer = function(container, options) {
+ IriSP.PopcornReplacement._container = container.slice(1); //eschew the '#'
+ options.events = {
+ onReady: IriSP.PopcornReplacement.__initApi,
+ onTime: IriSP.PopcornReplacement.__timeHandler,
+ onPlay: IriSP.PopcornReplacement.__playHandler,
+ onPause: IriSP.PopcornReplacement.__pauseHandler,
+ onSeek: IriSP.PopcornReplacement.__seekHandler
+ }
+
+ jwplayer(IriSP.PopcornReplacement._container).setup(options);
+ IriSP.PopcornReplacement.media.duration = options.duration;
+ return IriSP.PopcornReplacement;
+};
+
+IriSP.PopcornReplacement.currentTime = function(time) {
+ if (typeof(time) === "undefined") {
+ return jwplayer(IriSP.PopcornReplacement._container).getPosition();
+ } else {
+ var currentTime = +time;
+ jwplayer( IriSP.PopcornReplacement._container ).seek( currentTime );
+ IriSP.PopcornReplacement.trigger("seeked");
+ return jwplayer(IriSP.PopcornReplacement._container).getPosition();
+ }
+};
+
+IriSP.PopcornReplacement.play = function() {
+ IriSP.PopcornReplacement.media.paused = false;
+ IriSP.PopcornReplacement.trigger("play");
+// IriSP.PopcornReplacement.trigger("playing");
+ jwplayer( IriSP.PopcornReplacement._container ).play();
+};
+
+IriSP.PopcornReplacement.pause = function() {
+ if ( !IriSP.PopcornReplacement.media.paused ) {
+ IriSP.PopcornReplacement.media.paused = true;
+ IriSP.PopcornReplacement.trigger( "pause" );
+ jwplayer( IriSP.PopcornReplacement._container ).pause();
+ }
+};
+
+IriSP.PopcornReplacement.muted = function(val) {
+ if (typeof(val) !== "undefined") {
+
+ if (jwplayer(IriSP.PopcornReplacement._container).getMute() !== val) {
+ if (val) {
+ jwplayer(IriSP.PopcornReplacement._container).setMute(true);
+ IriSP.PopcornReplacement.media.muted = true;
+ } else {
+ jwplayer( IriSP.PopcornReplacement._container ).setMute(false);
+ IriSP.PopcornReplacement.media.muted = false;
+ }
+
+ IriSP.PopcornReplacement.trigger( "volumechange" );
+ }
+
+ return jwplayer( IriSP.PopcornReplacement._container ).getMute();
+ } else {
+ return jwplayer( IriSP.PopcornReplacement._container ).getMute();
+ }
+};
+
+IriSP.PopcornReplacement.mute = IriSP.PopcornReplacement.muted;
+
+IriSP.PopcornReplacement.__codes = [];
+IriSP.PopcornReplacement.code = function(options) {
+ IriSP.PopcornReplacement.__codes.push(options);
+ return IriSP.PopcornReplacement;
+};
+
+IriSP.PopcornReplacement.__runCode = function() {
+ var currentTime = jwplayer(IriSP.PopcornReplacement._container).getPosition();
+ var i = 0;
+ for(i = 0; i < IriSP.PopcornReplacement.__codes.length; i++) {
+ var c = IriSP.PopcornReplacement.__codes[i];
+ if (currentTime == c.start) {
+ c.onStart();
+ }
+
+ if (currentTime == c.end) {
+ c.onEnd();
+ }
+
+ }
+};
+
+/* called everytime the player updates itself
+ (onTime event)
+ */
+
+IriSP.PopcornReplacement.__timeHandler = function(event) {
+ var pos = event.position;
+
+ var i = 0;
+ for(i = 0; i < IriSP.PopcornReplacement.__codes.length; i++) {
+ var c = IriSP.PopcornReplacement.__codes[i];
+
+ if (pos >= c.start && pos < c.end &&
+ pos - 0.1 <= c.start) {
+ c.onStart();
+ }
+
+ if (pos > c.start && pos > c.end &&
+ pos - 0.1 <= c.end) {
+ console.log("eonedn");
+ c.onEnd();
+ }
+
+ }
+
+ IriSP.PopcornReplacement.trigger("timeupdate");
+};
+
+IriSP.PopcornReplacement.__seekHandler = function(event) {
+ var i = 0;
+
+ for(i = 0; i < IriSP.PopcornReplacement.__codes.length; i++) {
+ var c = IriSP.PopcornReplacement.__codes[i];
+
+ if (event.position >= c.start && event.position < c.end) {
+ c.onEnd();
+ }
+ }
+
+ for(i = 0; i < IriSP.PopcornReplacement.__codes.length; i++) {
+ var c = IriSP.PopcornReplacement.__codes[i];
+
+ if (typeof(event.offset) === "undefined")
+ event.offset = 0;
+
+ if (event.offset >= c.start && event.offset < c.end) {
+ c.onStart();
+ }
+
+ }
+
+ IriSP.PopcornReplacement.trigger("timeupdate");
+};
+
+
+IriSP.PopcornReplacement.__playHandler = function(event) {
+ IriSP.PopcornReplacement.media.paused = false;
+ IriSP.PopcornReplacement.trigger("play");
+};
+
+IriSP.PopcornReplacement.__pauseHandler = function(event) {
+ IriSP.PopcornReplacement.media.paused = true;
+ IriSP.PopcornReplacement.trigger("pause");
+};
+
+IriSP.PopcornReplacement.roundTime = function() {
+ var currentTime = IriSP.PopcornReplacement.currentTime();
+ return Math.round(currentTime);
+};
+/* utils.js - various utils that don't belong anywhere else */
+
+/* trace function, for debugging */
+
+IriSP.traceNum = 0;
+IriSP.trace = function( msg, value ) {
+/*
+ if( IriSP.config.gui.debug === true ) {
+ IriSP.traceNum += 1;
+ IriSP.jQuery( "i||a.bottomb&&a.rightg&&a.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable");
+this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a===
+"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&
+!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,
+left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};
+this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=
+document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);
+return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],
+e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();
+c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):
+this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,
+dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},
+toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+jg&&b+la[this.floating?"width":"height"]?j:g0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();
+if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),
+this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=
+this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=
+d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||
+0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",
+a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-
+f)this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-
+this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?f:!(f-this.offset.click.left=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,
+this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",
+a,this._uiHash());for(e=0;e li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");
+a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion",
+function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a=
+this.options;if(a.icons){c("").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex");
+this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons();
+b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target);
+a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+
+c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options;
+if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);
+if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(),
+e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight||
+e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false",
+"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.13",
+animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/);
+f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide",
+paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery);
+;/*
+ * jQuery UI Autocomplete 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g=
+false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=
+a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};
+this.menu=d("").data("item.autocomplete",b).append(d("").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,
+"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery);
+(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
+-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");
+this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,
+this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||
+this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||
+this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,f=d.primary&&d.secondary,e=[];if(d.primary||d.secondary){if(this.options.text)e.push("ui-button-text-icon"+(f?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("");d.secondary&&b.append("");if(!this.options.text){e.push(f?"ui-button-icons-only":
+"ui-button-icon-only");this.hasTitle||b.attr("title",c)}}else e.push("ui-button-text-only");b.addClass(e.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()},
+destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery);
+;/*
+ * jQuery UI Dialog 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.button.js
+ * jquery.ui.draggable.js
+ * jquery.ui.mouse.js
+ * jquery.ui.position.js
+ * jquery.ui.resizable.js
+ */
+(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,
+position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+
+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),
+h=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("").addClass("ui-dialog-title").attr("id",
+e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");
+a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==
+b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=
+1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===
+f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,
+function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",
+handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,
+originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",
+f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):
+[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);
+if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):
+e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=
+this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-
+b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.13",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),
+create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()
").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),
+height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);
+b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a"+IriSP.traceNum+" - "+msg+" : "+value+"
" ).appendTo( "#Ldt-output" );
+ }
+*/
+};
+
+/* used in callbacks - because in callbacks we lose "this",
+ we need to have a special function which wraps "this" in
+ a closure. This way, the
+*/
+IriSP.wrap = function (obj, fn) {
+ return function() {
+ var args = Array.prototype.slice.call(arguments, 0);
+ return fn.apply(obj, args);
+ }
+}
+
+/* convert a time to a percentage in the media */
+IriSP.timeToPourcent = function(time, timetotal){
+ var time = Math.abs(time);
+ var timetotal = Math.abs(timetotal);
+
+ return Math.floor((time/timetotal) * 100);
+};
+
+IriSP.padWithZeros = function(num) {
+ if (Math.abs(num) < 10) {
+ return "0" + num.toString();
+ } else {
+ return num.toString();
+ }
+};
+/* convert a number of seconds to a tuple of the form
+ [hours, minutes, seconds]
+*/
+IriSP.secondsToTime = function(secs) {
+ var hours = Math.abs(parseInt( secs / 3600 ) % 24);
+ var minutes = Math.abs(parseInt( secs / 60 ) % 60);
+ var seconds = parseFloat(Math.abs(secs % 60).toFixed(0));
+
+ var toString_fn = function() {
+ var ret = "";
+ if (hours > 0)
+ ret = IriSP.padWithZeros(this.hours) + ":";
+ ret += IriSP.padWithZeros(this.minutes) + ":" + IriSP.padWithZeros(this.seconds);
+
+ return ret;
+ }
+ return {"hours" : hours, "minutes" : minutes, "seconds" : seconds, toString: toString_fn};
+};
+
+IriSP.secondsToString
+
+/* format a tweet - replaces @name by a link to the profile, #hashtag, etc. */
+IriSP.formatTweet = function(tweet) {
+ /*
+ an array of arrays which hold a regexp and its replacement.
+ */
+ var regExps = [
+ /* copied from http://codegolf.stackexchange.com/questions/464/shortest-url-regex-match-in-javascript/480#480 */
+ [/((https?:\/\/)?[\w-]+(\.[\w-]+)+\.?(:\d+)?(\/\S*)?)/gi, "$1"],
+ [/@(\w+)/gi, "@$1"], // matches a @handle
+ [/#(\w+)/gi, "#$1"],// matches a hashtag
+ [/(\+\+)/gi, "$1"],
+ [/(--)/gi, "$1"],
+ [/(==)/gi, "$1"],
+ [/(\?\?)/gi, "$1"]
+ ];
+
+ var i = 0;
+ for(i = 0; i < regExps.length; i++) {
+ tweet = tweet.replace(regExps[i][0], regExps[i][1]);
+ }
+
+ return tweet;
+};
+
+IriSP.countProperties = function(obj) {
+ var count = 0;
+
+ for(var prop in obj) {
+ if(obj.hasOwnProperty(prop))
+ ++count;
+ }
+
+ return count;
+};
+
+// conversion de couleur Decimal vers HexaDecimal || 000 si fff
+IriSP.DEC_HEXA_COLOR = function (dec) {
+ var hexa='0123456789ABCDEF';
+ var hex='';
+ var tmp;
+ while (dec>15){
+ tmp = dec-(Math.floor(dec/16))*16;
+ hex = hexa.charAt(tmp)+hex;
+ dec = Math.floor(dec/16);
+ }
+ hex = hexa.charAt(dec)+hex;
+ return(hex);
+};
+
+/* shortcut to have global variables in templates */
+IriSP.templToHTML = function(template, values) {
+ var params = IriSP.jQuery.extend(IriSP.default_templates_vars, values);
+ return Mustache.to_html(template, params);
+};
+
+/* we need to be stricter than encodeURIComponent,
+ because of twitter
+*/
+IriSP.encodeURI = function(str) {
+ return encodeURIComponent(str).replace(/!/g, '%21').replace(/'/g, '%27').replace(/\(/g, '%28').
+ replace(/\)/g, '%29').replace(/\*/g, '%2A');
+}
+
+IriSP.__guidCounter = 0;
+IriSP.guid = function(prefix) {
+ IriSP.__guidCounter += 1;
+ return prefix + IriSP.__guidCounter;
+};
+/* for ie compatibility
+if (Object.prototype.__defineGetter__&&!Object.defineProperty) {
+ Object.defineProperty=function(obj,prop,desc) {
+ if ("get" in desc) obj.__defineGetter__(prop,desc.get);
+ if ("set" in desc) obj.__defineSetter__(prop,desc.set);
+ }
+}
+*/
+/* data.js - this file deals with how the players gets and sends data */
+
+IriSP.DataLoader = function() {
+ this._cache = {};
+
+ /*
+ A structure to hold callbacks for specific urls. We need it because
+ ajax calls are asynchronous, so it means that sometimes we ask
+ multiple times for a ressource because the first call hasn't been
+ received yet.
+ */
+ this._callbacks = {};
+};
+
+IriSP.DataLoader.prototype.get = function(url, callback) {
+
+ var base_url = url.split("&")[0]
+ if (this._cache.hasOwnProperty(base_url)) {
+ callback(this._cache[base_url]);
+ } else {
+ if (!this._callbacks.hasOwnProperty(base_url)) {
+ this._callbacks[base_url] = [];
+ this._callbacks[base_url].push(callback);
+ /* we need a closure because this gets lost when it's called back */
+
+ // uncomment you don't want to use caching.
+ // IriSP.jQuery.get(url, callback);
+
+ var func = function(data) {
+ this._cache[base_url] = data;
+ var i = 0;
+
+ for (i = 0; i < this._callbacks[base_url].length; i++) {
+ this._callbacks[base_url][i](this._cache[base_url]);
+ }
+ };
+
+ /* automagically choose between json and jsonp */
+ if (url.indexOf(document.location.hostname) === -1 &&
+ url.indexOf("http://") !== -1 /* not a relative url */ ) {
+ // we contacting a foreign domain, use JSONP
+
+ IriSP.jQuery.get(url, {}, IriSP.wrap(this, func), "jsonp");
+ } else {
+
+ // otherwise, hey, whatever rows your boat
+ IriSP.jQuery.get(url, IriSP.wrap(this, func));
+ }
+
+ } else {
+ /* simply push the callback - it'll get called when the ressource
+ has been received */
+
+ this._callbacks[base_url].push(callback);
+
+ }
+ }
+}
+
+/* the base abstract "class" */
+IriSP.Serializer = function(DataLoader, url) {
+ this._DataLoader = DataLoader;
+ this._url = url;
+ this._data = [];
+};
+
+IriSP.Serializer.prototype.serialize = function(data) { };
+IriSP.Serializer.prototype.deserialize = function(data) {};
+
+IriSP.Serializer.prototype.currentMedia = function() {
+};
+
+IriSP.Serializer.prototype.sync = function(callback) {
+ callback.call(this, this._data);
+};
+
+IriSP.SerializerFactory = function(DataLoader) {
+ this._dataloader = DataLoader;
+};
+
+IriSP.SerializerFactory.prototype.getSerializer = function(metadataOptions) {
+ /* This function returns serializer set-up with the correct
+ configuration - takes a metadata struct describing the metadata source
+ */
+
+ if (metadataOptions === undefined)
+ /* return an empty serializer */
+ return IriSP.Serializer("", "");
+
+ switch(metadataOptions.type) {
+ case "json":
+ return new IriSP.JSONSerializer(this._dataloader, metadataOptions.src);
+ break;
+
+ case "dummy": /* only used for unit testing - not defined in production */
+ return new IriSP.MockSerializer(this._dataloader, metadataOptions.src);
+ break;
+
+ case "empty":
+ return new IriSP.Serializer("", "empty");
+ break;
+
+ default:
+ return undefined;
+ }
+};
+/* site.js - all our site-dependent config : player chrome, cdn locations, etc...*/
+
+IriSP.lib = {
+ jQuery : "http://ajax.googleapis.com/ajax/libs/jquery/1.4.2/jquery.js",
+ jQueryUI : "http://ajax.googleapis.com/ajax/libs/jqueryui/1.8.4/jquery-ui.js",
+ jQueryToolTip : "http://cdn.jquerytools.org/1.2.4/all/jquery.tools.min.js",
+ swfObject : "http://ajax.googleapis.com/ajax/libs/swfobject/2.2/swfobject.js",
+ cssjQueryUI : "http://ajax.googleapis.com/ajax/libs/jqueryui/1.8.4/themes/base/jquery-ui.css",
+ popcorn : "/mdp/src/js/libs/popcorn.js",
+ jwplayer : "/mdp/src/js/libs/jwplayer.js",
+ popcornReplacement: "/mdp/src/js/libs/pop.js",
+ raphael: "/mdp/src/js/libs/raphael.js",
+ "popcorn.mediafragment" : "/mdp/src/js/libs/popcorn.mediafragment.js",
+ "popcorn.code" : "/mdp/src/js/libs/popcorn.code.js",
+ "popcorn.jwplayer": "/mdp/src/js/libs/popcorn.jwplayer.js",
+ "popcorn.youtube": "/mdp/src/js/libs/popcorn.youtube.js"
+};
+
+//Player Configuration
+IriSP.config = undefined;
+
+IriSP.widgetsDefaults = {
+ "LayoutManager" : {spacer_div_height : "0px" },
+ "PlayerWidget" : {},
+ "AnnotationsWidget": {
+ "share_text" : "I'm watching ",
+ "fb_link" : "http://www.facebook.com/share.php?u=",
+ "tw_link" : "http://twitter.com/home?status=",
+ "gplus_link" : ""
+ },
+ "TweetsWidget" : {
+ default_profile_picture : "https://si0.twimg.com/sticky/default_profile_images/default_profile_1_normal.png",
+ tweet_display_period: 10000 // how long do we show a tweet ?
+ },
+ "SliderWidget" : {
+ minimize_period: 850 // how long does the slider stays maximized after the user leaves the zone ?
+ },
+ "Main" : {
+ autoplay: true
+ }
+
+};
+
+IriSP.paths = {
+// "imgs": "/tweetlive/res/metadataplayer/src/css/imgs"
+ "imgs": "/mdp/src/css/imgs"
+};
+IriSP.default_templates_vars = {
+ "img_dir" : IriSP.paths.imgs
+};
+
+/* ui.js - ui related functions */
+
+/* FIXME: use an sharing library */
+IriSP.LdtShareTool = IriSP.share_template; /* the contents come from share.html */
+
+IriSP.createPlayerChrome = function(){
+ var width = IriSP.config.gui.width;
+ var height = IriSP.config.gui.height;
+ var heightS = IriSP.config.gui.height-20;
+
+ // AUDIO */
+ // PB dans le html : ;
+ IriSP.trace( "__IriSP.createMyHtml",IriSP.config.gui.container );
+
+
+ /* FIXME : factor this in another file */
+ if( IriSP.config.gui.mode=="radio" ){
+
+ IriSP.jQuery( "#"+IriSP.config.gui.container ).before(IriSP.search_template);
+ var radioPlayer = Mustache.to_html(IriSP.radio_template, {"share_template" : IriSP.share_template});
+ IriSP.jQuery(radioPlayer).appendTo("#"+IriSP.config.gui.container);
+
+ // special tricks for IE 7
+ if (IriSP.jQuery.browser.msie==true && IriSP.jQuery.browser.version=="7.0"){
+ //LdtSearchContainer
+ //__IriSP.jQuery("#LdtPlayer").attr("margin-top","50px");
+ IriSP.jQuery("#Ldt-Root").css("padding-top","25px");
+ IriSP.trace("__IriSP.createHtml","IE7 SPECIAL ");
+ }
+ } else if(IriSP.config.gui.mode=="video") {
+
+ var videoPlayer = Mustache.to_html(IriSP.video_template, {"share_template" : IriSP.share_template, "heightS" : heightS});
+ IriSP.jQuery(videoPlayer).appendTo("#"+IriSP.config.gui.container);
+ }
+
+ IriSP.jQuery("#Ldt-Annotations").width(width-(75*2));
+ IriSP.jQuery("#Ldt-Show-Arrow-container").width(width-(75*2));
+ IriSP.jQuery("#Ldt-ShowAnnotation-audio").width(width-10);
+ IriSP.jQuery("#Ldt-ShowAnnotation-video").width(width-10);
+ IriSP.jQuery("#Ldt-SaKeyword").width(width-10);
+ IriSP.jQuery("#Ldt-controler").width(width-10);
+ IriSP.jQuery("#Ldt-Control").attr("z-index","100");
+ IriSP.jQuery("#Ldt-controler").hide();
+
+ IriSP.jQuery(IriSP.annotation_loading_template).appendTo("#Ldt-ShowAnnotation-audio");
+
+ if(IriSP.config.gui.mode=='radio'){
+ IriSP.jQuery("#Ldt-load-container").attr("width",IriSP.config.gui.width);
+ }
+ // Show or not the output
+ if(IriSP.config.gui.debug===true){
+ IriSP.jQuery("#Ldt-output").show();
+ } else {
+ IriSP.jQuery("#Ldt-output").hide();
+ }
+
+};
+
+
+/* create the buttons and the slider */
+IriSP.createInterface = function( width, height, duration ) {
+
+ IriSP.jQuery( "#Ldt-controler" ).show();
+ //__IriSP.jQuery("#Ldt-Root").css('display','visible');
+ IriSP.trace( "__IriSP.createInterface" , width+","+height+","+duration+"," );
+
+ IriSP.jQuery( "#Ldt-ShowAnnotation").click( function () {
+ //__IriSP.jQuery(this).slideUp();
+ } );
+
+ var LdtpPlayerY = IriSP.jQuery("#Ldt-PlaceHolder").attr("top");
+ var LdtpPlayerX = IriSP.jQuery("#Ldt-PlaceHolder").attr("left");
+
+ IriSP.jQuery( "#slider-range-min" ).slider( { //range: "min",
+ value: 0,
+ min: 1,
+ max: duration/1000,//1:54:52.66 = 3600+3240+
+ step: 0.1,
+ slide: function(event, ui) {
+
+ //__IriSP.jQuery("#amount").val(ui.value+" s");
+ //player.sendEvent('SEEK', ui.value)
+ IriSP.MyApiPlayer.seek(ui.value);
+ //changePageUrlOffset(ui.value);
+ //player.sendEvent('PAUSE')
+ }
+ } );
+
+ IriSP.trace("__IriSP.createInterface","ICI");
+ IriSP.jQuery("#amount").val(IriSP.jQuery("#slider-range-min").slider("value")+" s");
+ IriSP.jQuery(".Ldt-Control1 button:first").button({
+ icons: {
+ primary: 'ui-icon-play'
+ },
+ text: false
+ }).next().button({
+ icons: {
+ primary: 'ui-icon-seek-next'
+ },
+ text: false
+ });
+ IriSP.jQuery(".Ldt-Control2 button:first").button({
+ icons: {
+ primary: 'ui-icon-search'//,
+ //secondary: 'ui-icon-volume-off'
+ },
+ text: false
+ }).next().button({
+ icons: {
+ primary: 'ui-icon-volume-on'
+ },
+ text: false
+ });
+
+ // /!\ PB A MODIFIER
+ //__IriSP.MyTags.draw();
+ IriSP.trace("__IriSP.createInterface","ICI2");
+ IriSP.jQuery( "#ldt-CtrlPlay" ).attr( "style", "background-color:#CD21C24;" );
+
+ IriSP.jQuery( "#Ldt-load-container" ).hide();
+
+ if( IriSP.config.gui.mode=="radio" & IriSP.jQuery.browser.msie != true ) {
+ IriSP.jQuery( "#Ldtplayer1" ).attr( "height", "0" );
+ }
+ IriSP.trace( "__IriSP.createInterface" , "3" );
+
+ IriSP.trace( "__IriSP.createInterface", "END" );
+
+ };
+/* the widget classes and definitions */
+
+IriSP.Widget = function(Popcorn, config, Serializer) {
+
+ if (config === undefined || config === null) {
+ config = {}
+ }
+
+ this._Popcorn = Popcorn;
+ this._config = config;
+ this._serializer = Serializer;
+
+ if (config.hasOwnProperty("container")) {
+ this._id = config.container;
+ this.selector = IriSP.jQuery("#" + this._id);
+ }
+
+ if (config.hasOwnProperty("spacer")) {
+ this._spacerId = config.spacer;
+ this.spacer = IriSP.jQuery("#" + this._spacerId);
+ }
+
+
+ if (config.hasOwnProperty("width")) {
+ // this.width and not this._width because we consider it public.
+ this.width = config.width;
+ }
+
+ if (config.hasOwnProperty("height")) {
+ this.height = config.height;
+ }
+
+ if (config.hasOwnProperty("heightmax")) {
+ this.heightmax = config.heightmax;
+ }
+
+ if (config.hasOwnProperty("widthmax")) {
+ this.widthmax = config.widthmax;
+ }
+
+};
+
+IriSP.Widget.prototype.draw = function() {
+ /* implemented by "sub-classes" */
+};
+
+IriSP.Widget.prototype.redraw = function() {
+ /* implemented by "sub-classes" */
+};
+/* modules are non-graphical entities, similar to widgets */
+
+IriSP.Module = function(Popcorn, config, Serializer) {
+
+ if (config === undefined || config === null) {
+ config = {}
+ }
+
+ this._Popcorn = Popcorn;
+ this._config = config;
+ this._serializer = Serializer;
+};
+/* layout.js - very basic layout management */
+
+/*
+ a layout manager manages a div and the layout of objects
+ inside it.
+*/
+
+IriSP.LayoutManager = function(options) {
+ this._Popcorn = null;
+ this._widgets = [];
+
+ this._div = "LdtPlayer";
+ this._width = 640;
+
+ if (options === undefined) {
+ options = {};
+ };
+
+ if (options.hasOwnProperty('container')) {
+ this._div = options.container;
+ }
+
+ if (options.hasOwnProperty('width')) {
+ this._width = options.width;
+ }
+
+ if (options.hasOwnProperty('height')) {
+ this._height = options.height;
+ }
+
+ /* this is a shortcut */
+ this.selector = IriSP.jQuery("#" + this._div);
+
+ this.selector.css("width", this._width);
+
+ if (this._height !== undefined)
+ this.selector.css("height", this._height);
+};
+
+/* we need this special setter because of a chicken and egg problem :
+ we want the manager to use popcorn but the popcorn div will be managed
+ by the manager. So we need a way to set the instance the manager uses
+*/
+
+IriSP.LayoutManager.prototype.setPopcornInstance = function(popcorn) {
+ this._Popcorn = popcorn;
+}
+
+/* stem is a string to append to the id of the widget */
+IriSP.LayoutManager.prototype.createDiv = function(stem) {
+ if (typeof(stem) === "undefined")
+ stem = "";
+
+ var newDiv = IriSP.guid(this._div + "_widget_" + stem + "_");
+ var spacerDiv = IriSP.guid("LdtPlayer_spacer_");
+ this._widgets.push(newDiv);
+
+ var divTempl = "");
+
+ if (options.hasOwnProperty("width"))
+ IriSP.jQuery("#" + containerDiv).css("width", options.width);
+
+ if (options.hasOwnProperty("height"))
+ IriSP.jQuery("#" + containerDiv).css("height", options.height);
+
+ pop = Popcorn("#" + tmpId);
+ break;
+
+ case "jwplayer":
+ var opts = IriSP.jQuery.extend({}, options);
+ delete opts.container;
+
+ if (options.provider === "rtmp") {
+ /* exit if we can't access the metadata */
+ if (typeof(IriSP.__jsonMetadata) === "undefined") {
+ break;
+ };
+
+
+ // the json format is totally illogical
+ opts.streamer = IriSP.__jsonMetadata["medias"][0]["meta"]["item"]["value"];
+ var source = IriSP.__jsonMetadata["medias"][0]["href"];
+
+ // the source if a full url but jwplayer wants an url relative to the
+ // streamer url, so we've got to remove the common part.
+ opts.file = source.slice(opts.streamer.length);
+ } else {
+ /* other providers type, video for instance -
+ pass everything as is */
+ }
+
+ pop = IriSP.PopcornReplacement.jwplayer("#" + containerDiv, opts);
+ break;
+
+ case "youtube":
+ var opts = IriSP.jQuery.extend({}, options);
+ delete opts.container;
+ opts.controls = 0;
+ opts.autostart = false;
+ templ = "width: {{width}}px; height: {{height}}px;";
+ var str = Mustache.to_html(templ, {width: opts.width, height: opts.height});
+ // Popcorn.youtube wants us to specify the size of the player in the style attribute of its container div.
+ IriSP.jQuery("#" + containerDiv).attr("style", str);
+
+ pop = Popcorn.youtube("#" + containerDiv, opts.video, opts);
+ break;
+
+ default:
+ pop = undefined;
+ };
+
+ return pop;
+};
+
+IriSP.configureWidgets = function (popcornInstance, layoutManager, guiOptions) {
+
+ var serialFactory = new IriSP.SerializerFactory(IriSP.__dataloader);
+ var params = {width: guiOptions.width, height: guiOptions.height};
+
+ var ret_widgets = [];
+ var index;
+
+ for (index = 0; index < guiOptions.widgets.length; index++) {
+ var widgetConfig = guiOptions.widgets[index];
+ var widget = IriSP.instantiateWidget(popcornInstance, serialFactory, layoutManager, widgetConfig);
+ ret_widgets.push(widget);
+
+ };
+
+ return ret_widgets;
+};
+
+IriSP.configureModules = function (popcornInstance, modulesList) {
+
+ var serialFactory = new IriSP.SerializerFactory(IriSP.__dataloader);
+ var ret_modules = [];
+ var index;
+
+ for (index = 0; index < modulesList.length; index++) {
+ var moduleConfig = modulesList[index];
+
+ var serializer = serialFactory.getSerializer(moduleConfig.metadata);
+ var module = new IriSP[moduleConfig.type](popcornInstance, moduleConfig, serializer);
+ ret_modules.push(module);
+ };
+
+ return ret_modules;
+};
+
+IriSP.instantiateWidget = function(popcornInstance, serialFactory, layoutManager, widgetConfig) {
+ /* create div returns us a container for the widget and a spacer */
+ var ret = layoutManager.createDiv(widgetConfig.type);
+ var container = ret[0];
+ var spacer = ret[1];
+
+ var arr = IriSP.jQuery.extend({}, widgetConfig);
+ arr.container = container;
+ arr.spacer = spacer;
+
+ var serializer = serialFactory.getSerializer(widgetConfig.metadata);
+
+ if (typeof serializer == "undefined")
+ debugger;
+
+ // instantiate the object passed as a string
+ var widget = new IriSP[widgetConfig.type](popcornInstance, arr, serializer);
+
+ if (widgetConfig.hasOwnProperty("requires")) {
+ // also create the widgets this one depends on.
+ // the dependency widget is available in the parent widget context as
+ // this.WidgetName (for instance, this.TipWidget);
+
+ var i = 0;
+ for(i = 0; i < widgetConfig.requires.length; i++) {
+ var widgetName = widgetConfig.requires[i]["type"];
+ widget[widgetName] = IriSP.instantiateWidget(popcornInstance, serialFactory, layoutManager, widgetConfig.requires[i]);
+ }
+ }
+
+ serializer.sync(IriSP.wrap(widget, function() { this.draw(); }));
+ return widget;
+};
+/* mediafragment module */
+
+IriSP.MediaFragment = function(Popcorn, config, Serializer) {
+ IriSP.Module.call(this, Popcorn, config, Serializer);
+
+ this.mutex = false; /* a mutex because we access the url from two different functions */
+
+ this._Popcorn.listen( "loadedmetadata", IriSP.wrap(this, IriSP.MediaFragment.advanceTime));
+ this._Popcorn.listen( "pause", IriSP.wrap(this, IriSP.MediaFragment.updateTime));
+ this._Popcorn.listen( "seeked", IriSP.wrap(this, IriSP.MediaFragment.updateTime));
+ this._Popcorn.listen( "IriSP.PolemicTweet.click", IriSP.wrap(this, IriSP.MediaFragment.updateAnnotation));
+ this._Popcorn.listen( "IriSP.SegmentsWidget.click", IriSP.wrap(this, IriSP.MediaFragment.updateAnnotation));
+};
+
+IriSP.MediaFragment.advanceTime = function() {
+ var url = window.location.href;
+
+ if ( url.split( "#" )[ 1 ] != null ) {
+ pageoffset = url.split( "#" )[1];
+
+ if ( pageoffset.substring(0, 2) === "t=") {
+ // timecode
+ if ( pageoffset.substring( 2 ) != null ) {
+ var offsettime = pageoffset.substring( 2 );
+ this._Popcorn.currentTime( parseFloat( offsettime ) );
+ }
+ } else if ( pageoffset.substring(0, 2) === "a=") {
+ // annotation
+ var annotationId = pageoffset.substring( 2 );
+
+ // there's no better way than that because
+ // of possible race conditions
+ this._serializer.sync(IriSP.wrap(this, function() {
+ IriSP.MediaFragment.lookupAnnotation.call(this, annotationId);
+ }));
+ }
+ }
+};
+
+IriSP.MediaFragment.updateTime = function() {
+ if (this.mutex === true) {
+ return;
+ }
+
+ var history = window.history;
+ if ( !history.pushState ) {
+ return false;
+ }
+
+ splitArr = window.location.href.split( "#" )
+ history.replaceState( {}, "", splitArr[0] + "#t=" + this._Popcorn.currentTime().toFixed( 2 ) );
+};
+
+
+IriSP.MediaFragment.updateAnnotation = function(annotationId) {
+ var _this = this;
+ this.mutex = true;
+
+ var history = window.history;
+ if ( !history.pushState ) {
+ return false;
+ }
+
+ splitArr = window.location.href.split( "#" )
+ history.replaceState( {}, "", splitArr[0] + "#a=" + annotationId);
+
+ window.setTimeout(function() { _this.mutex = false }, 50);
+};
+
+// lookup and seek to the beginning of an annotation
+IriSP.MediaFragment.lookupAnnotation = function(annotationId) {
+ var annotation = undefined;
+ var annotations = this._serializer._data.annotations;
+
+ var i;
+ for (i = 0; i < annotations.length; i++) {
+ if (annotations[i].id === annotationId) {
+ annotation = annotations[i];
+ break;
+ }
+ }
+
+ if (typeof(annotation) !== "undefined") {
+ this._Popcorn.currentTime(annotation.begin / 1000);
+ }
+};
+IriSP.AnnotationsWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+
+};
+
+
+IriSP.AnnotationsWidget.prototype = new IriSP.Widget();
+
+IriSP.AnnotationsWidget.prototype.clear = function() {
+ this.selector.find(".Ldt-SaTitle").text("");
+ this.selector.find(".Ldt-SaDescription").text("");
+ this.selector.find(".Ldt-SaKeywordText").text("");
+};
+
+IriSP.AnnotationsWidget.prototype.displayAnnotation = function(annotation) {
+
+ var title = annotation.content.title;
+ var description = annotation.content.description;
+ var keywords = "" // FIXME;
+ var begin = +annotation.begin / 1000;
+ var end = +annotation.end / 1000;
+ var duration = +this._serializer.currentMedia().meta["dc:duration"];
+
+ var title_templ = "{{title}} - ( {{begin}} - {{end}} )";
+ var endstr = Mustache.to_html(title_templ, {title: title, begin: IriSP.secondsToTime(begin), end: IriSP.secondsToTime(end)});
+
+ this.selector.find(".Ldt-SaTitle").text(endstr);
+ this.selector.find(".Ldt-SaDescription").text(description);
+
+ // update sharing buttons
+ var defaults = IriSP.widgetsDefaults.AnnotationsWidget;
+ var text = defaults.share_text;
+ var fb_link = defaults.fb_link;
+ var tw_link = defaults.tw_link;
+ var gplus_link = defaults.gplus_link;
+ var url = document.location.href + "#a=" + annotation.id;
+ this.selector.find(".Ldt-fbShare").attr("href", fb_link + IriSP.encodeURI(text) + IriSP.encodeURI(url));
+ this.selector.find(".Ldt-TwShare").attr("href", tw_link + IriSP.encodeURI(text) + IriSP.encodeURI(url));
+ this.selector.find(".Ldt-GplusShare").attr("href", fb_link + IriSP.encodeURI(text) + IriSP.encodeURI(url));
+};
+
+IriSP.AnnotationsWidget.prototype.clearWidget = function() {
+
+
+ /* retract the pane between two annotations */
+ this.selector.find(".Ldt-SaTitle").text("");
+ this.selector.find(".Ldt-SaDescription").text("");
+ this.selector.find(".Ldt-SaKeywordText").html("");
+ this.selector.find(".Ldt-ShowAnnotation").slideUp();
+};
+
+IriSP.AnnotationsWidget.prototype.draw = function() {
+ var _this = this;
+
+ var annotationMarkup = IriSP.templToHTML(IriSP.annotationWidget_template);
+ this.selector.append(annotationMarkup);
+ var view;
+
+ if (typeof(this._serializer._data.views) !== "undefined" && this._serializer._data.views !== null)
+ view = this._serializer._data.views[0];
+
+ var view_type = "";
+
+ if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) {
+ view_type = view.annotation_types[0];
+ }
+
+ var annotations = this._serializer._data.annotations;
+ var i;
+
+ for (i in annotations) {
+ var annotation = annotations[i];
+ var begin = Math.round((+ annotation.begin) / 1000);
+ var end = Math.round((+ annotation.end) / 1000);
+
+ if (view_type != "" && typeof(annotation.meta) !== "undefined" && typeof(annotation.meta["id-ref"]) !== "undefined"
+ && annotation.meta["id-ref"] != view_type) {
+ continue;
+ }
+
+
+ var conf = {start: begin, end: end,
+ onStart:
+ function(annotation) {
+ return function() {
+ _this.displayAnnotation(annotation);
+
+ } }(annotation),
+ onEnd:
+ function() { _this.clearWidget.call(_this); }
+ };
+ this._Popcorn = this._Popcorn.code(conf);
+ }
+
+};
+IriSP.ArrowWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+
+ this._oldAnnotation = null;
+
+};
+
+
+IriSP.ArrowWidget.prototype = new IriSP.Widget();
+
+IriSP.ArrowWidget.prototype.clear = function() {
+
+};
+
+IriSP.ArrowWidget.prototype.clearWidget = function() {
+};
+
+IriSP.ArrowWidget.prototype.draw = function() {
+ var templ = Mustache.to_html(IriSP.arrowWidget_template, {});
+ this.selector.append(templ);
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.timeUpdateHandler));
+};
+
+IriSP.ArrowWidget.prototype.timeUpdateHandler = function(percents) {
+ var currentTime = this._Popcorn.currentTime();
+ var currentAnnotation = this._serializer.currentAnnotations(currentTime)[0]; // FIXME : use the others ?
+
+ /* move the arrow only if the current annotation changes */
+ if (currentAnnotation != this._oldAnnotation) {
+ var begin = (+ currentAnnotation.begin) / 1000;
+ var end = (+ currentAnnotation.end) / 1000;
+
+ var duration = +this._serializer.currentMedia().meta["dc:duration"] / 1000;
+ var middle_time = (begin + end) / 2;
+ var percents = Math.floor((middle_time / duration) * 100);
+
+ // we need to apply a fix because the arrow has a certain length
+ // it's half the length of the arrow (27 / 2). We need to convert
+ // it in percents though.
+ var totalWidth = this.selector.width();
+ var correction = ((27 / 2) / totalWidth) * 100;
+ var corrected_percents = percents - correction;
+
+ /* don't move out of the screen */
+ if (corrected_percents <= 0)
+ corrected_percents = 0;
+
+ this.selector.children(".Ldt-arrowWidget").animate({"left" : corrected_percents + "%"});
+
+ this._oldAnnotation = currentAnnotation;
+ }
+}
+IriSP.PlayerWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+
+ this._searchBlockOpen = false;
+ this._searchLastValue = "";
+};
+
+IriSP.PlayerWidget.prototype = new IriSP.Widget();
+
+IriSP.PlayerWidget.prototype.draw = function() {
+ var self = this;
+ var width = this.width;
+ var height = this.height;
+ var heightS = this.height-20;
+
+ var Player_templ = Mustache.to_html(IriSP.player_template, {"share_template" : IriSP.share_template});
+ this.selector.append(Player_templ);
+
+ this.selector.children(".Ldt-controler").show();
+
+ // handle clicks by the user on the video.
+ this._Popcorn.listen("play", IriSP.wrap(this, this.playButtonUpdater));
+ this._Popcorn.listen("pause", IriSP.wrap(this, this.playButtonUpdater));
+
+ this._Popcorn.listen("volumechange", IriSP.wrap(this, this.muteButtonUpdater));
+
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.timeDisplayUpdater));
+ this._Popcorn.listen("IriSP.search.matchFound", IriSP.wrap(this, this.searchMatch));
+ this._Popcorn.listen("IriSP.search.noMatchFound", IriSP.wrap(this, this.searchNoMatch));
+
+
+ this.selector.find(".Ldt-CtrlPlay").click(function() { self.playHandler.call(self); });
+ this.selector.find(".Ldt-CtrlNext").click(function() { });
+ this.selector.find(".Ldt-CtrlSearch").click(function() { self.searchButtonHandler.call(self); });
+
+ this.selector.find('.Ldt-CtrlSound').click(function() { self.muteHandler.call(self); } );
+
+ this.selector.find(".Ldt-CtrlPlay").attr( "style", "background-color:#CD21C24;" );
+
+ var searchButtonPos = this.selector.find(".Ldt-CtrlSearch").position();
+ var searchBox = Mustache.to_html(IriSP.search_template, {margin_left : searchButtonPos.left + "px"});
+ this.selector.append(searchBox);
+
+ // trigger an IriSP.PlayerWidget.MouseOver to the widgets that are interested (i.e : sliderWidget)
+ this.selector.hover(function() { self._Popcorn.trigger("IriSP.PlayerWidget.MouseOver"); },
+ function() { self._Popcorn.trigger("IriSP.PlayerWidget.MouseOut"); });
+
+ this.muteButtonUpdater(); /* some player - jwplayer notable - save the state of the mute button between sessions */
+};
+
+/* Update the elasped time div */
+IriSP.PlayerWidget.prototype.timeDisplayUpdater = function() {
+
+ if (this._previousSecond === undefined)
+ this._previousSecond = this._Popcorn.roundTime();
+
+ else {
+ /* we're still in the same second, so it's not necessary to update time */
+ if (this._Popcorn.roundTime() == this._previousSecond)
+ return;
+
+ }
+
+ // we get it at each call because it may change.
+ var duration = +this._serializer.currentMedia().meta["dc:duration"] / 1000;
+ var totalTime = IriSP.secondsToTime(duration);
+ var elapsedTime = IriSP.secondsToTime(this._Popcorn.currentTime());
+
+ this.selector.find(".Ldt-ElapsedTime").html(elapsedTime.toString());
+ this.selector.find(".Ldt-TotalTime").html(totalTime.toString());
+ this._previousSecond = this._Popcorn.roundTime();
+};
+
+/* update the icon of the button - separate function from playHandler
+ because in some cases (for instance, when the user directly clicks on
+ the jwplayer window) we have to change the icon without playing/pausing
+*/
+IriSP.PlayerWidget.prototype.playButtonUpdater = function() {
+ var status = this._Popcorn.media.paused;
+
+ if ( status == true ){
+ this.selector.find(".Ldt-CtrlPlay").attr("title", "Play");
+
+ // we use templToHTML because it has some predefined
+ // vars like where to get the images
+ var templ = IriSP.templToHTML("url({{img_dir}}/play_sprite.png)");
+ this.selector.find(".Ldt-CtrlPlay").css("background-image", templ);
+
+ } else {
+ this.selector.find(".Ldt-CtrlPlay").attr("title", "Pause");
+
+ // we use templToHTML because it has some predefined
+ // vars like where to get the images
+ var templ = IriSP.templToHTML("url({{img_dir}}/pause_sprite.png)");
+ this.selector.find(".Ldt-CtrlPlay").css("background-image", templ);
+ }
+
+ return;
+};
+
+
+IriSP.PlayerWidget.prototype.playHandler = function() {
+ var status = this._Popcorn.media.paused;
+
+ if ( status == true ){
+ this._Popcorn.play();
+ } else {
+ this._Popcorn.pause();
+ }
+};
+
+IriSP.PlayerWidget.prototype.muteHandler = function() {
+ if (!this._Popcorn.muted()) {
+ this._Popcorn.mute(true);
+ } else {
+ this._Popcorn.mute(false);
+ }
+};
+
+IriSP.PlayerWidget.prototype.muteButtonUpdater = function() {
+ var status = this._Popcorn.media.muted;
+
+ if ( status == true ){
+ this.selector.find(".Ldt-CtrlSound").attr("title", "Unmute");
+
+ // we use templToHTML because it has some predefined
+ // vars like where to get the images
+ var templ = IriSP.templToHTML("url({{img_dir}}/sound_sprite.png)");
+ this.selector.find(".Ldt-CtrlSound").css("background-image", templ);
+
+ } else {
+ this.selector.find(".Ldt-CtrlSound").attr("title", "Mute");
+
+ // we use templToHTML because it has some predefined
+ // vars like where to get the images
+ var templ = IriSP.templToHTML("url({{img_dir}}/mute_sprite.png)");
+ this.selector.find(".Ldt-CtrlSound").css("background-image", templ);
+ }
+
+ return;
+};
+
+
+IriSP.PlayerWidget.prototype.searchButtonHandler = function() {
+ var self = this;
+
+ /* show the search field if it is not shown */
+ if ( this._searchBlockOpen == false ) {
+ this.selector.find(".LdtSearch").show(100);
+
+ this.selector.find(".LdtSearchInput").css('background-color','#fff');
+ this.selector.find(".LdtSearchInput").focus();
+ this.selector.find(".LdtSearchInput").attr('value', this._searchLastValue);
+ this._Popcorn.trigger("IriSP.search", this._searchLastValue); // trigger the search to make it more natural.
+
+ this._searchBlockOpen = true;
+ this.selector.find(".LdtSearchInput").bind('keyup', null, function() { self.searchHandler.call(self); } );
+
+ // we need this variable because some widget can find a match in
+ // their data while at the same time other's don't. As we want the
+ // search field to become green when there's a match, we need a
+ // variable to remember that we had one.
+ this._positiveMatch = false;
+
+ // tell the world the field is open
+ this._Popcorn.trigger("IriSP.search.open");
+
+ } else {
+ this._searchLastValue = this.selector.find(".LdtSearchInput").attr('value');
+ this.selector.find(".LdtSearchInput").attr('value','');
+ this.selector.find(".LdtSearch").hide(100);
+
+ // unbind the watcher event.
+ this.selector.find(".LdtSearchInput").unbind('keypress set');
+ this._searchBlockOpen = false;
+
+ this._positiveMatch = false;
+
+ this._Popcorn.trigger("IriSP.search.closed");
+ }
+};
+
+/* this handler is called whenever the content of the search
+ field changes */
+IriSP.PlayerWidget.prototype.searchHandler = function() {
+ this._searchLastValue = this.selector.find(".LdtSearchInput").attr('value');
+ this._positiveMatch = false;
+
+ // do nothing if the search field is empty, instead of highlighting everything.
+ if (this._searchLastValue == "") {
+ this._Popcorn.trigger("IriSP.search.cleared");
+ this.selector.find(".LdtSearchInput").css('background-color','');
+ } else {
+ this._Popcorn.trigger("IriSP.search", this._searchLastValue);
+ }
+};
+
+/*
+ handler for the IriSP.search.found message, which is sent by some views when they
+ highlight a match.
+*/
+IriSP.PlayerWidget.prototype.searchMatch = function() {
+ this._positiveMatch = true;
+ this.selector.find(".LdtSearchInput").css('background-color','#e1ffe1');
+}
+
+/* the same, except that no value could be found */
+IriSP.PlayerWidget.prototype.searchNoMatch = function() {
+ if (this._positiveMatch !== true)
+ this.selector.find(".LdtSearchInput").css('background-color', "#d62e3a");
+}
+
+/*
+ *
+ * Copyright 2010 Institut de recherche et d'innovation
+ * contributor(s) : Samuel Huron
+ *
+ * contact@iri.centrepompidou.fr
+ * http://www.iri.centrepompidou.fr
+ *
+ * This software is a computer program whose purpose is to show and add annotations on a video .
+ * This software is governed by the CeCILL-C license under French law and
+ * abiding by the rules of distribution of free software. You can use,
+ * modify and/ or redistribute the software under the terms of the CeCILL-C
+ * license as circulated by CEA, CNRS and INRIA at the following URL
+ * "http://www.cecill.info".
+ *
+ * The fact that you are presently reading this means that you have had
+ * knowledge of the CeCILL-C license and that you accept its terms.
+*/
+// CHART TIMELINE / VERSION PROTOTYPE ::
+
+IriSP.PolemicWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+
+ this.userPol = new Array();
+ this.userNoPol = new Array();
+ this.userst = new Array();
+ this.numberOfTweet = 0;
+ this.Users;
+ this.TweetPolemic;
+ this.yMax = this.height;
+ this.PaperSlider;
+ this.heightOfChart;
+ this.tweets = new Array();
+ this.svgElements = {};
+
+ // Make and define the Raphael area
+ this.paper = Raphael(document.getElementById(this._id), config.width, config.height);
+
+ this.oldSearchMatches = [];
+
+ // event handlers
+ this._Popcorn.listen("IriSP.search", IriSP.wrap(this, function(searchString) { this.searchHandler(searchString); }));
+ this._Popcorn.listen("IriSP.search.closed", IriSP.wrap(this, this.searchFieldClosedHandler));
+ this._Popcorn.listen("IriSP.search.cleared", IriSP.wrap(this, this.searchFieldClearedHandler));
+
+};
+
+IriSP.PolemicWidget.prototype = new IriSP.Widget();
+
+IriSP.PolemicWidget.prototype.draw = function() {
+
+ // variable
+ // yMax
+
+ var self = this;
+ var yCoef = 2; // coef for height of 1 tweet
+ var frameSize = 5; // frame size
+ var margin = 1; // marge between frame
+ var lineSize = this.width; // timeline pixel width
+ var nbrframes = lineSize/frameSize; // frame numbers
+ var numberOfTweet = 0; // number of tweet overide later
+ var duration = +this._serializer.currentMedia().meta["dc:duration"]; // timescale width
+ var frameLength = lineSize / frameSize; // frame timescale
+ var timeline;
+ var colors = new Array("","#1D973D","#C5A62D","#CE0A15","#036AAE","#585858");
+
+ // array
+ //var tweets = new Array();
+ var element = new Array();
+ var cluster = new Array();
+ var frames = new Array(frameLength);
+ var slices = new Array();
+
+
+ // Classes =======================================================================
+ var Frames = function(){
+
+ var Myclusters;
+ var x;
+ var y;
+ var width;
+ var height;
+ };
+ Frames = function(json){
+ // make my clusters
+ // ou Frame vide
+ };
+ Frames.prototype.draw = function(){
+ };
+ Frames.prototype.zoom = function(){
+ };
+ Frames.prototype.inside = function(){
+ };
+ var Clusters = function(){
+ var Object;
+ var yDist;
+ var x;
+ var y;
+ var width;
+ var height;
+ };
+ Clusters = function(json){
+ // make my object
+ };
+ var Tweet = function(){
+ };
+ // Classes =======================================================================
+
+ // Refactoring (parametere) ************************************************************
+ // color translastion
+ var qTweet_0 =0;
+ var qTweet_Q =0;
+ var qTweet_REF=0;
+ var qTweet_OK =0;
+ var qTweet_KO =0;
+ function colorTranslation(value){
+ if(value == "Q"){
+ qTweet_Q+=1;
+ return 2;
+ }else if(value =="REF"){
+ qTweet_REF+=1;
+ return 4;
+ }else if(value =="OK"){
+ qTweet_OK+=1;
+ return 1;
+ }else if(value =="KO"){
+ qTweet_KO+=1;
+ return 3;
+ }else if(value ==""){
+ qTweet_0+=1;
+ return 5;
+ }
+ }
+
+
+ this._serializer.sync(function(data) { loaded_callback.call(self, data) });
+
+ function loaded_callback (json) {
+
+ // get current view (the first ???)
+ view = json.views[0];
+
+ // the tweets are by definition of the second annotation type FIXME ?
+ tweet_annot_type = null;
+ if(typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) {
+ tweet_annot_type = view.annotation_types[1];
+ }
+
+ for(var i = 0; i < json.annotations.length; i++) {
+ var item = json.annotations[i];
+ var MyTime = Math.floor(item.begin/duration*lineSize);
+ var Myframe = Math.floor(MyTime/lineSize*frameLength);
+
+ if (typeof(item.meta) !== "undefined"
+ && typeof(item.meta["id-ref"]) !== "undefined"
+ && item.meta["id-ref"] === tweet_annot_type) {
+
+ var MyTJson = JSON.parse(item.meta['dc:source']['content']);
+
+ if (item.content['polemics'] != undefined
+ && item.content['polemics'][0] != null) {
+
+ // a tweet can have many polemics at the same time.
+ for(var j=0; j max) {
+ max = moy;
+ }
+ }
+
+ var tweetDrawed = new Array();
+ var TweetHeight = 5;
+
+ // DRAW TWEETS ============================================
+ for(var i = 0; i < nbrframes; i++) {
+ var addEheight = 5;
+ if (frames[i] != undefined){
+ // by type
+
+ for (var j = 6; j > -1; j--) {
+ if (frames[i].qualifVol[j] != undefined) {
+ // show tweet by type
+ for (var k = 0; k < frames[i].mytweetsID.length; k++) {
+
+ if (frames[i].mytweetsID[k].qualification == j) {
+ var x = i * frameSize;
+ var y = this.heightmax - addEheight;
+
+ if (this.yMax > y) {
+ this.yMax = y;
+ }
+
+ var e = this.paper.rect(x, y, frameSize - margin, TweetHeight /* height */)
+ .attr({stroke:"#00","stroke-width":0.1, fill: colors[j]});
+
+ addEheight += TweetHeight;
+
+ e.color = colors[j];
+ e.time = frames[i].mytweetsID[k].timeframe;
+ e.title = frames[i].mytweetsID[k].title;
+ e.id = frames[i].mytweetsID[k].cinecast_id;
+
+ this.svgElements[e.id] = e;
+
+ /*
+ e.mouseover(function(element) { return function (event) {
+ // event.clientX and event.clientY are to raphael what event.pageX and pageY are to jquery.
+ self.TooltipWidget.show.call(self.TooltipWidget, element.title, element.attr("fill"), event.clientX - 106, event.clientY - 160);
+ element.displayed = true;
+ }}(e)).mouseout(function(element) { return function () {
+ self.TooltipWidget.hide.call(self.TooltipWidget);
+ }}(e)).mousedown(function () {
+ self._Popcorn.currentTime(this.time/1000);
+ self._Popcorn.trigger("IriSP.PolemicTweet.click", this.id);
+ });
+ */
+
+ IriSP.jQuery(e.node).mouseenter(function(element) { return function (event) {
+ // event.clientX and event.clientY are to raphael what event.pageX and pageY are to jquery.
+ self.TooltipWidget.show.call(self.TooltipWidget, element.title, element.attr("fill"), event.pageX - 106, event.pageY - 160);
+ element.displayed = true;
+ }}(e)).mousedown(function(element) { return function () {
+ self._Popcorn.currentTime(element.time/1000);
+ self._Popcorn.trigger("IriSP.PolemicTweet.click", element.id);
+ }
+ }(e));
+
+ IriSP.jQuery(e.node).attr('id', 't' + k + '');
+ IriSP.jQuery(e.node).attr('title', frames[i].mytweetsID[k].title);
+ IriSP.jQuery(e.node).attr('begin', frames[i].mytweetsID[k].timeframe);
+ }
+ }
+ }
+ }
+ }
+
+ }
+ // DRAW UI :: resize border and bgd
+ this.paperBackground = this.paper.rect(0, 0, this.width, this.heightmax).attr({fill:"#F8F8F8","stroke-width":0.1,opacity: 1});
+
+ // outer borders
+ this.outerBorders = [];
+ this.outerBorders.push(this.paper.rect(0, this.height - 1, this.width, 1).attr({fill:"#ababab",stroke: "none",opacity: 1}));
+ this.outerBorders.push(this.paper.rect(0, 0, this.width, 1).attr({fill:"#ababab",stroke: "none",opacity: 1}));
+
+ // inner borders
+ this.innerBorders = [];
+ this.innerBorders.push(this.paper.rect(1, this.height - 2, this.width, 1).attr({fill:"#efefef",stroke: "none",opacity: 1}));
+ this.innerBorders.push(this.paper.rect(1, 1, this.width, 1).attr({fill:"#efefef",stroke: "none",opacity: 1}));
+ this.innerBorders.push(this.paper.rect(1, 1, 1, this.height - 2).attr({fill:"#d0d1d1",stroke: "none",opacity: 0.8}));
+ this.innerBorders.push(this.paper.rect(this.width - 2, 1, 1, this.height - 2).attr({fill:"#efefef",stroke: "none",opacity: 1}));
+
+
+
+ this.paperSlider = this.paper.rect(0, 0, 0, this.heightmax).attr({fill:"#D4D5D5", stroke: "none", opacity: 1});
+
+ // the small white line displayed over the slider.
+ this.sliderTip = this.paper.rect(0, 0, 1, this.heightmax).attr({fill:"#fc00ff", stroke: "none", opacity: 1});
+ // decalage
+ // tweetSelection = this.paper.rect(-100,-100,5,5).attr({fill:"#fff",stroke: "none",opacity: 1});
+
+
+ this.paperSlider.toBack();
+ this.paperBackground.toBack();
+ this.sliderTip.toFront();
+ }
+
+ this.selector.mouseleave(IriSP.wrap(this, function() { self.TooltipWidget.hide.call(self.TooltipWidget); }));
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.sliderUpdater));
+}
+
+IriSP.PolemicWidget.prototype.sliderUpdater = function() {
+
+ var time = +this._Popcorn.currentTime();
+ var duration = +this._serializer.currentMedia().meta["dc:duration"];
+
+ this.paperSlider.attr("width", time * (this.width / (duration / 1000)));
+
+ this.sliderTip.attr("x", time * (this.width / (duration / 1000)));
+};
+
+IriSP.PolemicWidget.prototype.searchHandler = function(searchString) {
+ if (searchString == "")
+ return;
+
+ var matches = this._serializer.searchTweetsOccurences(searchString);
+
+ if (IriSP.countProperties(matches) > 0) {
+ this._Popcorn.trigger("IriSP.search.matchFound");
+ } else {
+ this._Popcorn.trigger("IriSP.search.noMatchFound");
+ }
+
+ for (var id in matches) {
+ if (this.svgElements.hasOwnProperty(id)) {
+ var e = this.svgElements[id];
+ this.svgElements[id].attr({fill: "#fc00ff"});
+ }
+ }
+
+ // clean up the blocks that were in the previous search
+ // but who aren't in the current one.
+ for (var id in this.oldSearchMatches) {
+ if (!matches.hasOwnProperty(id)) {
+ var e = this.svgElements[id];
+ e.attr({fill: e.color});
+ }
+ }
+
+ this.oldSearchMatches = matches;
+};
+
+IriSP.PolemicWidget.prototype.searchFieldClearedHandler = function() {
+ // clean up the blocks that were in the previous search
+ // but who aren't in the current one.
+ for (var id in this.oldSearchMatches) {
+ var e = this.svgElements[id];
+ e.attr({fill: e.color});
+ }
+
+};
+
+IriSP.PolemicWidget.prototype.searchFieldClosedHandler = function() {
+ // clean up the blocks that were in the previous search
+ // but who aren't in the current one.
+ for (var id in this.oldSearchMatches) {
+ var e = this.svgElements[id];
+ e.attr({fill: e.color});
+ }
+
+};
+
+IriSP.SegmentsWidget = function(Popcorn, config, Serializer) {
+
+ var self = this;
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+ this.oldSearchMatches = [];
+
+ // event handlers
+ this._Popcorn.listen("IriSP.search", function(searchString) { self.searchHandler.call(self, searchString); });
+ this._Popcorn.listen("IriSP.search.closed", function() { self.searchFieldClosedHandler.call(self); });
+ this._Popcorn.listen("IriSP.search.cleared", function() { self.searchFieldClearedHandler.call(self); });
+};
+
+IriSP.SegmentsWidget.prototype = new IriSP.Widget();
+
+/* Get the width of a segment, in pixels. */
+IriSP.SegmentsWidget.prototype.segmentToPixel = function(annotation) {
+ var begin = Math.round((+ annotation.begin) / 1000);
+ var end = Math.round((+ annotation.end) / 1000);
+ var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000;
+
+ var startPourcent = IriSP.timeToPourcent(begin, duration);
+ var startPixel = Math.floor(this.selector.parent().width() * (startPourcent / 100));
+
+ var endPourcent = Math.floor(IriSP.timeToPourcent(end, duration) - startPourcent);
+ var endPixel = Math.floor(this.selector.parent().width() * (endPourcent / 100));
+
+ return endPixel;
+};
+
+/* compute the total length of a group of segments */
+IriSP.SegmentsWidget.prototype.segmentsLength = function(segmentsList) {
+ var self = this;
+ var total = 0;
+
+ for (var i = 0; i < segmentsList.length; i++)
+ total += self.segmentToPixel(segmentsList[i].annotation);
+
+ return total;
+};
+
+IriSP.SegmentsWidget.prototype.draw = function() {
+
+ var self = this;
+ var annotations = this._serializer._data.annotations;
+
+ this.selector.addClass("Ldt-SegmentsWidget");
+ this.selector.append(Mustache.to_html(IriSP.overlay_marker_template));
+
+ var view_type = this._serializer.getNonTweetIds()[0];
+
+ this.positionMarker = this.selector.children(":first");
+
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.positionUpdater));
+
+
+ var i = 0;
+
+ var segments_annotations = [];
+
+ for (i = 0; i < annotations.length; i++) {
+ var annotation = annotations[i];
+
+ /* filter the annotations whose type is not the one we want */
+ if (view_type != "" && typeof(annotation.meta) !== "undefined" && typeof(annotation.meta["id-ref"]) !== "undefined"
+ && annotation.meta["id-ref"] != view_type) {
+ continue;
+ }
+
+ segments_annotations.push(annotation);
+ }
+
+ var totalWidth = this.selector.width() - segments_annotations.length;
+ var lastSegment = IriSP.underscore.max(segments_annotations, function(annotation) { return annotation.end; });
+
+ for (i = 0; i < segments_annotations.length; i++) {
+
+ var annotation = segments_annotations[i];
+ var begin = (+ annotation.begin);
+ var end = (+ annotation.end);
+ var duration = this._serializer.currentMedia().meta["dc:duration"];
+ var id = annotation.id;
+
+ var startPixel = Math.floor(this.selector.parent().width() * (begin / duration));
+
+ var endPixel = Math.floor(this.selector.parent().width() * (end / duration));
+
+ if (annotation.id !== lastSegment.id)
+ var pxWidth = endPixel - startPixel -1;
+ else
+ /* the last segment has no segment following it */
+ var pxWidth = endPixel - startPixel;
+
+ var divTitle = (annotation.content.title + " - " + annotation.content.description).substr(0,55);
+
+ if (typeof(annotation.content.color) !== "undefined")
+ var color = annotation.content.color;
+ else
+ var color = annotation.color;
+
+ var hexa_color = IriSP.DEC_HEXA_COLOR(color);
+
+ if (hexa_color === "FFCC00")
+ hexa_color = "333";
+ if (hexa_color.length == 4)
+ hexa_color = hexa_color + '00';
+
+ var annotationTemplate = Mustache.to_html(IriSP.annotation_template,
+ {"divTitle" : divTitle, "id" : id, "startPixel" : startPixel,
+ "pxWidth" : pxWidth, "hexa_color" : hexa_color,
+ "seekPlace" : Math.round(begin/1000)});
+
+
+ this.selector.append(annotationTemplate);
+
+ /* add a special class to the last segment and change its border */
+ if (annotation.id === lastSegment.id) {
+ this.selector.find("#" + id).addClass("Ldt-lastSegment");
+ this.selector.find(".Ldt-lastSegment").css("border-color", "#" + hexa_color);
+ }
+
+ IriSP.jQuery("#" + id).fadeTo(0, 0.3);
+
+ IriSP.jQuery("#" + id).mouseover(
+ /* we wrap the handler in another function because js's scoping
+ rules are function-based - otherwise, the internal vars like
+ divTitle are preserved but they are looked-up from the draw
+ method scope, so after that the loop is run, so they're not
+ preserved */
+ (function(divTitle) {
+ return function(event) {
+ IriSP.jQuery(this).animate({opacity: 0.6}, 5);
+ var offset = IriSP.jQuery(this).offset();
+ var correction = IriSP.jQuery(this).outerWidth() / 2;
+
+ var offset_x = offset.left + correction - 106;
+ if (offset_x < 0)
+ offset_x = 0;
+
+ self.TooltipWidget.show(divTitle, color, offset_x, event.pageY - 160);
+ } })(divTitle)).mouseout(function(){
+ IriSP.jQuery(this).animate({opacity: 0.3}, 5);
+ self.TooltipWidget.hide();
+ });
+
+ IriSP.jQuery("#" + id).click(function(_this, annotation) {
+ return function() { _this.clickHandler(annotation)};
+ }(this, annotation));
+ }
+};
+
+/* restores the view after a search */
+IriSP.SegmentsWidget.prototype.clear = function() {
+ this.selector.children(".Ldt-iri-chapter").animate({opacity:0.3}, 100);
+};
+
+IriSP.SegmentsWidget.prototype.clickHandler = function(annotation) {
+ this._Popcorn.trigger("IriSP.SegmentsWidget.click", annotation.id);
+ var begin = (+ annotation.begin) / 1000;
+ this._Popcorn.currentTime(Math.round(begin));
+};
+
+IriSP.SegmentsWidget.prototype.searchHandler = function(searchString) {
+
+ if (searchString == "")
+ return;
+
+ var matches = this._serializer.searchOccurences(searchString);
+
+ if (IriSP.countProperties(matches) > 0) {
+ this._Popcorn.trigger("IriSP.search.matchFound");
+ } else {
+ this._Popcorn.trigger("IriSP.search.noMatchFound");
+ }
+
+ // un-highlight all the blocks
+ this.selector.children(".Ldt-iri-chapter").css("opacity", 0.1);
+
+ // then highlight the ones with matches.
+ for (var id in matches) {
+ var factor = 0.5 + matches[id] * 0.2;
+ this.selector.find("#"+id).dequeue();
+ this.selector.find("#"+id).animate({opacity:factor}, 200);
+ }
+
+
+ this.oldSearchMatches = matches;
+};
+
+IriSP.SegmentsWidget.prototype.searchFieldClearedHandler = function() {
+ this.clear();
+};
+
+IriSP.SegmentsWidget.prototype.searchFieldClosedHandler = function() {
+ this.clear();
+};
+
+IriSP.SegmentsWidget.prototype.positionUpdater = function() {
+ var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000;
+ var time = this._Popcorn.currentTime();
+ //var position = ((time / duration) * 100).toFixed(2);
+ var position = ((time / duration) * 100).toFixed(2);
+
+ this.positionMarker.css("left", position + "%");
+};
+IriSP.SliderWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+};
+
+IriSP.SliderWidget.prototype = new IriSP.Widget();
+
+IriSP.SliderWidget.prototype.draw = function() {
+ var self = this;
+
+ this.selector.append(Mustache.to_html(IriSP.sliderWidget_template, {}));
+ this.selector.addClass("Ldt-SliderMinimized");
+
+ this.sliderBackground = this.selector.find(".Ldt-sliderBackground");
+ this.sliderForeground = this.selector.find(".Ldt-sliderForeground");
+ this.positionMarker = this.selector.find(".Ldt-sliderPositionMarker");
+
+
+ // a special variable to stop methods from tinkering
+ // with the positionMarker when the user is dragging it
+ this.draggingOngoing = false;
+
+ // another special variable used by the timeout handler to
+ // open or close the slider.
+ this.sliderMaximized = false;
+ this.timeOutId = null;
+
+
+ this.positionMarker.draggable({axis: "x",
+ start: IriSP.wrap(this, this.positionMarkerDraggingStartedHandler),
+ stop: IriSP.wrap(this, this.positionMarkerDraggedHandler),
+ containment: "parent"
+ });
+ this.positionMarker.css("position", "absolute");
+
+ this.sliderBackground.click(function(event) { self.backgroundClickHandler.call(self, event); });
+ this.sliderForeground.click(function(event) { self.foregroundClickHandler.call(self, event); });
+
+ this.selector.hover(IriSP.wrap(this, this.mouseOverHandler), IriSP.wrap(this, this.mouseOutHandler));
+
+ // update the positions
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.sliderUpdater));
+
+ // special messages :
+ this._Popcorn.listen("IriSP.PlayerWidget.MouseOver", IriSP.wrap(this, this.mouseOverHandler));
+ this._Popcorn.listen("IriSP.PlayerWidget.MouseOut", IriSP.wrap(this, this.mouseOutHandler));
+};
+
+/* update the slider and the position marker as time passes */
+IriSP.SliderWidget.prototype.sliderUpdater = function() {
+ if(this.draggingOngoing || this._disableUpdate)
+ return;
+
+ var time = this._Popcorn.currentTime();
+
+ var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000;
+ var percent = ((time / duration) * 100).toFixed(2);
+
+ /* we do these complicated calculations to center exactly
+ the position Marker */
+ var pixels_to_percents = 100 / this.selector.width(); /* how much is a pixel in percents */
+ var positionMarker_width = this.positionMarker.width();
+ var correction = (pixels_to_percents * positionMarker_width) / 2;
+
+ var newPos = percent - correction;
+ if (newPos <= 0)
+ newPos = 0;
+
+ this.sliderForeground.css("width", percent + "%");
+ this.positionMarker.css("left", newPos + "%");
+
+};
+
+IriSP.SliderWidget.prototype.backgroundClickHandler = function(event) {
+ /* this piece of code is a little bit convoluted - here's how it works :
+ we want to handle clicks on the progress bar and convert those to seeks in the media.
+ However, jquery only gives us a global position, and we want a number of pixels relative
+ to our container div, so we get the parent position, and compute an offset to this position,
+ and finally compute the progress ratio in the media.
+ Finally we multiply this ratio with the duration to get the correct time
+ */
+
+ var parentOffset = this.sliderBackground.parent().offset();
+ var width = this.sliderBackground.width();
+ var relX = event.pageX - parentOffset.left;
+
+ var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000;
+ var newTime = ((relX / width) * duration).toFixed(2);
+
+ this._Popcorn.currentTime(newTime);
+};
+
+/* same function as the previous one, except that it handles clicks
+ on the foreground element */
+IriSP.SliderWidget.prototype.foregroundClickHandler = function(event) {
+ var parentOffset = this.sliderForeground.parent().offset();
+ var width = this.sliderBackground.width();
+ var relX = event.pageX - parentOffset.left;
+
+ var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000;
+ var newTime = ((relX / width) * duration).toFixed(2);
+
+ this._Popcorn.currentTime(newTime);
+};
+
+/* handles mouse over the slider */
+IriSP.SliderWidget.prototype.mouseOverHandler = function(event) {
+
+ if (this.timeOutId !== null) {
+ window.clearTimeout(this.timeOutId);
+ }
+
+ this.sliderMaximized = true;
+
+ this.sliderBackground.animate({"height": "9px"}, 100);
+ this.sliderForeground.animate({"height": "9px"}, 100);
+ this.positionMarker.animate({"height": "9px", "width": "9px"}, 100);
+ //this.positionMarker.css("margin-top", "-4px");
+
+// this.selector.removeClass("Ldt-SliderMinimized");
+// this.selector.addClass("Ldt-SliderMaximized");
+};
+
+/* handles when the mouse leaves the slider */
+IriSP.SliderWidget.prototype.mouseOutHandler = function(event) {
+
+ this.timeOutId = window.setTimeout(IriSP.wrap(this, this.minimizeOnTimeout),
+ IriSP.widgetsDefaults.SliderWidget.minimize_period);
+};
+
+IriSP.SliderWidget.prototype.minimizeOnTimeout = function(event) {
+ this.sliderBackground.animate({"height": "5px"}, 100);
+ this.sliderForeground.animate({"height": "5px"}, 100);
+ this.positionMarker.animate({"height": "5px", "width": "5px"}, 100);
+ this.positionMarker.css("margin-top", "0px");
+ this.sliderMinimized = true;
+
+// this.selector.removeClass("Ldt-SliderMaximized");
+// this.selector.addClass("Ldt-SliderMinimized");
+
+};
+
+// called when the user starts dragging the position indicator
+IriSP.SliderWidget.prototype.positionMarkerDraggingStartedHandler = function(event, ui) {
+ this.draggingOngoing = true;
+};
+
+IriSP.SliderWidget.prototype.positionMarkerDraggedHandler = function(event, ui) {
+ this._disableUpdate = true; // disable slider position updates while dragging is ongoing.
+ window.setTimeout(IriSP.wrap(this, function() { this._disableUpdate = false; }), 500);
+
+ var parentOffset = this.sliderForeground.parent().offset();
+ var width = this.sliderBackground.width();
+ var relX = event.pageX - parentOffset.left;
+
+ var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000;
+ var newTime = ((relX / width) * duration).toFixed(2);
+
+ this._Popcorn.currentTime(newTime);
+
+ this.draggingOngoing = false;
+};
+
+/* this widget displays a small tooltip */
+IriSP.TooltipWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+ this._shown = false;
+ this._displayedText = "";
+ this._hideTimeout = -1;
+};
+
+
+IriSP.TooltipWidget.prototype = new IriSP.Widget();
+
+IriSP.TooltipWidget.prototype.draw = function() {
+ var templ = Mustache.to_html(IriSP.tooltipWidget_template);
+
+ this.selector.append(templ);
+ this.hide();
+
+};
+
+IriSP.TooltipWidget.prototype.clear = function() {
+ this.selector.find(".tiptext").text("");
+};
+
+IriSP.TooltipWidget.prototype.show = function(text, color, x, y) {
+
+ if (this._displayedText == text)
+ return;
+
+ this.selector.find(".tipcolor").css("background-color", color);
+ this._displayedText = text;
+ this.selector.find(".tiptext").text(text);
+ //this.selector.find(".tip").css("left", x).css("top", y);
+ this.selector.find(".tip").css("left", x).css("top", y);
+ this.selector.find(".tip").show();
+ this._shown = true;
+};
+
+IriSP.TooltipWidget.prototype.hide = function() {
+ this.selector.find(".tip").hide();
+ this._shown = false;
+};/* a widget that displays tweet - used in conjunction with the polemicWidget */
+
+IriSP.TweetsWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+
+ this._displayingTweet = false;
+ this._timeoutId = undefined;
+};
+
+
+IriSP.TweetsWidget.prototype = new IriSP.Widget();
+
+
+IriSP.TweetsWidget.prototype.drawTweet = function(annotation) {
+
+ var title = IriSP.formatTweet(annotation.content.title);
+ var img = annotation.content.img.src;
+ if (typeof(img) === "undefined" || img === "" || img === "None") {
+ img = IriSP.widgetsDefaults.TweetsWidget.default_profile_picture;
+ }
+
+ var imageMarkup = IriSP.templToHTML("
",
+ {src : img});
+
+ if (typeof(annotation.meta["dc:source"].content) !== "undefined") {
+ var tweetContents = JSON.parse(annotation.meta["dc:source"].content);
+ var creator = tweetContents.user.screen_name;
+ var real_name = tweetContents.user.name;
+
+ imageMarkup = IriSP.templToHTML("",
+ {src : img, creator: creator});
+
+ var formatted_date = new Date(tweetContents.created_at).toLocaleDateString();
+ title = IriSP.templToHTML("@{{creator}} - " +
+ "
+
+All will be passed through.
+Additionally, jsrun.sh will take the following actions:
+1) If the environment variable JSDOCDIR is set, it will add
+"-Djsdoc.dir=$JSDOCDIR" to the command-line
+2) If the environment variable JSDOCTEMPLATEDIR is set, it will add
+"-Djsdoc.template.dir=$JSDOCTEMPLATEDIR" to the command-line
+3) java with the appropriate path to jsrun.jar and run.js will be instantiated
+
+If not variables are set, it is assumed that the path to jsrun.jar and app/ is in the current working directory.
+
+Example:
+# jsrun.sh ./src/
+Assuming JSDOCDIR=/some/path/to/my/jsdoc will cause the following command to
+execute:
+java -Djsdoc.dir=/some/path/to/my/jsdoc -jar /some/path/to/my/jsdoc/jsrun.jar
+/some/path/to/my/jsdoc/app/run.js ./src/
+
+======================================================================
+
+TESTING:
+
+To run the suite of unit tests included with JsDoc Toolkit enter this
+on the command line:
+
+$ java -jar jsrun.jar app/run.js -T
+
+To see a dump of the internal data structure that JsDoc Toolkit has
+built from your source files use this command:
+
+$ java -jar jsrun.jar app/run.js mycode.js -Z
+
+======================================================================
+
+LICENSE:
+
+JSDoc.pm
+
+This project is based on the JSDoc.pm tool, created by Michael
+Mathews and Gabriel Reid. More information on JsDoc.pm can
+be found on the JSDoc.pm homepage: http://jsdoc.sourceforge.net/
+
+Complete documentation on JsDoc Toolkit can be found on the project
+wiki at http://code.google.com/p/jsdoc-toolkit/w/list
+
+Rhino
+
+Rhino (JavaScript in Java) is open source and licensed by Mozilla
+under the MPL 1.1 or later/GPL 2.0 or later licenses, the text of
+which is available at http://www.mozilla.org/MPL/
+
+You can obtain the source code for Rhino from the Mozilla web site at
+http://www.mozilla.org/rhino/download.html
+
+JsDoc Toolkit is a larger work that uses the Rhino JavaScript engine
+but is not derived from it in any way. The Rhino library is used
+without modification and without any claims whatsoever.
+
+The Rhino Debugger
+
+You can obtain more information about the Rhino Debugger from the
+Mozilla web site at http://www.mozilla.org/rhino/debugger.html
+
+JsDoc Toolkit is a larger work that uses the Rhino Debugger but
+is not derived from it in any way. The Rhino Debugger is used
+without modification and without any claims whatsoever.
+
+JsDoc Toolkit
+
+All code specific to JsDoc Toolkit are free, open source and licensed
+for use under the X11/MIT License.
+
+JsDoc Toolkit is Copyright (c)2009 Michael Mathews
+
+This program is free software; you can redistribute it and/or
+modify it under the terms below.
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions: The above copyright notice and this
+permission notice must be included in all copies or substantial
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/frame.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/frame.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,33 @@
+IO.include("frame/Opt.js");
+IO.include("frame/Chain.js");
+IO.include("frame/Link.js");
+IO.include("frame/String.js");
+IO.include("frame/Hash.js");
+IO.include("frame/Namespace.js");
+//IO.include("frame/Reflection.js");
+
+/** A few helper functions to make life a little easier. */
+
+function defined(o) {
+ return (o !== undefined);
+}
+
+function copy(o) { // todo check for circular refs
+ if (o == null || typeof(o) != 'object') return o;
+ var c = new o.constructor();
+ for(var p in o) c[p] = copy(o[p]);
+ return c;
+}
+
+function isUnique(arr) {
+ var l = arr.length;
+ for(var i = 0; i < l; i++ ) {
+ if (arr.lastIndexOf(arr[i]) > i) return false;
+ }
+ return true;
+}
+
+/** Returns the given string with all regex meta characters backslashed. */
+RegExp.escapeMeta = function(str) {
+ return str.replace(/([$^\\\/()|?+*\[\]{}.-])/g, "\\$1");
+}
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/frame/Chain.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/frame/Chain.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,102 @@
+/**@constructor*/
+function ChainNode(object, link) {
+ this.value = object;
+ this.link = link; // describes this node's relationship to the previous node
+}
+
+/**@constructor*/
+function Chain(valueLinks) {
+ this.nodes = [];
+ this.cursor = -1;
+
+ if (valueLinks && valueLinks.length > 0) {
+ this.push(valueLinks[0], "//");
+ for (var i = 1, l = valueLinks.length; i < l; i+=2) {
+ this.push(valueLinks[i+1], valueLinks[i]);
+ }
+ }
+}
+
+Chain.prototype.push = function(o, link) {
+ if (this.nodes.length > 0 && link) this.nodes.push(new ChainNode(o, link));
+ else this.nodes.push(new ChainNode(o));
+}
+
+Chain.prototype.unshift = function(o, link) {
+ if (this.nodes.length > 0 && link) this.nodes[0].link = link;
+ this.nodes.unshift(new ChainNode(o));
+ this.cursor++;
+}
+
+Chain.prototype.get = function() {
+ if (this.cursor < 0 || this.cursor > this.nodes.length-1) return null;
+ return this.nodes[this.cursor];
+}
+
+Chain.prototype.first = function() {
+ this.cursor = 0;
+ return this.get();
+}
+
+Chain.prototype.last = function() {
+ this.cursor = this.nodes.length-1;
+ return this.get();
+}
+
+Chain.prototype.next = function() {
+ this.cursor++;
+ return this.get();
+}
+
+Chain.prototype.prev = function() {
+ this.cursor--;
+ return this.get();
+}
+
+Chain.prototype.toString = function() {
+ var string = "";
+ for (var i = 0, l = this.nodes.length; i < l; i++) {
+ if (this.nodes[i].link) string += " -("+this.nodes[i].link+")-> ";
+ string += this.nodes[i].value.toString();
+ }
+ return string;
+}
+
+Chain.prototype.joinLeft = function() {
+ var result = "";
+ for (var i = 0, l = this.cursor; i < l; i++) {
+ if (result && this.nodes[i].link) result += this.nodes[i].link;
+ result += this.nodes[i].value.toString();
+ }
+ return result;
+}
+
+
+/* USAGE:
+
+var path = "one/two/three.four/five-six";
+var pathChain = new Chain(path.split(/([\/.-])/));
+print(pathChain);
+
+var lineage = new Chain();
+lineage.push("Port");
+lineage.push("Les", "son");
+lineage.push("Dawn", "daughter");
+lineage.unshift("Purdie", "son");
+
+print(lineage);
+
+// walk left
+for (var node = lineage.last(); node !== null; node = lineage.prev()) {
+ print("< "+node.value);
+}
+
+// walk right
+var node = lineage.first()
+while (node !== null) {
+ print(node.value);
+ node = lineage.next();
+ if (node && node.link) print("had a "+node.link+" named");
+}
+
+*/
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/frame/Dumper.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/frame/Dumper.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,144 @@
+/**
+ * @class
+ 60 ? '\n' : ' ';
+ return nl + list.join(',' + nl) + nl;
+ },
+
+ _typeof: function (obj) {
+ if (obj && obj.circularReference && obj.circularReference > 1) return 'circular';
+ if (Array.prototype.isPrototypeOf(obj)) return 'array';
+ if (Date.prototype.isPrototypeOf(obj)) return 'date';
+ if (typeof obj.nodeType != 'undefined') return 'element';
+ return typeof(obj);
+ },
+
+ _dump_dom: function (obj) {
+ return '"' + Dumper.nodeTypes[obj.nodeType] + '"';
+ }
+};
+
+Dumper.ESC = {
+ "\t": "\\t",
+ "\n": "\\n",
+ "\f": "\\f"
+};
+
+Dumper.nodeTypes = {
+ 1: "ELEMENT_NODE",
+ 2: "ATTRIBUTE_NODE",
+ 3: "TEXT_NODE",
+ 4: "CDATA_SECTION_NODE",
+ 5: "ENTITY_REFERENCE_NODE",
+ 6: "ENTITY_NODE",
+ 7: "PROCESSING_INSTRUCTION_NODE",
+ 8: "COMMENT_NODE",
+ 9: "DOCUMENT_NODE",
+ 10: "DOCUMENT_TYPE_NODE",
+ 11: "DOCUMENT_FRAGMENT_NODE",
+ 12: "NOTATION_NODE"
+};
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/frame/Hash.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/frame/Hash.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,84 @@
+/**
+ @constructor
+ @example
+ var _index = new Hash();
+ _index.set("a", "apple");
+ _index.set("b", "blue");
+ _index.set("c", "coffee");
+
+ for (var p = _index.first(); p; p = _index.next()) {
+ print(p.key+" is for "+p.value);
+ }
+
+ */
+var Hash = function() {
+ this._map = {};
+ this._keys = [];
+ this._vals = [];
+ this.reset();
+}
+
+Hash.prototype.set = function(k, v) {
+ if (k != "") {
+ this._keys.push(k);
+ this._map["="+k] = this._vals.length;
+ this._vals.push(v);
+ }
+}
+
+Hash.prototype.replace = function(k, k2, v) {
+ if (k == k2) return;
+
+ var offset = this._map["="+k];
+ this._keys[offset] = k2;
+ if (typeof v != "undefined") this._vals[offset] = v;
+ this._map["="+k2] = offset;
+ delete(this._map["="+k]);
+}
+
+Hash.prototype.drop = function(k) {
+ if (k != "") {
+ var offset = this._map["="+k];
+ this._keys.splice(offset, 1);
+ this._vals.splice(offset, 1);
+ delete(this._map["="+k]);
+ for (var p in this._map) {
+ if (this._map[p] >= offset) this._map[p]--;
+ }
+ if (this._cursor >= offset && this._cursor > 0) this._cursor--;
+ }
+}
+
+Hash.prototype.get = function(k) {
+ if (k != "") {
+ return this._vals[this._map["="+k]];
+ }
+}
+
+Hash.prototype.keys = function() {
+ return this._keys;
+}
+
+Hash.prototype.hasKey = function(k) {
+ if (k != "") {
+ return (typeof this._map["="+k] != "undefined");
+ }
+}
+
+Hash.prototype.values = function() {
+ return this._vals;
+}
+
+Hash.prototype.reset = function() {
+ this._cursor = 0;
+}
+
+Hash.prototype.first = function() {
+ this.reset();
+ return this.next();
+}
+
+Hash.prototype.next = function() {
+ if (this._cursor++ < this._keys.length)
+ return {key: this._keys[this._cursor-1], value: this._vals[this._cursor-1]};
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/frame/Link.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/frame/Link.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,173 @@
+/** Handle the creation of HTML links to documented symbols.
+ @constructor
+*/
+function Link() {
+ this.alias = "";
+ this.src = "";
+ this.file = "";
+ this.text = "";
+ this.innerName = "";
+ this.classLink = false;
+ this.targetName = "";
+
+ this.target = function(targetName) {
+ if (defined(targetName)) this.targetName = targetName;
+ return this;
+ }
+ this.inner = function(inner) {
+ if (defined(inner)) this.innerName = inner;
+ return this;
+ }
+ this.withText = function(text) {
+ if (defined(text)) this.text = text;
+ return this;
+ }
+ this.toSrc = function(filename) {
+ if (defined(filename)) this.src = filename;
+ return this;
+ }
+ this.toSymbol = function(alias) {
+ if (defined(alias)) this.alias = new String(alias);
+ return this;
+ }
+ this.toClass = function(alias) {
+ this.classLink = true;
+ return this.toSymbol(alias);
+ }
+ this.toFile = function(file) {
+ if (defined(file)) this.file = file;
+ return this;
+ }
+
+ this.toString = function() {
+ var linkString;
+ var thisLink = this;
+
+ if (this.alias) {
+ linkString = this.alias.replace(/(^|[^a-z$0-9_#.:^-])([|a-z$0-9_#.:^-]+)($|[^a-z$0-9_#.:^-])/i,
+ function(match, prematch, symbolName, postmatch) {
+ var symbolNames = symbolName.split("|");
+ var links = [];
+ for (var i = 0, l = symbolNames.length; i < l; i++) {
+ thisLink.alias = symbolNames[i];
+ links.push(thisLink._makeSymbolLink(symbolNames[i]));
+ }
+ return prematch+links.join("|")+postmatch;
+ }
+ );
+ }
+ else if (this.src) {
+ linkString = thisLink._makeSrcLink(this.src);
+ }
+ else if (this.file) {
+ linkString = thisLink._makeFileLink(this.file);
+ }
+
+ return linkString;
+ }
+}
+
+/** prefixed for hashes */
+Link.hashPrefix = "";
+
+/** Appended to the front of relative link paths. */
+Link.base = "";
+
+Link.symbolNameToLinkName = function(symbol) {
+ var linker = "",
+ ns = "";
+
+ if (symbol.isStatic) linker = ".";
+ else if (symbol.isInner) linker = "-";
+
+ if (symbol.isEvent && !/^event:/.test(symbol.name)) {
+ ns = "event:";
+ }
+ return Link.hashPrefix+linker+ns+symbol.name;
+}
+
+Link.getSymbol= function(alias) {
+ var symbol= Link.symbolSet.getSymbol(alias);
+
+ if (symbol)
+ return symbol;
+
+ if ('#'!==alias.charAt(0) || !Link.currentSymbol)
+ return null;
+
+ // resolve relative name
+ var container= Link.currentSymbol;
+
+ while (container)
+ {
+ symbol= Link.symbolSet.getSymbol(container.alias + alias);
+ if (symbol)
+ return symbol;
+
+ // No superclass
+ if (!container.augments.length)
+ return null;
+
+ container= Link.symbolSet.getSymbol(container.augments[0].desc);
+ }
+
+ return null;
+}
+
+/** Create a link to another symbol. */
+Link.prototype._makeSymbolLink = function(alias) {
+ var linkBase = Link.base+publish.conf.symbolsDir;
+ var linkTo = Link.getSymbol(alias);
+ var linkPath;
+ var target = (this.targetName)? " target=\""+this.targetName+"\"" : "";
+
+ // if there is no symbol by that name just return the name unaltered
+ if (!linkTo)
+ return this.text || alias;
+
+ // it's a symbol in another file
+ else {
+ if (!linkTo.is("CONSTRUCTOR") && !linkTo.isNamespace) { // it's a method or property
+ linkPath= (Link.filemap) ? Link.filemap[linkTo.memberOf] :
+ escape(linkTo.memberOf) || "_global_";
+ linkPath += publish.conf.ext + "#" + Link.symbolNameToLinkName(linkTo);
+ }
+ else {
+ linkPath = (Link.filemap)? Link.filemap[linkTo.alias] : escape(linkTo.alias);
+ linkPath += publish.conf.ext;// + (this.classLink? "":"#" + Link.hashPrefix + "constructor");
+ }
+ linkPath = linkBase + linkPath
+ }
+
+ var linkText= this.text || alias;
+
+ var link = {linkPath: linkPath, linkText: linkText, linkInner: (this.innerName? "#"+this.innerName : "")};
+
+ if (typeof JSDOC.PluginManager != "undefined") {
+ JSDOC.PluginManager.run("onSymbolLink", link);
+ }
+
+ return ""+link.linkText+"";
+}
+
+/** Create a link to a source file. */
+Link.prototype._makeSrcLink = function(srcFilePath) {
+ var target = (this.targetName)? " target=\""+this.targetName+"\"" : "";
+
+ // transform filepath into a filename
+ var srcFile = srcFilePath.replace(/\.\.?[\\\/]/g, "").replace(/[:\\\/]/g, "_");
+ var outFilePath = Link.base + publish.conf.srcDir + srcFile + publish.conf.ext;
+
+ if (!this.text) this.text = FilePath.fileName(srcFilePath);
+ return ""+this.text+"";
+}
+
+/** Create a link to a source file. */
+Link.prototype._makeFileLink = function(filePath) {
+ var target = (this.targetName)? " target=\""+this.targetName+"\"" : "";
+
+ var outFilePath = Link.base + filePath;
+
+ if (!this.text) this.text = filePath;
+ return ""+this.text+"";
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/frame/Namespace.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/frame/Namespace.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,10 @@
+_global_ = this;
+
+function Namespace(name, f) {
+ var n = name.split(".");
+ for (var o = _global_, i = 0, l = n.length; i < l; i++) {
+ o = o[n[i]] = o[n[i]] || {};
+ }
+
+ if (f) f();
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/frame/Opt.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/frame/Opt.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,134 @@
+/** @namespace */
+Opt = {
+ /**
+ * Get commandline option values.
+ * @param {Array} args Commandline arguments. Like ["-a=xml", "-b", "--class=new", "--debug"]
+ * @param {object} optNames Map short names to long names. Like {a:"accept", b:"backtrace", c:"class", d:"debug"}.
+ * @return {object} Short names and values. Like {a:"xml", b:true, c:"new", d:true}
+ */
+ get: function(args, optNames) {
+ var opt = {"_": []}; // the unnamed option allows multiple values
+ for (var i = 0; i < args.length; i++) {
+ var arg = new String(args[i]);
+ var name;
+ var value;
+ if (arg.charAt(0) == "-") {
+ if (arg.charAt(1) == "-") { // it's a longname like --foo
+ arg = arg.substring(2);
+ var m = arg.split("=");
+ name = m.shift();
+ value = m.shift();
+ if (typeof value == "undefined") value = true;
+
+ for (var n in optNames) { // convert it to a shortname
+ if (name == optNames[n]) {
+ name = n;
+ }
+ }
+ }
+ else { // it's a shortname like -f
+ arg = arg.substring(1);
+ var m = arg.split("=");
+ name = m.shift();
+ value = m.shift();
+ if (typeof value == "undefined") value = true;
+
+ for (var n in optNames) { // find the matching key
+ if (name == n || name+'[]' == n) {
+ name = n;
+ break;
+ }
+ }
+ }
+ if (name.match(/(.+)\[\]$/)) { // it's an array type like n[]
+ name = RegExp.$1;
+ if (!opt[name]) opt[name] = [];
+ }
+
+ if (opt[name] && opt[name].push) {
+ opt[name].push(value);
+ }
+ else {
+ opt[name] = value;
+ }
+ }
+ else { // not associated with any optname
+ opt._.push(args[i]);
+ }
+ }
+ return opt;
+ }
+}
+
+/*t:
+ plan(11, "Testing Opt.");
+
+ is(
+ typeof Opt,
+ "object",
+ "Opt is an object."
+ );
+
+ is(
+ typeof Opt.get,
+ "function",
+ "Opt.get is a function."
+ );
+
+ var optNames = {a:"accept", b:"backtrace", c:"class", d:"debug", "e[]":"exceptions"};
+ var t_options = Opt.get(["-a=xml", "-b", "--class=new", "--debug", "-e=one", "-e=two", "foo", "bar"], optNames);
+
+ is(
+ t_options.a,
+ "xml",
+ "an option defined with a short name can be accessed by its short name."
+ );
+
+ is(
+ t_options.b,
+ true,
+ "an option defined with a short name and no value are true."
+ );
+
+ is(
+ t_options.c,
+ "new",
+ "an option defined with a long name can be accessed by its short name."
+ );
+
+ is(
+ t_options.d,
+ true,
+ "an option defined with a long name and no value are true."
+ );
+
+ is(
+ typeof t_options.e,
+ "object",
+ "an option that can accept multiple values is defined."
+ );
+
+ is(
+ t_options.e.length,
+ 2,
+ "an option that can accept multiple values can have more than one value."
+ );
+
+ is(
+ t_options.e[1],
+ "two",
+ "an option that can accept multiple values can be accessed as an array."
+ );
+
+ is(
+ typeof t_options._,
+ "object",
+ "the property '_' is defined for unnamed options."
+ );
+
+ is(
+ t_options._[0],
+ "foo",
+ "the property '_' can be accessed as an array."
+ );
+ */
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/frame/Reflection.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/frame/Reflection.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,26 @@
+/**@constructor*/
+function Reflection(obj) {
+ this.obj = obj;
+}
+
+Reflection.prototype.getConstructorName = function() {
+ if (this.obj.constructor.name) return this.obj.constructor.name;
+ var src = this.obj.constructor.toSource();
+ var name = src.substring(name.indexOf("function")+8, src.indexOf('(')).replace(/ /g,'');
+ return name;
+}
+
+Reflection.prototype.getMethod = function(name) {
+ for (var p in this.obj) {
+ if (p == name && typeof(this.obj[p]) == "function") return this.obj[p];
+ }
+ return null;
+}
+
+Reflection.prototype.getParameterNames = function() {
+ var src = this.obj.toSource();
+ src = src.substring(
+ src.indexOf("(", 8)+1, src.indexOf(")")
+ );
+ return src.split(/, ?/);
+}
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/frame/String.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/frame/String.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,93 @@
+/**
+ @name String
+ @class Additions to the core string object.
+*/
+
+/** @author Steven Levithan, released as public domain. */
+String.prototype.trim = function() {
+ var str = this.replace(/^\s+/, '');
+ for (var i = str.length - 1; i >= 0; i--) {
+ if (/\S/.test(str.charAt(i))) {
+ str = str.substring(0, i + 1);
+ break;
+ }
+ }
+ return str;
+}
+/*t:
+ plan(6, "Testing String.prototype.trim.");
+
+ var s = " a bc ".trim();
+ is(s, "a bc", "multiple spaces front and back are trimmed.");
+
+ s = "a bc\n\n".trim();
+ is(s, "a bc", "newlines only in back are trimmed.");
+
+ s = "\ta bc".trim();
+ is(s, "a bc", "tabs only in front are trimmed.");
+
+ s = "\n \t".trim();
+ is(s, "", "an all-space string is trimmed to empty.");
+
+ s = "a b\nc".trim();
+ is(s, "a b\nc", "a string with no spaces in front or back is trimmed to itself.");
+
+ s = "".trim();
+ is(s, "", "an empty string is trimmed to empty.");
+
+*/
+
+String.prototype.balance = function(open, close) {
+ var i = 0;
+ while (this.charAt(i) != open) {
+ if (i == this.length) return [-1, -1];
+ i++;
+ }
+
+ var j = i+1;
+ var balance = 1;
+ while (j < this.length) {
+ if (this.charAt(j) == open) balance++;
+ if (this.charAt(j) == close) balance--;
+ if (balance == 0) break;
+ j++;
+ if (j == this.length) return [-1, -1];
+ }
+
+ return [i, j];
+}
+/*t:
+ plan(16, "Testing String.prototype.balance.");
+
+ var s = "{abc}".balance("{","}");
+ is(s[0], 0, "opener in first is found.");
+ is(s[1], 4, "closer in last is found.");
+
+ s = "ab{c}de".balance("{","}");
+ is(s[0], 2, "opener in middle is found.");
+ is(s[1], 4, "closer in middle is found.");
+
+ s = "a{b{c}de}f".balance("{","}");
+ is(s[0], 1, "nested opener is found.");
+ is(s[1], 8, "nested closer is found.");
+
+ s = "{}".balance("{","}");
+ is(s[0], 0, "opener with no content is found.");
+ is(s[1], 1, "closer with no content is found.");
+
+ s = "".balance("{","}");
+ is(s[0], -1, "empty string opener is -1.");
+ is(s[1], -1, "empty string closer is -1.");
+
+ s = "{abc".balance("{","}");
+ is(s[0], -1, "opener with no closer returns -1.");
+ is(s[1], -1, "no closer returns -1.");
+
+ s = "abc".balance("{","}");
+ is(s[0], -1, "no opener or closer returns -1 for opener.");
+ is(s[1], -1, "no opener or closer returns -1 for closer.");
+
+ s = "aX11/MIT License
+ * (See the accompanying README file for full details.)
+ */
+
+/**
+ Yet another unit testing tool for JavaScript.
+ @author Michael Mathews micmath@gmail.com
+ @param {object} testCases Properties are testcase names, values are functions to execute as tests.
+*/
+function testrun(testCases) {
+ var ran = 0;
+ for (t in testCases) {
+ var result = testCases[t]();
+ ran++;
+ }
+
+ return testrun.reportOut+"-------------------------------\n"+((testrun.fails>0)? ":( Failed "+testrun.fails+"/" : ":) Passed all ")+testrun.count+" test"+((testrun.count == 1)? "":"s")+".\n";
+}
+
+
+testrun.count = 0;
+testrun.current = null;
+testrun.passes = 0;
+testrun.fails = 0;
+testrun.reportOut = "";
+
+/** @private */
+testrun.report = function(text) {
+ testrun.reportOut += text+"\n";
+}
+
+/**
+ Check if test evaluates to true.
+ @param {string} test To be evaluated.
+ @param {string} message Optional. To be displayed in the report.
+ @return {boolean} True if the string test evaluates to true.
+*/
+ok = function(test, message) {
+ testrun.count++;
+
+ var result;
+ try {
+ result = eval(test);
+
+ if (result) {
+ testrun.passes++;
+ testrun.report(" OK "+testrun.count+" - "+((message != null)? message : ""));
+ }
+ else {
+ testrun.fails++;
+ testrun.report("NOT OK "+testrun.count+" - "+((message != null)? message : ""));
+ }
+ }
+ catch(e) {
+ testrun.fails++
+ testrun.report("NOT OK "+testrun.count+" - "+((message != null)? message : ""));
+
+ }
+}
+
+/**
+ Check if test is same as expected.
+ @param {string} test To be evaluated.
+ @param {string} expected
+ @param {string} message Optional. To be displayed in the report.
+ @return {boolean} True if (test == expected). Note that the comparison is not a strict equality check.
+*/
+is = function(test, expected, message) {
+ testrun.count++;
+
+ var result;
+ try {
+ result = eval(test);
+
+ if (result == expected) {
+ testrun.passes++
+ testrun.report(" OK "+testrun.count+" - "+((message != null)? message : ""));
+ }
+ else {
+ testrun.fails++
+ testrun.report("NOT OK "+testrun.count+" - "+((message != null)? message : ""));
+ testrun.report("expected: "+expected);
+ testrun.report(" got: "+result);
+ }
+ }
+ catch(e) {
+ testrun.fails++
+ testrun.report("NOT OK "+testrun.count+" - "+((message != null)? message : ""));
+ testrun.report("expected: "+expected);
+ testrun.report(" got: "+result);}
+}
+
+/**
+ Check if test matches pattern.
+ @param {string} test To be evaluated.
+ @param {string} pattern Used to create a RegExp.
+ @param {string} message Optional. To be displayed in the report.
+ @return {boolean} True if test matches pattern.
+*/
+like = function(test, pattern, message) {
+ testrun.count++;
+
+ var result;
+ try {
+ result = eval(test);
+ var rgx = new RegExp(pattern);
+
+ if (rgx.test(result)) {
+ testrun.passes++
+ testrun.report(" OK "+testrun.count+" - "+((message != null)? message : ""));
+ }
+ else {
+ testrun.fails++
+ testrun.report("NOT OK "+testrun.count+" - "+((message != null)? message : ""));
+ testrun.report(" this: "+result);
+ testrun.report("is not like: "+pattern);
+ }
+ }
+ catch(e) {
+ testrun.fails++
+ testrun.report("NOT OK "+testrun.count+" - "+((message != null)? message : ""));
+ }
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/handlers/FOODOC.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/handlers/FOODOC.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,26 @@
+/**
+ This is the main container for the FOODOC handler.
+ @namespace
+*/
+FOODOC = {
+};
+
+/** The current version string of this application. */
+FOODOC.VERSION = "1.0";
+
+FOODOC.handle = function(srcFile, src) {
+ LOG.inform("Handling file '" + srcFile + "'");
+
+ return [
+ new JSDOC.Symbol(
+ "foo",
+ [],
+ "VIRTUAL",
+ new JSDOC.DocComment("/** This is a foo. */")
+ )
+ ];
+};
+
+FOODOC.publish = function(symbolgroup) {
+ LOG.inform("Publishing symbolgroup.");
+};
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/handlers/XMLDOC.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/handlers/XMLDOC.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,26 @@
+/**
+ * This is the main container for the XMLDOC handler.
+ * @namespace
+ * @author Brett Fattori (bfattori@fry.com)
+ * @version $Revision: 498 $
+ */
+XMLDOC = {
+
+};
+
+/** The current version string of this application. */
+XMLDOC.VERSION = "1.0";
+
+/** Include the library necessary to handle XML files */
+IO.includeDir("handlers/XMLDOC/");
+
+/**
+ * @type Symbol[]
+ */
+XMLDOC.handle = function(srcFile, src) {
+
+};
+
+XMLDOC.publish = function(symbolgroup) {
+
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/handlers/XMLDOC/DomReader.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/handlers/XMLDOC/DomReader.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,159 @@
+LOG.inform("XMLDOC.DomReader loaded");
+
+XMLDOC.DomReader = function(root) {
+
+ this.dom = root;
+
+ /**
+ * The current node the reader is on
+ */
+ this.node = root;
+
+ /**
+ * Get the current node the reader is on
+ * @type XMLDOC.Parser.node
+ */
+ XMLDOC.DomReader.prototype.getNode = function() {
+ return this.node;
+ };
+
+ /**
+ * Set the node the reader should be positioned on.
+ * @param node {XMLDOC.Parser.node}
+ */
+ XMLDOC.DomReader.prototype.setNode = function(node) {
+ this.node = node;
+ };
+
+ /**
+ * A helper method to make sure the current node will
+ * never return null, unless null is passed as the root.
+ * @param step {String} An expression to evaluate - should return a node or null
+ */
+ XMLDOC.DomReader.prototype.navigate = function(step) {
+ var n;
+ if ((n = step) != null)
+ {
+ this.node = n;
+ return this.node;
+ }
+ return null;
+ };
+
+ /**
+ * Get the root node of the current node's document.
+ */
+ XMLDOC.DomReader.prototype.root = function() {
+ this.navigate(this.dom);
+ };
+
+ /**
+ * Get the parent of the current node.
+ */
+ XMLDOC.DomReader.prototype.parent = function() {
+ return this.navigate(this.node.parentNode());
+ };
+
+ /**
+ * Get the first child of the current node.
+ */
+ XMLDOC.DomReader.prototype.firstChild = function() {
+ return this.navigate(this.node.firstChild());
+ };
+
+ /**
+ * Get the last child of the current node.
+ */
+ XMLDOC.DomReader.prototype.lastChild = function() {
+ return this.navigate(this.node.lastChild());
+ };
+
+ /**
+ * Get the next sibling of the current node.
+ */
+ XMLDOC.DomReader.prototype.nextSibling = function() {
+ return this.navigate(this.node.nextSibling());
+ };
+
+ /**
+ * Get the previous sibling of the current node.
+ */
+ XMLDOC.DomReader.prototype.prevSibling = function() {
+ return this.navigate(this.node.prevSibling());
+ };
+
+ //===============================================================================================
+ // Support methods
+
+ /**
+ * Walk the tree starting with the current node, calling the plug-in for
+ * each node visited. Each time the plug-in is called, the DomReader
+ * is passed as the only parameter. Use the {@link XMLDOC.DomReader#getNode} method
+ * to access the current node. This method uses a depth first traversal pattern.
+ *
+ * @param srcFile {String} The source file being evaluated
+ */
+ XMLDOC.DomReader.prototype.getSymbols = function(srcFile)
+ {
+ XMLDOC.DomReader.symbols = [];
+ XMLDOC.DomReader.currentFile = srcFile;
+ JSDOC.Symbol.srcFile = (srcFile || "");
+
+ if (defined(JSDOC.PluginManager)) {
+ JSDOC.PluginManager.run("onDomGetSymbols", this);
+ }
+
+ return XMLDOC.DomReader.symbols;
+ };
+
+ /**
+ * Find the node with the given name using a depth first traversal.
+ * Does not modify the DomReader's current node.
+ *
+ * @param name {String} The name of the node to find
+ * @return the node that was found, or null if not found
+ */
+ XMLDOC.DomReader.prototype.findNode = function(name)
+ {
+ var findNode = null;
+
+ // Start at the current node and move into the subtree,
+ // looking for the node with the given name
+ function deeper(node, find)
+ {
+ var look = null;
+
+ if (node) {
+ if (node.name == find)
+ {
+ return node;
+ }
+
+ if (node.firstChild())
+ {
+ look = deeper(node.firstChild(), find);
+ }
+
+ if (!look && node.nextSibling())
+ {
+ look = deeper(node.nextSibling(), find);
+ }
+ }
+
+ return look;
+ }
+
+ return deeper(this.getNode().firstChild(), name);
+ };
+
+ /**
+ * Find the next node with the given name using a depth first traversal.
+ *
+ * @param name {String} The name of the node to find
+ */
+ XMLDOC.DomReader.prototype.findPreviousNode = function(name)
+ {
+ };
+
+};
+
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/handlers/XMLDOC/XMLDoc.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/handlers/XMLDOC/XMLDoc.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,16 @@
+LOG.inform("XMLDOC.symbolize loaded");
+
+/**
+ * Convert the source file to a set of symbols
+ */
+XMLDOC.symbolize = function(srcFile, src) {
+
+ LOG.inform("Symbolizing file '" + srcFile + "'");
+
+ // XML files already have a defined structure, so we don't need to
+ // do anything but parse them. The DOM reader can create a symbol
+ // table from the parsed XML.
+ var dr = new XMLDOC.DomReader(XMLDOC.Parser.parse(src));
+ return dr.getSymbols(srcFile);
+
+};
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/handlers/XMLDOC/XMLParse.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/handlers/XMLDOC/XMLParse.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,292 @@
+LOG.inform("XMLDOC.Parser loaded");
+
+/**
+ * XML Parser object. Returns an {@link #XMLDOC.Parser.node} which is
+ * the root element of the parsed document.
+ *
+ * By default, this parser will only handle well formed XML. To
+ * allow the parser to handle HTML, set the XMLDOC.Parser.strictMode
+ * variable to false before calling XMLDOC.Parser.parse().
+ *
+ * Note: If you pass poorly formed XML, it will cause the parser to throw
+ * an exception.
+ *
+ * @author Brett Fattori (bfattori@fry.com)
+ * @author $Author: micmath $
+ * @version $Revision: 497 $
+ */
+XMLDOC.Parser = {};
+
+/**
+ * Strict mode setting. Setting this to false allows HTML-style source to
+ * be parsed. Normally, well formed XML has defined end tags, or empty tags
+ * are properly formed. Default: true
+ * @type Boolean
+ */
+XMLDOC.Parser.strictMode = true;
+
+/**
+ * A node in an XML Document. Node types are ROOT, ELEMENT, COMMENT, PI, and TEXT.
+ * @param parent {XMLDOC.Parser.node} The parent node
+ * @param name {String} The node name
+ * @param type {String} One of the types
+ */
+XMLDOC.Parser.node = function(parent, name, type)
+{
+ this.name = name;
+ this.type = type || "ELEMENT";
+ this.parent = parent;
+ this.charData = "";
+ this.attrs = {};
+ this.nodes = [];
+ this.cPtr = 0;
+
+ XMLDOC.Parser.node.prototype.getAttributeNames = function() {
+ var a = [];
+ for (var o in this.attrs)
+ {
+ a.push(o);
+ }
+
+ return a;
+ };
+
+ XMLDOC.Parser.node.prototype.getAttribute = function(attr) {
+ return this.attrs[attr];
+ };
+
+ XMLDOC.Parser.node.prototype.setAttribute = function(attr, val) {
+ this.attrs[attr] = val;
+ };
+
+ XMLDOC.Parser.node.prototype.getChild = function(idx) {
+ return this.nodes[idx];
+ };
+
+ XMLDOC.Parser.node.prototype.parentNode = function() {
+ return this.parent;
+ };
+
+ XMLDOC.Parser.node.prototype.firstChild = function() {
+ return this.nodes[0];
+ };
+
+ XMLDOC.Parser.node.prototype.lastChild = function() {
+ return this.nodes[this.nodes.length - 1];
+ };
+
+ XMLDOC.Parser.node.prototype.nextSibling = function() {
+ var p = this.parent;
+ if (p && (p.nodes.indexOf(this) + 1 != p.nodes.length))
+ {
+ return p.getChild(p.nodes.indexOf(this) + 1);
+ }
+ return null;
+ };
+
+ XMLDOC.Parser.node.prototype.prevSibling = function() {
+ var p = this.parent;
+ if (p && (p.nodes.indexOf(this) - 1 >= 0))
+ {
+ return p.getChild(p.nodes.indexOf(this) - 1);
+ }
+ return null;
+ };
+};
+
+/**
+ * Parse an XML Document from the specified source. The XML should be
+ * well formed, unless strict mode is disabled, then the parser will
+ * handle HTML-style XML documents.
+ * @param src {String} The source to parse
+ */
+XMLDOC.Parser.parse = function(src)
+{
+ var A = [];
+
+ // Normailize whitespace
+ A = src.split("\r\n");
+ src = A.join("\n");
+ A = src.split("\r");
+ src = A.join("\n");
+
+ // Remove XML and DOCTYPE specifier
+ src.replace(/<\?XML .*\?>/i, "");
+ src.replace(//i, "");
+
+ // The document is the root node and cannot be modified or removed
+ var doc = new XMLDOC.Parser.node(null, "ROOT", "DOCUMENT");
+
+ // Let's break it down
+ XMLDOC.Parser.eat(doc, src);
+
+ return doc;
+};
+
+/**
+ * The XML fragment processing routine. This method is private and should not be called
+ * directly.
+ * @param parentNode {XMLDOC.Parser.node} The node which is the parent of this fragment
+ * @param src {String} The source within the fragment to process
+ * @private
+ */
+XMLDOC.Parser.eat = function(parentNode, src)
+{
+ // A simple tag def
+ var reTag = new RegExp("<(!|)(\\?|--|)((.|\\s)*?)\\2>","g");
+
+ // Special tag types
+ var reCommentTag = //;
+ var rePITag = /<\?((.|\s)*?)\?>/;
+
+ // A start tag (with potential empty marker)
+ var reStartTag = /<(.*?)( +([\w_\-]*)=(\"|')(.*)\4)*(\/)?>/;
+
+ // An empty HTML style tag (not proper XML, but we'll accept it so we can process HTML)
+ var reHTMLEmptyTag = /<(.*?)( +([\w_\-]*)=(\"|')(.*)\4)*>/;
+
+ // Fully enclosing tag with nested tags
+ var reEnclosingTag = /<(.*?)( +([\w_\-]*)=(\"|')(.*?)\4)*>((.|\s)*?)<\/\1>/;
+
+ // Breaks down attributes
+ var reAttributes = new RegExp(" +([\\w_\\-]*)=(\"|')(.*?)\\2","g");
+
+ // Find us a tag
+ var tag;
+ while ((tag = reTag.exec(src)) != null)
+ {
+ if (tag.index > 0)
+ {
+ // The next tag has some text before it
+ var text = src.substring(0, tag.index).replace(/^[ \t\n]+((.|\n)*?)[ \t\n]+$/, "$1");
+
+ if (text.length > 0 && (text != "\n"))
+ {
+ var txtnode = new XMLDOC.Parser.node(parentNode, "", "TEXT");
+ txtnode.charData = text;
+
+ // Append the new text node
+ parentNode.nodes.push(txtnode);
+ }
+
+ // Reset the lastIndex of reTag
+ reTag.lastIndex -= src.substring(0, tag.index).length;
+
+ // Eat the text
+ src = src.substring(tag.index);
+ }
+
+ if (reCommentTag.test(tag[0]))
+ {
+ // Is this a comment?
+ var comment = new XMLDOC.Parser.node(parentNode, "", "COMMENT");
+ comment.charData = reCommentTag.exec(tag[0])[1];
+
+ // Append the comment
+ parentNode.nodes.push(comment);
+
+ // Move the lastIndex of reTag
+ reTag.lastIndex -= tag[0].length;
+
+ // Eat the tag
+ src = src.replace(reCommentTag, "");
+ }
+ else if (rePITag.test(tag[0]))
+ {
+ // Is this a processing instruction?
+ var pi = new XMLDOC.Parser.node(parentNode, "", "PI");
+ pi.charData = rePITag.exec(tag[0])[1];
+
+ // Append the processing instruction
+ parentNode.nodes.push(pi);
+
+ // Move the lastIndex of reTag
+ reTag.lastIndex -= tag[0].length;
+
+ // Eat the tag
+ src = src.replace(rePITag, "");
+ }
+ else if (reStartTag.test(tag[0]))
+ {
+ // Break it down
+ var e = reStartTag.exec(tag[0]);
+ var elem = new XMLDOC.Parser.node(parentNode, e[1], "ELEMENT");
+
+ // Get attributes from the tag
+ var a;
+ while ((a = reAttributes.exec(e[2])) != null )
+ {
+ elem.attrs[a[1]] = a[3];
+ }
+
+ // Is this an empty XML-style tag?
+ if (e[6] == "/")
+ {
+ // Append the empty element
+ parentNode.nodes.push(elem);
+
+ // Move the lastIndex of reTag (include the start tag length)
+ reTag.lastIndex -= e[0].length;
+
+ // Eat the tag
+ src = src.replace(reStartTag, "");
+ }
+ else
+ {
+ // Check for malformed XML tags
+ var htmlParsed = false;
+ var htmlStartTag = reHTMLEmptyTag.exec(src);
+
+ // See if there isn't an end tag within this block
+ var reHTMLEndTag = new RegExp("");
+ var htmlEndTag = reHTMLEndTag.exec(src);
+
+ if (XMLDOC.Parser.strictMode && htmlEndTag == null)
+ {
+ // Poorly formed XML fails in strict mode
+ var err = new Error("Malformed XML passed to XMLDOC.Parser... Error contains malformed 'src'");
+ err.src = src;
+ throw err;
+ }
+ else if (htmlEndTag == null)
+ {
+ // This is an HTML-style empty tag, store the element for it in non-strict mode
+ parentNode.nodes.push(elem);
+
+ // Eat the tag
+ src = src.replace(reHTMLEmptyTag, "");
+ htmlParsed = true;
+ }
+
+ // If we didn't parse HTML-style, it must be an enclosing tag
+ if (!htmlParsed)
+ {
+ var enc = reEnclosingTag.exec(src);
+
+ // Go deeper into the document
+ XMLDOC.Parser.eat(elem, enc[6]);
+
+ // Append the new element node
+ parentNode.nodes.push(elem);
+
+ // Eat the tag
+ src = src.replace(reEnclosingTag, "");
+ }
+ }
+
+ // Reset the lastIndex of reTag
+ reTag.lastIndex = 0;
+ }
+ }
+
+ // No tag was found... append the text if there is any
+ src = src.replace(/^[ \t\n]+((.|\n)*?)[ \t\n]+$/, "$1");
+ if (src.length > 0 && (src != "\n"))
+ {
+ var txtNode = new XMLDOC.Parser.node(parentNode, "", "TEXT");
+ txtNode.charData = src;
+
+ // Append the new text node
+ parentNode.nodes.push(txtNode);
+ }
+};
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/lib/JSDOC.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/lib/JSDOC.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,106 @@
+/**
+ @overview
+ @date $Date: 2010-06-13 22:02:44 +0100 (Sun, 13 Jun 2010) $
+ @version $Revision: 837 $
+ @location $HeadURL: https://jsdoc-toolkit.googlecode.com/svn/tags/jsdoc_toolkit-2.4.0/jsdoc-toolkit/app/lib/JSDOC.js $
+ @name JSDOC.js
+ */
+
+/**
+ This is the main container for the JSDOC application.
+ @namespace
+*/
+JSDOC = {
+};
+
+/**
+ @requires Opt
+ */
+if (typeof arguments == "undefined") arguments = [];
+JSDOC.opt = Opt.get(
+ arguments,
+ {
+ a: "allfunctions",
+ c: "conf",
+ d: "directory",
+ "D[]": "define",
+ e: "encoding",
+ "E[]": "exclude",
+ h: "help",
+ m: "multiple",
+ n: "nocode",
+ o: "out",
+ p: "private",
+ q: "quiet",
+ r: "recurse",
+ S: "securemodules",
+ s: "suppress",
+ t: "template",
+ T: "testmode",
+ u: "unique",
+ v: "verbose",
+ x: "ext"
+ }
+);
+
+/** The current version string of this application. */
+JSDOC.VERSION = "2.4.0";
+
+/** Print out usage information and quit. */
+JSDOC.usage = function() {
+ print("USAGE: java -jar jsrun.jar app/run.js [OPTIONS] ...");
+ print("");
+ print("OPTIONS:");
+ print(" -a or --allfunctions\n Include all functions, even undocumented ones.\n");
+ print(" -c or --conf\n Load a configuration file.\n");
+ print(" -d= or --directory=\n Output to this directory (defaults to \"out\").\n");
+ print(" -D=\"myVar:My value\" or --define=\"myVar:My value\"\n Multiple. Define a variable, available in JsDoc as JSDOC.opt.D.myVar.\n");
+ print(" -e= or --encoding=\n Use this encoding to read and write files.\n");
+ print(" -E=\"REGEX\" or --exclude=\"REGEX\"\n Multiple. Exclude files based on the supplied regex.\n");
+ print(" -h or --help\n Show this message and exit.\n");
+ print(" -m or --multiples\n Don't warn about symbols being documented more than once.\n");
+ print(" -n or --nocode\n Ignore all code, only document comments with @name tags.\n");
+ print(" -o= or --out=\n Print log messages to a file (defaults to stdout).\n");
+ print(" -p or --private\n Include symbols tagged as private, underscored and inner symbols.\n");
+ print(" -q or --quiet\n Do not output any messages, not even warnings.\n");
+ print(" -r= or --recurse=\n Descend into src directories.\n");
+ print(" -s or --suppress\n Suppress source code output.\n");
+ print(" -S or --securemodules\n Use Secure Modules mode to parse source code.\n");
+ print(" -t= or --template=\n Required. Use this template to format the output.\n");
+ print(" -T or --test\n Run all unit tests and exit.\n");
+ print(" -u or --unique\n Force file names to be unique, but not based on symbol names.\n");
+ print(" -v or --verbose\n Provide verbose feedback about what is happening.\n");
+ print(" -x=[,EXT]... or --ext=[,EXT]...\n Scan source files with the given extension/s (defaults to js).\n");
+
+ quit();
+}
+
+/*t:
+ plan(4, "Testing JSDOC namespace.");
+
+ is(
+ typeof JSDOC,
+ "object",
+ "JSDOC.usage is a function."
+ );
+
+ is(
+ typeof JSDOC.VERSION,
+ "string",
+ "JSDOC.VERSION is a string."
+ );
+
+ is(
+ typeof JSDOC.usage,
+ "function",
+ "JSDOC.usage is a function."
+ );
+
+ is(
+ typeof JSDOC.opt,
+ "object",
+ "JSDOC.opt is a object."
+ );
+ */
+
+if (this.IO) IO.includeDir("lib/JSDOC/");
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/lib/JSDOC/DocComment.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/lib/JSDOC/DocComment.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,204 @@
+if (typeof JSDOC == "undefined") JSDOC = {};
+
+/**
+ Create a new DocComment. This takes a raw documentation comment,
+ and wraps it in useful accessors.
+ @class Represents a documentation comment object.
+ */
+JSDOC.DocComment = function(/**String*/comment) {
+ this.init();
+ if (typeof comment != "undefined") {
+ this.parse(comment);
+ }
+}
+
+JSDOC.DocComment.prototype.init = function() {
+ this.isUserComment = true;
+ this.src = "";
+ this.meta = "";
+ this.tagTexts = [];
+ this.tags = [];
+}
+
+/**
+ @requires JSDOC.DocTag
+ */
+JSDOC.DocComment.prototype.parse = function(/**String*/comment) {
+ if (comment == "") {
+ comment = "/** @desc */";
+ this.isUserComment = false;
+ }
+
+ this.src = JSDOC.DocComment.unwrapComment(comment);
+
+ this.meta = "";
+ if (this.src.indexOf("#") == 0) {
+ this.src.match(/#(.+[+-])([\s\S]*)$/);
+ if (RegExp.$1) this.meta = RegExp.$1;
+ if (RegExp.$2) this.src = RegExp.$2;
+ }
+
+ if (typeof JSDOC.PluginManager != "undefined") {
+ JSDOC.PluginManager.run("onDocCommentSrc", this);
+ }
+
+ this.fixDesc();
+
+ this.src = JSDOC.DocComment.shared+"\n"+this.src;
+
+ this.tagTexts =
+ this.src
+ .split(/(^|[\r\n])\s*@/)
+ .filter(function($){return $.match(/\S/)});
+
+ /**
+ The tags found in the comment.
+ @type JSDOC.DocTag[]
+ */
+ this.tags = this.tagTexts.map(function($){return new JSDOC.DocTag($)});
+
+ if (typeof JSDOC.PluginManager != "undefined") {
+ JSDOC.PluginManager.run("onDocCommentTags", this);
+ }
+}
+
+/*t:
+ plan(5, "testing JSDOC.DocComment");
+ requires("../frame/String.js");
+ requires("../lib/JSDOC/DocTag.js");
+
+ var com = new JSDOC.DocComment("/**@foo some\n* comment here*"+"/");
+ is(com.tagTexts[0], "foo some\ncomment here", "first tag text is found.");
+ is(com.tags[0].title, "foo", "the title is found in a comment with one tag.");
+
+ var com = new JSDOC.DocComment("/** @foo first\n* @bar second*"+"/");
+ is(com.getTag("bar").length, 1, "getTag() returns one tag by that title.");
+
+ JSDOC.DocComment.shared = "@author John Smith";
+ var com = new JSDOC.DocComment("/**@foo some\n* comment here*"+"/");
+ is(com.tags[0].title, "author", "shared comment is added.");
+ is(com.tags[1].title, "foo", "shared comment is added to existing tag.");
+*/
+
+/**
+ If no @desc tag is provided, this function will add it.
+ */
+JSDOC.DocComment.prototype.fixDesc = function() {
+ if (this.meta && this.meta != "@+") return;
+ if (/^\s*[^@\s]/.test(this.src)) {
+ this.src = "@desc "+this.src;
+ }
+}
+
+/*t:
+ plan(5, "testing JSDOC.DocComment#fixDesc");
+
+ var com = new JSDOC.DocComment();
+
+ com.src = "this is a desc\n@author foo";
+ com.fixDesc();
+ is(com.src, "@desc this is a desc\n@author foo", "if no @desc tag is provided one is added.");
+
+ com.src = "x";
+ com.fixDesc();
+ is(com.src, "@desc x", "if no @desc tag is provided one is added to a single character.");
+
+ com.src = "\nx";
+ com.fixDesc();
+ is(com.src, "@desc \nx", "if no @desc tag is provided one is added to return and character.");
+
+ com.src = " ";
+ com.fixDesc();
+ is(com.src, " ", "if no @desc tag is provided one is not added to just whitespace.");
+
+ com.src = "";
+ com.fixDesc();
+ is(com.src, "", "if no @desc tag is provided one is not added to empty.");
+*/
+
+/**
+ Remove slash-star comment wrapper from a raw comment string.
+ @type String
+ */
+JSDOC.DocComment.unwrapComment = function(/**String*/comment) {
+ if (!comment) return "";
+ var unwrapped = comment.replace(/(^\/\*\*|\*\/$)/g, "").replace(/^\s*\* ?/gm, "");
+ return unwrapped;
+}
+
+/*t:
+ plan(5, "testing JSDOC.DocComment.unwrapComment");
+
+ var com = "/**x*"+"/";
+ var unwrapped = JSDOC.DocComment.unwrapComment(com);
+ is(unwrapped, "x", "a single character jsdoc is found.");
+
+ com = "/***x*"+"/";
+ unwrapped = JSDOC.DocComment.unwrapComment(com);
+ is(unwrapped, "x", "three stars are allowed in the opener.");
+
+ com = "/****x*"+"/";
+ unwrapped = JSDOC.DocComment.unwrapComment(com);
+ is(unwrapped, "*x", "fourth star in the opener is kept.");
+
+ com = "/**x\n * y\n*"+"/";
+ unwrapped = JSDOC.DocComment.unwrapComment(com);
+ is(unwrapped, "x\ny\n", "leading stars and spaces are trimmed.");
+
+ com = "/**x\n * y\n*"+"/";
+ unwrapped = JSDOC.DocComment.unwrapComment(com);
+ is(unwrapped, "x\n y\n", "only first space after leading stars are trimmed.");
+*/
+
+/**
+ Provides a printable version of the comment.
+ @type String
+ */
+JSDOC.DocComment.prototype.toString = function() {
+ return this.src;
+}
+
+/*t:
+ plan(1, "testing JSDOC.DocComment#fixDesc");
+ var com = new JSDOC.DocComment();
+ com.src = "foo";
+ is(""+com, "foo", "stringifying a comment returns the unwrapped src.");
+*/
+
+/**
+ Given the title of a tag, returns all tags that have that title.
+ @type JSDOC.DocTag[]
+ */
+JSDOC.DocComment.prototype.getTag = function(/**String*/tagTitle) {
+ return this.tags.filter(function($){return $.title == tagTitle});
+}
+
+JSDOC.DocComment.prototype.deleteTag = function(/**String*/tagTitle) {
+ this.tags = this.tags.filter(function($){return $.title != tagTitle})
+}
+
+/*t:
+ plan(1, "testing JSDOC.DocComment#getTag");
+ requires("../frame/String.js");
+ requires("../lib/JSDOC/DocTag.js");
+
+ var com = new JSDOC.DocComment("/**@foo some\n* @bar\n* @bar*"+"/");
+ is(com.getTag("bar").length, 2, "getTag returns expected number of tags.");
+*/
+
+/**
+ Used to store the currently shared tag text.
+*/
+JSDOC.DocComment.shared = "";
+
+/*t:
+ plan(2, "testing JSDOC.DocComment.shared");
+ requires("../frame/String.js");
+ requires("../lib/JSDOC/DocTag.js");
+
+ JSDOC.DocComment.shared = "@author Michael";
+
+ var com = new JSDOC.DocComment("/**@foo\n* @foo*"+"/");
+ is(com.getTag("author").length, 1, "getTag returns shared tag.");
+ is(com.getTag("foo").length, 2, "getTag returns unshared tags too.");
+*/
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/lib/JSDOC/DocTag.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/lib/JSDOC/DocTag.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,294 @@
+if (typeof JSDOC == "undefined") JSDOC = {};
+
+/**
+ @constructor
+ */
+JSDOC.DocTag = function(src) {
+ this.init();
+ if (typeof src != "undefined") {
+ this.parse(src);
+ }
+}
+
+/**
+ Create and initialize the properties of this.
+ */
+JSDOC.DocTag.prototype.init = function() {
+ this.title = "";
+ this.type = "";
+ this.name = "";
+ this.isOptional = false;
+ this.defaultValue = "";
+ this.desc = "";
+
+ return this;
+}
+
+/**
+ Populate the properties of this from the given tag src.
+ @param {string} src
+ */
+JSDOC.DocTag.prototype.parse = function(src) {
+ if (typeof src != "string") throw "src must be a string not "+(typeof src);
+
+ try {
+ src = this.nibbleTitle(src);
+ if (JSDOC.PluginManager) {
+ JSDOC.PluginManager.run("onDocTagSynonym", this);
+ }
+
+ src = this.nibbleType(src);
+
+ // only some tags are allowed to have names.
+ if (this.title == "param" || this.title == "property" || this.title == "config") { // @config is deprecated
+ src = this.nibbleName(src);
+ }
+ }
+ catch(e) {
+ if (LOG) LOG.warn(e);
+ else throw e;
+ }
+ this.desc = src; // whatever is left
+
+ // example tags need to have whitespace preserved
+ if (this.title != "example") this.desc = this.desc.trim();
+
+ if (JSDOC.PluginManager) {
+ JSDOC.PluginManager.run("onDocTag", this);
+ }
+}
+
+/**
+ Automatically called when this is stringified.
+ */
+JSDOC.DocTag.prototype.toString = function() {
+ return this.desc;
+}
+
+/*t:
+ plan(1, "testing JSDOC.DocTag#toString");
+
+ var tag = new JSDOC.DocTag("param {object} date A valid date.");
+ is(""+tag, "A valid date.", "stringifying a tag returns the desc.");
+ */
+
+/**
+ Find and shift off the title of a tag.
+ @param {string} src
+ @return src
+ */
+JSDOC.DocTag.prototype.nibbleTitle = function(src) {
+ if (typeof src != "string") throw "src must be a string not "+(typeof src);
+
+ var parts = src.match(/^\s*(\S+)(?:\s([\s\S]*))?$/);
+
+ if (parts && parts[1]) this.title = parts[1];
+ if (parts && parts[2]) src = parts[2];
+ else src = "";
+
+ return src;
+}
+
+/*t:
+ plan(8, "testing JSDOC.DocTag#nibbleTitle");
+
+ var tag = new JSDOC.DocTag();
+
+ tag.init().nibbleTitle("aTitleGoesHere");
+ is(tag.title, "aTitleGoesHere", "a title can be found in a single-word string.");
+
+ var src = tag.init().nibbleTitle("aTitleGoesHere and the rest");
+ is(tag.title, "aTitleGoesHere", "a title can be found in a multi-word string.");
+ is(src, "and the rest", "the rest is returned when the title is nibbled off.");
+
+ src = tag.init().nibbleTitle("");
+ is(tag.title, "", "given an empty string the title is empty.");
+ is(src, "", "the rest is empty when the tag is empty.");
+
+ var src = tag.init().nibbleTitle(" aTitleGoesHere\n a description");
+ is(tag.title, "aTitleGoesHere", "leading and trailing spaces are not part of the title.");
+ is(src, " a description", "leading spaces (less one) are part of the description.");
+
+ tag.init().nibbleTitle("a.Title::Goes_Here foo");
+ is(tag.title, "a.Title::Goes_Here", "titles with punctuation are allowed.");
+ */
+
+/**
+ Find and shift off the type of a tag.
+ @requires frame/String.js
+ @param {string} src
+ @return src
+ */
+JSDOC.DocTag.prototype.nibbleType = function(src) {
+ if (typeof src != "string") throw "src must be a string not "+(typeof src);
+
+ if (src.match(/^\s*\{/)) {
+ var typeRange = src.balance("{", "}");
+ if (typeRange[1] == -1) {
+ throw "Malformed comment tag ignored. Tag type requires an opening { and a closing }: "+src;
+ }
+ this.type = src.substring(typeRange[0]+1, typeRange[1]).trim();
+ this.type = this.type.replace(/\s*,\s*/g, "|"); // multiples can be separated by , or |
+ src = src.substring(typeRange[1]+1);
+ }
+
+ return src;
+}
+
+/*t:
+ plan(5, "testing JSDOC.DocTag.parser.nibbleType");
+ requires("../frame/String.js");
+
+ var tag = new JSDOC.DocTag();
+
+ tag.init().nibbleType("{String[]} aliases");
+ is(tag.type, "String[]", "type can have non-alpha characters.");
+
+ tag.init().nibbleType("{ aTypeGoesHere } etc etc");
+ is(tag.type, "aTypeGoesHere", "type is trimmed.");
+
+ tag.init().nibbleType("{ oneType, twoType ,\n threeType } etc etc");
+ is(tag.type, "oneType|twoType|threeType", "multiple types can be separated by commas.");
+
+ var error;
+ try { tag.init().nibbleType("{widget foo"); }
+ catch(e) { error = e; }
+ is(typeof error, "string", "malformed tag type throws error.");
+ isnt(error.indexOf("Malformed"), -1, "error message tells tag is malformed.");
+ */
+
+/**
+ Find and shift off the name of a tag.
+ @requires frame/String.js
+ @param {string} src
+ @return src
+ */
+JSDOC.DocTag.prototype.nibbleName = function(src) {
+ if (typeof src != "string") throw "src must be a string not "+(typeof src);
+
+ src = src.trim();
+
+ // is optional?
+ if (src.charAt(0) == "[") {
+ var nameRange = src.balance("[", "]");
+ if (nameRange[1] == -1) {
+ throw "Malformed comment tag ignored. Tag optional name requires an opening [ and a closing ]: "+src;
+ }
+ this.name = src.substring(nameRange[0]+1, nameRange[1]).trim();
+ this.isOptional = true;
+
+ src = src.substring(nameRange[1]+1);
+
+ // has default value?
+ var nameAndValue = this.name.split("=");
+ if (nameAndValue.length) {
+ this.name = nameAndValue.shift().trim();
+ this.defaultValue = nameAndValue.join("=");
+ }
+ }
+ else {
+ var parts = src.match(/^(\S+)(?:\s([\s\S]*))?$/);
+ if (parts) {
+ if (parts[1]) this.name = parts[1];
+ if (parts[2]) src = parts[2].trim();
+ else src = "";
+ }
+ }
+
+ return src;
+}
+
+/*t:
+ requires("../frame/String.js");
+ plan(9, "testing JSDOC.DocTag.parser.nibbleName");
+
+ var tag = new JSDOC.DocTag();
+
+ tag.init().nibbleName("[foo] This is a description.");
+ is(tag.isOptional, true, "isOptional syntax is detected.");
+ is(tag.name, "foo", "optional param name is found.");
+
+ tag.init().nibbleName("[foo] This is a description.");
+ is(tag.isOptional, true, "isOptional syntax is detected when no type.");
+ is(tag.name, "foo", "optional param name is found when no type.");
+
+ tag.init().nibbleName("[foo=7] This is a description.");
+ is(tag.name, "foo", "optional param name is found when default value.");
+ is(tag.defaultValue, 7, "optional param default value is found when default value.");
+
+ //tag.init().nibbleName("[foo= a value] This is a description.");
+ //is(tag.defaultValue, " a value", "optional param default value is found when default value has spaces (issue #112).");
+
+ tag.init().nibbleName("[foo=[]] This is a description.");
+ is(tag.defaultValue, "[]", "optional param default value is found when default value is [] (issue #95).");
+
+ tag.init().nibbleName("[foo=a=b] This is a description.");
+ is(tag.name, "foo", "optional param name is found when default value is a=b.");
+ is(tag.defaultValue, "a=b", "optional param default value is found when default value is a=b.")
+ */
+
+/*t:
+ plan(32, "Testing JSDOC.DocTag.parser.");
+ requires("../frame/String.js");
+
+ var tag = new JSDOC.DocTag();
+
+ is(typeof tag, "object", "JSDOC.DocTag.parser with an empty string returns an object.");
+ is(typeof tag.title, "string", "returned object has a string property 'title'.");
+ is(typeof tag.type, "string", "returned object has a string property 'type'.");
+ is(typeof tag.name, "string", "returned object has a string property 'name'.");
+ is(typeof tag.defaultValue, "string", "returned object has a string property 'defaultValue'.");
+ is(typeof tag.isOptional, "boolean", "returned object has a boolean property 'isOptional'.");
+ is(typeof tag.desc, "string", "returned object has a string property 'desc'.");
+
+ tag = new JSDOC.DocTag("param {widget} foo");
+ is(tag.title, "param", "param title is found.");
+ is(tag.name, "foo", "param name is found when desc is missing.");
+ is(tag.desc, "", "param desc is empty when missing.");
+
+ tag = new JSDOC.DocTag("param {object} date A valid date.");
+ is(tag.name, "date", "param name is found with a type.");
+ is(tag.type, "object", "param type is found.");
+ is(tag.desc, "A valid date.", "param desc is found with a type.");
+
+ tag = new JSDOC.DocTag("param aName a description goes\n here.");
+ is(tag.name, "aName", "param name is found without a type.");
+ is(tag.desc, "a description goes\n here.", "param desc is found without a type.");
+
+ tag = new JSDOC.DocTag("param {widget}");
+ is(tag.name, "", "param name is empty when it is not given.");
+
+ tag = new JSDOC.DocTag("param {widget} [foo] This is a description.");
+ is(tag.name, "foo", "optional param name is found.");
+
+ tag = new JSDOC.DocTag("return {aType} This is a description.");
+ is(tag.type, "aType", "when return tag has no name, type is found.");
+ is(tag.desc, "This is a description.", "when return tag has no name, desc is found.");
+
+ tag = new JSDOC.DocTag("author Joe Coder ");
+ is(tag.title, "author", "author tag has a title.");
+ is(tag.type, "", "the author tag has no type.");
+ is(tag.name, "", "the author tag has no name.");
+ is(tag.desc, "Joe Coder ", "author tag has desc.");
+
+ tag = new JSDOC.DocTag("private \t\n ");
+ is(tag.title, "private", "private tag has a title.");
+ is(tag.type, "", "the private tag has no type.");
+ is(tag.name, "", "the private tag has no name.");
+ is(tag.desc, "", "private tag has no desc.");
+
+ tag = new JSDOC.DocTag("example\n example(code);\n more();");
+ is(tag.desc, " example(code);\n more();", "leading whitespace (less one) in examples code is preserved.");
+
+ tag = new JSDOC.DocTag("param theName \n");
+ is(tag.name, "theName", "name only is found.");
+
+ tag = new JSDOC.DocTag("type theDesc \n");
+ is(tag.desc, "theDesc", "desc only is found.");
+
+ tag = new JSDOC.DocTag("type {theType} \n");
+ is(tag.type, "theType", "type only is found.");
+
+ tag = new JSDOC.DocTag("");
+ is(tag.title, "", "title is empty when tag is empty.");
+ */
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/lib/JSDOC/JsDoc.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/lib/JSDOC/JsDoc.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,140 @@
+/**
+ @constructor
+ @param [opt] Used to override the commandline options. Useful for testing.
+ @version $Id: JsDoc.js 831 2010-03-09 14:24:56Z micmath $
+*/
+JSDOC.JsDoc = function(/**object*/ opt) {
+ if (opt) {
+ JSDOC.opt = opt;
+ }
+
+ if (JSDOC.opt.h) {
+ JSDOC.usage();
+ quit();
+ }
+
+ // defend against options that are not sane
+ if (JSDOC.opt._.length == 0) {
+ LOG.warn("No source files to work on. Nothing to do.");
+ quit();
+ }
+ if (JSDOC.opt.t === true || JSDOC.opt.d === true) {
+ JSDOC.usage();
+ }
+
+ if (typeof JSDOC.opt.d == "string") {
+ if (!JSDOC.opt.d.charAt(JSDOC.opt.d.length-1).match(/[\\\/]/)) {
+ JSDOC.opt.d = JSDOC.opt.d+"/";
+ }
+ LOG.inform("Output directory set to '"+JSDOC.opt.d+"'.");
+ IO.mkPath(JSDOC.opt.d);
+ }
+ if (JSDOC.opt.e) IO.setEncoding(JSDOC.opt.e);
+
+ // the -r option: scan source directories recursively
+ if (typeof JSDOC.opt.r == "boolean") JSDOC.opt.r = 10;
+ else if (!isNaN(parseInt(JSDOC.opt.r))) JSDOC.opt.r = parseInt(JSDOC.opt.r);
+ else JSDOC.opt.r = 1;
+
+ // the -D option: define user variables
+ var D = {};
+ if (JSDOC.opt.D) {
+ for (var i = 0; i < JSDOC.opt.D.length; i++) {
+ var param = JSDOC.opt.D[i];
+ // remove first and last character if both == "
+ if (
+ param.length > 1
+ && param.charAt(0) == '"'
+ && param.charAt(param.length-1) == '"'
+ ) {
+ param = param.substr(1, param.length-2);
+ }
+ var defineParts = param.split(":");
+ if (defineParts && defineParts.length > 1) {
+ for ( var dpIdx = 2; dpIdx < defineParts.length; dpIdx++ ) {
+ defineParts[1] += ':' + defineParts[dpIdx];
+ }
+ D[defineParts[0]] = defineParts[1];
+ }
+ }
+ }
+ JSDOC.opt.D = D;
+ // combine any conf file D options with the commandline D options
+ if (defined(JSDOC.conf)) for (var c in JSDOC.conf.D) {
+ if (!defined(JSDOC.opt.D[c])) {
+ JSDOC.opt.D[c] = JSDOC.conf.D[c];
+ }
+ }
+
+ // Give plugins a chance to initialize
+ if (defined(JSDOC.PluginManager)) {
+ JSDOC.PluginManager.run("onInit", JSDOC.opt);
+ }
+
+ JSDOC.opt.srcFiles = JSDOC.JsDoc._getSrcFiles();
+ JSDOC.JsDoc._parseSrcFiles();
+ JSDOC.JsDoc.symbolSet = JSDOC.Parser.symbols;
+}
+
+/**
+ Retrieve source file list.
+ @returns {String[]} The pathnames of the files to be parsed.
+ */
+JSDOC.JsDoc._getSrcFiles = function() {
+ JSDOC.JsDoc.srcFiles = [];
+
+ var ext = ["js"];
+ if (JSDOC.opt.x) {
+ ext = JSDOC.opt.x.split(",").map(function($) {return $.toLowerCase()});
+ }
+
+ for (var i = 0; i < JSDOC.opt._.length; i++) {
+ JSDOC.JsDoc.srcFiles = JSDOC.JsDoc.srcFiles.concat(
+ IO.ls(JSDOC.opt._[i], JSDOC.opt.r).filter(
+ function($) {
+ var thisExt = $.split(".").pop().toLowerCase();
+
+ if (JSDOC.opt.E) {
+ for(var n = 0; n < JSDOC.opt.E.length; n++) {
+ if ($.match(new RegExp(JSDOC.opt.E[n]))) {
+ LOG.inform("Excluding " + $);
+ return false; // if the file matches the regex then it's excluded.
+ }
+ }
+ }
+
+ return (ext.indexOf(thisExt) > -1); // we're only interested in files with certain extensions
+ }
+ )
+ );
+ }
+
+ return JSDOC.JsDoc.srcFiles;
+}
+
+JSDOC.JsDoc._parseSrcFiles = function() {
+ JSDOC.Parser.init();
+ for (var i = 0, l = JSDOC.JsDoc.srcFiles.length; i < l; i++) {
+ var srcFile = JSDOC.JsDoc.srcFiles[i];
+
+ if (JSDOC.opt.v) LOG.inform("Parsing file: " + srcFile);
+
+ try {
+ var src = IO.readFile(srcFile);
+ }
+ catch(e) {
+ LOG.warn("Can't read source file '"+srcFile+"': "+e.message);
+ }
+
+ var tr = new JSDOC.TokenReader();
+ var ts = new JSDOC.TokenStream(tr.tokenize(new JSDOC.TextStream(src)));
+
+ JSDOC.Parser.parse(ts, srcFile);
+
+ }
+ JSDOC.Parser.finish();
+
+ if (JSDOC.PluginManager) {
+ JSDOC.PluginManager.run("onFinishedParsing", JSDOC.Parser.symbols);
+ }
+}
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/lib/JSDOC/JsPlate.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/lib/JSDOC/JsPlate.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,109 @@
+/**
+ @constructor
+*/
+JSDOC.JsPlate = function(templateFile) {
+ if (templateFile) this.template = IO.readFile(templateFile);
+
+ this.templateFile = templateFile;
+ this.code = "";
+ this.parse();
+}
+
+JSDOC.JsPlate.prototype.parse = function() {
+ this.template = this.template.replace(/\{#[\s\S]+?#\}/gi, "");
+ this.code = "var output=\u001e"+this.template;
+
+ this.code = this.code.replace(
+ //gi,
+ function (match, eachName, inName) {
+ return "\u001e;\rvar $"+eachName+"_keys = keys("+inName+");\rfor(var $"+eachName+"_i = 0; $"+eachName+"_i < $"+eachName+"_keys.length; $"+eachName+"_i++) {\rvar $"+eachName+"_last = ($"+eachName+"_i == $"+eachName+"_keys.length-1);\rvar $"+eachName+"_key = $"+eachName+"_keys[$"+eachName+"_i];\rvar "+eachName+" = "+inName+"[$"+eachName+"_key];\routput+=\u001e";
+ }
+ );
+ this.code = this.code.replace(//g, "\u001e;\rif ($1) { output+=\u001e");
+ this.code = this.code.replace(/"};
+ this.is = function(){return false;}
+}
+
+JSDOC.TokenStream.prototype.rewind = function() {
+ this.cursor = -1;
+}
+
+/**
+ @type JSDOC.Token
+*/
+JSDOC.TokenStream.prototype.look = function(/**Number*/n, /**Boolean*/considerWhitespace) {
+ if (typeof n == "undefined") n = 0;
+
+ if (considerWhitespace == true) {
+ if (this.cursor+n < 0 || this.cursor+n > this.tokens.length) return {};
+ return this.tokens[this.cursor+n];
+ }
+ else {
+ var count = 0;
+ var i = this.cursor;
+
+ while (true) {
+ if (i < 0) return new JSDOC.Token("", "VOID", "START_OF_STREAM");
+ else if (i > this.tokens.length) return new JSDOC.Token("", "VOID", "END_OF_STREAM");
+
+ if (i != this.cursor && (this.tokens[i] === undefined || this.tokens[i].is("WHIT"))) {
+ if (n < 0) i--; else i++;
+ continue;
+ }
+
+ if (count == Math.abs(n)) {
+ return this.tokens[i];
+ }
+ count++;
+ (n < 0)? i-- : i++;
+ }
+
+ return new JSDOC.Token("", "VOID", "STREAM_ERROR"); // because null isn't an object and caller always expects an object
+ }
+}
+
+/**
+ @type JSDOC.Token|JSDOC.Token[]
+*/
+JSDOC.TokenStream.prototype.next = function(/**Number*/howMany) {
+ if (typeof howMany == "undefined") howMany = 1;
+ if (howMany < 1) return null;
+ var got = [];
+
+ for (var i = 1; i <= howMany; i++) {
+ if (this.cursor+i >= this.tokens.length) {
+ return null;
+ }
+ got.push(this.tokens[this.cursor+i]);
+ }
+ this.cursor += howMany;
+
+ if (howMany == 1) {
+ return got[0];
+ }
+ else return got;
+}
+
+/**
+ @type JSDOC.Token[]
+*/
+JSDOC.TokenStream.prototype.balance = function(/**String*/start, /**String*/stop) {
+ if (!stop) stop = JSDOC.Lang.matching(start);
+
+ var depth = 0;
+ var got = [];
+ var started = false;
+
+ while ((token = this.look())) {
+ if (token.is(start)) {
+ depth++;
+ started = true;
+ }
+
+ if (started) {
+ got.push(token);
+ }
+
+ if (token.is(stop)) {
+ depth--;
+ if (depth == 0) return got;
+ }
+ if (!this.next()) break;
+ }
+}
+
+JSDOC.TokenStream.prototype.getMatchingToken = function(/**String*/start, /**String*/stop) {
+ var depth = 0;
+ var cursor = this.cursor;
+
+ if (!start) {
+ start = JSDOC.Lang.matching(stop);
+ depth = 1;
+ }
+ if (!stop) stop = JSDOC.Lang.matching(start);
+
+ while ((token = this.tokens[cursor])) {
+ if (token.is(start)) {
+ depth++;
+ }
+
+ if (token.is(stop) && cursor) {
+ depth--;
+ if (depth == 0) return this.tokens[cursor];
+ }
+ cursor++;
+ }
+}
+
+JSDOC.TokenStream.prototype.insertAhead = function(/**JSDOC.Token*/token) {
+ this.tokens.splice(this.cursor+1, 0, token);
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/lib/JSDOC/Util.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/lib/JSDOC/Util.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,32 @@
+/**
+ * @namespace
+ * @deprecated Use {@link FilePath} instead.
+ */
+JSDOC.Util = {
+}
+
+/**
+ * @deprecated Use {@link FilePath.fileName} instead.
+ */
+JSDOC.Util.fileName = function(path) {
+ LOG.warn("JSDOC.Util.fileName is deprecated. Use FilePath.fileName instead.");
+ var nameStart = Math.max(path.lastIndexOf("/")+1, path.lastIndexOf("\\")+1, 0);
+ return path.substring(nameStart);
+}
+
+/**
+ * @deprecated Use {@link FilePath.fileExtension} instead.
+ */
+JSDOC.Util.fileExtension = function(filename) {
+ LOG.warn("JSDOC.Util.fileExtension is deprecated. Use FilePath.fileExtension instead.");
+ return filename.split(".").pop().toLowerCase();
+};
+
+/**
+ * @deprecated Use {@link FilePath.dir} instead.
+ */
+JSDOC.Util.dir = function(path) {
+ LOG.warn("JSDOC.Util.dir is deprecated. Use FilePath.dir instead.");
+ var nameStart = Math.max(path.lastIndexOf("/")+1, path.lastIndexOf("\\")+1, 0);
+ return path.substring(0, nameStart-1);
+}
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/lib/JSDOC/Walker.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/lib/JSDOC/Walker.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,507 @@
+if (typeof JSDOC == "undefined") JSDOC = {};
+
+/** @constructor */
+JSDOC.Walker = function(/**JSDOC.TokenStream*/ts) {
+ this.init();
+ if (typeof ts != "undefined") {
+ this.walk(ts);
+ }
+}
+
+JSDOC.Walker.prototype.init = function() {
+ this.ts = null;
+
+ var globalSymbol = new JSDOC.Symbol("_global_", [], "GLOBAL", new JSDOC.DocComment(""));
+ globalSymbol.isNamespace = true;
+ globalSymbol.srcFile = "";
+ globalSymbol.isPrivate = false;
+ JSDOC.Parser.addSymbol(globalSymbol);
+ this.lastDoc = null;
+ this.token = null;
+
+ /**
+ The chain of symbols under which we are currently nested.
+ @type Array
+ */
+ this.namescope = [globalSymbol];
+ this.namescope.last = function(n){ if (!n) n = 0; return this[this.length-(1+n)] || "" };
+}
+
+JSDOC.Walker.prototype.walk = function(/**JSDOC.TokenStream*/ts) {
+ this.ts = ts;
+ while (this.token = this.ts.look()) {
+ if (this.token.popNamescope) {
+
+ var symbol = this.namescope.pop();
+ if (symbol.is("FUNCTION")) {
+ if (this.ts.look(1).is("LEFT_PAREN") && symbol.comment.getTag("function").length == 0) {
+ symbol.isa = "OBJECT";
+ }
+ }
+ }
+ this.step();
+ if (!this.ts.next()) break;
+ }
+}
+
+JSDOC.Walker.prototype.step = function() {
+ if (this.token.is("JSDOC")) { // it's a doc comment
+
+ var doc = new JSDOC.DocComment(this.token.data);
+
+
+ if (doc.getTag("exports").length > 0) {
+ var exports = doc.getTag("exports")[0];
+
+ exports.desc.match(/(\S+) as (\S+)/i);
+ var n1 = RegExp.$1;
+ var n2 = RegExp.$2;
+
+ if (!n1 && n2) throw "@exports tag requires a value like: 'name as ns.name'";
+
+ JSDOC.Parser.rename = (JSDOC.Parser.rename || {});
+ JSDOC.Parser.rename[n1] = n2
+ }
+
+ if (doc.getTag("lends").length > 0) {
+ var lends = doc.getTag("lends")[0];
+
+ var name = lends.desc
+ if (!name) throw "@lends tag requires a value.";
+
+ var symbol = new JSDOC.Symbol(name, [], "OBJECT", doc);
+
+ this.namescope.push(symbol);
+
+ var matching = this.ts.getMatchingToken("LEFT_CURLY");
+ if (matching) matching.popNamescope = name;
+ else LOG.warn("Mismatched } character. Can't parse code in file " + symbol.srcFile + ".");
+
+ this.lastDoc = null;
+ return true;
+ }
+ else if (doc.getTag("name").length > 0 && doc.getTag("overview").length == 0) { // it's a virtual symbol
+ var virtualName = doc.getTag("name")[0].desc;
+ if (!virtualName) throw "@name tag requires a value.";
+
+ if (doc.getTag("memberOf").length > 0) {
+ virtualName = (doc.getTag("memberOf")[0] + "." + virtualName)
+ .replace(/([#.])\./, "$1");
+ doc.deleteTag("memberOf");
+ }
+
+ var symbol = new JSDOC.Symbol(virtualName, [], "VIRTUAL", doc);
+
+ JSDOC.Parser.addSymbol(symbol);
+
+ this.lastDoc = null;
+ return true;
+ }
+ else if (doc.meta) { // it's a meta doclet
+ if (doc.meta == "@+") JSDOC.DocComment.shared = doc.src;
+ else if (doc.meta == "@-") JSDOC.DocComment.shared = "";
+ else if (doc.meta == "nocode+") JSDOC.Parser.conf.ignoreCode = true;
+ else if (doc.meta == "nocode-") JSDOC.Parser.conf.ignoreCode = JSDOC.opt.n;
+ else throw "Unrecognized meta comment: "+doc.meta;
+
+ this.lastDoc = null;
+ return true;
+ }
+ else if (doc.getTag("overview").length > 0) { // it's a file overview
+ symbol = new JSDOC.Symbol("", [], "FILE", doc);
+
+ JSDOC.Parser.addSymbol(symbol);
+
+ this.lastDoc = null;
+ return true;
+ }
+ else {
+ this.lastDoc = doc;
+ return false;
+ }
+ }
+ else if (!JSDOC.Parser.conf.ignoreCode) { // it's code
+ if (this.token.is("NAME")) { // it's the name of something
+ var symbol;
+ var name = this.token.data;
+ var doc = null; if (this.lastDoc) doc = this.lastDoc;
+ var params = [];
+
+ // it's inside an anonymous object
+ if (this.ts.look(1).is("COLON") && this.ts.look(-1).is("LEFT_CURLY") && !(this.ts.look(-2).is("JSDOC") || this.namescope.last().comment.getTag("lends").length || this.ts.look(-2).is("ASSIGN") || this.ts.look(-2).is("COLON"))) {
+ name = "$anonymous";
+ name = this.namescope.last().alias+"-"+name
+
+ params = [];
+
+ symbol = new JSDOC.Symbol(name, params, "OBJECT", doc);
+
+ JSDOC.Parser.addSymbol(symbol);
+
+ this.namescope.push(symbol);
+
+ var matching = this.ts.getMatchingToken(null, "RIGHT_CURLY");
+ if (matching) matching.popNamescope = name;
+ else LOG.warn("Mismatched } character. Can't parse code in file " + symbol.srcFile + ".");
+ }
+ // function foo() {}
+ else if (this.ts.look(-1).is("FUNCTION") && this.ts.look(1).is("LEFT_PAREN")) {
+ var isInner;
+
+ if (this.lastDoc) doc = this.lastDoc;
+
+ if (doc && doc.getTag("memberOf").length > 0) {
+ name = (doc.getTag("memberOf")[0]+"."+name).replace("#.", "#");
+ doc.deleteTag("memberOf");
+ }
+ else {
+ name = this.namescope.last().alias+"-"+name;
+ if (!this.namescope.last().is("GLOBAL")) isInner = true;
+ }
+
+ if (!this.namescope.last().is("GLOBAL")) isInner = true;
+
+ params = JSDOC.Walker.onParamList(this.ts.balance("LEFT_PAREN"));
+
+ symbol = new JSDOC.Symbol(name, params, "FUNCTION", doc);
+ if (isInner) symbol.isInner = true;
+
+ if (this.ts.look(1).is("JSDOC")) {
+ var inlineReturn = ""+this.ts.look(1).data;
+ inlineReturn = inlineReturn.replace(/(^\/\*\* *| *\*\/$)/g, "");
+ symbol.type = inlineReturn;
+ }
+
+ JSDOC.Parser.addSymbol(symbol);
+
+ this.namescope.push(symbol);
+
+ var matching = this.ts.getMatchingToken("LEFT_CURLY");
+ if (matching) matching.popNamescope = name;
+ else LOG.warn("Mismatched } character. Can't parse code in file " + symbol.srcFile + ".");
+ }
+ // foo = function() {}
+ else if (this.ts.look(1).is("ASSIGN") && this.ts.look(2).is("FUNCTION")) {
+ var constructs;
+ var isConstructor = false;
+ if (doc && (constructs = doc.getTag("constructs")) && constructs.length) {
+ if (constructs[0].desc) {
+ name = constructs[0].desc;
+ isConstructor = true;
+ }
+ }
+
+ var isInner;
+ if (this.ts.look(-1).is("VAR") || this.isInner) {
+ if (doc && doc.getTag("memberOf").length > 0) {
+ name = (doc.getTag("memberOf")[0]+"."+name).replace("#.", "#");
+ doc.deleteTag("memberOf");
+ }
+ else {
+ name = this.namescope.last().alias+"-"+name;
+ if (!this.namescope.last().is("GLOBAL")) isInner = true;
+ }
+ if (!this.namescope.last().is("GLOBAL")) isInner = true;
+ }
+ else if (name.indexOf("this.") == 0) {
+ name = this.resolveThis(name);
+ }
+
+ if (this.lastDoc) doc = this.lastDoc;
+ params = JSDOC.Walker.onParamList(this.ts.balance("LEFT_PAREN"));
+
+ symbol = new JSDOC.Symbol(name, params, "FUNCTION", doc);
+
+ if (isInner) symbol.isInner = true;
+ if (isConstructor) symbol.isa = "CONSTRUCTOR";
+
+ if (this.ts.look(1).is("JSDOC")) {
+ var inlineReturn = ""+this.ts.look(1).data;
+ inlineReturn = inlineReturn.replace(/(^\/\*\* *| *\*\/$)/g, "");
+ symbol.type = inlineReturn;
+ }
+
+ JSDOC.Parser.addSymbol(symbol);
+
+ this.namescope.push(symbol);
+
+ var matching = this.ts.getMatchingToken("LEFT_CURLY");
+ if (matching) matching.popNamescope = name;
+ else LOG.warn("Mismatched } character. Can't parse code in file " + symbol.srcFile + ".");
+ }
+ // foo = new function() {} or foo = (function() {}
+ else if (this.ts.look(1).is("ASSIGN") && (this.ts.look(2).is("NEW") || this.ts.look(2).is("LEFT_PAREN")) && this.ts.look(3).is("FUNCTION")) {
+ var isInner;
+ if (this.ts.look(-1).is("VAR") || this.isInner) {
+ name = this.namescope.last().alias+"-"+name
+ if (!this.namescope.last().is("GLOBAL")) isInner = true;
+ }
+ else if (name.indexOf("this.") == 0) {
+ name = this.resolveThis(name);
+ }
+
+ this.ts.next(3); // advance past the "new" or "("
+
+ if (this.lastDoc) doc = this.lastDoc;
+ params = JSDOC.Walker.onParamList(this.ts.balance("LEFT_PAREN"));
+
+ symbol = new JSDOC.Symbol(name, params, "OBJECT", doc);
+ if (isInner) symbol.isInner = true;
+
+ if (this.ts.look(1).is("JSDOC")) {
+ var inlineReturn = ""+this.ts.look(1).data;
+ inlineReturn = inlineReturn.replace(/(^\/\*\* *| *\*\/$)/g, "");
+ symbol.type = inlineReturn;
+ }
+
+ JSDOC.Parser.addSymbol(symbol);
+
+ symbol.scopeType = "INSTANCE";
+ this.namescope.push(symbol);
+
+ var matching = this.ts.getMatchingToken("LEFT_CURLY");
+ if (matching) matching.popNamescope = name;
+ else LOG.warn("Mismatched } character. Can't parse code in file " + symbol.srcFile + ".");
+ }
+ // foo: function() {}
+ else if (this.ts.look(1).is("COLON") && this.ts.look(2).is("FUNCTION")) {
+ name = (this.namescope.last().alias+"."+name).replace("#.", "#");
+
+ if (this.lastDoc) doc = this.lastDoc;
+ params = JSDOC.Walker.onParamList(this.ts.balance("LEFT_PAREN"));
+
+ if (doc && doc.getTag("constructs").length) {
+ name = name.replace(/\.prototype(\.|$)/, "#");
+
+ if (name.indexOf("#") > -1) name = name.match(/(^[^#]+)/)[0];
+ else name = this.namescope.last().alias;
+
+ symbol = new JSDOC.Symbol(name, params, "CONSTRUCTOR", doc);
+ }
+ else {
+ symbol = new JSDOC.Symbol(name, params, "FUNCTION", doc);
+ }
+
+ if (this.ts.look(1).is("JSDOC")) {
+ var inlineReturn = ""+this.ts.look(1).data;
+ inlineReturn = inlineReturn.replace(/(^\/\*\* *| *\*\/$)/g, "");
+ symbol.type = inlineReturn;
+ }
+
+ JSDOC.Parser.addSymbol(symbol);
+
+ this.namescope.push(symbol);
+
+ var matching = this.ts.getMatchingToken("LEFT_CURLY");
+ if (matching) matching.popNamescope = name;
+ else LOG.warn("Mismatched } character. Can't parse code in file " + symbol.srcFile + ".");
+ }
+ // foo = {}
+ else if (this.ts.look(1).is("ASSIGN") && this.ts.look(2).is("LEFT_CURLY")) {
+ var isInner;
+ if (this.ts.look(-1).is("VAR") || this.isInner) {
+ name = this.namescope.last().alias+"-"+name
+ if (!this.namescope.last().is("GLOBAL")) isInner = true;
+ }
+ else if (name.indexOf("this.") == 0) {
+ name = this.resolveThis(name);
+ }
+
+ if (this.lastDoc) doc = this.lastDoc;
+
+ symbol = new JSDOC.Symbol(name, params, "OBJECT", doc);
+ if (isInner) symbol.isInner = true;
+
+
+ if (doc) JSDOC.Parser.addSymbol(symbol);
+
+ this.namescope.push(symbol);
+
+ var matching = this.ts.getMatchingToken("LEFT_CURLY");
+ if (matching) matching.popNamescope = name;
+ else LOG.warn("Mismatched } character. Can't parse code in file " + symbol.srcFile + ".");
+ }
+ // var foo;
+ else if (this.ts.look(1).is("SEMICOLON")) {
+ var isInner;
+
+ if (this.ts.look(-1).is("VAR") || this.isInner) {
+ name = this.namescope.last().alias+"-"+name
+ if (!this.namescope.last().is("GLOBAL")) isInner = true;
+
+ if (this.lastDoc) doc = this.lastDoc;
+
+ symbol = new JSDOC.Symbol(name, params, "OBJECT", doc);
+ if (isInner) symbol.isInner = true;
+
+
+ if (doc) JSDOC.Parser.addSymbol(symbol);
+ }
+ }
+ // foo = x
+ else if (this.ts.look(1).is("ASSIGN")) {
+ var isInner;
+ if (this.ts.look(-1).is("VAR") || this.isInner) {
+ name = this.namescope.last().alias+"-"+name
+ if (!this.namescope.last().is("GLOBAL")) isInner = true;
+ }
+ else if (name.indexOf("this.") == 0) {
+ name = this.resolveThis(name);
+ }
+
+ if (this.lastDoc) doc = this.lastDoc;
+
+ symbol = new JSDOC.Symbol(name, params, "OBJECT", doc);
+ if (isInner) symbol.isInner = true;
+
+
+ if (doc) JSDOC.Parser.addSymbol(symbol);
+ }
+ // foo: {}
+ else if (this.ts.look(1).is("COLON") && this.ts.look(2).is("LEFT_CURLY")) {
+ name = (this.namescope.last().alias+"."+name).replace("#.", "#");
+
+ if (this.lastDoc) doc = this.lastDoc;
+
+ symbol = new JSDOC.Symbol(name, params, "OBJECT", doc);
+
+
+ if (doc) JSDOC.Parser.addSymbol(symbol);
+
+ this.namescope.push(symbol);
+
+ var matching = this.ts.getMatchingToken("LEFT_CURLY");
+ if (matching) matching.popNamescope = name;
+ else LOG.warn("Mismatched } character. Can't parse code in file " + symbol.srcFile + ".");
+ }
+ // foo: x
+ else if (this.ts.look(1).is("COLON")) {
+ name = (this.namescope.last().alias+"."+name).replace("#.", "#");;
+
+ if (this.lastDoc) doc = this.lastDoc;
+
+ symbol = new JSDOC.Symbol(name, params, "OBJECT", doc);
+
+
+ if (doc) JSDOC.Parser.addSymbol(symbol);
+ }
+ // foo(...)
+ else if (this.ts.look(1).is("LEFT_PAREN")) {
+ if (typeof JSDOC.PluginManager != "undefined") {
+ var functionCall = {name: name};
+
+ var cursor = this.ts.cursor;
+ params = JSDOC.Walker.onParamList(this.ts.balance("LEFT_PAREN"));
+ this.ts.cursor = cursor;
+
+ for (var i = 0; i < params.length; i++)
+ functionCall["arg" + (i + 1)] = params[i].name;
+
+ JSDOC.PluginManager.run("onFunctionCall", functionCall);
+ if (functionCall.doc) {
+ this.ts.insertAhead(new JSDOC.Token(functionCall.doc, "COMM", "JSDOC"));
+ }
+ }
+ }
+ this.lastDoc = null;
+ }
+ else if (this.token.is("FUNCTION")) { // it's an anonymous function
+ if (
+ (!this.ts.look(-1).is("COLON") || !this.ts.look(-1).is("ASSIGN"))
+ && !this.ts.look(1).is("NAME")
+ ) {
+ if (this.lastDoc) doc = this.lastDoc;
+
+ name = "$anonymous";
+ name = this.namescope.last().alias+"-"+name
+
+ params = JSDOC.Walker.onParamList(this.ts.balance("LEFT_PAREN"));
+
+ symbol = new JSDOC.Symbol(name, params, "FUNCTION", doc);
+
+ JSDOC.Parser.addSymbol(symbol);
+
+ this.namescope.push(symbol);
+
+ var matching = this.ts.getMatchingToken("LEFT_CURLY");
+ if (matching) matching.popNamescope = name;
+ else LOG.warn("Mismatched } character. Can't parse code in file " + symbol.srcFile + ".");
+ }
+ }
+ }
+ return true;
+}
+
+/**
+ Resolves what "this." means when it appears in a name.
+ @param name The name that starts with "this.".
+ @returns The name with "this." resolved.
+ */
+JSDOC.Walker.prototype.resolveThis = function(name) {
+ name.match(/^this\.(.+)$/)
+ var nameFragment = RegExp.$1;
+ if (!nameFragment) return name;
+
+ var symbol = this.namescope.last();
+ var scopeType = symbol.scopeType || symbol.isa;
+
+ // if we are in a constructor function, `this` means the instance
+ if (scopeType == "CONSTRUCTOR") {
+ name = symbol.alias+"#"+nameFragment;
+ }
+
+ // if we are in an anonymous constructor function, `this` means the instance
+ else if (scopeType == "INSTANCE") {
+ name = symbol.alias+"."+nameFragment;
+ }
+
+ // if we are in a function, `this` means the container (possibly the global)
+ else if (scopeType == "FUNCTION") {
+ // in a method of a prototype, so `this` means the constructor
+ if (symbol.alias.match(/(^.*)[#.-][^#.-]+/)) {
+ var parentName = RegExp.$1;
+ var parent = JSDOC.Parser.symbols.getSymbol(parentName);
+
+ if (!parent) {
+ if (JSDOC.Lang.isBuiltin(parentName)) parent = JSDOC.Parser.addBuiltin(parentName);
+ else {
+ if (symbol.alias.indexOf("$anonymous") < 0) // these will be ignored eventually
+ LOG.warn("Trying to document "+symbol.alias+" without first documenting "+parentName+".");
+ }
+ }
+ if (parent) name = parentName+(parent.is("CONSTRUCTOR")?"#":".")+nameFragment;
+ }
+ else {
+ parent = this.namescope.last(1);
+ name = parent.alias+(parent.is("CONSTRUCTOR")?"#":".")+nameFragment;
+ }
+ }
+ // otherwise it means the global
+ else {
+ name = nameFragment;
+ }
+
+ return name;
+}
+
+JSDOC.Walker.onParamList = function(/**Array*/paramTokens) {
+ if (!paramTokens) {
+ LOG.warn("Malformed parameter list. Can't parse code.");
+ return [];
+ }
+ var params = [];
+ for (var i = 0, l = paramTokens.length; i < l; i++) {
+ if (paramTokens[i].is("JSDOC")) {
+ var paramType = paramTokens[i].data.replace(/(^\/\*\* *| *\*\/$)/g, "");
+
+ if (paramTokens[i+1] && paramTokens[i+1].is("NAME")) {
+ i++;
+ params.push({type: paramType, name: paramTokens[i].data});
+ }
+ }
+ else if (paramTokens[i].is("NAME")) {
+ params.push({name: paramTokens[i].data});
+ }
+ }
+ return params;
+}
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/main.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/main.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,111 @@
+/**
+ * @version $Id: main.js 818 2009-11-08 14:51:41Z micmath $
+ */
+
+function main() {
+ IO.include("lib/JSDOC.js");
+ IO.includeDir("plugins/");
+
+ // process the options
+
+ // the -c option: options are defined in a configuration file
+ if (JSDOC.opt.c) {
+ eval("JSDOC.conf = " + IO.readFile(JSDOC.opt.c));
+
+ LOG.inform("Using configuration file at '"+JSDOC.opt.c+"'.");
+
+ for (var c in JSDOC.conf) {
+ if (c !== "D" && !defined(JSDOC.opt[c])) { // commandline overrules config file
+ JSDOC.opt[c] = JSDOC.conf[c];
+ }
+ }
+
+ if (typeof JSDOC.conf["_"] != "undefined") {
+ JSDOC.opt["_"] = JSDOC.opt["_"].concat(JSDOC.conf["_"]);
+ }
+
+ LOG.inform("With configuration: ");
+ for (var o in JSDOC.opt) {
+ LOG.inform(" "+o+": "+JSDOC.opt[o]);
+ }
+ }
+
+ // be verbose
+ if (JSDOC.opt.v) LOG.verbose = true;
+
+ // send log messages to a file
+ if (JSDOC.opt.o) LOG.out = IO.open(JSDOC.opt.o);
+
+ // run the unit tests
+ if (JSDOC.opt.T) {
+ LOG.inform("JsDoc Toolkit running in test mode at "+new Date()+".");
+ IO.include("frame/Testrun.js");
+ IO.include("test.js");
+ }
+ else {
+ // a template must be defined and must be a directory path
+ if (!JSDOC.opt.t && System.getProperty("jsdoc.template.dir")) {
+ JSDOC.opt.t = System.getProperty("jsdoc.template.dir");
+ }
+ if (JSDOC.opt.t && SYS.slash != JSDOC.opt.t.slice(-1)) {
+ JSDOC.opt.t += SYS.slash;
+ }
+
+ // verbose messages about the options we were given
+ LOG.inform("JsDoc Toolkit main() running at "+new Date()+".");
+ LOG.inform("With options: ");
+ for (var o in JSDOC.opt) {
+ LOG.inform(" "+o+": "+JSDOC.opt[o]);
+ }
+
+ // initialize and build a symbolSet from your code
+ JSDOC.JsDoc();
+
+ // debugger's option: dump the entire symbolSet produced from your code
+ if (JSDOC.opt.Z) {
+ LOG.warn("So you want to see the data structure, eh? This might hang if you have circular refs...");
+ IO.include("frame/Dumper.js");
+ var symbols = JSDOC.JsDoc.symbolSet.toArray();
+ for (var i = 0, l = symbols.length; i < l; i++) {
+ var symbol = symbols[i];
+ print("// symbol: " + symbol.alias);
+ print(symbol.serialize());
+ }
+ }
+ else {
+ if (typeof JSDOC.opt.t != "undefined") {
+ try {
+ // a file named "publish.js" must exist in the template directory
+ load(JSDOC.opt.t+"publish.js");
+
+ // and must define a function named "publish"
+ if (!publish) {
+ LOG.warn("No publish() function is defined in that template so nothing to do.");
+ }
+ else {
+ // which will be called with the symbolSet produced from your code
+ publish(JSDOC.JsDoc.symbolSet);
+ }
+ }
+ catch(e) {
+ LOG.warn("Sorry, that doesn't seem to be a valid template: "+JSDOC.opt.t+"publish.js : "+e);
+ }
+ }
+ else {
+ LOG.warn("No template given. Might as well read the usage notes.");
+ JSDOC.usage();
+ }
+ }
+ }
+
+ // notify of any warnings
+ if (!JSDOC.opt.q && LOG.warnings.length) {
+ print(LOG.warnings.length+" warning"+(LOG.warnings.length != 1? "s":"")+".");
+ }
+
+ // stop sending log messages to a file
+ if (LOG.out) {
+ LOG.out.flush();
+ LOG.out.close();
+ }
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/plugins/commentSrcJson.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/plugins/commentSrcJson.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,20 @@
+JSDOC.PluginManager.registerPlugin(
+ "JSDOC.commentSrcJson",
+ {
+ onDocCommentSrc: function(comment) {
+ var json;
+ if (/^\s*@json\b/.test(comment)) {
+ comment.src = new String(comment.src).replace("@json", "");
+
+ eval("json = "+comment.src);
+ var tagged = "";
+ for (var i in json) {
+ var tag = json[i];
+ // todo handle cases where tag is an object
+ tagged += "@"+i+" "+tag+"\n";
+ }
+ comment.src = tagged;
+ }
+ }
+ }
+);
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/plugins/frameworkPrototype.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/plugins/frameworkPrototype.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,16 @@
+JSDOC.PluginManager.registerPlugin(
+ "JSDOC.frameworkPrototype",
+ {
+ onPrototypeClassCreate: function(classCreator) {
+ var desc = "";
+ if (classCreator.comment) {
+ desc = classCreator.comment;
+ }
+ var insert = desc+"/** @name "+classCreator.name+"\n@constructor\n@scope "+classCreator.name+".prototype */"
+
+ insert = insert.replace(/\*\/\/\*\*/g, "\n");
+ /*DEBUG*///print("insert is "+insert);
+ classCreator.addComment.data = insert;
+ }
+ }
+);
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/plugins/functionCall.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/plugins/functionCall.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,10 @@
+JSDOC.PluginManager.registerPlugin(
+ "JSDOC.functionCall",
+ {
+ onFunctionCall: function(functionCall) {
+ if (functionCall.name == "dojo.define" && functionCall.arg1) {
+ functionCall.doc = "/** @lends "+eval(functionCall.arg1)+".prototype */";
+ }
+ }
+ }
+);
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/plugins/publishSrcHilite.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/plugins/publishSrcHilite.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,62 @@
+JSDOC.PluginManager.registerPlugin(
+ "JSDOC.publishSrcHilite",
+ {
+ onPublishSrc: function(src) {
+ if (src.path in JsHilite.cache) {
+ return; // already generated src code
+ }
+ else JsHilite.cache[src.path] = true;
+
+ try {
+ var sourceCode = IO.readFile(src.path);
+ }
+ catch(e) {
+ print(e.message);
+ quit();
+ }
+
+ var hiliter = new JsHilite(sourceCode, src.charset);
+ src.hilited = hiliter.hilite();
+ }
+ }
+);
+
+function JsHilite(src, charset) {
+
+ var tr = new JSDOC.TokenReader();
+
+ tr.keepComments = true;
+ tr.keepDocs = true;
+ tr.keepWhite = true;
+
+ this.tokens = tr.tokenize(new JSDOC.TextStream(src));
+
+ // TODO is redefining toString() the best way?
+ JSDOC.Token.prototype.toString = function() {
+ return ""+this.data.replace(/";
+ }
+
+ if (!charset) charset = "utf-8";
+
+ this.header = ' '+
+ "
"); } + } + TestDoc.run(TestDoc.readFile(filePath)); +} + +TestDoc.run = function(src) { + try { eval(src); } catch(e) { print("# ERROR! "+e); } + + var chunks = src.split(/\/\*t:/); + + var run = function(chunk) { + // local shortcuts + var is = TestDoc.assertEquals; + var isnt = TestDoc.assertNotEquals; + var plan = TestDoc.plan; + var requires = TestDoc.requires; + + try { eval(chunk); } catch(e) { print("# ERROR! "+e); } + } + for (var start = -1, end = 0; (start = src.indexOf("/*t:", end)) > end; start = end) { + run( + src.substring( + start+4, + (end = src.indexOf("*/", start)) + ) + ); + } +} + +TestDoc.Result = function(verdict, message) { + this.verdict = verdict; + this.message = message; +} + +TestDoc.Result.prototype.toString = function() { + if (typeof this.verdict == "boolean") { + return (this.verdict? "ok" : "not ok") + " " + (++TestDoc.report.counter) + " - " + this.message; + } + + return "# " + this.message; +} + +TestDoc.requires = function(file) { + if (!TestDoc.requires.loaded[file]) { + load(file); + TestDoc.requires.loaded[file] = true; + } +} +TestDoc.requires.loaded = {}; + +TestDoc.report = function() { + TestDoc.report.counter = 0; + print("1.."+TestDoc.plans); + for (var i = 0; i < TestDoc.results.length; i++) { + print(TestDoc.results[i]); + } + print("----------------------------------------"); + if (TestDoc.fails == 0 && TestDoc.passes == TestDoc.plans) { + print("All tests successful."); + } + else { + print("Failed " + TestDoc.fails + "/" + TestDoc.plans + " tests, "+((TestDoc.plans == 0)? 0 : Math.round(TestDoc.passes/(TestDoc.passes+TestDoc.fails)*10000)/100)+"% okay. Planned to run "+TestDoc.plans+", did run "+(TestDoc.passes+TestDoc.fails)+".") + } +} + +TestDoc.plan = function(n, message) { + TestDoc.plans += n; + TestDoc.record(new TestDoc.Result(null, message+" ("+n+" tests)")); +} + +TestDoc.assertEquals = function(a, b, message) { + var result = (a == b); + if (!result) message += "\n#\n# " + a + " does not equal " + b + "\n#"; + TestDoc.record(new TestDoc.Result(result, message)); +} + +TestDoc.assertNotEquals = function(a, b, message) { + var result = (a != b); + if (!result) message += "\n#\n# " + a + " equals " + b + "\n#"; + TestDoc.record(new TestDoc.Result(result, message)); +} + +TestDoc.readFile = (function(){ + // rhino + if (typeof readFile == "function") { + return function(url) { + var text = readFile(url); + return text || ""; + } + } + + // a web browser + else { + return function(url) { + var httpRequest; + + if (window.XMLHttpRequest) { // Mozilla, Safari, etc + httpRequest = new XMLHttpRequest(); + } + else if (window.ActiveXObject) { // IE + try { + httpRequest = new ActiveXObject("Msxml2.XMLHTTP"); + } + catch (e) { + try { + httpRequest = new ActiveXObject("Microsoft.XMLHTTP"); + } + catch (e) { + } + } + } + + if (!httpRequest) { throw "Cannot create HTTP Request."; } + + httpRequest.open('GET', url, false); + httpRequest.send(''); + if (httpRequest.readyState == 4) { + if (httpRequest.status >= 400) { + throw "The HTTP Request returned an error code: "+httpRequest.status; + } + } + + return httpRequest.responseText || ""; + } + } +})(); diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/t/runner.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/t/runner.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,13 @@ +// try: java -jar ../../jsrun.jar runner.js + +load("TestDoc.js"); + +TestDoc.prove("../frame/Opt.js"); +TestDoc.prove("../lib/JSDOC.js"); +TestDoc.prove("../frame/String.js"); +TestDoc.prove("../lib/JSDOC/DocTag.js"); +TestDoc.prove("../lib/JSDOC/DocComment.js"); +TestDoc.prove("../lib/JSDOC/TokenReader.js"); +TestDoc.prove("../lib/JSDOC/Symbol.js"); + +TestDoc.report(); diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,342 @@ +load("app/frame/Dumper.js"); +function symbolize(opt) { + symbols = null; + JSDOC.JsDoc(opt); + symbols = JSDOC.JsDoc.symbolSet; +} + +var testCases = [ + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/overview.js"]}); + //print(Dumper.dump(symbols)); + is('symbols.getSymbolByName("My Cool Library").name', 'My Cool Library', 'File overview can be found by alias.'); + } + , + function() { + symbolize({_: [SYS.pwd+"test/name.js"]}); + + is('symbols.getSymbol("Response").name', "Response", 'Virtual class name is found.'); + is('symbols.getSymbol("Response#text").alias', "Response#text", 'Virtual method name is found.'); + is('symbols.getSymbol("Response#text").memberOf', "Response", 'Virtual method parent name is found.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/prototype.js"]}); + + is('symbols.getSymbol("Article").name', "Article", 'Function set to constructor prototype with inner constructor name is found.'); + is('symbols.getSymbol("Article").hasMethod("init")', true, 'The initializer method name of prototype function is correct.'); + is('symbols.getSymbol("Article").hasMember("counter")', true, 'A static property set in the prototype definition is found.'); + is('symbols.getSymbol("Article").hasMember("title")', true, 'An instance property set in the prototype is found.'); + is('symbols.getSymbol("Article#title").isStatic', false, 'An instance property has isStatic set to false.'); + is('symbols.getSymbol("Article.counter").name', "counter", 'A static property set in the initializer has the name set correctly.'); + is('symbols.getSymbol("Article.counter").memberOf', "Article", 'A static property set in the initializer has the memberOf set correctly.'); + is('symbols.getSymbol("Article.counter").isStatic', true, 'A static property set in the initializer has isStatic set to true.'); + } + , + function() { + symbolize({a:true, _: [SYS.pwd+"test/prototype_oblit.js"]}); + + is('symbols.getSymbol("Article").name', "Article", 'Oblit set to constructor prototype name is found.'); + is('typeof symbols.getSymbol("Article.prototype")', "undefined", 'The prototype oblit is not a symbol.'); + is('symbols.getSymbol("Article#getTitle").name', "getTitle", 'The nonstatic method name of prototype oblit is correct.'); + is('symbols.getSymbol("Article#getTitle").alias', "Article#getTitle", 'The alias of non-static method of prototype oblit is correct.'); + is('symbols.getSymbol("Article#getTitle").isStatic', false, 'The isStatic of a nonstatic method of prototype oblit is correct.'); + is('symbols.getSymbol("Article.getTitle").name', "getTitle", 'The static method name of prototype oblit is correct.'); + is('symbols.getSymbol("Article.getTitle").isStatic', true, 'The isStatic of a static method of prototype oblit is correct.'); + is('symbols.getSymbol("Article#getTitle").isa', "FUNCTION", 'The isa of non-static method of prototype oblit is correct.'); + is('symbols.getSymbol("Article.getTitle").alias', "Article.getTitle", 'The alias of a static method of prototype oblit is correct.'); + is('symbols.getSymbol("Article.getTitle").isa', "FUNCTION", 'The isa of static method of prototype oblit is correct.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/prototype_oblit_constructor.js"]}); + + is('symbols.getSymbol("Article").name', "Article", 'Oblit set to constructor prototype with inner constructor name is found.'); + is('symbols.getSymbol("Article#init").name', "init", 'The initializer method name of prototype oblit is correct.'); + is('symbols.getSymbol("Article").hasMember("pages")', true, 'Property set by initializer method "this" is on the outer constructor.'); + is('symbols.getSymbol("Article#Title").name', "Title", 'Name of the inner constructor name is found.'); + is('symbols.getSymbol("Article#Title").memberOf', "Article", 'The memberOf of the inner constructor name is found.'); + is('symbols.getSymbol("Article#Title").isa', "CONSTRUCTOR", 'The isa of the inner constructor name is constructor.'); + is('symbols.getSymbol("Article#Title").hasMember("title")', true, 'A property set on the inner constructor "this" is on the inner constructor.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/inner.js"]}); + + is('symbols.getSymbol("Outer").name', "Outer", 'Outer constructor prototype name is found.'); + is('symbols.getSymbol("Outer").methods.length', 1, 'Inner function doesnt appear as a method of the outer.'); + is('symbols.getSymbol("Outer").hasMethod("open")', true, 'Outer constructors methods arent affected by inner function.'); + is('symbols.getSymbol("Outer-Inner").alias', "Outer-Inner", 'Alias of inner function is found.'); + is('symbols.getSymbol("Outer-Inner").isa', "CONSTRUCTOR", 'isa of inner function constructor is found.'); + is('symbols.getSymbol("Outer-Inner").memberOf', "Outer", 'The memberOf of inner function is found.'); + is('symbols.getSymbol("Outer-Inner").name', "Inner", 'The name of inner function is found.'); + is('symbols.getSymbol("Outer-Inner#name").name', "name", 'A member of the inner function constructor, attached to "this" is found on inner.'); + is('symbols.getSymbol("Outer-Inner#name").memberOf', "Outer-Inner", 'The memberOf of an inner function member is found.'); + } + , + function() { + symbolize({a:true, _: [SYS.pwd+"test/prototype_nested.js"]}); + + is('symbols.getSymbol("Word").name', "Word", 'Base constructor name is found.'); + is('symbols.getSymbol("Word").hasMethod("reverse")', true, 'Base constructor method is found.'); + is('symbols.getSymbol("Word").methods.length', 1, 'Base constructor has only one method.'); + is('symbols.getSymbol("Word").memberOf', "", 'Base constructor memberOf is empty.'); + is('symbols.getSymbol("Word#reverse").name', "reverse", 'Member of constructor prototype name is found.'); + is('symbols.getSymbol("Word#reverse").memberOf', "Word", 'Member of constructor prototype memberOf is found.'); + is('symbols.getSymbol("Word#reverse.utf8").name', "utf8", 'Member of constructor prototype method name is found.'); + is('symbols.getSymbol("Word#reverse.utf8").memberOf', "Word#reverse", 'Static nested member memberOf is found.'); + } + , + function() { + symbolize({a:true, _: [SYS.pwd+"test/namespace_nested.js"]}); + + is('symbols.getSymbol("ns1").name', "ns1", 'Base namespace name is found.'); + is('symbols.getSymbol("ns1").memberOf', "", 'Base namespace memberOf is empty (its a constructor).'); + is('symbols.getSymbol("ns1.ns2").name', "ns2", 'Nested namespace name is found.'); + is('symbols.getSymbol("ns1.ns2").alias', "ns1.ns2", 'Nested namespace alias is found.'); + is('symbols.getSymbol("ns1.ns2").memberOf', "ns1", 'Nested namespace memberOf is found.'); + is('symbols.getSymbol("ns1.ns2.Function1").name', "Function1", 'Method of nested namespace name is found.'); + is('symbols.getSymbol("ns1.ns2.Function1").memberOf', "ns1.ns2", 'Constructor of nested namespace memberOf is found.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/functions_nested.js"]}); + + is('symbols.getSymbol("Zop").name', "Zop", 'Any constructor name is found.'); + is('symbols.getSymbol("Zop").isa', "CONSTRUCTOR", 'It isa constructor.'); + is('symbols.getSymbol("Zop").hasMethod("zap")', true, 'Its method name, set later, is in methods array.'); + is('symbols.getSymbol("Foo").name', "Foo", 'The containing constructor name is found.'); + is('symbols.getSymbol("Foo").hasMethod("methodOne")', true, 'Its method name is found.'); + is('symbols.getSymbol("Foo").hasMethod("methodTwo")', true, 'Its second method name is found.'); + is('symbols.getSymbol("Foo#methodOne").alias', "Foo#methodOne", 'A methods alias is found.'); + is('symbols.getSymbol("Foo#methodOne").isStatic', false, 'A methods is not static.'); + is('symbols.getSymbol("Bar").name', "Bar", 'A global function declared inside another function is found.'); + is('symbols.getSymbol("Bar").isa', "FUNCTION", 'It isa function.'); + is('symbols.getSymbol("Bar").memberOf', "_global_", 'It is global.'); + is('symbols.getSymbol("Foo-inner").name', "inner", 'An inner functions name is found.'); + is('symbols.getSymbol("Foo-inner").memberOf', "Foo", 'It is member of the outer function.'); + is('symbols.getSymbol("Foo-inner").isInner', true, 'It is an inner function.'); + } + , + function() { + symbolize({a:true, _: [SYS.pwd+"test/memberof_constructor.js"]}); + + is('symbols.getSymbol("Circle#Tangent").name', "Tangent", 'Constructor set on prototype using @member has correct name.'); + is('symbols.getSymbol("Circle#Tangent").memberOf', "Circle", 'Constructor set on prototype using @member has correct memberOf.'); + is('symbols.getSymbol("Circle#Tangent").alias', "Circle#Tangent", 'Constructor set on prototype using @member has correct alias.'); + is('symbols.getSymbol("Circle#Tangent").isa', "CONSTRUCTOR", 'Constructor set on prototype using @member has correct isa.'); + is('symbols.getSymbol("Circle#Tangent").isStatic', false, 'Constructor set on prototype using @member is not static.'); + is('symbols.getSymbol("Circle#Tangent#getDiameter").name', "getDiameter", 'Method set on prototype using @member has correct name.'); + is('symbols.getSymbol("Circle#Tangent#getDiameter").memberOf', "Circle#Tangent", 'Method set on prototype using @member has correct memberOf.'); + is('symbols.getSymbol("Circle#Tangent#getDiameter").alias', "Circle#Tangent#getDiameter", 'Method set on prototype using @member has correct alias.'); + is('symbols.getSymbol("Circle#Tangent#getDiameter").isa', "FUNCTION", 'Method set on prototype using @member has correct isa.'); + is('symbols.getSymbol("Circle#Tangent#getDiameter").isStatic', false, 'Method set on prototype using @member is not static.'); + } + , + function() { + symbolize({a:true, p: true, _: [SYS.pwd+"test/memberof.js"]}); + + is('symbols.getSymbol("pack.install").alias', "pack.install", 'Using @memberOf sets alias, when parent name is in memberOf tag.'); + is('symbols.getSymbol("pack.install.overwrite").name', "install.overwrite", 'Using @memberOf sets name, even if the name is dotted.'); + is('symbols.getSymbol("pack.install.overwrite").memberOf', "pack", 'Using @memberOf sets memberOf.'); + is('symbols.getSymbol("pack.install.overwrite").isStatic', true, 'Using @memberOf with value not ending in octothorp sets isStatic to true.'); + } + , + function() { + symbolize({a:true, p: true, _: [SYS.pwd+"test/memberof2.js"]}); + + is('symbols.getSymbol("Foo#bar").alias', "Foo#bar", 'An inner function can be documented as an instance method.'); + is('symbols.getSymbol("Foo.zip").alias', "Foo.zip", 'An inner function can be documented as a static method.'); + is('symbols.getSymbol("Foo.Fiz").alias', "Foo.Fiz", 'An inner function can be documented as a static constructor.'); + is('symbols.getSymbol("Foo.Fiz#fipple").alias', "Foo.Fiz#fipple", 'An inner function can be documented as a static constructor with a method.'); + is('symbols.getSymbol("Foo#blat").alias', "Foo#blat", 'An global function can be documented as an instance method.'); + } + , + function() { + symbolize({a:true, p: true, _: [SYS.pwd+"test/memberof3.js"]}); + + is('symbols.getSymbol("Foo#bar").alias', "Foo#bar", 'A virtual field can be documented as an instance method.'); + is('symbols.getSymbol("Foo2#bar").alias', "Foo2#bar", 'A virtual field with the same name can be documented as an instance method.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/borrows.js"]}); + + is('symbols.getSymbol("Layout").name', "Layout", 'Constructor can be found.'); + is('symbols.getSymbol("Layout").hasMethod("init")', true, 'Constructor method name can be found.'); + is('symbols.getSymbol("Layout").hasMember("orientation")', true, 'Constructor property name can be found.'); + + is('symbols.getSymbol("Page").hasMethod("reset")', true, 'Second constructor method name can be found.'); + is('symbols.getSymbol("Page").hasMember("orientation")', true, 'Second constructor borrowed property name can be found in properties.'); + is('symbols.getSymbol("Page#orientation").memberOf', "Page", 'Second constructor borrowed property memberOf can be found.'); + is('symbols.getSymbol("Page-getInnerElements").alias', "Page-getInnerElements", 'Can borrow an inner function and it is still inner.'); + is('symbols.getSymbol("Page.units").alias', "Page.units", 'Can borrow a static function and it is still static.'); + + is('symbols.getSymbol("ThreeColumnPage#init").alias', "ThreeColumnPage#init", 'Third constructor method can be found even though method with same name is borrowed.'); + is('symbols.getSymbol("ThreeColumnPage#reset").alias', "ThreeColumnPage#reset", 'Borrowed method can be found.'); + is('symbols.getSymbol("ThreeColumnPage#orientation").alias', "ThreeColumnPage#orientation", 'Twice borrowed method can be found.'); + + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/borrows2.js"]}); + + is('symbols.getSymbol("Foo").hasMethod("my_zop")', true, 'Borrowed method can be found.'); + is('symbols.getSymbol("Bar").hasMethod("my_zip")', true, 'Second borrowed method can be found.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/constructs.js"]}); + + is('symbols.getSymbol("Person").hasMethod("say")', true, 'The constructs tag creates a class that lends can add a method to.'); + } + , + function() { + symbolize({a: true, _: [SYS.pwd+"test/augments.js", SYS.pwd+"test/augments2.js"]}); + + is('symbols.getSymbol("Page").augments[0]', "Layout", 'An augmented class can be found.'); + is('symbols.getSymbol("Page#reset").alias', "Page#reset", 'Method of augmenter can be found.'); + is('symbols.getSymbol("Page").hasMethod("Layout#init")', true, 'Method from augmented can be found.'); + is('symbols.getSymbol("Page").hasMember("Layout#orientation")', true, 'Property from augmented can be found.'); + is('symbols.getSymbol("Page").methods.length', 3, 'Methods of augmented class are included in methods array.'); + + is('symbols.getSymbol("ThreeColumnPage").augments[0]', "Page", 'The extends tag is a synonym for augments.'); + is('symbols.getSymbol("ThreeColumnPage").hasMethod("ThreeColumnPage#init")', true, 'Local method overrides augmented method of same name.'); + is('symbols.getSymbol("ThreeColumnPage").methods.length', 3, 'Local method count is right.'); + + is('symbols.getSymbol("NewsletterPage").augments[0]', "ThreeColumnPage", 'Can augment across file boundaries.'); + is('symbols.getSymbol("NewsletterPage").augments.length', 2, 'Multiple augments are supported.'); + is('symbols.getSymbol("NewsletterPage").inherits[0].alias', "Junkmail#annoy", 'Inherited method with augments.'); + is('symbols.getSymbol("NewsletterPage").methods.length', 6, 'Methods of augmented class are included in methods array across files.'); + is('symbols.getSymbol("NewsletterPage").properties.length', 1, 'Properties of augmented class are included in properties array across files.'); + } + , + function() { + symbolize({a:true, _: [SYS.pwd+"test/static_this.js"]}); + + is('symbols.getSymbol("box.holder").name', "holder", 'Static namespace name can be found.'); + is('symbols.getSymbol("box.holder.foo").name', "foo", 'Static namespace method name can be found.'); + is('symbols.getSymbol("box.holder").isStatic', true, 'Static namespace method is static.'); + + is('symbols.getSymbol("box.holder.counter").name', "counter", 'Instance namespace property name set on "this" can be found.'); + is('symbols.getSymbol("box.holder.counter").alias', "box.holder.counter", 'Instance namespace property alias set on "this" can be found.'); + is('symbols.getSymbol("box.holder.counter").memberOf', "box.holder", 'Static namespace property memberOf set on "this" can be found.'); + } + , + function() { + symbolize({a:true, p: true, _: [SYS.pwd+"test/lend.js"]}); + + is('symbols.getSymbol("Person").name', "Person", 'Class defined in lend comment is found.'); + is('symbols.getSymbol("Person").hasMethod("initialize")', true, 'Lent instance method name can be found.'); + is('symbols.getSymbol("Person").hasMethod("say")', true, 'Second instance method can be found.'); + is('symbols.getSymbol("Person#sing").isStatic', false, 'Instance method is known to be not static.'); + + is('symbols.getSymbol("Person.getCount").name', "getCount", 'Static method name from second lend comment can be found.'); + is('symbols.getSymbol("Person.getCount").isStatic', true, 'Static method from second lend comment is known to be static.'); + + is('LOG.warnings.filter(function($){if($.indexOf("notok") > -1) return $}).length', 1, 'A warning is emitted when lending to an undocumented parent.'); + } + , + function() { + symbolize({a:true, _: [SYS.pwd+"test/param_inline.js"]}); + + is('symbols.getSymbol("Layout").params[0].type', "int", 'Inline param name is set.'); + is('symbols.getSymbol("Layout").params[0].desc', "The number of columns.", 'Inline param desc is set from comment.'); + is('symbols.getSymbol("Layout#getElement").params[0].name', "id", 'User defined param documentation takes precedence over parser defined.'); + is('symbols.getSymbol("Layout#getElement").params[0].isOptional', true, 'Default for param is to not be optional.'); + is('symbols.getSymbol("Layout#getElement").params[1].isOptional', false, 'Can mark a param as being optional.'); + is('symbols.getSymbol("Layout#getElement").params[1].type', "number|string", 'Type of inline param doc can have multiple values.'); + is('symbols.getSymbol("Layout#Canvas").params[0].type', "", 'Type can be not defined for some params.'); + is('symbols.getSymbol("Layout#Canvas").params[2].type', "int", 'Type can be defined inline for only some params.'); + is('symbols.getSymbol("Layout#rotate").params.length', 0, 'Docomments inside function sig is ignored without a param.'); + is('symbols.getSymbol("Layout#init").params[2].type', "zoppler", 'Doc comment type overrides inline type for param with same name.'); + } + , + function() { + symbolize({a: true, _: [SYS.pwd+"test/shared.js", SYS.pwd+"test/shared2.js"]}); + + is('symbols.getSymbol("Array#some").name', 'some', 'The name of a symbol in a shared section is found.'); + is('symbols.getSymbol("Array#some").alias', 'Array#some', 'The alias of a symbol in a shared section is found.'); + is('symbols.getSymbol("Array#some").desc', "Extension to builtin array.", 'A description can be shared.'); + is('symbols.getSymbol("Array#filter").desc', "Extension to builtin array.\nChange every element of an array.", 'A shared description is appended.'); + is('symbols.getSymbol("Queue").desc', "A first in, first out data structure.", 'A description is not shared when outside a shared section.'); + is('symbols.getSymbol("Queue.rewind").alias', "Queue.rewind", 'Second shared tag can be started.'); + is('symbols.getSymbol("startOver").alias', "startOver", 'Shared tag doesnt cross over files.'); + } + , + function() { + symbolize({a: true, _: [SYS.pwd+"test/config.js"]}); + is('symbols.getSymbol("Contact").params[0].name', 'person', 'The name of a param is found.'); + is('symbols.getSymbol("Contact").params[1].name', 'person.name', 'The name of a param set with a dot name is found.'); + is('symbols.getSymbol("Contact").params[2].name', 'person.age', 'The name of a second param set with a dot name is found.'); + is('symbols.getSymbol("Contact").params[4].name', 'connection', 'The name of a param after config is found.'); + + is('symbols.getSymbol("Family").params[0].name', 'persons', 'Another name of a param is found.'); + is('symbols.getSymbol("Family").params[1].name', 'persons.Father', 'The name of a param+config is found.'); + is('symbols.getSymbol("Family").params[2].name', 'persons.Mother', 'The name of a second param+config is found.'); + is('symbols.getSymbol("Family").params[3].name', 'persons.Children', 'The name of a third param+config is found.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/ignore.js"]}); + is('LOG.warnings.filter(function($){if($.indexOf("undocumented symbol Ignored") > -1) return $}).length', 1, 'A warning is emitted when documenting members of an ignored parent.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/functions_anon.js"]}); + is('symbols.getSymbol("a.b").alias', 'a.b', 'In anonymous constructor this is found to be the container object.'); + is('symbols.getSymbol("a.f").alias', 'a.f', 'In anonymous constructor this can have a method.'); + is('symbols.getSymbol("a.c").alias', 'a.c', 'In anonymous constructor method this is found to be the container object.'); + is('symbols.getSymbol("g").alias', 'g', 'In anonymous function executed inline this is the global.'); + is('symbols.getSymbol("bar2.p").alias', 'bar2.p', 'In named constructor executed inline this is the container object.'); + is('symbols.getSymbol("module.pub").alias', 'module.pub', 'In parenthesized anonymous function executed inline function scoped variables arent documented.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/oblit_anon.js"]}); + is('symbols.getSymbol("opt").name', 'opt', 'Anonymous object properties are created.'); + is('symbols.getSymbol("opt.conf.keep").alias', 'opt.conf.keep', 'Anonymous object first property is assigned to $anonymous.'); + is('symbols.getSymbol("opt.conf.base").alias', 'opt.conf.base', 'Anonymous object second property is assigned to $anonymous.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/params_optional.js"]}); + is('symbols.getSymbol("Document").params.length', 3, 'Correct number of params are found when optional param syntax is used.'); + is('symbols.getSymbol("Document").params[1].name', "id", 'Name of optional param is found.'); + is('symbols.getSymbol("Document").params[1].isOptional', true, 'Optional param is marked isOptional.'); + is('symbols.getSymbol("Document").params[2].name', "title", 'Name of optional param with default value is found.'); + is('symbols.getSymbol("Document").params[2].isOptional', true, 'Optional param with default value is marked isOptional.'); + is('symbols.getSymbol("Document").params[2].defaultValue', " This is untitled.", 'Optional param default value is found.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/synonyms.js"]}); + is('symbols.getSymbol("myObject.myFunc").type', 'function', 'Type can be set to function.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/event.js"]}); + is('symbols.getSymbol("Kitchen#event:cakeEaten").isEvent', true, 'Function with event prefix is an event.'); + is('symbols.getSymbol("Kitchen#cakeEaten").isa', "FUNCTION", 'Function with same name as event isa function.'); + } + , + function() { + symbolize({x:"js", a:true, _: [SYS.pwd+"test/scripts/"]}); + is('JSDOC.JsDoc.srcFiles.length', 1, 'Only js files are scanned when -x=js.'); + } + , + function() { + symbolize({x:"js", a:true, _: [SYS.pwd+"test/exports.js"]}); + is('symbols.getSymbol("mxn.Map#doThings").name', 'doThings', 'Exports creates a documentation alias that can have methods.'); + } + , + function() { + symbolize({p:true, a:true, _: [SYS.pwd+"test/module.js"]}); + is('symbols.getSymbol("myProject.myModule.myPublicMethod").name', 'myPublicMethod', 'A function wrapped in parens can be recognized.'); + is('symbols.getSymbol("myProject.myModule-myPrivateMethod").name', 'myPrivateMethod', 'A private method in the scope of a function wrapped in parens can be recognized.'); + is('symbols.getSymbol("myProject.myModule-myPrivateVar").name', 'myPrivateVar', 'A private member in the scope of a function wrapped in parens can be recognized.'); + } +]; + +//// run and print results +print(testrun(testCases)); diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/addon.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/addon.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,24 @@ +String.prototype.reverse = function() { +} + +String.prototype.reverse.utf8 = function() { +} + +Function.count = function() { +} + +/** @memberOf Function */ +Function.count.reset = function() { +} + +/** @memberOf Function */ +count.getValue = function() { +} + +/** @memberOf Function.prototype */ +getSig = function() { +} + +/** @memberOf Function.prototype */ +Function.prototype.getProps = function() { +} diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/anon_inner.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/anon_inner.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,14 @@ +/** + * @name bar + * @namespace + */ + +new function() { + /** + * @name bar-foo + * @function + * @param {number} x + */ + function foo(x) { + } +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/augments.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/augments.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,31 @@ +/** +@constructor +*/ +function Layout(p) { + this.init = function(p) { + } + + this.getId = function() { + } + + /** @type Page */ + this.orientation = "landscape"; +} + +/** +@constructor +@augments Layout +*/ +function Page() { + this.reset = function(b) { + } +} + +/** +@extends Page +@constructor +*/ +function ThreeColumnPage() { + this.init = function(resetCode) { + } +} diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/augments2.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/augments2.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,26 @@ +/** +@constructor +*/ +function LibraryItem() { + this.reserve = function() { + } +} + +/** +@constructor +*/ +function Junkmail() { + this.annoy = function() { + } +} + +/** +@inherits Junkmail.prototype.annoy as pester +@augments ThreeColumnPage +@augments LibraryItem +@constructor +*/ +function NewsletterPage() { + this.getHeadline = function() { + } +} diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/borrows.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/borrows.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,46 @@ +/** +@constructor +*/ +function Layout(p) { + /** initilize 1 */ + this.init = function(p) { + } + + /** get the id */ + this.getId = function() { + } + + /** @type string */ + this.orientation = "landscape"; + + function getInnerElements(elementSecretId){ + } +} + +/** A static method. */ +Layout.units = function() { +} + +/** +@constructor +@borrows Layout#orientation +@borrows Layout-getInnerElements +@borrows Layout.units +*/ +function Page() { + /** reset the page */ + this.reset = function(b) { + } +} + +/** +@constructor +@borrows Layout.prototype.orientation as this.orientation +@borrows Layout.prototype.init as #init +@inherits Page.prototype.reset as #reset +*/ +function ThreeColumnPage() { + /** initilize 2 */ + this.init = function(p) { + } +} diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/borrows2.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/borrows2.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,23 @@ +// testing circular borrows + +/** + @class + @borrows Bar#zop as this.my_zop +*/ +function Foo() { + /** this is a zip. */ + this.zip = function() {} + + this.my_zop = new Bar().zop; +} + +/** + @class + @borrows Foo#zip as this.my_zip +*/ +function Bar() { + /** this is a zop. */ + this.zop = function() {} + + this.my_zip = new Foo().zip; +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/config.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/config.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,22 @@ +/** + * @constructor + * @param person The person. + * @param {string} person.name The person's name. + * @config {integer} age The person's age. + * @config [id=1] Optional id number to use. + * @param connection + */ +function Contact(person, connection) { + +} + +/** + * @constructor + * @param persons + * @config {string} Father The paternal person. + * @config {string} Mother The maternal person. + * @config {string[]} Children And the rest. + */ +function Family(/**Object*/persons) { + +} diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/constructs.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/constructs.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,18 @@ +var Person = makeClass( + /** + @scope Person + */ + { + /** + This is just another way to define a constructor. + @constructs + @param {string} name The name of the person. + */ + initialize: function(name) { + this.name = name; + }, + say: function(message) { + return this.name + " says: " + message; + } + } +); \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/encoding.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/encoding.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,10 @@ + +/** + * @Constructor + * @desc 配置文件 + * @class 什么也不返回 + */ +function Test(conf) { + // do something; +} + diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/encoding_other.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/encoding_other.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,12 @@ + +/** + * @Constructor + * @desc + * @class + */ +function Test(conf) { + // do something; +} + +// run with commanline option -e=iso-8859-5 + diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/event.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/event.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,54 @@ +/** + * @name Kitchen + * @constructor + * @fires Bakery#event:donutOrdered + */ + +/** + * Fired when some cake is eaten. + * @name Kitchen#event:cakeEaten + * @function + * @param {Number} pieces The number of pieces eaten. + */ + +/** + * Find out if cake was eaten. + * @name Kitchen#cakeEaten + * @function + * @param {Boolean} wasEaten + */ + +/** + * @name getDesert + * @function + * @fires Kitchen#event:cakeEaten + */ + +/** + * @name Bakery + * @constructor + * @extends Kitchen + */ + +/** + * Fired when a donut order is made. + * @name Bakery#event:donutOrdered + * @event + * @param {Event} e The event object. + * @param {String} [e.topping] Optional sprinkles. + */ + +/** + * @constructor + * @borrows Bakery#event:donutOrdered as this.event:cakeOrdered + */ +function CakeShop() { +} + +/** @event */ +CakeShop.prototype.icingReady = function(isPink) { +} + +/** @event */ +function amHungry(/**Boolean*/enoughToEatAHorse) { +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/exports.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/exports.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,14 @@ +/** @namespace */ +var mxn = {}; + +(function(){ + /** @exports Map as mxn.Map */ + var Map = + /** @constructor */ + mxn.Map = function() { + }; + + /** A method. */ + Map.prototype.doThings = function() { + }; +})(); \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/functions_anon.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/functions_anon.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,39 @@ +/** an anonymous constructor executed inline */ +a = new function() { + /** a.b*/ + this.b = 1; + /** a.f */ + this.f = function() { + /** a.c */ + this.c = 2; + } +} + + +/** + named function executed inline +*/ +bar1 = function Zoola1() { + /** property of global */ + this.g = 1; +}(); + +/** + named constructor executed inline +*/ +bar2 = new function Zoola2() { + /** property of bar */ + this.p = 1; +}; + +/** module pattern */ +module = (function () { + /** won't appear in documentation */ + var priv = 1; + + /** @scope module */ + return { + /** will appear as a property of module */ + pub: 1 + } +})(); diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/functions_nested.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/functions_nested.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,33 @@ +/** @constructor */ +function Zop() { +} + +/** + @class +*/ +Foo = function(id) { + // this is a bit twisted, but if you call Foo() you will then + // modify Foo(). This is kinda, sorta non-insane, because you + // would have to call Foo() 100% of the time to use Foo's methods + Foo.prototype.methodOne = function(bar) { + alert(bar); + }; + + // same again + Foo.prototype.methodTwo = function(bar2) { + alert(bar2); + }; + + // and these are only executed if the enclosing function is actually called + // and who knows if that will ever happen? + Bar = function(pez) { + alert(pez); + }; + Zop.prototype.zap = function(p){ + alert(p); + }; + + // but this is only visible inside Foo + function inner() { + } +}; diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/global.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/global.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,13 @@ +/** ecks */ +var x = [1, 2, 4]; + +var y = { + foo: function(){ + } +} + +bar = function() { +} + +function zop() { +} diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/globals.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/globals.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,25 @@ +function example(/**Circle*/a, b) { + /** a global defined in function */ + var number = a; + + var hideNumber = function(){ + } + + setNumber = function(){ + } + alert('You have chosen: ' + b); +} + +function initPage() { + var supported = document.createElement && document.getElementsByTagName; + if (!supported) return; + // start of DOM script + var x = document.getElementById('writeroot'); + // etc. +} + +/** an example var */ +var document = new Document(x, y); + +var getNumber = function(){ +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/ignore.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/ignore.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,10 @@ +/** + * A test constructor. + * @constructor + * @ignore + */ +function Ignored() { + /** a method */ + this.bar = function() { + } +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/inner.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/inner.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,16 @@ +/** + * @constructor + */ +function Outer() { + /** + * @constructor + */ + function Inner(name) { + /** The name of this. */ + this.name = name; + } + + this.open = function(name) { + return (new Inner(name)); + } +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/jsdoc_test.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/jsdoc_test.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,477 @@ +/** + * @fileoverview This file is to be used for testing the JSDoc parser + * It is not intended to be an example of good JavaScript OO-programming, + * nor is it intended to fulfill any specific purpose apart from + * demonstrating the functionality of the + * JSDoc parser + * + * @author Gabriel Reid gab_reid@users.sourceforge.net + * @version 0.1 + */ + + +/** + * Construct a new Shape object. + * @class This is the basic Shape class. + * It can be considered an abstract class, even though no such thing + * really existing in JavaScript + * @constructor + * @throws MemoryException if there is no more memory + * @throws GeneralShapeException rarely (if ever) + * @return {Shape|Coordinate} A new shape. + */ +function Shape(){ + + /** + * This is an example of a function that is not given as a property + * of a prototype, but instead it is assigned within a constructor. + * For inner functions like this to be picked up by the parser, the + * function that acts as a constructor must be denoted with + * the @constructor tag in its comment. + * @type String + */ + this.getClassName = function(){ + return "Shape"; + } + + /** + * This is an inner method, just used here as an example + * @since version 0.5 + * @author Sue Smart + */ + function addReference(){ + // Do nothing... + } + +} + +/** + * Create a new Hexagon instance. + * @extends Shape + * @class Hexagon is a class that is a logical sublcass of + * {@link Shape} (thanks to the
Text in bold and italic and a + * link to SourceForge + * @private + * @type int + */ +Rectangle.prototype.width = 0; + +/** + * Value to represent the height of the Rectangle + * @private + * @type int + */ +Rectangle.prototype.height = 0; + +/** + * Get the type of this object. + * @type String + */ +Rectangle.prototype.getClassName= function(){ + return "Rectangle"; +} + +/** + * Get the value of the width for the Rectangle + * @type int + * @see Rectangle#setWidth + */ +Rectangle.prototype.getWidth = function(){ + return this.width; +} + +/** + * Get the value of the height for the Rectangle. + * Another getter is the {@link Shape#getColor} method in the + * {@link Shape} base class. + * @return The height of this Rectangle + * @type int + * @see Rectangle#setHeight + */ +Rectangle.prototype.getHeight = function(){ + return this.height; +} + +/** + * Set the width value for this Rectangle. + * @param {int} width The width value to be set + * @see #setWidth + */ +Rectangle.prototype.setWidth = function(width){ + this.width = width; +} + +/** + * Set the height value for this Rectangle. + * @param {int} height The height value to be set + * @see #getHeight + */ +Rectangle.prototype.setHeight = function(height){ + this.height = height; +} + +/** + * Get the value for the total area of this Rectangle + * @return total area of this Rectangle + * @type int + */ +Rectangle.prototype.getArea = function(){ + return width * height; +} + + +/** + * Create a new Square instance. + * @class A Square is a subclass of {@link Rectangle} + * @param {int} width The optional width for this Rectangle + * @param {int} height The optional height for this Rectangle + * @augments Rectangle + */ +function Square(width, height){ + if (width){ + this.width = width; + if (height){ + this.height = height; + } + } + +} + +/* Square is a subclass of Rectangle */ +Square.prototype = new Rectangle(); + +/** + * Set the width value for this Shape. + * @param {int} width The width value to be set + * @see #getWidth + */ +Square.prototype.setWidth = function(width){ + this.width = this.height = width; +} + +/** + * Set the height value for this Shape + * Sets the {@link Rectangle#height} attribute in the Rectangle. + * @param {int} height The height value to be set + */ +Square.prototype.setHeight = function(height){ + this.height = this.width = height; +} + + +/** + * Create a new Circle instance based on a radius. + * @class Circle class is another subclass of Shape + * @extends Shape + * @param {int} radius The optional radius of this {@link Circle } + * @mixin Square.prototype.setWidth as this.setDiameter + */ +function Circle(radius){ + if (radius) { + /** The radius of the this Circle. */ + this.radius = radius; + } +} + +/* Circle inherits from {@link Shape} */ +Circle.prototype = new Shape(); + +/** + * The radius value for this Circle + * @private + * @type int + */ +Circle.prototype.radius = 0; + +/** + * A very simple class (static) field that is also a constant + * @final + * @type float + */ +Circle.PI = 3.14; + +/** + * Get the radius value for this Circle + * @type int + * @see #setRadius + */ +Circle.prototype.getRadius = function(){ + return this.radius; +} + +/** + * Set the radius value for this Circle + * @param {int} radius The {@link Circle#radius} value to set + * @see #getRadius + */ +Circle.prototype.setRadius = function(radius){ + this.radius = radius; +} + +/** + * An example of a class (static) method that acts as a factory for Circle + * objects. Given a radius value, this method creates a new Circle. + * @param {int} radius The radius value to use for the new Circle. + * @type Circle + */ +Circle.createCircle = function(radius){ + return new Circle(radius); +} + + +/** + * Create a new Coordinate instance based on x and y grid data. + * @class Coordinate is a class that can encapsulate location information. + * @param {int} [x=0] The optional x portion of the Coordinate + * @param {int} [y=0] The optinal y portion of the Coordinate + */ +function Coordinate(x, y){ + if (x){ + this.x = x; + if (y){ + this.y = y; + } + } +} + +/** + * The x portion of the Coordinate + * @type int + * @see #getX + * @see #setX + */ +Coordinate.prototype.x = 0; + +/** + * The y portion of the Coordinate + * @type int + * @see #getY + * @see #setY + */ +Coordinate.prototype.y = 0; + +/** + * Gets the x portion of the Coordinate. + * @type int + * @see #setX + */ +Coordinate.prototype.getX = function(){ + return this.x; +} + +/** + * Get the y portion of the Coordinate. + * @type int + * @see #setY + */ +Coordinate.prototype.getY = function(){ + return this.y; +} + +/** + * Sets the x portion of the Coordinate. + * @param {int} x The x value to set + * @see #getX + */ +Coordinate.prototype.setX = function(x){ + this.x = x; +} + +/** + * Sets the y portion of the Coordinate. + * @param {int} y The y value to set + * @see #getY + */ +Coordinate.prototype.setY = function(y){ + this.y = y; +} + +/** + * @class This class exists to demonstrate the assignment of a class prototype + * as an anonymous block. + */ +function ShapeFactory(){ +} + +ShapeFactory.prototype = { + /** + * Creates a new {@link Shape} instance. + * @return A new {@link Shape} + * @type Shape + */ + createShape: function(){ + return new Shape(); + } +} + +/** + * An example of a singleton class + * @param ... Arguments represent {@link coordinate}s in the shape. + * @constructor + */ +MySingletonShapeFactory = function(){ + + /** + * Get the next {@link Shape} + * @type Shape + * @return A new {@link Shape} + */ + this.getShape = function(){ + return null; + } + +} + + +/** + * Create a new Foo instance. + * @class This is the Foo class. It exists to demonstrate 'nested' classes. + * @constructor + * @see Foo.Bar + */ +function Foo(){} + +/** + * Creates a new instance of Bar. + * @class This class exists to demonstrate 'nested' classes. + * @constructor + * @see Foo.Bar + */ +function Bar(){} + +/** + * Nested class + * @constructor + */ +Foo.Bar = function(){ + /** The x. */ this.x = 2; +} + +Foo.Bar.prototype = new Bar(); +/** The y. */ +Foo.Bar.prototype.y = '3'; diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/lend.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/lend.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,33 @@ + /** @class */ +var Person = Class.create( + /** + @lends Person.prototype + */ + { + initialize: function(name) { + this.name = name; + }, + say: function(message) { + return this.name + ': ' + message; + } + } + ); + +/** @lends Person.prototype */ +{ + /** like say but more musical */ + sing: function(song) { + } +} + +/** @lends Person */ +{ + getCount: function() { + } +} + +/** @lends Unknown.prototype */ +{ + notok: function() { + } +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/memberof.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/memberof.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,19 @@ +/** @constructor */ +pack = function() { + this.init = function(){} + function config(){} +} + + pack.build = function(task) {}; + +/** @memberOf pack */ +pack.install = function() {} + +/** @memberOf pack */ +pack.install.overwrite = function() {} + +/** @memberOf pack */ +clean = function() {} + +/** @memberOf pack-config */ +install = function() {}; diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/memberof2.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/memberof2.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,38 @@ +/** + * @constructor + */ +function Foo() { + /** + @memberOf Foo.prototype + */ + function bar(a, b) { + } + + /** + @memberOf Foo + */ + var zip = function(p, q) { + } + + /** + @memberOf Foo + */ + function zop( x,y ) { + } + + /** + @memberOf Foo + @constructor + */ + function Fiz() { + /** A method of Foo#Fiz. */ + this.fipple = function(fop){} + } +} + +/** + @memberOf Foo# + */ +var blat = function() { + +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/memberof3.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/memberof3.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,33 @@ +/** +* @name Foo +* @class +*/ + +/**#@+ +* @memberOf Foo# +* @field +*/ + +/** +* @name bar +* @type Object[] +*/ + +/**#@-*/ + +/** +* @name Foo2 +* @class +*/ + +/**#@+ +* @memberOf Foo2# +* @field +*/ + +/** +* @name bar +* @type Object[] +*/ + +/**#@-*/ \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/memberof_constructor.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/memberof_constructor.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,17 @@ +/** @constructor */ +function Circle(){} + +/** + @constructor + @memberOf Circle# + */ +Circle.prototype.Tangent = function(){}; + +// renaming Circle#Tangent to Circle#Circle#Tangent + +/** + @memberOf Circle#Tangent# + */ +Circle.prototype.Tangent.prototype.getDiameter = function(){}; + + diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/module.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/module.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,17 @@ +/** @namespace */ +myProject = myProject || {}; + +/** @namespace */ +myProject.myModule = (function () { + /** describe myPrivateVar here */ + var myPrivateVar = ""; + + var myPrivateMethod = function () { + } + + /** @scope myProject.myModule */ + return { + myPublicMethod: function () { + } + }; +})(); \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/multi_methods.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/multi_methods.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,25 @@ + +/** + Get the entire flavor. + @name flavor^3 + @function + @returns {Object} The entire flavor hash. +*/ +/** + Get a named flavor. + @name flavor^2 + @function + @param {String} name The name of the flavor to get. + @returns {String} The value of that flavor. +*/ +/** + Set the flavor. + @param {String} name The name of the flavor to set. + @param {String} value The value of the flavor. + @returns {String} The value of that flavor. +*/ +function flavor(name, value) { + if (arguments.length > 1) flavor[name] = value; + else if (arguments.length == 1) return flavor[name]; + else return flavor; +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/name.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/name.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,19 @@ +/** + @name Response + @class +*/ + +Response.prototype = { + /** + @name Response#text + @function + @description + Gets the body of the response as plain text + @returns {String} + Response as text + */ + + text: function() { + return this.nativeResponse.responseText; + } +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/namespace_nested.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/namespace_nested.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,23 @@ +/** + @namespace This is the first namespace. +*/ +ns1 = {}; + +/** + This is the second namespace. + @namespace +*/ +ns1.ns2 = {}; + +/** + This part of ns1.ns2 + @constructor +*/ +ns1.ns2.Function1 = function() { +}; + +ns1.staticFunction = function() { +}; + +/** A static field in a namespace. */ +ns1.ns2.staticField = 1; diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/nocode.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/nocode.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,13 @@ +/**#nocode+*/ + /** + @name star + @function + */ + function blahblah() { + + } +/**#nocode-*/ + +function yaddayadda() { + +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/oblit_anon.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/oblit_anon.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,20 @@ +/** the options */ +opt = Opt.get( + arguments, + { + d: "directory", + c: "conf", + "D[]": "define" + } +); + +/** configuration */ +opt.conf = { + /** keep */ + keep: true, + /** base */ + base: getBase(this, {p: properties}) +} + + + diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/overview.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/overview.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,20 @@ +/** + * @overview This "library" contains a + * lot of classes and functions. + * @example +
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/java/build_1.4.xml
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/java/build_1.4.xml Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,36 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/java/classes/js.jar
Binary file sbin/res/jsdoc/java/classes/js.jar has changed
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/java/src/JsDebugRun.java
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/java/src/JsDebugRun.java Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,21 @@
+/**
+ * A trivial bootstrap class that simply adds the path to the
+ * .js file as an argument to the Rhino call. This little hack
+ * allows the code in the .js file to have access to it's own
+ * path via the Rhino arguments object. This is necessary to
+ * allow the .js code to find resource files in a location
+ * relative to itself.
+ *
+ * USAGE: java -jar jsdebug.jar path/to/file.js
+ */
+public class JsDebugRun {
+ public static void main(String[] args) {
+ String[] jsargs = {"-j="+args[0]};
+
+ String[] allArgs = new String[jsargs.length + args.length];
+ System.arraycopy(args, 0, allArgs, 0, args.length);
+ System.arraycopy(jsargs, 0, allArgs, args.length ,jsargs.length);
+
+ org.mozilla.javascript.tools.debugger.Main.main(allArgs);
+ }
+}
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/java/src/JsRun.java
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/java/src/JsRun.java Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,21 @@
+/**
+ * A trivial bootstrap class that simply adds the path to the
+ * .js file as an argument to the Rhino call. This little hack
+ * allows the code in the .js file to have access to it's own
+ * path via the Rhino arguments object. This is necessary to
+ * allow the .js code to find resource files in a location
+ * relative to itself.
+ *
+ * USAGE: java -jar jsrun.jar path/to/file.js
+ */
+public class JsRun {
+ public static void main(String[] args) {
+ String[] jsargs = {"-j="+args[0]};
+
+ String[] allArgs = new String[jsargs.length + args.length];
+ System.arraycopy(args, 0, allArgs, 0, args.length);
+ System.arraycopy(jsargs, 0, allArgs, args.length ,jsargs.length);
+
+ org.mozilla.javascript.tools.shell.Main.main(allArgs);
+ }
+}
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/jsdebug.jar
Binary file sbin/res/jsdoc/jsdebug.jar has changed
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/jsrun.jar
Binary file sbin/res/jsdoc/jsrun.jar has changed
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/jsrun.sh
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/jsrun.sh Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,52 @@
+#!/bin/ksh
+
+# launcher script for jsdoc
+# Author: Avi Deitcher
+#
+# This program is released under the MIT License as follows:
+
+# Copyright (c) 2008-2009 Atomic Inc
+#
+#Permission is hereby granted, free of charge, to any person
+#obtaining a copy of this software and associated documentation
+#files (the "Software"), to deal in the Software without
+#restriction, including without limitation the rights to use,
+#copy, modify, merge, publish, distribute, sublicense, and/or sell
+#copies of the Software, and to permit persons to whom the
+#Software is furnished to do so, subject to the following
+#conditions:
+##
+#The above copyright notice and this permission notice shall be
+#included in all copies or substantial portions of the Software.
+#
+#THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+#EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES
+#OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+#NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT
+#HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+#WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
+#FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+#OTHER DEALINGS IN THE SOFTWARE.
+#
+
+
+if [[ -n "$JSDOCDIR" ]]; then
+ _DOCDIR="-Djsdoc.dir=$JSDOCDIR"
+ _APPDIR="$JSDOCDIR/app"
+ _BASEDIR="$JSDOCDIR"
+else
+ _DOCDIR=""
+ _APPDIR="./app"
+ _BASEDIR="."
+fi
+
+if [[ -n "$JSDOCTEMPLATEDIR" ]]; then
+ _TDIR="-Djsdoc.template.dir=$JSDOCTEMPLATEDIR"
+else
+ _TDIR=""
+fi
+
+CMD="java $_DOCDIR $_TDIR -jar $_BASEDIR/jsrun.jar $_APPDIR/run.js $@"
+echo $CMD
+$CMD
+
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/out/jsdoc/files.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/out/jsdoc/files.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,216 @@
+
+
+
+
+
+ JsDoc Reference - File Index
+
+
+
+
+
+
+ JsDoc Reference - Index
+
+
+
+
+
+
+ JsDoc Reference - _global_
+
+
+
+
+
+
+
+
+
\ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/templates/jsdoc/allfiles.tmpl --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/templates/jsdoc/allfiles.tmpl Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,56 @@ + + + + + {! Link.base = ""; /* all generated links will be relative to this */ !} +JsDoc Reference - File Index
+
+
+
+
+
+
+ {+include("static/header.html")+}
+
+ JsDoc Reference - {+data.alias+}
+
+
+
+
+
+
+
+ {+include("static/header.html")+}
+
+
+
+ JsDoc Reference - Index
+
+
+
+
+
+
+ {+include("static/header.html")+}
+
+ Generated Javascript Documentation
+
+
+
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/templates/jsdoc/symbol.tmpl
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/templates/jsdoc/symbol.tmpl Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,35 @@
+
+ {+data.name+}
+ {+data.memberOf+}
+ {+data.isStatic+}
+ {+data.isa+}
+ {+data.desc+}
+ {+data.classDesc+}
+
+
+
+ {+method.name+}
+ {+method.memberOf+}
+ {+method.isStatic+}
+ {+method.desc+}
+
+
+ {+param.type+}
+ {+param.name+}
+ {+param.desc+}
+ {+param.defaultValue+}
+
+
+
+
+ {+property.name+}
+ {+property.memberOf+}
+ {+property.isStatic+}
+ {+property.desc+}
+ {+property.type+}
+
+
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jslint-wrapper.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jslint-wrapper.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,51 @@
+/* source comes from a similar jquery script */
+/* run it like this : java -jar rhino.jar jslint-wrapper.js file.js */
+
+
+if (arguments.length == 1) {
+ jslint = "jslint.js"
+ srcfile = arguments[0];
+} else if (arguments.length != 2) {
+ print("jslint-wrapper jslint.js myfile.js");
+ quit();
+} else {
+ var jslint = arguments[0];
+ var srcfile = arguments[1];
+}
+
+src = readFile(srcfile, "utf8");
+load(jslint);
+
+JSLINT(src, { browser: true, forin: true, maxerr: 5 });
+
+//All of the following are known issues that we think are 'ok'
+//(in contradiction with JSLint) more information here:
+//http://docs.jquery.com/JQuery_Core_Style_Guidelines
+var ok = {
+ "Expected an identifier and instead saw 'undefined' (a reserved word).": true,
+ "Use '===' to compare with 'null'.": true,
+ "Use '!==' to compare with 'null'.": true,
+ "Expected an assignment or function call and instead saw an expression.": true,
+ "Expected a 'break' statement before 'case'.": true,
+ "'e' is already defined.": true,
+ "Expected exactly one space between 'function' and '('": true
+};
+
+var e = JSLINT.errors, found = 0, w;
+
+for ( var i = 0; i < e.length; i++ ) {
+ w = e[i];
+
+ if ( !ok[ w.reason ] ) {
+ found++;
+ print( "\n" + w.evidence + "\n" );
+ print( " Problem at line " + w.line + " character " + w.character + ": " + w.reason );
+ }
+}
+
+if ( found > 0 ) {
+ print( "\n" + found + " Error(s) found.\n" );
+
+} else {
+ print( "JSLint check passed.\n" );
+}
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jslint.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jslint.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,6917 @@
+// jslint.js
+// 2011-10-17
+
+// Copyright (c) 2002 Douglas Crockford (www.JSLint.com)
+
+// Permission is hereby granted, free of charge, to any person obtaining a copy
+// of this software and associated documentation files (the "Software"), to deal
+// in the Software without restriction, including without limitation the rights
+// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+// copies of the Software, and to permit persons to whom the Software is
+// furnished to do so, subject to the following conditions:
+
+// The above copyright notice and this permission notice shall be included in
+// all copies or substantial portions of the Software.
+
+// The Software shall be used for Good, not Evil.
+
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+// SOFTWARE.
+
+// WARNING: JSLint will hurt your feelings.
+
+// JSLINT is a global function. It takes two parameters.
+
+// var myResult = JSLINT(source, option);
+
+// The first parameter is either a string or an array of strings. If it is a
+// string, it will be split on '\n' or '\r'. If it is an array of strings, it
+// is assumed that each string represents one line. The source can be a
+// JavaScript text, or HTML text, or a JSON text, or a CSS text.
+
+// The second parameter is an optional object of options that control the
+// operation of JSLINT. Most of the options are booleans: They are all
+// optional and have a default value of false. One of the options, predef,
+// can be an array of names, which will be used to declare global variables,
+// or an object whose keys are used as global names, with a boolean value
+// that determines if they are assignable.
+
+// If it checks out, JSLINT returns true. Otherwise, it returns false.
+
+// If false, you can inspect JSLINT.errors to find out the problems.
+// JSLINT.errors is an array of objects containing these properties:
+
+// {
+// line : The line (relative to 0) at which the lint was found
+// character : The character (relative to 0) at which the lint was found
+// reason : The problem
+// evidence : The text line in which the problem occurred
+// raw : The raw message before the details were inserted
+// a : The first detail
+// b : The second detail
+// c : The third detail
+// d : The fourth detail
+// }
+
+// If a stopping error was found, a null will be the last element of the
+// JSLINT.errors array. A stopping error means that JSLint was not confident
+// enough to continue. It does not necessarily mean that the error was
+// especially heinous.
+
+// You can request a Function Report, which shows all of the functions
+// and the parameters and vars that they use. This can be used to find
+// implied global variables and other problems. The report is in HTML and
+// can be inserted in an HTML .
+
+// var myReport = JSLINT.report(errors_only);
+
+// If errors_only is true, then the report will be limited to only errors.
+
+// You can request a data structure that contains JSLint's results.
+
+// var myData = JSLINT.data();
+
+// It returns a structure with this form:
+
+// {
+// errors: [
+// {
+// line: NUMBER,
+// character: NUMBER,
+// reason: STRING,
+// evidence: STRING
+// }
+// ],
+// functions: [
+// {
+// name: STRING,
+// line: NUMBER,
+// last: NUMBER,
+// params: [
+// {
+// string: STRING
+// }
+// ],
+// closure: [
+// STRING
+// ],
+// var: [
+// STRING
+// ],
+// exception: [
+// STRING
+// ],
+// outer: [
+// STRING
+// ],
+// unused: [
+// STRING
+// ],
+// undef: [
+// STRING
+// ],
+// global: [
+// STRING
+// ],
+// label: [
+// STRING
+// ]
+// }
+// ],
+// globals: [
+// STRING
+// ],
+// member: {
+// STRING: NUMBER
+// },
+// urls: [
+// STRING
+// ],
+// json: BOOLEAN
+// }
+
+// Empty arrays will not be included.
+
+// You can obtain the parse tree that JSLint constructed while parsing. The
+// latest tree is kept in JSLINT.tree. A nice stringication can be produced
+// with
+
+// JSON.stringify(JSLINT.tree, [
+// 'string', 'arity', 'name', 'first',
+// 'second', 'third', 'block', 'else'
+// ], 4));
+
+// JSLint provides three directives. They look like slashstar comments, and
+// allow for setting options, declaring global variables, and establishing a
+// set of allowed property names.
+
+// These directives respect function scope.
+
+// The jslint directive is a special comment that can set one or more options.
+// The current option set is
+
+// adsafe true, if ADsafe rules should be enforced
+// bitwise true, if bitwise operators should be allowed
+// browser true, if the standard browser globals should be predefined
+// cap true, if upper case HTML should be allowed
+// confusion true, if types can be used inconsistently
+// 'continue' true, if the continuation statement should be tolerated
+// css true, if CSS workarounds should be tolerated
+// debug true, if debugger statements should be allowed
+// devel true, if logging should be allowed (console, alert, etc.)
+// eqeq true, if == should be allowed
+// es5 true, if ES5 syntax should be allowed
+// evil true, if eval should be allowed
+// forin true, if for in statements need not filter
+// fragment true, if HTML fragments should be allowed
+// indent the indentation factor
+// maxerr the maximum number of errors to allow
+// maxlen the maximum length of a source line
+// newcap true, if constructor names capitalization is ignored
+// node true, if Node.js globals should be predefined
+// nomen true, if names may have dangling _
+// on true, if HTML event handlers should be allowed
+// passfail true, if the scan should stop on first error
+// plusplus true, if increment/decrement should be allowed
+// properties true, if all property names must be declared with /*properties*/
+// regexp true, if the . should be allowed in regexp literals
+// rhino true, if the Rhino environment globals should be predefined
+// undef true, if variables can be declared out of order
+// unparam true, if unused parameters should be tolerated
+// safe true, if use of some browser features should be restricted
+// sloppy true, if the 'use strict'; pragma is optional
+// sub true, if all forms of subscript notation are tolerated
+// vars true, if multiple var statements per function should be allowed
+// white true, if sloppy whitespace is tolerated
+// widget true if the Yahoo Widgets globals should be predefined
+// windows true, if MS Windows-specific globals should be predefined
+
+// For example:
+
+/*jslint
+ evil: true, nomen: true, regexp: true
+*/
+
+// The properties directive declares an exclusive list of property names.
+// Any properties named in the program that are not in the list will
+// produce a warning.
+
+// For example:
+
+/*properties
+ '\b': string, '\t': string, '\n': string, '\f': string, '\r': string,
+ '!=': boolean, '!==': boolean, '"': string, '%': boolean, '\'': string,
+ '(begin)', '(breakage)': number, '(complexity)', '(confusion)': boolean,
+ '(context)': object, '(error)', '(identifier)', '(line)': number,
+ '(loopage)': number, '(name)', '(old_property_type)', '(params)',
+ '(scope)': object, '(token)', '(vars)', '(verb)', '*': boolean,
+ '+': boolean, '-': boolean, '/': *, '<': boolean, '<=': boolean,
+ '==': boolean, '===': boolean, '>': boolean, '>=': boolean,
+ ADSAFE: boolean, Array, Date, E: string, Function, LN10: string,
+ LN2: string, LOG10E: string, LOG2E: string, MAX_VALUE: string,
+ MIN_VALUE: string, NEGATIVE_INFINITY: string, Object, PI: string,
+ POSITIVE_INFINITY: string, SQRT1_2: string, SQRT2: string, '\\': string,
+ a: object, a_label: string, a_not_allowed: string, a_not_defined: string,
+ a_scope: string, abbr: object, acronym: object, address: object, adsafe,
+ adsafe_a: string, adsafe_autocomplete: string, adsafe_bad_id: string,
+ adsafe_div: string, adsafe_fragment: string, adsafe_go: string,
+ adsafe_html: string, adsafe_id: string, adsafe_id_go: string,
+ adsafe_lib: string, adsafe_lib_second: string, adsafe_missing_id: string,
+ adsafe_name_a: string, adsafe_placement: string, adsafe_prefix_a: string,
+ adsafe_script: string, adsafe_source: string, adsafe_subscript_a: string,
+ adsafe_tag: string, all: boolean, already_defined: string, and: string,
+ applet: object, apply: string, approved: array, area: object,
+ arity: string, article: object, aside: object, assign: boolean,
+ assign_exception: string, assignment_function_expression: string,
+ at: number, attribute_case_a: string, audio: object, autocomplete: string,
+ avoid_a: string, b: *, background: array, 'background-attachment': array,
+ 'background-color': array, 'background-image': array,
+ 'background-position': array, 'background-repeat': array,
+ bad_assignment: string, bad_color_a: string, bad_constructor: string,
+ bad_entity: string, bad_html: string, bad_id_a: string, bad_in_a: string,
+ bad_invocation: string, bad_name_a: string, bad_new: string,
+ bad_number: string, bad_operand: string, bad_style: string,
+ bad_type: string, bad_url_a: string, bad_wrap: string, base: object,
+ bdo: object, big: object, bind: string, bitwise: boolean, block: array,
+ blockquote: object, body: object, border: array, 'border-bottom': array,
+ 'border-bottom-color', 'border-bottom-left-radius',
+ 'border-bottom-right-radius', 'border-bottom-style': array,
+ 'border-bottom-width', 'border-collapse': array, 'border-color': array,
+ 'border-left': array, 'border-left-color', 'border-left-style': array,
+ 'border-left-width', 'border-radius', 'border-right': array,
+ 'border-right-color', 'border-right-style': array, 'border-right-width',
+ 'border-spacing': array, 'border-style': array, 'border-top': array,
+ 'border-top-color', 'border-top-left-radius', 'border-top-right-radius',
+ 'border-top-style': array, 'border-top-width', 'border-width': array,
+ bottom: array, br: object, braille: boolean, browser: boolean,
+ button: object, c, call: string, canvas: object, cap, caption: object,
+ 'caption-side': array, ceil: string, center: object, charAt: *,
+ charCodeAt: *, character, cite: object, clear: array, clip: array, closure,
+ cm: boolean, code: object, col: object, colgroup: object, color,
+ combine_var: string, command: object, concat: string,
+ conditional_assignment: string, confusing_a: string,
+ confusing_regexp: string, confusion: boolean, constructor: string,
+ constructor_name_a: string, content: array, continue, control_a: string,
+ 'counter-increment': array, 'counter-reset': array, create: *, css: string,
+ cursor: array, d, dangerous_comment: string, dangling_a: string,
+ data: function object, datalist: object, dd: object, debug,
+ defineProperties: string, defineProperty: string, del: object,
+ deleted: string, details: object, devel: boolean, dfn: object,
+ dialog: object, dir: object, direction: array, display: array,
+ disrupt: boolean, div: object, dl: object, dt: object, duplicate_a: string,
+ edge: string, edition: string, else, em: *, embed: object,
+ embossed: boolean, empty: boolean, 'empty-cells': array,
+ empty_block: string, empty_case: string, empty_class: string,
+ entityify: function, eqeq, errors: array, es5: string, eval, every: string,
+ evidence, evil: string, ex: boolean, exception, exec: *,
+ expected_a: string, expected_a_at_b_c: string, expected_a_b: string,
+ expected_a_b_from_c_d: string, expected_at_a: string,
+ expected_attribute_a: string, expected_attribute_value_a: string,
+ expected_class_a: string, expected_fraction_a: string,
+ expected_id_a: string, expected_identifier_a: string,
+ expected_identifier_a_reserved: string, expected_lang_a: string,
+ expected_linear_a: string, expected_media_a: string,
+ expected_name_a: string, expected_nonstandard_style_attribute: string,
+ expected_number_a: string, expected_operator_a: string,
+ expected_percent_a: string, expected_positive_a: string,
+ expected_pseudo_a: string, expected_selector_a: string,
+ expected_small_a: string, expected_space_a_b: string,
+ expected_string_a: string, expected_style_attribute: string,
+ expected_style_pattern: string, expected_tagname_a: string,
+ expected_type_a: string, f: string, fieldset: object, figure: object,
+ filter: *, first: *, flag, float: array, floor: *, font: *, 'font-family',
+ 'font-size': array, 'font-size-adjust': array, 'font-stretch': array,
+ 'font-style': array, 'font-variant': array, 'font-weight': array,
+ footer: object, for, forEach: *, for_if: string, forin, form: object,
+ fragment, frame: object, frameset: object, freeze: string, from: number,
+ fromCharCode: function, fud: function, funct: object, function,
+ function_block: string, function_eval: string, function_loop: string,
+ function_statement: string, function_strict: string, functions: array,
+ getDate: string, getDay: string, getFullYear: string, getHours: string,
+ getMilliseconds: string, getMinutes: string, getMonth: string,
+ getOwnPropertyDescriptor: string, getOwnPropertyNames: string,
+ getPrototypeOf: string, getSeconds: string, getTime: string,
+ getTimezoneOffset: string, getUTCDate: string, getUTCDay: string,
+ getUTCFullYear: string, getUTCHours: string, getUTCMilliseconds: string,
+ getUTCMinutes: string, getUTCMonth: string, getUTCSeconds: string,
+ getYear: string, global, globals, h1: object, h2: object, h3: object,
+ h4: object, h5: object, h6: object, handheld: boolean, hasOwnProperty: *,
+ head: object, header: object, height: array, hgroup: object, hr: object,
+ 'hta:application': object, html: *, html_confusion_a: string,
+ html_handlers: string, i: object, id: string, identifier: boolean,
+ identifier_function: string, iframe: object, img: object, immed: boolean,
+ implied_evil: string, in, indent: number, indexOf: *, infix_in: string,
+ init: function, input: object, ins: object, insecure_a: string,
+ isAlpha: function, isArray: function boolean, isDigit: function,
+ isExtensible: string, isFrozen: string, isNaN: string,
+ isPrototypeOf: string, isSealed: string, join: *, jslint: function boolean,
+ json: boolean, kbd: object, keygen: object, keys: *, label: object,
+ label_a_b: string, labeled: boolean, lang: string, lastIndex: string,
+ lastIndexOf: *, lbp: number, leading_decimal_a: string, led: function,
+ left: array, legend: object, length: *, 'letter-spacing': array,
+ li: object, lib: boolean, line: number, 'line-height': array, link: object,
+ 'list-style': array, 'list-style-image': array,
+ 'list-style-position': array, 'list-style-type': array, map: *,
+ margin: array, 'margin-bottom', 'margin-left', 'margin-right',
+ 'margin-top', mark: object, 'marker-offset': array, match: function,
+ 'max-height': array, 'max-width': array, maxerr: number,
+ maxlen: number, member: object, menu: object, message, meta: object,
+ meter: object, 'min-height': function, 'min-width': function,
+ missing_a: string, missing_a_after_b: string, missing_option: string,
+ missing_property: string, missing_space_a_b: string, missing_url: string,
+ missing_use_strict: string, mixed: string, mm: boolean, mode: string,
+ move_invocation: string, move_var: string, n: string, name: string,
+ name_function: string, nav: object, nested_comment: string,
+ newcap: boolean, node: boolean, noframes: object, nomen, noscript: object,
+ not: string, not_a_constructor: string, not_a_defined: string,
+ not_a_function: string, not_a_label: string, not_a_scope: string,
+ not_greater: string, now: string, nud: function, number: number,
+ object: object, ol: object, on, opacity, open: boolean, optgroup: object,
+ option: object, outer: regexp, outline: array, 'outline-color': array,
+ 'outline-style': array, 'outline-width', output: object, overflow: array,
+ 'overflow-x': array, 'overflow-y': array, p: object, padding: array,
+ 'padding-bottom': function, 'padding-left': function,
+ 'padding-right': function, 'padding-top': function,
+ 'page-break-after': array, 'page-break-before': array, param: object,
+ parameter_a_get_b: string, parameter_set_a: string, params: array,
+ paren: boolean, parent: string, parse: string, passfail, pc: boolean,
+ plusplus, pop: *, position: array, postscript: boolean, pre: object,
+ predef, preventExtensions: string, print: boolean, progress: object,
+ projection: boolean, properties: boolean, propertyIsEnumerable: string,
+ prototype: string, pt: boolean, push: *, px: boolean, q: object, quote,
+ quotes: array, r: string, radix: string, range: function, raw,
+ read_only: string, reason, redefinition_a: string, reduce: string,
+ reduceRight: string, regexp, replace: function, report: function,
+ reserved: boolean, reserved_a: string, reverse: string, rhino: boolean,
+ right: array, rp: object, rt: object, ruby: object, safe: boolean,
+ samp: object, scanned_a_b: string, screen: boolean, script: object,
+ seal: string, search: function, second: *, section: object, select: object,
+ setDate: string, setDay: string, setFullYear: string, setHours: string,
+ setMilliseconds: string, setMinutes: string, setMonth: string,
+ setSeconds: string, setTime: string, setTimezoneOffset: string,
+ setUTCDate: string, setUTCDay: string, setUTCFullYear: string,
+ setUTCHours: string, setUTCMilliseconds: string, setUTCMinutes: string,
+ setUTCMonth: string, setUTCSeconds: string, setYear: string, shift: *,
+ slash_equal: string, slice: string, sloppy, small: object, some: string,
+ sort: *, source: object, span: object, speech: boolean, splice: string,
+ split: function, src, statement_block: string, stopping: string,
+ strange_loop: string, strict: string, string: string, stringify: string,
+ strong: object, style: *, styleproperty: regexp, sub: object,
+ subscript: string, substr: *, substring: string, sup: object,
+ supplant: function, t: string, table: object, 'table-layout': array,
+ tag_a_in_b: string, tbody: object, td: object, test: *,
+ 'text-align': array, 'text-decoration': array, 'text-indent': function,
+ 'text-shadow': array, 'text-transform': array, textarea: object,
+ tfoot: object, th: object, thead: object, third: array, thru: number,
+ time: object, title: object, toDateString: string, toExponential: string,
+ toFixed: string, toISOString: string, toJSON: string,
+ toLocaleDateString: string, toLocaleLowerCase: string,
+ toLocaleString: string, toLocaleTimeString: string,
+ toLocaleUpperCase: string, toLowerCase: *, toPrecision: string,
+ toString: function, toTimeString: string, toUTCString: string,
+ toUpperCase: *, token: function, too_long: string, too_many: string,
+ top: array, tr: object, trailing_decimal_a: string, tree: string,
+ trim: string, tt: object, tty: boolean, tv: boolean, type: string,
+ type_confusion_a_b: string, u: object, ul: object, unclosed: string,
+ unclosed_comment: string, unclosed_regexp: string, undef: boolean,
+ undefined, unescaped_a: string, unexpected_a: string,
+ unexpected_char_a_b: string, unexpected_comment: string,
+ unexpected_property_a: string, unexpected_space_a_b: string,
+ 'unicode-bidi': array, unnecessary_initialize: string,
+ unnecessary_use: string, unparam, unreachable_a_b: string,
+ unrecognized_style_attribute_a: string, unrecognized_tag_a: string,
+ unsafe: string, unshift: string, unused: array, url: string, urls: array,
+ use_array: string, use_braces: string, use_charAt: string,
+ use_object: string, use_or: string, use_param: string,
+ used_before_a: string, valueOf: string, var: object, var_a_not: string,
+ vars, 'vertical-align': array, video: object, visibility: array,
+ warn: boolean, was: object, weird_assignment: string,
+ weird_condition: string, weird_new: string, weird_program: string,
+ weird_relation: string, weird_ternary: string, white: boolean,
+ 'white-space': array, widget: boolean, width: array, windows: boolean,
+ 'word-spacing': array, 'word-wrap': array, wrap: boolean,
+ wrap_immediate: string, wrap_regexp: string, write_is_wrong: string,
+ writeable: boolean, 'z-index': array
+*/
+
+// The global directive is used to declare global variables that can
+// be accessed by the program. If a declaration is true, then the variable
+// is writeable. Otherwise, it is read-only.
+
+// We build the application inside a function so that we produce only a single
+// global variable. That function will be invoked immediately, and its return
+// value is the JSLINT function itself. That function is also an object that
+// can contain data and other functions.
+
+var JSLINT = (function () {
+ 'use strict';
+
+ function array_to_object(array, value) {
+
+// Make an object from an array of keys and a common value.
+
+ var i, length = array.length, object = {};
+ for (i = 0; i < length; i += 1) {
+ object[array[i]] = value;
+ }
+ return object;
+ }
+
+
+ var adsafe_id, // The widget's ADsafe id.
+ adsafe_may, // The widget may load approved scripts.
+ adsafe_top, // At the top of the widget script.
+ adsafe_went, // ADSAFE.go has been called.
+ anonname, // The guessed name for anonymous functions.
+ approved, // ADsafe approved urls.
+
+// These are operators that should not be used with the ! operator.
+
+ bang = {
+ '<' : true,
+ '<=' : true,
+ '==' : true,
+ '===': true,
+ '!==': true,
+ '!=' : true,
+ '>' : true,
+ '>=' : true,
+ '+' : true,
+ '-' : true,
+ '*' : true,
+ '/' : true,
+ '%' : true
+ },
+
+// These are property names that should not be permitted in the safe subset.
+
+ banned = array_to_object([
+ 'arguments', 'callee', 'caller', 'constructor', 'eval', 'prototype',
+ 'stack', 'unwatch', 'valueOf', 'watch'
+ ], true),
+ begin, // The root token
+
+// browser contains a set of global names that are commonly provided by a
+// web browser environment.
+
+ browser = array_to_object([
+ 'clearInterval', 'clearTimeout', 'document', 'event', 'frames',
+ 'history', 'Image', 'localStorage', 'location', 'name', 'navigator',
+ 'Option', 'parent', 'screen', 'sessionStorage', 'setInterval',
+ 'setTimeout', 'Storage', 'window', 'XMLHttpRequest'
+ ], false),
+
+// bundle contains the text messages.
+
+ bundle = {
+ a_label: "'{a}' is a statement label.",
+ a_not_allowed: "'{a}' is not allowed.",
+ a_not_defined: "'{a}' is not defined.",
+ a_scope: "'{a}' used out of scope.",
+ adsafe_a: "ADsafe violation: '{a}'.",
+ adsafe_autocomplete: "ADsafe autocomplete violation.",
+ adsafe_bad_id: "ADSAFE violation: bad id.",
+ adsafe_div: "ADsafe violation: Wrap the widget in a div.",
+ adsafe_fragment: "ADSAFE: Use the fragment option.",
+ adsafe_go: "ADsafe violation: Misformed ADSAFE.go.",
+ adsafe_html: "Currently, ADsafe does not operate on whole HTML " +
+ "documents. It operates on b.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=
+a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=
+this.helper||this.element,a=0;a
');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-
+c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,
+arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,
+element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.13"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};
+if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),
+p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,
+c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),
+g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),
+10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,
+top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;
+g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:
+0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));
+if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&
+!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost==
+"string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;
+var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,
+10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
+;/*
+ * jQuery UI Selectable 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),
+selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
+c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",
+c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d=
+this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right{{real_name}}
" +
+ "{{{ contents }}}
" +
+ "{{ date }}
",
+ {creator: creator, real_name: real_name, contents : title, date : formatted_date});
+
+ this.selector.find(".Ldt-TweetReply").attr("href", "http://twitter.com/home?status=@" + creator + ":%20");
+
+
+ var rtText = Mustache.to_html("http://twitter.com/home?status=RT @{{creator}}: {{text}}",
+ {creator: creator, text: IriSP.encodeURI(annotation.content.title)});
+ this.selector.find(".Ldt-Retweet").attr("href", rtText);
+ }
+
+ this.selector.find(".Ldt-tweetContents").html(title);
+ this.selector.find(".Ldt-tweetAvatar").html(imageMarkup);
+ this.selector.show("blind", 250);
+};
+
+IriSP.TweetsWidget.prototype.displayTweet = function(annotation) {
+ if (this._displayingTweet === false) {
+ this._displayingTweet = true;
+ } else {
+ window.clearTimeout(this._timeoutId);
+ }
+
+ this.drawTweet(annotation);
+
+ var time = this._Popcorn.currentTime();
+ this._timeoutId = window.setTimeout(IriSP.wrap(this, this.clearPanel), IriSP.widgetsDefaults.TweetsWidget.tweet_display_period);
+};
+
+
+IriSP.TweetsWidget.prototype.clearPanel = function() {
+ this._displayingTweet = false;
+ this._timeoutId = undefined;
+ this.closePanel();
+
+};
+
+IriSP.TweetsWidget.prototype.closePanel = function() {
+ if (this._timeoutId != undefined) {
+ /* we're called from the "close window" link */
+ /* cancel the timeout */
+ window.clearTimeout(this._timeoutId);
+ this._timeoutId = null;
+ }
+
+ this.selector.hide("blind", 400);
+
+};
+
+/* cancel the timeout if the user clicks on the keep panel open button */
+IriSP.TweetsWidget.prototype.keepPanel = function() {
+ if (this._timeoutId != undefined) {
+ /* we're called from the "close window" link */
+ /* cancel the timeout */
+ window.clearTimeout(this._timeoutId);
+ this._timeoutId = null;
+ }
+};
+
+IriSP.TweetsWidget.prototype.draw = function() {
+ var _this = this;
+
+ var tweetMarkup = IriSP.templToHTML(IriSP.tweetWidget_template, {"share_template" : IriSP.share_template});
+ this.selector.append(tweetMarkup);
+ this.selector.hide();
+ this.selector.find(".Ldt-tweetWidgetMinimize").click(IriSP.wrap(this, this.closePanel));
+ this.selector.find(".Ldt-tweetWidgetKeepOpen").click(IriSP.wrap(this, this.keepPanel));
+
+ this._Popcorn.listen("IriSP.PolemicTweet.click", IriSP.wrap(this, this.PolemicTweetClickHandler));
+};
+
+IriSP.TweetsWidget.prototype.PolemicTweetClickHandler = function(tweet_id) {
+ var index, annotation;
+ for (index in this._serializer._data.annotations) {
+ annotation = this._serializer._data.annotations[index];
+
+ if (annotation.id === tweet_id)
+ break;
+ }
+
+ if (annotation.id !== tweet_id)
+ /* we haven't found it */
+ return;
+
+ this.displayTweet(annotation);
+ return;
+};
+
+IriSP.JSONSerializer = function(DataLoader, url) {
+ IriSP.Serializer.call(this, DataLoader, url);
+};
+
+IriSP.JSONSerializer.prototype = new IriSP.Serializer();
+
+IriSP.JSONSerializer.prototype.serialize = function(data) {
+ return JSON.stringify(data);
+};
+
+IriSP.JSONSerializer.prototype.deserialize = function(data) {
+ return JSON.parse(data);
+};
+
+IriSP.JSONSerializer.prototype.sync = function(callback) {
+ /* we don't have to do much because jQuery handles json for us */
+
+ var self = this;
+
+ var fn = function(data) {
+ self._data = data;
+ // sort the data too
+ self._data["annotations"].sort(function(a, b)
+ { var a_begin = +a.begin;
+ var b_begin = +b.begin;
+ return a_begin - b_begin;
+ });
+
+ callback(data);
+ };
+
+ this._DataLoader.get(this._url, fn);
+};
+
+IriSP.JSONSerializer.prototype.currentMedia = function() {
+ return this._data.medias[0]; /* FIXME: don't hardcode it */
+};
+
+/* this function searches for an annotation which matches title, description and keyword
+ "" matches any field.
+ Note: it ignores tweets.
+*/
+IriSP.JSONSerializer.prototype.searchAnnotations = function(title, description, keyword) {
+ /* we can have many types of annotations. We want search to only look for regular segments */
+ /* the next two lines are a bit verbose because for some test data, _serializer.data.view is either
+ null or undefined.
+ */
+ var view;
+
+ if (typeof(this._data.views) !== "undefined" && this._data.views !== null)
+ view = this._data.views[0];
+
+ var searchViewType = "";
+
+ if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) {
+ searchViewType = view.annotation_types[0];
+ }
+
+ var filterfn = function(annotation) {
+ if( searchViewType != "" &&
+ typeof(annotation.meta) !== "undefined" &&
+ typeof(annotation.meta["id-ref"]) !== "undefined" &&
+ annotation.meta["id-ref"] !== searchViewType) {
+ return true; // don't pass
+ } else {
+ return false;
+ }
+ };
+
+ return this.searchAnnotationsFilter(title, description, keyword, filterfn);
+
+};
+
+/* only look for tweets */
+IriSP.JSONSerializer.prototype.searchTweets = function(title, description, keyword) {
+ /* we can have many types of annotations. We want search to only look for regular segments */
+ /* the next two lines are a bit verbose because for some test data, _serializer.data.view is either
+ null or undefined.
+ */
+ var view;
+
+ if (typeof(this._data.views) !== "undefined" && this._data.views !== null)
+ view = this._data.views[0];
+
+ var searchViewType = "";
+
+ if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) {
+ searchViewType = view.annotation_types[0];
+ }
+
+ var filterfn = function(annotation) {
+ if( searchViewType != "" &&
+ typeof(annotation.meta) !== "undefined" &&
+ typeof(annotation.meta["id-ref"]) !== "undefined" &&
+ annotation.meta["id-ref"] !== searchViewType) {
+ return false; // pass
+ } else {
+ return true;
+ }
+ };
+
+ return this.searchAnnotationsFilter(title, description, keyword, filterfn);
+
+};
+
+/*
+ the previous function call this one, which is more general:
+ */
+IriSP.JSONSerializer.prototype.searchAnnotationsFilter = function(title, description, keyword, filter) {
+
+ var rTitle;
+ var rDescription;
+ var rKeyword;
+ /* match anything if given the empty string */
+ if (title == "")
+ title = ".*";
+ if (description == "")
+ description = ".*";
+ if (keyword == "")
+ keyword = ".*";
+
+ rTitle = new RegExp(title, "i");
+ rDescription = new RegExp(description, "i");
+ rKeyword = new RegExp(keyword, "i");
+
+ var ret_array = [];
+
+ var i;
+ for (i in this._data.annotations) {
+ var annotation = this._data.annotations[i];
+
+ /* filter the annotations whose type is not the one we want */
+ if (filter(annotation)) {
+ continue;
+ }
+
+ if (rTitle.test(annotation.content.title) &&
+ rDescription.test(annotation.content.description)) {
+ /* FIXME : implement keyword support */
+ ret_array.push(annotation);
+ }
+ }
+
+ return ret_array;
+};
+
+/* breaks a string in words and searches each of these words. Returns an array
+ of objects with the id of the annotation and its number of occurences.
+
+ FIXME: optimize ? seems to be n^2 in the worst case.
+*/
+IriSP.JSONSerializer.prototype.searchOccurences = function(searchString) {
+ var ret = { };
+ var keywords = searchString.split(/\s+/);
+
+ for (var i in keywords) {
+ var keyword = keywords[i];
+
+ // search this keyword in descriptions and title
+ var found_annotations = []
+ found_annotations = found_annotations.concat(this.searchAnnotations(keyword, "", ""));
+ found_annotations = found_annotations.concat(this.searchAnnotations("", keyword, ""));
+
+ for (var j in found_annotations) {
+ var current_annotation = found_annotations[j];
+
+ if (!ret.hasOwnProperty(current_annotation.id)) {
+ ret[current_annotation.id] = 1;
+ } else {
+ ret[current_annotation.id] += 1;
+ }
+
+ }
+
+ };
+
+ return ret;
+};
+
+/* breaks a string in words and searches each of these words. Returns an array
+ of objects with the id of the annotation and its number of occurences.
+
+ FIXME: optimize ? seems to be n^2 in the worst case.
+*/
+IriSP.JSONSerializer.prototype.searchTweetsOccurences = function(searchString) {
+ var ret = { };
+ var keywords = searchString.split(/\s+/);
+
+ for (var i in keywords) {
+ var keyword = keywords[i];
+
+ // search this keyword in descriptions and title
+ var found_annotations = []
+ found_annotations = found_annotations.concat(this.searchTweets(keyword, "", ""));
+ found_annotations = found_annotations.concat(this.searchTweets("", keyword, ""));
+
+ for (var j in found_annotations) {
+ var current_annotation = found_annotations[j];
+
+ if (!ret.hasOwnProperty(current_annotation.id)) {
+ ret[current_annotation.id] = 1;
+ } else {
+ ret[current_annotation.id] += 1;
+ }
+
+ }
+
+ };
+
+ return ret;
+};
+
+/* takes the currentTime and returns all the annotations that are displayable at the moment
+ NB: only takes account the first type of annotations - ignores tweets
+ currentTime is in seconds.
+ */
+
+IriSP.JSONSerializer.prototype.currentAnnotations = function(currentTime) {
+ var view;
+ var currentTimeMs = 1000 * currentTime;
+
+ if (typeof(this._data.views) !== "undefined" && this._data.views !== null)
+ view = this._data.views[0];
+
+ var view_type = "";
+
+ if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length >= 1) {
+ view_type = view.annotation_types[0];
+ }
+
+ var ret_array = [];
+
+ var i;
+
+ for (i in this._data.annotations) {
+ var annotation = this._data.annotations[i];
+
+ if (annotation.meta["id-ref"] === view_type && annotation.begin <= currentTimeMs && annotation.end >= currentTimeMs)
+ ret_array.push(annotation);
+ }
+
+ return ret_array;
+};
+
+
+/* this function returns a list of ids of tweet lines */
+IriSP.JSONSerializer.prototype.getTweetIds = function() {
+ if (typeof(this._data.lists) === "undefined" || this._data.lists === null)
+ return [];
+
+ var tweetsId = [];
+
+ /* first get the list containing the tweets */
+ var tweets = IriSP.underscore.filter(this._data.lists, function(entry) { return entry.id.indexOf("tweet") !== -1 });
+
+ // FIXME: collect tweets from multiple sources ?
+ tweetsId = IriSP.underscore.pluck(tweets[0].items, "id-ref");
+
+ return tweetsId;
+};
+
+/* this function returns a list of lines which are not tweet lines */
+IriSP.JSONSerializer.prototype.getNonTweetIds = function() {
+ if (typeof(this._data.lists) === "undefined" || this._data.lists === null)
+ return [];
+
+ /* get all the ids */
+ var ids = IriSP.underscore.map(this._data.lists, function(entry) {
+ return IriSP.underscore.pluck(entry.items, "id-ref"); });
+
+ var illegal_values = this.getTweetIds();
+ return IriSP.underscore.difference(ids, illegal_values);
+
+};
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/README.txt
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/README.txt Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,183 @@
+======================================================================
+
+DESCRIPTION:
+
+This is the source code for JsDoc Toolkit, an automatic documentation
+generation tool for JavaScript. It is written in JavaScript and is run
+from a command line (or terminal) using Java and Mozilla's Rhino
+JavaScript runtime engine.
+
+Using this tool you can automatically turn JavaDoc-like comments in
+your JavaScript source code into published output files, such as HTML
+or XML.
+
+For more information, to report a bug, or to browse the technical
+documentation for this tool please visit the official JsDoc Toolkit
+project homepage at http://code.google.com/p/jsdoc-toolkit/
+
+For the most up-to-date documentation on JsDoc Toolkit see the
+official wiki at http://code.google.com/p/jsdoc-toolkit/w/list
+
+======================================================================
+
+REQUIREMENTS:
+
+JsDoc Toolkit is known to work with:
+java version "1.6.0_03"
+Java(TM) SE Runtime Environment (build 1.6.0_03-b05)
+on Windows XP,
+and java version "1.5.0_19"
+Java(TM) 2 Runtime Environment, Standard Edition (build 1.5.0_19-b02-304)
+on Mac OS X 10.5.
+
+Other versions of java may or may not work with JsDoc Toolkit.
+
+======================================================================
+
+USAGE:
+
+Running JsDoc Toolkit requires you to have Java installed on your
+computer. For more information see http://www.java.com/getjava/
+
+Before running the JsDoc Toolkit app you should change your current
+working directory to the jsdoc-toolkit folder. Then follow the
+examples below, or as shown on the project wiki.
+
+On a computer running Windows a valid command line to run JsDoc
+Toolkit might look like this:
+
+> java -jar jsrun.jar app\run.js -a -t=templates\jsdoc mycode.js
+
+On Mac OS X or Linux the same command would look like this:
+
+$ java -jar jsrun.jar app/run.js -a -t=templates/jsdoc mycode.js
+
+The above assumes your current working directory contains jsrun.jar,
+the "app" and "templates" subdirectories from the standard JsDoc
+Toolkit distribution and that the relative path to the code you wish
+to document is "mycode.js".
+
+The output documentation files will be saved to a new directory named
+"out" (by default) in the current directory, or if you specify a
+-d=somewhere_else option, to the somewhere_else directory.
+
+For help (usage notes) enter this on the command line:
+
+$ java -jar jsrun.jar app/run.js --help
+
+More information about the various command line options used by JsDoc
+Toolkit are available on the project wiki.
+
+======================================================================
+
+RUNNING VIA SHELL SCRIPT
+
+Avi Deitcher has contributed the file jsrun.sh with the following usage notes:
+
+A script to simplify running jsdoc from the command-line, especially when
+running from within a development or build environment such as ant.
+
+Normally, to run jsdoc, you need a command-line as the following:
+java -Djsdoc.dir=/some/long/dir/path/to/jsdoc -jar
+/some/long/dir/path/to/jsdoc/jsrun.jar /some/long/dir/path/to/jsdoc/app/run.js
+-t=template -r=4 /some/long/dir/path/to/my/src/code
+
+This can get tedious to redo time and again, and difficult to use from within a build environment.
+
+To simplify the process, jsrun.sh will automatically run this path, as well as passing through any arguments.
+
+Usage: jsrun.sh +This is a lightly modified version of Kevin Jones' JavaScript +library Data.Dump. To download the original visit: + http://openjsan.org/doc/k/ke/kevinj/Data/Dump/ + +AUTHORS + +The Data.Dump JavaScript module is written by Kevin Jones +(kevinj@cpan.org), based on Data::Dump by Gisle Aas (gisle@aas.no), +based on Data::Dumper by Gurusamy Sarathy (gsar@umich.edu). + +COPYRIGHT + +Copyright 2007 Kevin Jones. Copyright 1998-2000,2003-2004 Gisle Aas. +Copyright 1996-1998 Gurusamy Sarathy. + +This program is free software; you can redistribute it and/or modify +it under the terms of the Perl Artistic License + +See http://www.perl.com/perl/misc/Artistic.html ++ * @static + */ +Dumper = { + /** @param [...] The objects to dump. */ + dump: function () { + if (arguments.length > 1) + return this._dump(arguments); + else if (arguments.length == 1) + return this._dump(arguments[0]); + else + return "()"; + }, + + _dump: function (obj) { + if (typeof obj == 'undefined') return 'undefined'; + var out; + if (obj.serialize) { return obj.serialize(); } + var type = this._typeof(obj); + if (obj.circularReference) obj.circularReference++; + switch (type) { + case 'circular': + out = "{ //circularReference\n}"; + break; + case 'object': + var pairs = new Array; + + for (var prop in obj) { + if (prop != "circularReference" && obj.hasOwnProperty(prop)) { //hide inherited properties + pairs.push(prop + ': ' + this._dump(obj[prop])); + } + } + + out = '{' + this._format_list(pairs) + '}'; + break; + + case 'string': + for (var prop in Dumper.ESC) { + if (Dumper.ESC.hasOwnProperty(prop)) { + obj = obj.replace(prop, Dumper.ESC[prop]); + } + } + + // Escape UTF-8 Strings + if (obj.match(/^[\x00-\x7f]*$/)) { + out = '"' + obj.replace(/\"/g, "\\\"").replace(/([\n\r]+)/g, "\\$1") + '"'; + } + else { + out = "unescape('"+escape(obj)+"')"; + } + break; + + case 'array': + var elems = new Array; + + for (var i=0; i
"; + this.footer = ""; + this.showLinenumbers = true; +} + +JsHilite.cache = {}; + +JsHilite.prototype.hilite = function() { + var hilited = this.tokens.join(""); + var line = 1; + if (this.showLinenumbers) hilited = hilited.replace(/(^|\n)/g, function(m){return m+""+((line<10)? " ":"")+((line<100)? " ":"")+(line++)+" "}); + + return this.header+hilited+this.footer; +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/plugins/symbolLink.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/plugins/symbolLink.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,10 @@ +JSDOC.PluginManager.registerPlugin( + "JSDOC.symbolLink", + { + onSymbolLink: function(link) { + // modify link.linkPath (the href part of the link) + // or link.linkText (the text displayed) + // or link.linkInner (the #name part of the link) + } + } +); \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/plugins/tagParamConfig.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/plugins/tagParamConfig.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,31 @@ +JSDOC.PluginManager.registerPlugin( + "JSDOC.tagParamConfig", + { + onDocCommentTags: function(comment) { + var currentParam = null; + var tags = comment.tags; + for (var i = 0, l = tags.length; i < l; i++) { + + if (tags[i].title == "param") { + if (tags[i].name.indexOf(".") == -1) { + currentParam = i; + } + } + else if (tags[i].title == "config") { + tags[i].title = "param"; + if (currentParam == null) { + tags[i].name = "arguments"+"."+tags[i].name; + } + else if (tags[i].name.indexOf(tags[currentParam].name+".") != 0) { + tags[i].name = tags[currentParam].name+"."+tags[i].name; + } + currentParam != null + //tags[currentParam].properties.push(tags[i]); + } + else { + currentParam = null; + } + } + } + } +); diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/plugins/tagSynonyms.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/plugins/tagSynonyms.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,43 @@ +JSDOC.PluginManager.registerPlugin( + "JSDOC.tagSynonyms", + { + onDocCommentSrc: function(comment) { + comment.src = comment.src.replace(/@methodOf\b/i, "@function\n@memberOf"); + comment.src = comment.src.replace(/@fieldOf\b/i, "@field\n@memberOf"); + }, + + onDocCommentTags: function(comment) { + for (var i = 0, l = comment.tags.length; i < l; i++) { + var title = comment.tags[i].title.toLowerCase(); + var syn; + if ((syn = JSDOC.tagSynonyms.synonyms["="+title])) { + comment.tags[i].title = syn; + } + } + } + } +); + +new Namespace( + "JSDOC.tagSynonyms", + function() { + JSDOC.tagSynonyms.synonyms = { + "=member": "memberOf", + "=memberof": "memberOf", + "=description": "desc", + "=exception": "throws", + "=argument": "param", + "=returns": "return", + "=classdescription": "class", + "=fileoverview": "overview", + "=extends": "augments", + "=base": "augments", + "=projectdescription": "overview", + "=classdescription": "class", + "=link": "see", + "=borrows": "inherits", + "=scope": "lends", + "=construct": "constructor" + } + } +); \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/run.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/run.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,348 @@ +/** + * @fileOverview + * A bootstrap script that creates some basic required objects + * for loading other scripts. + * @author Michael Mathews, micmath@gmail.com + * @version $Id: run.js 756 2009-01-07 21:32:58Z micmath $ + */ + +/** + * @namespace Keep track of any messages from the running script. + */ +LOG = { + warn: function(msg, e) { + if (JSDOC.opt.q) return; + if (e) msg = e.fileName+", line "+e.lineNumber+": "+msg; + + msg = ">> WARNING: "+msg; + LOG.warnings.push(msg); + if (LOG.out) LOG.out.write(msg+"\n"); + else print(msg); + }, + + inform: function(msg) { + if (JSDOC.opt.q) return; + msg = " > "+msg; + if (LOG.out) LOG.out.write(msg+"\n"); + else if (typeof LOG.verbose != "undefined" && LOG.verbose) print(msg); + } +}; +LOG.warnings = []; +LOG.verbose = false +LOG.out = undefined; + +/** + * @class Manipulate a filepath. + */ +function FilePath(absPath, separator) { + this.slash = separator || "/"; + this.root = this.slash; + this.path = []; + this.file = ""; + + var parts = absPath.split(/[\\\/]/); + if (parts) { + if (parts.length) this.root = parts.shift() + this.slash; + if (parts.length) this.file = parts.pop() + if (parts.length) this.path = parts; + } + + this.path = this.resolvePath(); +} + +/** Collapse any dot-dot or dot items in a filepath. */ +FilePath.prototype.resolvePath = function() { + var resolvedPath = []; + for (var i = 0; i < this.path.length; i++) { + if (this.path[i] == "..") resolvedPath.pop(); + else if (this.path[i] != ".") resolvedPath.push(this.path[i]); + } + return resolvedPath; +} + +/** Trim off the filename. */ +FilePath.prototype.toDir = function() { + if (this.file) this.file = ""; + return this; +} + +/** Go up a directory. */ +FilePath.prototype.upDir = function() { + this.toDir(); + if (this.path.length) this.path.pop(); + return this; +} + +FilePath.prototype.toString = function() { + return this.root + + this.path.join(this.slash) + + ((this.path.length > 0)? this.slash : "") + + this.file; +} + +/** + * Turn a path into just the name of the file. + */ +FilePath.fileName = function(path) { + var nameStart = Math.max(path.lastIndexOf("/")+1, path.lastIndexOf("\\")+1, 0); + return path.substring(nameStart); +} + +/** + * Get the extension of a filename + */ +FilePath.fileExtension = function(filename) { + return filename.split(".").pop().toLowerCase(); +}; + +/** + * Turn a path into just the directory part. + */ +FilePath.dir = function(path) { + var nameStart = Math.max(path.lastIndexOf("/")+1, path.lastIndexOf("\\")+1, 0); + return path.substring(0, nameStart-1); +} + + +importClass(java.lang.System); + +/** + * @namespace A collection of information about your system. + */ +SYS = { + /** + * Information about your operating system: arch, name, version. + * @type string + */ + os: [ + new String(System.getProperty("os.arch")), + new String(System.getProperty("os.name")), + new String(System.getProperty("os.version")) + ].join(", "), + + /** + * Which way does your slash lean. + * @type string + */ + slash: System.getProperty("file.separator")||"/", + + /** + * The path to the working directory where you ran java. + * @type string + */ + userDir: new String(System.getProperty("user.dir")), + + /** + * Where is Java's home folder. + * @type string + */ + javaHome: new String(System.getProperty("java.home")), + + /** + * The absolute path to the directory containing this script. + * @type string + */ + pwd: undefined +}; + +// jsrun appends an argument, with the path to here. +if (arguments[arguments.length-1].match(/^-j=(.+)/)) { + if (RegExp.$1.charAt(0) == SYS.slash || RegExp.$1.charAt(1) == ":") { // absolute path to here + SYS.pwd = new FilePath(RegExp.$1).toDir().toString(); + } + else { // relative path to here + SYS.pwd = new FilePath(SYS.userDir + SYS.slash + RegExp.$1).toDir().toString(); + } + arguments.pop(); +} +else { + print("The run.js script requires you use jsrun.jar."); + quit(); +} + +// shortcut +var File = Packages.java.io.File; + +/** + * @namespace A collection of functions that deal with reading a writing to disk. + */ +IO = { + + /** + * Create a new file in the given directory, with the given name and contents. + */ + saveFile: function(/**string*/ outDir, /**string*/ fileName, /**string*/ content) { + var out = new Packages.java.io.PrintWriter( + new Packages.java.io.OutputStreamWriter( + new Packages.java.io.FileOutputStream(outDir+SYS.slash+fileName), + IO.encoding + ) + ); + out.write(content); + out.flush(); + out.close(); + }, + + /** + * @type string + */ + readFile: function(/**string*/ path) { + if (!IO.exists(path)) { + throw "File doesn't exist there: "+path; + } + return readFile(path, IO.encoding); + }, + + /** + * @param inFile + * @param outDir + * @param [fileName=The original filename] + */ + copyFile: function(/**string*/ inFile, /**string*/ outDir, /**string*/ fileName) { + if (fileName == null) fileName = FilePath.fileName(inFile); + + var inFile = new File(inFile); + var outFile = new File(outDir+SYS.slash+fileName); + + var bis = new Packages.java.io.BufferedInputStream(new Packages.java.io.FileInputStream(inFile), 4096); + var bos = new Packages.java.io.BufferedOutputStream(new Packages.java.io.FileOutputStream(outFile), 4096); + var theChar; + while ((theChar = bis.read()) != -1) { + bos.write(theChar); + } + bos.close(); + bis.close(); + }, + + /** + * Creates a series of nested directories. + */ + mkPath: function(/**Array*/ path) { + if (path.constructor != Array) path = path.split(/[\\\/]/); + var make = ""; + for (var i = 0, l = path.length; i < l; i++) { + make += path[i] + SYS.slash; + if (! IO.exists(make)) { + IO.makeDir(make); + } + } + }, + + /** + * Creates a directory at the given path. + */ + makeDir: function(/**string*/ path) { + (new File(path)).mkdir(); + }, + + /** + * @type string[] + * @param dir The starting directory to look in. + * @param [recurse=1] How many levels deep to scan. + * @returns An array of all the paths to files in the given dir. + */ + ls: function(/**string*/ dir, /**number*/ recurse, _allFiles, _path) { + if (_path === undefined) { // initially + var _allFiles = []; + var _path = [dir]; + } + if (_path.length == 0) return _allFiles; + if (recurse === undefined) recurse = 1; + + dir = new File(dir); + if (!dir.directory) return [String(dir)]; + var files = dir.list(); + + for (var f = 0; f < files.length; f++) { + var file = String(files[f]); + if (file.match(/^\.[^\.\/\\]/)) continue; // skip dot files + + if ((new File(_path.join(SYS.slash)+SYS.slash+file)).list()) { // it's a directory + _path.push(file); + if (_path.length-1 < recurse) IO.ls(_path.join(SYS.slash), recurse, _allFiles, _path); + _path.pop(); + } + else { + _allFiles.push((_path.join(SYS.slash)+SYS.slash+file).replace(SYS.slash+SYS.slash, SYS.slash)); + } + } + + return _allFiles; + }, + + /** + * @type boolean + */ + exists: function(/**string*/ path) { + file = new File(path); + + if (file.isDirectory()){ + return true; + } + if (!file.exists()){ + return false; + } + if (!file.canRead()){ + return false; + } + return true; + }, + + /** + * + */ + open: function(/**string*/ path, /**string*/ append) { + var append = true; + var outFile = new File(path); + var out = new Packages.java.io.PrintWriter( + new Packages.java.io.OutputStreamWriter( + new Packages.java.io.FileOutputStream(outFile, append), + IO.encoding + ) + ); + return out; + }, + + /** + * Sets {@link IO.encoding}. + * Encoding is used when reading and writing text to files, + * and in the meta tags of HTML output. + */ + setEncoding: function(/**string*/ encoding) { + if (/ISO-8859-([0-9]+)/i.test(encoding)) { + IO.encoding = "ISO8859_"+RegExp.$1; + } + else { + IO.encoding = encoding; + } + }, + + /** + * @default "utf-8" + * @private + */ + encoding: "utf-8", + + /** + * Load the given script. + */ + include: function(relativePath) { + load(SYS.pwd+relativePath); + }, + + /** + * Loads all scripts from the given directory path. + */ + includeDir: function(path) { + if (!path) return; + + for (var lib = IO.ls(SYS.pwd+path), i = 0; i < lib.length; i++) + if (/\.js$/i.test(lib[i])) load(lib[i]); + } +} + +// now run the application +IO.include("frame.js"); +IO.include("main.js"); + +main(); diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/t/TestDoc.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/t/TestDoc.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,144 @@ +var TestDoc = { + fails: 0, + plans: 0, + passes: 0, + results: [] +}; + +TestDoc.record = function(result) { + TestDoc.results.push(result); + if (typeof result.verdict == "boolean") { + if (result.verdict === false) TestDoc.fails++; + if (result.verdict === true) TestDoc.passes++; + } +} + +TestDoc.prove = function(filePath) { + if (typeof document != "undefined" && typeof document.write != "undefined") { + if (TestDoc.console) print = function(s) { TestDoc.console.appendChild(document.createTextNode(s+"\n")); } + else print = function(s) { document.write(s+"
"); } + } + TestDoc.run(TestDoc.readFile(filePath)); +} + +TestDoc.run = function(src) { + try { eval(src); } catch(e) { print("# ERROR! "+e); } + + var chunks = src.split(/\/\*t:/); + + var run = function(chunk) { + // local shortcuts + var is = TestDoc.assertEquals; + var isnt = TestDoc.assertNotEquals; + var plan = TestDoc.plan; + var requires = TestDoc.requires; + + try { eval(chunk); } catch(e) { print("# ERROR! "+e); } + } + for (var start = -1, end = 0; (start = src.indexOf("/*t:", end)) > end; start = end) { + run( + src.substring( + start+4, + (end = src.indexOf("*/", start)) + ) + ); + } +} + +TestDoc.Result = function(verdict, message) { + this.verdict = verdict; + this.message = message; +} + +TestDoc.Result.prototype.toString = function() { + if (typeof this.verdict == "boolean") { + return (this.verdict? "ok" : "not ok") + " " + (++TestDoc.report.counter) + " - " + this.message; + } + + return "# " + this.message; +} + +TestDoc.requires = function(file) { + if (!TestDoc.requires.loaded[file]) { + load(file); + TestDoc.requires.loaded[file] = true; + } +} +TestDoc.requires.loaded = {}; + +TestDoc.report = function() { + TestDoc.report.counter = 0; + print("1.."+TestDoc.plans); + for (var i = 0; i < TestDoc.results.length; i++) { + print(TestDoc.results[i]); + } + print("----------------------------------------"); + if (TestDoc.fails == 0 && TestDoc.passes == TestDoc.plans) { + print("All tests successful."); + } + else { + print("Failed " + TestDoc.fails + "/" + TestDoc.plans + " tests, "+((TestDoc.plans == 0)? 0 : Math.round(TestDoc.passes/(TestDoc.passes+TestDoc.fails)*10000)/100)+"% okay. Planned to run "+TestDoc.plans+", did run "+(TestDoc.passes+TestDoc.fails)+".") + } +} + +TestDoc.plan = function(n, message) { + TestDoc.plans += n; + TestDoc.record(new TestDoc.Result(null, message+" ("+n+" tests)")); +} + +TestDoc.assertEquals = function(a, b, message) { + var result = (a == b); + if (!result) message += "\n#\n# " + a + " does not equal " + b + "\n#"; + TestDoc.record(new TestDoc.Result(result, message)); +} + +TestDoc.assertNotEquals = function(a, b, message) { + var result = (a != b); + if (!result) message += "\n#\n# " + a + " equals " + b + "\n#"; + TestDoc.record(new TestDoc.Result(result, message)); +} + +TestDoc.readFile = (function(){ + // rhino + if (typeof readFile == "function") { + return function(url) { + var text = readFile(url); + return text || ""; + } + } + + // a web browser + else { + return function(url) { + var httpRequest; + + if (window.XMLHttpRequest) { // Mozilla, Safari, etc + httpRequest = new XMLHttpRequest(); + } + else if (window.ActiveXObject) { // IE + try { + httpRequest = new ActiveXObject("Msxml2.XMLHTTP"); + } + catch (e) { + try { + httpRequest = new ActiveXObject("Microsoft.XMLHTTP"); + } + catch (e) { + } + } + } + + if (!httpRequest) { throw "Cannot create HTTP Request."; } + + httpRequest.open('GET', url, false); + httpRequest.send(''); + if (httpRequest.readyState == 4) { + if (httpRequest.status >= 400) { + throw "The HTTP Request returned an error code: "+httpRequest.status; + } + } + + return httpRequest.responseText || ""; + } + } +})(); diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/t/runner.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/t/runner.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,13 @@ +// try: java -jar ../../jsrun.jar runner.js + +load("TestDoc.js"); + +TestDoc.prove("../frame/Opt.js"); +TestDoc.prove("../lib/JSDOC.js"); +TestDoc.prove("../frame/String.js"); +TestDoc.prove("../lib/JSDOC/DocTag.js"); +TestDoc.prove("../lib/JSDOC/DocComment.js"); +TestDoc.prove("../lib/JSDOC/TokenReader.js"); +TestDoc.prove("../lib/JSDOC/Symbol.js"); + +TestDoc.report(); diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,342 @@ +load("app/frame/Dumper.js"); +function symbolize(opt) { + symbols = null; + JSDOC.JsDoc(opt); + symbols = JSDOC.JsDoc.symbolSet; +} + +var testCases = [ + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/overview.js"]}); + //print(Dumper.dump(symbols)); + is('symbols.getSymbolByName("My Cool Library").name', 'My Cool Library', 'File overview can be found by alias.'); + } + , + function() { + symbolize({_: [SYS.pwd+"test/name.js"]}); + + is('symbols.getSymbol("Response").name', "Response", 'Virtual class name is found.'); + is('symbols.getSymbol("Response#text").alias', "Response#text", 'Virtual method name is found.'); + is('symbols.getSymbol("Response#text").memberOf', "Response", 'Virtual method parent name is found.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/prototype.js"]}); + + is('symbols.getSymbol("Article").name', "Article", 'Function set to constructor prototype with inner constructor name is found.'); + is('symbols.getSymbol("Article").hasMethod("init")', true, 'The initializer method name of prototype function is correct.'); + is('symbols.getSymbol("Article").hasMember("counter")', true, 'A static property set in the prototype definition is found.'); + is('symbols.getSymbol("Article").hasMember("title")', true, 'An instance property set in the prototype is found.'); + is('symbols.getSymbol("Article#title").isStatic', false, 'An instance property has isStatic set to false.'); + is('symbols.getSymbol("Article.counter").name', "counter", 'A static property set in the initializer has the name set correctly.'); + is('symbols.getSymbol("Article.counter").memberOf', "Article", 'A static property set in the initializer has the memberOf set correctly.'); + is('symbols.getSymbol("Article.counter").isStatic', true, 'A static property set in the initializer has isStatic set to true.'); + } + , + function() { + symbolize({a:true, _: [SYS.pwd+"test/prototype_oblit.js"]}); + + is('symbols.getSymbol("Article").name', "Article", 'Oblit set to constructor prototype name is found.'); + is('typeof symbols.getSymbol("Article.prototype")', "undefined", 'The prototype oblit is not a symbol.'); + is('symbols.getSymbol("Article#getTitle").name', "getTitle", 'The nonstatic method name of prototype oblit is correct.'); + is('symbols.getSymbol("Article#getTitle").alias', "Article#getTitle", 'The alias of non-static method of prototype oblit is correct.'); + is('symbols.getSymbol("Article#getTitle").isStatic', false, 'The isStatic of a nonstatic method of prototype oblit is correct.'); + is('symbols.getSymbol("Article.getTitle").name', "getTitle", 'The static method name of prototype oblit is correct.'); + is('symbols.getSymbol("Article.getTitle").isStatic', true, 'The isStatic of a static method of prototype oblit is correct.'); + is('symbols.getSymbol("Article#getTitle").isa', "FUNCTION", 'The isa of non-static method of prototype oblit is correct.'); + is('symbols.getSymbol("Article.getTitle").alias', "Article.getTitle", 'The alias of a static method of prototype oblit is correct.'); + is('symbols.getSymbol("Article.getTitle").isa', "FUNCTION", 'The isa of static method of prototype oblit is correct.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/prototype_oblit_constructor.js"]}); + + is('symbols.getSymbol("Article").name', "Article", 'Oblit set to constructor prototype with inner constructor name is found.'); + is('symbols.getSymbol("Article#init").name', "init", 'The initializer method name of prototype oblit is correct.'); + is('symbols.getSymbol("Article").hasMember("pages")', true, 'Property set by initializer method "this" is on the outer constructor.'); + is('symbols.getSymbol("Article#Title").name', "Title", 'Name of the inner constructor name is found.'); + is('symbols.getSymbol("Article#Title").memberOf', "Article", 'The memberOf of the inner constructor name is found.'); + is('symbols.getSymbol("Article#Title").isa', "CONSTRUCTOR", 'The isa of the inner constructor name is constructor.'); + is('symbols.getSymbol("Article#Title").hasMember("title")', true, 'A property set on the inner constructor "this" is on the inner constructor.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/inner.js"]}); + + is('symbols.getSymbol("Outer").name', "Outer", 'Outer constructor prototype name is found.'); + is('symbols.getSymbol("Outer").methods.length', 1, 'Inner function doesnt appear as a method of the outer.'); + is('symbols.getSymbol("Outer").hasMethod("open")', true, 'Outer constructors methods arent affected by inner function.'); + is('symbols.getSymbol("Outer-Inner").alias', "Outer-Inner", 'Alias of inner function is found.'); + is('symbols.getSymbol("Outer-Inner").isa', "CONSTRUCTOR", 'isa of inner function constructor is found.'); + is('symbols.getSymbol("Outer-Inner").memberOf', "Outer", 'The memberOf of inner function is found.'); + is('symbols.getSymbol("Outer-Inner").name', "Inner", 'The name of inner function is found.'); + is('symbols.getSymbol("Outer-Inner#name").name', "name", 'A member of the inner function constructor, attached to "this" is found on inner.'); + is('symbols.getSymbol("Outer-Inner#name").memberOf', "Outer-Inner", 'The memberOf of an inner function member is found.'); + } + , + function() { + symbolize({a:true, _: [SYS.pwd+"test/prototype_nested.js"]}); + + is('symbols.getSymbol("Word").name', "Word", 'Base constructor name is found.'); + is('symbols.getSymbol("Word").hasMethod("reverse")', true, 'Base constructor method is found.'); + is('symbols.getSymbol("Word").methods.length', 1, 'Base constructor has only one method.'); + is('symbols.getSymbol("Word").memberOf', "", 'Base constructor memberOf is empty.'); + is('symbols.getSymbol("Word#reverse").name', "reverse", 'Member of constructor prototype name is found.'); + is('symbols.getSymbol("Word#reverse").memberOf', "Word", 'Member of constructor prototype memberOf is found.'); + is('symbols.getSymbol("Word#reverse.utf8").name', "utf8", 'Member of constructor prototype method name is found.'); + is('symbols.getSymbol("Word#reverse.utf8").memberOf', "Word#reverse", 'Static nested member memberOf is found.'); + } + , + function() { + symbolize({a:true, _: [SYS.pwd+"test/namespace_nested.js"]}); + + is('symbols.getSymbol("ns1").name', "ns1", 'Base namespace name is found.'); + is('symbols.getSymbol("ns1").memberOf', "", 'Base namespace memberOf is empty (its a constructor).'); + is('symbols.getSymbol("ns1.ns2").name', "ns2", 'Nested namespace name is found.'); + is('symbols.getSymbol("ns1.ns2").alias', "ns1.ns2", 'Nested namespace alias is found.'); + is('symbols.getSymbol("ns1.ns2").memberOf', "ns1", 'Nested namespace memberOf is found.'); + is('symbols.getSymbol("ns1.ns2.Function1").name', "Function1", 'Method of nested namespace name is found.'); + is('symbols.getSymbol("ns1.ns2.Function1").memberOf', "ns1.ns2", 'Constructor of nested namespace memberOf is found.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/functions_nested.js"]}); + + is('symbols.getSymbol("Zop").name', "Zop", 'Any constructor name is found.'); + is('symbols.getSymbol("Zop").isa', "CONSTRUCTOR", 'It isa constructor.'); + is('symbols.getSymbol("Zop").hasMethod("zap")', true, 'Its method name, set later, is in methods array.'); + is('symbols.getSymbol("Foo").name', "Foo", 'The containing constructor name is found.'); + is('symbols.getSymbol("Foo").hasMethod("methodOne")', true, 'Its method name is found.'); + is('symbols.getSymbol("Foo").hasMethod("methodTwo")', true, 'Its second method name is found.'); + is('symbols.getSymbol("Foo#methodOne").alias', "Foo#methodOne", 'A methods alias is found.'); + is('symbols.getSymbol("Foo#methodOne").isStatic', false, 'A methods is not static.'); + is('symbols.getSymbol("Bar").name', "Bar", 'A global function declared inside another function is found.'); + is('symbols.getSymbol("Bar").isa', "FUNCTION", 'It isa function.'); + is('symbols.getSymbol("Bar").memberOf', "_global_", 'It is global.'); + is('symbols.getSymbol("Foo-inner").name', "inner", 'An inner functions name is found.'); + is('symbols.getSymbol("Foo-inner").memberOf', "Foo", 'It is member of the outer function.'); + is('symbols.getSymbol("Foo-inner").isInner', true, 'It is an inner function.'); + } + , + function() { + symbolize({a:true, _: [SYS.pwd+"test/memberof_constructor.js"]}); + + is('symbols.getSymbol("Circle#Tangent").name', "Tangent", 'Constructor set on prototype using @member has correct name.'); + is('symbols.getSymbol("Circle#Tangent").memberOf', "Circle", 'Constructor set on prototype using @member has correct memberOf.'); + is('symbols.getSymbol("Circle#Tangent").alias', "Circle#Tangent", 'Constructor set on prototype using @member has correct alias.'); + is('symbols.getSymbol("Circle#Tangent").isa', "CONSTRUCTOR", 'Constructor set on prototype using @member has correct isa.'); + is('symbols.getSymbol("Circle#Tangent").isStatic', false, 'Constructor set on prototype using @member is not static.'); + is('symbols.getSymbol("Circle#Tangent#getDiameter").name', "getDiameter", 'Method set on prototype using @member has correct name.'); + is('symbols.getSymbol("Circle#Tangent#getDiameter").memberOf', "Circle#Tangent", 'Method set on prototype using @member has correct memberOf.'); + is('symbols.getSymbol("Circle#Tangent#getDiameter").alias', "Circle#Tangent#getDiameter", 'Method set on prototype using @member has correct alias.'); + is('symbols.getSymbol("Circle#Tangent#getDiameter").isa', "FUNCTION", 'Method set on prototype using @member has correct isa.'); + is('symbols.getSymbol("Circle#Tangent#getDiameter").isStatic', false, 'Method set on prototype using @member is not static.'); + } + , + function() { + symbolize({a:true, p: true, _: [SYS.pwd+"test/memberof.js"]}); + + is('symbols.getSymbol("pack.install").alias', "pack.install", 'Using @memberOf sets alias, when parent name is in memberOf tag.'); + is('symbols.getSymbol("pack.install.overwrite").name', "install.overwrite", 'Using @memberOf sets name, even if the name is dotted.'); + is('symbols.getSymbol("pack.install.overwrite").memberOf', "pack", 'Using @memberOf sets memberOf.'); + is('symbols.getSymbol("pack.install.overwrite").isStatic', true, 'Using @memberOf with value not ending in octothorp sets isStatic to true.'); + } + , + function() { + symbolize({a:true, p: true, _: [SYS.pwd+"test/memberof2.js"]}); + + is('symbols.getSymbol("Foo#bar").alias', "Foo#bar", 'An inner function can be documented as an instance method.'); + is('symbols.getSymbol("Foo.zip").alias', "Foo.zip", 'An inner function can be documented as a static method.'); + is('symbols.getSymbol("Foo.Fiz").alias', "Foo.Fiz", 'An inner function can be documented as a static constructor.'); + is('symbols.getSymbol("Foo.Fiz#fipple").alias', "Foo.Fiz#fipple", 'An inner function can be documented as a static constructor with a method.'); + is('symbols.getSymbol("Foo#blat").alias', "Foo#blat", 'An global function can be documented as an instance method.'); + } + , + function() { + symbolize({a:true, p: true, _: [SYS.pwd+"test/memberof3.js"]}); + + is('symbols.getSymbol("Foo#bar").alias', "Foo#bar", 'A virtual field can be documented as an instance method.'); + is('symbols.getSymbol("Foo2#bar").alias', "Foo2#bar", 'A virtual field with the same name can be documented as an instance method.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/borrows.js"]}); + + is('symbols.getSymbol("Layout").name', "Layout", 'Constructor can be found.'); + is('symbols.getSymbol("Layout").hasMethod("init")', true, 'Constructor method name can be found.'); + is('symbols.getSymbol("Layout").hasMember("orientation")', true, 'Constructor property name can be found.'); + + is('symbols.getSymbol("Page").hasMethod("reset")', true, 'Second constructor method name can be found.'); + is('symbols.getSymbol("Page").hasMember("orientation")', true, 'Second constructor borrowed property name can be found in properties.'); + is('symbols.getSymbol("Page#orientation").memberOf', "Page", 'Second constructor borrowed property memberOf can be found.'); + is('symbols.getSymbol("Page-getInnerElements").alias', "Page-getInnerElements", 'Can borrow an inner function and it is still inner.'); + is('symbols.getSymbol("Page.units").alias', "Page.units", 'Can borrow a static function and it is still static.'); + + is('symbols.getSymbol("ThreeColumnPage#init").alias', "ThreeColumnPage#init", 'Third constructor method can be found even though method with same name is borrowed.'); + is('symbols.getSymbol("ThreeColumnPage#reset").alias', "ThreeColumnPage#reset", 'Borrowed method can be found.'); + is('symbols.getSymbol("ThreeColumnPage#orientation").alias', "ThreeColumnPage#orientation", 'Twice borrowed method can be found.'); + + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/borrows2.js"]}); + + is('symbols.getSymbol("Foo").hasMethod("my_zop")', true, 'Borrowed method can be found.'); + is('symbols.getSymbol("Bar").hasMethod("my_zip")', true, 'Second borrowed method can be found.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/constructs.js"]}); + + is('symbols.getSymbol("Person").hasMethod("say")', true, 'The constructs tag creates a class that lends can add a method to.'); + } + , + function() { + symbolize({a: true, _: [SYS.pwd+"test/augments.js", SYS.pwd+"test/augments2.js"]}); + + is('symbols.getSymbol("Page").augments[0]', "Layout", 'An augmented class can be found.'); + is('symbols.getSymbol("Page#reset").alias', "Page#reset", 'Method of augmenter can be found.'); + is('symbols.getSymbol("Page").hasMethod("Layout#init")', true, 'Method from augmented can be found.'); + is('symbols.getSymbol("Page").hasMember("Layout#orientation")', true, 'Property from augmented can be found.'); + is('symbols.getSymbol("Page").methods.length', 3, 'Methods of augmented class are included in methods array.'); + + is('symbols.getSymbol("ThreeColumnPage").augments[0]', "Page", 'The extends tag is a synonym for augments.'); + is('symbols.getSymbol("ThreeColumnPage").hasMethod("ThreeColumnPage#init")', true, 'Local method overrides augmented method of same name.'); + is('symbols.getSymbol("ThreeColumnPage").methods.length', 3, 'Local method count is right.'); + + is('symbols.getSymbol("NewsletterPage").augments[0]', "ThreeColumnPage", 'Can augment across file boundaries.'); + is('symbols.getSymbol("NewsletterPage").augments.length', 2, 'Multiple augments are supported.'); + is('symbols.getSymbol("NewsletterPage").inherits[0].alias', "Junkmail#annoy", 'Inherited method with augments.'); + is('symbols.getSymbol("NewsletterPage").methods.length', 6, 'Methods of augmented class are included in methods array across files.'); + is('symbols.getSymbol("NewsletterPage").properties.length', 1, 'Properties of augmented class are included in properties array across files.'); + } + , + function() { + symbolize({a:true, _: [SYS.pwd+"test/static_this.js"]}); + + is('symbols.getSymbol("box.holder").name', "holder", 'Static namespace name can be found.'); + is('symbols.getSymbol("box.holder.foo").name', "foo", 'Static namespace method name can be found.'); + is('symbols.getSymbol("box.holder").isStatic', true, 'Static namespace method is static.'); + + is('symbols.getSymbol("box.holder.counter").name', "counter", 'Instance namespace property name set on "this" can be found.'); + is('symbols.getSymbol("box.holder.counter").alias', "box.holder.counter", 'Instance namespace property alias set on "this" can be found.'); + is('symbols.getSymbol("box.holder.counter").memberOf', "box.holder", 'Static namespace property memberOf set on "this" can be found.'); + } + , + function() { + symbolize({a:true, p: true, _: [SYS.pwd+"test/lend.js"]}); + + is('symbols.getSymbol("Person").name', "Person", 'Class defined in lend comment is found.'); + is('symbols.getSymbol("Person").hasMethod("initialize")', true, 'Lent instance method name can be found.'); + is('symbols.getSymbol("Person").hasMethod("say")', true, 'Second instance method can be found.'); + is('symbols.getSymbol("Person#sing").isStatic', false, 'Instance method is known to be not static.'); + + is('symbols.getSymbol("Person.getCount").name', "getCount", 'Static method name from second lend comment can be found.'); + is('symbols.getSymbol("Person.getCount").isStatic', true, 'Static method from second lend comment is known to be static.'); + + is('LOG.warnings.filter(function($){if($.indexOf("notok") > -1) return $}).length', 1, 'A warning is emitted when lending to an undocumented parent.'); + } + , + function() { + symbolize({a:true, _: [SYS.pwd+"test/param_inline.js"]}); + + is('symbols.getSymbol("Layout").params[0].type', "int", 'Inline param name is set.'); + is('symbols.getSymbol("Layout").params[0].desc', "The number of columns.", 'Inline param desc is set from comment.'); + is('symbols.getSymbol("Layout#getElement").params[0].name', "id", 'User defined param documentation takes precedence over parser defined.'); + is('symbols.getSymbol("Layout#getElement").params[0].isOptional', true, 'Default for param is to not be optional.'); + is('symbols.getSymbol("Layout#getElement").params[1].isOptional', false, 'Can mark a param as being optional.'); + is('symbols.getSymbol("Layout#getElement").params[1].type', "number|string", 'Type of inline param doc can have multiple values.'); + is('symbols.getSymbol("Layout#Canvas").params[0].type', "", 'Type can be not defined for some params.'); + is('symbols.getSymbol("Layout#Canvas").params[2].type', "int", 'Type can be defined inline for only some params.'); + is('symbols.getSymbol("Layout#rotate").params.length', 0, 'Docomments inside function sig is ignored without a param.'); + is('symbols.getSymbol("Layout#init").params[2].type', "zoppler", 'Doc comment type overrides inline type for param with same name.'); + } + , + function() { + symbolize({a: true, _: [SYS.pwd+"test/shared.js", SYS.pwd+"test/shared2.js"]}); + + is('symbols.getSymbol("Array#some").name', 'some', 'The name of a symbol in a shared section is found.'); + is('symbols.getSymbol("Array#some").alias', 'Array#some', 'The alias of a symbol in a shared section is found.'); + is('symbols.getSymbol("Array#some").desc', "Extension to builtin array.", 'A description can be shared.'); + is('symbols.getSymbol("Array#filter").desc', "Extension to builtin array.\nChange every element of an array.", 'A shared description is appended.'); + is('symbols.getSymbol("Queue").desc', "A first in, first out data structure.", 'A description is not shared when outside a shared section.'); + is('symbols.getSymbol("Queue.rewind").alias', "Queue.rewind", 'Second shared tag can be started.'); + is('symbols.getSymbol("startOver").alias', "startOver", 'Shared tag doesnt cross over files.'); + } + , + function() { + symbolize({a: true, _: [SYS.pwd+"test/config.js"]}); + is('symbols.getSymbol("Contact").params[0].name', 'person', 'The name of a param is found.'); + is('symbols.getSymbol("Contact").params[1].name', 'person.name', 'The name of a param set with a dot name is found.'); + is('symbols.getSymbol("Contact").params[2].name', 'person.age', 'The name of a second param set with a dot name is found.'); + is('symbols.getSymbol("Contact").params[4].name', 'connection', 'The name of a param after config is found.'); + + is('symbols.getSymbol("Family").params[0].name', 'persons', 'Another name of a param is found.'); + is('symbols.getSymbol("Family").params[1].name', 'persons.Father', 'The name of a param+config is found.'); + is('symbols.getSymbol("Family").params[2].name', 'persons.Mother', 'The name of a second param+config is found.'); + is('symbols.getSymbol("Family").params[3].name', 'persons.Children', 'The name of a third param+config is found.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/ignore.js"]}); + is('LOG.warnings.filter(function($){if($.indexOf("undocumented symbol Ignored") > -1) return $}).length', 1, 'A warning is emitted when documenting members of an ignored parent.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/functions_anon.js"]}); + is('symbols.getSymbol("a.b").alias', 'a.b', 'In anonymous constructor this is found to be the container object.'); + is('symbols.getSymbol("a.f").alias', 'a.f', 'In anonymous constructor this can have a method.'); + is('symbols.getSymbol("a.c").alias', 'a.c', 'In anonymous constructor method this is found to be the container object.'); + is('symbols.getSymbol("g").alias', 'g', 'In anonymous function executed inline this is the global.'); + is('symbols.getSymbol("bar2.p").alias', 'bar2.p', 'In named constructor executed inline this is the container object.'); + is('symbols.getSymbol("module.pub").alias', 'module.pub', 'In parenthesized anonymous function executed inline function scoped variables arent documented.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/oblit_anon.js"]}); + is('symbols.getSymbol("opt").name', 'opt', 'Anonymous object properties are created.'); + is('symbols.getSymbol("opt.conf.keep").alias', 'opt.conf.keep', 'Anonymous object first property is assigned to $anonymous.'); + is('symbols.getSymbol("opt.conf.base").alias', 'opt.conf.base', 'Anonymous object second property is assigned to $anonymous.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/params_optional.js"]}); + is('symbols.getSymbol("Document").params.length', 3, 'Correct number of params are found when optional param syntax is used.'); + is('symbols.getSymbol("Document").params[1].name', "id", 'Name of optional param is found.'); + is('symbols.getSymbol("Document").params[1].isOptional', true, 'Optional param is marked isOptional.'); + is('symbols.getSymbol("Document").params[2].name', "title", 'Name of optional param with default value is found.'); + is('symbols.getSymbol("Document").params[2].isOptional', true, 'Optional param with default value is marked isOptional.'); + is('symbols.getSymbol("Document").params[2].defaultValue', " This is untitled.", 'Optional param default value is found.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/synonyms.js"]}); + is('symbols.getSymbol("myObject.myFunc").type', 'function', 'Type can be set to function.'); + } + , + function() { + symbolize({a:true, p:true, _: [SYS.pwd+"test/event.js"]}); + is('symbols.getSymbol("Kitchen#event:cakeEaten").isEvent', true, 'Function with event prefix is an event.'); + is('symbols.getSymbol("Kitchen#cakeEaten").isa', "FUNCTION", 'Function with same name as event isa function.'); + } + , + function() { + symbolize({x:"js", a:true, _: [SYS.pwd+"test/scripts/"]}); + is('JSDOC.JsDoc.srcFiles.length', 1, 'Only js files are scanned when -x=js.'); + } + , + function() { + symbolize({x:"js", a:true, _: [SYS.pwd+"test/exports.js"]}); + is('symbols.getSymbol("mxn.Map#doThings").name', 'doThings', 'Exports creates a documentation alias that can have methods.'); + } + , + function() { + symbolize({p:true, a:true, _: [SYS.pwd+"test/module.js"]}); + is('symbols.getSymbol("myProject.myModule.myPublicMethod").name', 'myPublicMethod', 'A function wrapped in parens can be recognized.'); + is('symbols.getSymbol("myProject.myModule-myPrivateMethod").name', 'myPrivateMethod', 'A private method in the scope of a function wrapped in parens can be recognized.'); + is('symbols.getSymbol("myProject.myModule-myPrivateVar").name', 'myPrivateVar', 'A private member in the scope of a function wrapped in parens can be recognized.'); + } +]; + +//// run and print results +print(testrun(testCases)); diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/addon.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/addon.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,24 @@ +String.prototype.reverse = function() { +} + +String.prototype.reverse.utf8 = function() { +} + +Function.count = function() { +} + +/** @memberOf Function */ +Function.count.reset = function() { +} + +/** @memberOf Function */ +count.getValue = function() { +} + +/** @memberOf Function.prototype */ +getSig = function() { +} + +/** @memberOf Function.prototype */ +Function.prototype.getProps = function() { +} diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/anon_inner.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/anon_inner.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,14 @@ +/** + * @name bar + * @namespace + */ + +new function() { + /** + * @name bar-foo + * @function + * @param {number} x + */ + function foo(x) { + } +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/augments.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/augments.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,31 @@ +/** +@constructor +*/ +function Layout(p) { + this.init = function(p) { + } + + this.getId = function() { + } + + /** @type Page */ + this.orientation = "landscape"; +} + +/** +@constructor +@augments Layout +*/ +function Page() { + this.reset = function(b) { + } +} + +/** +@extends Page +@constructor +*/ +function ThreeColumnPage() { + this.init = function(resetCode) { + } +} diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/augments2.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/augments2.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,26 @@ +/** +@constructor +*/ +function LibraryItem() { + this.reserve = function() { + } +} + +/** +@constructor +*/ +function Junkmail() { + this.annoy = function() { + } +} + +/** +@inherits Junkmail.prototype.annoy as pester +@augments ThreeColumnPage +@augments LibraryItem +@constructor +*/ +function NewsletterPage() { + this.getHeadline = function() { + } +} diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/borrows.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/borrows.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,46 @@ +/** +@constructor +*/ +function Layout(p) { + /** initilize 1 */ + this.init = function(p) { + } + + /** get the id */ + this.getId = function() { + } + + /** @type string */ + this.orientation = "landscape"; + + function getInnerElements(elementSecretId){ + } +} + +/** A static method. */ +Layout.units = function() { +} + +/** +@constructor +@borrows Layout#orientation +@borrows Layout-getInnerElements +@borrows Layout.units +*/ +function Page() { + /** reset the page */ + this.reset = function(b) { + } +} + +/** +@constructor +@borrows Layout.prototype.orientation as this.orientation +@borrows Layout.prototype.init as #init +@inherits Page.prototype.reset as #reset +*/ +function ThreeColumnPage() { + /** initilize 2 */ + this.init = function(p) { + } +} diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/borrows2.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/borrows2.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,23 @@ +// testing circular borrows + +/** + @class + @borrows Bar#zop as this.my_zop +*/ +function Foo() { + /** this is a zip. */ + this.zip = function() {} + + this.my_zop = new Bar().zop; +} + +/** + @class + @borrows Foo#zip as this.my_zip +*/ +function Bar() { + /** this is a zop. */ + this.zop = function() {} + + this.my_zip = new Foo().zip; +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/config.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/config.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,22 @@ +/** + * @constructor + * @param person The person. + * @param {string} person.name The person's name. + * @config {integer} age The person's age. + * @config [id=1] Optional id number to use. + * @param connection + */ +function Contact(person, connection) { + +} + +/** + * @constructor + * @param persons + * @config {string} Father The paternal person. + * @config {string} Mother The maternal person. + * @config {string[]} Children And the rest. + */ +function Family(/**Object*/persons) { + +} diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/constructs.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/constructs.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,18 @@ +var Person = makeClass( + /** + @scope Person + */ + { + /** + This is just another way to define a constructor. + @constructs + @param {string} name The name of the person. + */ + initialize: function(name) { + this.name = name; + }, + say: function(message) { + return this.name + " says: " + message; + } + } +); \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/encoding.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/encoding.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,10 @@ + +/** + * @Constructor + * @desc 配置文件 + * @class 什么也不返回 + */ +function Test(conf) { + // do something; +} + diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/encoding_other.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/encoding_other.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,12 @@ + +/** + * @Constructor + * @desc + * @class + */ +function Test(conf) { + // do something; +} + +// run with commanline option -e=iso-8859-5 + diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/event.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/event.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,54 @@ +/** + * @name Kitchen + * @constructor + * @fires Bakery#event:donutOrdered + */ + +/** + * Fired when some cake is eaten. + * @name Kitchen#event:cakeEaten + * @function + * @param {Number} pieces The number of pieces eaten. + */ + +/** + * Find out if cake was eaten. + * @name Kitchen#cakeEaten + * @function + * @param {Boolean} wasEaten + */ + +/** + * @name getDesert + * @function + * @fires Kitchen#event:cakeEaten + */ + +/** + * @name Bakery + * @constructor + * @extends Kitchen + */ + +/** + * Fired when a donut order is made. + * @name Bakery#event:donutOrdered + * @event + * @param {Event} e The event object. + * @param {String} [e.topping] Optional sprinkles. + */ + +/** + * @constructor + * @borrows Bakery#event:donutOrdered as this.event:cakeOrdered + */ +function CakeShop() { +} + +/** @event */ +CakeShop.prototype.icingReady = function(isPink) { +} + +/** @event */ +function amHungry(/**Boolean*/enoughToEatAHorse) { +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/exports.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/exports.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,14 @@ +/** @namespace */ +var mxn = {}; + +(function(){ + /** @exports Map as mxn.Map */ + var Map = + /** @constructor */ + mxn.Map = function() { + }; + + /** A method. */ + Map.prototype.doThings = function() { + }; +})(); \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/functions_anon.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/functions_anon.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,39 @@ +/** an anonymous constructor executed inline */ +a = new function() { + /** a.b*/ + this.b = 1; + /** a.f */ + this.f = function() { + /** a.c */ + this.c = 2; + } +} + + +/** + named function executed inline +*/ +bar1 = function Zoola1() { + /** property of global */ + this.g = 1; +}(); + +/** + named constructor executed inline +*/ +bar2 = new function Zoola2() { + /** property of bar */ + this.p = 1; +}; + +/** module pattern */ +module = (function () { + /** won't appear in documentation */ + var priv = 1; + + /** @scope module */ + return { + /** will appear as a property of module */ + pub: 1 + } +})(); diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/functions_nested.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/functions_nested.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,33 @@ +/** @constructor */ +function Zop() { +} + +/** + @class +*/ +Foo = function(id) { + // this is a bit twisted, but if you call Foo() you will then + // modify Foo(). This is kinda, sorta non-insane, because you + // would have to call Foo() 100% of the time to use Foo's methods + Foo.prototype.methodOne = function(bar) { + alert(bar); + }; + + // same again + Foo.prototype.methodTwo = function(bar2) { + alert(bar2); + }; + + // and these are only executed if the enclosing function is actually called + // and who knows if that will ever happen? + Bar = function(pez) { + alert(pez); + }; + Zop.prototype.zap = function(p){ + alert(p); + }; + + // but this is only visible inside Foo + function inner() { + } +}; diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/global.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/global.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,13 @@ +/** ecks */ +var x = [1, 2, 4]; + +var y = { + foo: function(){ + } +} + +bar = function() { +} + +function zop() { +} diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/globals.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/globals.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,25 @@ +function example(/**Circle*/a, b) { + /** a global defined in function */ + var number = a; + + var hideNumber = function(){ + } + + setNumber = function(){ + } + alert('You have chosen: ' + b); +} + +function initPage() { + var supported = document.createElement && document.getElementsByTagName; + if (!supported) return; + // start of DOM script + var x = document.getElementById('writeroot'); + // etc. +} + +/** an example var */ +var document = new Document(x, y); + +var getNumber = function(){ +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/ignore.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/ignore.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,10 @@ +/** + * A test constructor. + * @constructor + * @ignore + */ +function Ignored() { + /** a method */ + this.bar = function() { + } +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/inner.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/inner.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,16 @@ +/** + * @constructor + */ +function Outer() { + /** + * @constructor + */ + function Inner(name) { + /** The name of this. */ + this.name = name; + } + + this.open = function(name) { + return (new Inner(name)); + } +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/jsdoc_test.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/jsdoc_test.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,477 @@ +/** + * @fileoverview This file is to be used for testing the JSDoc parser + * It is not intended to be an example of good JavaScript OO-programming, + * nor is it intended to fulfill any specific purpose apart from + * demonstrating the functionality of the + * JSDoc parser + * + * @author Gabriel Reid gab_reid@users.sourceforge.net + * @version 0.1 + */ + + +/** + * Construct a new Shape object. + * @class This is the basic Shape class. + * It can be considered an abstract class, even though no such thing + * really existing in JavaScript + * @constructor + * @throws MemoryException if there is no more memory + * @throws GeneralShapeException rarely (if ever) + * @return {Shape|Coordinate} A new shape. + */ +function Shape(){ + + /** + * This is an example of a function that is not given as a property + * of a prototype, but instead it is assigned within a constructor. + * For inner functions like this to be picked up by the parser, the + * function that acts as a constructor must be denoted with + * the @constructor tag in its comment. + * @type String + */ + this.getClassName = function(){ + return "Shape"; + } + + /** + * This is an inner method, just used here as an example + * @since version 0.5 + * @author Sue Smart + */ + function addReference(){ + // Do nothing... + } + +} + +/** + * Create a new Hexagon instance. + * @extends Shape + * @class Hexagon is a class that is a logical sublcass of + * {@link Shape} (thanks to the
@extends tag), but in
+ * reality it is completely unrelated to Shape.
+ * @param {int} sideLength The length of one side for the new Hexagon
+ * @example
+ * var h = new Hexagon(2);
+ * @example
+ * if (hasHex) {
+ * hex = new Hexagon(5);
+ * color = hex.getColor();
+ * }
+ */
+function Hexagon(sideLength) {
+}
+
+
+/**
+ * This is an unattached (static) function that adds two integers together.
+ * @param {int} One The first number to add
+ * @param {int} Two The second number to add
+ * @author Gabriel Reid
+ * @deprecated So you shouldn't use it anymore! Use {@link Shape#getClassName} instead.
+ */
+function Add(One, Two){
+ return One + Two;
+}
+
+
+/**
+ * The color of this shape
+ * @type Color
+ */
+Shape.prototype.color = null;
+
+/**
+ * The border of this shape.
+ * @field
+ * @type int
+ */
+Shape.prototype.border = function(){return border;};
+
+/*
+ * These are all the instance method implementations for Shape
+ */
+
+/**
+ * Get the coordinates of this shape. It is assumed that we're always talking
+ * about shapes in a 2D location here.
+ * @requires The {@link Shape} class
+ * @returns A Coordinate object representing the location of this Shape
+ * @type Coordinate[]
+ */
+Shape.prototype.getCoords = function(){
+ return this.coords;
+}
+
+/**
+ * Get the color of this shape.
+ * @see #setColor
+ * @see The Color library.
+ * @link Shape
+ * @type Color
+ */
+Shape.prototype.getColor = function(){
+ return this.color;
+}
+
+/**
+ * Set the coordinates for this Shape
+ * @param {Coordinate} coordinates The coordinates to set for this Shape
+ */
+Shape.prototype.setCoords = function(coordinates){
+ this.coords = coordinates;
+}
+
+/**
+ * Set the color for this Shape
+ * @param {Color} color The color to set for this Shape
+ * @param other There is no other param, but it can still be documented if
+ * optional parameters are used
+ * @throws NonExistantColorException (no, not really!)
+ * @see #getColor
+ */
+Shape.prototype.setColor = function(color){
+ this.color = color;
+}
+
+/**
+ * Clone this shape
+ * @returns A copy of this shape
+ * @type Shape
+ * @author Gabriel Reid
+ */
+Shape.prototype.clone = function(){
+ return new Shape();
+}
+
+/**
+ * Create a new Rectangle instance.
+ * @class A basic rectangle class, inherits from Shape.
+ * This class could be considered a concrete implementation class
+ * @constructor
+ * @param {int} width The optional width for this Rectangle
+ * @param {int} height Thie optional height for this Rectangle
+ * @author Gabriel Reid
+ * @see Shape is the base class for this
+ * @augments Shape
+ * @hilited
+ */
+function Rectangle(width, // This is the width
+ height // This is the height
+ ){
+ if (width){
+ this.width = width;
+ if (height){
+ this.height = height;
+ }
+ }
+}
+
+
+/* Inherit from Shape */
+Rectangle.prototype = new Shape();
+
+/**
+ * Value to represent the width of the Rectangle.
+ * Text in bold and italic and a + * link to SourceForge + * @private + * @type int + */ +Rectangle.prototype.width = 0; + +/** + * Value to represent the height of the Rectangle + * @private + * @type int + */ +Rectangle.prototype.height = 0; + +/** + * Get the type of this object. + * @type String + */ +Rectangle.prototype.getClassName= function(){ + return "Rectangle"; +} + +/** + * Get the value of the width for the Rectangle + * @type int + * @see Rectangle#setWidth + */ +Rectangle.prototype.getWidth = function(){ + return this.width; +} + +/** + * Get the value of the height for the Rectangle. + * Another getter is the {@link Shape#getColor} method in the + * {@link Shape} base class. + * @return The height of this Rectangle + * @type int + * @see Rectangle#setHeight + */ +Rectangle.prototype.getHeight = function(){ + return this.height; +} + +/** + * Set the width value for this Rectangle. + * @param {int} width The width value to be set + * @see #setWidth + */ +Rectangle.prototype.setWidth = function(width){ + this.width = width; +} + +/** + * Set the height value for this Rectangle. + * @param {int} height The height value to be set + * @see #getHeight + */ +Rectangle.prototype.setHeight = function(height){ + this.height = height; +} + +/** + * Get the value for the total area of this Rectangle + * @return total area of this Rectangle + * @type int + */ +Rectangle.prototype.getArea = function(){ + return width * height; +} + + +/** + * Create a new Square instance. + * @class A Square is a subclass of {@link Rectangle} + * @param {int} width The optional width for this Rectangle + * @param {int} height The optional height for this Rectangle + * @augments Rectangle + */ +function Square(width, height){ + if (width){ + this.width = width; + if (height){ + this.height = height; + } + } + +} + +/* Square is a subclass of Rectangle */ +Square.prototype = new Rectangle(); + +/** + * Set the width value for this Shape. + * @param {int} width The width value to be set + * @see #getWidth + */ +Square.prototype.setWidth = function(width){ + this.width = this.height = width; +} + +/** + * Set the height value for this Shape + * Sets the {@link Rectangle#height} attribute in the Rectangle. + * @param {int} height The height value to be set + */ +Square.prototype.setHeight = function(height){ + this.height = this.width = height; +} + + +/** + * Create a new Circle instance based on a radius. + * @class Circle class is another subclass of Shape + * @extends Shape + * @param {int} radius The optional radius of this {@link Circle } + * @mixin Square.prototype.setWidth as this.setDiameter + */ +function Circle(radius){ + if (radius) { + /** The radius of the this Circle. */ + this.radius = radius; + } +} + +/* Circle inherits from {@link Shape} */ +Circle.prototype = new Shape(); + +/** + * The radius value for this Circle + * @private + * @type int + */ +Circle.prototype.radius = 0; + +/** + * A very simple class (static) field that is also a constant + * @final + * @type float + */ +Circle.PI = 3.14; + +/** + * Get the radius value for this Circle + * @type int + * @see #setRadius + */ +Circle.prototype.getRadius = function(){ + return this.radius; +} + +/** + * Set the radius value for this Circle + * @param {int} radius The {@link Circle#radius} value to set + * @see #getRadius + */ +Circle.prototype.setRadius = function(radius){ + this.radius = radius; +} + +/** + * An example of a class (static) method that acts as a factory for Circle + * objects. Given a radius value, this method creates a new Circle. + * @param {int} radius The radius value to use for the new Circle. + * @type Circle + */ +Circle.createCircle = function(radius){ + return new Circle(radius); +} + + +/** + * Create a new Coordinate instance based on x and y grid data. + * @class Coordinate is a class that can encapsulate location information. + * @param {int} [x=0] The optional x portion of the Coordinate + * @param {int} [y=0] The optinal y portion of the Coordinate + */ +function Coordinate(x, y){ + if (x){ + this.x = x; + if (y){ + this.y = y; + } + } +} + +/** + * The x portion of the Coordinate + * @type int + * @see #getX + * @see #setX + */ +Coordinate.prototype.x = 0; + +/** + * The y portion of the Coordinate + * @type int + * @see #getY + * @see #setY + */ +Coordinate.prototype.y = 0; + +/** + * Gets the x portion of the Coordinate. + * @type int + * @see #setX + */ +Coordinate.prototype.getX = function(){ + return this.x; +} + +/** + * Get the y portion of the Coordinate. + * @type int + * @see #setY + */ +Coordinate.prototype.getY = function(){ + return this.y; +} + +/** + * Sets the x portion of the Coordinate. + * @param {int} x The x value to set + * @see #getX + */ +Coordinate.prototype.setX = function(x){ + this.x = x; +} + +/** + * Sets the y portion of the Coordinate. + * @param {int} y The y value to set + * @see #getY + */ +Coordinate.prototype.setY = function(y){ + this.y = y; +} + +/** + * @class This class exists to demonstrate the assignment of a class prototype + * as an anonymous block. + */ +function ShapeFactory(){ +} + +ShapeFactory.prototype = { + /** + * Creates a new {@link Shape} instance. + * @return A new {@link Shape} + * @type Shape + */ + createShape: function(){ + return new Shape(); + } +} + +/** + * An example of a singleton class + * @param ... Arguments represent {@link coordinate}s in the shape. + * @constructor + */ +MySingletonShapeFactory = function(){ + + /** + * Get the next {@link Shape} + * @type Shape + * @return A new {@link Shape} + */ + this.getShape = function(){ + return null; + } + +} + + +/** + * Create a new Foo instance. + * @class This is the Foo class. It exists to demonstrate 'nested' classes. + * @constructor + * @see Foo.Bar + */ +function Foo(){} + +/** + * Creates a new instance of Bar. + * @class This class exists to demonstrate 'nested' classes. + * @constructor + * @see Foo.Bar + */ +function Bar(){} + +/** + * Nested class + * @constructor + */ +Foo.Bar = function(){ + /** The x. */ this.x = 2; +} + +Foo.Bar.prototype = new Bar(); +/** The y. */ +Foo.Bar.prototype.y = '3'; diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/lend.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/lend.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,33 @@ + /** @class */ +var Person = Class.create( + /** + @lends Person.prototype + */ + { + initialize: function(name) { + this.name = name; + }, + say: function(message) { + return this.name + ': ' + message; + } + } + ); + +/** @lends Person.prototype */ +{ + /** like say but more musical */ + sing: function(song) { + } +} + +/** @lends Person */ +{ + getCount: function() { + } +} + +/** @lends Unknown.prototype */ +{ + notok: function() { + } +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/memberof.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/memberof.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,19 @@ +/** @constructor */ +pack = function() { + this.init = function(){} + function config(){} +} + + pack.build = function(task) {}; + +/** @memberOf pack */ +pack.install = function() {} + +/** @memberOf pack */ +pack.install.overwrite = function() {} + +/** @memberOf pack */ +clean = function() {} + +/** @memberOf pack-config */ +install = function() {}; diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/memberof2.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/memberof2.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,38 @@ +/** + * @constructor + */ +function Foo() { + /** + @memberOf Foo.prototype + */ + function bar(a, b) { + } + + /** + @memberOf Foo + */ + var zip = function(p, q) { + } + + /** + @memberOf Foo + */ + function zop( x,y ) { + } + + /** + @memberOf Foo + @constructor + */ + function Fiz() { + /** A method of Foo#Fiz. */ + this.fipple = function(fop){} + } +} + +/** + @memberOf Foo# + */ +var blat = function() { + +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/memberof3.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/memberof3.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,33 @@ +/** +* @name Foo +* @class +*/ + +/**#@+ +* @memberOf Foo# +* @field +*/ + +/** +* @name bar +* @type Object[] +*/ + +/**#@-*/ + +/** +* @name Foo2 +* @class +*/ + +/**#@+ +* @memberOf Foo2# +* @field +*/ + +/** +* @name bar +* @type Object[] +*/ + +/**#@-*/ \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/memberof_constructor.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/memberof_constructor.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,17 @@ +/** @constructor */ +function Circle(){} + +/** + @constructor + @memberOf Circle# + */ +Circle.prototype.Tangent = function(){}; + +// renaming Circle#Tangent to Circle#Circle#Tangent + +/** + @memberOf Circle#Tangent# + */ +Circle.prototype.Tangent.prototype.getDiameter = function(){}; + + diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/module.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/module.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,17 @@ +/** @namespace */ +myProject = myProject || {}; + +/** @namespace */ +myProject.myModule = (function () { + /** describe myPrivateVar here */ + var myPrivateVar = ""; + + var myPrivateMethod = function () { + } + + /** @scope myProject.myModule */ + return { + myPublicMethod: function () { + } + }; +})(); \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/multi_methods.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/multi_methods.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,25 @@ + +/** + Get the entire flavor. + @name flavor^3 + @function + @returns {Object} The entire flavor hash. +*/ +/** + Get a named flavor. + @name flavor^2 + @function + @param {String} name The name of the flavor to get. + @returns {String} The value of that flavor. +*/ +/** + Set the flavor. + @param {String} name The name of the flavor to set. + @param {String} value The value of the flavor. + @returns {String} The value of that flavor. +*/ +function flavor(name, value) { + if (arguments.length > 1) flavor[name] = value; + else if (arguments.length == 1) return flavor[name]; + else return flavor; +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/name.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/name.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,19 @@ +/** + @name Response + @class +*/ + +Response.prototype = { + /** + @name Response#text + @function + @description + Gets the body of the response as plain text + @returns {String} + Response as text + */ + + text: function() { + return this.nativeResponse.responseText; + } +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/namespace_nested.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/namespace_nested.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,23 @@ +/** + @namespace This is the first namespace. +*/ +ns1 = {}; + +/** + This is the second namespace. + @namespace +*/ +ns1.ns2 = {}; + +/** + This part of ns1.ns2 + @constructor +*/ +ns1.ns2.Function1 = function() { +}; + +ns1.staticFunction = function() { +}; + +/** A static field in a namespace. */ +ns1.ns2.staticField = 1; diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/nocode.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/nocode.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,13 @@ +/**#nocode+*/ + /** + @name star + @function + */ + function blahblah() { + + } +/**#nocode-*/ + +function yaddayadda() { + +} \ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/oblit_anon.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/oblit_anon.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,20 @@ +/** the options */ +opt = Opt.get( + arguments, + { + d: "directory", + c: "conf", + "D[]": "define" + } +); + +/** configuration */ +opt.conf = { + /** keep */ + keep: true, + /** base */ + base: getBase(this, {p: properties}) +} + + + diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/overview.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/app/test/overview.js Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,20 @@ +/** + * @overview This "library" contains a + * lot of classes and functions. + * @example +
+ var x (x < 1);
+ alert("This 'is' \"code\"");
+
+ * @name My Cool Library
+ * @author Joe Smith jsmith@company.com
+ * @version 0.1
+ */
+
+/**
+ * Gets the current foo
+ * @param {String} fooId The unique identifier for the foo.
+ * @return {Object} Returns the current foo.
+ */
+function getFoo(fooID){
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/param_inline.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/param_inline.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,37 @@
+/**
+ @constructor
+ @param columns The number of columns.
+*/
+function Layout(/**int*/columns){
+ /**
+ @param [id] The id of the element.
+ @param elName The name of the element.
+ */
+ this.getElement = function(
+ /** string */ elName,
+ /** number|string */ id
+ ) {
+ };
+
+ /**
+ @constructor
+ */
+ this.Canvas = function(top, left, /**int*/width, height) {
+ /** Is it initiated yet? */
+ this.initiated = true;
+ }
+
+ this.rotate = function(/**nothing*/) {
+ }
+
+ /**
+ @param x
+ @param y
+ @param {zoppler} z*/
+ this.init = function(x, y, /**abbler*/z) {
+ /** The xyz. */
+ this.xyz = x+y+z;
+ this.getXyz = function() {
+ }
+ }
+}
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/params_optional.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/params_optional.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,8 @@
+
+/**
+ * @param {Page[]} pages
+ * @param {number} [id] Specifies the id, if applicable.
+ * @param {String} [title = This is untitled.] Specifies the title.
+ */
+function Document(pages, id, title){
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/prototype.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/prototype.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,17 @@
+/** @constructor */
+function Article() {
+}
+
+Article.prototype.init = function(title) {
+ /** the instance title */
+ this.title = title;
+
+ /** the static counter */
+ Article.counter = 1;
+}
+
+a = new Article();
+a.Init("my title");
+
+print(a.title);
+print(Article.counter);
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/prototype_nested.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/prototype_nested.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,9 @@
+/** @constructor */
+function Word() {
+}
+
+Word.prototype.reverse = function() {
+}
+
+Word.prototype.reverse.utf8 = function() {
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/prototype_oblit.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/prototype_oblit.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,13 @@
+/** @constructor */
+function Article() {
+}
+
+Article.prototype = {
+ /** instance get title */
+ getTitle: function(){
+ }
+}
+
+/** static get title */
+Article.getTitle = function(){
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/prototype_oblit_constructor.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/prototype_oblit_constructor.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,24 @@
+/** @constructor */
+function Article() {
+}
+
+Article.prototype = {
+ /** @constructor */
+ Title: function(title) {
+ /** the value of the Title instance */
+ this.title = title;
+ },
+
+ init: function(pages) {
+ /** the value of the pages of the Article instance */
+ this.pages = pages;
+ }
+}
+
+f = new Article();
+f.init("one two three");
+
+t = new f.Title("my title");
+
+print(f.pages);
+print(t.title);
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/public.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/public.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,10 @@
+/**@constructor*/
+function Foo() {
+ /**
+ @public
+ @static
+ @field
+ */
+ var bar = function(x) {
+ }
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/scripts/code.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/scripts/code.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,5 @@
+/**
+ @class
+ */
+function thisiscode() {
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/scripts/notcode.txt
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/scripts/notcode.txt Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,5 @@
+(This is not code)
+function foo(){{{{
+(
+!
+@
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/shared.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/shared.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,42 @@
+
+/**
+ * Builtin object.
+ * @class
+ * @name Array
+ */
+
+/**#@+
+ * Extension to builtin array.
+ * @memberOf Array
+ * @method
+ */
+
+/**
+ * @returns Boolen if some array members...
+ */
+Array.prototype.some = function(){};
+
+/**
+ * Change every element of an array.
+ * @returns Filtered array copy.
+ */
+Array.prototype.filter = function(){};
+
+/**#@-*/
+
+
+/**
+ * A first in, first out data structure.
+ * @constructor
+ */
+Queue = function(){};
+
+/**#@+
+ * Extension to Queue.
+ * @memberOf Queue
+ */
+
+rewind = function(){
+}
+
+// should close automatically here.
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/shared2.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/shared2.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,2 @@
+startOver = function(){
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/shortcuts.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/shortcuts.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,22 @@
+// /**#=+
+// * {
+// * 'D': 'Date.prototype',
+// * '$N': 'Number'
+// * }
+// */
+// var D = Date.prototype,
+// $N = Number;
+//
+// D.locale = function(){
+// };
+//
+// /**
+// @return {string} The cardinal number string.
+// */
+// $N.nth = function(n){
+// };
+//
+// LOAD.file = function(){
+// }
+//
+// /**#=-*/
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/static_this.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/static_this.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,13 @@
+/** the parent */
+var box = {};
+
+/** @namespace */
+box.holder = {}
+
+box.holder.foo = function() {
+ /** the counter */
+ this.counter = 1;
+}
+
+box.holder.foo();
+print(box.holder.counter);
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/synonyms.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/synonyms.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,31 @@
+/**
+ @class
+ @inherits Bar#zop as #my_zop
+*/
+function Foo() {
+ /** this is a zip. */
+ this.zip = function() {}
+
+ /** from Bar */
+ this.my_zop = new Bar().zop;
+}
+
+/**
+ @class
+ @borrows Foo#zip as this.my_zip
+*/
+function Bar() {
+ /** this is a zop. */
+ this.zop = function() {}
+
+ /** from Foo */
+ this.my_zip = new Foo().zip;
+}
+
+/** @namespace */
+var myObject = {
+ /**
+ @type function
+ */
+ myFunc: getFunction()
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/tosource.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/tosource.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,23 @@
+/**
+ * @param {Object} object
+ * @return {string}
+ */
+function valueOf(object) {}
+
+/**
+ * @param {Object} object
+ * @return {string}
+ */
+function toString(object) {}
+
+/**
+ * @param {Object} object
+ * @return {string}
+ */
+function toSource(object) {}
+
+/**
+ * @param {Object} object
+ * @return {string}
+ */
+function constructor(object) {}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/app/test/variable_redefine.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/app/test/variable_redefine.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,14 @@
+/** @constructor */
+function Foo() {
+ var bar = 1;
+ bar = 2; // redefining a private
+
+ this.baz = 1;
+ baz = 2; // global
+
+ /** a private */
+ var blap = {
+ /** in here */
+ tada: 1
+ }
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/changes.txt
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/changes.txt Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,124 @@
+== 2.4.0 ==
+
+ * Fixed bug that added mutiple symbols with the same name to docs.
+ * Added support for the -m option to suppress warnings for multiple docs.
+ * Added patch by brownsea42 to support quoted user variables on the command line. ( issue #281 )
+ * Fixed bug that sometimes caused links to events to be incorrect. ( issue #292 )
+
+== 2.3.3 ==
+
+ * Fixed bug that made all fields declared with the @property tag static. ( issue #262 )
+ * Minor fix to better handle trailing slash on path to template (from jwmetrocat). ( issue #237 )
+ * Fix for @memberOf when applied to inner members. ( issue #264 )
+ * Fix for @memberOf when applied to symbols documented with @name. ( issue #260 )
+ * Applied patch from kunhualqk, fix for bug where @link to borrowed member did not resolve to parent class. ( issue #218 )
+ * Fix for @requires not linking back to the required class
+ * Added experimental support for @constructs to have an argument, the class name, when applied to a function assignment.
+
+== 2.3.2 ==
+
+ * Minor update to the usage notes and corrected the version number displayed in the output.
+
+== 2.3.1 ==
+
+ * Fixed HTML typo in allfiles template. ( issue #228 )
+ * Modified template to display version information for classes.
+ * Modified template to better support multiple methods with the same name.
+ * Fixed bug that caused template to error when backtick characters appeared around class names.
+
+== 2.3.0 ==
+
+ * Added option -u, --unique to avoid bug that causes multiple symbols with names that differ only by case to overwrite each others output on case-insensitive filesystems. ( issue #162 )
+ * Fixed bug where {@links} in @deprecated tags did not resolve. ( issue #220 )
+ * Fixed bug that caused parens around a function to make it to be unrecognized. ( issue #213 )
+ * Fixed bug prevented explicit links to named anchors from working (thanks katgao.pku). ( issue #215 )
+ * Fixed bug that prevented full description from appearing in file overview. ( issue #224 )
+
+== 2.2.1 ==
+
+ * Fixed bug with class template, where sorting of methods was accidentally removed (thanks dezfowler).
+ * Added missing test files for the @exports unit tests.
+
+== 2.2.0 ==
+
+ * Fixed bug that caused exception when given a folder containing non-js files, even with the x commandline option set to "js". ( issue #193 )
+ * Fixed typo in index template [patch submitted by olle]. ( issue #198 )
+ * Modified @borrows tag experimentally to allow for missing "as ..." clause.
+ * Added support for the @exports tag, to allow one symbol to be documented as another.
+ * Added support for the -S option to document code following the Secure Modules pattern.
+
+== 2.1.0 ==
+
+ * Added support for the @event tag.
+ * Fixed bug that prevented the : character from appearing in symbol names.
+ * Fixed bug that prevented underscored symbols marked with @public being tagged as private. (issue #184 )
+ * Fixed bug that randomly affected the @memberOf tag when the name of the symbol did not include the parent name.
+ * Fixed bug that prevented templates that were not in the jsdoc-toolkit folder from being found. ( issue #176 )
+ * Added ability to check for trailing slash on template path. ( issue #177 )
+ * Modified classDesc so that it no longer is appended with the constructor desc.
+ * Fixed call to plugin onDocCommentSrc.
+ * Added missing support for inline doc comments for function return types. ( issue #189 )
+ * Added command line option -q, --quiet.
+ * Added command line option -E, --exclude. ( issue #143 )
+ * Added 2 more hooks for plugins. ( issue #163 )
+ * Added support for extending built-ins. ( issue #160 )
+ * Added "compact" option to JSDOC.JsPlate.prototype.process. ( issue #159 )
+ * @augments no longer documents static members as inherited. ( issue #138 )
+ * @link to a class now goes to the page for that class, not the constructor. ( issue #178 )
+ * Warnings of mismatched curly brace now include filename. ( issue #166 )
+ * Fixed bug affecting template paths loaded via a configuration file when the trailing slash is missing. ( issue #191 )
+ * Minor optimizations.
+
+== 2.0.2 ==
+
+ * Fixed bug that sometimes caused an example of division in the source code to be interpretted as a regex by the JsDoc Toolkit analyzer. ( issue #158 )
+ * Fixed a bug that prevented private variables marked as @public from appearing in the documentation. ( issue #161 )
+ * Fixed bug that prevented variable names with underscored properties from appearing in summaries. ( issue #173 )
+
+== 2.0.1 ==
+
+ * Fixed bug that prevented @fileOverview tag from being recognized.
+ * Added support for @fieldOf as a synonym for @field plus @memberOf.
+ * Added support for @name tag in a @fileOverview comment to control the displayed name of the file.
+ * Added support for multiple @example tags. ( issue #152 )
+ * Modified style sheet of jsdoc template to make more readable. ( issue #151 )
+ * Fixed bug that prevented @since documentation from displaying correctly when it appeared in a class. ( issue #150 )
+ * Fixed bug that caused inhertited properties to sometimes not resolve correctly. ( issue #144 )
+ * Modified so that trailing whitespace in @example is always trimmed. ( issue #153 )
+ * Added support for elseif to JsPlate. (hat tip to fredck)
+ * Added support for @location urls in the @overview comment to the jsdoc template.
+
+== Changes From Versions 1.4.0 to 2.0.0 ==
+
+ * Upgraded included version of Rhino from 1.6 to 1.7R1.
+ * Removed circular references in parsed documentation objects.
+ * Improved inheritance handling, now properties and events can be inherited same as methods.
+ * Improved handling of cross-file relationships, now having two related objects in separate files is not a problem.
+ * Improved ability to recognize membership of previously defined objects.
+ * Added ability to redefine parsing behavior with plugins.
+ * @methodOf is a synonym for @function and @memberOf.
+ * Added @default to document default values of members that are objects.
+ * Added ability to parse and refer to inner functions.
+ * Fixed bug that appeared when calling a method to set properties of the instance referred to by "this".
+ * Added ability to automatically create links to other symbols.
+ * New "jsdoc" template now produces fully W3C valid XHTML.
+ * Inline parameter type hint comments are now documented.
+ * Fixed error: Locally scoped variables (declared with var) no longer appear as global.
+ * It is now possible to run JsDoc Toolkit from any directory.
+ * Added support for inline {@link ...} tags.
+ * Added support for the -H command-line option to allow for custom content handlers.
+ * Tag names @inherits and @scope changed to @borrows and @lends.
+ ? Combining @constructor in a doclet with @lends now supported.
+ * Multiple @lend tags now supported.
+ * Added support for the @constructs tag, used inside a @lends block.
+ * Added support for the @constant tag.
+ * Fixed bug that prevented the use of [] as a default value.
+ * Added support for the @field tag.
+ * Added support for the @public tag (applied to inner functions).
+ * @namespace tag can now be applied to functions, not just object literals.
+ * Added support for the -s command line option to suppress source code output.
+ * Added new unit test framework.
+ * Underscored symbols are now treated as if they have a @private tag by default.
+ * Improved support for anonymous constructors.
+ * Added support for the nocode meta tag.
+
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/conf/sample.conf
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/conf/sample.conf Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,31 @@
+/*
+ This is an example of one way you could set up a configuration file to more
+ conveniently define some commandline options. You might like to do this if
+ you frequently reuse the same options. Note that you don't need to define
+ every option in this file, you can combine a configuration file with
+ additional options on the commandline if your wish.
+
+ You would include this configuration file by running JsDoc Toolkit like so:
+ java -jar jsrun.jar app/run.js -c=conf/sample.conf
+
+*/
+
+{
+ // source files to use
+ _: ['app/test/jsdoc_test.js'],
+
+ // document all functions, even uncommented ones
+ a: true,
+
+ // including those marked @private
+ p: true,
+
+ // some extra variables I want to include
+ D: {generatedBy: "Michael Mathews", copyright: "2008"},
+
+ // use this directory as the output directory
+ d: "docs",
+
+ // use this template
+ t: "templates/jsdoc"
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/java/build.xml
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/java/build.xml Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,36 @@
+
+
+
+
+
+
+
+
+ Documentation generated by JsDoc Toolkit 2.4.0 on Fri Dec 23 2011 10:50:32 GMT+0100 (CET)
+
+
+
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/out/jsdoc/index.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/out/jsdoc/index.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,210 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+ Documentation generated by JsDoc Toolkit 2.4.0 on Fri Dec 23 2011 10:50:32 GMT+0100 (CET)
+
+
+
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/out/jsdoc/symbols/_global_.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/out/jsdoc/symbols/_global_.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,778 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ + +
+ + +
+ + +
+ + +
+ + +
+ + +
+ + +
+ + +
+ + +
+
+
+
+
+ + + Built-In Namespace _global_ +
+ + ++ + + + + + +
+ + + + + + + + +| Field Attributes | +Field Name and Description | +
|---|---|
| + |
+
+ Mustache
+
+
+ |
+
| Method Attributes | +Method Name and Description | +
|---|---|
| + |
+ b(a)
+
+
+ |
+
| + |
+ Clusters(json)
+
+
+ |
+
| + |
+ d()
+
+
+ |
+
| + |
+ finished_cb()
+
+
+ |
+
| + |
+ Frames(json)
+
+
+ |
+
| + |
+ handler()
+
+
+ |
+
| + |
+ J(a, c)
+
+
+ |
+
| + |
+ log_error(msg, err)
+
+
+ |
+
| + |
+ log_msg(msg)
+
+
+ |
+
| + |
+ ready_cb()
+
+
+ |
+
+ Field Detail
+
+
+
+
+
+
+ Mustache
+
+
+
+
+
+
+ Defined in: LdtPlayer-release.js. + + +
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ + Defined in: LdtPlayer-release.js. + + +
+ Method Detail
+
+
+
+
+
+
+ b(a)
+
+
+
+
+
+
+ Defined in: LdtPlayer-release.js. + + +
+
+
+
+
+ + Defined in: LdtPlayer-release.js. + + +
-
+
- Parameters: + +
- + a + + + + +
+ + +
+
+
+ Clusters(json)
+
+
+
+
+
+
+ Defined in: LdtPlayer-release.js. + + +
+
+
+
+
+ + Defined in: LdtPlayer-release.js. + + +
-
+
- Parameters: + +
- + json + + + + +
+ + +
+
+
+ d()
+
+
+
+
+
+
+ Defined in: LdtPlayer-release.js. + + +
+
+
+
+
+
+
+
+
+
+
+
+ + Defined in: LdtPlayer-release.js. + + +
+ + +
+
+
+ finished_cb()
+
+
+
+
+
+
+ Defined in: LdtPlayer-release.js. + + +
+
+
+
+
+
+
+
+
+
+
+
+ + Defined in: LdtPlayer-release.js. + + +
+ + +
+
+
+ Frames(json)
+
+
+
+
+
+
+ Defined in: LdtPlayer-release.js. + + +
+
+
+
+
+ + Defined in: LdtPlayer-release.js. + + +
-
+
- Parameters: + +
- + json + + + + +
+ + +
+
+
+ handler()
+
+
+
+
+
+
+ Defined in: LdtPlayer-release.js. + + +
+
+
+
+
+
+
+
+
+
+
+
+ + Defined in: LdtPlayer-release.js. + + +
+ + +
+
+
+ J(a, c)
+
+
+
+
+
+
+ Defined in: LdtPlayer-release.js. + + +
+
+
+
+
+ + Defined in: LdtPlayer-release.js. + + +
-
+
- Parameters: + +
- + a + + + + +
- + c + + + + +
+ + +
+
+
+ log_error(msg, err)
+
+
+
+
+
+
+ Defined in: LdtPlayer-release.js. + + +
+
+
+
+
+ + Defined in: LdtPlayer-release.js. + + +
-
+
- Parameters: + +
- + msg + + + + +
- + err + + + + +
+ + +
+
+
+ log_msg(msg)
+
+
+
+
+
+
+ Defined in: LdtPlayer-release.js. + + +
+
+
+
+
+ + Defined in: LdtPlayer-release.js. + + +
-
+
- Parameters: + +
- + msg + + + + +
+ + +
+
+
+ ready_cb()
+
+
+
+
+
+
+ Defined in: LdtPlayer-release.js. + + +
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ + Defined in: LdtPlayer-release.js. + + +
+
+
+ Documentation generated by JsDoc Toolkit 2.4.0 on Fri Dec 23 2011 10:50:32 GMT+0100 (CET)
+
+
+
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/out/jsdoc/symbols/src/LdtPlayer-release.js.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/out/jsdoc/symbols/src/LdtPlayer-release.js.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,3549 @@
+ 1 /* + 2 * + 3 * Copyright 2010 Institut de recherche et d'innovation + 4 * contributor(s) : Samuel Huron + 5 * + 6 * contact@iri.centrepompidou.fr + 7 * http://www.iri.centrepompidou.fr + 8 * + 9 * This software is a computer program whose purpose is to show and add annotations on a video . + 10 * This software is governed by the CeCILL-C license under French law and + 11 * abiding by the rules of distribution of free software. You can use, + 12 * modify and/ or redistribute the software under the terms of the CeCILL-C + 13 * license as circulated by CEA, CNRS and INRIA at the following URL + 14 * "http://www.cecill.info". + 15 * + 16 * The fact that you are presently reading this means that you have had + 17 * knowledge of the CeCILL-C license and that you accept its terms. + 18 */ + 19 /*! LAB.js (LABjs :: Loading And Blocking JavaScript) + 20 v2.0.3 (c) Kyle Simpson + 21 MIT License + 22 */ + 23 + 24 (function(global){ + 25 var _$LAB = global.$LAB, + 26 + 27 // constants for the valid keys of the options object + 28 _UseLocalXHR = "UseLocalXHR", + 29 _AlwaysPreserveOrder = "AlwaysPreserveOrder", + 30 _AllowDuplicates = "AllowDuplicates", + 31 _CacheBust = "CacheBust", + 32 /*!START_DEBUG*/_Debug = "Debug",/*!END_DEBUG*/ + 33 _BasePath = "BasePath", + 34 + 35 // stateless variables used across all $LAB instances + 36 root_page = /^[^?#]*\//.exec(location.href)[0], + 37 root_domain = /^\w+\:\/\/\/?[^\/]+/.exec(root_page)[0], + 38 append_to = document.head || document.getElementsByTagName("head"), + 39 + 40 // inferences... ick, but still necessary + 41 opera_or_gecko = (global.opera && Object.prototype.toString.call(global.opera) == "[object Opera]") || ("MozAppearance" in document.documentElement.style), + 42 + 43 /*!START_DEBUG*/ + 44 // console.log() and console.error() wrappers + 45 log_msg = function(){}, + 46 log_error = log_msg, + 47 /*!END_DEBUG*/ + 48 + 49 // feature sniffs (yay!) + 50 test_script_elem = document.createElement("script"), + 51 explicit_preloading = typeof test_script_elem.preload == "boolean", // http://wiki.whatwg.org/wiki/Script_Execution_Control#Proposal_1_.28Nicholas_Zakas.29 + 52 real_preloading = explicit_preloading || (test_script_elem.readyState && test_script_elem.readyState == "uninitialized"), // will a script preload with `src` set before DOM append? + 53 script_ordered_async = !real_preloading && test_script_elem.async === true, // http://wiki.whatwg.org/wiki/Dynamic_Script_Execution_Order + 54 + 55 // XHR preloading (same-domain) and cache-preloading (remote-domain) are the fallbacks (for some browsers) + 56 xhr_or_cache_preloading = !real_preloading && !script_ordered_async && !opera_or_gecko + 57 ; + 58 + 59 /*!START_DEBUG*/ + 60 // define console wrapper functions if applicable + 61 if (global.console && global.console.log) { + 62 if (!global.console.error) global.console.error = global.console.log; + 63 log_msg = function(msg) { global.console.log(msg); }; + 64 log_error = function(msg,err) { global.console.error(msg,err); }; + 65 } + 66 /*!END_DEBUG*/ + 67 + 68 // test for function + 69 function is_func(func) { return Object.prototype.toString.call(func) == "[object Function]"; } + 70 + 71 // test for array + 72 function is_array(arr) { return Object.prototype.toString.call(arr) == "[object Array]"; } + 73 + 74 // make script URL absolute/canonical + 75 function canonical_uri(src,base_path) { + 76 var absolute_regex = /^\w+\:\/\//; + 77 + 78 // is `src` is protocol-relative (begins with // or ///), prepend protocol + 79 if (/^\/\/\/?/.test(src)) { + 80 src = location.protocol + src; + 81 } + 82 // is `src` page-relative? (not an absolute URL, and not a domain-relative path, beginning with /) + 83 else if (!absolute_regex.test(src) && src.charAt(0) != "/") { + 84 // prepend `base_path`, if any + 85 src = (base_path || "") + src; + 86 } + 87 // make sure to return `src` as absolute + 88 return absolute_regex.test(src) ? src : ((src.charAt(0) == "/" ? root_domain : root_page) + src); + 89 } + 90 + 91 // merge `source` into `target` + 92 function merge_objs(source,target) { + 93 for (var k in source) { if (source.hasOwnProperty(k)) { + 94 target[k] = source[k]; // TODO: does this need to be recursive for our purposes? + 95 }} + 96 return target; + 97 } + 98 + 99 // does the chain group have any ready-to-execute scripts? +100 function check_chain_group_scripts_ready(chain_group) { +101 var any_scripts_ready = false; +102 for (var i=0; i<chain_group.scripts.length; i++) { +103 if (chain_group.scripts[i].ready && chain_group.scripts[i].exec_trigger) { +104 any_scripts_ready = true; +105 chain_group.scripts[i].exec_trigger(); +106 chain_group.scripts[i].exec_trigger = null; +107 } +108 } +109 return any_scripts_ready; +110 } +111 +112 // creates a script load listener +113 function create_script_load_listener(elem,registry_item,flag,onload) { +114 elem.onload = elem.onreadystatechange = function() { +115 if ((elem.readyState && elem.readyState != "complete" && elem.readyState != "loaded") || registry_item[flag]) return; +116 elem.onload = elem.onreadystatechange = null; +117 onload(); +118 }; +119 } +120 +121 // script executed handler +122 function script_executed(registry_item) { +123 registry_item.ready = registry_item.finished = true; +124 for (var i=0; i<registry_item.finished_listeners.length; i++) { +125 registry_item.finished_listeners[i](); +126 } +127 registry_item.ready_listeners = []; +128 registry_item.finished_listeners = []; +129 } +130 +131 // make the request for a scriptha +132 function request_script(chain_opts,script_obj,registry_item,onload,preload_this_script) { +133 // setTimeout() "yielding" prevents some weird race/crash conditions in older browsers +134 setTimeout(function(){ +135 var script, src = script_obj.real_src, xhr; +136 +137 // don't proceed until `append_to` is ready to append to +138 if ("item" in append_to) { // check if `append_to` ref is still a live node list +139 if (!append_to[0]) { // `append_to` node not yet ready +140 // try again in a little bit -- note: will re-call the anonymous function in the outer setTimeout, not the parent `request_script()` +141 setTimeout(arguments.callee,25); +142 return; +143 } +144 // reassign from live node list ref to pure node ref -- avoids nasty IE bug where changes to DOM invalidate live node lists +145 append_to = append_to[0]; +146 } +147 script = document.createElement("script"); +148 if (script_obj.type) script.type = script_obj.type; +149 if (script_obj.charset) script.charset = script_obj.charset; +150 +151 // should preloading be used for this script? +152 if (preload_this_script) { +153 // real script preloading? +154 if (real_preloading) { +155 /*!START_DEBUG*/if (chain_opts[_Debug]) log_msg("start script preload: "+src);/*!END_DEBUG*/ +156 registry_item.elem = script; +157 if (explicit_preloading) { // explicit preloading (aka, Zakas' proposal) +158 script.preload = true; +159 script.onpreload = onload; +160 } +161 else { +162 script.onreadystatechange = function(){ +163 if (script.readyState == "loaded") onload(); +164 }; +165 } +166 script.src = src; +167 // NOTE: no append to DOM yet, appending will happen when ready to execute +168 } +169 // same-domain and XHR allowed? use XHR preloading +170 else if (preload_this_script && src.indexOf(root_domain) == 0 && chain_opts[_UseLocalXHR]) { +171 xhr = new XMLHttpRequest(); // note: IE never uses XHR (it supports true preloading), so no more need for ActiveXObject fallback for IE <= 7 +172 /*!START_DEBUG*/if (chain_opts[_Debug]) log_msg("start script preload (xhr): "+src);/*!END_DEBUG*/ +173 xhr.onreadystatechange = function() { +174 if (xhr.readyState == 4) { +175 xhr.onreadystatechange = function(){}; // fix a memory leak in IE +176 registry_item.text = xhr.responseText + "\n//@ sourceURL=" + src; // http://blog.getfirebug.com/2009/08/11/give-your-eval-a-name-with-sourceurl/ +177 onload(); +178 } +179 }; +180 xhr.open("GET",src); +181 xhr.send(); +182 } +183 // as a last resort, use cache-preloading +184 else { +185 /*!START_DEBUG*/if (chain_opts[_Debug]) log_msg("start script preload (cache): "+src);/*!END_DEBUG*/ +186 script.type = "text/cache-script"; +187 create_script_load_listener(script,registry_item,"ready",function() { +188 append_to.removeChild(script); +189 onload(); +190 }); +191 script.src = src; +192 append_to.insertBefore(script,append_to.firstChild); +193 } +194 } +195 // use async=false for ordered async? parallel-load-serial-execute http://wiki.whatwg.org/wiki/Dynamic_Script_Execution_Order +196 else if (script_ordered_async) { +197 /*!START_DEBUG*/if (chain_opts[_Debug]) log_msg("start script load (ordered async): "+src);/*!END_DEBUG*/ +198 script.async = false; +199 create_script_load_listener(script,registry_item,"finished",onload); +200 script.src = src; +201 append_to.insertBefore(script,append_to.firstChild); +202 } +203 // otherwise, just a normal script element +204 else { +205 /*!START_DEBUG*/if (chain_opts[_Debug]) log_msg("start script load: "+src);/*!END_DEBUG*/ +206 create_script_load_listener(script,registry_item,"finished",onload); +207 script.src = src; +208 append_to.insertBefore(script,append_to.firstChild); +209 } +210 },0); +211 } +212 +213 // create a clean instance of $LAB +214 function create_sandbox() { +215 var global_defaults = {}, +216 can_use_preloading = real_preloading || xhr_or_cache_preloading, +217 queue = [], +218 registry = {}, +219 instanceAPI +220 ; +221 +222 // global defaults +223 global_defaults[_UseLocalXHR] = true; +224 global_defaults[_AlwaysPreserveOrder] = false; +225 global_defaults[_AllowDuplicates] = false; +226 global_defaults[_CacheBust] = false; +227 /*!START_DEBUG*/global_defaults[_Debug] = false;/*!END_DEBUG*/ +228 global_defaults[_BasePath] = ""; +229 +230 // execute a script that has been preloaded already +231 function execute_preloaded_script(chain_opts,script_obj,registry_item) { +232 var script; +233 +234 function preload_execute_finished() { +235 if (script != null) { // make sure this only ever fires once +236 script = null; +237 script_executed(registry_item); +238 } +239 } +240 +241 if (registry[script_obj.src].finished) return; +242 if (!chain_opts[_AllowDuplicates]) registry[script_obj.src].finished = true; +243 +244 script = registry_item.elem || document.createElement("script"); +245 if (script_obj.type) script.type = script_obj.type; +246 if (script_obj.charset) script.charset = script_obj.charset; +247 create_script_load_listener(script,registry_item,"finished",preload_execute_finished); +248 +249 // script elem was real-preloaded +250 if (registry_item.elem) { +251 registry_item.elem = null; +252 } +253 // script was XHR preloaded +254 else if (registry_item.text) { +255 script.onload = script.onreadystatechange = null; // script injection doesn't fire these events +256 script.text = registry_item.text; +257 } +258 // script was cache-preloaded +259 else { +260 script.src = script_obj.real_src; +261 } +262 append_to.insertBefore(script,append_to.firstChild); +263 +264 // manually fire execution callback for injected scripts, since events don't fire +265 if (registry_item.text) { +266 preload_execute_finished(); +267 } +268 } +269 +270 // process the script request setup +271 function do_script(chain_opts,script_obj,chain_group,preload_this_script) { +272 var registry_item, +273 registry_items, +274 ready_cb = function(){ script_obj.ready_cb(script_obj,function(){ execute_preloaded_script(chain_opts,script_obj,registry_item); }); }, +275 finished_cb = function(){ script_obj.finished_cb(script_obj,chain_group); } +276 ; +277 +278 script_obj.src = canonical_uri(script_obj.src,chain_opts[_BasePath]); +279 script_obj.real_src = script_obj.src + +280 // append cache-bust param to URL? +281 (chain_opts[_CacheBust] ? ((/\?.*$/.test(script_obj.src) ? "&_" : "?_") + ~~(Math.random()*1E9) + "=") : "") +282 ; +283 +284 if (!registry[script_obj.src]) registry[script_obj.src] = {items:[],finished:false}; +285 registry_items = registry[script_obj.src].items; +286 +287 // allowing duplicates, or is this the first recorded load of this script? +288 if (chain_opts[_AllowDuplicates] || registry_items.length == 0) { +289 registry_item = registry_items[registry_items.length] = { +290 ready:false, +291 finished:false, +292 ready_listeners:[ready_cb], +293 finished_listeners:[finished_cb] +294 }; +295 +296 request_script(chain_opts,script_obj,registry_item, +297 // which callback type to pass? +298 ( +299 (preload_this_script) ? // depends on script-preloading +300 function(){ +301 registry_item.ready = true; +302 for (var i=0; i<registry_item.ready_listeners.length; i++) { +303 registry_item.ready_listeners[i](); +304 } +305 registry_item.ready_listeners = []; +306 } : +307 function(){ script_executed(registry_item); } +308 ), +309 // signal if script-preloading should be used or not +310 preload_this_script +311 ); +312 } +313 else { +314 registry_item = registry_items[0]; +315 if (registry_item.finished) { +316 finished_cb(); +317 } +318 else { +319 registry_item.finished_listeners.push(finished_cb); +320 } +321 } +322 } +323 +324 // creates a closure for each separate chain spawned from this $LAB instance, to keep state cleanly separated between chains +325 function create_chain() { +326 var chainedAPI, +327 chain_opts = merge_objs(global_defaults,{}), +328 chain = [], +329 exec_cursor = 0, +330 scripts_currently_loading = false, +331 group +332 ; +333 +334 // called when a script has finished preloading +335 function chain_script_ready(script_obj,exec_trigger) { +336 /*!START_DEBUG*/if (chain_opts[_Debug]) log_msg("script preload finished: "+script_obj.real_src);/*!END_DEBUG*/ +337 script_obj.ready = true; +338 script_obj.exec_trigger = exec_trigger; +339 advance_exec_cursor(); // will only check for 'ready' scripts to be executed +340 } +341 +342 // called when a script has finished executing +343 function chain_script_executed(script_obj,chain_group) { +344 /*!START_DEBUG*/if (chain_opts[_Debug]) log_msg("script execution finished: "+script_obj.real_src);/*!END_DEBUG*/ +345 script_obj.ready = script_obj.finished = true; +346 script_obj.exec_trigger = null; +347 // check if chain group is all finished +348 for (var i=0; i<chain_group.scripts.length; i++) { +349 if (!chain_group.scripts[i].finished) return; +350 } +351 // chain_group is all finished if we get this far +352 chain_group.finished = true; +353 advance_exec_cursor(); +354 } +355 +356 // main driver for executing each part of the chain +357 function advance_exec_cursor() { +358 while (exec_cursor < chain.length) { +359 if (is_func(chain[exec_cursor])) { +360 /*!START_DEBUG*/if (chain_opts[_Debug]) log_msg("$LAB.wait() executing: "+chain[exec_cursor]);/*!END_DEBUG*/ +361 try { chain[exec_cursor++](); } catch (err) { +362 /*!START_DEBUG*/if (chain_opts[_Debug]) log_error("$LAB.wait() error caught: ",err);/*!END_DEBUG*/ +363 } +364 continue; +365 } +366 else if (!chain[exec_cursor].finished) { +367 if (check_chain_group_scripts_ready(chain[exec_cursor])) continue; +368 break; +369 } +370 exec_cursor++; +371 } +372 // we've reached the end of the chain (so far) +373 if (exec_cursor == chain.length) { +374 scripts_currently_loading = false; +375 group = false; +376 } +377 } +378 +379 // setup next chain script group +380 function init_script_chain_group() { +381 if (!group || !group.scripts) { +382 chain.push(group = {scripts:[],finished:true}); +383 } +384 } +385 +386 // API for $LAB chains +387 chainedAPI = { +388 // start loading one or more scripts +389 script:function(){ +390 for (var i=0; i<arguments.length; i++) { +391 (function(script_obj,script_list){ +392 var splice_args; +393 +394 if (!is_array(script_obj)) { +395 script_list = [script_obj]; +396 } +397 for (var j=0; j<script_list.length; j++) { +398 init_script_chain_group(); +399 script_obj = script_list[j]; +400 +401 if (is_func(script_obj)) script_obj = script_obj(); +402 if (!script_obj) continue; +403 if (is_array(script_obj)) { +404 // set up an array of arguments to pass to splice() +405 splice_args = [].slice.call(script_obj); // first include the actual array elements we want to splice in +406 splice_args.unshift(j,1); // next, put the `index` and `howMany` parameters onto the beginning of the splice-arguments array +407 [].splice.apply(script_list,splice_args); // use the splice-arguments array as arguments for splice() +408 j--; // adjust `j` to account for the loop's subsequent `j++`, so that the next loop iteration uses the same `j` index value +409 continue; +410 } +411 if (typeof script_obj == "string") script_obj = {src:script_obj}; +412 script_obj = merge_objs(script_obj,{ +413 ready:false, +414 ready_cb:chain_script_ready, +415 finished:false, +416 finished_cb:chain_script_executed +417 }); +418 group.finished = false; +419 group.scripts.push(script_obj); +420 +421 do_script(chain_opts,script_obj,group,(can_use_preloading && scripts_currently_loading)); +422 scripts_currently_loading = true; +423 +424 if (chain_opts[_AlwaysPreserveOrder]) chainedAPI.wait(); +425 } +426 })(arguments[i],arguments[i]); +427 } +428 return chainedAPI; +429 }, +430 // force LABjs to pause in execution at this point in the chain, until the execution thus far finishes, before proceeding +431 wait:function(){ +432 if (arguments.length > 0) { +433 for (var i=0; i<arguments.length; i++) { +434 chain.push(arguments[i]); +435 } +436 group = chain[chain.length-1]; +437 } +438 else group = false; +439 +440 advance_exec_cursor(); +441 +442 return chainedAPI; +443 } +444 }; +445 +446 // the first chain link API (includes `setOptions` only this first time) +447 return { +448 script:chainedAPI.script, +449 wait:chainedAPI.wait, +450 setOptions:function(opts){ +451 merge_objs(opts,chain_opts); +452 return chainedAPI; +453 } +454 }; +455 } +456 +457 // API for each initial $LAB instance (before chaining starts) +458 instanceAPI = { +459 // main API functions +460 setGlobalDefaults:function(opts){ +461 merge_objs(opts,global_defaults); +462 return instanceAPI; +463 }, +464 setOptions:function(){ +465 return create_chain().setOptions.apply(null,arguments); +466 }, +467 script:function(){ +468 return create_chain().script.apply(null,arguments); +469 }, +470 wait:function(){ +471 return create_chain().wait.apply(null,arguments); +472 }, +473 +474 // built-in queuing for $LAB `script()` and `wait()` calls +475 // useful for building up a chain programmatically across various script locations, and simulating +476 // execution of the chain +477 queueScript:function(){ +478 queue[queue.length] = {type:"script", args:[].slice.call(arguments)}; +479 return instanceAPI; +480 }, +481 queueWait:function(){ +482 queue[queue.length] = {type:"wait", args:[].slice.call(arguments)}; +483 return instanceAPI; +484 }, +485 runQueue:function(){ +486 var $L = instanceAPI, len=queue.length, i=len, val; +487 for (;--i>=0;) { +488 val = queue.shift(); +489 $L = $L[val.type].apply(null,val.args); +490 } +491 return $L; +492 }, +493 +494 // rollback `[global].$LAB` to what it was before this file was loaded, the return this current instance of $LAB +495 noConflict:function(){ +496 global.$LAB = _$LAB; +497 return instanceAPI; +498 }, +499 +500 // create another clean instance of $LAB +501 sandbox:function(){ +502 return create_sandbox(); +503 } +504 }; +505 +506 return instanceAPI; +507 } +508 +509 // create the main instance of $LAB +510 global.$LAB = create_sandbox(); +511 +512 +513 /* The following "hack" was suggested by Andrea Giammarchi and adapted from: http://webreflection.blogspot.com/2009/11/195-chars-to-help-lazy-loading.html +514 NOTE: this hack only operates in FF and then only in versions where document.readyState is not present (FF < 3.6?). +515 +516 The hack essentially "patches" the **page** that LABjs is loaded onto so that it has a proper conforming document.readyState, so that if a script which does +517 proper and safe dom-ready detection is loaded onto a page, after dom-ready has passed, it will still be able to detect this state, by inspecting the now hacked +518 document.readyState property. The loaded script in question can then immediately trigger any queued code executions that were waiting for the DOM to be ready. +519 For instance, jQuery 1.4+ has been patched to take advantage of document.readyState, which is enabled by this hack. But 1.3.2 and before are **not** safe or +520 fixed by this hack, and should therefore **not** be lazy-loaded by script loader tools such as LABjs. +521 */ +522 (function(addEvent,domLoaded,handler){ +523 if (document.readyState == null && document[addEvent]){ +524 document.readyState = "loading"; +525 document[addEvent](domLoaded,handler = function(){ +526 document.removeEventListener(domLoaded,handler,false); +527 document.readyState = "complete"; +528 },false); +529 } +530 })("addEventListener","DOMContentLoaded"); +531 +532 })(this);/* +533 mustache.js — Logic-less templates in JavaScript +534 +535 See http://mustache.github.com/ for more info. +536 */ +537 +538 var Mustache = function() { +539 var Renderer = function() {}; +540 +541 Renderer.prototype = { +542 otag: "{{", +543 ctag: "}}", +544 pragmas: {}, +545 buffer: [], +546 pragmas_implemented: { +547 "IMPLICIT-ITERATOR": true +548 }, +549 context: {}, +550 +551 render: function(template, context, partials, in_recursion) { +552 // reset buffer & set context +553 if(!in_recursion) { +554 this.context = context; +555 this.buffer = []; // TODO: make this non-lazy +556 } +557 +558 // fail fast +559 if(!this.includes("", template)) { +560 if(in_recursion) { +561 return template; +562 } else { +563 this.send(template); +564 return; +565 } +566 } +567 +568 template = this.render_pragmas(template); +569 var html = this.render_section(template, context, partials); +570 if(in_recursion) { +571 return this.render_tags(html, context, partials, in_recursion); +572 } +573 +574 this.render_tags(html, context, partials, in_recursion); +575 }, +576 +577 /* +578 Sends parsed lines +579 */ +580 send: function(line) { +581 if(line !== "") { +582 this.buffer.push(line); +583 } +584 }, +585 +586 /* +587 Looks for %PRAGMAS +588 */ +589 render_pragmas: function(template) { +590 // no pragmas +591 if(!this.includes("%", template)) { +592 return template; +593 } +594 +595 var that = this; +596 var regex = new RegExp(this.otag + "%([\\w-]+) ?([\\w]+=[\\w]+)?" + +597 this.ctag, "g"); +598 return template.replace(regex, function(match, pragma, options) { +599 if(!that.pragmas_implemented[pragma]) { +600 throw({message: +601 "This implementation of mustache doesn't understand the '" + +602 pragma + "' pragma"}); +603 } +604 that.pragmas[pragma] = {}; +605 if(options) { +606 var opts = options.split("="); +607 that.pragmas[pragma][opts[0]] = opts[1]; +608 } +609 return ""; +610 // ignore unknown pragmas silently +611 }); +612 }, +613 +614 /* +615 Tries to find a partial in the curent scope and render it +616 */ +617 render_partial: function(name, context, partials) { +618 name = this.trim(name); +619 if(!partials || partials[name] === undefined) { +620 throw({message: "unknown_partial '" + name + "'"}); +621 } +622 if(typeof(context[name]) != "object") { +623 return this.render(partials[name], context, partials, true); +624 } +625 return this.render(partials[name], context[name], partials, true); +626 }, +627 +628 /* +629 Renders inverted (^) and normal (#) sections +630 */ +631 render_section: function(template, context, partials) { +632 if(!this.includes("#", template) && !this.includes("^", template)) { +633 return template; +634 } +635 +636 var that = this; +637 // CSW - Added "+?" so it finds the tighest bound, not the widest +638 var regex = new RegExp(this.otag + "(\\^|\\#)\\s*(.+)\\s*" + this.ctag + +639 "\n*([\\s\\S]+?)" + this.otag + "\\/\\s*\\2\\s*" + this.ctag + +640 "\\s*", "mg"); +641 +642 // for each {{#foo}}{{/foo}} section do... +643 return template.replace(regex, function(match, type, name, content) { +644 var value = that.find(name, context); +645 if(type == "^") { // inverted section +646 if(!value || that.is_array(value) && value.length === 0) { +647 // false or empty list, render it +648 return that.render(content, context, partials, true); +649 } else { +650 return ""; +651 } +652 } else if(type == "#") { // normal section +653 if(that.is_array(value)) { // Enumerable, Let's loop! +654 return that.map(value, function(row) { +655 return that.render(content, that.create_context(row), +656 partials, true); +657 }).join(""); +658 } else if(that.is_object(value)) { // Object, Use it as subcontext! +659 return that.render(content, that.create_context(value), +660 partials, true); +661 } else if(typeof value === "function") { +662 // higher order section +663 return value.call(context, content, function(text) { +664 return that.render(text, context, partials, true); +665 }); +666 } else if(value) { // boolean section +667 return that.render(content, context, partials, true); +668 } else { +669 return ""; +670 } +671 } +672 }); +673 }, +674 +675 /* +676 Replace {{foo}} and friends with values from our view +677 */ +678 render_tags: function(template, context, partials, in_recursion) { +679 // tit for tat +680 var that = this; +681 +682 var new_regex = function() { +683 return new RegExp(that.otag + "(=|!|>|\\{|%)?([^\\/#\\^]+?)\\1?" + +684 that.ctag + "+", "g"); +685 }; +686 +687 var regex = new_regex(); +688 var tag_replace_callback = function(match, operator, name) { +689 switch(operator) { +690 case "!": // ignore comments +691 return ""; +692 case "=": // set new delimiters, rebuild the replace regexp +693 that.set_delimiters(name); +694 regex = new_regex(); +695 return ""; +696 case ">": // render partial +697 return that.render_partial(name, context, partials); +698 case "{": // the triple mustache is unescaped +699 return that.find(name, context); +700 default: // escape the value +701 return that.escape(that.find(name, context)); +702 } +703 }; +704 var lines = template.split("\n"); +705 for(var i = 0; i < lines.length; i++) { +706 lines[i] = lines[i].replace(regex, tag_replace_callback, this); +707 if(!in_recursion) { +708 this.send(lines[i]); +709 } +710 } +711 +712 if(in_recursion) { +713 return lines.join("\n"); +714 } +715 }, +716 +717 set_delimiters: function(delimiters) { +718 var dels = delimiters.split(" "); +719 this.otag = this.escape_regex(dels[0]); +720 this.ctag = this.escape_regex(dels[1]); +721 }, +722 +723 escape_regex: function(text) { +724 // thank you Simon Willison +725 if(!arguments.callee.sRE) { +726 var specials = [ +727 '/', '.', '*', '+', '?', '|', +728 '(', ')', '[', ']', '{', '}', '\\' +729 ]; +730 arguments.callee.sRE = new RegExp( +731 '(\\' + specials.join('|\\') + ')', 'g' +732 ); +733 } +734 return text.replace(arguments.callee.sRE, '\\$1'); +735 }, +736 +737 /* +738 find `name` in current `context`. That is find me a value +739 from the view object +740 */ +741 find: function(name, context) { +742 name = this.trim(name); +743 +744 // Checks whether a value is thruthy or false or 0 +745 function is_kinda_truthy(bool) { +746 return bool === false || bool === 0 || bool; +747 } +748 +749 var value; +750 if(is_kinda_truthy(context[name])) { +751 value = context[name]; +752 } else if(is_kinda_truthy(this.context[name])) { +753 value = this.context[name]; +754 } +755 +756 if(typeof value === "function") { +757 return value.apply(context); +758 } +759 if(value !== undefined) { +760 return value; +761 } +762 // silently ignore unkown variables +763 return ""; +764 }, +765 +766 // Utility methods +767 +768 /* includes tag */ +769 includes: function(needle, haystack) { +770 return haystack.indexOf(this.otag + needle) != -1; +771 }, +772 +773 /* +774 Does away with nasty characters +775 */ +776 escape: function(s) { +777 s = String(s === null ? "" : s); +778 return s.replace(/&(?!\w+;)|["'<>\\]/g, function(s) { +779 switch(s) { +780 case "&": return "&"; +781 case "\\": return "\\\\"; +782 case '"': return '"'; +783 case "'": return '''; +784 case "<": return "<"; +785 case ">": return ">"; +786 default: return s; +787 } +788 }); +789 }, +790 +791 // by @langalex, support for arrays of strings +792 create_context: function(_context) { +793 if(this.is_object(_context)) { +794 return _context; +795 } else { +796 var iterator = "."; +797 if(this.pragmas["IMPLICIT-ITERATOR"]) { +798 iterator = this.pragmas["IMPLICIT-ITERATOR"].iterator; +799 } +800 var ctx = {}; +801 ctx[iterator] = _context; +802 return ctx; +803 } +804 }, +805 +806 is_object: function(a) { +807 return a && typeof a == "object"; +808 }, +809 +810 is_array: function(a) { +811 return Object.prototype.toString.call(a) === '[object Array]'; +812 }, +813 +814 /* +815 Gets rid of leading and trailing whitespace +816 */ +817 trim: function(s) { +818 return s.replace(/^\s*|\s*$/g, ""); +819 }, +820 +821 /* +822 Why, why, why? Because IE. Cry, cry cry. +823 */ +824 map: function(array, fn) { +825 if (typeof array.map == "function") { +826 return array.map(fn); +827 } else { +828 var r = []; +829 var l = array.length; +830 for(var i = 0; i < l; i++) { +831 r.push(fn(array[i])); +832 } +833 return r; +834 } +835 } +836 }; +837 +838 return({ +839 name: "mustache.js", +840 version: "0.3.1-dev", +841 +842 /* +843 Turns a template and view into HTML +844 */ +845 to_html: function(template, view, partials, send_fun) { +846 var renderer = new Renderer(); +847 if(send_fun) { +848 renderer.send = send_fun; +849 } +850 renderer.render(template, view, partials); +851 if(!send_fun) { +852 return renderer.buffer.join("\n"); +853 } +854 } +855 }); +856 }(); +857 // Underscore.js 1.2.3 +858 // (c) 2009-2011 Jeremy Ashkenas, DocumentCloud Inc. +859 // Underscore is freely distributable under the MIT license. +860 // Portions of Underscore are inspired or borrowed from Prototype, +861 // Oliver Steele's Functional, and John Resig's Micro-Templating. +862 // For all details and documentation: +863 // http://documentcloud.github.com/underscore +864 (function(){function r(a,c,d){if(a===c)return a!==0||1/a==1/c;if(a==null||c==null)return a===c;if(a._chain)a=a._wrapped;if(c._chain)c=c._wrapped;if(a.isEqual&&b.isFunction(a.isEqual))return a.isEqual(c);if(c.isEqual&&b.isFunction(c.isEqual))return c.isEqual(a);var e=l.call(a);if(e!=l.call(c))return false;switch(e){case "[object String]":return a==String(c);case "[object Number]":return a!=+a?c!=+c:a==0?1/a==1/c:a==+c;case "[object Date]":case "[object Boolean]":return+a==+c;case "[object RegExp]":return a.source== +865 c.source&&a.global==c.global&&a.multiline==c.multiline&&a.ignoreCase==c.ignoreCase}if(typeof a!="object"||typeof c!="object")return false;for(var f=d.length;f--;)if(d[f]==a)return true;d.push(a);var f=0,g=true;if(e=="[object Array]"){if(f=a.length,g=f==c.length)for(;f--;)if(!(g=f in a==f in c&&r(a[f],c[f],d)))break}else{if("constructor"in a!="constructor"in c||a.constructor!=c.constructor)return false;for(var h in a)if(m.call(a,h)&&(f++,!(g=m.call(c,h)&&r(a[h],c[h],d))))break;if(g){for(h in c)if(m.call(c, +866 h)&&!f--)break;g=!f}}d.pop();return g}var s=this,F=s._,o={},k=Array.prototype,p=Object.prototype,i=k.slice,G=k.concat,H=k.unshift,l=p.toString,m=p.hasOwnProperty,v=k.forEach,w=k.map,x=k.reduce,y=k.reduceRight,z=k.filter,A=k.every,B=k.some,q=k.indexOf,C=k.lastIndexOf,p=Array.isArray,I=Object.keys,t=Function.prototype.bind,b=function(a){return new n(a)};if(typeof exports!=="undefined"){if(typeof module!=="undefined"&&module.exports)exports=module.exports=b;exports._=b}else typeof define==="function"&& +867 define.amd?define("underscore",function(){return b}):s._=b;b.VERSION="1.2.3";var j=b.each=b.forEach=function(a,c,b){if(a!=null)if(v&&a.forEach===v)a.forEach(c,b);else if(a.length===+a.length)for(var e=0,f=a.length;e<f;e++){if(e in a&&c.call(b,a[e],e,a)===o)break}else for(e in a)if(m.call(a,e)&&c.call(b,a[e],e,a)===o)break};b.map=function(a,c,b){var e=[];if(a==null)return e;if(w&&a.map===w)return a.map(c,b);j(a,function(a,g,h){e[e.length]=c.call(b,a,g,h)});return e};b.reduce=b.foldl=b.inject=function(a, +868 c,d,e){var f=arguments.length>2;a==null&&(a=[]);if(x&&a.reduce===x)return e&&(c=b.bind(c,e)),f?a.reduce(c,d):a.reduce(c);j(a,function(a,b,i){f?d=c.call(e,d,a,b,i):(d=a,f=true)});if(!f)throw new TypeError("Reduce of empty array with no initial value");return d};b.reduceRight=b.foldr=function(a,c,d,e){var f=arguments.length>2;a==null&&(a=[]);if(y&&a.reduceRight===y)return e&&(c=b.bind(c,e)),f?a.reduceRight(c,d):a.reduceRight(c);var g=b.toArray(a).reverse();e&&!f&&(c=b.bind(c,e));return f?b.reduce(g, +869 c,d,e):b.reduce(g,c)};b.find=b.detect=function(a,c,b){var e;D(a,function(a,g,h){if(c.call(b,a,g,h))return e=a,true});return e};b.filter=b.select=function(a,c,b){var e=[];if(a==null)return e;if(z&&a.filter===z)return a.filter(c,b);j(a,function(a,g,h){c.call(b,a,g,h)&&(e[e.length]=a)});return e};b.reject=function(a,c,b){var e=[];if(a==null)return e;j(a,function(a,g,h){c.call(b,a,g,h)||(e[e.length]=a)});return e};b.every=b.all=function(a,c,b){var e=true;if(a==null)return e;if(A&&a.every===A)return a.every(c, +870 b);j(a,function(a,g,h){if(!(e=e&&c.call(b,a,g,h)))return o});return e};var D=b.some=b.any=function(a,c,d){c||(c=b.identity);var e=false;if(a==null)return e;if(B&&a.some===B)return a.some(c,d);j(a,function(a,b,h){if(e||(e=c.call(d,a,b,h)))return o});return!!e};b.include=b.contains=function(a,c){var b=false;if(a==null)return b;return q&&a.indexOf===q?a.indexOf(c)!=-1:b=D(a,function(a){return a===c})};b.invoke=function(a,c){var d=i.call(arguments,2);return b.map(a,function(a){return(c.call?c||a:a[c]).apply(a, +871 d)})};b.pluck=function(a,c){return b.map(a,function(a){return a[c]})};b.max=function(a,c,d){if(!c&&b.isArray(a))return Math.max.apply(Math,a);if(!c&&b.isEmpty(a))return-Infinity;var e={computed:-Infinity};j(a,function(a,b,h){b=c?c.call(d,a,b,h):a;b>=e.computed&&(e={value:a,computed:b})});return e.value};b.min=function(a,c,d){if(!c&&b.isArray(a))return Math.min.apply(Math,a);if(!c&&b.isEmpty(a))return Infinity;var e={computed:Infinity};j(a,function(a,b,h){b=c?c.call(d,a,b,h):a;b<e.computed&&(e={value:a, +872 computed:b})});return e.value};b.shuffle=function(a){var c=[],b;j(a,function(a,f){f==0?c[0]=a:(b=Math.floor(Math.random()*(f+1)),c[f]=c[b],c[b]=a)});return c};b.sortBy=function(a,c,d){return b.pluck(b.map(a,function(a,b,g){return{value:a,criteria:c.call(d,a,b,g)}}).sort(function(a,c){var b=a.criteria,d=c.criteria;return b<d?-1:b>d?1:0}),"value")};b.groupBy=function(a,c){var d={},e=b.isFunction(c)?c:function(a){return a[c]};j(a,function(a,b){var c=e(a,b);(d[c]||(d[c]=[])).push(a)});return d};b.sortedIndex= +873 function(a,c,d){d||(d=b.identity);for(var e=0,f=a.length;e<f;){var g=e+f>>1;d(a[g])<d(c)?e=g+1:f=g}return e};b.toArray=function(a){return!a?[]:a.toArray?a.toArray():b.isArray(a)?i.call(a):b.isArguments(a)?i.call(a):b.values(a)};b.size=function(a){return b.toArray(a).length};b.first=b.head=function(a,b,d){return b!=null&&!d?i.call(a,0,b):a[0]};b.initial=function(a,b,d){return i.call(a,0,a.length-(b==null||d?1:b))};b.last=function(a,b,d){return b!=null&&!d?i.call(a,Math.max(a.length-b,0)):a[a.length- +874 1]};b.rest=b.tail=function(a,b,d){return i.call(a,b==null||d?1:b)};b.compact=function(a){return b.filter(a,function(a){return!!a})};b.flatten=function(a,c){return b.reduce(a,function(a,e){if(b.isArray(e))return a.concat(c?e:b.flatten(e));a[a.length]=e;return a},[])};b.without=function(a){return b.difference(a,i.call(arguments,1))};b.uniq=b.unique=function(a,c,d){var d=d?b.map(a,d):a,e=[];b.reduce(d,function(d,g,h){if(0==h||(c===true?b.last(d)!=g:!b.include(d,g)))d[d.length]=g,e[e.length]=a[h];return d}, +875 []);return e};b.union=function(){return b.uniq(b.flatten(arguments,true))};b.intersection=b.intersect=function(a){var c=i.call(arguments,1);return b.filter(b.uniq(a),function(a){return b.every(c,function(c){return b.indexOf(c,a)>=0})})};b.difference=function(a){var c=b.flatten(i.call(arguments,1));return b.filter(a,function(a){return!b.include(c,a)})};b.zip=function(){for(var a=i.call(arguments),c=b.max(b.pluck(a,"length")),d=Array(c),e=0;e<c;e++)d[e]=b.pluck(a,""+e);return d};b.indexOf=function(a, +876 c,d){if(a==null)return-1;var e;if(d)return d=b.sortedIndex(a,c),a[d]===c?d:-1;if(q&&a.indexOf===q)return a.indexOf(c);for(d=0,e=a.length;d<e;d++)if(d in a&&a[d]===c)return d;return-1};b.lastIndexOf=function(a,b){if(a==null)return-1;if(C&&a.lastIndexOf===C)return a.lastIndexOf(b);for(var d=a.length;d--;)if(d in a&&a[d]===b)return d;return-1};b.range=function(a,b,d){arguments.length<=1&&(b=a||0,a=0);for(var d=arguments[2]||1,e=Math.max(Math.ceil((b-a)/d),0),f=0,g=Array(e);f<e;)g[f++]=a,a+=d;return g}; +877 var E=function(){};b.bind=function(a,c){var d,e;if(a.bind===t&&t)return t.apply(a,i.call(arguments,1));if(!b.isFunction(a))throw new TypeError;e=i.call(arguments,2);return d=function(){if(!(this instanceof d))return a.apply(c,e.concat(i.call(arguments)));E.prototype=a.prototype;var b=new E,g=a.apply(b,e.concat(i.call(arguments)));return Object(g)===g?g:b}};b.bindAll=function(a){var c=i.call(arguments,1);c.length==0&&(c=b.functions(a));j(c,function(c){a[c]=b.bind(a[c],a)});return a};b.memoize=function(a, +878 c){var d={};c||(c=b.identity);return function(){var b=c.apply(this,arguments);return m.call(d,b)?d[b]:d[b]=a.apply(this,arguments)}};b.delay=function(a,b){var d=i.call(arguments,2);return setTimeout(function(){return a.apply(a,d)},b)};b.defer=function(a){return b.delay.apply(b,[a,1].concat(i.call(arguments,1)))};b.throttle=function(a,c){var d,e,f,g,h,i=b.debounce(function(){h=g=false},c);return function(){d=this;e=arguments;var b;f||(f=setTimeout(function(){f=null;h&&a.apply(d,e);i()},c));g?h=true: +879 a.apply(d,e);i();g=true}};b.debounce=function(a,b){var d;return function(){var e=this,f=arguments;clearTimeout(d);d=setTimeout(function(){d=null;a.apply(e,f)},b)}};b.once=function(a){var b=false,d;return function(){if(b)return d;b=true;return d=a.apply(this,arguments)}};b.wrap=function(a,b){return function(){var d=G.apply([a],arguments);return b.apply(this,d)}};b.compose=function(){var a=arguments;return function(){for(var b=arguments,d=a.length-1;d>=0;d--)b=[a[d].apply(this,b)];return b[0]}};b.after= +880 function(a,b){return a<=0?b():function(){if(--a<1)return b.apply(this,arguments)}};b.keys=I||function(a){if(a!==Object(a))throw new TypeError("Invalid object");var b=[],d;for(d in a)m.call(a,d)&&(b[b.length]=d);return b};b.values=function(a){return b.map(a,b.identity)};b.functions=b.methods=function(a){var c=[],d;for(d in a)b.isFunction(a[d])&&c.push(d);return c.sort()};b.extend=function(a){j(i.call(arguments,1),function(b){for(var d in b)b[d]!==void 0&&(a[d]=b[d])});return a};b.defaults=function(a){j(i.call(arguments, +881 1),function(b){for(var d in b)a[d]==null&&(a[d]=b[d])});return a};b.clone=function(a){return!b.isObject(a)?a:b.isArray(a)?a.slice():b.extend({},a)};b.tap=function(a,b){b(a);return a};b.isEqual=function(a,b){return r(a,b,[])};b.isEmpty=function(a){if(b.isArray(a)||b.isString(a))return a.length===0;for(var c in a)if(m.call(a,c))return false;return true};b.isElement=function(a){return!!(a&&a.nodeType==1)};b.isArray=p||function(a){return l.call(a)=="[object Array]"};b.isObject=function(a){return a=== +882 Object(a)};b.isArguments=function(a){return l.call(a)=="[object Arguments]"};if(!b.isArguments(arguments))b.isArguments=function(a){return!(!a||!m.call(a,"callee"))};b.isFunction=function(a){return l.call(a)=="[object Function]"};b.isString=function(a){return l.call(a)=="[object String]"};b.isNumber=function(a){return l.call(a)=="[object Number]"};b.isNaN=function(a){return a!==a};b.isBoolean=function(a){return a===true||a===false||l.call(a)=="[object Boolean]"};b.isDate=function(a){return l.call(a)== +883 "[object Date]"};b.isRegExp=function(a){return l.call(a)=="[object RegExp]"};b.isNull=function(a){return a===null};b.isUndefined=function(a){return a===void 0};b.noConflict=function(){s._=F;return this};b.identity=function(a){return a};b.times=function(a,b,d){for(var e=0;e<a;e++)b.call(d,e)};b.escape=function(a){return(""+a).replace(/&/g,"&").replace(/</g,"<").replace(/>/g,">").replace(/"/g,""").replace(/'/g,"'").replace(/\//g,"/")};b.mixin=function(a){j(b.functions(a),function(c){J(c, +884 b[c]=a[c])})};var K=0;b.uniqueId=function(a){var b=K++;return a?a+b:b};b.templateSettings={evaluate:/<%([\s\S]+?)%>/g,interpolate:/<%=([\s\S]+?)%>/g,escape:/<%-([\s\S]+?)%>/g};b.template=function(a,c){var d=b.templateSettings,d="var __p=[],print=function(){__p.push.apply(__p,arguments);};with(obj||{}){__p.push('"+a.replace(/\\/g,"\\\\").replace(/'/g,"\\'").replace(d.escape,function(a,b){return"',_.escape("+b.replace(/\\'/g,"'")+"),'"}).replace(d.interpolate,function(a,b){return"',"+b.replace(/\\'/g, +885 "'")+",'"}).replace(d.evaluate||null,function(a,b){return"');"+b.replace(/\\'/g,"'").replace(/[\r\n\t]/g," ")+";__p.push('"}).replace(/\r/g,"\\r").replace(/\n/g,"\\n").replace(/\t/g,"\\t")+"');}return __p.join('');",e=new Function("obj","_",d);return c?e(c,b):function(a){return e.call(this,a,b)}};var n=function(a){this._wrapped=a};b.prototype=n.prototype;var u=function(a,c){return c?b(a).chain():a},J=function(a,c){n.prototype[a]=function(){var a=i.call(arguments);H.call(a,this._wrapped);return u(c.apply(b, +886 a),this._chain)}};b.mixin(b);j("pop,push,reverse,shift,sort,splice,unshift".split(","),function(a){var b=k[a];n.prototype[a]=function(){b.apply(this._wrapped,arguments);return u(this._wrapped,this._chain)}});j(["concat","join","slice"],function(a){var b=k[a];n.prototype[a]=function(){return u(b.apply(this._wrapped,arguments),this._chain)}});n.prototype.chain=function(){this._chain=true;return this};n.prototype.value=function(){return this._wrapped}}).call(this); +887 /* main file */ +888 +889 if ( window.IriSP === undefined && window.__IriSP === undefined ) { +890 var IriSP = {}; +891 var __IriSP = IriSP; /* for backward compatibility */ +892 } +893 +894 IriSP.loadLibs = function( libs, config, metadata_url, callback ) { +895 // Localize jQuery variable +896 IriSP.jQuery = null; +897 var $L = $LAB.script(libs.jQuery).script(libs.swfObject) +898 .script(libs.jQueryUI) +899 +900 if (config.player.type === "jwplayer") { +901 // load our popcorn.js lookalike +902 $L = $L.script(libs.jwplayer); +903 } else { +904 // load the real popcorn +905 $L = $L.script(libs.popcorn).script(libs["popcorn.code"]); +906 if (config.player.type === "youtube") { +907 $L = $L.script(libs["popcorn.youtube"]); +908 } +909 if (config.player.type === "vimeo") +910 $L = $L.script(libs["popcorn.vimeo"]); +911 +912 /* do nothing for html5 */ +913 } +914 +915 /* widget specific requirements */ +916 for (var idx in config.gui.widgets) { +917 if (config.gui.widgets[idx].type === "PolemicWidget") { +918 $L.script(libs.raphael); +919 } +920 } +921 +922 // same for modules +923 /* +924 for (var idx in config.modules) { +925 if (config.modules[idx].type === "PolemicWidget") +926 $L.script(libs.raphaelJs); +927 } +928 */ +929 +930 $L.wait(function() { +931 IriSP.jQuery = window.jQuery.noConflict( true ); +932 IriSP._ = window._.noConflict(); +933 IriSP.underscore = IriSP._; +934 +935 var css_link_jquery = IriSP.jQuery( "<link>", { +936 rel: "stylesheet", +937 type: "text/css", +938 href: libs.cssjQueryUI, +939 'class': "dynamic_css" +940 } ); +941 var css_link_custom = IriSP.jQuery( "<link>", { +942 rel: "stylesheet", +943 type: "text/css", +944 href: config.gui.css, +945 'class': "dynamic_css" +946 } ); +947 +948 css_link_jquery.appendTo('head'); +949 css_link_custom.appendTo('head'); +950 +951 IriSP.setupDataLoader(); +952 IriSP.__dataloader.get(metadata_url, +953 function(data) { +954 /* save the data so that we could re-use it to +955 configure the video +956 */ +957 IriSP.__jsonMetadata = data; +958 callback.call(window) }); +959 }); +960 }; +961 IriSP.annotation_template = "{{! template for an annotation displayed in a segmentWidget }}<div title='{{divTitle}}' id='{{id}}' class='Ldt-iri-chapter' style='left: {{startPixel}}px; width: {{pxWidth}}px; background-color:#{{hexa_color}};' ></div>"; +962 IriSP.annotationWidget_template = "{{! template for the annotation widget }}<div class='Ldt-AnnotationsWidget'> <!-- ugly div because we want to have a double border --> <div class='Ldt-Annotation-DoubleBorder'> <div class='Ldt-AnnotationContent'> <div class='Ldt-AnnotationShareIcons'> <a class='Ldt-fbShare' href=''><img src='{{img_dir}}/facebook.png' alt='share on facebook'></img></a> <a class='Ldt-TwShare' href=''><img src='{{img_dir}}/twitter.png' alt='share on twitter'></img></a> <a class='Ldt-GplusShare' href=''><img src='{{img_dir}}/google.png' alt='share on google+'></img></a> </div> <div class='Ldt-SaTitle'></div> <div class='Ldt-SaDescription'></div> </div> </div></div>"; +963 IriSP.annotation_loading_template = "{{! template shown while the annotation widget is loading }}<div id='Ldt-load-container'><div id='Ldt-loader'> </div> Chargement... </div>"; +964 IriSP.arrowWidget_template = "<div class='Ldt-arrowWidget'></div>"; +965 IriSP.overlay_marker_template = "{{! the template for the small bars which is z-indexed over our segment widget }}<div class='Ldt-SegmentPositionMarker' style='background-color: #F7268E;'></div>"; +966 IriSP.player_template = "{{! template for the radio player }}<div class='Ldt-controler demo'> <div class='Ldt-LeftPlayerControls'> <div class='Ldt-button Ldt-CtrlPlay'></div> <div class='Ldt-button Ldt-CtrlAnnotate'></div> <div class='Ldt-button Ldt-CtrlSearch'></div> </div> <div class='Ldt-RightPlayerControls'> <div class='Ldt-Time'> <div class='Ldt-ElapsedTime'></div> <div class='Ldt-TimeSeparator'>/</div> <div class='Ldt-TotalTime'></div> </div> <div class='Ldt-button Ldt-CtrlSound'></div> </div></div>"; +967 IriSP.search_template = "{{! template for the search container }}<div class='LdtSearchContainer' style='margin-left: {{margin_left}}; position: absolute; margin-top: -60px;'> <div class='LdtSearch' style='display: none; background-color: #EEE; width: 165px; boder: 1px; border-color: #CFCFCF; position: absolute; text-align: center;'> <input class='LdtSearchInput' style='margin-top: 2px; margin-bottom: 2px;' /> </div></div><div class='cleaner'></div>"; +968 IriSP.share_template = "{{! social network sharing template }}<a onclick='__IriSP.MyApiPlayer.share(\'delicious\');' title='partager avec delicious'><span class='share shareDelicious'> </span></a> <a onclick='__IriSP.MyApiPlayer.share(\'facebook\');' title='partager avec facebook'> <span class='share shareFacebook'> </span></a><a onclick='__IriSP.MyApiPlayer.share(\'twitter\');' title='partager avec twitter'> <span class='share shareTwitter'> </span></a><a onclick='__IriSP.MyApiPlayer.share(\'myspace\');' title='partager avec Myspace'> <span class='share shareMySpace'> </span></a>"; +969 IriSP.sliderWidget_template = "{{! template for the slider widget - it's composed of two divs we one overlayed on top of the other }}<div class='Ldt-sliderBackground'></div><div class='Ldt-sliderForeground'></div><div class='Ldt-sliderPositionMarker'></div>"; +970 IriSP.tooltip_template = "{{! template used by the jquery ui tooltip }}<div class='Ldt-tooltip'> <div class='title'>{{title}}</div> <div class='time'>{{begin}} : {{end}} </div> <div class='description'>{{description}}</div></div>"; +971 IriSP.tooltipWidget_template = "{{! template for the tooltip widget }}<div class='tip'> <div class='tipcolor' style='height:10px;width:10px'></div> <div class='tiptext'></div>"; +972 IriSP.tweetWidget_template = "{{! template for the tweet widget }}<div class='Ldt-tweetWidget'> <div class='Ldt-tweet-DoubleBorder'> <img src='{{img_dir}}/minimize.png' class='Ldt-tweetWidgetKeepOpen' alt='dont minimize automatically'></img> <img src='{{img_dir}}/minimize.png' class='Ldt-tweetWidgetMinimize' alt='minimize window'></img> <div class='Ldt-tweetAvatar'></div> <img src='{{img_dir}}/profile_arrow.png' class='Ldt-tweetAvatar-profileArrow'></img> <div class='Ldt-tweetContents'></div> <a href='' target='_blank' class='Ldt-Retweet'><div class='Ldt-RetweetIcon'></div> - Retweet </a> <a href='' target='_blank' class='Ldt-TweetReply'><div class='Ldt-TweetReplyIcon'></div> - Reply</a> </div></div>";/* wrapper that simulates popcorn.js because +973 popcorn is a bit unstable at the time */ +974 +975 IriSP.PopcornReplacement = { +976 msgPump : {} /* used by jquery to receive and send messages */ +977 }; +978 +979 IriSP.PopcornReplacement.media = { +980 "paused": true, +981 "muted": false +982 }; +983 +984 IriSP.PopcornReplacement.listen = function(msg, callback) { +985 // IriSP.jQuery(IriSP.PopcornReplacement.msgPump).bind(msg, function(event, rest) { callback(rest); }); +986 if (!IriSP.PopcornReplacement.msgPump.hasOwnProperty(msg)) +987 IriSP.PopcornReplacement.msgPump[msg] = []; +988 +989 IriSP.PopcornReplacement.msgPump[msg].push(callback); +990 }; +991 +992 IriSP.PopcornReplacement.trigger = function(msg, params) { +993 // IriSP.jQuery(IriSP.PopcornReplacement.msgPump).trigger(msg, params); +994 +995 if (!IriSP.PopcornReplacement.msgPump.hasOwnProperty(msg)) +996 return; +997 +998 var d = IriSP.PopcornReplacement.msgPump[msg]; +999 for(var entry in d) { +1000 d[entry].call(window, params); +1001 } +1002 +1003 }; +1004 +1005 IriSP.PopcornReplacement.guid = function(prefix) { +1006 var str = 'xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g, function(c) { +1007 var r = Math.random()*16|0, v = c == 'x' ? r : (r&0x3|0x8); +1008 return v.toString(16); +1009 }); +1010 +1011 return prefix + str; +1012 }; +1013 +1014 IriSP.PopcornReplacement.__initApi = function() { +1015 IriSP.PopcornReplacement.trigger("loadedmetadata"); // we've done more than loading metadata of course, +1016 // but popcorn doesn't need to know more. +1017 IriSP.PopcornReplacement.media.muted = jwplayer(IriSP.PopcornReplacement._container).getMute(); +1018 }; +1019 +1020 IriSP.PopcornReplacement.jwplayer = function(container, options) { +1021 IriSP.PopcornReplacement._container = container.slice(1); //eschew the '#' +1022 options.events = { +1023 onReady: IriSP.PopcornReplacement.__initApi, +1024 onTime: IriSP.PopcornReplacement.__timeHandler, +1025 onPlay: IriSP.PopcornReplacement.__playHandler, +1026 onPause: IriSP.PopcornReplacement.__pauseHandler, +1027 onSeek: IriSP.PopcornReplacement.__seekHandler +1028 } +1029 +1030 jwplayer(IriSP.PopcornReplacement._container).setup(options); +1031 IriSP.PopcornReplacement.media.duration = options.duration; +1032 return IriSP.PopcornReplacement; +1033 }; +1034 +1035 IriSP.PopcornReplacement.currentTime = function(time) { +1036 if (typeof(time) === "undefined") { +1037 return jwplayer(IriSP.PopcornReplacement._container).getPosition(); +1038 } else { +1039 var currentTime = +time; +1040 jwplayer( IriSP.PopcornReplacement._container ).seek( currentTime ); +1041 IriSP.PopcornReplacement.trigger("seeked"); +1042 return jwplayer(IriSP.PopcornReplacement._container).getPosition(); +1043 } +1044 }; +1045 +1046 IriSP.PopcornReplacement.play = function() { +1047 IriSP.PopcornReplacement.media.paused = false; +1048 IriSP.PopcornReplacement.trigger("play"); +1049 // IriSP.PopcornReplacement.trigger("playing"); +1050 jwplayer( IriSP.PopcornReplacement._container ).play(); +1051 }; +1052 +1053 IriSP.PopcornReplacement.pause = function() { +1054 if ( !IriSP.PopcornReplacement.media.paused ) { +1055 IriSP.PopcornReplacement.media.paused = true; +1056 IriSP.PopcornReplacement.trigger( "pause" ); +1057 jwplayer( IriSP.PopcornReplacement._container ).pause(); +1058 } +1059 }; +1060 +1061 IriSP.PopcornReplacement.muted = function(val) { +1062 if (typeof(val) !== "undefined") { +1063 +1064 if (jwplayer(IriSP.PopcornReplacement._container).getMute() !== val) { +1065 if (val) { +1066 jwplayer(IriSP.PopcornReplacement._container).setMute(true); +1067 IriSP.PopcornReplacement.media.muted = true; +1068 } else { +1069 jwplayer( IriSP.PopcornReplacement._container ).setMute(false); +1070 IriSP.PopcornReplacement.media.muted = false; +1071 } +1072 +1073 IriSP.PopcornReplacement.trigger( "volumechange" ); +1074 } +1075 +1076 return jwplayer( IriSP.PopcornReplacement._container ).getMute(); +1077 } else { +1078 return jwplayer( IriSP.PopcornReplacement._container ).getMute(); +1079 } +1080 }; +1081 +1082 IriSP.PopcornReplacement.mute = IriSP.PopcornReplacement.muted; +1083 +1084 IriSP.PopcornReplacement.__codes = []; +1085 IriSP.PopcornReplacement.code = function(options) { +1086 IriSP.PopcornReplacement.__codes.push(options); +1087 return IriSP.PopcornReplacement; +1088 }; +1089 +1090 IriSP.PopcornReplacement.__runCode = function() { +1091 var currentTime = jwplayer(IriSP.PopcornReplacement._container).getPosition(); +1092 var i = 0; +1093 for(i = 0; i < IriSP.PopcornReplacement.__codes.length; i++) { +1094 var c = IriSP.PopcornReplacement.__codes[i]; +1095 if (currentTime == c.start) { +1096 c.onStart(); +1097 } +1098 +1099 if (currentTime == c.end) { +1100 c.onEnd(); +1101 } +1102 +1103 } +1104 }; +1105 +1106 /* called everytime the player updates itself +1107 (onTime event) +1108 */ +1109 +1110 IriSP.PopcornReplacement.__timeHandler = function(event) { +1111 var pos = event.position; +1112 +1113 var i = 0; +1114 for(i = 0; i < IriSP.PopcornReplacement.__codes.length; i++) { +1115 var c = IriSP.PopcornReplacement.__codes[i]; +1116 +1117 if (pos >= c.start && pos < c.end && +1118 pos - 0.1 <= c.start) { +1119 c.onStart(); +1120 } +1121 +1122 if (pos > c.start && pos > c.end && +1123 pos - 0.1 <= c.end) { +1124 console.log("eonedn"); +1125 c.onEnd(); +1126 } +1127 +1128 } +1129 +1130 IriSP.PopcornReplacement.trigger("timeupdate"); +1131 }; +1132 +1133 IriSP.PopcornReplacement.__seekHandler = function(event) { +1134 var i = 0; +1135 +1136 for(i = 0; i < IriSP.PopcornReplacement.__codes.length; i++) { +1137 var c = IriSP.PopcornReplacement.__codes[i]; +1138 +1139 if (event.position >= c.start && event.position < c.end) { +1140 c.onEnd(); +1141 } +1142 } +1143 +1144 for(i = 0; i < IriSP.PopcornReplacement.__codes.length; i++) { +1145 var c = IriSP.PopcornReplacement.__codes[i]; +1146 +1147 if (typeof(event.offset) === "undefined") +1148 event.offset = 0; +1149 +1150 if (event.offset >= c.start && event.offset < c.end) { +1151 c.onStart(); +1152 } +1153 +1154 } +1155 +1156 IriSP.PopcornReplacement.trigger("timeupdate"); +1157 }; +1158 +1159 +1160 IriSP.PopcornReplacement.__playHandler = function(event) { +1161 IriSP.PopcornReplacement.media.paused = false; +1162 IriSP.PopcornReplacement.trigger("play"); +1163 }; +1164 +1165 IriSP.PopcornReplacement.__pauseHandler = function(event) { +1166 IriSP.PopcornReplacement.media.paused = true; +1167 IriSP.PopcornReplacement.trigger("pause"); +1168 }; +1169 +1170 IriSP.PopcornReplacement.roundTime = function() { +1171 var currentTime = IriSP.PopcornReplacement.currentTime(); +1172 return Math.round(currentTime); +1173 }; +1174 /* utils.js - various utils that don't belong anywhere else */ +1175 +1176 /* trace function, for debugging */ +1177 +1178 IriSP.traceNum = 0; +1179 IriSP.trace = function( msg, value ) { +1180 /* +1181 if( IriSP.config.gui.debug === true ) { +1182 IriSP.traceNum += 1; +1183 IriSP.jQuery( "<div>"+IriSP.traceNum+" - "+msg+" : "+value+"</div>" ).appendTo( "#Ldt-output" ); +1184 } +1185 */ +1186 }; +1187 +1188 /* used in callbacks - because in callbacks we lose "this", +1189 we need to have a special function which wraps "this" in +1190 a closure. This way, the +1191 */ +1192 IriSP.wrap = function (obj, fn) { +1193 return function() { +1194 var args = Array.prototype.slice.call(arguments, 0); +1195 return fn.apply(obj, args); +1196 } +1197 } +1198 +1199 /* convert a time to a percentage in the media */ +1200 IriSP.timeToPourcent = function(time, timetotal){ +1201 var time = Math.abs(time); +1202 var timetotal = Math.abs(timetotal); +1203 +1204 return Math.floor((time/timetotal) * 100); +1205 }; +1206 +1207 IriSP.padWithZeros = function(num) { +1208 if (Math.abs(num) < 10) { +1209 return "0" + num.toString(); +1210 } else { +1211 return num.toString(); +1212 } +1213 }; +1214 /* convert a number of seconds to a tuple of the form +1215 [hours, minutes, seconds] +1216 */ +1217 IriSP.secondsToTime = function(secs) { +1218 var hours = Math.abs(parseInt( secs / 3600 ) % 24); +1219 var minutes = Math.abs(parseInt( secs / 60 ) % 60); +1220 var seconds = parseFloat(Math.abs(secs % 60).toFixed(0)); +1221 +1222 var toString_fn = function() { +1223 var ret = ""; +1224 if (hours > 0) +1225 ret = IriSP.padWithZeros(this.hours) + ":"; +1226 ret += IriSP.padWithZeros(this.minutes) + ":" + IriSP.padWithZeros(this.seconds); +1227 +1228 return ret; +1229 } +1230 return {"hours" : hours, "minutes" : minutes, "seconds" : seconds, toString: toString_fn}; +1231 }; +1232 +1233 IriSP.secondsToString +1234 +1235 /* format a tweet - replaces @name by a link to the profile, #hashtag, etc. */ +1236 IriSP.formatTweet = function(tweet) { +1237 /* +1238 an array of arrays which hold a regexp and its replacement. +1239 */ +1240 var regExps = [ +1241 /* copied from http://codegolf.stackexchange.com/questions/464/shortest-url-regex-match-in-javascript/480#480 */ +1242 [/((https?:\/\/)?[\w-]+(\.[\w-]+)+\.?(:\d+)?(\/\S*)?)/gi, "<a href='$1'>$1</a>"], +1243 [/@(\w+)/gi, "<a href='http://twitter.com/$1'>@$1</a>"], // matches a @handle +1244 [/#(\w+)/gi, "<a href='http://twitter.com/search?q=%23$1'>#$1</a>"],// matches a hashtag +1245 [/(\+\+)/gi, "<span class='Ldt-PolemicPlusPlus'>$1</span>"], +1246 [/(--)/gi, "<span class='Ldt-PolemicMinusMinus'>$1</span>"], +1247 [/(==)/gi, "<span class='Ldt-PolemicEqualEqual'>$1</span>"], +1248 [/(\?\?)/gi, "<span class='Ldt-PolemicQuestion'>$1</span>"] +1249 ]; +1250 +1251 var i = 0; +1252 for(i = 0; i < regExps.length; i++) { +1253 tweet = tweet.replace(regExps[i][0], regExps[i][1]); +1254 } +1255 +1256 return tweet; +1257 }; +1258 +1259 IriSP.countProperties = function(obj) { +1260 var count = 0; +1261 +1262 for(var prop in obj) { +1263 if(obj.hasOwnProperty(prop)) +1264 ++count; +1265 } +1266 +1267 return count; +1268 }; +1269 +1270 // conversion de couleur Decimal vers HexaDecimal || 000 si fff +1271 IriSP.DEC_HEXA_COLOR = function (dec) { +1272 var hexa='0123456789ABCDEF'; +1273 var hex=''; +1274 var tmp; +1275 while (dec>15){ +1276 tmp = dec-(Math.floor(dec/16))*16; +1277 hex = hexa.charAt(tmp)+hex; +1278 dec = Math.floor(dec/16); +1279 } +1280 hex = hexa.charAt(dec)+hex; +1281 return(hex); +1282 }; +1283 +1284 /* shortcut to have global variables in templates */ +1285 IriSP.templToHTML = function(template, values) { +1286 var params = IriSP.jQuery.extend(IriSP.default_templates_vars, values); +1287 return Mustache.to_html(template, params); +1288 }; +1289 +1290 /* we need to be stricter than encodeURIComponent, +1291 because of twitter +1292 */ +1293 IriSP.encodeURI = function(str) { +1294 return encodeURIComponent(str).replace(/!/g, '%21').replace(/'/g, '%27').replace(/\(/g, '%28'). +1295 replace(/\)/g, '%29').replace(/\*/g, '%2A'); +1296 } +1297 +1298 IriSP.__guidCounter = 0; +1299 IriSP.guid = function(prefix) { +1300 IriSP.__guidCounter += 1; +1301 return prefix + IriSP.__guidCounter; +1302 }; +1303 /* for ie compatibility +1304 if (Object.prototype.__defineGetter__&&!Object.defineProperty) { +1305 Object.defineProperty=function(obj,prop,desc) { +1306 if ("get" in desc) obj.__defineGetter__(prop,desc.get); +1307 if ("set" in desc) obj.__defineSetter__(prop,desc.set); +1308 } +1309 } +1310 */ +1311 /* data.js - this file deals with how the players gets and sends data */ +1312 +1313 IriSP.DataLoader = function() { +1314 this._cache = {}; +1315 +1316 /* +1317 A structure to hold callbacks for specific urls. We need it because +1318 ajax calls are asynchronous, so it means that sometimes we ask +1319 multiple times for a ressource because the first call hasn't been +1320 received yet. +1321 */ +1322 this._callbacks = {}; +1323 }; +1324 +1325 IriSP.DataLoader.prototype.get = function(url, callback) { +1326 +1327 var base_url = url.split("&")[0] +1328 if (this._cache.hasOwnProperty(base_url)) { +1329 callback(this._cache[base_url]); +1330 } else { +1331 if (!this._callbacks.hasOwnProperty(base_url)) { +1332 this._callbacks[base_url] = []; +1333 this._callbacks[base_url].push(callback); +1334 /* we need a closure because this gets lost when it's called back */ +1335 +1336 // uncomment you don't want to use caching. +1337 // IriSP.jQuery.get(url, callback); +1338 +1339 var func = function(data) { +1340 this._cache[base_url] = data; +1341 var i = 0; +1342 +1343 for (i = 0; i < this._callbacks[base_url].length; i++) { +1344 this._callbacks[base_url][i](this._cache[base_url]); +1345 } +1346 }; +1347 +1348 /* automagically choose between json and jsonp */ +1349 if (url.indexOf(document.location.hostname) === -1 && +1350 url.indexOf("http://") !== -1 /* not a relative url */ ) { +1351 // we contacting a foreign domain, use JSONP +1352 +1353 IriSP.jQuery.get(url, {}, IriSP.wrap(this, func), "jsonp"); +1354 } else { +1355 +1356 // otherwise, hey, whatever rows your boat +1357 IriSP.jQuery.get(url, IriSP.wrap(this, func)); +1358 } +1359 +1360 } else { +1361 /* simply push the callback - it'll get called when the ressource +1362 has been received */ +1363 +1364 this._callbacks[base_url].push(callback); +1365 +1366 } +1367 } +1368 } +1369 +1370 /* the base abstract "class" */ +1371 IriSP.Serializer = function(DataLoader, url) { +1372 this._DataLoader = DataLoader; +1373 this._url = url; +1374 this._data = []; +1375 }; +1376 +1377 IriSP.Serializer.prototype.serialize = function(data) { }; +1378 IriSP.Serializer.prototype.deserialize = function(data) {}; +1379 +1380 IriSP.Serializer.prototype.currentMedia = function() { +1381 }; +1382 +1383 IriSP.Serializer.prototype.sync = function(callback) { +1384 callback.call(this, this._data); +1385 }; +1386 +1387 IriSP.SerializerFactory = function(DataLoader) { +1388 this._dataloader = DataLoader; +1389 }; +1390 +1391 IriSP.SerializerFactory.prototype.getSerializer = function(metadataOptions) { +1392 /* This function returns serializer set-up with the correct +1393 configuration - takes a metadata struct describing the metadata source +1394 */ +1395 +1396 if (metadataOptions === undefined) +1397 /* return an empty serializer */ +1398 return IriSP.Serializer("", ""); +1399 +1400 switch(metadataOptions.type) { +1401 case "json": +1402 return new IriSP.JSONSerializer(this._dataloader, metadataOptions.src); +1403 break; +1404 +1405 case "dummy": /* only used for unit testing - not defined in production */ +1406 return new IriSP.MockSerializer(this._dataloader, metadataOptions.src); +1407 break; +1408 +1409 case "empty": +1410 return new IriSP.Serializer("", "empty"); +1411 break; +1412 +1413 default: +1414 return undefined; +1415 } +1416 }; +1417 /* site.js - all our site-dependent config : player chrome, cdn locations, etc...*/ +1418 +1419 IriSP.lib = { +1420 jQuery : "http://ajax.googleapis.com/ajax/libs/jquery/1.4.2/jquery.js", +1421 jQueryUI : "http://ajax.googleapis.com/ajax/libs/jqueryui/1.8.4/jquery-ui.js", +1422 jQueryToolTip : "http://cdn.jquerytools.org/1.2.4/all/jquery.tools.min.js", +1423 swfObject : "http://ajax.googleapis.com/ajax/libs/swfobject/2.2/swfobject.js", +1424 cssjQueryUI : "http://ajax.googleapis.com/ajax/libs/jqueryui/1.8.4/themes/base/jquery-ui.css", +1425 popcorn : "/mdp/src/js/libs/popcorn.js", +1426 jwplayer : "/mdp/src/js/libs/jwplayer.js", +1427 popcornReplacement: "/mdp/src/js/libs/pop.js", +1428 raphael: "/mdp/src/js/libs/raphael.js", +1429 "popcorn.mediafragment" : "/mdp/src/js/libs/popcorn.mediafragment.js", +1430 "popcorn.code" : "/mdp/src/js/libs/popcorn.code.js", +1431 "popcorn.jwplayer": "/mdp/src/js/libs/popcorn.jwplayer.js", +1432 "popcorn.youtube": "/mdp/src/js/libs/popcorn.youtube.js" +1433 }; +1434 +1435 //Player Configuration +1436 IriSP.config = undefined; +1437 +1438 IriSP.widgetsDefaults = { +1439 "LayoutManager" : {spacer_div_height : "0px" }, +1440 "PlayerWidget" : {}, +1441 "AnnotationsWidget": { +1442 "share_text" : "I'm watching ", +1443 "fb_link" : "http://www.facebook.com/share.php?u=", +1444 "tw_link" : "http://twitter.com/home?status=", +1445 "gplus_link" : "" +1446 }, +1447 "TweetsWidget" : { +1448 default_profile_picture : "https://si0.twimg.com/sticky/default_profile_images/default_profile_1_normal.png", +1449 tweet_display_period: 10000 // how long do we show a tweet ? +1450 }, +1451 "SliderWidget" : { +1452 minimize_period: 850 // how long does the slider stays maximized after the user leaves the zone ? +1453 }, +1454 "Main" : { +1455 autoplay: true +1456 } +1457 +1458 }; +1459 +1460 IriSP.paths = { +1461 // "imgs": "/tweetlive/res/metadataplayer/src/css/imgs" +1462 "imgs": "/mdp/src/css/imgs" +1463 }; +1464 IriSP.default_templates_vars = { +1465 "img_dir" : IriSP.paths.imgs +1466 }; +1467 +1468 /* ui.js - ui related functions */ +1469 +1470 /* FIXME: use an sharing library */ +1471 IriSP.LdtShareTool = IriSP.share_template; /* the contents come from share.html */ +1472 +1473 IriSP.createPlayerChrome = function(){ +1474 var width = IriSP.config.gui.width; +1475 var height = IriSP.config.gui.height; +1476 var heightS = IriSP.config.gui.height-20; +1477 +1478 // AUDIO */ +1479 // PB dans le html : ; +1480 IriSP.trace( "__IriSP.createMyHtml",IriSP.config.gui.container ); +1481 +1482 +1483 /* FIXME : factor this in another file */ +1484 if( IriSP.config.gui.mode=="radio" ){ +1485 +1486 IriSP.jQuery( "#"+IriSP.config.gui.container ).before(IriSP.search_template); +1487 var radioPlayer = Mustache.to_html(IriSP.radio_template, {"share_template" : IriSP.share_template}); +1488 IriSP.jQuery(radioPlayer).appendTo("#"+IriSP.config.gui.container); +1489 +1490 // special tricks for IE 7 +1491 if (IriSP.jQuery.browser.msie==true && IriSP.jQuery.browser.version=="7.0"){ +1492 //LdtSearchContainer +1493 //__IriSP.jQuery("#LdtPlayer").attr("margin-top","50px"); +1494 IriSP.jQuery("#Ldt-Root").css("padding-top","25px"); +1495 IriSP.trace("__IriSP.createHtml","IE7 SPECIAL "); +1496 } +1497 } else if(IriSP.config.gui.mode=="video") { +1498 +1499 var videoPlayer = Mustache.to_html(IriSP.video_template, {"share_template" : IriSP.share_template, "heightS" : heightS}); +1500 IriSP.jQuery(videoPlayer).appendTo("#"+IriSP.config.gui.container); +1501 } +1502 +1503 IriSP.jQuery("#Ldt-Annotations").width(width-(75*2)); +1504 IriSP.jQuery("#Ldt-Show-Arrow-container").width(width-(75*2)); +1505 IriSP.jQuery("#Ldt-ShowAnnotation-audio").width(width-10); +1506 IriSP.jQuery("#Ldt-ShowAnnotation-video").width(width-10); +1507 IriSP.jQuery("#Ldt-SaKeyword").width(width-10); +1508 IriSP.jQuery("#Ldt-controler").width(width-10); +1509 IriSP.jQuery("#Ldt-Control").attr("z-index","100"); +1510 IriSP.jQuery("#Ldt-controler").hide(); +1511 +1512 IriSP.jQuery(IriSP.annotation_loading_template).appendTo("#Ldt-ShowAnnotation-audio"); +1513 +1514 if(IriSP.config.gui.mode=='radio'){ +1515 IriSP.jQuery("#Ldt-load-container").attr("width",IriSP.config.gui.width); +1516 } +1517 // Show or not the output +1518 if(IriSP.config.gui.debug===true){ +1519 IriSP.jQuery("#Ldt-output").show(); +1520 } else { +1521 IriSP.jQuery("#Ldt-output").hide(); +1522 } +1523 +1524 }; +1525 +1526 +1527 /* create the buttons and the slider */ +1528 IriSP.createInterface = function( width, height, duration ) { +1529 +1530 IriSP.jQuery( "#Ldt-controler" ).show(); +1531 //__IriSP.jQuery("#Ldt-Root").css('display','visible'); +1532 IriSP.trace( "__IriSP.createInterface" , width+","+height+","+duration+"," ); +1533 +1534 IriSP.jQuery( "#Ldt-ShowAnnotation").click( function () { +1535 //__IriSP.jQuery(this).slideUp(); +1536 } ); +1537 +1538 var LdtpPlayerY = IriSP.jQuery("#Ldt-PlaceHolder").attr("top"); +1539 var LdtpPlayerX = IriSP.jQuery("#Ldt-PlaceHolder").attr("left"); +1540 +1541 IriSP.jQuery( "#slider-range-min" ).slider( { //range: "min", +1542 value: 0, +1543 min: 1, +1544 max: duration/1000,//1:54:52.66 = 3600+3240+ +1545 step: 0.1, +1546 slide: function(event, ui) { +1547 +1548 //__IriSP.jQuery("#amount").val(ui.value+" s"); +1549 //player.sendEvent('SEEK', ui.value) +1550 IriSP.MyApiPlayer.seek(ui.value); +1551 //changePageUrlOffset(ui.value); +1552 //player.sendEvent('PAUSE') +1553 } +1554 } ); +1555 +1556 IriSP.trace("__IriSP.createInterface","ICI"); +1557 IriSP.jQuery("#amount").val(IriSP.jQuery("#slider-range-min").slider("value")+" s"); +1558 IriSP.jQuery(".Ldt-Control1 button:first").button({ +1559 icons: { +1560 primary: 'ui-icon-play' +1561 }, +1562 text: false +1563 }).next().button({ +1564 icons: { +1565 primary: 'ui-icon-seek-next' +1566 }, +1567 text: false +1568 }); +1569 IriSP.jQuery(".Ldt-Control2 button:first").button({ +1570 icons: { +1571 primary: 'ui-icon-search'//, +1572 //secondary: 'ui-icon-volume-off' +1573 }, +1574 text: false +1575 }).next().button({ +1576 icons: { +1577 primary: 'ui-icon-volume-on' +1578 }, +1579 text: false +1580 }); +1581 +1582 // /!\ PB A MODIFIER +1583 //__IriSP.MyTags.draw(); +1584 IriSP.trace("__IriSP.createInterface","ICI2"); +1585 IriSP.jQuery( "#ldt-CtrlPlay" ).attr( "style", "background-color:#CD21C24;" ); +1586 +1587 IriSP.jQuery( "#Ldt-load-container" ).hide(); +1588 +1589 if( IriSP.config.gui.mode=="radio" & IriSP.jQuery.browser.msie != true ) { +1590 IriSP.jQuery( "#Ldtplayer1" ).attr( "height", "0" ); +1591 } +1592 IriSP.trace( "__IriSP.createInterface" , "3" ); +1593 +1594 IriSP.trace( "__IriSP.createInterface", "END" ); +1595 +1596 }; +1597 /* the widget classes and definitions */ +1598 +1599 IriSP.Widget = function(Popcorn, config, Serializer) { +1600 +1601 if (config === undefined || config === null) { +1602 config = {} +1603 } +1604 +1605 this._Popcorn = Popcorn; +1606 this._config = config; +1607 this._serializer = Serializer; +1608 +1609 if (config.hasOwnProperty("container")) { +1610 this._id = config.container; +1611 this.selector = IriSP.jQuery("#" + this._id); +1612 } +1613 +1614 if (config.hasOwnProperty("spacer")) { +1615 this._spacerId = config.spacer; +1616 this.spacer = IriSP.jQuery("#" + this._spacerId); +1617 } +1618 +1619 +1620 if (config.hasOwnProperty("width")) { +1621 // this.width and not this._width because we consider it public. +1622 this.width = config.width; +1623 } +1624 +1625 if (config.hasOwnProperty("height")) { +1626 this.height = config.height; +1627 } +1628 +1629 if (config.hasOwnProperty("heightmax")) { +1630 this.heightmax = config.heightmax; +1631 } +1632 +1633 if (config.hasOwnProperty("widthmax")) { +1634 this.widthmax = config.widthmax; +1635 } +1636 +1637 }; +1638 +1639 IriSP.Widget.prototype.draw = function() { +1640 /* implemented by "sub-classes" */ +1641 }; +1642 +1643 IriSP.Widget.prototype.redraw = function() { +1644 /* implemented by "sub-classes" */ +1645 }; +1646 /* modules are non-graphical entities, similar to widgets */ +1647 +1648 IriSP.Module = function(Popcorn, config, Serializer) { +1649 +1650 if (config === undefined || config === null) { +1651 config = {} +1652 } +1653 +1654 this._Popcorn = Popcorn; +1655 this._config = config; +1656 this._serializer = Serializer; +1657 }; +1658 /* layout.js - very basic layout management */ +1659 +1660 /* +1661 a layout manager manages a div and the layout of objects +1662 inside it. +1663 */ +1664 +1665 IriSP.LayoutManager = function(options) { +1666 this._Popcorn = null; +1667 this._widgets = []; +1668 +1669 this._div = "LdtPlayer"; +1670 this._width = 640; +1671 +1672 if (options === undefined) { +1673 options = {}; +1674 }; +1675 +1676 if (options.hasOwnProperty('container')) { +1677 this._div = options.container; +1678 } +1679 +1680 if (options.hasOwnProperty('width')) { +1681 this._width = options.width; +1682 } +1683 +1684 if (options.hasOwnProperty('height')) { +1685 this._height = options.height; +1686 } +1687 +1688 /* this is a shortcut */ +1689 this.selector = IriSP.jQuery("#" + this._div); +1690 +1691 this.selector.css("width", this._width); +1692 +1693 if (this._height !== undefined) +1694 this.selector.css("height", this._height); +1695 }; +1696 +1697 /* we need this special setter because of a chicken and egg problem : +1698 we want the manager to use popcorn but the popcorn div will be managed +1699 by the manager. So we need a way to set the instance the manager uses +1700 */ +1701 +1702 IriSP.LayoutManager.prototype.setPopcornInstance = function(popcorn) { +1703 this._Popcorn = popcorn; +1704 } +1705 +1706 /* stem is a string to append to the id of the widget */ +1707 IriSP.LayoutManager.prototype.createDiv = function(stem) { +1708 if (typeof(stem) === "undefined") +1709 stem = ""; +1710 +1711 var newDiv = IriSP.guid(this._div + "_widget_" + stem + "_"); +1712 var spacerDiv = IriSP.guid("LdtPlayer_spacer_"); +1713 this._widgets.push(newDiv); +1714 +1715 var divTempl = "<div id='{{id}}' style='width: {{width}}px; position: relative;'></div"; +1716 var spacerTempl = "<div id='{{spacer_id}}' style='width: {{width}}px; position: relative; height: {{spacer_div_height}};'></div"; +1717 +1718 var divCode = Mustache.to_html(divTempl, {id: newDiv, width: this._width}); +1719 var spacerCode = Mustache.to_html(spacerTempl, {spacer_id: spacerDiv, width: this._width, +1720 spacer_div_height: IriSP.widgetsDefaults.LayoutManager.spacer_div_height }); +1721 +1722 this.selector.append(divCode); +1723 this.selector.append(spacerCode); +1724 +1725 return [newDiv, spacerDiv]; +1726 }; +1727 /* init.js - initialization and configuration of Popcorn and the widgets +1728 exemple json configuration: +1729 +1730 */ +1731 +1732 IriSP.setupDataLoader = function() { +1733 /* we set it up separately because we need to +1734 get data at the very beginning, for instance when +1735 setting up the video */ +1736 IriSP.__dataloader = new IriSP.DataLoader(); +1737 }; +1738 +1739 IriSP.configurePopcorn = function (layoutManager, options) { +1740 var pop; +1741 var ret = layoutManager.createDiv(); +1742 var containerDiv = ret[0]; +1743 +1744 switch(options.type) { +1745 /* +1746 todo : dynamically create the div/video tag which +1747 will contain the video. +1748 */ +1749 case "html5": +1750 var tmpId = Popcorn.guid("video"); +1751 IriSP.jQuery("#" + containerDiv).append("<video src='" + options.file + "' id='" + tmpId + "'></video>"); +1752 +1753 if (options.hasOwnProperty("width")) +1754 IriSP.jQuery("#" + containerDiv).css("width", options.width); +1755 +1756 if (options.hasOwnProperty("height")) +1757 IriSP.jQuery("#" + containerDiv).css("height", options.height); +1758 +1759 pop = Popcorn("#" + tmpId); +1760 break; +1761 +1762 case "jwplayer": +1763 var opts = IriSP.jQuery.extend({}, options); +1764 delete opts.container; +1765 +1766 if (options.provider === "rtmp") { +1767 /* exit if we can't access the metadata */ +1768 if (typeof(IriSP.__jsonMetadata) === "undefined") { +1769 break; +1770 }; +1771 +1772 +1773 // the json format is totally illogical +1774 opts.streamer = IriSP.__jsonMetadata["medias"][0]["meta"]["item"]["value"]; +1775 var source = IriSP.__jsonMetadata["medias"][0]["href"]; +1776 +1777 // the source if a full url but jwplayer wants an url relative to the +1778 // streamer url, so we've got to remove the common part. +1779 opts.file = source.slice(opts.streamer.length); +1780 } else { +1781 /* other providers type, video for instance - +1782 pass everything as is */ +1783 } +1784 +1785 pop = IriSP.PopcornReplacement.jwplayer("#" + containerDiv, opts); +1786 break; +1787 +1788 case "youtube": +1789 var opts = IriSP.jQuery.extend({}, options); +1790 delete opts.container; +1791 opts.controls = 0; +1792 opts.autostart = false; +1793 templ = "width: {{width}}px; height: {{height}}px;"; +1794 var str = Mustache.to_html(templ, {width: opts.width, height: opts.height}); +1795 // Popcorn.youtube wants us to specify the size of the player in the style attribute of its container div. +1796 IriSP.jQuery("#" + containerDiv).attr("style", str); +1797 +1798 pop = Popcorn.youtube("#" + containerDiv, opts.video, opts); +1799 break; +1800 +1801 default: +1802 pop = undefined; +1803 }; +1804 +1805 return pop; +1806 }; +1807 +1808 IriSP.configureWidgets = function (popcornInstance, layoutManager, guiOptions) { +1809 +1810 var serialFactory = new IriSP.SerializerFactory(IriSP.__dataloader); +1811 var params = {width: guiOptions.width, height: guiOptions.height}; +1812 +1813 var ret_widgets = []; +1814 var index; +1815 +1816 for (index = 0; index < guiOptions.widgets.length; index++) { +1817 var widgetConfig = guiOptions.widgets[index]; +1818 var widget = IriSP.instantiateWidget(popcornInstance, serialFactory, layoutManager, widgetConfig); +1819 ret_widgets.push(widget); +1820 +1821 }; +1822 +1823 return ret_widgets; +1824 }; +1825 +1826 IriSP.configureModules = function (popcornInstance, modulesList) { +1827 +1828 var serialFactory = new IriSP.SerializerFactory(IriSP.__dataloader); +1829 var ret_modules = []; +1830 var index; +1831 +1832 for (index = 0; index < modulesList.length; index++) { +1833 var moduleConfig = modulesList[index]; +1834 +1835 var serializer = serialFactory.getSerializer(moduleConfig.metadata); +1836 var module = new IriSP[moduleConfig.type](popcornInstance, moduleConfig, serializer); +1837 ret_modules.push(module); +1838 }; +1839 +1840 return ret_modules; +1841 }; +1842 +1843 IriSP.instantiateWidget = function(popcornInstance, serialFactory, layoutManager, widgetConfig) { +1844 /* create div returns us a container for the widget and a spacer */ +1845 var ret = layoutManager.createDiv(widgetConfig.type); +1846 var container = ret[0]; +1847 var spacer = ret[1]; +1848 +1849 var arr = IriSP.jQuery.extend({}, widgetConfig); +1850 arr.container = container; +1851 arr.spacer = spacer; +1852 +1853 var serializer = serialFactory.getSerializer(widgetConfig.metadata); +1854 +1855 if (typeof serializer == "undefined") +1856 debugger; +1857 +1858 // instantiate the object passed as a string +1859 var widget = new IriSP[widgetConfig.type](popcornInstance, arr, serializer); +1860 +1861 if (widgetConfig.hasOwnProperty("requires")) { +1862 // also create the widgets this one depends on. +1863 // the dependency widget is available in the parent widget context as +1864 // this.WidgetName (for instance, this.TipWidget); +1865 +1866 var i = 0; +1867 for(i = 0; i < widgetConfig.requires.length; i++) { +1868 var widgetName = widgetConfig.requires[i]["type"]; +1869 widget[widgetName] = IriSP.instantiateWidget(popcornInstance, serialFactory, layoutManager, widgetConfig.requires[i]); +1870 } +1871 } +1872 +1873 serializer.sync(IriSP.wrap(widget, function() { this.draw(); })); +1874 return widget; +1875 }; +1876 /* mediafragment module */ +1877 +1878 IriSP.MediaFragment = function(Popcorn, config, Serializer) { +1879 IriSP.Module.call(this, Popcorn, config, Serializer); +1880 +1881 this.mutex = false; /* a mutex because we access the url from two different functions */ +1882 +1883 this._Popcorn.listen( "loadedmetadata", IriSP.wrap(this, IriSP.MediaFragment.advanceTime)); +1884 this._Popcorn.listen( "pause", IriSP.wrap(this, IriSP.MediaFragment.updateTime)); +1885 this._Popcorn.listen( "seeked", IriSP.wrap(this, IriSP.MediaFragment.updateTime)); +1886 this._Popcorn.listen( "IriSP.PolemicTweet.click", IriSP.wrap(this, IriSP.MediaFragment.updateAnnotation)); +1887 this._Popcorn.listen( "IriSP.SegmentsWidget.click", IriSP.wrap(this, IriSP.MediaFragment.updateAnnotation)); +1888 }; +1889 +1890 IriSP.MediaFragment.advanceTime = function() { +1891 var url = window.location.href; +1892 +1893 if ( url.split( "#" )[ 1 ] != null ) { +1894 pageoffset = url.split( "#" )[1]; +1895 +1896 if ( pageoffset.substring(0, 2) === "t=") { +1897 // timecode +1898 if ( pageoffset.substring( 2 ) != null ) { +1899 var offsettime = pageoffset.substring( 2 ); +1900 this._Popcorn.currentTime( parseFloat( offsettime ) ); +1901 } +1902 } else if ( pageoffset.substring(0, 2) === "a=") { +1903 // annotation +1904 var annotationId = pageoffset.substring( 2 ); +1905 +1906 // there's no better way than that because +1907 // of possible race conditions +1908 this._serializer.sync(IriSP.wrap(this, function() { +1909 IriSP.MediaFragment.lookupAnnotation.call(this, annotationId); +1910 })); +1911 } +1912 } +1913 }; +1914 +1915 IriSP.MediaFragment.updateTime = function() { +1916 if (this.mutex === true) { +1917 return; +1918 } +1919 +1920 var history = window.history; +1921 if ( !history.pushState ) { +1922 return false; +1923 } +1924 +1925 splitArr = window.location.href.split( "#" ) +1926 history.replaceState( {}, "", splitArr[0] + "#t=" + this._Popcorn.currentTime().toFixed( 2 ) ); +1927 }; +1928 +1929 +1930 IriSP.MediaFragment.updateAnnotation = function(annotationId) { +1931 var _this = this; +1932 this.mutex = true; +1933 +1934 var history = window.history; +1935 if ( !history.pushState ) { +1936 return false; +1937 } +1938 +1939 splitArr = window.location.href.split( "#" ) +1940 history.replaceState( {}, "", splitArr[0] + "#a=" + annotationId); +1941 +1942 window.setTimeout(function() { _this.mutex = false }, 50); +1943 }; +1944 +1945 // lookup and seek to the beginning of an annotation +1946 IriSP.MediaFragment.lookupAnnotation = function(annotationId) { +1947 var annotation = undefined; +1948 var annotations = this._serializer._data.annotations; +1949 +1950 var i; +1951 for (i = 0; i < annotations.length; i++) { +1952 if (annotations[i].id === annotationId) { +1953 annotation = annotations[i]; +1954 break; +1955 } +1956 } +1957 +1958 if (typeof(annotation) !== "undefined") { +1959 this._Popcorn.currentTime(annotation.begin / 1000); +1960 } +1961 }; +1962 IriSP.AnnotationsWidget = function(Popcorn, config, Serializer) { +1963 IriSP.Widget.call(this, Popcorn, config, Serializer); +1964 +1965 }; +1966 +1967 +1968 IriSP.AnnotationsWidget.prototype = new IriSP.Widget(); +1969 +1970 IriSP.AnnotationsWidget.prototype.clear = function() { +1971 this.selector.find(".Ldt-SaTitle").text(""); +1972 this.selector.find(".Ldt-SaDescription").text(""); +1973 this.selector.find(".Ldt-SaKeywordText").text(""); +1974 }; +1975 +1976 IriSP.AnnotationsWidget.prototype.displayAnnotation = function(annotation) { +1977 +1978 var title = annotation.content.title; +1979 var description = annotation.content.description; +1980 var keywords = "" // FIXME; +1981 var begin = +annotation.begin / 1000; +1982 var end = +annotation.end / 1000; +1983 var duration = +this._serializer.currentMedia().meta["dc:duration"]; +1984 +1985 var title_templ = "{{title}} - ( {{begin}} - {{end}} )"; +1986 var endstr = Mustache.to_html(title_templ, {title: title, begin: IriSP.secondsToTime(begin), end: IriSP.secondsToTime(end)}); +1987 +1988 this.selector.find(".Ldt-SaTitle").text(endstr); +1989 this.selector.find(".Ldt-SaDescription").text(description); +1990 +1991 // update sharing buttons +1992 var defaults = IriSP.widgetsDefaults.AnnotationsWidget; +1993 var text = defaults.share_text; +1994 var fb_link = defaults.fb_link; +1995 var tw_link = defaults.tw_link; +1996 var gplus_link = defaults.gplus_link; +1997 var url = document.location.href + "#a=" + annotation.id; +1998 this.selector.find(".Ldt-fbShare").attr("href", fb_link + IriSP.encodeURI(text) + IriSP.encodeURI(url)); +1999 this.selector.find(".Ldt-TwShare").attr("href", tw_link + IriSP.encodeURI(text) + IriSP.encodeURI(url)); +2000 this.selector.find(".Ldt-GplusShare").attr("href", fb_link + IriSP.encodeURI(text) + IriSP.encodeURI(url)); +2001 }; +2002 +2003 IriSP.AnnotationsWidget.prototype.clearWidget = function() { +2004 +2005 +2006 /* retract the pane between two annotations */ +2007 this.selector.find(".Ldt-SaTitle").text(""); +2008 this.selector.find(".Ldt-SaDescription").text(""); +2009 this.selector.find(".Ldt-SaKeywordText").html(""); +2010 this.selector.find(".Ldt-ShowAnnotation").slideUp(); +2011 }; +2012 +2013 IriSP.AnnotationsWidget.prototype.draw = function() { +2014 var _this = this; +2015 +2016 var annotationMarkup = IriSP.templToHTML(IriSP.annotationWidget_template); +2017 this.selector.append(annotationMarkup); +2018 var view; +2019 +2020 if (typeof(this._serializer._data.views) !== "undefined" && this._serializer._data.views !== null) +2021 view = this._serializer._data.views[0]; +2022 +2023 var view_type = ""; +2024 +2025 if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) { +2026 view_type = view.annotation_types[0]; +2027 } +2028 +2029 var annotations = this._serializer._data.annotations; +2030 var i; +2031 +2032 for (i in annotations) { +2033 var annotation = annotations[i]; +2034 var begin = Math.round((+ annotation.begin) / 1000); +2035 var end = Math.round((+ annotation.end) / 1000); +2036 +2037 if (view_type != "" && typeof(annotation.meta) !== "undefined" && typeof(annotation.meta["id-ref"]) !== "undefined" +2038 && annotation.meta["id-ref"] != view_type) { +2039 continue; +2040 } +2041 +2042 +2043 var conf = {start: begin, end: end, +2044 onStart: +2045 function(annotation) { +2046 return function() { +2047 _this.displayAnnotation(annotation); +2048 +2049 } }(annotation), +2050 onEnd: +2051 function() { _this.clearWidget.call(_this); } +2052 }; +2053 this._Popcorn = this._Popcorn.code(conf); +2054 } +2055 +2056 }; +2057 IriSP.ArrowWidget = function(Popcorn, config, Serializer) { +2058 IriSP.Widget.call(this, Popcorn, config, Serializer); +2059 +2060 this._oldAnnotation = null; +2061 +2062 }; +2063 +2064 +2065 IriSP.ArrowWidget.prototype = new IriSP.Widget(); +2066 +2067 IriSP.ArrowWidget.prototype.clear = function() { +2068 +2069 }; +2070 +2071 IriSP.ArrowWidget.prototype.clearWidget = function() { +2072 }; +2073 +2074 IriSP.ArrowWidget.prototype.draw = function() { +2075 var templ = Mustache.to_html(IriSP.arrowWidget_template, {}); +2076 this.selector.append(templ); +2077 this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.timeUpdateHandler)); +2078 }; +2079 +2080 IriSP.ArrowWidget.prototype.timeUpdateHandler = function(percents) { +2081 var currentTime = this._Popcorn.currentTime(); +2082 var currentAnnotation = this._serializer.currentAnnotations(currentTime)[0]; // FIXME : use the others ? +2083 +2084 /* move the arrow only if the current annotation changes */ +2085 if (currentAnnotation != this._oldAnnotation) { +2086 var begin = (+ currentAnnotation.begin) / 1000; +2087 var end = (+ currentAnnotation.end) / 1000; +2088 +2089 var duration = +this._serializer.currentMedia().meta["dc:duration"] / 1000; +2090 var middle_time = (begin + end) / 2; +2091 var percents = Math.floor((middle_time / duration) * 100); +2092 +2093 // we need to apply a fix because the arrow has a certain length +2094 // it's half the length of the arrow (27 / 2). We need to convert +2095 // it in percents though. +2096 var totalWidth = this.selector.width(); +2097 var correction = ((27 / 2) / totalWidth) * 100; +2098 var corrected_percents = percents - correction; +2099 +2100 /* don't move out of the screen */ +2101 if (corrected_percents <= 0) +2102 corrected_percents = 0; +2103 +2104 this.selector.children(".Ldt-arrowWidget").animate({"left" : corrected_percents + "%"}); +2105 +2106 this._oldAnnotation = currentAnnotation; +2107 } +2108 } +2109 IriSP.PlayerWidget = function(Popcorn, config, Serializer) { +2110 IriSP.Widget.call(this, Popcorn, config, Serializer); +2111 +2112 this._searchBlockOpen = false; +2113 this._searchLastValue = ""; +2114 }; +2115 +2116 IriSP.PlayerWidget.prototype = new IriSP.Widget(); +2117 +2118 IriSP.PlayerWidget.prototype.draw = function() { +2119 var self = this; +2120 var width = this.width; +2121 var height = this.height; +2122 var heightS = this.height-20; +2123 +2124 var Player_templ = Mustache.to_html(IriSP.player_template, {"share_template" : IriSP.share_template}); +2125 this.selector.append(Player_templ); +2126 +2127 this.selector.children(".Ldt-controler").show(); +2128 +2129 // handle clicks by the user on the video. +2130 this._Popcorn.listen("play", IriSP.wrap(this, this.playButtonUpdater)); +2131 this._Popcorn.listen("pause", IriSP.wrap(this, this.playButtonUpdater)); +2132 +2133 this._Popcorn.listen("volumechange", IriSP.wrap(this, this.muteButtonUpdater)); +2134 +2135 this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.timeDisplayUpdater)); +2136 this._Popcorn.listen("IriSP.search.matchFound", IriSP.wrap(this, this.searchMatch)); +2137 this._Popcorn.listen("IriSP.search.noMatchFound", IriSP.wrap(this, this.searchNoMatch)); +2138 +2139 +2140 this.selector.find(".Ldt-CtrlPlay").click(function() { self.playHandler.call(self); }); +2141 this.selector.find(".Ldt-CtrlNext").click(function() { }); +2142 this.selector.find(".Ldt-CtrlSearch").click(function() { self.searchButtonHandler.call(self); }); +2143 +2144 this.selector.find('.Ldt-CtrlSound').click(function() { self.muteHandler.call(self); } ); +2145 +2146 this.selector.find(".Ldt-CtrlPlay").attr( "style", "background-color:#CD21C24;" ); +2147 +2148 var searchButtonPos = this.selector.find(".Ldt-CtrlSearch").position(); +2149 var searchBox = Mustache.to_html(IriSP.search_template, {margin_left : searchButtonPos.left + "px"}); +2150 this.selector.append(searchBox); +2151 +2152 // trigger an IriSP.PlayerWidget.MouseOver to the widgets that are interested (i.e : sliderWidget) +2153 this.selector.hover(function() { self._Popcorn.trigger("IriSP.PlayerWidget.MouseOver"); }, +2154 function() { self._Popcorn.trigger("IriSP.PlayerWidget.MouseOut"); }); +2155 +2156 this.muteButtonUpdater(); /* some player - jwplayer notable - save the state of the mute button between sessions */ +2157 }; +2158 +2159 /* Update the elasped time div */ +2160 IriSP.PlayerWidget.prototype.timeDisplayUpdater = function() { +2161 +2162 if (this._previousSecond === undefined) +2163 this._previousSecond = this._Popcorn.roundTime(); +2164 +2165 else { +2166 /* we're still in the same second, so it's not necessary to update time */ +2167 if (this._Popcorn.roundTime() == this._previousSecond) +2168 return; +2169 +2170 } +2171 +2172 // we get it at each call because it may change. +2173 var duration = +this._serializer.currentMedia().meta["dc:duration"] / 1000; +2174 var totalTime = IriSP.secondsToTime(duration); +2175 var elapsedTime = IriSP.secondsToTime(this._Popcorn.currentTime()); +2176 +2177 this.selector.find(".Ldt-ElapsedTime").html(elapsedTime.toString()); +2178 this.selector.find(".Ldt-TotalTime").html(totalTime.toString()); +2179 this._previousSecond = this._Popcorn.roundTime(); +2180 }; +2181 +2182 /* update the icon of the button - separate function from playHandler +2183 because in some cases (for instance, when the user directly clicks on +2184 the jwplayer window) we have to change the icon without playing/pausing +2185 */ +2186 IriSP.PlayerWidget.prototype.playButtonUpdater = function() { +2187 var status = this._Popcorn.media.paused; +2188 +2189 if ( status == true ){ +2190 this.selector.find(".Ldt-CtrlPlay").attr("title", "Play"); +2191 +2192 // we use templToHTML because it has some predefined +2193 // vars like where to get the images +2194 var templ = IriSP.templToHTML("url({{img_dir}}/play_sprite.png)"); +2195 this.selector.find(".Ldt-CtrlPlay").css("background-image", templ); +2196 +2197 } else { +2198 this.selector.find(".Ldt-CtrlPlay").attr("title", "Pause"); +2199 +2200 // we use templToHTML because it has some predefined +2201 // vars like where to get the images +2202 var templ = IriSP.templToHTML("url({{img_dir}}/pause_sprite.png)"); +2203 this.selector.find(".Ldt-CtrlPlay").css("background-image", templ); +2204 } +2205 +2206 return; +2207 }; +2208 +2209 +2210 IriSP.PlayerWidget.prototype.playHandler = function() { +2211 var status = this._Popcorn.media.paused; +2212 +2213 if ( status == true ){ +2214 this._Popcorn.play(); +2215 } else { +2216 this._Popcorn.pause(); +2217 } +2218 }; +2219 +2220 IriSP.PlayerWidget.prototype.muteHandler = function() { +2221 if (!this._Popcorn.muted()) { +2222 this._Popcorn.mute(true); +2223 } else { +2224 this._Popcorn.mute(false); +2225 } +2226 }; +2227 +2228 IriSP.PlayerWidget.prototype.muteButtonUpdater = function() { +2229 var status = this._Popcorn.media.muted; +2230 +2231 if ( status == true ){ +2232 this.selector.find(".Ldt-CtrlSound").attr("title", "Unmute"); +2233 +2234 // we use templToHTML because it has some predefined +2235 // vars like where to get the images +2236 var templ = IriSP.templToHTML("url({{img_dir}}/sound_sprite.png)"); +2237 this.selector.find(".Ldt-CtrlSound").css("background-image", templ); +2238 +2239 } else { +2240 this.selector.find(".Ldt-CtrlSound").attr("title", "Mute"); +2241 +2242 // we use templToHTML because it has some predefined +2243 // vars like where to get the images +2244 var templ = IriSP.templToHTML("url({{img_dir}}/mute_sprite.png)"); +2245 this.selector.find(".Ldt-CtrlSound").css("background-image", templ); +2246 } +2247 +2248 return; +2249 }; +2250 +2251 +2252 IriSP.PlayerWidget.prototype.searchButtonHandler = function() { +2253 var self = this; +2254 +2255 /* show the search field if it is not shown */ +2256 if ( this._searchBlockOpen == false ) { +2257 this.selector.find(".LdtSearch").show(100); +2258 +2259 this.selector.find(".LdtSearchInput").css('background-color','#fff'); +2260 this.selector.find(".LdtSearchInput").focus(); +2261 this.selector.find(".LdtSearchInput").attr('value', this._searchLastValue); +2262 this._Popcorn.trigger("IriSP.search", this._searchLastValue); // trigger the search to make it more natural. +2263 +2264 this._searchBlockOpen = true; +2265 this.selector.find(".LdtSearchInput").bind('keyup', null, function() { self.searchHandler.call(self); } ); +2266 +2267 // we need this variable because some widget can find a match in +2268 // their data while at the same time other's don't. As we want the +2269 // search field to become green when there's a match, we need a +2270 // variable to remember that we had one. +2271 this._positiveMatch = false; +2272 +2273 // tell the world the field is open +2274 this._Popcorn.trigger("IriSP.search.open"); +2275 +2276 } else { +2277 this._searchLastValue = this.selector.find(".LdtSearchInput").attr('value'); +2278 this.selector.find(".LdtSearchInput").attr('value',''); +2279 this.selector.find(".LdtSearch").hide(100); +2280 +2281 // unbind the watcher event. +2282 this.selector.find(".LdtSearchInput").unbind('keypress set'); +2283 this._searchBlockOpen = false; +2284 +2285 this._positiveMatch = false; +2286 +2287 this._Popcorn.trigger("IriSP.search.closed"); +2288 } +2289 }; +2290 +2291 /* this handler is called whenever the content of the search +2292 field changes */ +2293 IriSP.PlayerWidget.prototype.searchHandler = function() { +2294 this._searchLastValue = this.selector.find(".LdtSearchInput").attr('value'); +2295 this._positiveMatch = false; +2296 +2297 // do nothing if the search field is empty, instead of highlighting everything. +2298 if (this._searchLastValue == "") { +2299 this._Popcorn.trigger("IriSP.search.cleared"); +2300 this.selector.find(".LdtSearchInput").css('background-color',''); +2301 } else { +2302 this._Popcorn.trigger("IriSP.search", this._searchLastValue); +2303 } +2304 }; +2305 +2306 /* +2307 handler for the IriSP.search.found message, which is sent by some views when they +2308 highlight a match. +2309 */ +2310 IriSP.PlayerWidget.prototype.searchMatch = function() { +2311 this._positiveMatch = true; +2312 this.selector.find(".LdtSearchInput").css('background-color','#e1ffe1'); +2313 } +2314 +2315 /* the same, except that no value could be found */ +2316 IriSP.PlayerWidget.prototype.searchNoMatch = function() { +2317 if (this._positiveMatch !== true) +2318 this.selector.find(".LdtSearchInput").css('background-color', "#d62e3a"); +2319 } +2320 +2321 /* +2322 * +2323 * Copyright 2010 Institut de recherche et d'innovation +2324 * contributor(s) : Samuel Huron +2325 * +2326 * contact@iri.centrepompidou.fr +2327 * http://www.iri.centrepompidou.fr +2328 * +2329 * This software is a computer program whose purpose is to show and add annotations on a video . +2330 * This software is governed by the CeCILL-C license under French law and +2331 * abiding by the rules of distribution of free software. You can use, +2332 * modify and/ or redistribute the software under the terms of the CeCILL-C +2333 * license as circulated by CEA, CNRS and INRIA at the following URL +2334 * "http://www.cecill.info". +2335 * +2336 * The fact that you are presently reading this means that you have had +2337 * knowledge of the CeCILL-C license and that you accept its terms. +2338 */ +2339 // CHART TIMELINE / VERSION PROTOTYPE :: +2340 +2341 IriSP.PolemicWidget = function(Popcorn, config, Serializer) { +2342 IriSP.Widget.call(this, Popcorn, config, Serializer); +2343 +2344 this.userPol = new Array(); +2345 this.userNoPol = new Array(); +2346 this.userst = new Array(); +2347 this.numberOfTweet = 0; +2348 this.Users; +2349 this.TweetPolemic; +2350 this.yMax = this.height; +2351 this.PaperSlider; +2352 this.heightOfChart; +2353 this.tweets = new Array(); +2354 this.svgElements = {}; +2355 +2356 // Make and define the Raphael area +2357 this.paper = Raphael(document.getElementById(this._id), config.width, config.height); +2358 +2359 this.oldSearchMatches = []; +2360 +2361 // event handlers +2362 this._Popcorn.listen("IriSP.search", IriSP.wrap(this, function(searchString) { this.searchHandler(searchString); })); +2363 this._Popcorn.listen("IriSP.search.closed", IriSP.wrap(this, this.searchFieldClosedHandler)); +2364 this._Popcorn.listen("IriSP.search.cleared", IriSP.wrap(this, this.searchFieldClearedHandler)); +2365 +2366 }; +2367 +2368 IriSP.PolemicWidget.prototype = new IriSP.Widget(); +2369 +2370 IriSP.PolemicWidget.prototype.draw = function() { +2371 +2372 // variable +2373 // yMax +2374 +2375 var self = this; +2376 var yCoef = 2; // coef for height of 1 tweet +2377 var frameSize = 5; // frame size +2378 var margin = 1; // marge between frame +2379 var lineSize = this.width; // timeline pixel width +2380 var nbrframes = lineSize/frameSize; // frame numbers +2381 var numberOfTweet = 0; // number of tweet overide later +2382 var duration = +this._serializer.currentMedia().meta["dc:duration"]; // timescale width +2383 var frameLength = lineSize / frameSize; // frame timescale +2384 var timeline; +2385 var colors = new Array("","#1D973D","#C5A62D","#CE0A15","#036AAE","#585858"); +2386 +2387 // array +2388 //var tweets = new Array(); +2389 var element = new Array(); +2390 var cluster = new Array(); +2391 var frames = new Array(frameLength); +2392 var slices = new Array(); +2393 +2394 +2395 // Classes ======================================================================= +2396 var Frames = function(){ +2397 +2398 var Myclusters; +2399 var x; +2400 var y; +2401 var width; +2402 var height; +2403 }; +2404 Frames = function(json){ +2405 // make my clusters +2406 // ou Frame vide +2407 }; +2408 Frames.prototype.draw = function(){ +2409 }; +2410 Frames.prototype.zoom = function(){ +2411 }; +2412 Frames.prototype.inside = function(){ +2413 }; +2414 var Clusters = function(){ +2415 var Object; +2416 var yDist; +2417 var x; +2418 var y; +2419 var width; +2420 var height; +2421 }; +2422 Clusters = function(json){ +2423 // make my object +2424 }; +2425 var Tweet = function(){ +2426 }; +2427 // Classes ======================================================================= +2428 +2429 // Refactoring (parametere) ************************************************************ +2430 // color translastion +2431 var qTweet_0 =0; +2432 var qTweet_Q =0; +2433 var qTweet_REF=0; +2434 var qTweet_OK =0; +2435 var qTweet_KO =0; +2436 function colorTranslation(value){ +2437 if(value == "Q"){ +2438 qTweet_Q+=1; +2439 return 2; +2440 }else if(value =="REF"){ +2441 qTweet_REF+=1; +2442 return 4; +2443 }else if(value =="OK"){ +2444 qTweet_OK+=1; +2445 return 1; +2446 }else if(value =="KO"){ +2447 qTweet_KO+=1; +2448 return 3; +2449 }else if(value ==""){ +2450 qTweet_0+=1; +2451 return 5; +2452 } +2453 } +2454 +2455 +2456 this._serializer.sync(function(data) { loaded_callback.call(self, data) }); +2457 +2458 function loaded_callback (json) { +2459 +2460 // get current view (the first ???) +2461 view = json.views[0]; +2462 +2463 // the tweets are by definition of the second annotation type FIXME ? +2464 tweet_annot_type = null; +2465 if(typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) { +2466 tweet_annot_type = view.annotation_types[1]; +2467 } +2468 +2469 for(var i = 0; i < json.annotations.length; i++) { +2470 var item = json.annotations[i]; +2471 var MyTime = Math.floor(item.begin/duration*lineSize); +2472 var Myframe = Math.floor(MyTime/lineSize*frameLength); +2473 +2474 if (typeof(item.meta) !== "undefined" +2475 && typeof(item.meta["id-ref"]) !== "undefined" +2476 && item.meta["id-ref"] === tweet_annot_type) { +2477 +2478 var MyTJson = JSON.parse(item.meta['dc:source']['content']); +2479 +2480 if (item.content['polemics'] != undefined +2481 && item.content['polemics'][0] != null) { +2482 +2483 // a tweet can have many polemics at the same time. +2484 for(var j=0; j<item.content['polemics'].length; j++){ +2485 +2486 this.tweets[numberOfTweet] = { +2487 id:i, +2488 qualification:colorTranslation(item.content['polemics'][j]), +2489 yIndicator:MyTime, +2490 yframe:Myframe, +2491 title:item.content['title'], +2492 timeframe:item.begin, +2493 userId: MyTJson.id, +2494 userScreenName: MyTJson.screen_name, +2495 tsource:MyTJson, +2496 cinecast_id: item.id +2497 }; +2498 numberOfTweet+=1; +2499 +2500 } +2501 } +2502 else { +2503 this.tweets[numberOfTweet] = { +2504 id:i, +2505 qualification:colorTranslation(""), +2506 yIndicator:MyTime, +2507 yframe:Myframe, +2508 title:item.content['title'], +2509 timeframe:item.begin, +2510 userId: MyTJson.id, +2511 userScreenName: MyTJson.screen_name, +2512 tsource:MyTJson, +2513 cinecast_id: item.id +2514 }; +2515 numberOfTweet+=1; +2516 } +2517 +2518 } +2519 }; +2520 +2521 DrawTweets.call (this); // FIXME: ugly. +2522 +2523 }; +2524 +2525 // tweet Drawing (in raphael) +2526 function DrawTweets (){ +2527 // GROUPES TWEET ============================================ +2528 // Count nbr of cluster and tweet in a frame an save int in "frames" +2529 numberOfTweet = this.tweets.length; +2530 for(var i=0; i<nbrframes; i++) { +2531 for(var j=0; j<numberOfTweet; j++) { +2532 +2533 if (i==this.tweets[j].yframe){ +2534 +2535 var k = this.tweets[j].qualification; +2536 +2537 // make array for frame cluster +2538 if(frames[i]==undefined){ +2539 frames[i] = {id:i, +2540 qualifVol:new Array(), +2541 mytweetsID:new Array() +2542 }; +2543 } +2544 // add my tweet to frame +2545 frames[i].mytweetsID.push(this.tweets[j]); +2546 +2547 // count opinion by frame +2548 if( frames[i].qualifVol[k] == undefined){ +2549 frames[i].qualifVol[k] = 1; +2550 }else{ +2551 frames[i].qualifVol[k] += 1; +2552 } +2553 +2554 } +2555 } +2556 } +2557 +2558 // GROUPES TWEET ============================================ +2559 // max of tweet by Frame +2560 var max = 0; +2561 for(var i = 0; i < nbrframes; i++) { +2562 var moy = 0; +2563 for (var j = 0; j < 6; j++) { +2564 if (frames[i] != undefined) { +2565 if (frames[i].qualifVol[j] != undefined) { +2566 moy += frames[i].qualifVol[j]; +2567 } +2568 } +2569 } +2570 +2571 if (moy > max) { +2572 max = moy; +2573 } +2574 } +2575 +2576 var tweetDrawed = new Array(); +2577 var TweetHeight = 5; +2578 +2579 // DRAW TWEETS ============================================ +2580 for(var i = 0; i < nbrframes; i++) { +2581 var addEheight = 5; +2582 if (frames[i] != undefined){ +2583 // by type +2584 +2585 for (var j = 6; j > -1; j--) { +2586 if (frames[i].qualifVol[j] != undefined) { +2587 // show tweet by type +2588 for (var k = 0; k < frames[i].mytweetsID.length; k++) { +2589 +2590 if (frames[i].mytweetsID[k].qualification == j) { +2591 var x = i * frameSize; +2592 var y = this.heightmax - addEheight; +2593 +2594 if (this.yMax > y) { +2595 this.yMax = y; +2596 } +2597 +2598 var e = this.paper.rect(x, y, frameSize - margin, TweetHeight /* height */) +2599 .attr({stroke:"#00","stroke-width":0.1, fill: colors[j]}); +2600 +2601 addEheight += TweetHeight; +2602 +2603 e.color = colors[j]; +2604 e.time = frames[i].mytweetsID[k].timeframe; +2605 e.title = frames[i].mytweetsID[k].title; +2606 e.id = frames[i].mytweetsID[k].cinecast_id; +2607 +2608 this.svgElements[e.id] = e; +2609 +2610 /* +2611 e.mouseover(function(element) { return function (event) { +2612 // event.clientX and event.clientY are to raphael what event.pageX and pageY are to jquery. +2613 self.TooltipWidget.show.call(self.TooltipWidget, element.title, element.attr("fill"), event.clientX - 106, event.clientY - 160); +2614 element.displayed = true; +2615 }}(e)).mouseout(function(element) { return function () { +2616 self.TooltipWidget.hide.call(self.TooltipWidget); +2617 }}(e)).mousedown(function () { +2618 self._Popcorn.currentTime(this.time/1000); +2619 self._Popcorn.trigger("IriSP.PolemicTweet.click", this.id); +2620 }); +2621 */ +2622 +2623 IriSP.jQuery(e.node).mouseenter(function(element) { return function (event) { +2624 // event.clientX and event.clientY are to raphael what event.pageX and pageY are to jquery. +2625 self.TooltipWidget.show.call(self.TooltipWidget, element.title, element.attr("fill"), event.pageX - 106, event.pageY - 160); +2626 element.displayed = true; +2627 }}(e)).mousedown(function(element) { return function () { +2628 self._Popcorn.currentTime(element.time/1000); +2629 self._Popcorn.trigger("IriSP.PolemicTweet.click", element.id); +2630 } +2631 }(e)); +2632 +2633 IriSP.jQuery(e.node).attr('id', 't' + k + ''); +2634 IriSP.jQuery(e.node).attr('title', frames[i].mytweetsID[k].title); +2635 IriSP.jQuery(e.node).attr('begin', frames[i].mytweetsID[k].timeframe); +2636 } +2637 } +2638 } +2639 } +2640 } +2641 +2642 } +2643 // DRAW UI :: resize border and bgd +2644 this.paperBackground = this.paper.rect(0, 0, this.width, this.heightmax).attr({fill:"#F8F8F8","stroke-width":0.1,opacity: 1}); +2645 +2646 // outer borders +2647 this.outerBorders = []; +2648 this.outerBorders.push(this.paper.rect(0, this.height - 1, this.width, 1).attr({fill:"#ababab",stroke: "none",opacity: 1})); +2649 this.outerBorders.push(this.paper.rect(0, 0, this.width, 1).attr({fill:"#ababab",stroke: "none",opacity: 1})); +2650 +2651 // inner borders +2652 this.innerBorders = []; +2653 this.innerBorders.push(this.paper.rect(1, this.height - 2, this.width, 1).attr({fill:"#efefef",stroke: "none",opacity: 1})); +2654 this.innerBorders.push(this.paper.rect(1, 1, this.width, 1).attr({fill:"#efefef",stroke: "none",opacity: 1})); +2655 this.innerBorders.push(this.paper.rect(1, 1, 1, this.height - 2).attr({fill:"#d0d1d1",stroke: "none",opacity: 0.8})); +2656 this.innerBorders.push(this.paper.rect(this.width - 2, 1, 1, this.height - 2).attr({fill:"#efefef",stroke: "none",opacity: 1})); +2657 +2658 +2659 +2660 this.paperSlider = this.paper.rect(0, 0, 0, this.heightmax).attr({fill:"#D4D5D5", stroke: "none", opacity: 1}); +2661 +2662 // the small white line displayed over the slider. +2663 this.sliderTip = this.paper.rect(0, 0, 1, this.heightmax).attr({fill:"#fc00ff", stroke: "none", opacity: 1}); +2664 // decalage +2665 // tweetSelection = this.paper.rect(-100,-100,5,5).attr({fill:"#fff",stroke: "none",opacity: 1}); +2666 +2667 +2668 this.paperSlider.toBack(); +2669 this.paperBackground.toBack(); +2670 this.sliderTip.toFront(); +2671 } +2672 +2673 this.selector.mouseleave(IriSP.wrap(this, function() { self.TooltipWidget.hide.call(self.TooltipWidget); })); +2674 this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.sliderUpdater)); +2675 } +2676 +2677 IriSP.PolemicWidget.prototype.sliderUpdater = function() { +2678 +2679 var time = +this._Popcorn.currentTime(); +2680 var duration = +this._serializer.currentMedia().meta["dc:duration"]; +2681 +2682 this.paperSlider.attr("width", time * (this.width / (duration / 1000))); +2683 +2684 this.sliderTip.attr("x", time * (this.width / (duration / 1000))); +2685 }; +2686 +2687 IriSP.PolemicWidget.prototype.searchHandler = function(searchString) { +2688 if (searchString == "") +2689 return; +2690 +2691 var matches = this._serializer.searchTweetsOccurences(searchString); +2692 +2693 if (IriSP.countProperties(matches) > 0) { +2694 this._Popcorn.trigger("IriSP.search.matchFound"); +2695 } else { +2696 this._Popcorn.trigger("IriSP.search.noMatchFound"); +2697 } +2698 +2699 for (var id in matches) { +2700 if (this.svgElements.hasOwnProperty(id)) { +2701 var e = this.svgElements[id]; +2702 this.svgElements[id].attr({fill: "#fc00ff"}); +2703 } +2704 } +2705 +2706 // clean up the blocks that were in the previous search +2707 // but who aren't in the current one. +2708 for (var id in this.oldSearchMatches) { +2709 if (!matches.hasOwnProperty(id)) { +2710 var e = this.svgElements[id]; +2711 e.attr({fill: e.color}); +2712 } +2713 } +2714 +2715 this.oldSearchMatches = matches; +2716 }; +2717 +2718 IriSP.PolemicWidget.prototype.searchFieldClearedHandler = function() { +2719 // clean up the blocks that were in the previous search +2720 // but who aren't in the current one. +2721 for (var id in this.oldSearchMatches) { +2722 var e = this.svgElements[id]; +2723 e.attr({fill: e.color}); +2724 } +2725 +2726 }; +2727 +2728 IriSP.PolemicWidget.prototype.searchFieldClosedHandler = function() { +2729 // clean up the blocks that were in the previous search +2730 // but who aren't in the current one. +2731 for (var id in this.oldSearchMatches) { +2732 var e = this.svgElements[id]; +2733 e.attr({fill: e.color}); +2734 } +2735 +2736 }; +2737 +2738 IriSP.SegmentsWidget = function(Popcorn, config, Serializer) { +2739 +2740 var self = this; +2741 IriSP.Widget.call(this, Popcorn, config, Serializer); +2742 this.oldSearchMatches = []; +2743 +2744 // event handlers +2745 this._Popcorn.listen("IriSP.search", function(searchString) { self.searchHandler.call(self, searchString); }); +2746 this._Popcorn.listen("IriSP.search.closed", function() { self.searchFieldClosedHandler.call(self); }); +2747 this._Popcorn.listen("IriSP.search.cleared", function() { self.searchFieldClearedHandler.call(self); }); +2748 }; +2749 +2750 IriSP.SegmentsWidget.prototype = new IriSP.Widget(); +2751 +2752 /* Get the width of a segment, in pixels. */ +2753 IriSP.SegmentsWidget.prototype.segmentToPixel = function(annotation) { +2754 var begin = Math.round((+ annotation.begin) / 1000); +2755 var end = Math.round((+ annotation.end) / 1000); +2756 var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000; +2757 +2758 var startPourcent = IriSP.timeToPourcent(begin, duration); +2759 var startPixel = Math.floor(this.selector.parent().width() * (startPourcent / 100)); +2760 +2761 var endPourcent = Math.floor(IriSP.timeToPourcent(end, duration) - startPourcent); +2762 var endPixel = Math.floor(this.selector.parent().width() * (endPourcent / 100)); +2763 +2764 return endPixel; +2765 }; +2766 +2767 /* compute the total length of a group of segments */ +2768 IriSP.SegmentsWidget.prototype.segmentsLength = function(segmentsList) { +2769 var self = this; +2770 var total = 0; +2771 +2772 for (var i = 0; i < segmentsList.length; i++) +2773 total += self.segmentToPixel(segmentsList[i].annotation); +2774 +2775 return total; +2776 }; +2777 +2778 IriSP.SegmentsWidget.prototype.draw = function() { +2779 +2780 var self = this; +2781 var annotations = this._serializer._data.annotations; +2782 +2783 this.selector.addClass("Ldt-SegmentsWidget"); +2784 this.selector.append(Mustache.to_html(IriSP.overlay_marker_template)); +2785 +2786 var view_type = this._serializer.getNonTweetIds()[0]; +2787 +2788 this.positionMarker = this.selector.children(":first"); +2789 +2790 this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.positionUpdater)); +2791 +2792 +2793 var i = 0; +2794 +2795 var segments_annotations = []; +2796 +2797 for (i = 0; i < annotations.length; i++) { +2798 var annotation = annotations[i]; +2799 +2800 /* filter the annotations whose type is not the one we want */ +2801 if (view_type != "" && typeof(annotation.meta) !== "undefined" && typeof(annotation.meta["id-ref"]) !== "undefined" +2802 && annotation.meta["id-ref"] != view_type) { +2803 continue; +2804 } +2805 +2806 segments_annotations.push(annotation); +2807 } +2808 +2809 var totalWidth = this.selector.width() - segments_annotations.length; +2810 var lastSegment = IriSP.underscore.max(segments_annotations, function(annotation) { return annotation.end; }); +2811 +2812 for (i = 0; i < segments_annotations.length; i++) { +2813 +2814 var annotation = segments_annotations[i]; +2815 var begin = (+ annotation.begin); +2816 var end = (+ annotation.end); +2817 var duration = this._serializer.currentMedia().meta["dc:duration"]; +2818 var id = annotation.id; +2819 +2820 var startPixel = Math.floor(this.selector.parent().width() * (begin / duration)); +2821 +2822 var endPixel = Math.floor(this.selector.parent().width() * (end / duration)); +2823 +2824 if (annotation.id !== lastSegment.id) +2825 var pxWidth = endPixel - startPixel -1; +2826 else +2827 /* the last segment has no segment following it */ +2828 var pxWidth = endPixel - startPixel; +2829 +2830 var divTitle = (annotation.content.title + " - " + annotation.content.description).substr(0,55); +2831 +2832 if (typeof(annotation.content.color) !== "undefined") +2833 var color = annotation.content.color; +2834 else +2835 var color = annotation.color; +2836 +2837 var hexa_color = IriSP.DEC_HEXA_COLOR(color); +2838 +2839 if (hexa_color === "FFCC00") +2840 hexa_color = "333"; +2841 if (hexa_color.length == 4) +2842 hexa_color = hexa_color + '00'; +2843 +2844 var annotationTemplate = Mustache.to_html(IriSP.annotation_template, +2845 {"divTitle" : divTitle, "id" : id, "startPixel" : startPixel, +2846 "pxWidth" : pxWidth, "hexa_color" : hexa_color, +2847 "seekPlace" : Math.round(begin/1000)}); +2848 +2849 +2850 this.selector.append(annotationTemplate); +2851 +2852 /* add a special class to the last segment and change its border */ +2853 if (annotation.id === lastSegment.id) { +2854 this.selector.find("#" + id).addClass("Ldt-lastSegment"); +2855 this.selector.find(".Ldt-lastSegment").css("border-color", "#" + hexa_color); +2856 } +2857 +2858 IriSP.jQuery("#" + id).fadeTo(0, 0.3); +2859 +2860 IriSP.jQuery("#" + id).mouseover( +2861 /* we wrap the handler in another function because js's scoping +2862 rules are function-based - otherwise, the internal vars like +2863 divTitle are preserved but they are looked-up from the draw +2864 method scope, so after that the loop is run, so they're not +2865 preserved */ +2866 (function(divTitle) { +2867 return function(event) { +2868 IriSP.jQuery(this).animate({opacity: 0.6}, 5); +2869 var offset = IriSP.jQuery(this).offset(); +2870 var correction = IriSP.jQuery(this).outerWidth() / 2; +2871 +2872 var offset_x = offset.left + correction - 106; +2873 if (offset_x < 0) +2874 offset_x = 0; +2875 +2876 self.TooltipWidget.show(divTitle, color, offset_x, event.pageY - 160); +2877 } })(divTitle)).mouseout(function(){ +2878 IriSP.jQuery(this).animate({opacity: 0.3}, 5); +2879 self.TooltipWidget.hide(); +2880 }); +2881 +2882 IriSP.jQuery("#" + id).click(function(_this, annotation) { +2883 return function() { _this.clickHandler(annotation)}; +2884 }(this, annotation)); +2885 } +2886 }; +2887 +2888 /* restores the view after a search */ +2889 IriSP.SegmentsWidget.prototype.clear = function() { +2890 this.selector.children(".Ldt-iri-chapter").animate({opacity:0.3}, 100); +2891 }; +2892 +2893 IriSP.SegmentsWidget.prototype.clickHandler = function(annotation) { +2894 this._Popcorn.trigger("IriSP.SegmentsWidget.click", annotation.id); +2895 var begin = (+ annotation.begin) / 1000; +2896 this._Popcorn.currentTime(Math.round(begin)); +2897 }; +2898 +2899 IriSP.SegmentsWidget.prototype.searchHandler = function(searchString) { +2900 +2901 if (searchString == "") +2902 return; +2903 +2904 var matches = this._serializer.searchOccurences(searchString); +2905 +2906 if (IriSP.countProperties(matches) > 0) { +2907 this._Popcorn.trigger("IriSP.search.matchFound"); +2908 } else { +2909 this._Popcorn.trigger("IriSP.search.noMatchFound"); +2910 } +2911 +2912 // un-highlight all the blocks +2913 this.selector.children(".Ldt-iri-chapter").css("opacity", 0.1); +2914 +2915 // then highlight the ones with matches. +2916 for (var id in matches) { +2917 var factor = 0.5 + matches[id] * 0.2; +2918 this.selector.find("#"+id).dequeue(); +2919 this.selector.find("#"+id).animate({opacity:factor}, 200); +2920 } +2921 +2922 +2923 this.oldSearchMatches = matches; +2924 }; +2925 +2926 IriSP.SegmentsWidget.prototype.searchFieldClearedHandler = function() { +2927 this.clear(); +2928 }; +2929 +2930 IriSP.SegmentsWidget.prototype.searchFieldClosedHandler = function() { +2931 this.clear(); +2932 }; +2933 +2934 IriSP.SegmentsWidget.prototype.positionUpdater = function() { +2935 var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000; +2936 var time = this._Popcorn.currentTime(); +2937 //var position = ((time / duration) * 100).toFixed(2); +2938 var position = ((time / duration) * 100).toFixed(2); +2939 +2940 this.positionMarker.css("left", position + "%"); +2941 }; +2942 IriSP.SliderWidget = function(Popcorn, config, Serializer) { +2943 IriSP.Widget.call(this, Popcorn, config, Serializer); +2944 }; +2945 +2946 IriSP.SliderWidget.prototype = new IriSP.Widget(); +2947 +2948 IriSP.SliderWidget.prototype.draw = function() { +2949 var self = this; +2950 +2951 this.selector.append(Mustache.to_html(IriSP.sliderWidget_template, {})); +2952 this.selector.addClass("Ldt-SliderMinimized"); +2953 +2954 this.sliderBackground = this.selector.find(".Ldt-sliderBackground"); +2955 this.sliderForeground = this.selector.find(".Ldt-sliderForeground"); +2956 this.positionMarker = this.selector.find(".Ldt-sliderPositionMarker"); +2957 +2958 +2959 // a special variable to stop methods from tinkering +2960 // with the positionMarker when the user is dragging it +2961 this.draggingOngoing = false; +2962 +2963 // another special variable used by the timeout handler to +2964 // open or close the slider. +2965 this.sliderMaximized = false; +2966 this.timeOutId = null; +2967 +2968 +2969 this.positionMarker.draggable({axis: "x", +2970 start: IriSP.wrap(this, this.positionMarkerDraggingStartedHandler), +2971 stop: IriSP.wrap(this, this.positionMarkerDraggedHandler), +2972 containment: "parent" +2973 }); +2974 this.positionMarker.css("position", "absolute"); +2975 +2976 this.sliderBackground.click(function(event) { self.backgroundClickHandler.call(self, event); }); +2977 this.sliderForeground.click(function(event) { self.foregroundClickHandler.call(self, event); }); +2978 +2979 this.selector.hover(IriSP.wrap(this, this.mouseOverHandler), IriSP.wrap(this, this.mouseOutHandler)); +2980 +2981 // update the positions +2982 this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.sliderUpdater)); +2983 +2984 // special messages : +2985 this._Popcorn.listen("IriSP.PlayerWidget.MouseOver", IriSP.wrap(this, this.mouseOverHandler)); +2986 this._Popcorn.listen("IriSP.PlayerWidget.MouseOut", IriSP.wrap(this, this.mouseOutHandler)); +2987 }; +2988 +2989 /* update the slider and the position marker as time passes */ +2990 IriSP.SliderWidget.prototype.sliderUpdater = function() { +2991 if(this.draggingOngoing || this._disableUpdate) +2992 return; +2993 +2994 var time = this._Popcorn.currentTime(); +2995 +2996 var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000; +2997 var percent = ((time / duration) * 100).toFixed(2); +2998 +2999 /* we do these complicated calculations to center exactly +3000 the position Marker */ +3001 var pixels_to_percents = 100 / this.selector.width(); /* how much is a pixel in percents */ +3002 var positionMarker_width = this.positionMarker.width(); +3003 var correction = (pixels_to_percents * positionMarker_width) / 2; +3004 +3005 var newPos = percent - correction; +3006 if (newPos <= 0) +3007 newPos = 0; +3008 +3009 this.sliderForeground.css("width", percent + "%"); +3010 this.positionMarker.css("left", newPos + "%"); +3011 +3012 }; +3013 +3014 IriSP.SliderWidget.prototype.backgroundClickHandler = function(event) { +3015 /* this piece of code is a little bit convoluted - here's how it works : +3016 we want to handle clicks on the progress bar and convert those to seeks in the media. +3017 However, jquery only gives us a global position, and we want a number of pixels relative +3018 to our container div, so we get the parent position, and compute an offset to this position, +3019 and finally compute the progress ratio in the media. +3020 Finally we multiply this ratio with the duration to get the correct time +3021 */ +3022 +3023 var parentOffset = this.sliderBackground.parent().offset(); +3024 var width = this.sliderBackground.width(); +3025 var relX = event.pageX - parentOffset.left; +3026 +3027 var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000; +3028 var newTime = ((relX / width) * duration).toFixed(2); +3029 +3030 this._Popcorn.currentTime(newTime); +3031 }; +3032 +3033 /* same function as the previous one, except that it handles clicks +3034 on the foreground element */ +3035 IriSP.SliderWidget.prototype.foregroundClickHandler = function(event) { +3036 var parentOffset = this.sliderForeground.parent().offset(); +3037 var width = this.sliderBackground.width(); +3038 var relX = event.pageX - parentOffset.left; +3039 +3040 var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000; +3041 var newTime = ((relX / width) * duration).toFixed(2); +3042 +3043 this._Popcorn.currentTime(newTime); +3044 }; +3045 +3046 /* handles mouse over the slider */ +3047 IriSP.SliderWidget.prototype.mouseOverHandler = function(event) { +3048 +3049 if (this.timeOutId !== null) { +3050 window.clearTimeout(this.timeOutId); +3051 } +3052 +3053 this.sliderMaximized = true; +3054 +3055 this.sliderBackground.animate({"height": "9px"}, 100); +3056 this.sliderForeground.animate({"height": "9px"}, 100); +3057 this.positionMarker.animate({"height": "9px", "width": "9px"}, 100); +3058 //this.positionMarker.css("margin-top", "-4px"); +3059 +3060 // this.selector.removeClass("Ldt-SliderMinimized"); +3061 // this.selector.addClass("Ldt-SliderMaximized"); +3062 }; +3063 +3064 /* handles when the mouse leaves the slider */ +3065 IriSP.SliderWidget.prototype.mouseOutHandler = function(event) { +3066 +3067 this.timeOutId = window.setTimeout(IriSP.wrap(this, this.minimizeOnTimeout), +3068 IriSP.widgetsDefaults.SliderWidget.minimize_period); +3069 }; +3070 +3071 IriSP.SliderWidget.prototype.minimizeOnTimeout = function(event) { +3072 this.sliderBackground.animate({"height": "5px"}, 100); +3073 this.sliderForeground.animate({"height": "5px"}, 100); +3074 this.positionMarker.animate({"height": "5px", "width": "5px"}, 100); +3075 this.positionMarker.css("margin-top", "0px"); +3076 this.sliderMinimized = true; +3077 +3078 // this.selector.removeClass("Ldt-SliderMaximized"); +3079 // this.selector.addClass("Ldt-SliderMinimized"); +3080 +3081 }; +3082 +3083 // called when the user starts dragging the position indicator +3084 IriSP.SliderWidget.prototype.positionMarkerDraggingStartedHandler = function(event, ui) { +3085 this.draggingOngoing = true; +3086 }; +3087 +3088 IriSP.SliderWidget.prototype.positionMarkerDraggedHandler = function(event, ui) { +3089 this._disableUpdate = true; // disable slider position updates while dragging is ongoing. +3090 window.setTimeout(IriSP.wrap(this, function() { this._disableUpdate = false; }), 500); +3091 +3092 var parentOffset = this.sliderForeground.parent().offset(); +3093 var width = this.sliderBackground.width(); +3094 var relX = event.pageX - parentOffset.left; +3095 +3096 var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000; +3097 var newTime = ((relX / width) * duration).toFixed(2); +3098 +3099 this._Popcorn.currentTime(newTime); +3100 +3101 this.draggingOngoing = false; +3102 }; +3103 +3104 /* this widget displays a small tooltip */ +3105 IriSP.TooltipWidget = function(Popcorn, config, Serializer) { +3106 IriSP.Widget.call(this, Popcorn, config, Serializer); +3107 this._shown = false; +3108 this._displayedText = ""; +3109 this._hideTimeout = -1; +3110 }; +3111 +3112 +3113 IriSP.TooltipWidget.prototype = new IriSP.Widget(); +3114 +3115 IriSP.TooltipWidget.prototype.draw = function() { +3116 var templ = Mustache.to_html(IriSP.tooltipWidget_template); +3117 +3118 this.selector.append(templ); +3119 this.hide(); +3120 +3121 }; +3122 +3123 IriSP.TooltipWidget.prototype.clear = function() { +3124 this.selector.find(".tiptext").text(""); +3125 }; +3126 +3127 IriSP.TooltipWidget.prototype.show = function(text, color, x, y) { +3128 +3129 if (this._displayedText == text) +3130 return; +3131 +3132 this.selector.find(".tipcolor").css("background-color", color); +3133 this._displayedText = text; +3134 this.selector.find(".tiptext").text(text); +3135 //this.selector.find(".tip").css("left", x).css("top", y); +3136 this.selector.find(".tip").css("left", x).css("top", y); +3137 this.selector.find(".tip").show(); +3138 this._shown = true; +3139 }; +3140 +3141 IriSP.TooltipWidget.prototype.hide = function() { +3142 this.selector.find(".tip").hide(); +3143 this._shown = false; +3144 };/* a widget that displays tweet - used in conjunction with the polemicWidget */ +3145 +3146 IriSP.TweetsWidget = function(Popcorn, config, Serializer) { +3147 IriSP.Widget.call(this, Popcorn, config, Serializer); +3148 +3149 this._displayingTweet = false; +3150 this._timeoutId = undefined; +3151 }; +3152 +3153 +3154 IriSP.TweetsWidget.prototype = new IriSP.Widget(); +3155 +3156 +3157 IriSP.TweetsWidget.prototype.drawTweet = function(annotation) { +3158 +3159 var title = IriSP.formatTweet(annotation.content.title); +3160 var img = annotation.content.img.src; +3161 if (typeof(img) === "undefined" || img === "" || img === "None") { +3162 img = IriSP.widgetsDefaults.TweetsWidget.default_profile_picture; +3163 } +3164 +3165 var imageMarkup = IriSP.templToHTML("<img src='{{src}}' alt='user image'></img>", +3166 {src : img}); +3167 +3168 if (typeof(annotation.meta["dc:source"].content) !== "undefined") { +3169 var tweetContents = JSON.parse(annotation.meta["dc:source"].content); +3170 var creator = tweetContents.user.screen_name; +3171 var real_name = tweetContents.user.name; +3172 +3173 imageMarkup = IriSP.templToHTML("<a href='http://twitter.com/{{creator}}'><img src='{{src}}' alt='user image'></img></a>", +3174 {src : img, creator: creator}); +3175 +3176 var formatted_date = new Date(tweetContents.created_at).toLocaleDateString(); +3177 title = IriSP.templToHTML("<a class='Ldt-tweet_userHandle' href='http://twitter.com/{{creator}}'>@{{creator}}</a> - " + +3178 "<div class='Ldt-tweet_realName'>{{real_name}}</div>" + +3179 "<div class='Ldt-tweet_tweetContents'>{{{ contents }}}</div>" + +3180 "<div class='Ldt-tweet_date'>{{ date }}</div>", +3181 {creator: creator, real_name: real_name, contents : title, date : formatted_date}); +3182 +3183 this.selector.find(".Ldt-TweetReply").attr("href", "http://twitter.com/home?status=@" + creator + ":%20"); +3184 +3185 +3186 var rtText = Mustache.to_html("http://twitter.com/home?status=RT @{{creator}}: {{text}}", +3187 {creator: creator, text: IriSP.encodeURI(annotation.content.title)}); +3188 this.selector.find(".Ldt-Retweet").attr("href", rtText); +3189 } +3190 +3191 this.selector.find(".Ldt-tweetContents").html(title); +3192 this.selector.find(".Ldt-tweetAvatar").html(imageMarkup); +3193 this.selector.show("blind", 250); +3194 }; +3195 +3196 IriSP.TweetsWidget.prototype.displayTweet = function(annotation) { +3197 if (this._displayingTweet === false) { +3198 this._displayingTweet = true; +3199 } else { +3200 window.clearTimeout(this._timeoutId); +3201 } +3202 +3203 this.drawTweet(annotation); +3204 +3205 var time = this._Popcorn.currentTime(); +3206 this._timeoutId = window.setTimeout(IriSP.wrap(this, this.clearPanel), IriSP.widgetsDefaults.TweetsWidget.tweet_display_period); +3207 }; +3208 +3209 +3210 IriSP.TweetsWidget.prototype.clearPanel = function() { +3211 this._displayingTweet = false; +3212 this._timeoutId = undefined; +3213 this.closePanel(); +3214 +3215 }; +3216 +3217 IriSP.TweetsWidget.prototype.closePanel = function() { +3218 if (this._timeoutId != undefined) { +3219 /* we're called from the "close window" link */ +3220 /* cancel the timeout */ +3221 window.clearTimeout(this._timeoutId); +3222 this._timeoutId = null; +3223 } +3224 +3225 this.selector.hide("blind", 400); +3226 +3227 }; +3228 +3229 /* cancel the timeout if the user clicks on the keep panel open button */ +3230 IriSP.TweetsWidget.prototype.keepPanel = function() { +3231 if (this._timeoutId != undefined) { +3232 /* we're called from the "close window" link */ +3233 /* cancel the timeout */ +3234 window.clearTimeout(this._timeoutId); +3235 this._timeoutId = null; +3236 } +3237 }; +3238 +3239 IriSP.TweetsWidget.prototype.draw = function() { +3240 var _this = this; +3241 +3242 var tweetMarkup = IriSP.templToHTML(IriSP.tweetWidget_template, {"share_template" : IriSP.share_template}); +3243 this.selector.append(tweetMarkup); +3244 this.selector.hide(); +3245 this.selector.find(".Ldt-tweetWidgetMinimize").click(IriSP.wrap(this, this.closePanel)); +3246 this.selector.find(".Ldt-tweetWidgetKeepOpen").click(IriSP.wrap(this, this.keepPanel)); +3247 +3248 this._Popcorn.listen("IriSP.PolemicTweet.click", IriSP.wrap(this, this.PolemicTweetClickHandler)); +3249 }; +3250 +3251 IriSP.TweetsWidget.prototype.PolemicTweetClickHandler = function(tweet_id) { +3252 var index, annotation; +3253 for (index in this._serializer._data.annotations) { +3254 annotation = this._serializer._data.annotations[index]; +3255 +3256 if (annotation.id === tweet_id) +3257 break; +3258 } +3259 +3260 if (annotation.id !== tweet_id) +3261 /* we haven't found it */ +3262 return; +3263 +3264 this.displayTweet(annotation); +3265 return; +3266 }; +3267 +3268 IriSP.JSONSerializer = function(DataLoader, url) { +3269 IriSP.Serializer.call(this, DataLoader, url); +3270 }; +3271 +3272 IriSP.JSONSerializer.prototype = new IriSP.Serializer(); +3273 +3274 IriSP.JSONSerializer.prototype.serialize = function(data) { +3275 return JSON.stringify(data); +3276 }; +3277 +3278 IriSP.JSONSerializer.prototype.deserialize = function(data) { +3279 return JSON.parse(data); +3280 }; +3281 +3282 IriSP.JSONSerializer.prototype.sync = function(callback) { +3283 /* we don't have to do much because jQuery handles json for us */ +3284 +3285 var self = this; +3286 +3287 var fn = function(data) { +3288 self._data = data; +3289 // sort the data too +3290 self._data["annotations"].sort(function(a, b) +3291 { var a_begin = +a.begin; +3292 var b_begin = +b.begin; +3293 return a_begin - b_begin; +3294 }); +3295 +3296 callback(data); +3297 }; +3298 +3299 this._DataLoader.get(this._url, fn); +3300 }; +3301 +3302 IriSP.JSONSerializer.prototype.currentMedia = function() { +3303 return this._data.medias[0]; /* FIXME: don't hardcode it */ +3304 }; +3305 +3306 /* this function searches for an annotation which matches title, description and keyword +3307 "" matches any field. +3308 Note: it ignores tweets. +3309 */ +3310 IriSP.JSONSerializer.prototype.searchAnnotations = function(title, description, keyword) { +3311 /* we can have many types of annotations. We want search to only look for regular segments */ +3312 /* the next two lines are a bit verbose because for some test data, _serializer.data.view is either +3313 null or undefined. +3314 */ +3315 var view; +3316 +3317 if (typeof(this._data.views) !== "undefined" && this._data.views !== null) +3318 view = this._data.views[0]; +3319 +3320 var searchViewType = ""; +3321 +3322 if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) { +3323 searchViewType = view.annotation_types[0]; +3324 } +3325 +3326 var filterfn = function(annotation) { +3327 if( searchViewType != "" && +3328 typeof(annotation.meta) !== "undefined" && +3329 typeof(annotation.meta["id-ref"]) !== "undefined" && +3330 annotation.meta["id-ref"] !== searchViewType) { +3331 return true; // don't pass +3332 } else { +3333 return false; +3334 } +3335 }; +3336 +3337 return this.searchAnnotationsFilter(title, description, keyword, filterfn); +3338 +3339 }; +3340 +3341 /* only look for tweets */ +3342 IriSP.JSONSerializer.prototype.searchTweets = function(title, description, keyword) { +3343 /* we can have many types of annotations. We want search to only look for regular segments */ +3344 /* the next two lines are a bit verbose because for some test data, _serializer.data.view is either +3345 null or undefined. +3346 */ +3347 var view; +3348 +3349 if (typeof(this._data.views) !== "undefined" && this._data.views !== null) +3350 view = this._data.views[0]; +3351 +3352 var searchViewType = ""; +3353 +3354 if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) { +3355 searchViewType = view.annotation_types[0]; +3356 } +3357 +3358 var filterfn = function(annotation) { +3359 if( searchViewType != "" && +3360 typeof(annotation.meta) !== "undefined" && +3361 typeof(annotation.meta["id-ref"]) !== "undefined" && +3362 annotation.meta["id-ref"] !== searchViewType) { +3363 return false; // pass +3364 } else { +3365 return true; +3366 } +3367 }; +3368 +3369 return this.searchAnnotationsFilter(title, description, keyword, filterfn); +3370 +3371 }; +3372 +3373 /* +3374 the previous function call this one, which is more general: +3375 */ +3376 IriSP.JSONSerializer.prototype.searchAnnotationsFilter = function(title, description, keyword, filter) { +3377 +3378 var rTitle; +3379 var rDescription; +3380 var rKeyword; +3381 /* match anything if given the empty string */ +3382 if (title == "") +3383 title = ".*"; +3384 if (description == "") +3385 description = ".*"; +3386 if (keyword == "") +3387 keyword = ".*"; +3388 +3389 rTitle = new RegExp(title, "i"); +3390 rDescription = new RegExp(description, "i"); +3391 rKeyword = new RegExp(keyword, "i"); +3392 +3393 var ret_array = []; +3394 +3395 var i; +3396 for (i in this._data.annotations) { +3397 var annotation = this._data.annotations[i]; +3398 +3399 /* filter the annotations whose type is not the one we want */ +3400 if (filter(annotation)) { +3401 continue; +3402 } +3403 +3404 if (rTitle.test(annotation.content.title) && +3405 rDescription.test(annotation.content.description)) { +3406 /* FIXME : implement keyword support */ +3407 ret_array.push(annotation); +3408 } +3409 } +3410 +3411 return ret_array; +3412 }; +3413 +3414 /* breaks a string in words and searches each of these words. Returns an array +3415 of objects with the id of the annotation and its number of occurences. +3416 +3417 FIXME: optimize ? seems to be n^2 in the worst case. +3418 */ +3419 IriSP.JSONSerializer.prototype.searchOccurences = function(searchString) { +3420 var ret = { }; +3421 var keywords = searchString.split(/\s+/); +3422 +3423 for (var i in keywords) { +3424 var keyword = keywords[i]; +3425 +3426 // search this keyword in descriptions and title +3427 var found_annotations = [] +3428 found_annotations = found_annotations.concat(this.searchAnnotations(keyword, "", "")); +3429 found_annotations = found_annotations.concat(this.searchAnnotations("", keyword, "")); +3430 +3431 for (var j in found_annotations) { +3432 var current_annotation = found_annotations[j]; +3433 +3434 if (!ret.hasOwnProperty(current_annotation.id)) { +3435 ret[current_annotation.id] = 1; +3436 } else { +3437 ret[current_annotation.id] += 1; +3438 } +3439 +3440 } +3441 +3442 }; +3443 +3444 return ret; +3445 }; +3446 +3447 /* breaks a string in words and searches each of these words. Returns an array +3448 of objects with the id of the annotation and its number of occurences. +3449 +3450 FIXME: optimize ? seems to be n^2 in the worst case. +3451 */ +3452 IriSP.JSONSerializer.prototype.searchTweetsOccurences = function(searchString) { +3453 var ret = { }; +3454 var keywords = searchString.split(/\s+/); +3455 +3456 for (var i in keywords) { +3457 var keyword = keywords[i]; +3458 +3459 // search this keyword in descriptions and title +3460 var found_annotations = [] +3461 found_annotations = found_annotations.concat(this.searchTweets(keyword, "", "")); +3462 found_annotations = found_annotations.concat(this.searchTweets("", keyword, "")); +3463 +3464 for (var j in found_annotations) { +3465 var current_annotation = found_annotations[j]; +3466 +3467 if (!ret.hasOwnProperty(current_annotation.id)) { +3468 ret[current_annotation.id] = 1; +3469 } else { +3470 ret[current_annotation.id] += 1; +3471 } +3472 +3473 } +3474 +3475 }; +3476 +3477 return ret; +3478 }; +3479 +3480 /* takes the currentTime and returns all the annotations that are displayable at the moment +3481 NB: only takes account the first type of annotations - ignores tweets +3482 currentTime is in seconds. +3483 */ +3484 +3485 IriSP.JSONSerializer.prototype.currentAnnotations = function(currentTime) { +3486 var view; +3487 var currentTimeMs = 1000 * currentTime; +3488 +3489 if (typeof(this._data.views) !== "undefined" && this._data.views !== null) +3490 view = this._data.views[0]; +3491 +3492 var view_type = ""; +3493 +3494 if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length >= 1) { +3495 view_type = view.annotation_types[0]; +3496 } +3497 +3498 var ret_array = []; +3499 +3500 var i; +3501 +3502 for (i in this._data.annotations) { +3503 var annotation = this._data.annotations[i]; +3504 +3505 if (annotation.meta["id-ref"] === view_type && annotation.begin <= currentTimeMs && annotation.end >= currentTimeMs) +3506 ret_array.push(annotation); +3507 } +3508 +3509 return ret_array; +3510 }; +3511 +3512 +3513 /* this function returns a list of ids of tweet lines */ +3514 IriSP.JSONSerializer.prototype.getTweetIds = function() { +3515 if (typeof(this._data.lists) === "undefined" || this._data.lists === null) +3516 return []; +3517 +3518 var tweetsId = []; +3519 +3520 /* first get the list containing the tweets */ +3521 var tweets = IriSP.underscore.filter(this._data.lists, function(entry) { return entry.id.indexOf("tweet") !== -1 }); +3522 +3523 // FIXME: collect tweets from multiple sources ? +3524 tweetsId = IriSP.underscore.pluck(tweets[0].items, "id-ref"); +3525 +3526 return tweetsId; +3527 }; +3528 +3529 /* this function returns a list of lines which are not tweet lines */ +3530 IriSP.JSONSerializer.prototype.getNonTweetIds = function() { +3531 if (typeof(this._data.lists) === "undefined" || this._data.lists === null) +3532 return []; +3533 +3534 /* get all the ids */ +3535 var ids = IriSP.underscore.map(this._data.lists, function(entry) { +3536 return IriSP.underscore.pluck(entry.items, "id-ref"); }); +3537 +3538 var illegal_values = this.getTweetIds(); +3539 return IriSP.underscore.difference(ids, illegal_values); +3540 +3541 }; +3542\ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/templates/jsdoc/allclasses.tmpl --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/templates/jsdoc/allclasses.tmpl Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,17 @@ +
{+new Link().toFile("index.html").withText("Class Index")+}
+| {+new Link().toFile("files.html").withText("File Index")+}
++
Classes
+-
+
- {! + if (thisClass.alias == "_global_") { + output += ""+new Link().toClass(thisClass.alias)+""; + } + else { + output += new Link().toClass(thisClass.alias); + } + !} +
\ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/templates/jsdoc/allfiles.tmpl --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/sbin/res/jsdoc/templates/jsdoc/allfiles.tmpl Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,56 @@ + + + + + {! Link.base = ""; /* all generated links will be relative to this */ !} +
+ {+publish.classesIndex+}
+
+
+
+
+
+
+
+
+ File Index
+ +
+ {+resolveLinks(item.desc)+}
+
+ {+new Link().toSrc(item.alias).withText(item.name)+}
+-
+
- Author: +
- {+item.author+} +
- Version: +
- {+item.version+} +
- Location: +
- {+location+} +
+
+ ©{+JSDOC.opt.D.copyright+}
+ Documentation generated by JsDoc Toolkit {+JSDOC.VERSION+} on {+new Date()+}
+
+
+
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/templates/jsdoc/class.tmpl
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/templates/jsdoc/class.tmpl Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,649 @@
+
+
+
+
+
+ {! Link.base = "../"; /* all generated links will be relative to this */ !}
+
+
+ {+publish.classesIndex+}
+
+
+
+
+
+
+
+
+
+
+
+
+ {! var ownProperties = data.properties.filter(function($){return $.memberOf == data.alias && !$.isNamespace}).sort(makeSortby("name")); !}
+
+
+
+
+
+
+
+
+
+
+
+ {! var ownMethods = data.methods.filter(function($){return $.memberOf == data.alias && !$.isNamespace}).sort(makeSortby("name")); !}
+
+
+
+
+
+
+
+
+
+
+ {! var ownEvents = data.events.filter(function($){return $.memberOf == data.alias && !$.isNamespace}).sort(makeSortby("name")); !}
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ + {! + var classType = ""; + + if (data.isBuiltin()) { + classType += "Built-In "; + } + + if (data.isNamespace) { + if (data.is('FUNCTION')) { + classType += "Function "; + } + classType += "Namespace "; + } + else { + classType += "Class "; + } + !} + {+classType+}{+data.alias+} +
+ + +
+
Version
+ {+ data.version +}.
+
Extends
+ {+
+ data.augments
+ .sort()
+ .map(
+ function($) { return new Link().toSymbol($); }
+ )
+ .join(", ")
+ +}.
+
Defined in: {+new Link().toSrc(data.srcFile)+}.
+
| Constructor Attributes | +Constructor Name and Description | +
|---|---|
| {! + if (data.isPrivate) output += "<private> "; + if (data.isInner) output += "<inner> "; + !} | +
+
+ {+ new Link().toSymbol(data.alias).inner('constructor')+}
+ {+resolveLinks(summarize(data.desc))+}
+ |
+
| Field Attributes | +Field Name and Description | +
|---|---|
| {! + if (member.isPrivate) output += "<private> "; + if (member.isInner) output += "<inner> "; + if (member.isStatic) output += "<static> "; + if (member.isConstant) output += "<constant> "; + !} | +
+
+
+ {+resolveLinks(summarize(member.desc))+}
+ |
+
-
+ {!
+ var borrowedMembers = data.properties.filter(function($) {return $.memberOf != data.alias});
+
+ var contributers = [];
+ borrowedMembers.map(function($) {if (contributers.indexOf($.memberOf) < 0) contributers.push($.memberOf)});
+ for (var i = 0, l = contributers.length; i < l; i++) {
+ output +=
+ "
- Fields borrowed from class "+new Link().toSymbol(contributers[i])+": " + + + "
- " + + borrowedMembers + .filter( + function($) { return $.memberOf == contributers[i] } + ) + .sort(makeSortby("name")) + .map( + function($) { return new Link().toSymbol($.alias).withText($.name) } + ) + .join(", ") + + + " "; + } + !} +
| Method Attributes | +Method Name and Description | +
|---|---|
| {! + if (member.isPrivate) output += "<private> "; + if (member.isInner) output += "<inner> "; + if (member.isStatic) output += "<static> "; + !} | +
+ {+resolveLinks(summarize(member.desc))+}
+ |
+
-
+ {!
+ var borrowedMembers = data.methods.filter(function($) {return $.memberOf != data.alias});
+ var contributers = [];
+ borrowedMembers.map(function($) {if (contributers.indexOf($.memberOf) < 0) contributers.push($.memberOf)});
+ for (var i = 0, l = contributers.length; i < l; i++) {
+ output +=
+ "
- Methods borrowed from class "+new Link().toSymbol(contributers[i])+": " + + + "
- " + + borrowedMembers + .filter( + function($) { return $.memberOf == contributers[i] } + ) + .sort(makeSortby("name")) + .map( + function($) { return new Link().toSymbol($.alias).withText($.name) } + ) + .join(", ") + + + " "; + } + + !} +
| Event Attributes | +Event Name and Description | +
|---|---|
| {! + if (member.isPrivate) output += "<private> "; + if (member.isInner) output += "<inner> "; + if (member.isStatic) output += "<static> "; + !} | +
+ {+resolveLinks(summarize(member.desc))+}
+ |
+
-
+ {!
+ var borrowedMembers = data.events.filter(function($) {return $.memberOf != data.alias});
+ var contributers = [];
+ borrowedMembers.map(function($) {if (contributers.indexOf($.memberOf) < 0) contributers.push($.memberOf)});
+ for (var i = 0, l = contributers.length; i < l; i++) {
+ output +=
+ "
- Events borrowed from class "+new Link().toSymbol(contributers[i])+": " + + + "
- " + + borrowedMembers + .filter( + function($) { return $.memberOf == contributers[i] } + ) + .sort(makeSortby("name")) + .map( + function($) { return new Link().toSymbol($.alias).withText($.name) } + ) + .join(", ") + + + " "; + } + + !} +
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ {+classType+}Detail
+
+
+ {!
+ if (data.isPrivate) output += "<private> ";
+ if (data.isInner) output += "<inner> ";
+ !}
+ {+ data.alias +}{+ makeSignature(data.params) +}
+
+
+
+ {+resolveLinks(data.desc)+}
+
Author: {+data.author+}.
+
+ Author: {+data.author+}.
{+example+}
+ -
+
- Parameters: +
-
+ {+((item.type)?""+("{"+(new Link().toSymbol(item.type)+"} ")) : "")+} {+item.name+}
+
Optional +, Default: {+item.defaultValue+}
+ - {+resolveLinks(item.desc)+} +
-
+
- Deprecated: +
- + {+resolveLinks(data.deprecated)+} + +
-
+
- Since: +
- {+ data.since +} +
-
+
- Throws: +
- + {+((item.type)?"{"+(new Link().toSymbol(item.type))+"} " : "")+} {+item.name+} + +
- {+resolveLinks(item.desc)+} +
-
+
- Returns: +
- {+((item.type)?"{"+(new Link().toSymbol(item.type))+"} " : "")+}{+resolveLinks(item.desc)+} +
-
+
- Requires: +
- {+ new Link().toSymbol(item) +} +
-
+
- See: +
- {+ new Link().toSymbol(item) +} +
+ Field Detail
+
+ {!
+ if (member.isPrivate) output += "<private> ";
+ if (member.isInner) output += "<inner> ";
+ if (member.isStatic) output += "<static> ";
+ if (member.isConstant) output += "<constant> ";
+ !}
+
+ {{+new Link().toSymbol(member.type)+}}
+ {+member.memberOf+}. {+member.name+}
+
+
+
+ {+resolveLinks(member.desc)+}
+
+
+ Defined in: {+new Link().toSrc(member.srcFile)+}. +
+
Author: {+member.author+}.
+
+ + Defined in: {+new Link().toSrc(member.srcFile)+}. +
Author: {+member.author+}.
{+example+}
+ -
+
- Deprecated: +
- + {+ resolveLinks(member.deprecated) +} + +
-
+
- Since: +
- {+ member.since +} +
-
+
- See: +
- {+ new Link().toSymbol(item) +} +
-
+
- Default Value: +
- + {+resolveLinks(member.defaultValue)+} + +
+ Method Detail
+
+ {!
+ if (member.isPrivate) output += "<private> ";
+ if (member.isInner) output += "<inner> ";
+ if (member.isStatic) output += "<static> ";
+ !}
+
+ {{+new Link().toSymbol(member.type)+}}
+ {+member.memberOf+}. {+member.name.replace(/\^\d+$/, '')+}{+makeSignature(member.params)+}
+
+
+
+ {+resolveLinks(member.desc)+}
+
+
+ Defined in: {+new Link().toSrc(member.srcFile)+}. +
+
Author: {+member.author+}.
+
+ + Defined in: {+new Link().toSrc(member.srcFile)+}. +
Author: {+member.author+}.
{+example+}
+ -
+
- Parameters: +
-
+ {+((item.type)?"{"+(new Link().toSymbol(item.type))+"} " : "")+}{+item.name+}
+
Optional +, Default: {+item.defaultValue+}
+ - {+resolveLinks(item.desc)+} +
-
+
- Deprecated: +
- + {+ resolveLinks(member.deprecated) +} + +
-
+
- Since: +
- {+ member.since +} +
-
+
- Throws: +
- + {+((item.type)?"{"+(new Link().toSymbol(item.type))+"} " : "")+} {+item.name+} + +
- {+resolveLinks(item.desc)+} +
-
+
- Returns: +
- {+((item.type)?"{"+(new Link().toSymbol(item.type))+"} " : "")+}{+resolveLinks(item.desc)+} +
-
+
- Requires: +
- {+ resolveLinks(item) +} +
-
+
- See: +
- {+ new Link().toSymbol(item) +} +
+ Event Detail
+
+ {!
+ if (member.isPrivate) output += "<private> ";
+ if (member.isInner) output += "<inner> ";
+ if (member.isStatic) output += "<static> ";
+ !}
+
+ {{+new Link().toSymbol(member.type)+}}
+ {+member.memberOf+}. {+member.name+}{+makeSignature(member.params)+}
+
+
+
+ {+resolveLinks(member.desc)+}
+
+
+ Defined in: {+new Link().toSrc(member.srcFile)+}. +
+
Author: {+member.author+}.
+
+ + Defined in: {+new Link().toSrc(member.srcFile)+}. +
Author: {+member.author+}.
{+example+}
+ -
+
- Parameters: +
-
+ {+((item.type)?"{"+(new Link().toSymbol(item.type))+"} " : "")+}{+item.name+}
+
Optional +, Default: {+item.defaultValue+}
+ - {+ resolveLinks(item.desc) +} +
-
+
- Deprecated: +
- + {+ resolveLinks(member.deprecated) +} + +
-
+
- Since: +
- {+ member.since +} +
-
+
- Throws: +
- + {+((item.type)?"{"+(new Link().toSymbol(item.type))+"} " : "")+} {+item.name+} + +
- {+ resolveLinks(item.desc) +} +
-
+
- Returns: +
- {+((item.type)?"{"+(new Link().toSymbol(item.type))+"} " : "")+}{+resolveLinks(item.desc)+} +
-
+
- Requires: +
- {+ resolveLinks(item) +} +
-
+
- See: +
- {+ new Link().toSymbol(item) +} +
+
+ ©{+JSDOC.opt.D.copyright+}
+ Documentation generated by JsDoc Toolkit {+JSDOC.VERSION+} on {+new Date()+}
+
+
+
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/templates/jsdoc/index.tmpl
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/templates/jsdoc/index.tmpl Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,39 @@
+
+
+
+
+
+
+ {+publish.classesIndex+}
+
+
+
+
+
+
+
+
+ Class Index
+ +
+
+ {+(new Link().toSymbol(thisClass.alias))+}
+ {+resolveLinks(summarize(thisClass.classDesc))+} ++
+ ©{+JSDOC.opt.D.copyright+}
+ Documentation generated by JsDoc Toolkit {+JSDOC.VERSION+} on {+new Date()+}
+
+
+
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/templates/jsdoc/publish.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/templates/jsdoc/publish.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,201 @@
+/** Called automatically by JsDoc Toolkit. */
+function publish(symbolSet) {
+ publish.conf = { // trailing slash expected for dirs
+ ext: ".html",
+ outDir: JSDOC.opt.d || SYS.pwd+"../out/jsdoc/",
+ templatesDir: JSDOC.opt.t || SYS.pwd+"../templates/jsdoc/",
+ symbolsDir: "symbols/",
+ srcDir: "symbols/src/"
+ };
+
+ // is source output is suppressed, just display the links to the source file
+ if (JSDOC.opt.s && defined(Link) && Link.prototype._makeSrcLink) {
+ Link.prototype._makeSrcLink = function(srcFilePath) {
+ return "<"+srcFilePath+">";
+ }
+ }
+
+ // create the folders and subfolders to hold the output
+ IO.mkPath((publish.conf.outDir+"symbols/src").split("/"));
+
+ // used to allow Link to check the details of things being linked to
+ Link.symbolSet = symbolSet;
+
+ // create the required templates
+ try {
+ var classTemplate = new JSDOC.JsPlate(publish.conf.templatesDir+"class.tmpl");
+ var classesTemplate = new JSDOC.JsPlate(publish.conf.templatesDir+"allclasses.tmpl");
+ }
+ catch(e) {
+ print("Couldn't create the required templates: "+e);
+ quit();
+ }
+
+ // some ustility filters
+ function hasNoParent($) {return ($.memberOf == "")}
+ function isaFile($) {return ($.is("FILE"))}
+ function isaClass($) {return ($.is("CONSTRUCTOR") || $.isNamespace)}
+
+ // get an array version of the symbolset, useful for filtering
+ var symbols = symbolSet.toArray();
+
+ // create the hilited source code files
+ var files = JSDOC.opt.srcFiles;
+ for (var i = 0, l = files.length; i < l; i++) {
+ var file = files[i];
+ var srcDir = publish.conf.outDir + "symbols/src/";
+ makeSrcFile(file, srcDir);
+ }
+
+ // get a list of all the classes in the symbolset
+ var classes = symbols.filter(isaClass).sort(makeSortby("alias"));
+
+ // create a filemap in which outfiles must be to be named uniquely, ignoring case
+ if (JSDOC.opt.u) {
+ var filemapCounts = {};
+ Link.filemap = {};
+ for (var i = 0, l = classes.length; i < l; i++) {
+ var lcAlias = classes[i].alias.toLowerCase();
+
+ if (!filemapCounts[lcAlias]) filemapCounts[lcAlias] = 1;
+ else filemapCounts[lcAlias]++;
+
+ Link.filemap[classes[i].alias] =
+ (filemapCounts[lcAlias] > 1)?
+ lcAlias+"_"+filemapCounts[lcAlias] : lcAlias;
+ }
+ }
+
+ // create a class index, displayed in the left-hand column of every class page
+ Link.base = "../";
+ publish.classesIndex = classesTemplate.process(classes); // kept in memory
+
+ // create each of the class pages
+ for (var i = 0, l = classes.length; i < l; i++) {
+ var symbol = classes[i];
+
+ symbol.events = symbol.getEvents(); // 1 order matters
+ symbol.methods = symbol.getMethods(); // 2
+
+ Link.currentSymbol= symbol;
+ var output = "";
+ output = classTemplate.process(symbol);
+
+ IO.saveFile(publish.conf.outDir+"symbols/", ((JSDOC.opt.u)? Link.filemap[symbol.alias] : symbol.alias) + publish.conf.ext, output);
+ }
+
+ // regenerate the index with different relative links, used in the index pages
+ Link.base = "";
+ publish.classesIndex = classesTemplate.process(classes);
+
+ // create the class index page
+ try {
+ var classesindexTemplate = new JSDOC.JsPlate(publish.conf.templatesDir+"index.tmpl");
+ }
+ catch(e) { print(e.message); quit(); }
+
+ var classesIndex = classesindexTemplate.process(classes);
+ IO.saveFile(publish.conf.outDir, "index"+publish.conf.ext, classesIndex);
+ classesindexTemplate = classesIndex = classes = null;
+
+ // create the file index page
+ try {
+ var fileindexTemplate = new JSDOC.JsPlate(publish.conf.templatesDir+"allfiles.tmpl");
+ }
+ catch(e) { print(e.message); quit(); }
+
+ var documentedFiles = symbols.filter(isaFile); // files that have file-level docs
+ var allFiles = []; // not all files have file-level docs, but we need to list every one
+
+ for (var i = 0; i < files.length; i++) {
+ allFiles.push(new JSDOC.Symbol(files[i], [], "FILE", new JSDOC.DocComment("/** */")));
+ }
+
+ for (var i = 0; i < documentedFiles.length; i++) {
+ var offset = files.indexOf(documentedFiles[i].alias);
+ allFiles[offset] = documentedFiles[i];
+ }
+
+ allFiles = allFiles.sort(makeSortby("name"));
+
+ // output the file index page
+ var filesIndex = fileindexTemplate.process(allFiles);
+ IO.saveFile(publish.conf.outDir, "files"+publish.conf.ext, filesIndex);
+ fileindexTemplate = filesIndex = files = null;
+}
+
+
+/** Just the first sentence (up to a full stop). Should not break on dotted variable names. */
+function summarize(desc) {
+ if (typeof desc != "undefined")
+ return desc.match(/([\w\W]+?\.)[^a-z0-9_$]/i)? RegExp.$1 : desc;
+}
+
+/** Make a symbol sorter by some attribute. */
+function makeSortby(attribute) {
+ return function(a, b) {
+ if (a[attribute] != undefined && b[attribute] != undefined) {
+ a = a[attribute].toLowerCase();
+ b = b[attribute].toLowerCase();
+ if (a < b) return -1;
+ if (a > b) return 1;
+ return 0;
+ }
+ }
+}
+
+/** Pull in the contents of an external file at the given path. */
+function include(path) {
+ var path = publish.conf.templatesDir+path;
+ return IO.readFile(path);
+}
+
+/** Turn a raw source file into a code-hilited page in the docs. */
+function makeSrcFile(path, srcDir, name) {
+ if (JSDOC.opt.s) return;
+
+ if (!name) {
+ name = path.replace(/\.\.?[\\\/]/g, "").replace(/[\\\/]/g, "_");
+ name = name.replace(/\:/g, "_");
+ }
+
+ var src = {path: path, name:name, charset: IO.encoding, hilited: ""};
+
+ if (defined(JSDOC.PluginManager)) {
+ JSDOC.PluginManager.run("onPublishSrc", src);
+ }
+
+ if (src.hilited) {
+ IO.saveFile(srcDir, name+publish.conf.ext, src.hilited);
+ }
+}
+
+/** Build output for displaying function parameters. */
+function makeSignature(params) {
+ if (!params) return "()";
+ var signature = "("
+ +
+ params.filter(
+ function($) {
+ return $.name.indexOf(".") == -1; // don't show config params in signature
+ }
+ ).map(
+ function($) {
+ return $.name;
+ }
+ ).join(", ")
+ +
+ ")";
+ return signature;
+}
+
+/** Find symbol {@link ...} strings in text and turn into html links */
+function resolveLinks(str, from) {
+ str = str.replace(/\{@link ([^} ]+) ?\}/gi,
+ function(match, symbolName) {
+ return new Link().toSymbol(symbolName);
+ }
+ );
+
+ return str;
+}
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/templates/jsdoc/static/default.css
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/templates/jsdoc/static/default.css Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,162 @@
+/* default.css */
+body
+{
+ font: 12px "Lucida Grande", Tahoma, Arial, Helvetica, sans-serif;
+ width: 800px;
+}
+
+.header
+{
+ clear: both;
+ background-color: #ccc;
+ padding: 8px;
+}
+
+h1
+{
+ font-size: 150%;
+ font-weight: bold;
+ padding: 0;
+ margin: 1em 0 0 .3em;
+}
+
+hr
+{
+ border: none 0;
+ border-top: 1px solid #7F8FB1;
+ height: 1px;
+}
+
+pre.code
+{
+ display: block;
+ padding: 8px;
+ border: 1px dashed #ccc;
+}
+
+#index
+{
+ margin-top: 24px;
+ float: left;
+ width: 160px;
+ position: absolute;
+ left: 8px;
+ background-color: #F3F3F3;
+ padding: 8px;
+}
+
+#content
+{
+ margin-left: 190px;
+ width: 600px;
+}
+
+.classList
+{
+ list-style-type: none;
+ padding: 0;
+ margin: 0 0 0 8px;
+ font-family: arial, sans-serif;
+ font-size: 1em;
+ overflow: auto;
+}
+
+.classList li
+{
+ padding: 0;
+ margin: 0 0 8px 0;
+}
+
+.summaryTable { width: 100%; }
+
+h1.classTitle
+{
+ font-size:170%;
+ line-height:130%;
+}
+
+h2 { font-size: 110%; }
+caption, div.sectionTitle
+{
+ background-color: #7F8FB1;
+ color: #fff;
+ font-size:130%;
+ text-align: left;
+ padding: 2px 6px 2px 6px;
+ border: 1px #7F8FB1 solid;
+}
+
+div.sectionTitle { margin-bottom: 8px; }
+.summaryTable thead { display: none; }
+
+.summaryTable td
+{
+ vertical-align: top;
+ padding: 4px;
+ border-bottom: 1px #7F8FB1 solid;
+ border-right: 1px #7F8FB1 solid;
+}
+
+/*col#summaryAttributes {}*/
+.summaryTable td.attributes
+{
+ border-left: 1px #7F8FB1 solid;
+ width: 140px;
+ text-align: right;
+}
+
+td.attributes, .fixedFont
+{
+ line-height: 15px;
+ color: #002EBE;
+ font-family: "Courier New",Courier,monospace;
+ font-size: 13px;
+}
+
+.summaryTable td.nameDescription
+{
+ text-align: left;
+ font-size: 13px;
+ line-height: 15px;
+}
+
+.summaryTable td.nameDescription, .description
+{
+ line-height: 15px;
+ padding: 4px;
+ padding-left: 4px;
+}
+
+.summaryTable { margin-bottom: 8px; }
+
+ul.inheritsList
+{
+ list-style: square;
+ margin-left: 20px;
+ padding-left: 0;
+}
+
+.detailList {
+ margin-left: 20px;
+ line-height: 15px;
+}
+.detailList dt { margin-left: 20px; }
+
+.detailList .heading
+{
+ font-weight: bold;
+ padding-bottom: 6px;
+ margin-left: 0;
+}
+
+.light, td.attributes, .light a:link, .light a:visited
+{
+ color: #777;
+ font-style: italic;
+}
+
+.fineprint
+{
+ text-align: right;
+ font-size: 10px;
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/templates/jsdoc/static/header.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/templates/jsdoc/static/header.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,2 @@
+
+
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/jsdoc/templates/jsdoc/static/index.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/sbin/res/jsdoc/templates/jsdoc/static/index.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,19 @@
+
+
+
+
+ fragments and .js files.",
+ adsafe_id: "ADsafe violation: id does not match.",
+ adsafe_id_go: "ADsafe violation: Missing ADSAFE.id or ADSAFE.go.",
+ adsafe_lib: "ADsafe lib violation.",
+ adsafe_lib_second: "ADsafe: The second argument to lib must be a function.",
+ adsafe_missing_id: "ADSAFE violation: missing ID_.",
+ adsafe_name_a: "ADsafe name violation: '{a}'.",
+ adsafe_placement: "ADsafe script placement violation.",
+ adsafe_prefix_a: "ADsafe violation: An id must have a '{a}' prefix",
+ adsafe_script: "ADsafe script violation.",
+ adsafe_source: "ADsafe unapproved script source.",
+ adsafe_subscript_a: "ADsafe subscript '{a}'.",
+ adsafe_tag: "ADsafe violation: Disallowed tag '{a}'.",
+ already_defined: "'{a}' is already defined.",
+ and: "The '&&' subexpression should be wrapped in parens.",
+ assign_exception: "Do not assign to the exception parameter.",
+ assignment_function_expression: "Expected an assignment or " +
+ "function call and instead saw an expression.",
+ attribute_case_a: "Attribute '{a}' not all lower case.",
+ avoid_a: "Avoid '{a}'.",
+ bad_assignment: "Bad assignment.",
+ bad_color_a: "Bad hex color '{a}'.",
+ bad_constructor: "Bad constructor.",
+ bad_entity: "Bad entity.",
+ bad_html: "Bad HTML string",
+ bad_id_a: "Bad id: '{a}'.",
+ bad_in_a: "Bad for in variable '{a}'.",
+ bad_invocation: "Bad invocation.",
+ bad_name_a: "Bad name: '{a}'.",
+ bad_new: "Do not use 'new' for side effects.",
+ bad_number: "Bad number '{a}'.",
+ bad_operand: "Bad operand.",
+ bad_style: "Bad style.",
+ bad_type: "Bad type.",
+ bad_url_a: "Bad url '{a}'.",
+ bad_wrap: "Do not wrap function literals in parens unless they " +
+ "are to be immediately invoked.",
+ combine_var: "Combine this with the previous 'var' statement.",
+ conditional_assignment: "Expected a conditional expression and " +
+ "instead saw an assignment.",
+ confusing_a: "Confusing use of '{a}'.",
+ confusing_regexp: "Confusing regular expression.",
+ constructor_name_a: "A constructor name '{a}' should start with " +
+ "an uppercase letter.",
+ control_a: "Unexpected control character '{a}'.",
+ css: "A css file should begin with @charset 'UTF-8';",
+ dangling_a: "Unexpected dangling '_' in '{a}'.",
+ dangerous_comment: "Dangerous comment.",
+ deleted: "Only properties should be deleted.",
+ duplicate_a: "Duplicate '{a}'.",
+ empty_block: "Empty block.",
+ empty_case: "Empty case.",
+ empty_class: "Empty class.",
+ es5: "This is an ES5 feature.",
+ evil: "eval is evil.",
+ expected_a: "Expected '{a}'.",
+ expected_a_b: "Expected '{a}' and instead saw '{b}'.",
+ expected_a_b_from_c_d: "Expected '{a}' to match '{b}' from line " +
+ "{c} and instead saw '{d}'.",
+ expected_at_a: "Expected an at-rule, and instead saw @{a}.",
+ expected_a_at_b_c: "Expected '{a}' at column {b}, not column {c}.",
+ expected_attribute_a: "Expected an attribute, and instead saw [{a}].",
+ expected_attribute_value_a: "Expected an attribute value and " +
+ "instead saw '{a}'.",
+ expected_class_a: "Expected a class, and instead saw .{a}.",
+ expected_fraction_a: "Expected a number between 0 and 1 and " +
+ "instead saw '{a}'",
+ expected_id_a: "Expected an id, and instead saw #{a}.",
+ expected_identifier_a: "Expected an identifier and instead saw '{a}'.",
+ expected_identifier_a_reserved: "Expected an identifier and " +
+ "instead saw '{a}' (a reserved word).",
+ expected_linear_a: "Expected a linear unit and instead saw '{a}'.",
+ expected_lang_a: "Expected a lang code, and instead saw :{a}.",
+ expected_media_a: "Expected a CSS media type, and instead saw '{a}'.",
+ expected_name_a: "Expected a name and instead saw '{a}'.",
+ expected_nonstandard_style_attribute: "Expected a non-standard " +
+ "style attribute and instead saw '{a}'.",
+ expected_number_a: "Expected a number and instead saw '{a}'.",
+ expected_operator_a: "Expected an operator and instead saw '{a}'.",
+ expected_percent_a: "Expected a percentage and instead saw '{a}'",
+ expected_positive_a: "Expected a positive number and instead saw '{a}'",
+ expected_pseudo_a: "Expected a pseudo, and instead saw :{a}.",
+ expected_selector_a: "Expected a CSS selector, and instead saw {a}.",
+ expected_small_a: "Expected a small positive integer and instead saw '{a}'",
+ expected_space_a_b: "Expected exactly one space between '{a}' and '{b}'.",
+ expected_string_a: "Expected a string and instead saw {a}.",
+ expected_style_attribute: "Excepted a style attribute, and instead saw '{a}'.",
+ expected_style_pattern: "Expected a style pattern, and instead saw '{a}'.",
+ expected_tagname_a: "Expected a tagName, and instead saw {a}.",
+ expected_type_a: "Expected a type, and instead saw {a}.",
+ for_if: "The body of a for in should be wrapped in an if " +
+ "statement to filter unwanted properties from the prototype.",
+ function_block: "Function statements should not be placed in blocks. " +
+ "Use a function expression or move the statement to the top of " +
+ "the outer function.",
+ function_eval: "The Function constructor is eval.",
+ function_loop: "Don't make functions within a loop.",
+ function_statement: "Function statements are not invocable. " +
+ "Wrap the whole function invocation in parens.",
+ function_strict: "Use the function form of 'use strict'.",
+ html_confusion_a: "HTML confusion in regular expression '<{a}'.",
+ html_handlers: "Avoid HTML event handlers.",
+ identifier_function: "Expected an identifier in an assignment " +
+ "and instead saw a function invocation.",
+ implied_evil: "Implied eval is evil. Pass a function instead of a string.",
+ infix_in: "Unexpected 'in'. Compare with undefined, or use the " +
+ "hasOwnProperty method instead.",
+ insecure_a: "Insecure '{a}'.",
+ isNaN: "Use the isNaN function to compare with NaN.",
+ label_a_b: "Label '{a}' on '{b}' statement.",
+ lang: "lang is deprecated.",
+ leading_decimal_a: "A leading decimal point can be confused with a dot: '.{a}'.",
+ missing_a: "Missing '{a}'.",
+ missing_a_after_b: "Missing '{a}' after '{b}'.",
+ missing_option: "Missing option value.",
+ missing_property: "Missing property name.",
+ missing_space_a_b: "Missing space between '{a}' and '{b}'.",
+ missing_url: "Missing url.",
+ missing_use_strict: "Missing 'use strict' statement.",
+ mixed: "Mixed spaces and tabs.",
+ move_invocation: "Move the invocation into the parens that " +
+ "contain the function.",
+ move_var: "Move 'var' declarations to the top of the function.",
+ name_function: "Missing name in function statement.",
+ nested_comment: "Nested comment.",
+ not: "Nested not.",
+ not_a_constructor: "Do not use {a} as a constructor.",
+ not_a_defined: "'{a}' has not been fully defined yet.",
+ not_a_function: "'{a}' is not a function.",
+ not_a_label: "'{a}' is not a label.",
+ not_a_scope: "'{a}' is out of scope.",
+ not_greater: "'{a}' should not be greater than '{b}'.",
+ parameter_a_get_b: "Unexpected parameter '{a}' in get {b} function.",
+ parameter_set_a: "Expected parameter (value) in set {a} function.",
+ radix: "Missing radix parameter.",
+ read_only: "Read only.",
+ redefinition_a: "Redefinition of '{a}'.",
+ reserved_a: "Reserved name '{a}'.",
+ scanned_a_b: "{a} ({b}% scanned).",
+ slash_equal: "A regular expression literal can be confused with '/='.",
+ statement_block: "Expected to see a statement and instead saw a block.",
+ stopping: "Stopping. ",
+ strange_loop: "Strange loop.",
+ strict: "Strict violation.",
+ subscript: "['{a}'] is better written in dot notation.",
+ tag_a_in_b: "A '<{a}>' must be within '<{b}>'.",
+ too_long: "Line too long.",
+ too_many: "Too many errors.",
+ trailing_decimal_a: "A trailing decimal point can be confused " +
+ "with a dot: '.{a}'.",
+ type: "type is unnecessary.",
+ type_confusion_a_b: "Type confusion: {a} and {b}.",
+ unclosed: "Unclosed string.",
+ unclosed_comment: "Unclosed comment.",
+ unclosed_regexp: "Unclosed regular expression.",
+ unescaped_a: "Unescaped '{a}'.",
+ unexpected_a: "Unexpected '{a}'.",
+ unexpected_char_a_b: "Unexpected character '{a}' in {b}.",
+ unexpected_comment: "Unexpected comment.",
+ unexpected_property_a: "Unexpected /*property*/ '{a}'.",
+ unexpected_space_a_b: "Unexpected space between '{a}' and '{b}'.",
+ unnecessary_initialize: "It is not necessary to initialize '{a}' " +
+ "to 'undefined'.",
+ unnecessary_use: "Unnecessary 'use strict'.",
+ unreachable_a_b: "Unreachable '{a}' after '{b}'.",
+ unrecognized_style_attribute_a: "Unrecognized style attribute '{a}'.",
+ unrecognized_tag_a: "Unrecognized tag '<{a}>'.",
+ unsafe: "Unsafe character.",
+ url: "JavaScript URL.",
+ use_array: "Use the array literal notation [].",
+ use_braces: "Spaces are hard to count. Use {{a}}.",
+ use_charAt: "Use the charAt method.",
+ use_object: "Use the object literal notation {}.",
+ use_or: "Use the || operator.",
+ use_param: "Use a named parameter.",
+ used_before_a: "'{a}' was used before it was defined.",
+ var_a_not: "Variable {a} was not declared correctly.",
+ weird_assignment: "Weird assignment.",
+ weird_condition: "Weird condition.",
+ weird_new: "Weird construction. Delete 'new'.",
+ weird_program: "Weird program.",
+ weird_relation: "Weird relation.",
+ weird_ternary: "Weird ternary.",
+ wrap_immediate: "Wrap an immediate function invocation in parentheses " +
+ "to assist the reader in understanding that the expression " +
+ "is the result of a function, and not the function itself.",
+ wrap_regexp: "Wrap the /regexp/ literal in parens to " +
+ "disambiguate the slash operator.",
+ write_is_wrong: "document.write can be a form of eval."
+ },
+ comments_off,
+ css_attribute_data,
+ css_any,
+
+ css_colorData = array_to_object([
+ "aliceblue", "antiquewhite", "aqua", "aquamarine", "azure", "beige",
+ "bisque", "black", "blanchedalmond", "blue", "blueviolet", "brown",
+ "burlywood", "cadetblue", "chartreuse", "chocolate", "coral",
+ "cornflowerblue", "cornsilk", "crimson", "cyan", "darkblue",
+ "darkcyan", "darkgoldenrod", "darkgray", "darkgreen", "darkkhaki",
+ "darkmagenta", "darkolivegreen", "darkorange", "darkorchid",
+ "darkred", "darksalmon", "darkseagreen", "darkslateblue",
+ "darkslategray", "darkturquoise", "darkviolet", "deeppink",
+ "deepskyblue", "dimgray", "dodgerblue", "firebrick", "floralwhite",
+ "forestgreen", "fuchsia", "gainsboro", "ghostwhite", "gold",
+ "goldenrod", "gray", "green", "greenyellow", "honeydew", "hotpink",
+ "indianred", "indigo", "ivory", "khaki", "lavender",
+ "lavenderblush", "lawngreen", "lemonchiffon", "lightblue",
+ "lightcoral", "lightcyan", "lightgoldenrodyellow", "lightgreen",
+ "lightpink", "lightsalmon", "lightseagreen", "lightskyblue",
+ "lightslategray", "lightsteelblue", "lightyellow", "lime",
+ "limegreen", "linen", "magenta", "maroon", "mediumaquamarine",
+ "mediumblue", "mediumorchid", "mediumpurple", "mediumseagreen",
+ "mediumslateblue", "mediumspringgreen", "mediumturquoise",
+ "mediumvioletred", "midnightblue", "mintcream", "mistyrose",
+ "moccasin", "navajowhite", "navy", "oldlace", "olive", "olivedrab",
+ "orange", "orangered", "orchid", "palegoldenrod", "palegreen",
+ "paleturquoise", "palevioletred", "papayawhip", "peachpuff",
+ "peru", "pink", "plum", "powderblue", "purple", "red", "rosybrown",
+ "royalblue", "saddlebrown", "salmon", "sandybrown", "seagreen",
+ "seashell", "sienna", "silver", "skyblue", "slateblue", "slategray",
+ "snow", "springgreen", "steelblue", "tan", "teal", "thistle",
+ "tomato", "turquoise", "violet", "wheat", "white", "whitesmoke",
+ "yellow", "yellowgreen",
+
+ "activeborder", "activecaption", "appworkspace", "background",
+ "buttonface", "buttonhighlight", "buttonshadow", "buttontext",
+ "captiontext", "graytext", "highlight", "highlighttext",
+ "inactiveborder", "inactivecaption", "inactivecaptiontext",
+ "infobackground", "infotext", "menu", "menutext", "scrollbar",
+ "threeddarkshadow", "threedface", "threedhighlight",
+ "threedlightshadow", "threedshadow", "window", "windowframe",
+ "windowtext"
+ ], true),
+
+ css_border_style,
+ css_break,
+
+ css_lengthData = {
+ '%': true,
+ 'cm': true,
+ 'em': true,
+ 'ex': true,
+ 'in': true,
+ 'mm': true,
+ 'pc': true,
+ 'pt': true,
+ 'px': true
+ },
+
+ css_media,
+ css_overflow,
+
+ descapes = {
+ 'b': '\b',
+ 't': '\t',
+ 'n': '\n',
+ 'f': '\f',
+ 'r': '\r',
+ '"': '"',
+ '/': '/',
+ '\\': '\\'
+ },
+
+ devel = array_to_object([
+ 'alert', 'confirm', 'console', 'Debug', 'opera', 'prompt', 'WSH'
+ ], false),
+ directive,
+ escapes = {
+ '\b': '\\b',
+ '\t': '\\t',
+ '\n': '\\n',
+ '\f': '\\f',
+ '\r': '\\r',
+ '\'': '\\\'',
+ '"' : '\\"',
+ '/' : '\\/',
+ '\\': '\\\\'
+ },
+
+ funct, // The current function, including the labels used in
+ // the function, as well as (breakage), (complexity),
+ // (context), (loopage), (name), (params), (token),
+ // (vars), (verb)
+
+ functionicity = [
+ 'closure', 'exception', 'global', 'label', 'outer', 'undef',
+ 'unused', 'var'
+ ],
+
+ functions, // All of the functions
+ global_funct, // The global body
+ global_scope, // The global scope
+ html_tag = {
+ a: {},
+ abbr: {},
+ acronym: {},
+ address: {},
+ applet: {},
+ area: {empty: true, parent: ' map '},
+ article: {},
+ aside: {},
+ audio: {},
+ b: {},
+ base: {empty: true, parent: ' head '},
+ bdo: {},
+ big: {},
+ blockquote: {},
+ body: {parent: ' html noframes '},
+ br: {empty: true},
+ button: {},
+ canvas: {parent: ' body p div th td '},
+ caption: {parent: ' table '},
+ center: {},
+ cite: {},
+ code: {},
+ col: {empty: true, parent: ' table colgroup '},
+ colgroup: {parent: ' table '},
+ command: {parent: ' menu '},
+ datalist: {},
+ dd: {parent: ' dl '},
+ del: {},
+ details: {},
+ dialog: {},
+ dfn: {},
+ dir: {},
+ div: {},
+ dl: {},
+ dt: {parent: ' dl '},
+ em: {},
+ embed: {},
+ fieldset: {},
+ figure: {},
+ font: {},
+ footer: {},
+ form: {},
+ frame: {empty: true, parent: ' frameset '},
+ frameset: {parent: ' html frameset '},
+ h1: {},
+ h2: {},
+ h3: {},
+ h4: {},
+ h5: {},
+ h6: {},
+ head: {parent: ' html '},
+ header: {},
+ hgroup: {},
+ hr: {empty: true},
+ 'hta:application':
+ {empty: true, parent: ' head '},
+ html: {parent: '*'},
+ i: {},
+ iframe: {},
+ img: {empty: true},
+ input: {empty: true},
+ ins: {},
+ kbd: {},
+ keygen: {},
+ label: {},
+ legend: {parent: ' details fieldset figure '},
+ li: {parent: ' dir menu ol ul '},
+ link: {empty: true, parent: ' head '},
+ map: {},
+ mark: {},
+ menu: {},
+ meta: {empty: true, parent: ' head noframes noscript '},
+ meter: {},
+ nav: {},
+ noframes: {parent: ' html body '},
+ noscript: {parent: ' body head noframes '},
+ object: {},
+ ol: {},
+ optgroup: {parent: ' select '},
+ option: {parent: ' optgroup select '},
+ output: {},
+ p: {},
+ param: {empty: true, parent: ' applet object '},
+ pre: {},
+ progress: {},
+ q: {},
+ rp: {},
+ rt: {},
+ ruby: {},
+ samp: {},
+ script: {empty: true, parent: ' body div frame head iframe p pre span '},
+ section: {},
+ select: {},
+ small: {},
+ span: {},
+ source: {},
+ strong: {},
+ style: {parent: ' head ', empty: true},
+ sub: {},
+ sup: {},
+ table: {},
+ tbody: {parent: ' table '},
+ td: {parent: ' tr '},
+ textarea: {},
+ tfoot: {parent: ' table '},
+ th: {parent: ' tr '},
+ thead: {parent: ' table '},
+ time: {},
+ title: {parent: ' head '},
+ tr: {parent: ' table tbody thead tfoot '},
+ tt: {},
+ u: {},
+ ul: {},
+ 'var': {},
+ video: {}
+ },
+
+ ids, // HTML ids
+ in_block,
+ indent,
+// infer_statement,// Inference rules for statements
+ is_type = array_to_object([
+ '*', 'array', 'boolean', 'function', 'number', 'object',
+ 'regexp', 'string'
+ ], true),
+ itself, // JSLint itself
+ jslint_limit = {
+ indent: 10,
+ maxerr: 1000,
+ maxlen: 256
+ },
+ json_mode,
+ lex, // the tokenizer
+ lines,
+ lookahead,
+ member,
+ node = array_to_object([
+ 'Buffer', 'clearInterval', 'clearTimeout', 'console', 'exports',
+ 'global', 'module', 'process', 'querystring', 'require',
+ 'setInterval', 'setTimeout', '__dirname', '__filename'
+ ], false),
+ node_js,
+ numbery = array_to_object(['indexOf', 'lastIndexOf', 'search'], true),
+ next_token,
+ option,
+ predefined, // Global variables defined by option
+ prereg,
+ prev_token,
+ property_type,
+ regexp_flag = array_to_object(['g', 'i', 'm'], true),
+ return_this = function return_this() {
+ return this;
+ },
+ rhino = array_to_object([
+ 'defineClass', 'deserialize', 'gc', 'help', 'load', 'loadClass',
+ 'print', 'quit', 'readFile', 'readUrl', 'runCommand', 'seal',
+ 'serialize', 'spawn', 'sync', 'toint32', 'version'
+ ], false),
+
+ scope, // An object containing an object for each variable in scope
+ semicolon_coda = array_to_object([';', '"', '\'', ')'], true),
+ src,
+ stack,
+
+// standard contains the global names that are provided by the
+// ECMAScript standard.
+
+ standard = array_to_object([
+ 'Array', 'Boolean', 'Date', 'decodeURI', 'decodeURIComponent',
+ 'encodeURI', 'encodeURIComponent', 'Error', 'eval', 'EvalError',
+ 'Function', 'isFinite', 'isNaN', 'JSON', 'Math', 'Number', 'Object',
+ 'parseInt', 'parseFloat', 'RangeError', 'ReferenceError', 'RegExp',
+ 'String', 'SyntaxError', 'TypeError', 'URIError'
+ ], false),
+
+ standard_property_type = {
+ E : 'number',
+ LN2 : 'number',
+ LN10 : 'number',
+ LOG2E : 'number',
+ LOG10E : 'number',
+ MAX_VALUE : 'number',
+ MIN_VALUE : 'number',
+ NEGATIVE_INFINITY : 'number',
+ PI : 'number',
+ POSITIVE_INFINITY : 'number',
+ SQRT1_2 : 'number',
+ SQRT2 : 'number',
+ apply : 'function',
+ bind : 'function function',
+ call : 'function',
+ ceil : 'function number',
+ charAt : 'function string',
+ concat : 'function',
+ constructor : 'function object',
+ create : 'function object',
+ defineProperty : 'function object',
+ defineProperties : 'function object',
+ every : 'function boolean',
+ exec : 'function array',
+ filter : 'function array',
+ floor : 'function number',
+ forEach : 'function',
+ freeze : 'function object',
+ getDate : 'function number',
+ getDay : 'function number',
+ getFullYear : 'function number',
+ getHours : 'function number',
+ getMilliseconds : 'function number',
+ getMinutes : 'function number',
+ getMonth : 'function number',
+ getOwnPropertyDescriptor
+ : 'function object',
+ getOwnPropertyNames : 'function array',
+ getPrototypeOf : 'function object',
+ getSeconds : 'function number',
+ getTime : 'function number',
+ getTimezoneOffset : 'function number',
+ getUTCDate : 'function number',
+ getUTCDay : 'function number',
+ getUTCFullYear : 'function number',
+ getUTCHours : 'function number',
+ getUTCMilliseconds : 'function number',
+ getUTCMinutes : 'function number',
+ getUTCMonth : 'function number',
+ getUTCSeconds : 'function number',
+ getYear : 'function number',
+ hasOwnProperty : 'function boolean',
+ indexOf : 'function number',
+ isExtensible : 'function boolean',
+ isFrozen : 'function boolean',
+ isPrototypeOf : 'function boolean',
+ isSealed : 'function boolean',
+ join : 'function string',
+ keys : 'function array',
+ lastIndexOf : 'function number',
+ lastIndex : 'number',
+ length : 'number',
+ map : 'function array',
+ now : 'function number',
+ parse : 'function',
+ pop : 'function',
+ preventExtensions : 'function object',
+ propertyIsEnumerable: 'function boolean',
+ prototype : 'object',
+ push : 'function number',
+ reduce : 'function',
+ reduceRight : 'function',
+ reverse : 'function',
+ seal : 'function object',
+ setDate : 'function',
+ setDay : 'function',
+ setFullYear : 'function',
+ setHours : 'function',
+ setMilliseconds : 'function',
+ setMinutes : 'function',
+ setMonth : 'function',
+ setSeconds : 'function',
+ setTime : 'function',
+ setTimezoneOffset : 'function',
+ setUTCDate : 'function',
+ setUTCDay : 'function',
+ setUTCFullYear : 'function',
+ setUTCHours : 'function',
+ setUTCMilliseconds : 'function',
+ setUTCMinutes : 'function',
+ setUTCMonth : 'function',
+ setUTCSeconds : 'function',
+ setYear : 'function',
+ shift : 'function',
+ slice : 'function',
+ some : 'function boolean',
+ sort : 'function',
+ splice : 'function',
+ stringify : 'function string',
+ substr : 'function string',
+ substring : 'function string',
+ test : 'function boolean',
+ toDateString : 'function string',
+ toExponential : 'function string',
+ toFixed : 'function string',
+ toJSON : 'function',
+ toISOString : 'function string',
+ toLocaleDateString : 'function string',
+ toLocaleLowerCase : 'function string',
+ toLocaleUpperCase : 'function string',
+ toLocaleString : 'function string',
+ toLocaleTimeString : 'function string',
+ toLowerCase : 'function string',
+ toPrecision : 'function string',
+ toTimeString : 'function string',
+ toUpperCase : 'function string',
+ toUTCString : 'function string',
+ trim : 'function string',
+ unshift : 'function number',
+ valueOf : 'function'
+ },
+
+ strict_mode,
+ syntax = {},
+ tab,
+ token,
+// type_state_change,
+ urls,
+ var_mode,
+ warnings,
+
+// widget contains the global names which are provided to a Yahoo
+// (fna Konfabulator) widget.
+
+ widget = array_to_object([
+ 'alert', 'animator', 'appleScript', 'beep', 'bytesToUIString',
+ 'Canvas', 'chooseColor', 'chooseFile', 'chooseFolder',
+ 'closeWidget', 'COM', 'convertPathToHFS', 'convertPathToPlatform',
+ 'CustomAnimation', 'escape', 'FadeAnimation', 'filesystem', 'Flash',
+ 'focusWidget', 'form', 'FormField', 'Frame', 'HotKey', 'Image',
+ 'include', 'isApplicationRunning', 'iTunes', 'konfabulatorVersion',
+ 'log', 'md5', 'MenuItem', 'MoveAnimation', 'openURL', 'play',
+ 'Point', 'popupMenu', 'preferenceGroups', 'preferences', 'print',
+ 'prompt', 'random', 'Rectangle', 'reloadWidget', 'ResizeAnimation',
+ 'resolvePath', 'resumeUpdates', 'RotateAnimation', 'runCommand',
+ 'runCommandInBg', 'saveAs', 'savePreferences', 'screen',
+ 'ScrollBar', 'showWidgetPreferences', 'sleep', 'speak', 'Style',
+ 'suppressUpdates', 'system', 'tellWidget', 'Text', 'TextArea',
+ 'Timer', 'unescape', 'updateNow', 'URL', 'Web', 'widget', 'Window',
+ 'XMLDOM', 'XMLHttpRequest', 'yahooCheckLogin', 'yahooLogin',
+ 'yahooLogout'
+ ], true),
+
+ windows = array_to_object([
+ 'ActiveXObject', 'CScript', 'Debug', 'Enumerator', 'System',
+ 'VBArray', 'WScript', 'WSH'
+ ], false),
+
+// xmode is used to adapt to the exceptions in html parsing.
+// It can have these states:
+// '' .js script file
+// 'html'
+// 'outer'
+// 'script'
+// 'style'
+// 'scriptstring'
+// 'styleproperty'
+
+ xmode,
+ xquote,
+
+// Regular expressions. Some of these are stupidly long.
+
+// unsafe comment or string
+ ax = /@cc|<\/?|script|\]\s*\]|<\s*!|</i,
+// carriage return, or carriage return linefeed
+ crx = /\r/g,
+ crlfx = /\r\n/g,
+// unsafe characters that are silently deleted by one or more browsers
+ cx = /[\u0000-\u001f\u007f-\u009f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/,
+// query characters for ids
+ dx = /[\[\]\/\\"'*<>.&:(){}+=#]/,
+// html token
+ hx = /^\s*(['"=>\/&#]|<(?:\/|\!(?:--)?)?|[a-zA-Z][a-zA-Z0-9_\-:]*|[0-9]+|--)/,
+// identifier
+ ix = /^([a-zA-Z_$][a-zA-Z0-9_$]*)$/,
+// javascript url
+ jx = /^(?:javascript|jscript|ecmascript|vbscript|mocha|livescript)\s*:/i,
+// star slash
+ lx = /\*\/|\/\*/,
+// characters in strings that need escapement
+ nx = /[\u0000-\u001f'\\\u007f-\u009f\u00ad\u0600-\u0604\u070f\u17b4\u17b5\u200c-\u200f\u2028-\u202f\u2060-\u206f\ufeff\ufff0-\uffff]/g,
+// outer html token
+ ox = /[>&]|<[\/!]?|--/,
+// attributes characters
+ qx = /[^a-zA-Z0-9+\-_\/ ]/,
+// style
+ sx = /^\s*([{}:#%.=,>+\[\]@()"';]|\*=?|\$=|\|=|\^=|~=|[a-zA-Z_][a-zA-Z0-9_\-]*|[0-9]+|<\/|\/\*)/,
+ ssx = /^\s*([@#!"'};:\-%.=,+\[\]()*_]|[a-zA-Z][a-zA-Z0-9._\-]*|\/\*?|\d+(?:\.\d+)?|<\/)/,
+// token
+ tx = /^\s*([(){}\[.,:;'"~\?\]#@]|==?=?|\/(\*(jslint|properties|property|members?|globals?)?|=|\/)?|\*[\/=]?|\+(?:=|\++)?|-(?:=|-+)?|%=?|&[&=]?|\|[|=]?|>>?>?=?|<([\/=!]|\!(\[|--)?|<=?)?|\^=?|\!=?=?|[a-zA-Z_$][a-zA-Z0-9_$]*|[0-9]+([xX][0-9a-fA-F]+|\.[0-9]*)?([eE][+\-]?[0-9]+)?)/,
+// url badness
+ ux = /&|\+|\u00AD|\.\.|\/\*|%[^;]|base64|url|expression|data|mailto|script/i,
+
+ rx = {
+ outer: hx,
+ html: hx,
+ style: sx,
+ styleproperty: ssx
+ };
+
+
+ function F() {} // Used by Object.create
+
+// Provide critical ES5 functions to ES3.
+
+ if (typeof Array.prototype.filter !== 'function') {
+ Array.prototype.filter = function (f) {
+ var i, length = this.length, result = [], value;
+ for (i = 0; i < length; i += 1) {
+ try {
+ value = this[i];
+ if (f(value)) {
+ result.push(value);
+ }
+ } catch (ignore) {
+ }
+ }
+ return result;
+ };
+ }
+
+ if (typeof Array.prototype.forEach !== 'function') {
+ Array.prototype.forEach = function (f) {
+ var i, length = this.length;
+ for (i = 0; i < length; i += 1) {
+ try {
+ f(this[i]);
+ } catch (ignore) {
+ }
+ }
+ };
+ }
+
+ if (typeof Array.isArray !== 'function') {
+ Array.isArray = function (o) {
+ return Object.prototype.toString.apply(o) === '[object Array]';
+ };
+ }
+
+ if (!Object.prototype.hasOwnProperty.call(Object, 'create')) {
+ Object.create = function (o) {
+ F.prototype = o;
+ return new F();
+ };
+ }
+
+ if (typeof Object.keys !== 'function') {
+ Object.keys = function (o) {
+ var array = [], key;
+ for (key in o) {
+ if (Object.prototype.hasOwnProperty.call(o, key)) {
+ array.push(key);
+ }
+ }
+ return array;
+ };
+ }
+
+ if (typeof String.prototype.entityify !== 'function') {
+ String.prototype.entityify = function () {
+ return this
+ .replace(/&/g, '&')
+ .replace(//g, '>');
+ };
+ }
+
+ if (typeof String.prototype.isAlpha !== 'function') {
+ String.prototype.isAlpha = function () {
+ return (this >= 'a' && this <= 'z\uffff') ||
+ (this >= 'A' && this <= 'Z\uffff');
+ };
+ }
+
+ if (typeof String.prototype.isDigit !== 'function') {
+ String.prototype.isDigit = function () {
+ return (this >= '0' && this <= '9');
+ };
+ }
+
+ if (typeof String.prototype.supplant !== 'function') {
+ String.prototype.supplant = function (o) {
+ return this.replace(/\{([^{}]*)\}/g, function (a, b) {
+ var replacement = o[b];
+ return typeof replacement === 'string' ||
+ typeof replacement === 'number' ? replacement : a;
+ });
+ };
+ }
+
+
+ function sanitize(a) {
+
+// Escapify a troublesome character.
+
+ return escapes[a] ||
+ '\\u' + ('0000' + a.charCodeAt().toString(16)).slice(-4);
+ }
+
+
+ function add_to_predefined(group) {
+ Object.keys(group).forEach(function (name) {
+ predefined[name] = group[name];
+ });
+ }
+
+
+ function assume() {
+ if (!option.safe) {
+ if (option.rhino) {
+ add_to_predefined(rhino);
+ option.rhino = false;
+ }
+ if (option.devel) {
+ add_to_predefined(devel);
+ option.devel = false;
+ }
+ if (option.browser) {
+ add_to_predefined(browser);
+ option.browser = false;
+ }
+ if (option.windows) {
+ add_to_predefined(windows);
+ option.windows = false;
+ }
+ if (option.node) {
+ add_to_predefined(node);
+ option.node = false;
+ node_js = true;
+ }
+ if (option.widget) {
+ add_to_predefined(widget);
+ option.widget = false;
+ }
+ }
+ if (option.type) {
+ option.confusion = true;
+ }
+ }
+
+
+// Produce an error warning.
+
+ function artifact(tok) {
+ if (!tok) {
+ tok = next_token;
+ }
+ return tok.number || tok.string;
+ }
+
+ function quit(message, line, character) {
+ throw {
+ name: 'JSLintError',
+ line: line,
+ character: character,
+ message: bundle.scanned_a_b.supplant({
+ a: message,
+ b: Math.floor((line / lines.length) * 100)
+ })
+ };
+ }
+
+ function warn(message, offender, a, b, c, d) {
+ var character, line, warning;
+ offender = offender || next_token; // `~
+ line = offender.line || 0;
+ character = offender.from || 0;
+ warning = {
+ id: '(error)',
+ raw: bundle[message] || message,
+ evidence: lines[line - 1] || '',
+ line: line,
+ character: character,
+ a: a || (offender.id === '(number)'
+ ? String(offender.number)
+ : offender.string),
+ b: b,
+ c: c,
+ d: d
+ };
+ warning.reason = warning.raw.supplant(warning);
+ JSLINT.errors.push(warning);
+ if (option.passfail) {
+ quit(bundle.stopping, line, character);
+ }
+ warnings += 1;
+ if (warnings >= option.maxerr) {
+ quit(bundle.too_many, line, character);
+ }
+ return warning;
+ }
+
+ function warn_at(message, line, character, a, b, c, d) {
+ return warn(message, {
+ line: line,
+ from: character
+ }, a, b, c, d);
+ }
+
+ function stop(message, offender, a, b, c, d) {
+ var warning = warn(message, offender, a, b, c, d);
+ quit(bundle.stopping, warning.line, warning.character);
+ }
+
+ function stop_at(message, line, character, a, b, c, d) {
+ return stop(message, {
+ line: line,
+ from: character
+ }, a, b, c, d);
+ }
+
+ function expected_at(at) {
+ if (!option.white && next_token.from !== at) {
+ warn('expected_a_at_b_c', next_token, '', at,
+ next_token.from);
+ }
+ }
+
+ function aint(it, name, expected) {
+ if (it[name] !== expected) {
+ warn('expected_a_b', it, expected, it[name]);
+ return true;
+ } else {
+ return false;
+ }
+ }
+
+
+// lexical analysis and token construction
+
+ lex = (function lex() {
+ var character, c, from, length, line, pos, source_row;
+
+// Private lex methods
+
+ function next_line() {
+ var at;
+ if (line >= lines.length) {
+ return false;
+ }
+ character = 1;
+ source_row = lines[line];
+ line += 1;
+ at = source_row.search(/ \t/);
+ if (at >= 0) {
+ warn_at('mixed', line, at + 1);
+ }
+ source_row = source_row.replace(/\t/g, tab);
+ at = source_row.search(cx);
+ if (at >= 0) {
+ warn_at('unsafe', line, at);
+ }
+ if (option.maxlen && option.maxlen < source_row.length) {
+ warn_at('too_long', line, source_row.length);
+ }
+ return true;
+ }
+
+// Produce a token object. The token inherits from a syntax symbol.
+
+ function it(type, value) {
+ var id, the_token;
+ if (type === '(string)' || type === '(range)') {
+ if (jx.test(value)) {
+ warn_at('url', line, from);
+ }
+ }
+ the_token = Object.create(syntax[(
+ type === '(punctuator)' || (type === '(identifier)' &&
+ Object.prototype.hasOwnProperty.call(syntax, value))
+ ? value
+ : type
+ )] || syntax['(error)']);
+ if (type === '(identifier)') {
+ the_token.identifier = true;
+ if (value === '__iterator__' || value === '__proto__') {
+ stop_at('reserved_a', line, from, value);
+ } else if (!option.nomen &&
+ (value.charAt(0) === '_' ||
+ value.charAt(value.length - 1) === '_')) {
+ warn_at('dangling_a', line, from, value);
+ }
+ }
+ if (type === '(number)') {
+ the_token.number = +value;
+ } else if (value !== undefined) {
+ the_token.string = String(value);
+ }
+ the_token.line = line;
+ the_token.from = from;
+ the_token.thru = character;
+ id = the_token.id;
+ prereg = id && (
+ ('(,=:[!&|?{};'.indexOf(id.charAt(id.length - 1)) >= 0) ||
+ id === 'return' || id === 'case'
+ );
+ return the_token;
+ }
+
+ function match(x) {
+ var exec = x.exec(source_row), first;
+ if (exec) {
+ length = exec[0].length;
+ first = exec[1];
+ c = first.charAt(0);
+ source_row = source_row.slice(length);
+ from = character + length - first.length;
+ character += length;
+ return first;
+ }
+ }
+
+ function string(x) {
+ var c, pos = 0, r = '', result;
+
+ function hex(n) {
+ var i = parseInt(source_row.substr(pos + 1, n), 16);
+ pos += n;
+ if (i >= 32 && i <= 126 &&
+ i !== 34 && i !== 92 && i !== 39) {
+ warn_at('unexpected_a', line, character, '\\');
+ }
+ character += n;
+ c = String.fromCharCode(i);
+ }
+
+ if (json_mode && x !== '"') {
+ warn_at('expected_a', line, character, '"');
+ }
+
+ if (xquote === x || (xmode === 'scriptstring' && !xquote)) {
+ return it('(punctuator)', x);
+ }
+
+ for (;;) {
+ while (pos >= source_row.length) {
+ pos = 0;
+ if (xmode !== 'html' || !next_line()) {
+ stop_at('unclosed', line, from);
+ }
+ }
+ c = source_row.charAt(pos);
+ if (c === x) {
+ character += 1;
+ source_row = source_row.slice(pos + 1);
+ result = it('(string)', r);
+ result.quote = x;
+ return result;
+ }
+ if (c < ' ') {
+ if (c === '\n' || c === '\r') {
+ break;
+ }
+ warn_at('control_a', line, character + pos,
+ source_row.slice(0, pos));
+ } else if (c === xquote) {
+ warn_at('bad_html', line, character + pos);
+ } else if (c === '<') {
+ if (option.safe && xmode === 'html') {
+ warn_at('adsafe_a', line, character + pos, c);
+ } else if (source_row.charAt(pos + 1) === '/' && (xmode || option.safe)) {
+ warn_at('expected_a_b', line, character,
+ '<\\/', ' 0) {
+ warn_at('unescaped_a', line, from + length, '/');
+ }
+ c = source_row.slice(0, length - 1);
+ potential = Object.create(regexp_flag);
+ for (;;) {
+ letter = source_row.charAt(length);
+ if (potential[letter] !== true) {
+ break;
+ }
+ potential[letter] = false;
+ length += 1;
+ flag += letter;
+ }
+ if (source_row.charAt(length).isAlpha()) {
+ stop_at('unexpected_a', line, from, source_row.charAt(length));
+ }
+ character += length;
+ source_row = source_row.slice(length);
+ quote = source_row.charAt(0);
+ if (quote === '/' || quote === '*') {
+ stop_at('confusing_regexp', line, from);
+ }
+ result = it('(regexp)', c);
+ result.flag = flag;
+ return result;
+ case '\\':
+ c = source_row.charAt(length);
+ if (c < ' ') {
+ warn_at('control_a', line, from + length, String(c));
+ } else if (c === '<') {
+ warn_at(bundle.unexpected_a, line, from + length, '\\');
+ }
+ length += 1;
+ break;
+ case '(':
+ depth += 1;
+ b = false;
+ if (source_row.charAt(length) === '?') {
+ length += 1;
+ switch (source_row.charAt(length)) {
+ case ':':
+ case '=':
+ case '!':
+ length += 1;
+ break;
+ default:
+ warn_at(bundle.expected_a_b, line, from + length,
+ ':', source_row.charAt(length));
+ }
+ } else {
+ captures += 1;
+ }
+ break;
+ case '|':
+ b = false;
+ break;
+ case ')':
+ if (depth === 0) {
+ warn_at('unescaped_a', line, from + length, ')');
+ } else {
+ depth -= 1;
+ }
+ break;
+ case ' ':
+ pos = 1;
+ while (source_row.charAt(length) === ' ') {
+ length += 1;
+ pos += 1;
+ }
+ if (pos > 1) {
+ warn_at('use_braces', line, from + length, pos);
+ }
+ break;
+ case '[':
+ c = source_row.charAt(length);
+ if (c === '^') {
+ length += 1;
+ if (!option.regexp) {
+ warn_at('insecure_a', line, from + length, c);
+ } else if (source_row.charAt(length) === ']') {
+ stop_at('unescaped_a', line, from + length, '^');
+ }
+ }
+ bit = false;
+ if (c === ']') {
+ warn_at('empty_class', line, from + length - 1);
+ bit = true;
+ }
+klass: do {
+ c = source_row.charAt(length);
+ length += 1;
+ switch (c) {
+ case '[':
+ case '^':
+ warn_at('unescaped_a', line, from + length, c);
+ bit = true;
+ break;
+ case '-':
+ if (bit) {
+ bit = false;
+ } else {
+ warn_at('unescaped_a', line, from + length, '-');
+ bit = true;
+ }
+ break;
+ case ']':
+ if (!bit) {
+ warn_at('unescaped_a', line, from + length - 1, '-');
+ }
+ break klass;
+ case '\\':
+ c = source_row.charAt(length);
+ if (c < ' ') {
+ warn_at(bundle.control_a, line, from + length, String(c));
+ } else if (c === '<') {
+ warn_at(bundle.unexpected_a, line, from + length, '\\');
+ }
+ length += 1;
+ bit = true;
+ break;
+ case '/':
+ warn_at('unescaped_a', line, from + length - 1, '/');
+ bit = true;
+ break;
+ case '<':
+ if (xmode === 'script') {
+ c = source_row.charAt(length);
+ if (c === '!' || c === '/') {
+ warn_at(bundle.html_confusion_a, line,
+ from + length, c);
+ }
+ }
+ bit = true;
+ break;
+ default:
+ bit = true;
+ }
+ } while (c);
+ break;
+ case '.':
+ if (!option.regexp) {
+ warn_at('insecure_a', line, from + length, c);
+ }
+ break;
+ case ']':
+ case '?':
+ case '{':
+ case '}':
+ case '+':
+ case '*':
+ warn_at('unescaped_a', line, from + length, c);
+ break;
+ case '<':
+ if (xmode === 'script') {
+ c = source_row.charAt(length);
+ if (c === '!' || c === '/') {
+ warn_at(bundle.html_confusion_a, line, from + length, c);
+ }
+ }
+ break;
+ }
+ if (b) {
+ switch (source_row.charAt(length)) {
+ case '?':
+ case '+':
+ case '*':
+ length += 1;
+ if (source_row.charAt(length) === '?') {
+ length += 1;
+ }
+ break;
+ case '{':
+ length += 1;
+ c = source_row.charAt(length);
+ if (c < '0' || c > '9') {
+ warn_at(bundle.expected_number_a, line,
+ from + length, c);
+ }
+ length += 1;
+ low = +c;
+ for (;;) {
+ c = source_row.charAt(length);
+ if (c < '0' || c > '9') {
+ break;
+ }
+ length += 1;
+ low = +c + (low * 10);
+ }
+ high = low;
+ if (c === ',') {
+ length += 1;
+ high = Infinity;
+ c = source_row.charAt(length);
+ if (c >= '0' && c <= '9') {
+ length += 1;
+ high = +c;
+ for (;;) {
+ c = source_row.charAt(length);
+ if (c < '0' || c > '9') {
+ break;
+ }
+ length += 1;
+ high = +c + (high * 10);
+ }
+ }
+ }
+ if (source_row.charAt(length) !== '}') {
+ warn_at(bundle.expected_a_b, line, from + length,
+ '}', c);
+ } else {
+ length += 1;
+ }
+ if (source_row.charAt(length) === '?') {
+ length += 1;
+ }
+ if (low > high) {
+ warn_at(bundle.not_greater, line, from + length,
+ low, high);
+ }
+ break;
+ }
+ }
+ }
+ c = source_row.slice(0, length - 1);
+ character += length;
+ source_row = source_row.slice(length);
+ return it('(regexp)', c);
+ }
+
+// Public lex methods
+
+ return {
+ init: function (source) {
+ if (typeof source === 'string') {
+ lines = source
+ .replace(crlfx, '\n')
+ .replace(crx, '\n')
+ .split('\n');
+ } else {
+ lines = source;
+ }
+ line = 0;
+ next_line();
+ from = 1;
+ },
+
+ range: function (begin, end) {
+ var c, value = '';
+ from = character;
+ if (source_row.charAt(0) !== begin) {
+ stop_at('expected_a_b', line, character, begin,
+ source_row.charAt(0));
+ }
+ for (;;) {
+ source_row = source_row.slice(1);
+ character += 1;
+ c = source_row.charAt(0);
+ switch (c) {
+ case '':
+ stop_at('missing_a', line, character, c);
+ break;
+ case end:
+ source_row = source_row.slice(1);
+ character += 1;
+ return it('(range)', value);
+ case xquote:
+ case '\\':
+ warn_at('unexpected_a', line, character, c);
+ break;
+ }
+ value += c;
+ }
+ },
+
+// token -- this is called by advance to get the next token.
+
+ token: function () {
+ var c, i, snippet;
+
+ for (;;) {
+ while (!source_row) {
+ if (!next_line()) {
+ return it('(end)');
+ }
+ }
+ while (xmode === 'outer') {
+ i = source_row.search(ox);
+ if (i === 0) {
+ break;
+ } else if (i > 0) {
+ character += 1;
+ source_row = source_row.slice(i);
+ break;
+ } else {
+ if (!next_line()) {
+ return it('(end)', '');
+ }
+ }
+ }
+ snippet = match(rx[xmode] || tx);
+ if (!snippet) {
+ if (source_row) {
+ if (source_row.charAt(0) === ' ') {
+ if (!option.white) {
+ warn_at('unexpected_a', line, character,
+ '(space)');
+ }
+ character += 1;
+ source_row = '';
+ } else {
+ stop_at('unexpected_a', line, character,
+ source_row.charAt(0));
+ }
+ }
+ } else {
+
+// identifier
+
+ c = snippet.charAt(0);
+ if (c.isAlpha() || c === '_' || c === '$') {
+ return it('(identifier)', snippet);
+ }
+
+// number
+
+ if (c.isDigit()) {
+ return number(snippet);
+ }
+ switch (snippet) {
+
+// string
+
+ case '"':
+ case "'":
+ return string(snippet);
+
+// // comment
+
+ case '//':
+ comment(source_row);
+ source_row = '';
+ break;
+
+// /* comment
+
+ case '/*':
+ for (;;) {
+ i = source_row.search(lx);
+ if (i >= 0) {
+ break;
+ }
+ comment(source_row);
+ if (!next_line()) {
+ stop_at('unclosed_comment', line, character);
+ }
+ }
+ comment(source_row.slice(0, i));
+ character += i + 2;
+ if (source_row.charAt(i) === '/') {
+ stop_at('nested_comment', line, character);
+ }
+ source_row = source_row.slice(i + 2);
+ break;
+
+ case '':
+ break;
+// /
+ case '/':
+ if (token.id === '/=') {
+ stop_at(
+ bundle.slash_equal,
+ line,
+ from
+ );
+ }
+ return prereg
+ ? regexp()
+ : it('(punctuator)', snippet);
+
+// punctuator
+
+ case '');
+ }
+ character += 3;
+ source_row = source_row.slice(i + 3);
+ break;
+ case '#':
+ if (xmode === 'html' || xmode === 'styleproperty') {
+ for (;;) {
+ c = source_row.charAt(0);
+ if ((c < '0' || c > '9') &&
+ (c < 'a' || c > 'f') &&
+ (c < 'A' || c > 'F')) {
+ break;
+ }
+ character += 1;
+ source_row = source_row.slice(1);
+ snippet += c;
+ }
+ if (snippet.length !== 4 && snippet.length !== 7) {
+ warn_at('bad_color_a', line,
+ from + length, snippet);
+ }
+ return it('(color)', snippet);
+ }
+ return it('(punctuator)', snippet);
+
+ default:
+ if (xmode === 'outer' && c === '&') {
+ character += 1;
+ source_row = source_row.slice(1);
+ for (;;) {
+ c = source_row.charAt(0);
+ character += 1;
+ source_row = source_row.slice(1);
+ if (c === ';') {
+ break;
+ }
+ if (!((c >= '0' && c <= '9') ||
+ (c >= 'a' && c <= 'z') ||
+ c === '#')) {
+ stop_at('bad_entity', line, from + length,
+ character);
+ }
+ }
+ break;
+ }
+ return it('(punctuator)', snippet);
+ }
+ }
+ }
+ }
+ };
+ }());
+
+
+ function add_label(token, kind, name) {
+
+// Define the symbol in the current function in the current scope.
+
+ name = name || token.string;
+
+// Global variables cannot be created in the safe subset. If a global variable
+// already exists, do nothing. If it is predefined, define it.
+
+ if (funct === global_funct) {
+ if (option.safe) {
+ warn('adsafe_a', token, name);
+ }
+ if (typeof global_funct[name] !== 'string') {
+ token.writeable = typeof predefined[name] === 'boolean'
+ ? predefined[name]
+ : true;
+ token.funct = funct;
+ global_scope[name] = token;
+ }
+ if (kind === 'becoming') {
+ kind = 'var';
+ }
+
+// Ordinary variables.
+
+ } else {
+
+// Warn if the variable already exists.
+
+ if (typeof funct[name] === 'string') {
+ if (funct[name] === 'undef') {
+ if (!option.undef) {
+ warn('used_before_a', token, name);
+ }
+ kind = 'var';
+ } else {
+ warn('already_defined', token, name);
+ }
+ } else {
+
+// Add the symbol to the current function.
+
+ token.funct = funct;
+ token.writeable = true;
+ scope[name] = token;
+ }
+ }
+ funct[name] = kind;
+ }
+
+
+ function peek(distance) {
+
+// Peek ahead to a future token. The distance is how far ahead to look. The
+// default is the next token.
+
+ var found, slot = 0;
+
+ distance = distance || 0;
+ while (slot <= distance) {
+ found = lookahead[slot];
+ if (!found) {
+ found = lookahead[slot] = lex.token();
+ }
+ slot += 1;
+ }
+ return found;
+ }
+
+
+ function advance(id, match) {
+
+// Produce the next token, also looking for programming errors.
+
+ if (indent) {
+
+// If indentation checking was requested, then inspect all of the line breakings.
+// The var statement is tricky because the names might be aligned or not. We
+// look at the first line break after the var to determine the programmer's
+// intention.
+
+ if (var_mode && next_token.line !== token.line) {
+ if ((var_mode !== indent || !next_token.edge) &&
+ next_token.from === indent.at -
+ (next_token.edge ? option.indent : 0)) {
+ var dent = indent;
+ for (;;) {
+ dent.at -= option.indent;
+ if (dent === var_mode) {
+ break;
+ }
+ dent = dent.was;
+ }
+ dent.open = false;
+ }
+ var_mode = null;
+ }
+ if (next_token.id === '?' && indent.mode === ':' &&
+ token.line !== next_token.line) {
+ indent.at -= option.indent;
+ }
+ if (indent.open) {
+
+// If the token is an edge.
+
+ if (next_token.edge) {
+ if (next_token.edge === 'label') {
+ expected_at(1);
+ } else if (next_token.edge === 'case') {
+ expected_at(indent.at - option.indent);
+ } else if (indent.mode !== 'array' || next_token.line !== token.line) {
+ expected_at(indent.at);
+ }
+
+// If the token is not an edge, but is the first token on the line.
+
+ } else if (next_token.line !== token.line) {
+ if (next_token.from < indent.at + (indent.mode ===
+ 'expression' ? 0 : option.indent)) {
+ expected_at(indent.at + option.indent);
+ }
+ indent.wrap = true;
+ }
+ } else if (next_token.line !== token.line) {
+ if (next_token.edge) {
+ expected_at(indent.at);
+ } else {
+ indent.wrap = true;
+ if (indent.mode === 'statement' || indent.mode === 'var') {
+ expected_at(indent.at + option.indent);
+ } else if (next_token.from < indent.at + (indent.mode ===
+ 'expression' ? 0 : option.indent)) {
+ expected_at(indent.at + option.indent);
+ }
+ }
+ }
+ }
+
+ switch (token.id) {
+ case '(number)':
+ if (next_token.id === '.') {
+ warn('trailing_decimal_a');
+ }
+ break;
+ case '-':
+ if (next_token.id === '-' || next_token.id === '--') {
+ warn('confusing_a');
+ }
+ break;
+ case '+':
+ if (next_token.id === '+' || next_token.id === '++') {
+ warn('confusing_a');
+ }
+ break;
+ }
+ if (token.id === '(string)' || token.identifier) {
+ anonname = token.string;
+ }
+
+ if (id && next_token.id !== id) {
+ if (match) {
+ warn('expected_a_b_from_c_d', next_token, id,
+ match.id, match.line, artifact());
+ } else if (!next_token.identifier || next_token.string !== id) {
+ warn('expected_a_b', next_token, id, artifact());
+ }
+ }
+ prev_token = token;
+ token = next_token;
+ next_token = lookahead.shift() || lex.token();
+ }
+
+
+ function advance_identifier(string) {
+ if (next_token.identifier && next_token.string === string) {
+ advance();
+ } else {
+ warn('expected_a_b', next_token, string, artifact());
+ }
+ }
+
+
+ function do_safe() {
+ if (option.adsafe) {
+ option.safe = true;
+ }
+ if (option.safe) {
+ option.browser =
+ option['continue'] =
+ option.css =
+ option.debug =
+ option.devel =
+ option.evil =
+ option.forin =
+ option.newcap =
+ option.nomen =
+ option.on =
+ option.rhino =
+ option.sloppy =
+ option.sub =
+ option.undef =
+ option.widget =
+ option.windows = false;
+
+
+ delete predefined.Array;
+ delete predefined.Date;
+ delete predefined.Function;
+ delete predefined.Object;
+ delete predefined['eval'];
+
+ add_to_predefined({
+ ADSAFE: false,
+ lib: false
+ });
+ }
+ }
+
+
+ function do_globals() {
+ var name, writeable;
+ for (;;) {
+ if (next_token.id !== '(string)' && !next_token.identifier) {
+ return;
+ }
+ name = next_token.string;
+ advance();
+ writeable = false;
+ if (next_token.id === ':') {
+ advance(':');
+ switch (next_token.id) {
+ case 'true':
+ writeable = predefined[name] !== false;
+ advance('true');
+ break;
+ case 'false':
+ advance('false');
+ break;
+ default:
+ stop('unexpected_a');
+ }
+ }
+ predefined[name] = writeable;
+ if (next_token.id !== ',') {
+ return;
+ }
+ advance(',');
+ }
+ }
+
+
+ function do_jslint() {
+ var name, value;
+ while (next_token.id === '(string)' || next_token.identifier) {
+ name = next_token.string;
+ advance();
+ if (next_token.id !== ':') {
+ stop('expected_a_b', next_token, ':', artifact());
+ }
+ advance(':');
+ if (typeof jslint_limit[name] === 'number') {
+ value = next_token.number;
+ if (value > jslint_limit[name] || value <= 0 ||
+ Math.floor(value) !== value) {
+ stop('expected_small_a');
+ }
+ option[name] = value;
+ } else {
+ if (next_token.id === 'true') {
+ option[name] = true;
+ } else if (next_token.id === 'false') {
+ option[name] = false;
+ } else {
+ stop('unexpected_a');
+ }
+ switch (name) {
+ case 'adsafe':
+ option.safe = true;
+ do_safe();
+ break;
+ case 'safe':
+ do_safe();
+ break;
+ }
+ }
+ advance();
+ if (next_token.id === ',') {
+ advance(',');
+ }
+ }
+ assume();
+ }
+
+
+ function do_properties() {
+ var name, type;
+ option.properties = true;
+ if (!funct['(old_property_type)']) {
+ funct['(old_property_type)'] = property_type;
+ property_type = Object.create(property_type);
+ }
+ for (;;) {
+ if (next_token.id !== '(string)' && !next_token.identifier) {
+ return;
+ }
+ name = next_token.string;
+ type = '';
+ advance();
+ if (next_token.id === ':') {
+ advance(':');
+ if (next_token.id === 'function') {
+ advance('function');
+ if (is_type[next_token.string] === true) {
+ type = 'function ' + next_token.string;
+ advance();
+ } else {
+ type = 'function';
+ }
+ } else {
+ type = next_token.string;
+ if (is_type[type] !== true) {
+ warn('expected_type_a', next_token);
+ type = '';
+ }
+ advance();
+ }
+ }
+ property_type[name] = type;
+ if (next_token.id !== ',') {
+ return;
+ }
+ advance(',');
+ }
+ }
+
+
+ directive = function directive() {
+ var command = this.id,
+ old_comments_off = comments_off,
+ old_indent = indent;
+ comments_off = true;
+ indent = null;
+ if (next_token.line === token.line && next_token.from === token.thru) {
+ warn('missing_space_a_b', next_token, artifact(token), artifact());
+ }
+ if (lookahead.length > 0) {
+ warn('unexpected_a', this);
+ }
+ switch (command) {
+ case '/*properties':
+ case '/*property':
+ case '/*members':
+ case '/*member':
+ do_properties();
+ break;
+ case '/*jslint':
+ if (option.safe) {
+ warn('adsafe_a', this);
+ }
+ do_jslint();
+ break;
+ case '/*globals':
+ case '/*global':
+ if (option.safe) {
+ warn('adsafe_a', this);
+ }
+ do_globals();
+ break;
+ default:
+ stop('unexpected_a', this);
+ }
+ comments_off = old_comments_off;
+ advance('*/');
+ indent = old_indent;
+ };
+
+
+// Indentation intention
+
+ function edge(mode) {
+ next_token.edge = indent ? indent.open && (mode || 'edge') : '';
+ }
+
+
+ function step_in(mode) {
+ var open;
+ if (typeof mode === 'number') {
+ indent = {
+ at: +mode,
+ open: true,
+ was: indent
+ };
+ } else if (!indent) {
+ indent = {
+ at: 1,
+ mode: 'statement',
+ open: true
+ };
+ } else {
+ open = mode === 'var' ||
+ (next_token.line !== token.line && mode !== 'statement');
+ indent = {
+ at: (open || mode === 'control'
+ ? indent.at + option.indent
+ : indent.at) + (indent.wrap ? option.indent : 0),
+ mode: mode,
+ open: open,
+ was: indent
+ };
+ if (mode === 'var' && open) {
+ var_mode = indent;
+ }
+ }
+ }
+
+ function step_out(id, symbol) {
+ if (id) {
+ if (indent && indent.open) {
+ indent.at -= option.indent;
+ edge();
+ }
+ advance(id, symbol);
+ }
+ if (indent) {
+ indent = indent.was;
+ }
+ }
+
+// Functions for conformance of whitespace.
+
+ function one_space(left, right) {
+ left = left || token;
+ right = right || next_token;
+ if (right.id !== '(end)' && !option.white &&
+ (token.line !== right.line ||
+ token.thru + 1 !== right.from)) {
+ warn('expected_space_a_b', right, artifact(token), artifact(right));
+ }
+ }
+
+ function one_space_only(left, right) {
+ left = left || token;
+ right = right || next_token;
+ if (right.id !== '(end)' && (left.line !== right.line ||
+ (!option.white && left.thru + 1 !== right.from))) {
+ warn('expected_space_a_b', right, artifact(left), artifact(right));
+ }
+ }
+
+ function no_space(left, right) {
+ left = left || token;
+ right = right || next_token;
+ if ((!option.white || xmode === 'styleproperty' || xmode === 'style') &&
+ left.thru !== right.from && left.line === right.line) {
+ warn('unexpected_space_a_b', right, artifact(left), artifact(right));
+ }
+ }
+
+ function no_space_only(left, right) {
+ left = left || token;
+ right = right || next_token;
+ if (right.id !== '(end)' && (left.line !== right.line ||
+ (!option.white && left.thru !== right.from))) {
+ warn('unexpected_space_a_b', right, artifact(left), artifact(right));
+ }
+ }
+
+ function spaces(left, right) {
+ if (!option.white) {
+ left = left || token;
+ right = right || next_token;
+ if (left.thru === right.from && left.line === right.line) {
+ warn('missing_space_a_b', right, artifact(left), artifact(right));
+ }
+ }
+ }
+
+ function comma() {
+ if (next_token.id !== ',') {
+ warn_at('expected_a_b', token.line, token.thru, ',', artifact());
+ } else {
+ if (!option.white) {
+ no_space_only();
+ }
+ advance(',');
+ spaces();
+ }
+ }
+
+
+ function semicolon() {
+ if (next_token.id !== ';') {
+ warn_at('expected_a_b', token.line, token.thru, ';', artifact());
+ } else {
+ if (!option.white) {
+ no_space_only();
+ }
+ advance(';');
+ if (semicolon_coda[next_token.id] !== true) {
+ spaces();
+ }
+ }
+ }
+
+ function use_strict() {
+ if (next_token.string === 'use strict') {
+ if (strict_mode) {
+ warn('unnecessary_use');
+ }
+ edge();
+ advance();
+ semicolon();
+ strict_mode = true;
+ option.newcap = false;
+ option.undef = false;
+ return true;
+ } else {
+ return false;
+ }
+ }
+
+
+ function are_similar(a, b) {
+ if (a === b) {
+ return true;
+ }
+ if (Array.isArray(a)) {
+ if (Array.isArray(b) && a.length === b.length) {
+ var i;
+ for (i = 0; i < a.length; i += 1) {
+ if (!are_similar(a[i], b[i])) {
+ return false;
+ }
+ }
+ return true;
+ }
+ return false;
+ }
+ if (Array.isArray(b)) {
+ return false;
+ }
+ if (a.id === '(number)' && b.id === '(number)') {
+ return a.number === b.number;
+ }
+ if (a.arity === b.arity && a.string === b.string) {
+ switch (a.arity) {
+ case 'prefix':
+ case 'suffix':
+ case undefined:
+ return a.id === b.id && are_similar(a.first, b.first);
+ case 'infix':
+ return are_similar(a.first, b.first) &&
+ are_similar(a.second, b.second);
+ case 'ternary':
+ return are_similar(a.first, b.first) &&
+ are_similar(a.second, b.second) &&
+ are_similar(a.third, b.third);
+ case 'function':
+ case 'regexp':
+ return false;
+ default:
+ return true;
+ }
+ } else {
+ if (a.id === '.' && b.id === '[' && b.arity === 'infix') {
+ return a.second.string === b.second.string && b.second.id === '(string)';
+ } else if (a.id === '[' && a.arity === 'infix' && b.id === '.') {
+ return a.second.string === b.second.string && a.second.id === '(string)';
+ }
+ }
+ return false;
+ }
+
+
+// This is the heart of JSLINT, the Pratt parser. In addition to parsing, it
+// is looking for ad hoc lint patterns. We add .fud to Pratt's model, which is
+// like .nud except that it is only used on the first token of a statement.
+// Having .fud makes it much easier to define statement-oriented languages like
+// JavaScript. I retained Pratt's nomenclature.
+
+// .nud Null denotation
+// .fud First null denotation
+// .led Left denotation
+// lbp Left binding power
+// rbp Right binding power
+
+// They are elements of the parsing method called Top Down Operator Precedence.
+
+ function expression(rbp, initial) {
+
+// rbp is the right binding power.
+// initial indicates that this is the first expression of a statement.
+
+ var left;
+ if (next_token.id === '(end)') {
+ stop('unexpected_a', token, next_token.id);
+ }
+ advance();
+ if (option.safe && scope[token.string] &&
+ scope[token.string] === global_scope[token.string] &&
+ (next_token.id !== '(' && next_token.id !== '.')) {
+ warn('adsafe_a', token);
+ }
+ if (initial) {
+ anonname = 'anonymous';
+ funct['(verb)'] = token.string;
+ }
+ if (initial === true && token.fud) {
+ left = token.fud();
+ } else {
+ if (token.nud) {
+ left = token.nud();
+ } else {
+ if (next_token.id === '(number)' && token.id === '.') {
+ warn('leading_decimal_a', token, artifact());
+ advance();
+ return token;
+ } else {
+ stop('expected_identifier_a', token, token.id);
+ }
+ }
+ while (rbp < next_token.lbp) {
+ advance();
+ if (token.led) {
+ left = token.led(left);
+ } else {
+ stop('expected_operator_a', token, token.id);
+ }
+ }
+ }
+ return left;
+ }
+
+
+// Functional constructors for making the symbols that will be inherited by
+// tokens.
+
+ function symbol(s, p) {
+ var x = syntax[s];
+ if (!x || typeof x !== 'object') {
+ syntax[s] = x = {
+ id: s,
+ lbp: p || 0,
+ string: s
+ };
+ }
+ return x;
+ }
+
+ function postscript(x) {
+ x.postscript = true;
+ return x;
+ }
+
+ function ultimate(s) {
+ var x = symbol(s, 0);
+ x.from = 1;
+ x.thru = 1;
+ x.line = 0;
+ x.edge = 'edge';
+ s.string = s;
+ return postscript(x);
+ }
+
+
+ function stmt(s, f) {
+ var x = symbol(s);
+ x.identifier = x.reserved = true;
+ x.fud = f;
+ return x;
+ }
+
+ function labeled_stmt(s, f) {
+ var x = stmt(s, f);
+ x.labeled = true;
+ }
+
+ function disrupt_stmt(s, f) {
+ var x = stmt(s, f);
+ x.disrupt = true;
+ }
+
+
+ function reserve_name(x) {
+ var c = x.id.charAt(0);
+ if ((c >= 'a' && c <= 'z') || (c >= 'A' && c <= 'Z')) {
+ x.identifier = x.reserved = true;
+ }
+ return x;
+ }
+
+
+ function prefix(s, f, type) {
+ var x = symbol(s, 150);
+ reserve_name(x);
+ x.nud = typeof f === 'function'
+ ? f
+ : function () {
+ if (s === 'typeof') {
+ one_space();
+ } else {
+ no_space_only();
+ }
+ this.first = expression(150);
+ this.arity = 'prefix';
+ if (this.id === '++' || this.id === '--') {
+ if (!option.plusplus) {
+ warn('unexpected_a', this);
+ } else if ((!this.first.identifier || this.first.reserved) &&
+ this.first.id !== '.' && this.first.id !== '[') {
+ warn('bad_operand', this);
+ }
+ }
+ this.type = type;
+ return this;
+ };
+ return x;
+ }
+
+
+ function type(s, t, nud) {
+ var x = symbol(s);
+ x.arity = x.type = t;
+ if (nud) {
+ x.nud = nud;
+ }
+ return x;
+ }
+
+
+ function reserve(s, f) {
+ var x = symbol(s);
+ x.identifier = x.reserved = true;
+ if (typeof f === 'function') {
+ x.nud = f;
+ }
+ return x;
+ }
+
+
+ function constant(name, type) {
+ var x = reserve(name);
+ x.type = type;
+ x.string = name;
+ x.nud = return_this;
+ return x;
+ }
+
+
+ function reservevar(s, v) {
+ return reserve(s, function () {
+ if (typeof v === 'function') {
+ v(this);
+ }
+ return this;
+ });
+ }
+
+
+ function infix(s, p, f, type, w) {
+ var x = symbol(s, p);
+ reserve_name(x);
+ x.led = function (left) {
+ this.arity = 'infix';
+ if (!w) {
+ spaces(prev_token, token);
+ spaces();
+ }
+ if (!option.bitwise && this.bitwise) {
+ warn('unexpected_a', this);
+ }
+ if (typeof f === 'function') {
+ return f(left, this);
+ } else {
+ this.first = left;
+ this.second = expression(p);
+ return this;
+ }
+ };
+ if (type) {
+ x.type = type;
+ }
+ return x;
+ }
+
+ function expected_relation(node, message) {
+ if (node.assign) {
+ warn(message || bundle.conditional_assignment, node);
+ }
+ return node;
+ }
+
+ function expected_condition(node, message) {
+ switch (node.id) {
+ case '[':
+ case '-':
+ if (node.arity !== 'infix') {
+ warn(message || bundle.weird_condition, node);
+ }
+ break;
+ case 'false':
+ case 'function':
+ case 'Infinity':
+ case 'NaN':
+ case 'null':
+ case 'true':
+ case 'undefined':
+ case 'void':
+ case '(number)':
+ case '(regexp)':
+ case '(string)':
+ case '{':
+ warn(message || bundle.weird_condition, node);
+ break;
+ case '(':
+ if (node.first.id === '.' && numbery[node.first.second.string] === true) {
+ warn(message || bundle.weird_condition, node);
+ }
+ break;
+ }
+ return node;
+ }
+
+ function check_relation(node) {
+ switch (node.arity) {
+ case 'prefix':
+ switch (node.id) {
+ case '{':
+ case '[':
+ warn('unexpected_a', node);
+ break;
+ case '!':
+ warn('confusing_a', node);
+ break;
+ }
+ break;
+ case 'function':
+ case 'regexp':
+ warn('unexpected_a', node);
+ break;
+ default:
+ if (node.id === 'NaN') {
+ warn('isnan', node);
+ }
+ }
+ return node;
+ }
+
+
+ function relation(s, eqeq) {
+ return infix(s, 100, function (left, that) {
+ check_relation(left);
+ if (eqeq && !option.eqeq) {
+ warn('expected_a_b', that, eqeq, that.id);
+ }
+ var right = expression(100);
+ if (are_similar(left, right) ||
+ ((left.id === '(string)' || left.id === '(number)') &&
+ (right.id === '(string)' || right.id === '(number)'))) {
+ warn('weird_relation', that);
+ }
+ that.first = left;
+ that.second = check_relation(right);
+ return that;
+ }, 'boolean');
+ }
+
+
+ function assignop(s, op) {
+ var x = infix(s, 20, function (left, that) {
+ var l;
+ that.first = left;
+ if (left.identifier) {
+ if (scope[left.string]) {
+ if (scope[left.string].writeable === false) {
+ warn('read_only', left);
+ }
+ } else {
+ stop('read_only');
+ }
+ } else if (option.safe) {
+ l = left;
+ do {
+ if (typeof predefined[l.string] === 'boolean') {
+ warn('adsafe_a', l);
+ }
+ l = l.first;
+ } while (l);
+ }
+ if (left === syntax['function']) {
+ warn('identifier_function', token);
+ }
+ if (left.id === '.' || left.id === '[') {
+ if (!left.first || left.first.string === 'arguments') {
+ warn('bad_assignment', that);
+ }
+ } else if (left.identifier && !left.reserved) {
+ if (funct[left.string] === 'exception') {
+ warn('assign_exception', left);
+ }
+ }
+ that.second = expression(19);
+ if (that.id === '=' && are_similar(that.first, that.second)) {
+ warn('weird_assignment', that);
+ }
+ return that;
+ });
+ x.assign = true;
+ if (op) {
+ if (syntax[op].type) {
+ x.type = syntax[op].type;
+ }
+ if (syntax[op].bitwise) {
+ x.bitwise = true;
+ }
+ }
+ return x;
+ }
+
+
+ function bitwise(s, p) {
+ var x = infix(s, p, 'number');
+ x.bitwise = true;
+ return x;
+ }
+
+
+ function suffix(s) {
+ var x = symbol(s, 150);
+ x.led = function (left) {
+ no_space_only(prev_token, token);
+ if (!option.plusplus) {
+ warn('unexpected_a', this);
+ } else if ((!left.identifier || left.reserved) &&
+ left.id !== '.' && left.id !== '[') {
+ warn('bad_operand', this);
+ }
+ this.first = left;
+ this.arity = 'suffix';
+ return this;
+ };
+ return x;
+ }
+
+
+ function optional_identifier() {
+ if (next_token.identifier) {
+ advance();
+ if (option.safe && banned[token.string]) {
+ warn('adsafe_a', token);
+ } else if (token.reserved && !option.es5) {
+ warn('expected_identifier_a_reserved', token);
+ }
+ return token.string;
+ }
+ }
+
+
+ function identifier() {
+ var i = optional_identifier();
+ if (!i) {
+ stop(token.id === 'function' && next_token.id === '('
+ ? 'name_function'
+ : 'expected_identifier_a');
+ }
+ return i;
+ }
+
+
+ function statement() {
+
+ var label, old_scope = scope, the_statement;
+
+// We don't like the empty statement.
+
+ if (next_token.id === ';') {
+ warn('unexpected_a');
+ semicolon();
+ return;
+ }
+
+// Is this a labeled statement?
+
+ if (next_token.identifier && !next_token.reserved && peek().id === ':') {
+ edge('label');
+ label = next_token;
+ advance();
+ advance(':');
+ scope = Object.create(old_scope);
+ add_label(label, 'label');
+ if (next_token.labeled !== true) {
+ warn('label_a_b', next_token, label.string, artifact());
+ } else if (jx.test(label.string + ':')) {
+ warn('url', label);
+ } else if (funct === global_funct) {
+ stop('unexpected_a', token);
+ }
+ next_token.label = label;
+ }
+
+// Parse the statement.
+
+ edge();
+ step_in('statement');
+ the_statement = expression(0, true);
+ if (the_statement) {
+
+// Look for the final semicolon.
+
+ if (the_statement.arity === 'statement') {
+ if (the_statement.id === 'switch' ||
+ (the_statement.block && the_statement.id !== 'do')) {
+ spaces();
+ } else {
+ semicolon();
+ }
+ } else {
+
+// If this is an expression statement, determine if it is acceptable.
+// We do not like
+// new Blah();
+// statments. If it is to be used at all, new should only be used to make
+// objects, not side effects. The expression statements we do like do
+// assignment or invocation or delete.
+
+ if (the_statement.id === '(') {
+ if (the_statement.first.id === 'new') {
+ warn('bad_new');
+ }
+ } else if (!the_statement.assign &&
+ the_statement.id !== 'delete' &&
+ the_statement.id !== '++' &&
+ the_statement.id !== '--') {
+ warn('assignment_function_expression', token);
+ }
+ semicolon();
+ }
+ }
+ step_out();
+ scope = old_scope;
+ return the_statement;
+ }
+
+
+ function statements() {
+ var array = [], disruptor, the_statement;
+
+// A disrupt statement may not be followed by any other statement.
+// If the last statement is disrupt, then the sequence is disrupt.
+
+ while (next_token.postscript !== true) {
+ if (next_token.id === ';') {
+ warn('unexpected_a', next_token);
+ semicolon();
+ } else {
+ if (next_token.string === 'use strict') {
+ if ((!node_js && xmode !== 'script') || funct !== global_funct || array.length > 0) {
+ warn('function_strict');
+ }
+ use_strict();
+ }
+ if (disruptor) {
+ warn('unreachable_a_b', next_token, next_token.string,
+ disruptor.string);
+ disruptor = null;
+ }
+ the_statement = statement();
+ if (the_statement) {
+ array.push(the_statement);
+ if (the_statement.disrupt) {
+ disruptor = the_statement;
+ array.disrupt = true;
+ }
+ }
+ }
+ }
+ return array;
+ }
+
+
+ function block(ordinary) {
+
+// array block is array sequence of statements wrapped in braces.
+// ordinary is false for function bodies and try blocks.
+// ordinary is true for if statements, while, etc.
+
+ var array,
+ curly = next_token,
+ old_in_block = in_block,
+ old_scope = scope,
+ old_strict_mode = strict_mode;
+
+ in_block = ordinary;
+ scope = Object.create(scope);
+ spaces();
+ if (next_token.id === '{') {
+ advance('{');
+ step_in();
+ if (!ordinary && !use_strict() && !old_strict_mode &&
+ !option.sloppy && funct['(context)'] === global_funct) {
+ warn('missing_use_strict');
+ }
+ array = statements();
+ strict_mode = old_strict_mode;
+ step_out('}', curly);
+ } else if (!ordinary) {
+ stop('expected_a_b', next_token, '{', artifact());
+ } else {
+ warn('expected_a_b', next_token, '{', artifact());
+ array = [statement()];
+ array.disrupt = array[0].disrupt;
+ }
+ funct['(verb)'] = null;
+ scope = old_scope;
+ in_block = old_in_block;
+ if (ordinary && array.length === 0) {
+ warn('empty_block');
+ }
+ return array;
+ }
+
+
+ function tally_property(name) {
+ if (option.properties && typeof property_type[name] !== 'string') {
+ warn('unexpected_property_a', token, name);
+ }
+ if (typeof member[name] === 'number') {
+ member[name] += 1;
+ } else {
+ member[name] = 1;
+ }
+ }
+
+
+// ECMAScript parser
+
+ syntax['(identifier)'] = {
+ id: '(identifier)',
+ lbp: 0,
+ identifier: true,
+ nud: function () {
+ var name = this.string,
+ variable = scope[name],
+ site,
+ writeable;
+
+// If the variable is not in scope, then we may have an undeclared variable.
+// Check the predefined list. If it was predefined, create the global
+// variable.
+
+ if (typeof variable !== 'object') {
+ writeable = predefined[name];
+ if (typeof writeable === 'boolean') {
+ global_scope[name] = variable = {
+ string: name,
+ writeable: writeable,
+ funct: global_funct
+ };
+ global_funct[name] = 'var';
+
+// But if the variable is not in scope, and is not predefined, and if we are not
+// in the global scope, then we have an undefined variable error.
+
+ } else {
+ if (!option.undef) {
+ warn('used_before_a', token);
+ }
+ scope[name] = variable = {
+ string: name,
+ writeable: true,
+ funct: funct
+ };
+ funct[name] = 'undef';
+ }
+
+ }
+ site = variable.funct;
+
+// The name is in scope and defined in the current function.
+
+ if (funct === site) {
+
+// Change 'unused' to 'var', and reject labels.
+
+ switch (funct[name]) {
+ case 'becoming':
+ warn('unexpected_a', token);
+ funct[name] = 'var';
+ break;
+ case 'unused':
+ funct[name] = 'var';
+ break;
+ case 'unparam':
+ funct[name] = 'parameter';
+ break;
+ case 'unction':
+ funct[name] = 'function';
+ break;
+ case 'label':
+ warn('a_label', token, name);
+ break;
+ }
+
+// If the name is already defined in the current
+// function, but not as outer, then there is a scope error.
+
+ } else {
+ switch (funct[name]) {
+ case 'closure':
+ case 'function':
+ case 'var':
+ case 'unused':
+ warn('a_scope', token, name);
+ break;
+ case 'label':
+ warn('a_label', token, name);
+ break;
+ case 'outer':
+ case 'global':
+ break;
+ default:
+
+// If the name is defined in an outer function, make an outer entry, and if
+// it was unused, make it var.
+
+ switch (site[name]) {
+ case 'becoming':
+ case 'closure':
+ case 'function':
+ case 'parameter':
+ case 'unction':
+ case 'unused':
+ case 'var':
+ site[name] = 'closure';
+ funct[name] = site === global_funct
+ ? 'global'
+ : 'outer';
+ break;
+ case 'unparam':
+ site[name] = 'parameter';
+ funct[name] = 'outer';
+ break;
+ case 'undef':
+ funct[name] = 'undef';
+ break;
+ case 'label':
+ warn('a_label', token, name);
+ break;
+ }
+ }
+ }
+ return this;
+ },
+ led: function () {
+ stop('expected_operator_a');
+ }
+ };
+
+// Build the syntax table by declaring the syntactic elements.
+
+ type('(array)', 'array');
+ type('(color)', 'color');
+ type('(function)', 'function');
+ type('(number)', 'number', return_this);
+ type('(object)', 'object');
+ type('(string)', 'string', return_this);
+ type('(boolean)', 'boolean', return_this);
+ type('(range)', 'range');
+ type('(regexp)', 'regexp', return_this);
+
+ ultimate('(begin)');
+ ultimate('(end)');
+ ultimate('(error)');
+ postscript(symbol('');
+ postscript(symbol('}'));
+ symbol(')');
+ symbol(']');
+ postscript(symbol('"'));
+ postscript(symbol('\''));
+ symbol(';');
+ symbol(':');
+ symbol(',');
+ symbol('#');
+ symbol('@');
+ symbol('*/');
+ postscript(reserve('case'));
+ reserve('catch');
+ postscript(reserve('default'));
+ reserve('else');
+ reserve('finally');
+
+ reservevar('arguments', function (x) {
+ if (strict_mode && funct === global_funct) {
+ warn('strict', x);
+ } else if (option.safe) {
+ warn('adsafe_a', x);
+ }
+ });
+ reservevar('eval', function (x) {
+ if (option.safe) {
+ warn('adsafe_a', x);
+ }
+ });
+ constant('false', 'boolean');
+ constant('Infinity', 'number');
+ constant('NaN', 'number');
+ constant('null', '');
+ reservevar('this', function (x) {
+ if (option.safe) {
+ warn('adsafe_a', x);
+ } else if (strict_mode && funct['(token)'].arity === 'statement' &&
+ funct['(name)'].charAt(0) > 'Z') {
+ warn('strict', x);
+ }
+ });
+ constant('true', 'boolean');
+ constant('undefined', '');
+
+ infix('?', 30, function (left, that) {
+ step_in('?');
+ that.first = expected_condition(expected_relation(left));
+ that.second = expression(0);
+ spaces();
+ step_out();
+ var colon = next_token;
+ advance(':');
+ step_in(':');
+ spaces();
+ that.third = expression(10);
+ that.arity = 'ternary';
+ if (are_similar(that.second, that.third)) {
+ warn('weird_ternary', colon);
+ } else if (are_similar(that.first, that.second)) {
+ warn('use_or', that);
+ }
+ step_out();
+ return that;
+ });
+
+ infix('||', 40, function (left, that) {
+ function paren_check(that) {
+ if (that.id === '&&' && !that.paren) {
+ warn('and', that);
+ }
+ return that;
+ }
+
+ that.first = paren_check(expected_condition(expected_relation(left)));
+ that.second = paren_check(expected_relation(expression(40)));
+ if (are_similar(that.first, that.second)) {
+ warn('weird_condition', that);
+ }
+ return that;
+ });
+
+ infix('&&', 50, function (left, that) {
+ that.first = expected_condition(expected_relation(left));
+ that.second = expected_relation(expression(50));
+ if (are_similar(that.first, that.second)) {
+ warn('weird_condition', that);
+ }
+ return that;
+ });
+
+ prefix('void', function () {
+ this.first = expression(0);
+ this.arity = 'prefix';
+ if (option.es5) {
+ warn('expected_a_b', this, 'undefined', 'void');
+ } else if (this.first.number !== 0) {
+ warn('expected_a_b', this.first, '0', artifact(this.first));
+ }
+ this.type = 'undefined';
+ return this;
+ });
+
+ bitwise('|', 70);
+ bitwise('^', 80);
+ bitwise('&', 90);
+
+ relation('==', '===');
+ relation('===');
+ relation('!=', '!==');
+ relation('!==');
+ relation('<');
+ relation('>');
+ relation('<=');
+ relation('>=');
+
+ bitwise('<<', 120);
+ bitwise('>>', 120);
+ bitwise('>>>', 120);
+
+ infix('in', 120, function (left, that) {
+ warn('infix_in', that);
+ that.left = left;
+ that.right = expression(130);
+ return that;
+ }, 'boolean');
+ infix('instanceof', 120, null, 'boolean');
+ infix('+', 130, function (left, that) {
+ if (left.id === '(number)') {
+ if (left.number === 0) {
+ warn('unexpected_a', left, '0');
+ }
+ } else if (left.id === '(string)') {
+ if (left.string === '') {
+ warn('expected_a_b', left, 'String', '\'\'');
+ }
+ }
+ var right = expression(130);
+ if (right.id === '(number)') {
+ if (right.number === 0) {
+ warn('unexpected_a', right, '0');
+ }
+ } else if (right.id === '(string)') {
+ if (right.string === '') {
+ warn('expected_a_b', right, 'String', '\'\'');
+ }
+ }
+ if (left.id === right.id) {
+ if (left.id === '(string)' || left.id === '(number)') {
+ if (left.id === '(string)') {
+ left.string += right.string;
+ if (jx.test(left.string)) {
+ warn('url', left);
+ }
+ } else {
+ left.number += right.number;
+ }
+ left.thru = right.thru;
+ return left;
+ }
+ }
+ that.first = left;
+ that.second = right;
+ return that;
+ });
+ prefix('+', 'num');
+ prefix('+++', function () {
+ warn('confusing_a', token);
+ this.first = expression(150);
+ this.arity = 'prefix';
+ return this;
+ });
+ infix('+++', 130, function (left) {
+ warn('confusing_a', token);
+ this.first = left;
+ this.second = expression(130);
+ return this;
+ });
+ infix('-', 130, function (left, that) {
+ if ((left.id === '(number)' && left.number === 0) || left.id === '(string)') {
+ warn('unexpected_a', left);
+ }
+ var right = expression(130);
+ if ((right.id === '(number)' && right.number === 0) || right.id === '(string)') {
+ warn('unexpected_a', left);
+ }
+ if (left.id === right.id && left.id === '(number)') {
+ left.number -= right.number;
+ left.thru = right.thru;
+ return left;
+ }
+ that.first = left;
+ that.second = right;
+ return that;
+ }, 'number');
+ prefix('-');
+ prefix('---', function () {
+ warn('confusing_a', token);
+ this.first = expression(150);
+ this.arity = 'prefix';
+ return this;
+ });
+ infix('---', 130, function (left) {
+ warn('confusing_a', token);
+ this.first = left;
+ this.second = expression(130);
+ return this;
+ });
+ infix('*', 140, function (left, that) {
+ if ((left.id === '(number)' && (left.number === 0 || left.number === 1)) || left.id === '(string)') {
+ warn('unexpected_a', left);
+ }
+ var right = expression(140);
+ if ((right.id === '(number)' && (right.number === 0 || right.number === 1)) || right.id === '(string)') {
+ warn('unexpected_a', right);
+ }
+ if (left.id === right.id && left.id === '(number)') {
+ left.number *= right.number;
+ left.thru = right.thru;
+ return left;
+ }
+ that.first = left;
+ that.second = right;
+ return that;
+ }, 'number');
+ infix('/', 140, function (left, that) {
+ if ((left.id === '(number)' && left.number === 0) || left.id === '(string)') {
+ warn('unexpected_a', left);
+ }
+ var right = expression(140);
+ if ((right.id === '(number)' && (right.number === 0 || right.number === 1)) || right.id === '(string)') {
+ warn('unexpected_a', right);
+ }
+ if (left.id === right.id && left.id === '(number)') {
+ left.number /= right.number;
+ left.thru = right.thru;
+ return left;
+ }
+ that.first = left;
+ that.second = right;
+ return that;
+ }, 'number');
+ infix('%', 140, function (left, that) {
+ if ((left.id === '(number)' && (left.number === 0 || left.number === 1)) || left.id === '(string)') {
+ warn('unexpected_a', left);
+ }
+ var right = expression(140);
+ if ((right.id === '(number)' && right.number === 0) || right.id === '(string)') {
+ warn('unexpected_a', right);
+ }
+ if (left.id === right.id && left.id === '(number)') {
+ left.number %= right.number;
+ left.thru = right.thru;
+ return left;
+ }
+ that.first = left;
+ that.second = right;
+ return that;
+ }, 'number');
+
+ suffix('++');
+ prefix('++');
+
+ suffix('--');
+ prefix('--');
+ prefix('delete', function () {
+ one_space();
+ var p = expression(0);
+ if (!p || (p.id !== '.' && p.id !== '[')) {
+ warn('deleted');
+ }
+ this.first = p;
+ return this;
+ });
+
+
+ prefix('~', function () {
+ no_space_only();
+ if (!option.bitwise) {
+ warn('unexpected_a', this);
+ }
+ expression(150);
+ return this;
+ }, 'number');
+ prefix('!', function () {
+ no_space_only();
+ this.first = expected_condition(expression(150));
+ this.arity = 'prefix';
+ if (bang[this.first.id] === true || this.first.assign) {
+ warn('confusing_a', this);
+ }
+ return this;
+ }, 'boolean');
+ prefix('typeof', null, 'string');
+ prefix('new', function () {
+ one_space();
+ var c = expression(160), n, p, v;
+ this.first = c;
+ if (c.id !== 'function') {
+ if (c.identifier) {
+ switch (c.string) {
+ case 'Object':
+ warn('use_object', token);
+ break;
+ case 'Array':
+ if (next_token.id === '(') {
+ p = next_token;
+ p.first = this;
+ advance('(');
+ if (next_token.id !== ')') {
+ n = expression(0);
+ p.second = [n];
+ if (n.type !== 'number' || next_token.id === ',') {
+ warn('use_array', p);
+ }
+ while (next_token.id === ',') {
+ advance(',');
+ p.second.push(expression(0));
+ }
+ } else {
+ warn('use_array', token);
+ }
+ advance(')', p);
+ return p;
+ }
+ warn('use_array', token);
+ break;
+ case 'Number':
+ case 'String':
+ case 'Boolean':
+ case 'Math':
+ case 'JSON':
+ warn('not_a_constructor', c);
+ break;
+ case 'Function':
+ if (!option.evil) {
+ warn('function_eval');
+ }
+ break;
+ case 'Date':
+ case 'RegExp':
+ break;
+ default:
+ if (c.id !== 'function') {
+ v = c.string.charAt(0);
+ if (!option.newcap && (v < 'A' || v > 'Z')) {
+ warn('constructor_name_a', token);
+ }
+ }
+ }
+ } else {
+ if (c.id !== '.' && c.id !== '[' && c.id !== '(') {
+ warn('bad_constructor', token);
+ }
+ }
+ } else {
+ warn('weird_new', this);
+ }
+ if (next_token.id !== '(') {
+ warn('missing_a', next_token, '()');
+ }
+ return this;
+ });
+
+ infix('(', 160, function (left, that) {
+ var p;
+ if (indent && indent.mode === 'expression') {
+ no_space(prev_token, token);
+ } else {
+ no_space_only(prev_token, token);
+ }
+ if (!left.immed && left.id === 'function') {
+ warn('wrap_immediate');
+ }
+ p = [];
+ if (left.identifier) {
+ if (left.string.match(/^[A-Z]([A-Z0-9_$]*[a-z][A-Za-z0-9_$]*)?$/)) {
+ if (left.string !== 'Number' && left.string !== 'String' &&
+ left.string !== 'Boolean' && left.string !== 'Date') {
+ if (left.string === 'Math' || left.string === 'JSON') {
+ warn('not_a_function', left);
+ } else if (left.string === 'Object') {
+ warn('use_object', token);
+ } else if (left.string === 'Array' || !option.newcap) {
+ warn('missing_a', left, 'new');
+ }
+ }
+ }
+ } else if (left.id === '.') {
+ if (option.safe && left.first.string === 'Math' &&
+ left.second === 'random') {
+ warn('adsafe_a', left);
+ } else if (left.second.string === 'split' &&
+ left.first.id === '(string)') {
+ warn('use_array', left.second);
+ }
+ }
+ step_in();
+ if (next_token.id !== ')') {
+ no_space();
+ for (;;) {
+ edge();
+ p.push(expression(10));
+ if (next_token.id !== ',') {
+ break;
+ }
+ comma();
+ }
+ }
+ no_space();
+ step_out(')', that);
+ if (typeof left === 'object') {
+ if (left.string === 'parseInt' && p.length === 1) {
+ warn('radix', left);
+ }
+ if (!option.evil) {
+ if (left.string === 'eval' || left.string === 'Function' ||
+ left.string === 'execScript') {
+ warn('evil', left);
+ } else if (p[0] && p[0].id === '(string)' &&
+ (left.string === 'setTimeout' ||
+ left.string === 'setInterval')) {
+ warn('implied_evil', left);
+ }
+ }
+ if (!left.identifier && left.id !== '.' && left.id !== '[' &&
+ left.id !== '(' && left.id !== '&&' && left.id !== '||' &&
+ left.id !== '?') {
+ warn('bad_invocation', left);
+ }
+ }
+ that.first = left;
+ that.second = p;
+ return that;
+ }, '', true);
+
+ prefix('(', function () {
+ step_in('expression');
+ no_space();
+ edge();
+ if (next_token.id === 'function') {
+ next_token.immed = true;
+ }
+ var value = expression(0);
+ value.paren = true;
+ no_space();
+ step_out(')', this);
+ if (value.id === 'function') {
+ if (next_token.id === '(') {
+ warn('move_invocation');
+ } else {
+ warn('bad_wrap', this);
+ }
+ }
+ return value;
+ });
+
+ infix('.', 170, function (left, that) {
+ no_space(prev_token, token);
+ no_space();
+ var name = identifier(), type;
+ if (typeof name === 'string') {
+ tally_property(name);
+ }
+ that.first = left;
+ that.second = token;
+ if (left && left.string === 'arguments' &&
+ (name === 'callee' || name === 'caller')) {
+ warn('avoid_a', left, 'arguments.' + name);
+ } else if (!option.evil && left && left.string === 'document' &&
+ (name === 'write' || name === 'writeln')) {
+ warn('write_is_wrong', left);
+ } else if (option.adsafe) {
+ if (!adsafe_top && left.string === 'ADSAFE') {
+ if (name === 'id' || name === 'lib') {
+ warn('adsafe_a', that);
+ } else if (name === 'go') {
+ if (xmode !== 'script') {
+ warn('adsafe_a', that);
+ } else if (adsafe_went || next_token.id !== '(' ||
+ peek(0).id !== '(string)' ||
+ peek(0).string !== adsafe_id ||
+ peek(1).id !== ',') {
+ stop('adsafe_a', that, 'go');
+ }
+ adsafe_went = true;
+ adsafe_may = false;
+ }
+ }
+ adsafe_top = false;
+ }
+ if (!option.evil && (name === 'eval' || name === 'execScript')) {
+ warn('evil');
+ } else if (option.safe) {
+ for (;;) {
+ if (banned[name] === true) {
+ warn('adsafe_a', token, name);
+ }
+ if (typeof predefined[left.string] !== 'boolean' || //// check for writeable
+ next_token.id === '(') {
+ break;
+ }
+ if (next_token.id !== '.') {
+ warn('adsafe_a', that);
+ break;
+ }
+ advance('.');
+ token.first = that;
+ token.second = name;
+ that = token;
+ name = identifier();
+ if (typeof name === 'string') {
+ tally_property(name);
+ }
+ }
+ }
+ type = property_type[name];
+ if (type && typeof type === 'string' && type !== '*') {
+ that.type = type;
+ }
+ return that;
+ }, '', true);
+
+ infix('[', 170, function (left, that) {
+ var e, s;
+ no_space_only(prev_token, token);
+ no_space();
+ step_in();
+ edge();
+ e = expression(0);
+ switch (e.type) {
+ case 'number':
+ if (e.id === '(number)' && left.id === 'arguments') {
+ warn('use_param', left);
+ }
+ break;
+ case 'string':
+ if (e.id === '(string)') {
+ if (option.safe && (banned[e.string] ||
+ e.string.charAt(0) === '_' || e.string.slice(-1) === '_')) {
+ warn('adsafe_subscript_a', e);
+ } else if (!option.evil &&
+ (e.string === 'eval' || e.string === 'execScript')) {
+ warn('evil', e);
+ } else if (!option.sub && ix.test(e.string)) {
+ s = syntax[e.string];
+ if (!s || !s.reserved) {
+ warn('subscript', e);
+ }
+ }
+ tally_property(e.string);
+ } else if (option.safe && e.id !== 'typeof') {
+ warn('adsafe_subscript_a', e);
+ }
+ break;
+ case undefined:
+ if (option.safe) {
+ warn('adsafe_subscript_a', e);
+ }
+ break;
+ default:
+ if (option.safe) {
+ warn('adsafe_subscript_a', e);
+ }
+ }
+ step_out(']', that);
+ no_space(prev_token, token);
+ that.first = left;
+ that.second = e;
+ return that;
+ }, '', true);
+
+ prefix('[', function () {
+ this.arity = 'prefix';
+ this.first = [];
+ step_in('array');
+ while (next_token.id !== '(end)') {
+ while (next_token.id === ',') {
+ warn('unexpected_a', next_token);
+ advance(',');
+ }
+ if (next_token.id === ']') {
+ break;
+ }
+ indent.wrap = false;
+ edge();
+ this.first.push(expression(10));
+ if (next_token.id === ',') {
+ comma();
+ if (next_token.id === ']' && !option.es5) {
+ warn('unexpected_a', token);
+ break;
+ }
+ } else {
+ break;
+ }
+ }
+ step_out(']', this);
+ return this;
+ }, 170);
+
+
+ function property_name() {
+ var id = optional_identifier(true);
+ if (!id) {
+ if (next_token.id === '(string)') {
+ id = next_token.string;
+ if (option.safe) {
+ if (banned[id]) {
+ warn('adsafe_a');
+ } else if (id.charAt(0) === '_' ||
+ id.charAt(id.length - 1) === '_') {
+ warn('dangling_a');
+ }
+ }
+ advance();
+ } else if (next_token.id === '(number)') {
+ id = next_token.number.toString();
+ advance();
+ }
+ }
+ return id;
+ }
+
+
+ function function_params() {
+ var id, paren = next_token, params = [];
+ advance('(');
+ step_in();
+ no_space();
+ if (next_token.id === ')') {
+ no_space();
+ step_out(')', paren);
+ return;
+ }
+ for (;;) {
+ edge();
+ id = identifier();
+ params.push(token);
+ add_label(token, option.unparam ? 'parameter' : 'unparam');
+ if (next_token.id === ',') {
+ comma();
+ } else {
+ no_space();
+ step_out(')', paren);
+ return params;
+ }
+ }
+ }
+
+
+ function complexity(exp) {
+ var score = 0;
+ if (exp) {
+ if (Array.isArray(exp)) {
+ exp.forEach(function (tok) {
+ score += complexity(tok);
+ });
+ } else {
+ switch (exp.arity) {
+ case 'statement':
+ switch (exp.id) {
+ case 'if':
+ score += complexity(exp.first) + complexity(exp.block) +
+ complexity(exp['else']) + 1;
+ break;
+ case 'while':
+ case 'do':
+ if (exp.first.id !== 'true' && exp.first.number !== 1) {
+ score += 1;
+ }
+ score += complexity(exp.first) + complexity(exp.block);
+ break;
+ case 'for':
+ if (exp.second !== undefined &&
+ exp.second.id !== 'true' &&
+ exp.second.number !== 1) {
+ score += 1;
+ }
+ score += complexity(exp.first) + complexity(exp.second) +
+ complexity(exp.third) + complexity(exp.block);
+ break;
+ case 'switch':
+ score += complexity(exp.first) +
+ complexity(exp.second) + exp.second.length;
+ if (exp.second[exp.second.length - 1].id === 'default') {
+ score -= 1;
+ }
+ break;
+ case 'try':
+ if (exp.second) {
+ score += 1;
+ }
+ if (exp.third) {
+ score += 1;
+ }
+ score += complexity(exp.first) + complexity(exp.second) +
+ complexity(exp.third) + complexity(exp.block);
+ break;
+ }
+ break;
+ case 'prefix':
+ score += complexity(exp.first);
+ break;
+ case 'case':
+ case 'infix':
+ score += complexity(exp.first) + complexity(exp.second);
+ if (exp.id === '&&' || exp.id === '||') {
+ score += 1;
+ }
+ break;
+ case 'ternary':
+ score += complexity(exp.first) + complexity(exp.second) + complexity(exp.third);
+ break;
+ }
+ }
+ }
+ return score;
+ }
+
+
+ function do_function(func, name) {
+ var old_funct = funct,
+ old_option = option,
+ old_scope = scope;
+ funct = {
+ '(name)' : name || '\'' + (anonname || '').replace(nx, sanitize) + '\'',
+ '(line)' : next_token.line,
+ '(context)' : old_funct,
+ '(breakage)' : 0,
+ '(loopage)' : 0,
+ '(scope)' : scope,
+ '(token)' : func
+ };
+ option = Object.create(old_option);
+ scope = Object.create(old_scope);
+ functions.push(funct);
+ func.name = name;
+ if (name) {
+ add_label(func, 'function', name);
+ }
+ func.writeable = false;
+ func.first = funct['(params)'] = function_params();
+ one_space();
+ func.block = block(false);
+ if (funct['(old_property_type)']) {
+ property_type = funct['(old_property_type)'];
+ delete funct['(old_property_type)'];
+ }
+ funct['(complexity)'] = complexity(func.block) + 1;
+ if (option.confusion) {
+ funct['(confusion)'] = true;
+ }
+ funct = old_funct;
+ option = old_option;
+ scope = old_scope;
+ }
+
+
+ assignop('=');
+ assignop('+=', '+');
+ assignop('-=', '-');
+ assignop('*=', '*');
+ assignop('/=', '/').nud = function () {
+ stop('slash_equal');
+ };
+ assignop('%=', '%');
+ assignop('&=', '&');
+ assignop('|=', '|');
+ assignop('^=', '^');
+ assignop('<<=', '<<');
+ assignop('>>=', '>>');
+ assignop('>>>=', '>>>');
+
+
+ prefix('{', function () {
+ var get, i, j, name, p, set, seen = {};
+ this.arity = 'prefix';
+ this.first = [];
+ step_in();
+ while (next_token.id !== '}') {
+ indent.wrap = false;
+
+// JSLint recognizes the ES5 extension for get/set in object literals,
+// but requires that they be used in pairs.
+
+ edge();
+ if (next_token.string === 'get' && peek().id !== ':') {
+ if (!option.es5) {
+ warn('es5');
+ }
+ get = next_token;
+ advance('get');
+ one_space_only();
+ name = next_token;
+ i = property_name();
+ if (!i) {
+ stop('missing_property');
+ }
+ get.string = '';
+ do_function(get);
+ if (funct['(loopage)']) {
+ warn('function_loop', get);
+ }
+ p = get.first;
+ if (p) {
+ warn('parameter_a_get_b', p[0], p[0].string, i);
+ }
+ comma();
+ set = next_token;
+ spaces();
+ edge();
+ advance('set');
+ set.string = '';
+ one_space_only();
+ j = property_name();
+ if (i !== j) {
+ stop('expected_a_b', token, i, j || next_token.string);
+ }
+ do_function(set);
+ p = set.first;
+ if (!p || p.length !== 1) {
+ stop('parameter_set_a', set, 'value');
+ } else if (p[0].string !== 'value') {
+ stop('expected_a_b', p[0], 'value', p[0].string);
+ }
+ name.first = [get, set];
+ } else {
+ name = next_token;
+ i = property_name();
+ if (typeof i !== 'string') {
+ stop('missing_property');
+ }
+ advance(':');
+ spaces();
+ name.first = expression(10);
+ }
+ this.first.push(name);
+ if (seen[i] === true) {
+ warn('duplicate_a', next_token, i);
+ }
+ seen[i] = true;
+ tally_property(i);
+ if (next_token.id !== ',') {
+ break;
+ }
+ for (;;) {
+ comma();
+ if (next_token.id !== ',') {
+ break;
+ }
+ warn('unexpected_a', next_token);
+ }
+ if (next_token.id === '}' && !option.es5) {
+ warn('unexpected_a', token);
+ }
+ }
+ step_out('}', this);
+ return this;
+ });
+
+ stmt('{', function () {
+ warn('statement_block');
+ this.arity = 'statement';
+ this.block = statements();
+ this.disrupt = this.block.disrupt;
+ advance('}', this);
+ return this;
+ });
+
+ stmt('/*global', directive);
+ stmt('/*globals', directive);
+ stmt('/*jslint', directive);
+ stmt('/*member', directive);
+ stmt('/*members', directive);
+ stmt('/*property', directive);
+ stmt('/*properties', directive);
+
+ stmt('var', function () {
+
+// JavaScript does not have block scope. It only has function scope. So,
+// declaring a variable in a block can have unexpected consequences.
+
+// var.first will contain an array, the array containing name tokens
+// and assignment tokens.
+
+ var assign, id, name;
+
+ if (funct['(vars)'] && !option.vars) {
+ warn('combine_var');
+ } else if (funct !== global_funct) {
+ funct['(vars)'] = true;
+ }
+ this.arity = 'statement';
+ this.first = [];
+ step_in('var');
+ for (;;) {
+ name = next_token;
+ id = identifier();
+ add_label(name, 'becoming');
+
+ if (next_token.id === '=') {
+ assign = next_token;
+ assign.first = name;
+ spaces();
+ advance('=');
+ spaces();
+ if (next_token.id === 'undefined') {
+ warn('unnecessary_initialize', token, id);
+ }
+ if (peek(0).id === '=' && next_token.identifier) {
+ stop('var_a_not');
+ }
+ assign.second = expression(0);
+ assign.arity = 'infix';
+ this.first.push(assign);
+ } else {
+ this.first.push(name);
+ }
+ if (funct[id] === 'becoming') {
+ funct[id] = 'unused';
+ }
+ if (next_token.id !== ',') {
+ break;
+ }
+ comma();
+ indent.wrap = false;
+ if (var_mode && next_token.line === token.line &&
+ this.first.length === 1) {
+ var_mode = null;
+ indent.open = false;
+ indent.at -= option.indent;
+ }
+ spaces();
+ edge();
+ }
+ var_mode = null;
+ step_out();
+ return this;
+ });
+
+ stmt('function', function () {
+ one_space();
+ if (in_block) {
+ warn('function_block', token);
+ }
+ var name = next_token, id = identifier();
+ add_label(name, 'unction');
+ no_space();
+ this.arity = 'statement';
+ do_function(this, id);
+ if (next_token.id === '(' && next_token.line === token.line) {
+ stop('function_statement');
+ }
+ return this;
+ });
+
+ prefix('function', function () {
+ one_space();
+ var id = optional_identifier();
+ if (id) {
+ no_space();
+ } else {
+ id = '';
+ }
+ do_function(this, id);
+ if (funct['(loopage)']) {
+ warn('function_loop');
+ }
+ this.arity = 'function';
+ return this;
+ });
+
+ stmt('if', function () {
+ var paren = next_token;
+ one_space();
+ advance('(');
+ step_in('control');
+ no_space();
+ edge();
+ this.arity = 'statement';
+ this.first = expected_condition(expected_relation(expression(0)));
+ no_space();
+ step_out(')', paren);
+ one_space();
+ this.block = block(true);
+ if (next_token.id === 'else') {
+ one_space();
+ advance('else');
+ one_space();
+ this['else'] = next_token.id === 'if' || next_token.id === 'switch'
+ ? statement(true)
+ : block(true);
+ if (this['else'].disrupt && this.block.disrupt) {
+ this.disrupt = true;
+ }
+ }
+ return this;
+ });
+
+ stmt('try', function () {
+
+// try.first The catch variable
+// try.second The catch clause
+// try.third The finally clause
+// try.block The try block
+
+ var exception_variable, old_scope, paren;
+ if (option.adsafe) {
+ warn('adsafe_a', this);
+ }
+ one_space();
+ this.arity = 'statement';
+ this.block = block(false);
+ if (next_token.id === 'catch') {
+ one_space();
+ advance('catch');
+ one_space();
+ paren = next_token;
+ advance('(');
+ step_in('control');
+ no_space();
+ edge();
+ old_scope = scope;
+ scope = Object.create(old_scope);
+ exception_variable = next_token.string;
+ this.first = exception_variable;
+ if (!next_token.identifier) {
+ warn('expected_identifier_a', next_token);
+ } else {
+ add_label(next_token, 'exception');
+ }
+ advance();
+ no_space();
+ step_out(')', paren);
+ one_space();
+ this.second = block(false);
+ scope = old_scope;
+ }
+ if (next_token.id === 'finally') {
+ one_space();
+ advance('finally');
+ one_space();
+ this.third = block(false);
+ } else if (!this.second) {
+ stop('expected_a_b', next_token, 'catch', artifact());
+ }
+ return this;
+ });
+
+ labeled_stmt('while', function () {
+ one_space();
+ var paren = next_token;
+ funct['(breakage)'] += 1;
+ funct['(loopage)'] += 1;
+ advance('(');
+ step_in('control');
+ no_space();
+ edge();
+ this.arity = 'statement';
+ this.first = expected_relation(expression(0));
+ if (this.first.id !== 'true') {
+ expected_condition(this.first, bundle.unexpected_a);
+ }
+ no_space();
+ step_out(')', paren);
+ one_space();
+ this.block = block(true);
+ if (this.block.disrupt) {
+ warn('strange_loop', prev_token);
+ }
+ funct['(breakage)'] -= 1;
+ funct['(loopage)'] -= 1;
+ return this;
+ });
+
+ reserve('with');
+
+ labeled_stmt('switch', function () {
+
+// switch.first the switch expression
+// switch.second the array of cases. A case is 'case' or 'default' token:
+// case.first the array of case expressions
+// case.second the array of statements
+// If all of the arrays of statements are disrupt, then the switch is disrupt.
+
+ var cases = [],
+ old_in_block = in_block,
+ particular,
+ the_case = next_token,
+ unbroken = true;
+
+ function find_duplicate_case(value) {
+ if (are_similar(particular, value)) {
+ warn('duplicate_a', value);
+ }
+ }
+
+ funct['(breakage)'] += 1;
+ one_space();
+ advance('(');
+ no_space();
+ step_in();
+ this.arity = 'statement';
+ this.first = expected_condition(expected_relation(expression(0)));
+ no_space();
+ step_out(')', the_case);
+ one_space();
+ advance('{');
+ step_in();
+ in_block = true;
+ this.second = [];
+ while (next_token.id === 'case') {
+ the_case = next_token;
+ cases.forEach(find_duplicate_case);
+ the_case.first = [];
+ the_case.arity = 'case';
+ spaces();
+ edge('case');
+ advance('case');
+ for (;;) {
+ one_space();
+ particular = expression(0);
+ cases.forEach(find_duplicate_case);
+ cases.push(particular);
+ the_case.first.push(particular);
+ if (particular.id === 'NaN') {
+ warn('unexpected_a', particular);
+ }
+ no_space_only();
+ advance(':');
+ if (next_token.id !== 'case') {
+ break;
+ }
+ spaces();
+ edge('case');
+ advance('case');
+ }
+ spaces();
+ the_case.second = statements();
+ if (the_case.second && the_case.second.length > 0) {
+ particular = the_case.second[the_case.second.length - 1];
+ if (particular.disrupt) {
+ if (particular.id === 'break') {
+ unbroken = false;
+ }
+ } else {
+ warn('missing_a_after_b', next_token, 'break', 'case');
+ }
+ } else {
+ warn('empty_case');
+ }
+ this.second.push(the_case);
+ }
+ if (this.second.length === 0) {
+ warn('missing_a', next_token, 'case');
+ }
+ if (next_token.id === 'default') {
+ spaces();
+ the_case = next_token;
+ the_case.arity = 'case';
+ edge('case');
+ advance('default');
+ no_space_only();
+ advance(':');
+ spaces();
+ the_case.second = statements();
+ if (the_case.second && the_case.second.length > 0) {
+ particular = the_case.second[the_case.second.length - 1];
+ if (unbroken && particular.disrupt && particular.id !== 'break') {
+ this.disrupt = true;
+ }
+ }
+ this.second.push(the_case);
+ }
+ funct['(breakage)'] -= 1;
+ spaces();
+ step_out('}', this);
+ in_block = old_in_block;
+ return this;
+ });
+
+ stmt('debugger', function () {
+ if (!option.debug) {
+ warn('unexpected_a', this);
+ }
+ this.arity = 'statement';
+ return this;
+ });
+
+ labeled_stmt('do', function () {
+ funct['(breakage)'] += 1;
+ funct['(loopage)'] += 1;
+ one_space();
+ this.arity = 'statement';
+ this.block = block(true);
+ if (this.block.disrupt) {
+ warn('strange_loop', prev_token);
+ }
+ one_space();
+ advance('while');
+ var paren = next_token;
+ one_space();
+ advance('(');
+ step_in();
+ no_space();
+ edge();
+ this.first = expected_condition(expected_relation(expression(0)), bundle.unexpected_a);
+ no_space();
+ step_out(')', paren);
+ funct['(breakage)'] -= 1;
+ funct['(loopage)'] -= 1;
+ return this;
+ });
+
+ labeled_stmt('for', function () {
+
+ var blok, filter, ok = false, paren = next_token, value;
+ this.arity = 'statement';
+ funct['(breakage)'] += 1;
+ funct['(loopage)'] += 1;
+ advance('(');
+ if (next_token.id === ';') {
+ no_space();
+ advance(';');
+ no_space();
+ advance(';');
+ no_space();
+ advance(')');
+ blok = block(true);
+ } else {
+ step_in('control');
+ spaces(this, paren);
+ no_space();
+ if (next_token.id === 'var') {
+ stop('move_var');
+ }
+ edge();
+ if (peek(0).id === 'in') {
+ this.forin = true;
+ value = next_token;
+ switch (funct[value.string]) {
+ case 'unused':
+ funct[value.string] = 'var';
+ break;
+ case 'closure':
+ case 'var':
+ break;
+ default:
+ warn('bad_in_a', value);
+ }
+ advance();
+ advance('in');
+ this.first = value;
+ this.second = expression(20);
+ step_out(')', paren);
+ blok = block(true);
+ if (!option.forin) {
+ if (blok.length === 1 && typeof blok[0] === 'object' &&
+ blok[0].string === 'if' && !blok[0]['else']) {
+ filter = blok[0].first;
+ while (filter.id === '&&') {
+ filter = filter.first;
+ }
+ switch (filter.id) {
+ case '===':
+ case '!==':
+ ok = filter.first.id === '['
+ ? filter.first.first.string === this.second.string &&
+ filter.first.second.string === this.first.string
+ : filter.first.id === 'typeof' &&
+ filter.first.first.id === '[' &&
+ filter.first.first.first.string === this.second.string &&
+ filter.first.first.second.string === this.first.string;
+ break;
+ case '(':
+ ok = filter.first.id === '.' && ((
+ filter.first.first.string === this.second.string &&
+ filter.first.second.string === 'hasOwnProperty' &&
+ filter.second[0].string === this.first.string
+ ) || (
+ filter.first.first.string === 'ADSAFE' &&
+ filter.first.second.string === 'has' &&
+ filter.second[0].string === this.second.string &&
+ filter.second[1].string === this.first.string
+ ) || (
+ filter.first.first.id === '.' &&
+ filter.first.first.first.id === '.' &&
+ filter.first.first.first.first.string === 'Object' &&
+ filter.first.first.first.second.string === 'prototype' &&
+ filter.first.first.second.string === 'hasOwnProperty' &&
+ filter.first.second.string === 'call' &&
+ filter.second[0].string === this.second.string &&
+ filter.second[1].string === this.first.string
+ ));
+ break;
+ }
+ }
+ if (!ok) {
+ warn('for_if', this);
+ }
+ }
+ } else {
+ edge();
+ this.first = [];
+ for (;;) {
+ this.first.push(expression(0, 'for'));
+ if (next_token.id !== ',') {
+ break;
+ }
+ comma();
+ }
+ semicolon();
+ edge();
+ this.second = expected_relation(expression(0));
+ if (this.second.id !== 'true') {
+ expected_condition(this.second, bundle.unexpected_a);
+ }
+ semicolon(token);
+ if (next_token.id === ';') {
+ stop('expected_a_b', next_token, ')', ';');
+ }
+ this.third = [];
+ edge();
+ for (;;) {
+ this.third.push(expression(0, 'for'));
+ if (next_token.id !== ',') {
+ break;
+ }
+ comma();
+ }
+ no_space();
+ step_out(')', paren);
+ one_space();
+ blok = block(true);
+ }
+ }
+ if (blok.disrupt) {
+ warn('strange_loop', prev_token);
+ }
+ this.block = blok;
+ funct['(breakage)'] -= 1;
+ funct['(loopage)'] -= 1;
+ return this;
+ });
+
+ disrupt_stmt('break', function () {
+ var label = next_token.string;
+ this.arity = 'statement';
+ if (funct['(breakage)'] === 0) {
+ warn('unexpected_a', this);
+ }
+ if (next_token.identifier && token.line === next_token.line) {
+ one_space_only();
+ if (funct[label] !== 'label') {
+ warn('not_a_label', next_token);
+ } else if (scope[label].funct !== funct) {
+ warn('not_a_scope', next_token);
+ }
+ this.first = next_token;
+ advance();
+ }
+ return this;
+ });
+
+ disrupt_stmt('continue', function () {
+ if (!option['continue']) {
+ warn('unexpected_a', this);
+ }
+ var label = next_token.string;
+ this.arity = 'statement';
+ if (funct['(breakage)'] === 0) {
+ warn('unexpected_a', this);
+ }
+ if (next_token.identifier && token.line === next_token.line) {
+ one_space_only();
+ if (funct[label] !== 'label') {
+ warn('not_a_label', next_token);
+ } else if (scope[label].funct !== funct) {
+ warn('not_a_scope', next_token);
+ }
+ this.first = next_token;
+ advance();
+ }
+ return this;
+ });
+
+ disrupt_stmt('return', function () {
+ if (funct === global_funct) {
+ warn('unexpected_a', this);
+ }
+ this.arity = 'statement';
+ if (next_token.id !== ';' && next_token.line === token.line) {
+ one_space_only();
+ if (next_token.id === '/' || next_token.id === '(regexp)') {
+ warn('wrap_regexp');
+ }
+ this.first = expression(20);
+ }
+ return this;
+ });
+
+ disrupt_stmt('throw', function () {
+ this.arity = 'statement';
+ one_space_only();
+ this.first = expression(20);
+ return this;
+ });
+
+
+// Superfluous reserved words
+
+ reserve('class');
+ reserve('const');
+ reserve('enum');
+ reserve('export');
+ reserve('extends');
+ reserve('import');
+ reserve('super');
+
+// Harmony reserved words
+
+ reserve('implements');
+ reserve('interface');
+ reserve('let');
+ reserve('package');
+ reserve('private');
+ reserve('protected');
+ reserve('public');
+ reserve('static');
+ reserve('yield');
+
+
+// Type inference
+
+// function get_type(one) {
+// var type;
+// if (typeof one === 'string') {
+// return one;
+// } else if (one.type) {
+// return one.type;
+// } else if (one.id === '.') {
+// type = property_type[one.second.string];
+// return typeof type === 'string' ? type : '';
+// } else {
+// return ((one.identifier && scope[one.string]) || one).type;
+// }
+// }
+
+
+// function match_type(one_type, two_type, one, two) {
+// if (one_type === two_type) {
+// return true;
+// } else {
+// if (!funct.confusion && !two.warn) {
+// if (typeof one !== 'string') {
+// if (one.id === '.') {
+// one_type = '.' + one.second.string + ': ' + one_type;
+// } else {
+// one_type = one.string + ': ' + one_type;
+// }
+// }
+// if (two.id === '.') {
+// two_type = '.' + two.second.string + ': ' + one_type;
+// } else {
+// two_type = two.string + ': ' + one_type;
+// }
+// warn('type_confusion_a_b', two, one_type, two_type);
+// two.warn = true;
+// }
+// return false;
+// }
+// }
+
+
+// function conform(one, two) {
+//
+// // The conform function takes a type string and a token, or two tokens.
+//
+// var one_type = typeof one === 'string' ? one : one.type,
+// two_type = two.type,
+// two_thing;
+//
+// // If both tokens already have a type, and if they match, then we are done.
+// // Once a token has a type, it is locked. Neither token will change, but if
+// // they do not match, there will be a warning.
+//
+// if (one_type) {
+// if (two_type) {
+// match_type(one_type, two_type, one, two);
+// } else {
+//
+// // two does not have a type, so look deeper. If two is a variable or property,
+// // then use its type if it has one, and make the deep type one's type if it
+// // doesn't. If the type was *, or if there was a mismatch, don't change the
+// // deep type.
+//
+// two_thing = two.id === '(identifier)'
+// ? scope[two.string]
+// : two.id === '.'
+// ? property_type[two.second.string]
+// : null;
+// if (two_thing) {
+// two_type = two_thing.type;
+// if (two_type) {
+// if (two_type !== '*') {
+// if (!match_type(one_type, two_type, one, two)) {
+// return '';
+// }
+// }
+// } else {
+// two_thing.type = one_type;
+// }
+// }
+//
+// // In any case, we give two a type.
+//
+// two.type = one_type;
+// type_state_change = true;
+// return one_type;
+// }
+//
+// // one does not have a type, but two does, so do the old switcheroo.
+//
+// } else {
+// if (two_type) {
+// return conform(two, one);
+//
+// // Neither token has a type yet. So we have to look deeper to see if either
+// // is a variable or property.
+//
+// } else {
+// if (one.id === '(identifier)') {
+// one_type = scope[one.string].type;
+// if (one_type && one_type !== '*') {
+// one.type = one_type;
+// return conform(one, two);
+// }
+// } else if (one.id === '.') {
+// one_type = property_type[one.second.string];
+// if (one_type && one_type !== '*') {
+// one.type = scope[one.string].type;
+// return conform(one, two);
+// }
+// }
+// if (two.id === '(identifier)') {
+// two_type = scope[two.string].type;
+// if (two_type && two_type !== '*') {
+// two.type = two_type;
+// return conform(two, one);
+// }
+// } else if (two.id === '.') {
+// two_type = property_type[two.second.string];
+// if (two_type && two_type !== '*') {
+// two.type = scope[two.string].type;
+// return conform(two, one);
+// }
+// }
+// }
+// }
+//
+// // Return a falsy string if we were unable to determine the type of either token.
+//
+// return '';
+// }
+
+// function conform_array(type, array) {
+// array.forEach(function (item) {
+// return conform(type, item);
+// }, type);
+// }
+
+
+// function infer(node) {
+// if (Array.isArray(node)) {
+// node.forEach(infer);
+// } else {
+// switch (node.arity) {
+// case 'statement':
+// infer_statement[node.id](node);
+// break;
+// case 'infix':
+// infer(node.first);
+// infer(node.second);
+// switch (node.id) {
+// case '(':
+// conform('function', node.first);
+// break;
+// default:
+// stop('unfinished');
+// }
+// break;
+// case 'number':
+// case 'string':
+// case 'boolean':
+// break;
+// default:
+// stop('unfinished');
+// }
+// }
+// }
+
+
+// infer_statement = {
+// 'var': function (node) {
+// var i, item, list = node.first;
+// for (i = 0; i < list.length; i += 1) {
+// item = list[i];
+// if (item.id === '=') {
+// infer(item.second);
+// conform(item.first, item.second);
+// conform(item.first, item);
+// }
+// }
+// },
+// 'for': function (node) {
+// infer(node.first);
+// infer(node.second);
+// if (node.forin) {
+// conform('string', node.first);
+// conform('object', node.second);
+// } else {
+// infer(node.third);
+// conform_array('number', node.first);
+// conform('boolean', node.second);
+// conform_array('number', node.third);
+// }
+// infer(node.block);
+// }
+// };
+
+
+// function infer_types(node) {
+// do {
+// funct = global_funct;
+// scope = global_scope;
+// type_state_change = false;
+// infer(node);
+// } while (type_state_change);
+// }
+
+
+// Parse JSON
+
+ function json_value() {
+
+ function json_object() {
+ var brace = next_token, object = {};
+ advance('{');
+ if (next_token.id !== '}') {
+ while (next_token.id !== '(end)') {
+ while (next_token.id === ',') {
+ warn('unexpected_a', next_token);
+ advance(',');
+ }
+ if (next_token.id !== '(string)') {
+ warn('expected_string_a');
+ }
+ if (object[next_token.string] === true) {
+ warn('duplicate_a');
+ } else if (next_token.string === '__proto__') {
+ warn('dangling_a');
+ } else {
+ object[next_token.string] = true;
+ }
+ advance();
+ advance(':');
+ json_value();
+ if (next_token.id !== ',') {
+ break;
+ }
+ advance(',');
+ if (next_token.id === '}') {
+ warn('unexpected_a', token);
+ break;
+ }
+ }
+ }
+ advance('}', brace);
+ }
+
+ function json_array() {
+ var bracket = next_token;
+ advance('[');
+ if (next_token.id !== ']') {
+ while (next_token.id !== '(end)') {
+ while (next_token.id === ',') {
+ warn('unexpected_a', next_token);
+ advance(',');
+ }
+ json_value();
+ if (next_token.id !== ',') {
+ break;
+ }
+ advance(',');
+ if (next_token.id === ']') {
+ warn('unexpected_a', token);
+ break;
+ }
+ }
+ }
+ advance(']', bracket);
+ }
+
+ switch (next_token.id) {
+ case '{':
+ json_object();
+ break;
+ case '[':
+ json_array();
+ break;
+ case 'true':
+ case 'false':
+ case 'null':
+ case '(number)':
+ case '(string)':
+ advance();
+ break;
+ case '-':
+ advance('-');
+ no_space_only();
+ advance('(number)');
+ break;
+ default:
+ stop('unexpected_a');
+ }
+ }
+
+
+// CSS parsing.
+
+ function css_name() {
+ if (next_token.identifier) {
+ advance();
+ return true;
+ }
+ }
+
+
+ function css_number() {
+ if (next_token.id === '-') {
+ advance('-');
+ no_space_only();
+ }
+ if (next_token.id === '(number)') {
+ advance('(number)');
+ return true;
+ }
+ }
+
+
+ function css_string() {
+ if (next_token.id === '(string)') {
+ advance();
+ return true;
+ }
+ }
+
+ function css_color() {
+ var i, number, paren, value;
+ if (next_token.identifier) {
+ value = next_token.string;
+ if (value === 'rgb' || value === 'rgba') {
+ advance();
+ paren = next_token;
+ advance('(');
+ for (i = 0; i < 3; i += 1) {
+ if (i) {
+ comma();
+ }
+ number = next_token.number;
+ if (next_token.id !== '(number)' || number < 0) {
+ warn('expected_positive_a', next_token);
+ advance();
+ } else {
+ advance();
+ if (next_token.id === '%') {
+ advance('%');
+ if (number > 100) {
+ warn('expected_percent_a', token, number);
+ }
+ } else {
+ if (number > 255) {
+ warn('expected_small_a', token, number);
+ }
+ }
+ }
+ }
+ if (value === 'rgba') {
+ comma();
+ number = next_token.number;
+ if (next_token.id !== '(number)' || number < 0 || number > 1) {
+ warn('expected_fraction_a', next_token);
+ }
+ advance();
+ if (next_token.id === '%') {
+ warn('unexpected_a');
+ advance('%');
+ }
+ }
+ advance(')', paren);
+ return true;
+ } else if (css_colorData[next_token.string] === true) {
+ advance();
+ return true;
+ }
+ } else if (next_token.id === '(color)') {
+ advance();
+ return true;
+ }
+ return false;
+ }
+
+
+ function css_length() {
+ if (next_token.id === '-') {
+ advance('-');
+ no_space_only();
+ }
+ if (next_token.id === '(number)') {
+ advance();
+ if (next_token.id !== '(string)' &&
+ css_lengthData[next_token.string] === true) {
+ no_space_only();
+ advance();
+ } else if (+token.number !== 0) {
+ warn('expected_linear_a');
+ }
+ return true;
+ }
+ return false;
+ }
+
+
+ function css_line_height() {
+ if (next_token.id === '-') {
+ advance('-');
+ no_space_only();
+ }
+ if (next_token.id === '(number)') {
+ advance();
+ if (next_token.id !== '(string)' &&
+ css_lengthData[next_token.string] === true) {
+ no_space_only();
+ advance();
+ }
+ return true;
+ }
+ return false;
+ }
+
+
+ function css_width() {
+ if (next_token.identifier) {
+ switch (next_token.string) {
+ case 'thin':
+ case 'medium':
+ case 'thick':
+ advance();
+ return true;
+ }
+ } else {
+ return css_length();
+ }
+ }
+
+
+ function css_margin() {
+ if (next_token.identifier) {
+ if (next_token.string === 'auto') {
+ advance();
+ return true;
+ }
+ } else {
+ return css_length();
+ }
+ }
+
+ function css_attr() {
+ if (next_token.identifier && next_token.string === 'attr') {
+ advance();
+ advance('(');
+ if (!next_token.identifier) {
+ warn('expected_name_a');
+ }
+ advance();
+ advance(')');
+ return true;
+ }
+ return false;
+ }
+
+
+ function css_comma_list() {
+ while (next_token.id !== ';') {
+ if (!css_name() && !css_string()) {
+ warn('expected_name_a');
+ }
+ if (next_token.id !== ',') {
+ return true;
+ }
+ comma();
+ }
+ }
+
+
+ function css_counter() {
+ if (next_token.identifier && next_token.string === 'counter') {
+ advance();
+ advance('(');
+ advance();
+ if (next_token.id === ',') {
+ comma();
+ if (next_token.id !== '(string)') {
+ warn('expected_string_a');
+ }
+ advance();
+ }
+ advance(')');
+ return true;
+ }
+ if (next_token.identifier && next_token.string === 'counters') {
+ advance();
+ advance('(');
+ if (!next_token.identifier) {
+ warn('expected_name_a');
+ }
+ advance();
+ if (next_token.id === ',') {
+ comma();
+ if (next_token.id !== '(string)') {
+ warn('expected_string_a');
+ }
+ advance();
+ }
+ if (next_token.id === ',') {
+ comma();
+ if (next_token.id !== '(string)') {
+ warn('expected_string_a');
+ }
+ advance();
+ }
+ advance(')');
+ return true;
+ }
+ return false;
+ }
+
+
+ function css_radius() {
+ return css_length() && (next_token.id !== '(number)' || css_length());
+ }
+
+
+ function css_shape() {
+ var i;
+ if (next_token.identifier && next_token.string === 'rect') {
+ advance();
+ advance('(');
+ for (i = 0; i < 4; i += 1) {
+ if (!css_length()) {
+ warn('expected_number_a');
+ break;
+ }
+ }
+ advance(')');
+ return true;
+ }
+ return false;
+ }
+
+
+ function css_url() {
+ var c, url;
+ if (next_token.identifier && next_token.string === 'url') {
+ next_token = lex.range('(', ')');
+ url = next_token.string;
+ c = url.charAt(0);
+ if (c === '"' || c === '\'') {
+ if (url.slice(-1) !== c) {
+ warn('bad_url_a');
+ } else {
+ url = url.slice(1, -1);
+ if (url.indexOf(c) >= 0) {
+ warn('bad_url_a');
+ }
+ }
+ }
+ if (!url) {
+ warn('missing_url');
+ }
+ if (ux.test(url)) {
+ stop('bad_url_a');
+ }
+ urls.push(url);
+ advance();
+ return true;
+ }
+ return false;
+ }
+
+
+ css_any = [css_url, function () {
+ for (;;) {
+ if (next_token.identifier) {
+ switch (next_token.string.toLowerCase()) {
+ case 'url':
+ css_url();
+ break;
+ case 'expression':
+ warn('unexpected_a');
+ advance();
+ break;
+ default:
+ advance();
+ }
+ } else {
+ if (next_token.id === ';' || next_token.id === '!' ||
+ next_token.id === '(end)' || next_token.id === '}') {
+ return true;
+ }
+ advance();
+ }
+ }
+ }];
+
+
+ function font_face() {
+ advance_identifier('font-family');
+ advance(':');
+ if (!css_name() && !css_string()) {
+ stop('expected_name_a');
+ }
+ semicolon();
+ advance_identifier('src');
+ advance(':');
+ while (true) {
+ if (next_token.string === 'local') {
+ advance_identifier('local');
+ advance('(');
+ if (ux.test(next_token.string)) {
+ stop('bad_url_a');
+ }
+
+ if (!css_name() && !css_string()) {
+ stop('expected_name_a');
+ }
+ advance(')');
+ } else if (!css_url()) {
+ stop('expected_a_b', next_token, 'url', artifact());
+ }
+ if (next_token.id !== ',') {
+ break;
+ }
+ comma();
+ }
+ semicolon();
+ }
+
+
+ css_border_style = [
+ 'none', 'dashed', 'dotted', 'double', 'groove',
+ 'hidden', 'inset', 'outset', 'ridge', 'solid'
+ ];
+
+ css_break = [
+ 'auto', 'always', 'avoid', 'left', 'right'
+ ];
+
+ css_media = {
+ 'all': true,
+ 'braille': true,
+ 'embossed': true,
+ 'handheld': true,
+ 'print': true,
+ 'projection': true,
+ 'screen': true,
+ 'speech': true,
+ 'tty': true,
+ 'tv': true
+ };
+
+ css_overflow = [
+ 'auto', 'hidden', 'scroll', 'visible'
+ ];
+
+ css_attribute_data = {
+ background: [
+ true, 'background-attachment', 'background-color',
+ 'background-image', 'background-position', 'background-repeat'
+ ],
+ 'background-attachment': ['scroll', 'fixed'],
+ 'background-color': ['transparent', css_color],
+ 'background-image': ['none', css_url],
+ 'background-position': [
+ 2, [css_length, 'top', 'bottom', 'left', 'right', 'center']
+ ],
+ 'background-repeat': [
+ 'repeat', 'repeat-x', 'repeat-y', 'no-repeat'
+ ],
+ 'border': [true, 'border-color', 'border-style', 'border-width'],
+ 'border-bottom': [
+ true, 'border-bottom-color', 'border-bottom-style',
+ 'border-bottom-width'
+ ],
+ 'border-bottom-color': css_color,
+ 'border-bottom-left-radius': css_radius,
+ 'border-bottom-right-radius': css_radius,
+ 'border-bottom-style': css_border_style,
+ 'border-bottom-width': css_width,
+ 'border-collapse': ['collapse', 'separate'],
+ 'border-color': ['transparent', 4, css_color],
+ 'border-left': [
+ true, 'border-left-color', 'border-left-style', 'border-left-width'
+ ],
+ 'border-left-color': css_color,
+ 'border-left-style': css_border_style,
+ 'border-left-width': css_width,
+ 'border-radius': function () {
+ function count(separator) {
+ var n = 1;
+ if (separator) {
+ advance(separator);
+ }
+ if (!css_length()) {
+ return false;
+ }
+ while (next_token.id === '(number)') {
+ if (!css_length()) {
+ return false;
+ }
+ n += 1;
+ }
+ if (n > 4) {
+ warn('bad_style');
+ }
+ return true;
+ }
+
+ return count() && (next_token.id !== '/' || count('/'));
+ },
+ 'border-right': [
+ true, 'border-right-color', 'border-right-style',
+ 'border-right-width'
+ ],
+ 'border-right-color': css_color,
+ 'border-right-style': css_border_style,
+ 'border-right-width': css_width,
+ 'border-spacing': [2, css_length],
+ 'border-style': [4, css_border_style],
+ 'border-top': [
+ true, 'border-top-color', 'border-top-style', 'border-top-width'
+ ],
+ 'border-top-color': css_color,
+ 'border-top-left-radius': css_radius,
+ 'border-top-right-radius': css_radius,
+ 'border-top-style': css_border_style,
+ 'border-top-width': css_width,
+ 'border-width': [4, css_width],
+ bottom: [css_length, 'auto'],
+ 'caption-side' : ['bottom', 'left', 'right', 'top'],
+ clear: ['both', 'left', 'none', 'right'],
+ clip: [css_shape, 'auto'],
+ color: css_color,
+ content: [
+ 'open-quote', 'close-quote', 'no-open-quote', 'no-close-quote',
+ css_string, css_url, css_counter, css_attr
+ ],
+ 'counter-increment': [
+ css_name, 'none'
+ ],
+ 'counter-reset': [
+ css_name, 'none'
+ ],
+ cursor: [
+ css_url, 'auto', 'crosshair', 'default', 'e-resize', 'help', 'move',
+ 'n-resize', 'ne-resize', 'nw-resize', 'pointer', 's-resize',
+ 'se-resize', 'sw-resize', 'w-resize', 'text', 'wait'
+ ],
+ direction: ['ltr', 'rtl'],
+ display: [
+ 'block', 'compact', 'inline', 'inline-block', 'inline-table',
+ 'list-item', 'marker', 'none', 'run-in', 'table', 'table-caption',
+ 'table-cell', 'table-column', 'table-column-group',
+ 'table-footer-group', 'table-header-group', 'table-row',
+ 'table-row-group'
+ ],
+ 'empty-cells': ['show', 'hide'],
+ 'float': ['left', 'none', 'right'],
+ font: [
+ 'caption', 'icon', 'menu', 'message-box', 'small-caption',
+ 'status-bar', true, 'font-size', 'font-style', 'font-weight',
+ 'font-family'
+ ],
+ 'font-family': css_comma_list,
+ 'font-size': [
+ 'xx-small', 'x-small', 'small', 'medium', 'large', 'x-large',
+ 'xx-large', 'larger', 'smaller', css_length
+ ],
+ 'font-size-adjust': ['none', css_number],
+ 'font-stretch': [
+ 'normal', 'wider', 'narrower', 'ultra-condensed',
+ 'extra-condensed', 'condensed', 'semi-condensed',
+ 'semi-expanded', 'expanded', 'extra-expanded'
+ ],
+ 'font-style': [
+ 'normal', 'italic', 'oblique'
+ ],
+ 'font-variant': [
+ 'normal', 'small-caps'
+ ],
+ 'font-weight': [
+ 'normal', 'bold', 'bolder', 'lighter', css_number
+ ],
+ height: [css_length, 'auto'],
+ left: [css_length, 'auto'],
+ 'letter-spacing': ['normal', css_length],
+ 'line-height': ['normal', css_line_height],
+ 'list-style': [
+ true, 'list-style-image', 'list-style-position', 'list-style-type'
+ ],
+ 'list-style-image': ['none', css_url],
+ 'list-style-position': ['inside', 'outside'],
+ 'list-style-type': [
+ 'circle', 'disc', 'square', 'decimal', 'decimal-leading-zero',
+ 'lower-roman', 'upper-roman', 'lower-greek', 'lower-alpha',
+ 'lower-latin', 'upper-alpha', 'upper-latin', 'hebrew', 'katakana',
+ 'hiragana-iroha', 'katakana-oroha', 'none'
+ ],
+ margin: [4, css_margin],
+ 'margin-bottom': css_margin,
+ 'margin-left': css_margin,
+ 'margin-right': css_margin,
+ 'margin-top': css_margin,
+ 'marker-offset': [css_length, 'auto'],
+ 'max-height': [css_length, 'none'],
+ 'max-width': [css_length, 'none'],
+ 'min-height': css_length,
+ 'min-width': css_length,
+ opacity: css_number,
+ outline: [true, 'outline-color', 'outline-style', 'outline-width'],
+ 'outline-color': ['invert', css_color],
+ 'outline-style': [
+ 'dashed', 'dotted', 'double', 'groove', 'inset', 'none',
+ 'outset', 'ridge', 'solid'
+ ],
+ 'outline-width': css_width,
+ overflow: css_overflow,
+ 'overflow-x': css_overflow,
+ 'overflow-y': css_overflow,
+ padding: [4, css_length],
+ 'padding-bottom': css_length,
+ 'padding-left': css_length,
+ 'padding-right': css_length,
+ 'padding-top': css_length,
+ 'page-break-after': css_break,
+ 'page-break-before': css_break,
+ position: ['absolute', 'fixed', 'relative', 'static'],
+ quotes: [8, css_string],
+ right: [css_length, 'auto'],
+ 'table-layout': ['auto', 'fixed'],
+ 'text-align': ['center', 'justify', 'left', 'right'],
+ 'text-decoration': [
+ 'none', 'underline', 'overline', 'line-through', 'blink'
+ ],
+ 'text-indent': css_length,
+ 'text-shadow': ['none', 4, [css_color, css_length]],
+ 'text-transform': ['capitalize', 'uppercase', 'lowercase', 'none'],
+ top: [css_length, 'auto'],
+ 'unicode-bidi': ['normal', 'embed', 'bidi-override'],
+ 'vertical-align': [
+ 'baseline', 'bottom', 'sub', 'super', 'top', 'text-top', 'middle',
+ 'text-bottom', css_length
+ ],
+ visibility: ['visible', 'hidden', 'collapse'],
+ 'white-space': [
+ 'normal', 'nowrap', 'pre', 'pre-line', 'pre-wrap', 'inherit'
+ ],
+ width: [css_length, 'auto'],
+ 'word-spacing': ['normal', css_length],
+ 'word-wrap': ['break-word', 'normal'],
+ 'z-index': ['auto', css_number]
+ };
+
+ function style_attribute() {
+ var v;
+ while (next_token.id === '*' || next_token.id === '#' ||
+ next_token.string === '_') {
+ if (!option.css) {
+ warn('unexpected_a');
+ }
+ advance();
+ }
+ if (next_token.id === '-') {
+ if (!option.css) {
+ warn('unexpected_a');
+ }
+ advance('-');
+ if (!next_token.identifier) {
+ warn('expected_nonstandard_style_attribute');
+ }
+ advance();
+ return css_any;
+ } else {
+ if (!next_token.identifier) {
+ warn('expected_style_attribute');
+ } else {
+ if (Object.prototype.hasOwnProperty.call(css_attribute_data,
+ next_token.string)) {
+ v = css_attribute_data[next_token.string];
+ } else {
+ v = css_any;
+ if (!option.css) {
+ warn('unrecognized_style_attribute_a');
+ }
+ }
+ }
+ advance();
+ return v;
+ }
+ }
+
+
+ function style_value(v) {
+
+ /*jslint confusion: true */
+
+ var i = 0,
+ n,
+ once,
+ match,
+ round,
+ start = 0,
+ vi;
+ switch (typeof v) {
+ case 'function':
+ return v();
+ case 'string':
+ if (next_token.identifier && next_token.string === v) {
+ advance();
+ return true;
+ }
+ return false;
+ }
+ for (;;) {
+ if (i >= v.length) {
+ return false;
+ }
+ vi = v[i];
+ i += 1;
+ if (typeof vi === 'boolean') {
+ break;
+ } else if (typeof vi === 'number') {
+ n = vi;
+ vi = v[i];
+ i += 1;
+ } else {
+ n = 1;
+ }
+ match = false;
+ while (n > 0) {
+ if (style_value(vi)) {
+ match = true;
+ n -= 1;
+ } else {
+ break;
+ }
+ }
+ if (match) {
+ return true;
+ }
+ }
+ start = i;
+ once = [];
+ for (;;) {
+ round = false;
+ for (i = start; i < v.length; i += 1) {
+ if (!once[i]) {
+ if (style_value(css_attribute_data[v[i]])) {
+ match = true;
+ round = true;
+ once[i] = true;
+ break;
+ }
+ }
+ }
+ if (!round) {
+ return match;
+ }
+ }
+ }
+
+ function style_child() {
+ if (next_token.id === '(number)') {
+ advance();
+ if (next_token.string === 'n' && next_token.identifier) {
+ no_space_only();
+ advance();
+ if (next_token.id === '+') {
+ no_space_only();
+ advance('+');
+ no_space_only();
+ advance('(number)');
+ }
+ }
+ return;
+ } else {
+ if (next_token.identifier &&
+ (next_token.string === 'odd' || next_token.string === 'even')) {
+ advance();
+ return;
+ }
+ }
+ warn('unexpected_a');
+ }
+
+ function substyle() {
+ var v;
+ for (;;) {
+ if (next_token.id === '}' || next_token.id === '(end)' ||
+ (xquote && next_token.id === xquote)) {
+ return;
+ }
+ v = style_attribute();
+ advance(':');
+ if (next_token.identifier && next_token.string === 'inherit') {
+ advance();
+ } else {
+ if (!style_value(v)) {
+ warn('unexpected_a');
+ advance();
+ }
+ }
+ if (next_token.id === '!') {
+ advance('!');
+ no_space_only();
+ if (next_token.identifier && next_token.string === 'important') {
+ advance();
+ } else {
+ warn('expected_a_b',
+ next_token, 'important', artifact());
+ }
+ }
+ if (next_token.id === '}' || next_token.id === xquote) {
+ warn('expected_a_b', next_token, ';', artifact());
+ } else {
+ semicolon();
+ }
+ }
+ }
+
+ function style_selector() {
+ if (next_token.identifier) {
+ if (!Object.prototype.hasOwnProperty.call(html_tag, option.cap
+ ? next_token.string.toLowerCase()
+ : next_token.string)) {
+ warn('expected_tagname_a');
+ }
+ advance();
+ } else {
+ switch (next_token.id) {
+ case '>':
+ case '+':
+ advance();
+ style_selector();
+ break;
+ case ':':
+ advance(':');
+ switch (next_token.string) {
+ case 'active':
+ case 'after':
+ case 'before':
+ case 'checked':
+ case 'disabled':
+ case 'empty':
+ case 'enabled':
+ case 'first-child':
+ case 'first-letter':
+ case 'first-line':
+ case 'first-of-type':
+ case 'focus':
+ case 'hover':
+ case 'last-child':
+ case 'last-of-type':
+ case 'link':
+ case 'only-of-type':
+ case 'root':
+ case 'target':
+ case 'visited':
+ advance_identifier(next_token.string);
+ break;
+ case 'lang':
+ advance_identifier('lang');
+ advance('(');
+ if (!next_token.identifier) {
+ warn('expected_lang_a');
+ }
+ advance(')');
+ break;
+ case 'nth-child':
+ case 'nth-last-child':
+ case 'nth-last-of-type':
+ case 'nth-of-type':
+ advance_identifier(next_token.string);
+ advance('(');
+ style_child();
+ advance(')');
+ break;
+ case 'not':
+ advance_identifier('not');
+ advance('(');
+ if (next_token.id === ':' && peek(0).string === 'not') {
+ warn('not');
+ }
+ style_selector();
+ advance(')');
+ break;
+ default:
+ warn('expected_pseudo_a');
+ }
+ break;
+ case '#':
+ advance('#');
+ if (!next_token.identifier) {
+ warn('expected_id_a');
+ }
+ advance();
+ break;
+ case '*':
+ advance('*');
+ break;
+ case '.':
+ advance('.');
+ if (!next_token.identifier) {
+ warn('expected_class_a');
+ }
+ advance();
+ break;
+ case '[':
+ advance('[');
+ if (!next_token.identifier) {
+ warn('expected_attribute_a');
+ }
+ advance();
+ if (next_token.id === '=' || next_token.string === '~=' ||
+ next_token.string === '$=' ||
+ next_token.string === '|=' ||
+ next_token.id === '*=' ||
+ next_token.id === '^=') {
+ advance();
+ if (next_token.id !== '(string)') {
+ warn('expected_string_a');
+ }
+ advance();
+ }
+ advance(']');
+ break;
+ default:
+ stop('expected_selector_a');
+ }
+ }
+ }
+
+ function style_pattern() {
+ if (next_token.id === '{') {
+ warn('expected_style_pattern');
+ }
+ for (;;) {
+ style_selector();
+ if (next_token.id === '= 0) {
+ warn('unexpected_char_a_b', token, v.charAt(x), a);
+ }
+ ids[u] = true;
+ } else if (a === 'class' || a === 'type' || a === 'name') {
+ x = v.search(qx);
+ if (x >= 0) {
+ warn('unexpected_char_a_b', token, v.charAt(x), a);
+ }
+ ids[u] = true;
+ } else if (a === 'href' || a === 'background' ||
+ a === 'content' || a === 'data' ||
+ a.indexOf('src') >= 0 || a.indexOf('url') >= 0) {
+ if (option.safe && ux.test(v)) {
+ stop('bad_url_a', next_token, v);
+ }
+ urls.push(v);
+ } else if (a === 'for') {
+ if (option.adsafe) {
+ if (adsafe_id) {
+ if (v.slice(0, adsafe_id.length) !== adsafe_id) {
+ warn('adsafe_prefix_a', next_token, adsafe_id);
+ } else if (!/^[A-Z]+_[A-Z]+$/.test(v)) {
+ warn('adsafe_bad_id');
+ }
+ } else {
+ warn('adsafe_bad_id');
+ }
+ }
+ } else if (a === 'name') {
+ if (option.adsafe && v.indexOf('_') >= 0) {
+ warn('adsafe_name_a', next_token, v);
+ }
+ }
+ }
+
+ function do_tag(name, attribute) {
+ var i, tag = html_tag[name], script, x;
+ src = false;
+ if (!tag) {
+ stop(
+ bundle.unrecognized_tag_a,
+ next_token,
+ name === name.toLowerCase()
+ ? name
+ : name + ' (capitalization error)'
+ );
+ }
+ if (stack.length > 0) {
+ if (name === 'html') {
+ stop('unexpected_a', token, name);
+ }
+ x = tag.parent;
+ if (x) {
+ if (x.indexOf(' ' + stack[stack.length - 1].name + ' ') < 0) {
+ stop('tag_a_in_b', token, name, x);
+ }
+ } else if (!option.adsafe && !option.fragment) {
+ i = stack.length;
+ do {
+ if (i <= 0) {
+ stop('tag_a_in_b', token, name, 'body');
+ }
+ i -= 1;
+ } while (stack[i].name !== 'body');
+ }
+ }
+ switch (name) {
+ case 'div':
+ if (option.adsafe && stack.length === 1 && !adsafe_id) {
+ warn('adsafe_missing_id');
+ }
+ break;
+ case 'script':
+ xmode = 'script';
+ advance('>');
+ if (attribute.lang) {
+ warn('lang', token);
+ }
+ if (option.adsafe && stack.length !== 1) {
+ warn('adsafe_placement', token);
+ }
+ if (attribute.src) {
+ if (option.adsafe && (!adsafe_may || !approved[attribute.src])) {
+ warn('adsafe_source', token);
+ }
+ if (attribute.type) {
+ warn('type', token);
+ }
+ } else {
+ step_in(next_token.from);
+ edge();
+ use_strict();
+ adsafe_top = true;
+ script = statements();
+
+// JSLint is also the static analyzer for ADsafe. See www.ADsafe.org.
+
+ if (option.adsafe) {
+ if (adsafe_went) {
+ stop('adsafe_script', token);
+ }
+ if (script.length !== 1 ||
+ aint(script[0], 'id', '(') ||
+ aint(script[0].first, 'id', '.') ||
+ aint(script[0].first.first, 'string', 'ADSAFE') ||
+ aint(script[0].second[0], 'string', adsafe_id)) {
+ stop('adsafe_id_go');
+ }
+ switch (script[0].first.second.string) {
+ case 'id':
+ if (adsafe_may || adsafe_went ||
+ script[0].second.length !== 1) {
+ stop('adsafe_id', next_token);
+ }
+ adsafe_may = true;
+ break;
+ case 'go':
+ if (adsafe_went) {
+ stop('adsafe_go');
+ }
+ if (script[0].second.length !== 2 ||
+ aint(script[0].second[1], 'id', 'function') ||
+ !script[0].second[1].first ||
+ script[0].second[1].first.length !== 2 ||
+ aint(script[0].second[1].first[0], 'string', 'dom') ||
+ aint(script[0].second[1].first[1], 'string', 'lib')) {
+ stop('adsafe_go', next_token);
+ }
+ adsafe_went = true;
+ break;
+ default:
+ stop('adsafe_id_go');
+ }
+ }
+ indent = null;
+ }
+ xmode = 'html';
+ advance('');
+ styles();
+ xmode = 'html';
+ advance('';
+ }
+
+ function html() {
+
+ /*jslint confusion: true */
+
+ var attribute, attributes, is_empty, name, old_white = option.white,
+ quote, tag_name, tag, wmode;
+ xmode = 'html';
+ xquote = '';
+ stack = null;
+ for (;;) {
+ switch (next_token.string) {
+ case '<':
+ xmode = 'html';
+ advance('<');
+ attributes = {};
+ tag_name = next_token;
+ name = tag_name.string;
+ advance_identifier(name);
+ if (option.cap) {
+ name = name.toLowerCase();
+ }
+ tag_name.name = name;
+ if (!stack) {
+ stack = [];
+ do_begin(name);
+ }
+ tag = html_tag[name];
+ if (typeof tag !== 'object') {
+ stop('unrecognized_tag_a', tag_name, name);
+ }
+ is_empty = tag.empty;
+ tag_name.type = name;
+ for (;;) {
+ if (next_token.id === '/') {
+ advance('/');
+ if (next_token.id !== '>') {
+ warn('expected_a_b', next_token, '>', artifact());
+ }
+ break;
+ }
+ if (next_token.id && next_token.id.charAt(0) === '>') {
+ break;
+ }
+ if (!next_token.identifier) {
+ if (next_token.id === '(end)' || next_token.id === '(error)') {
+ warn('expected_a_b', next_token, '>', artifact());
+ }
+ warn('bad_name_a');
+ }
+ option.white = false;
+ spaces();
+ attribute = next_token.string;
+ option.white = old_white;
+ advance();
+ if (!option.cap && attribute !== attribute.toLowerCase()) {
+ warn('attribute_case_a', token);
+ }
+ attribute = attribute.toLowerCase();
+ xquote = '';
+ if (Object.prototype.hasOwnProperty.call(attributes, attribute)) {
+ warn('duplicate_a', token, attribute);
+ }
+ if (attribute.slice(0, 2) === 'on') {
+ if (!option.on) {
+ warn('html_handlers');
+ }
+ xmode = 'scriptstring';
+ advance('=');
+ quote = next_token.id;
+ if (quote !== '"' && quote !== '\'') {
+ stop('expected_a_b', next_token, '"', artifact());
+ }
+ xquote = quote;
+ wmode = option.white;
+ option.white = true;
+ advance(quote);
+ use_strict();
+ statements();
+ option.white = wmode;
+ if (next_token.id !== quote) {
+ stop('expected_a_b', next_token, quote, artifact());
+ }
+ xmode = 'html';
+ xquote = '';
+ advance(quote);
+ tag = false;
+ } else if (attribute === 'style') {
+ xmode = 'scriptstring';
+ advance('=');
+ quote = next_token.id;
+ if (quote !== '"' && quote !== '\'') {
+ stop('expected_a_b', next_token, '"', artifact());
+ }
+ xmode = 'styleproperty';
+ xquote = quote;
+ advance(quote);
+ substyle();
+ xmode = 'html';
+ xquote = '';
+ advance(quote);
+ tag = false;
+ } else {
+ if (next_token.id === '=') {
+ advance('=');
+ tag = next_token.string;
+ if (!next_token.identifier &&
+ next_token.id !== '"' &&
+ next_token.id !== '\'' &&
+ next_token.id !== '(string)' &&
+ next_token.id !== '(string)' &&
+ next_token.id !== '(color)') {
+ warn('expected_attribute_value_a', token, attribute);
+ }
+ advance();
+ } else {
+ tag = true;
+ }
+ }
+ attributes[attribute] = tag;
+ do_attribute(attribute, tag);
+ }
+ do_tag(name, attributes);
+ if (!is_empty) {
+ stack.push(tag_name);
+ }
+ xmode = 'outer';
+ advance('>');
+ break;
+ case '') {
+ stop('expected_a_b', next_token, '>', artifact());
+ }
+ xmode = 'outer';
+ advance('>');
+ break;
+ case '' || next_token.id === '(end)') {
+ break;
+ }
+ if (next_token.string.indexOf('--') >= 0) {
+ stop('unexpected_a', next_token, '--');
+ }
+ if (next_token.string.indexOf('<') >= 0) {
+ stop('unexpected_a', next_token, '<');
+ }
+ if (next_token.string.indexOf('>') >= 0) {
+ stop('unexpected_a', next_token, '>');
+ }
+ }
+ xmode = 'outer';
+ advance('>');
+ break;
+ case '(end)':
+ return;
+ default:
+ if (next_token.id === '(end)') {
+ stop('missing_a', next_token,
+ '');
+ } else {
+ advance();
+ }
+ }
+ if (stack && stack.length === 0 && (option.adsafe ||
+ !option.fragment || next_token.id === '(end)')) {
+ break;
+ }
+ }
+ if (next_token.id !== '(end)') {
+ stop('unexpected_a');
+ }
+ }
+
+
+// The actual JSLINT function itself.
+
+ itself = function JSLint(the_source, the_option) {
+
+ var i, predef, tree;
+ JSLINT.errors = [];
+ JSLINT.tree = '';
+ begin = prev_token = token = next_token =
+ Object.create(syntax['(begin)']);
+ predefined = {};
+ add_to_predefined(standard);
+ property_type = Object.create(standard_property_type);
+ if (the_option) {
+ option = Object.create(the_option);
+ predef = option.predef;
+ if (predef) {
+ if (Array.isArray(predef)) {
+ for (i = 0; i < predef.length; i += 1) {
+ predefined[predef[i]] = true;
+ }
+ } else if (typeof predef === 'object') {
+ add_to_predefined(predef);
+ }
+ }
+ do_safe();
+ } else {
+ option = {};
+ }
+ option.indent = +option.indent || 4;
+ option.maxerr = +option.maxerr || 50;
+ adsafe_id = '';
+ adsafe_may = adsafe_top = adsafe_went = false;
+ approved = {};
+ if (option.approved) {
+ for (i = 0; i < option.approved.length; i += 1) {
+ approved[option.approved[i]] = option.approved[i];
+ }
+ } else {
+ approved.test = 'test';
+ }
+ tab = '';
+ for (i = 0; i < option.indent; i += 1) {
+ tab += ' ';
+ }
+ global_scope = scope = {};
+ global_funct = funct = {
+ '(scope)': scope,
+ '(breakage)': 0,
+ '(loopage)': 0
+ };
+ functions = [funct];
+
+ comments_off = false;
+ ids = {};
+ in_block = false;
+ indent = null;
+ json_mode = false;
+ lookahead = [];
+ member = {};
+ node_js = false;
+ prereg = true;
+ src = false;
+ stack = null;
+ strict_mode = false;
+ urls = [];
+ var_mode = null;
+ warnings = 0;
+ xmode = '';
+ lex.init(the_source);
+
+ assume();
+
+ try {
+ advance();
+ if (next_token.id === '(number)') {
+ stop('unexpected_a');
+ } else if (next_token.string.charAt(0) === '<') {
+ html();
+ if (option.adsafe && !adsafe_went) {
+ warn('adsafe_go', this);
+ }
+ } else {
+ switch (next_token.id) {
+ case '{':
+ case '[':
+ json_mode = true;
+ json_value();
+ break;
+ case '@':
+ case '*':
+ case '#':
+ case '.':
+ case ':':
+ xmode = 'style';
+ advance();
+ if (token.id !== '@' || !next_token.identifier ||
+ next_token.string !== 'charset' || token.line !== 1 ||
+ token.from !== 1) {
+ stop('css');
+ }
+ advance();
+ if (next_token.id !== '(string)' &&
+ next_token.string !== 'UTF-8') {
+ stop('css');
+ }
+ advance();
+ semicolon();
+ styles();
+ break;
+
+ default:
+ if (option.adsafe && option.fragment) {
+ stop('expected_a_b',
+ next_token, '
');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
+String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
+this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();
+var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=
+false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});
+this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff=
+{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];
+if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=
+false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);
+c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,
+d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidth', artifact());
+ }
+
+// If the first token is a semicolon, ignore it. This is sometimes used when
+// files are intended to be appended to files that may be sloppy. A sloppy
+// file may be depending on semicolon insertion on its last line.
+
+ step_in(1);
+ if (next_token.id === ';' && !node_js) {
+ semicolon();
+ }
+ adsafe_top = true;
+ tree = statements();
+ begin.first = tree;
+ JSLINT.tree = begin;
+ // infer_types(tree);
+ if (option.adsafe && (tree.length !== 1 ||
+ aint(tree[0], 'id', '(') ||
+ aint(tree[0].first, 'id', '.') ||
+ aint(tree[0].first.first, 'string', 'ADSAFE') ||
+ aint(tree[0].first.second, 'string', 'lib') ||
+ tree[0].second.length !== 2 ||
+ tree[0].second[0].id !== '(string)' ||
+ aint(tree[0].second[1], 'id', 'function'))) {
+ stop('adsafe_lib');
+ }
+ if (tree.disrupt) {
+ warn('weird_program', prev_token);
+ }
+ }
+ }
+ indent = null;
+ advance('(end)');
+ } catch (e) {
+ if (e) { // `~
+ JSLINT.errors.push({
+ reason : e.message,
+ line : e.line || next_token.line,
+ character : e.character || next_token.from
+ }, null);
+ }
+ }
+ return JSLINT.errors.length === 0;
+ };
+
+
+// Data summary.
+
+ itself.data = function () {
+ var data = {functions: []},
+ function_data,
+ globals,
+ i,
+ j,
+ kind,
+ members = [],
+ name,
+ the_function,
+ undef = [],
+ unused = [];
+ if (itself.errors.length) {
+ data.errors = itself.errors;
+ }
+
+ if (json_mode) {
+ data.json = true;
+ }
+
+ if (urls.length > 0) {
+ data.urls = urls;
+ }
+
+ globals = Object.keys(global_scope).filter(function (value) {
+ return value.charAt(0) !== '(' && typeof standard[value] !== 'boolean';
+ });
+ if (globals.length > 0) {
+ data.globals = globals;
+ }
+
+ for (i = 1; i < functions.length; i += 1) {
+ the_function = functions[i];
+ function_data = {};
+ for (j = 0; j < functionicity.length; j += 1) {
+ function_data[functionicity[j]] = [];
+ }
+ for (name in the_function) {
+ if (Object.prototype.hasOwnProperty.call(the_function, name)) {
+ if (name.charAt(0) !== '(') {
+ kind = the_function[name];
+ if (kind === 'unction' || kind === 'unparam') {
+ kind = 'unused';
+ }
+ if (Array.isArray(function_data[kind])) {
+ function_data[kind].push(name);
+ if (kind === 'unused') {
+ unused.push({
+ name: name,
+ line: the_function['(line)'],
+ 'function': the_function['(name)']
+ });
+ } else if (kind === 'undef') {
+ undef.push({
+ name: name,
+ line: the_function['(line)'],
+ 'function': the_function['(name)']
+ });
+ }
+ }
+ }
+ }
+ }
+ for (j = 0; j < functionicity.length; j += 1) {
+ if (function_data[functionicity[j]].length === 0) {
+ delete function_data[functionicity[j]];
+ }
+ }
+ function_data.name = the_function['(name)'];
+ function_data.params = the_function['(params)'];
+ function_data.line = the_function['(line)'];
+ function_data['(complexity)'] = the_function['(complexity)'];
+ data.functions.push(function_data);
+ }
+
+ if (unused.length > 0) {
+ data.unused = unused;
+ }
+ if (undef.length > 0) {
+ data['undefined'] = undef;
+ }
+
+ members = [];
+ for (name in member) {
+ if (typeof member[name] === 'number') {
+ data.member = member;
+ break;
+ }
+ }
+
+ return data;
+ };
+
+
+ itself.report = function (errors_only) {
+ var data = itself.data(), err, evidence, i, italics, j, key, keys, length,
+ mem = '', name, names, output = [], snippets, the_function, type,
+ warning;
+
+ function detail(h, value) {
+ var comma_needed, singularity;
+ if (Array.isArray(value)) {
+ output.push('
').replace(/'/g, ''').replace(/"/g, '"'); -}; - -// conversion de couleur Decimal vers HexaDecimal || 000 si fff -/* FIXME : move it somewhere else */ -IriSP.DEC_HEXA_COLOR = function (dec) { - var hexa='0123456789ABCDEF',hex=''; - var tmp; - while (dec>15){ - tmp = dec-(Math.floor(dec/16))*16; - hex = hexa.charAt(tmp)+hex; - dec = Math.floor(dec/16); - } - hex = hexa.charAt(dec)+hex; - if (hex == "FFCC00"){ hex="";/* by default color of Ldt annotation */ } - return(hex); -}; - - -/* Search methods */ -IriSP.SearchOldValue=""; -IriSP.searchblockOpen=false; -IriSP.searchblock = function () { - IriSP.trace( "__IriSP.searchblock", IriSP.searchblockOpen ); - - if ( IriSP.searchblockOpen == false ) { - IriSP.jQuery( ".ui-icon-search" ).css( "background-position", "-144px -112px" ); - //__IriSP.jQuery("#LdtSearch").animate({height:26},250); - IriSP.jQuery("#LdtSearch").show(250); - /* FIXME : refactor this */ - IriSP.jQuery("#LdtSearchInput").css('background-color','#fff'); - IriSP.jQuery("#LdtSearchInput").focus(); - IriSP.jQuery("#LdtSearchInput").attr('value',IriSP.SearchOldValue); - IriSP.Search(IriSP.SearchOldValue); - IriSP.searchblockOpen = true; - } else { - IriSP.SearchOldValue = IriSP.jQuery("#LdtSearchInput").attr('value'); - IriSP.jQuery("#LdtSearchInput").attr('value',''); - IriSP.SearchClean(); - IriSP.jQuery(".ui-icon-search").css("background-position","-160px -112px"); - //__IriSP.jQuery("#LdtSearch").animate({height:0},250); - IriSP.jQuery("#LdtSearch").hide(250); - IriSP.searchblockOpen = false; - } -}; - -/* Search with typeahead */ -IriSP.Search = function ( value ){ - - annotations = IriSP.LDTligne.annotations; - - IriSP.trace("__IriSP.Search", annotations.length+" "+value); - - var found = 0; - var findmem = 0; - var factor = 0; - IriSP.trace(value,value.length); - var valueS = value.toLowerCase(); - IriSP.trace("__IriSP.Search", annotations.length+" "+valueS); - if(valueS.length>=3){ - - for (var i=0; i < annotations.length; ++i){ - annotation = annotations[i]; - - IriSP.jQuery("#output2").text(annotation.title+" ?= "+value); - - chaine1 = annotation.title.toLowerCase(); - chaine2 = annotation.description.toLowerCase(); - chaine3 = annotation.htmlTags.toLowerCase(); - - if(chaine1.indexOf(valueS,0) !=-1){ - found+=1; - } - if(chaine2.indexOf(valueS,0) !=-1){ - found+=1; - } - if(chaine3.indexOf(valueS,0) !=-1){ - found+=1; - } - - findmem += found; - if(found>0){ - factor = found*8; - IriSP.jQuery("#"+annotation.id).dequeue(); - IriSP.jQuery("#"+annotation.id).animate({height:factor},200); - IriSP.jQuery("#"+annotation.id).css('border','2px'); - IriSP.jQuery("#"+annotation.id).css('border-color','red'); - IriSP.jQuery("#"+annotation.id).animate({opacity:0.6},200); - - IriSP.trace("!!!!!!!!!!!!!!!!!!"," ?= "+annotation.id); - IriSP.jQuery("#LdtSearchInput").css('background-color','#e1ffe1'); - }else { - IriSP.jQuery("#"+annotation.id).dequeue(); - IriSP.jQuery("#"+annotation.id).animate({height:0},250); - IriSP.jQuery("#"+annotation.id).animate({opacity:0.3},200); - } - - found = 0; - } - if(findmem==0){ - IriSP.jQuery("#LdtSearchInput").css('background-color','#f6f6f6'); - } - - } else if(value.length==0){ - IriSP.SearchClean(); - IriSP.jQuery("#LdtSearchInput").css('background-color','#fff'); - } else { - IriSP.SearchClean(); - IriSP.jQuery("#LdtSearchInput").css('background-color','#f6f6f6'); - } -}; - -IriSP.SearchClean = function (){ - annotations = IriSP.LDTligne.annotations; - - for (var i=0; i < annotations.length; ++i){ - annotation = annotations[i]; - IriSP.jQuery("#"+annotation.id).dequeue(); - IriSP.jQuery("#"+annotation.id).animate({height:0},100); - IriSP.jQuery("#"+annotation.id).css('border','0px'); - IriSP.jQuery("#"+annotation.id).css('border-color','red'); - IriSP.jQuery("#"+annotation.id).animate({opacity:0.3},100); - } -}; - - -IriSP.SearchThisSegment = function (annotation){ - /* FIXME: to implement */ - IriSP.jQuery("#LdtSearchInput").text(annotation.title); - IriSP.trace("__IriSP.Ligne.prototype.checkTimeLigne",annotation.title); - /*__IriSP.jQuery("#Ldt-SaDescription").text(annotationTempo.description); - __IriSP.jQuery("#Ldt-SaKeywordText").html("Mots clefs : "+annotationTempo.htmlTags);*/ -}; - - -/* CLASS Ligne (annotationType) */ - -IriSP.LDTligne = null; -__IriSP.Ligne = function( id, title, description, duration ) { - this.id = id; - this.title = title; - this.description = description; - // - this.annotations = new Array(); - this.duration = duration; - this.annotationOldRead = ""; - IriSP.LDTligne = this; - IriSP.trace("__IriSP.Ligne","CREATE "+IriSP.LDTligne); -}; - -__IriSP.Ligne.prototype.addAnnotation = function ( id, begin, end, media, title, description, color, tags ) { - var myAnnotation = new __IriSP.Annotation(id,begin,end,media,title,description,color,tags,this.duration); - this.annotations.push(myAnnotation); - //__IriSP.trace("__IriSP.Ligne.prototype.addAnnotation ","add annotation "+title); -}; - -__IriSP.Ligne.prototype.onClickLigneAnnotation = function( id ) { - /* TODO implement */ - //changePageUrlOffset(currentPosition); - //player.sendEvent('SEEK', this.start); - //__IriSP.trace("SEEK",this.start); -}; - -__IriSP.Ligne.prototype.searchLigneAnnotation = function( id ) { - /* TODO implement */ - /*for (){ - }*/ -}; - -__IriSP.Ligne.prototype.listAnnotations = function() { - /* TODO implement */ -}; - -__IriSP.Ligne.prototype.nextAnnotation = function () { - - var annotationCibleNumber = this.numAnnotation(this.annotationOldRead)+1; - var annotationCible = this.annotations[annotationCibleNumber]; - - if( annotationCibleNumberannotationTempo.begin/1000 && time"+IriSP.jQueryAnnotationTemplate+"
").appendTo("#Ldt-Annotations");
- // TOOLTIP BUG !
-
- IriSP.jQuery("#"+this.id).tooltip({ effect: 'slide'});
-
-
- IriSP.jQuery("#"+this.id).fadeTo(0,0.3);
- IriSP.jQuery("#"+this.id).mouseover(function() {
- IriSP.jQuery("#"+this.id).animate({opacity: 0.6}, 5);
- }).mouseout(function(){
- IriSP.jQuery("#"+this.id).animate({opacity: 0.3}, 5);
- });
- IriSP.trace("__IriSP.Annotation.prototype.draw","ADD ANOTATION : "+this.begin+" "+this.end+" "+IriSP.stripHtml(this.title)+" | "+startPourcent+" | "+endPourcent+" | duration = "+this.duration);
-
-};
-
-__IriSP.Annotation.prototype.drawTags = function(){
- /* FIXME : to implement */
- var KeywordPattern = ' '+' ';
-
- //__IriSP.trace(" !? Tags : ",this.tags);
-
- if (this.tags!=undefined){
- for (var i = 0; i < this.tags.length; ++i){
-
- //this.htmlTags += ' '+MyTags.getTitle(this.tags[i]['id-ref'])+' '+" , ";
- this.htmlTags += ' '+IriSP.MyTags.getTitle(this.tags[i]['id-ref'])+' '+" , ";
-
- }
- }
-};
-
-__IriSP.Annotation.prototype.tootTipAnnotation = function() {
- // 1 chercher le div correspondant
- // 2 y mettre les information
- return this.color + ' ' + this.type + ' apple';
-};
-
-__IriSP.Annotation.prototype.onRollOverAnnotation = function (){
- this.tootTip();
-};
-
-__IriSP.Annotation.prototype.timeToPourcent = function(time,timetotal){
- return (parseInt(Math.round(time/timetotal*100)));
-};
-
-
-/* CLASS Tags */
-
-__IriSP.Tags = function(object){
- this.myTags = object;
- this.htmlTags = null;
- this.weigthMax = 0;
- //this.mySegments = new array();
-};
-
-__IriSP.Tags.prototype.addAnnotation = function (annotation){
- for (var i = 0; i < this.myTags.length; ++i){
- this.myTags[i].mySegments = new Array();
- if (annotation.tags!=null){
- for (var j = 0; j < annotation.tags.length; ++j){
- if (this.myTags[i]['id'] == annotation.tags[j]['id-ref']){
- this.myTags[i].mySegments.push([annotation.begin,annotation.end,annotation.id]);
- var weigthTempo = this.myTags[i].mySegments.length;
- var tempo = this.myTags[i].mySegments[weigthTempo-1];
- //__IriSP.trace ("__IriSP.Tags.prototype.addAnnotation "," "+this.myTags[i]['meta']['dc:title']+" "+this.myTags[i]['id']+" : "+tempo[0]+" - "+tempo[1]);
-
- if (this.weigthMax < weigthTempo ){
- this.weigthMax = weigthTempo;
- }
- }
- }
- }
- }
-};
-
-__IriSP.Tags.prototype.getTitle = function (id){
- for (var i = 0; i < this.myTags.length; ++i){
- if(this.myTags[i]['id']==id){
- return(this.myTags[i]['meta']['dc:title']);
- }
- }
-
-};
-
-__IriSP.Tags.prototype.draw = function (){
-
- IriSP.trace("__IriSP.Tags.prototype.draw"," !!! WELL START " );
- for (var i = 0; i < this.myTags.length; ++i){
- IriSP.trace("__IriSP.Tags.prototype.draw"," ADD Tags : "+this.myTags[i]['id']);
- if(this.myTags[i]['id']!=null){
- this.htmlTags += ' '+this.myTags[i]['meta']['dc:title']+' '+' , ';
- }
- }
-
- IriSP.jQuery('#Ldt-Tags').html(this.htmlTags);
- IriSP.trace("__IriSP.Tags.prototype.draw"," !!!! END WMAX= "+this.weigthMax );
-
-};
-
-__IriSP.Tags.prototype.show = function (id){
-
- var timeStartOffsetA = 100000000000000000000;
- var timeStartOffsetB = 100000000000000000000;
- var timeEndOffsetA = 0;
- var timeEndOffsetB = 0;
- var timeStartID;
- var timeEndID;
- var WidthPourCent;
- var leftPourCent;
- var timeStartOffset;
-
- // case 1 : seul segment
- // case 2 : 2 ou X segments
-
-
- for (var i = 0; i < this.myTags.length; ++i){
- if (this.myTags[i]['id']==id){
- IriSP.trace("######### TAG DRAWing : "," END" );
-
- for (var j = 0; j < this.myTags[i].mySegments.length; ++j){
- if(timeStartOffset> this.myTags[i].mySegments[j][0]){
- timeStartOffsetA = this.myTags[i].mySegments[j][0];
- timeStartOffsetB = this.myTags[i].mySegments[j][1];
- timeStartID = this.myTags[i].mySegments[j][2]
- }
- if(timeStartOffset> this.myTags[i].mySegments[j][0]){
- timeEndOffsetA = this.myTags[i].mySegments[j][0];
- timeEndOffsetB = this.myTags[i].mySegments[j][1];
- timeEndID = this.myTags[i].mySegments[j][2]
- }
- }
-
- }
- }
-
- // -------------------------------------------------
- //
- // -------------------------------------------------
-
- leftPourCent = IriSP.timeToPourcent((timeStartOffsetA*1+(timeStartOffsetB-timeStartOffsetA)/2),IriSP.MyLdt.duration);
- WidthPourCent = IriSP.timeToPourcent((timeEndOffsetA*1+(timeEndOffsetB-timeEndOffsetA)/2),IriSP.MyLdt.duration)-leftPourCent;
- //WidthPourCent = timeToPourcent((timeEndOffsetA*1+(timeEndOffsetB-timeEndOffsetA)/2),MyLdt.duration)-startPourcent;
- IriSP.jQuery("#Ldt-Show-Tags").css('left',leftPourCent+'%');
- IriSP.jQuery("#Ldt-Show-Tags").css('width',WidthPourCent+'%');
- IriSP.jQuery("#Ldt-Show-Tags").text('joijoij');
- // like arrow script
-
-
-
-};
-
diff -r 7b55777486c3 -r 75ba66457232 src/js/data.js
--- a/src/js/data.js Tue Oct 04 11:16:06 2011 +0200
+++ b/src/js/data.js Fri Apr 06 16:55:34 2012 +0200
@@ -1,86 +1,111 @@
/* data.js - this file deals with how the players gets and sends data */
-IriSP.getMetadata = function() {
-
- IriSP.jQuery.ajax({
- dataType: IriSP.config.metadata.load,
- url:IriSP.config.metadata.src,
- success : function( json ){
-
- IriSP.trace( "ajax", "success" );
-
- // START PARSING -----------------------
- if( json === "" ){
- alert( "Json load error" );
- } else {
- // # CREATE MEDIA //
- // # JUSTE ONE PLAYER FOR THE MOMENT //
- //__IriSP.jQuery("").appendTo("#output");
- var MyMedia = new __IriSP.Media(
- json.medias[0].id,
- json.medias[0].href,
- json.medias[0]['meta']['dc:duration'],
- json.medias[0]['dc:title'],
- json.medias[0]['dc:description']);
-
- IriSP.trace( "__IriSP.MyApiPlayer",
- IriSP.config.gui.width+" "
- + IriSP.config.gui.height + " "
- + json.medias[0].href + " "
- + json.medias[0]['meta']['dc:duration'] + " "
- + json.medias[0]['meta']['item']['value']);
-
- // Create APIplayer
- IriSP.MyApiPlayer = new __IriSP.APIplayer (
- IriSP.config.gui.width,
- IriSP.config.gui.height,
- json.medias[0].href,
- json.medias[0]['meta']['dc:duration'],
- json.medias[0]['meta']['item']['value']);
-
- // # CREATE THE FIRST LINE //
- IriSP.trace( "__IriSP.init.main","__IriSP.Ligne" );
- IriSP.MyLdt = new __IriSP.Ligne(
- json['annotation-types'][0].id,
- json['annotation-types'][0]['dc:title'],
- json['annotation-types'][0]['dc:description'],
- json.medias[0]['meta']['dc:duration']);
-
- // CREATE THE TAG CLOUD //
- IriSP.trace( "__IriSP.init.main","__IriSP.Tags" );
- IriSP.MyTags = new __IriSP.Tags( json.tags );
-
- // CREATE THE ANNOTATIONS //
- // JUSTE FOR THE FIRST TYPE //
- /* FIXME: make it support more than one ligne de temps */
- IriSP.jQuery.each( json.annotations, function(i,item) {
- if (item.meta['id-ref'] == IriSP.MyLdt.id) {
- //__IriSP.trace("__IriSP.init.main","__IriSP.MyLdt.addAnnotation");
- IriSP.MyLdt.addAnnotation(
- item.id,
- item.begin,
- item.end,
- item.media,
- item.content.title,
- item.content.description,
- item.content.color,
- item.tags);
- }
- //MyTags.addAnnotation(item);
- } );
- IriSP.jQuery.each( json.lists, function(i,item) {
- IriSP.trace("lists","");
- } );
- IriSP.jQuery.each( json.views, function(i,item) {
- IriSP.trace("views","");
- } );
- }
- // END PARSING ----------------------- //
-
-
- }, error : function(data){
- alert("ERROR : "+data);
- }
- });
+IriSP.DataLoader = function() {
+ this._cache = {};
+
+ /*
+ A structure to hold callbacks for specific urls. We need it because
+ ajax calls are asynchronous, so it means that sometimes we ask
+ multiple times for a ressource because the first call hasn't been
+ received yet.
+ */
+ this._callbacks = {};
+};
+
+IriSP.DataLoader.prototype.get = function(url, callback, force_reload) {
+ var base_url = url.split("&")[0];
+ if (typeof force_reload != "undefined" && force_reload && this._cache.hasOwnProperty(base_url)) {
+ delete this._cache[base_url]
+ }
+ if (this._cache.hasOwnProperty(base_url)) {
+ callback(this._cache[base_url]);
+ } else {
+ if (!this._callbacks.hasOwnProperty(base_url)) {
+ this._callbacks[base_url] = [callback];
+ /* we need a closure because this gets lost when it's called back */
+
+ // uncomment you don't want to use caching.
+ // IriSP.jQuery.get(url, callback);
+
+ var func = function(data) {
+ this._cache[base_url] = data;
+ var i = 0;
+
+ for (i = 0; i < this._callbacks[base_url].length; i++) {
+ this._callbacks[base_url][i](this._cache[base_url]);
+ }
+ delete this._callbacks[base_url];
+ };
+
+ /* automagically choose between json and jsonp */
+ if (url.indexOf(document.location.hostname) === -1 &&
+ url.indexOf("http://") !== -1 /* not a relative url */ ) {
+ // we contacting a foreign domain, use JSONP
+
+ IriSP.jQuery.get(url, {}, IriSP.wrap(this, func), "jsonp");
+ } else {
-}
\ No newline at end of file
+ // otherwise, hey, whatever rows your boat
+ IriSP.jQuery.get(url, IriSP.wrap(this, func));
+ }
+
+ } else {
+ /* simply push the callback - it'll get called when the ressource
+ has been received */
+
+ this._callbacks[base_url].push(callback);
+
+ }
+ }
+}
+
+/* the base abstract "class" */
+IriSP.Serializer = function(DataLoader, url) {
+ this._DataLoader = DataLoader;
+ this._url = url;
+ this._data = [];
+};
+
+IriSP.Serializer.prototype.serialize = function(data) { };
+IriSP.Serializer.prototype.deserialize = function(data) {};
+
+IriSP.Serializer.prototype.currentMedia = function() {
+};
+
+IriSP.Serializer.prototype.getDuration = function() {
+};
+
+IriSP.Serializer.prototype.sync = function(callback) {
+ this._DataLoader.get(this._url, callback, force_refresh);
+};
+
+IriSP.SerializerFactory = function(DataLoader) {
+ this._dataloader = DataLoader;
+};
+
+IriSP.SerializerFactory.prototype.getSerializer = function(metadataOptions) {
+ /* This function returns serializer set-up with the correct
+ configuration - takes a metadata struct describing the metadata source
+ */
+
+ if (metadataOptions === undefined)
+ /* return an empty serializer */
+ return IriSP.Serializer("", "");
+
+ switch(metadataOptions.type) {
+ case "json":
+ return new IriSP.JSONSerializer(this._dataloader, metadataOptions.src);
+ break;
+
+ case "dummy": /* only used for unit testing - not defined in production */
+ return new IriSP.MockSerializer(this._dataloader, metadataOptions.src);
+ break;
+
+ case "empty":
+ return new IriSP.Serializer("", "empty");
+ break;
+
+ default:
+ return undefined;
+ }
+};
diff -r 7b55777486c3 -r 75ba66457232 src/js/defaults.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/js/defaults.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,140 @@
+IriSP.language = 'en';
+
+IriSP.libFiles = {
+ defaultDir : "js/libs/",
+ inDefaultDir : {
+ jQuery : "jquery.min.js",
+ jQueryUI : "jquery-ui.min.js",
+ jQueryToolTip : "jquery.tools.min.js",
+ swfObject : "swfobject.js",
+ cssjQueryUI : "jquery-ui.css",
+ popcorn : "popcorn.js",
+ jwplayer : "jwplayer.js",
+ raphael : "raphael.js",
+ "popcorn.mediafragment" : "popcorn.mediafragment.js",
+ "popcorn.code" : "popcorn.code.js",
+ "popcorn.jwplayer" : "popcorn.jwplayer.js",
+ "popcorn.youtube" : "popcorn.youtube.js",
+ "tracemanager" : "tracemanager.js"
+ },
+ locations : {
+ // use to define locations outside defautl_dir
+ },
+ cdn : {
+ jQueryUI : "http://ajax.googleapis.com/ajax/libs/jqueryui/1.8.17/jquery-ui.js",
+ jQueryToolTip : "http://cdn.jquerytools.org/1.2.4/all/jquery.tools.min.js",
+ swfObject : "http://ajax.googleapis.com/ajax/libs/swfobject/2.2/swfobject.js",
+ cssjQueryUI : "http://ajax.googleapis.com/ajax/libs/jqueryui/1.8.4/themes/base/jquery-ui.css"
+ },
+ useCdn : false
+}
+
+IriSP.widgetsDefaults = {
+ "LayoutManager" : {
+ spacer_div_height : 0
+ },
+ "PlayerWidget" : {
+
+ },
+ "AnnotationsWidget" : {
+ "share_text" : "I'm watching "
+ },
+ "TweetsWidget" : {
+ default_profile_picture : "https://si0.twimg.com/sticky/default_profile_images/default_profile_1_normal.png",
+ tweet_display_period : 10000 // how long do we show a tweet ?
+ },
+ "SliderWidget" : {
+ minimize_period : 850 // how long does the slider stays maximized after the user leaves the zone ?
+ },
+ "SegmentsWidget" : {
+ cinecast_version : false
+ },
+ "createAnnotationWidget" : {
+ tags : [
+ {
+ "id" : "digitalstudies",
+ "meta" : {
+ "description" : "#digital-studies"
+ }
+ },
+ {
+ "id" : "amateur",
+ "meta" : {
+ "description" : "#amateur"
+ },
+ }
+ ],
+ remote_tags : false,
+ random_tags : false,
+ show_from_field : false,
+ polemic_mode : true, /* enable polemics ? */
+ polemics : [{
+ "className" : "positive",
+ "keyword" : "++"
+ }, {
+ "className" : "negative",
+ "keyword" : "--"
+ }, {
+ "className" : "reference",
+ "keyword" : "=="
+ }, {
+ "className" : "question",
+ "keyword" : "??"
+ }],
+ cinecast_version : false, /* put to false to enable the platform version, true for the festival cinecast one. */
+
+ /* where does the widget PUT the annotations - this is a mustache template. id refers to the id of the media ans is filled
+ by the widget.
+ */
+ api_endpoint_template : "", // platform_url + "/ldtplatform/api/ldt/annotations/{{id}}.json",
+ api_method : "PUT"
+ },
+ "SparklineWidget" : {
+ lineColor : "#7492b4",
+ fillColor : "#aeaeb8",
+ lineWidth : 2
+ },
+ "AnnotationsListWidget" : {
+ ajax_mode : true, /* use ajax to get information about the annotations.
+ if set to false, only search in the annotations for the
+ current project. */
+ /* the platform generates some funky urls. We replace them afterwards to point to the
+ correct place - this setting will probably be overwritten by the platform
+ implementers.
+ Note that the player has to replace the variables between {{ and }} by its own values.
+ */
+ ajax_url : "", //platform_url + "/ldtplatform/api/ldt/segments/{{media}}/{{begin}}/{{end}}",
+ ajax_granularity : 10000, /* how much ms should we look before and after the current timecode */
+ default_thumbnail : "http://ldt.iri.centrepompidou.fr/static/site/ldt/css/imgs/video_sequence.png",
+ project_url : "", //platform_url + "/ldtplatform/ldt/front/player/"
+ /* the beginning of a link to the new front */
+ cinecast_version : false,
+ refresh_interval : 10000
+ },
+ "StackGraphWidget" : {
+ defaultcolor : "#585858",
+ tags : [
+ {
+ "keywords" : [ "++" ],
+ "description" : "positif",
+ "color" : "#1D973D"
+ },
+ {
+ "keywords" : [ "--" ],
+ "description" : "negatif",
+ "color" : "#CE0A15"
+ },
+ {
+ "keywords" : [ "==" ],
+ "description" : "reference",
+ "color" : "#C5A62D"
+ },
+ {
+ "keywords" : [ "??" ],
+ "description" : "question",
+ "color" : "#036AAE"
+ }
+ ],
+ streamgraph : false
+ }
+}
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 src/js/header.js
--- a/src/js/header.js Tue Oct 04 11:16:06 2011 +0200
+++ b/src/js/header.js Fri Apr 06 16:55:34 2012 +0200
@@ -1,7 +1,7 @@
/*
*
- * Copyright 2010 Institut de recherche et d'innovation
- * contributor(s) : Samuel Huron
+ * Copyright 2010-2012 Institut de recherche et d'innovation
+ * contributor(s) : Karim Hamidou, Samuel Huron, Raphael Velt, Thibaut Cavalie
*
* contact@iri.centrepompidou.fr
* http://www.iri.centrepompidou.fr
diff -r 7b55777486c3 -r 75ba66457232 src/js/i18n.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/js/i18n.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,70 @@
+IriSP.I18n = function() {
+ this.messages = {};
+ this.base_lang = 'en';
+}
+
+IriSP.I18n.prototype.getLanguage = function(lang) {
+ var _lang = (
+ typeof lang != "undefined"
+ ? lang
+ : (
+ typeof IriSP.language != "undefined"
+ ? IriSP.language
+ : this.base_lang
+ )
+ );
+ return (
+ typeof this.messages[_lang] == "object"
+ ? _lang
+ : (
+ typeof this.messages[this.base_lang] == "object"
+ ? this.base_lang
+ : null
+ )
+ )
+}
+
+IriSP.I18n.prototype.getMessages = function(lang) {
+ var _lang = this.getLanguage(lang);
+ return (
+ _lang != null
+ ? this.messages[_lang]
+ : {}
+ );
+}
+
+IriSP.I18n.prototype.getMessage = function(message, lang) {
+ var _msgs = this.getMessages(lang);
+ return (
+ typeof _msgs[message] != "undefined"
+ ? _msgs[message]
+ : message
+ )
+}
+
+IriSP.I18n.prototype.addMessage = function(lang, messagekey, messagevalue) {
+ if (typeof this.messages[lang] == "undefined") {
+ this.messages[lang] = {};
+ }
+ this.messages[lang][messagekey] = messagevalue;
+}
+
+IriSP.I18n.prototype.addMessages = function(messagesObj) {
+ var _this = this;
+ IriSP.underscore(messagesObj).each(function(_messages, _lang) {
+ IriSP.underscore(_messages).each(function(_value, _key) {
+ _this.addMessage(_lang, _key, _value);
+ })
+ });
+}
+
+IriSP.i18n = new IriSP.I18n();
+
+IriSP.i18n.addMessages({
+ "fr": {
+ "loading_wait": "Chargement en cours, veuillez patienter…"
+ },
+ "en": {
+ "loading_wait": "Loading, please wait…"
+ }
+})
diff -r 7b55777486c3 -r 75ba66457232 src/js/iframe_embed/embedder.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/js/iframe_embed/embedder.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,260 @@
+/* This piece of code is directly requested by the page the player is embedded
+ on. It creates the iframe the player is embedded in and it reflects changes
+ to the iframe url in the page url.
+*/
+
+IriSP = {};
+
+window.onhashchange = function() {
+ var url = window.location.href;
+ var frame = document.getElementById("metadataplayer_embed");
+
+ if ( url.split( "#" )[ 1 ] != null ) {
+ hashvalue = url.split("#")[1];
+ frame.contentWindow.postMessage({type: "hashchange", value: hashvalue}, "*");
+ }
+};
+
+
+IriSP.handleMessages = function(e) {
+ var history = window.history;
+
+ if ( !history.pushState ) {
+ return false;
+ }
+
+ if (e.data.type === "hashchange") {
+ console.log(e.data.value);
+ history.replaceState( {}, "", e.data.value);
+ }
+};
+
+// http://stackoverflow.com/questions/799981/document-ready-equivalent-without-jquery
+var ready = (function(){
+
+ var readyList,
+ DOMContentLoaded,
+ class2type = {};
+ class2type["[object Boolean]"] = "boolean";
+ class2type["[object Number]"] = "number";
+ class2type["[object String]"] = "string";
+ class2type["[object Function]"] = "function";
+ class2type["[object Array]"] = "array";
+ class2type["[object Date]"] = "date";
+ class2type["[object RegExp]"] = "regexp";
+ class2type["[object Object]"] = "object";
+
+ var ReadyObj = {
+ // Is the DOM ready to be used? Set to true once it occurs.
+ isReady: false,
+ // A counter to track how many items to wait for before
+ // the ready event fires. See #6781
+ readyWait: 1,
+ // Hold (or release) the ready event
+ holdReady: function( hold ) {
+ if ( hold ) {
+ ReadyObj.readyWait++;
+ } else {
+ ReadyObj.ready( true );
+ }
+ },
+ // Handle when the DOM is ready
+ ready: function( wait ) {
+ // Either a released hold or an DOMready/load event and not yet ready
+ if ( (wait === true && !--ReadyObj.readyWait) || (wait !== true && !ReadyObj.isReady) ) {
+ // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+ if ( !document.body ) {
+ return setTimeout( ReadyObj.ready, 1 );
+ }
+
+ // Remember that the DOM is ready
+ ReadyObj.isReady = true;
+ // If a normal DOM Ready event fired, decrement, and wait if need be
+ if ( wait !== true && --ReadyObj.readyWait > 0 ) {
+ return;
+ }
+ // If there are functions bound, to execute
+ readyList.resolveWith( document, [ ReadyObj ] );
+
+ // Trigger any bound ready events
+ //if ( ReadyObj.fn.trigger ) {
+ // ReadyObj( document ).trigger( "ready" ).unbind( "ready" );
+ //}
+ }
+ },
+ bindReady: function() {
+ if ( readyList ) {
+ return;
+ }
+ readyList = ReadyObj._Deferred();
+
+ // Catch cases where $(document).ready() is called after the
+ // browser event has already occurred.
+ if ( document.readyState === "complete" ) {
+ // Handle it asynchronously to allow scripts the opportunity to delay ready
+ return setTimeout( ReadyObj.ready, 1 );
+ }
+
+ // Mozilla, Opera and webkit nightlies currently support this event
+ if ( document.addEventListener ) {
+ // Use the handy event callback
+ document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+ // A fallback to window.onload, that will always work
+ window.addEventListener( "load", ReadyObj.ready, false );
+
+ // If IE event model is used
+ } else if ( document.attachEvent ) {
+ // ensure firing before onload,
+ // maybe late but safe also for iframes
+ document.attachEvent( "onreadystatechange", DOMContentLoaded );
+
+ // A fallback to window.onload, that will always work
+ window.attachEvent( "onload", ReadyObj.ready );
+
+ // If IE and not a frame
+ // continually check to see if the document is ready
+ var toplevel = false;
+
+ try {
+ toplevel = window.frameElement == null;
+ } catch(e) {}
+
+ if ( document.documentElement.doScroll && toplevel ) {
+ doScrollCheck();
+ }
+ }
+ },
+ _Deferred: function() {
+ var // callbacks list
+ callbacks = [],
+ // stored [ context , args ]
+ fired,
+ // to avoid firing when already doing so
+ firing,
+ // flag to know if the deferred has been cancelled
+ cancelled,
+ // the deferred itself
+ deferred = {
+
+ // done( f1, f2, ...)
+ done: function() {
+ if ( !cancelled ) {
+ var args = arguments,
+ i,
+ length,
+ elem,
+ type,
+ _fired;
+ if ( fired ) {
+ _fired = fired;
+ fired = 0;
+ }
+ for ( i = 0, length = args.length; i < length; i++ ) {
+ elem = args[ i ];
+ type = ReadyObj.type( elem );
+ if ( type === "array" ) {
+ deferred.done.apply( deferred, elem );
+ } else if ( type === "function" ) {
+ callbacks.push( elem );
+ }
+ }
+ if ( _fired ) {
+ deferred.resolveWith( _fired[ 0 ], _fired[ 1 ] );
+ }
+ }
+ return this;
+ },
+
+ // resolve with given context and args
+ resolveWith: function( context, args ) {
+ if ( !cancelled && !fired && !firing ) {
+ // make sure args are available (#8421)
+ args = args || [];
+ firing = 1;
+ try {
+ while( callbacks[ 0 ] ) {
+ callbacks.shift().apply( context, args );//shifts a callback, and applies it to document
+ }
+ }
+ finally {
+ fired = [ context, args ];
+ firing = 0;
+ }
+ }
+ return this;
+ },
+
+ // resolve with this as context and given arguments
+ resolve: function() {
+ deferred.resolveWith( this, arguments );
+ return this;
+ },
+
+ // Has this deferred been resolved?
+ isResolved: function() {
+ return !!( firing || fired );
+ },
+
+ // Cancel
+ cancel: function() {
+ cancelled = 1;
+ callbacks = [];
+ return this;
+ }
+ };
+
+ return deferred;
+ },
+ type: function( obj ) {
+ return obj == null ?
+ String( obj ) :
+ class2type[ Object.prototype.toString.call(obj) ] || "object";
+ }
+ }
+ // The DOM ready check for Internet Explorer
+ function doScrollCheck() {
+ if ( ReadyObj.isReady ) {
+ return;
+ }
+
+ try {
+ // If IE is used, use the trick by Diego Perini
+ // http://javascript.nwbox.com/IEContentLoaded/
+ document.documentElement.doScroll("left");
+ } catch(e) {
+ setTimeout( doScrollCheck, 1 );
+ return;
+ }
+
+ // and execute any waiting functions
+ ReadyObj.ready();
+ }
+ // Cleanup functions for the document ready method
+ if ( document.addEventListener ) {
+ DOMContentLoaded = function() {
+ document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false );
+ ReadyObj.ready();
+ };
+
+ } else if ( document.attachEvent ) {
+ DOMContentLoaded = function() {
+ // Make sure body exists, at least, in case IE gets a little overzealous (ticket #5443).
+ if ( document.readyState === "complete" ) {
+ document.detachEvent( "onreadystatechange", DOMContentLoaded );
+ ReadyObj.ready();
+ }
+ };
+ }
+ function ready( fn ) {
+ // Attach the listeners
+ ReadyObj.bindReady();
+
+ var type = ReadyObj.type( fn );
+
+ // Add the callback
+ readyList.done( fn );//readyList is result of _Deferred()
+ }
+ return ready;
+})();
+
+ready(function() { window.addEventListener('message', IriSP.handleMessages, false); });
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 src/js/init.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/js/init.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,257 @@
+/* init.js - initialization and configuration of Popcorn and the widgets
+exemple json configuration:
+
+ */
+
+/**
+ set up the IriSP.__dataloader instance -
+ we need it because we have to get the metadata
+ about the video before that the widget have even
+ loaded.
+*/
+IriSP.setupDataLoader = function() {
+ /* we set it up separately because we need to
+ get data at the very beginning, for instance when
+ setting up the video */
+ IriSP.__dataloader = new IriSP.DataLoader();
+};
+
+/** do some magic to configure popcorn according to the options object passed.
+ Works for html5, jwplayer and youtube videos
+*/
+IriSP.configurePopcorn = function (layoutManager, options) {
+ var pop;
+ var ret = layoutManager.createDiv();
+ var containerDiv = ret[0];
+ var spacerDiv = ret[1];
+
+ /* insert one pixel of margin between the video and the first widget, using the
+ spacer.
+ */
+ IriSP.jQuery("#" + spacerDiv).css("height", "1px");
+
+ switch(options.type) {
+ /*
+ todo : dynamically create the div/video tag which
+ will contain the video.
+ */
+ case "html5":
+ var tmpId = Popcorn.guid("video");
+ IriSP.jQuery("#" + containerDiv).append("");
+
+ if (options.hasOwnProperty("width"))
+ IriSP.jQuery("#" + containerDiv).css("width", options.width);
+
+ if (options.hasOwnProperty("height"))
+ IriSP.jQuery("#" + containerDiv).css("height", options.height);
+
+ pop = Popcorn("#" + tmpId);
+ break;
+
+ case "jwplayer":
+ var opts = IriSP.jQuery.extend({}, options);
+ delete opts.container;
+ delete opts.type;
+
+
+ /* Try to guess options.file and options.streamer only if file and streamer
+ are not already defined in the configuration */
+ if (options.provider === "rtmp" && !opts.hasOwnProperty("file") && !opts.hasOwnProperty("streamer")) {
+ /* exit if we can't access the metadata */
+ if (typeof(IriSP.__jsonMetadata) === "undefined") {
+ break;
+ };
+
+ // the json format is totally illogical
+ //opts.streamer = IriSP.__jsonMetadata["medias"][0]["meta"]["item"]["value"];
+ //var source = IriSP.__jsonMetadata["medias"][0]["href"];
+
+ // the source if a full url but jwplayer wants an url relative to the
+ // streamer url, so we've got to remove the common part.
+ //opts.file = source.slice(opts.streamer.length);
+
+ /* sometimes we get served a file with a wrong path and streamer.
+ as a streamer is of the form rtmp://domain/path/ and the media is
+ the rest, we uglily do this :
+ */
+ opts.file = "";
+ opts.streamer = "";
+ var fullPath = IriSP.get_aliased(IriSP.__jsonMetadata["medias"][0], ["href","url"]);
+
+ if (fullPath === null) {
+ console.log("no url or href field defined in the metadata.");
+ }
+
+ var pathSplit = fullPath.split('/');
+
+ for (var i = 0; i < pathSplit.length; i++) {
+ if (i < 4) {
+ opts.streamer += pathSplit[i] + "/";
+ } else {
+ opts.file += pathSplit[i];
+ /* omit the last slash if we're on the last element */
+ if (i < pathSplit.length - 1)
+ opts.file += "/";
+ }
+ }
+ } else {
+ /* other providers type, video for instance -
+ pass everything as is */
+ }
+
+ if (!options.hasOwnProperty("flashplayer")) {
+ opts.flashplayer = IriSP.jwplayer_swf_path;
+ }
+
+ if (!options.hasOwnProperty("controlbar.position")) {
+ opts["controlbar.position"] = "none";
+ }
+
+ pop = new IriSP.PopcornReplacement.jwplayer("#" + containerDiv, opts);
+ break;
+
+ case "youtube":
+ var opts = IriSP.jQuery.extend({}, options);
+ delete opts.container;
+ opts.controls = 0;
+ opts.autostart = false;
+ templ = "width: {{width}}px; height: {{height}}px;";
+ var str = Mustache.to_html(templ, {width: opts.width, height: opts.height});
+ // Popcorn.youtube wants us to specify the size of the player in the style attribute of its container div.
+ IriSP.jQuery("#" + containerDiv).attr("style", str);
+
+ pop = Popcorn.youtube("#" + containerDiv, opts.video, opts);
+ break;
+
+ case "dailymotion":
+ pop = new IriSP.PopcornReplacement.dailymotion("#" + containerDiv, options);
+ break;
+
+ case "allocine":
+ /* pass the options as-is to the allocine player and let it handle everything */
+ pop = new IriSP.PopcornReplacement.allocine("#" + containerDiv, options);
+ break;
+
+ default:
+ pop = undefined;
+ };
+
+ return pop;
+};
+
+/** Configure the gui and instantiate the widgets passed as parameters
+ @param guiOptions the gui object as seen in the examples.
+ */
+IriSP.configureWidgets = function (popcornInstance, layoutManager, guiOptions) {
+
+ var serialFactory = new IriSP.SerializerFactory(IriSP.__dataloader);
+ var params = {width: guiOptions.width, height: guiOptions.height};
+
+ var default_options = guiOptions.default_options;
+ if (IriSP.null_or_undefined(default_options))
+ default_options = {};
+
+ var ret_widgets = [];
+ var index;
+
+ for (index = 0; index < guiOptions.widgets.length; index++) {
+ var widget = IriSP.instantiateWidget(popcornInstance, serialFactory, layoutManager, guiOptions.widgets[index], default_options);
+
+ ret_widgets.push(widget);
+ };
+
+ return ret_widgets;
+};
+
+/** configure modules. @see configureWidgets */
+IriSP.configureModules = function (popcornInstance, modulesList) {
+ if (IriSP.null_or_undefined(modulesList))
+ return;
+
+ var serialFactory = new IriSP.SerializerFactory(IriSP.__dataloader);
+ var ret_modules = [];
+ var index;
+
+ for (index = 0; index < modulesList.length; index++) {
+ var moduleConfig = modulesList[index];
+
+ var serializer = serialFactory.getSerializer(moduleConfig.metadata);
+ var module = new IriSP[moduleConfig.type](popcornInstance, moduleConfig, serializer);
+ ret_modules.push(module);
+ };
+
+ return ret_modules;
+};
+
+/** instantiate a widget - only called by configureWidgets, never by the user. Handles widget
+ dependencies.
+ @param popcornInstance popcorn instance the widget will user
+ @param serialFactory serializer factory to instantiate the widget with
+ @param layoutManager layout manager
+ @param widgetConfig configuration options for the widget
+ @param defaultOptions a dictionnary with some options defined for every widget.
+ */
+IriSP.instantiateWidget = function(popcornInstance, serialFactory, layoutManager, widgetConfig, defaultOptions) {
+
+ if (IriSP.null_or_undefined(defaultOptions))
+ defaultOptions = {};
+
+ widgetConfig = IriSP.underscore.defaults(widgetConfig, defaultOptions);
+
+ var arr = IriSP.jQuery.extend({}, widgetConfig);
+
+ /* create a div for those widgets who didn't already specify a container; */
+ if (!arr.hasOwnProperty("container")) {
+ /* create div returns us a container for the widget and a spacer */
+ var ret = layoutManager.createDiv(widgetConfig.type);
+ var container = ret[0];
+ var spacer = ret[1];
+ arr.container = container;
+ arr.spacer = spacer;
+ arr.layoutManager = layoutManager;
+ }
+ var serializer = serialFactory.getSerializer(widgetConfig.metadata);
+
+ if (typeof serializer == "undefined")
+ debugger;
+
+ // instantiate the object passed as a string
+ var widget = new IriSP[widgetConfig.type](popcornInstance, arr, serializer);
+
+ if (widgetConfig.hasOwnProperty("requires")) {
+ // also create the widgets this one depends on.
+ // the dependency widget is available in the parent widget context as
+ // this.WidgetName (for instance, this.TipWidget);
+
+ var i = 0;
+ for(i = 0; i < widgetConfig.requires.length; i++) {
+ var widgetName = widgetConfig.requires[i]["type"],
+ _configobj = IriSP.jQuery.extend({}, widgetConfig.requires[i]),
+ _div = document.createElement('div'),
+ _container = IriSP.guid(arr.container + '_' + widgetName + '_');
+ _configobj.container = _container;
+ _div.id = _container;
+ widget.selector.append(_div);
+ widget[widgetName] = IriSP.instantiateWidget(popcornInstance, serialFactory, layoutManager, _configobj, defaultOptions);
+ }
+ }
+
+ serializer.sync(IriSP.wrap(widget, function() { this.draw(); }));
+ return widget;
+};
+
+/** single point of entry for the metadataplayer */
+IriSP.initPlayer = function(config, metadata_url) {
+ document.getElementById(config.gui.container).innerHTML = IriSP.templToHTML(IriSP.loading_template, config.gui);
+ IriSP.loadLibs(config, metadata_url,
+ function() {
+
+ var layoutManager = new IriSP.LayoutManager(config.gui);
+
+ var pop = IriSP.configurePopcorn(layoutManager, config.player);
+
+ IriSP._widgets = IriSP.configureWidgets(pop, layoutManager, config.gui);
+ IriSP._modules = IriSP.configureModules(pop, config.modules);
+ IriSP.jQuery('#Ldt-loader').detach();
+ });
+};
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 src/js/layout.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/js/layout.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,77 @@
+/* layout.js - very basic layout management */
+
+/**
+ @class a layout manager manages a div and the layout of objects
+ inside it.
+*/
+IriSP.LayoutManager = function(options) {
+ this._Popcorn = null;
+ this._widgets = [];
+
+ this._div = "LdtPlayer";
+ this._width = 640;
+
+ if (options === undefined) {
+ options = {};
+ };
+
+ if (options.hasOwnProperty('container')) {
+ this._div = options.container;
+ }
+
+ if (options.hasOwnProperty('width')) {
+ this._width = options.width;
+ }
+
+ if (options.hasOwnProperty('height')) {
+ this._height = options.height;
+ }
+
+ /* this is a shortcut */
+ this.selector = IriSP.jQuery("#" + this._div);
+
+ this.selector.css({
+ "width": this._width,
+ "clear": "both"
+ });
+
+ if (this._height !== undefined)
+ this.selector.css("height", this._height);
+};
+
+/**
+ Set the popcorn instance used by the manager.
+
+ we need this special setter because of a chicken and egg problem :
+ we want the manager to use popcorn but the popcorn div will be managed
+ by the manager. So we need a way to set the instance the manager uses
+*/
+
+IriSP.LayoutManager.prototype.setPopcornInstance = function(popcorn) {
+ this._Popcorn = popcorn;
+}
+
+/** create a subdiv with an unique id, and a spacer div as well.
+ @param widgetName the name of the widget.
+ @return an array of the form [createdivId, spacerdivId].
+*/
+IriSP.LayoutManager.prototype.createDiv = function(widgetName) {
+ if (typeof(widgetName) === "undefined")
+ widgetName = "";
+
+ var newDiv = IriSP.guid(this._div + "_widget_" + widgetName + "_");
+ var spacerDiv = IriSP.guid("LdtPlayer_spacer_");
+ this._widgets.push([widgetName, newDiv]);
+
+ var divTempl = "' + h + ' ');
+ value.sort().forEach(function (item) {
+ if (item !== singularity) {
+ singularity = item;
+ output.push((comma_needed ? ', ' : '') + singularity);
+ comma_needed = true;
+ }
+ });
+ output.push('
');
+ } else if (value) {
+ output.push('' + h + ' ' + value + '
');
+ }
+ }
+
+ if (data.errors || data.unused || data['undefined']) {
+ err = true;
+ output.push('Error:');
+ if (data.errors) {
+ for (i = 0; i < data.errors.length; i += 1) {
+ warning = data.errors[i];
+ if (warning) {
+ evidence = warning.evidence || '';
+ output.push('
');
+ }
+
+ if (!errors_only) {
+
+ output.push('Problem' + (isFinite(warning.line) + ? ' at line ' + String(warning.line) + + ' character ' + String(warning.character) + : '') + + ': ' + warning.reason.entityify() + + '
' + + (evidence && (evidence.length > 80 + ? evidence.slice(0, 77) + '...' + : evidence).entityify()) + '
'); + } + } + } + + if (data['undefined']) { + snippets = []; + for (i = 0; i < data['undefined'].length; i += 1) { + snippets[i] = '' + data['undefined'][i].name + ' ' +
+ String(data['undefined'][i].line) + ' ' +
+ data['undefined'][i]['function'] + '';
+ }
+ output.push('Undefined variable: ' + snippets.join(', ') + '
'); + } + if (data.unused) { + snippets = []; + for (i = 0; i < data.unused.length; i += 1) { + snippets[i] = '' + data.unused[i].name + ' ' +
+ String(data.unused[i].line) + ' ' +
+ data.unused[i]['function'] + '';
+ }
+ output.push('Unused variable: ' + snippets.join(', ') + '
'); + } + if (data.json) { + output.push('JSON: bad.
'); + } + output.push('');
+
+ if (data.urls) {
+ detail("URLs
", data.urls, '
'); + } + + if (xmode === 'style') { + output.push('
');
+ }
+ }
+ return output.join('');
+ };
+ itself.jslint = itself;
+
+ itself.edition = '2011-10-17';
+
+ return itself;
+
+}());
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 sbin/res/rhino.jar
Binary file sbin/res/rhino.jar has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/LdtPlayer.css
--- a/src/css/LdtPlayer.css Tue Oct 04 11:16:06 2011 +0200
+++ b/src/css/LdtPlayer.css Fri Apr 06 16:55:34 2012 +0200
@@ -1,166 +1,968 @@
- #demo-frame > div.demo { padding: 5px !important; };
-
- button.ui-button-icon-only {
- height:1.5em;
- width:1.5em;
- }
-
- #Ldt-loader {
- background:url(imgs/loader.gif) no-repeat;
- width:20px;
- height:16px;
- float:left;
- }
-
- #Ldt-controler {
- font-size: 62.5%;
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- background-color:#eeeeee;
- height:35px;
- padding:5px;
- }
-
- .Ldt-iri-chapter{
- padding-top:10px;
- padding-bottom:5px;
- border-left:solid 1px #000;
- border-right:solid 1px #000;
- }
-
- .tooltip {
- display:none;
- background:transparent url(imgs/white_arrow_mini.png);
- font-size:12px;
- height:55px;
- width:180px;
- padding:10px;
- padding-left:15px;
- padding-top:15px;
- padding-right:15px;
- color:#000;
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- }
- #Ldt-Root{
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- }
- #Ldt-Hat{
- height:3px;
- }
- #Ldt-Annotations{
- padding-left:5px;
- width:470px;
- float:left;
- font-size: 62.5%;
- }
- #Ldt-SaTitle{
- padding-top:2px;
- padding-bottom:5px;
- font-size:18px;
- height:22p;
- }
- #Ldt-SaDescription{
- font-size:12px;
- }
- #Ldt-Show-Arrow-container{
- margin-left:60px;
- }
- #Ldt-Show-Arrow{
- position:relative;
- background:url(imgs/grey_arrow_Show.png);
- width:27px;
- height:13px;
- margin-top:12px;
- margin-left:-10px;
- z-index:999;
- }
-
- #Ldt-Show-Tags{
- position:relative;
- height:13px;
- margin-top:-10px;
- border: solid 1px #000;
- }
- #Ldt-ShowAnnotation-video{
- position:absolute;
- z-index: 999;
- padding:5px;
- background:url(imgs/transBlack.png);
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- color:#FFF;
- }
- #Ldt-ShowAnnotation-audio{
- position:relative;
- padding:5px;
- background-color:#cfcfcf;
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- color:#4D4D4D;
- }
- #Ldt-SaKeyword{
- background-color:#b9b9b9;
- color:#4D4D4D;
- padding:5px;
- font-weight:bold;
- text-align:left;
- float:left;
- font-size:10px;
- }
- #Ldt-SaShareTools{
- text-align:right;
- float:right;
- }
-
-
- #Ldt-PlaceHolder{
- position:absolue;
- float:none;
- }
-
- .Ldt-mode-radio{
- visibility:hidden;
- height:0px;
- display:none
- }
-
- .Ldt-Control1{
- width:60px;
- float:left;
- }
- .Ldt-Control2{
- padding-left:10px;
- width:60px;
- float:left;
- }
- .Ldt-cleaner {
- clear:both;
- }
- .share {
- background:url('imgs/widget20.png') no-repeat scroll 0 0 transparent ;
- display:block;
- height:16px;
- line-height:16px !important;
- overflow:hidden;
- width:16px;
- float:left;
- cursor:pointer;
- margin:2px;
- }
- .shareFacebook{
- background-position:0 -704px;
- }
- .shareMySpace{
- background-position:0 -736px;
- }
- .shareTwitter{
- background-position:0 -1072px;
- }
- .shareGoogle{
- background-position:0 -752px;
- }
- .shareDelicious{
- background-position:0 -672px;
- }
- .shareJamesPot{
- background-position:0 -1808px;
- }
-
-
\ No newline at end of file
+/* Some general styling classes */
+
+.Ldt-floatClear {
+ display: block; width: 100%; height: 0; clear: both;
+}
+
+ul.Ldt-floatList {
+ padding: 0; margin: 0; list-style: none;
+}
+
+.Ldt-floatList li {
+ float: left;
+}
+
+
+/* */
+
+#demo-frame > div.demo { padding: 5px !important; };
+
+button.ui-button-icon-only {
+ height:1.5em;
+ width:1.5em;
+}
+
+#Ldt-loader {
+ background:url(imgs/loader.gif) center no-repeat;
+ text-indent: -9999px;
+ position: absolute;
+}
+
+/* general class for all buttons */
+.Ldt-button {
+
+}
+
+.Ldt-SegmentsWidget {
+ /* overflow: auto; /* clear the floats */
+ margin-top: 1px;
+ padding-bottom: 8px; /* FIXME: only a temporary fix. This should be put into the layout manager. */
+}
+
+.Ldt-iri-chapter {
+ position: absolute;
+ height: 10px;
+ border-right: 1px solid white;
+}
+
+.Ldt-SegmentPositionMarker {
+ position: absolute;
+ z-index: 100;
+ width: 1px;
+ height: 10px;
+ background-color: white;
+}
+.tooltip {
+ display:none;
+ background:transparent url(imgs/white_arrow_mini.png);
+ font-size:12px;
+ height:55px;
+ width:180px;
+ padding:10px;
+ padding-left:15px;
+ padding-top:15px;
+ padding-right:15px;
+ color:#000;
+ font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
+}
+#Ldt-Root{
+ font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
+}
+#Ldt-Hat{
+ height:3px;
+}
+
+.Ldt-AnnotationsWidget {
+ font-size: 12px;
+ font-family: "Arial", "Verdana", "sans-serif";
+ background-color:#eeeeee;
+ background:url('imgs/wire_pattern.png') repeat scroll transparent ;
+ border: 1px solid #b6b8b8;
+}
+
+.Ldt-Annotation-DoubleBorder {
+ border: 1px solid white;
+ overflow: auto;
+}
+
+.Ldt-AnnotationContent {
+ padding:5px;
+ padding-left: 12px;
+
+}
+
+.Ldt-fbShare {
+ display: block;
+ float: left;
+ width: 24px;
+ height: 24px;
+ background:url('imgs/facebook.png');
+}
+
+.Ldt-TwShare {
+ display: block;
+ float: left;
+ width: 24px;
+ height: 24px;
+ background:url('imgs/twitter.png');
+}
+
+.Ldt-GplusShare {
+ display: block;
+ float: left;
+ width: 24px;
+ height: 24px;
+ background:url('imgs/google.png');
+}
+
+.Ldt-SaTitle{
+ padding-top:2px;
+ padding-bottom:3px;
+ font-size: 12pt;
+ color : #0068c4;
+}
+
+.Ldt-SaDescription{
+ font-size:12px;
+}
+
+.Ldt-SaKeywords {
+ font-weight:bold;
+ font-size:10px;
+}
+
+.Ldt-AnnotationShareIcons {
+ float:right;
+ position: relative;
+}
+
+
+#Ldt-PlaceHolder{
+ position:absolue;
+ float:none;
+}
+
+.Ldt-Segments{
+ float:left;
+ font-size: 62.5%;
+}
+
+.Ldt-mode-radio{
+ visibility:hidden;
+ height:0px;
+ display:none
+}
+
+/* player */
+.Ldt-controler {
+ font-size: 10px;
+ font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
+ background:url('imgs/player_gradient.png') repeat-x transparent ;
+ height: 25px;
+ border: 1px solid #b6b8b8;
+ position: relative;
+}
+
+
+.Ldt-LeftPlayerControls {
+ float:left;
+}
+
+.Ldt-RightPlayerControls {
+ float: right;
+}
+
+.Ldt-Ctrl-button {
+ float: left;
+ width: 30px; height: 25px;
+ background: url('imgs/player-sprites.png');
+ cursor: pointer;
+}
+
+.Ldt-Ctrl-spacer {
+ float: left; width: 1px; height: 25px; background: #b6b8b8;
+}
+
+.Ldt-CtrlPlay {
+ margin: 0 15px;
+}
+
+.Ldt-CtrlPlay-PlayState {
+ background-position: 0 0;
+}
+
+.Ldt-CtrlPlay-PlayState:hover {
+ background-position: 0 -25px;
+}
+
+.Ldt-CtrlPlay-PlayState:active {
+ background-position: 0 -50px;
+}
+
+.Ldt-CtrlPlay-PauseState {
+ background-position: -30px 0;
+}
+
+.Ldt-CtrlPlay-PauseState:hover {
+ background-position: -30px -25px;
+}
+
+.Ldt-CtrlPlay-PauseState:active {
+ background-position: -30px -50px;
+}
+
+
+.Ldt-CtrlAnnotate {
+ margin: 0 2px;
+ background-position: -60px 0;
+}
+
+.Ldt-CtrlAnnotate:hover {
+ background-position: -60px -25px;
+}
+
+.Ldt-CtrlAnnotate:active {
+ background-position: -60px -50px;
+}
+
+.Ldt-CtrlSearch {
+ margin: 0 2px;
+ background-position: -90px 0;
+}
+
+.Ldt-CtrlSearch:hover {
+ background-position: -90px -25px;
+}
+
+.Ldt-CtrlSearch:active {
+ background-position: -90px -50px;
+}
+
+.LdtSearch {
+ display: none;
+ width: 165px;
+ height: 25px;
+ border: 1px;
+ border-color: #CFCFCF;
+ float: left;
+ text-align: center;
+}
+
+.Ldt-Time {
+ float: left;
+ margin: 5px;
+ font-size: 12px;
+ font-family: Arial, Verdana, sans-serif;
+}
+
+.Ldt-ElapsedTime {
+ float: left;
+ color: #4a4a4a;
+}
+
+.Ldt-TimeSeparator {
+ margin: 0 4px;
+ float: left;
+}
+
+.Ldt-TotalTime {
+ float: left;
+ color: #b2b2b2;
+}
+
+.Ldt-CtrlSound {
+ margin: 0 2px;
+}
+
+.Ldt-CtrlSound-Full {
+ background-position: -120px 0;
+}
+
+.Ldt-CtrlSound-Full:hover {
+ background-position: -120px -25px;
+}
+
+.Ldt-CtrlSound-Full:active {
+ background-position: -120px -50px;
+}
+
+.Ldt-CtrlSound-Mute {
+ background-position: -150px 0;
+}
+
+.Ldt-CtrlSound-Mute:hover {
+ background-position: -150px -25px;
+}
+
+.Ldt-CtrlSound-Mute:active {
+ background-position: -150px -50px;
+}
+
+.Ldt-CtrlSound-Half {
+ background-position: -180px 0;
+}
+
+.Ldt-CtrlSound-Half:hover {
+ background-position: -180px -25px;
+}
+
+.Ldt-CtrlSound-Half:active {
+ background-position: -180px -50px;
+}
+
+.Ldt-Ctrl-Volume-Control {
+ display: none;
+ position: absolute;
+ background:url('imgs/player_gradient.png') repeat-x transparent ;
+ height: 25px;
+ width: 100px; top: 25px; right: -1px; z-index: 100;
+ padding: 0 2px;
+ border: 1px solid #b6b8b8;
+}
+
+.Ldt-Ctrl-Volume-Bar {
+ height: 5px; margin: 9px 3px 0; background: #cccccc; border: 1px solid #999999; border-radius: 2px;
+}
+
+.Ldt-Ctrl-Volume-Cursor {
+ position: absolute; top: 2px; width: 6px; height: 19px; background: #a8a8a8; border: 1px solid #999999; border-radius: 2px;
+ cursor: pointer;
+}
+
+.Ldt-Ctrl-Volume-Control:hover .Ldt-Ctrl-Volume-Cursor {
+ background: #F7268E;
+}
+
+.Ldt-cleaner {
+ clear:both;
+}
+
+/* Arrow Widget */
+.Ldt-arrowWidget {
+ position: relative;
+
+ height:16px;
+ width:27px;
+ margin-bottom: -3px;
+ z-index: 4;
+ left: 0%;
+}
+
+.Ldt-arrowLeftEdge {
+ background:url('imgs/left_edge_arrow.png') no-repeat scroll 0 0 transparent ;
+}
+
+.Ldt-arrowCenter {
+ background:url('imgs/arrow.png') no-repeat scroll 0 0 transparent ;
+}
+
+.Ldt-arrowRightEdge {
+ background:url('imgs/right_edge_arrow.png') no-repeat scroll 0 0 transparent ;
+}
+
+.cleaner {
+ clear:both;
+}
+
+.share {
+ background:url('imgs/widget20.png') no-repeat scroll 0 0 transparent ;
+ display:block;
+ height:16px;
+ line-height:16px !important;
+ overflow:hidden;
+ width:16px;
+ float:left;
+ cursor:pointer;
+ margin:2px;
+}
+.shareFacebook{
+ background-position:0 -704px;
+}
+.shareMySpace{
+ background-position:0 -736px;
+}
+.shareTwitter{
+ background-position:0 -1072px;
+}
+.shareGoogle{
+ background-position:0 -752px;
+}
+.shareDelicious{
+ background-position:0 -672px;
+}
+.shareJamesPot{
+ background-position:0 -1808px;
+}
+
+.tip{
+ position: absolute;
+ padding : 3px;
+ z-index: 10000000000;
+ max-width: 200px;
+ background: transparent url("imgs/white_arrow_long.png");
+ font-size: 12px;
+ height: 115px;
+ width: 180px;
+ padding: 15px 15px 20px;
+ color: black;
+ font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
+ overflow:hidden;
+}
+
+.tipcolor {
+ float: left; margin: 2px 4px 2px 0;
+}
+
+.tip img {
+ max-width: 140px; max-height: 70px; margin: 0 20px;
+}
+
+/* slider */
+.Ldt-SliderMinimized {
+ height: 6px;
+}
+
+.Ldt-SliderMaximized {
+ height: 11px;
+}
+
+.Ldt-sliderElementMinimized {
+ width: 100%;
+ height: 5px;
+}
+
+.Ldt-sliderElementMaximized {
+ width: 100%;
+ height: 10px;
+}
+
+.Ldt-sliderBackground {
+ background-color: #B6B8B8;
+ position: absolute;
+ z-index: 2;
+ bottom: 1px;
+ width: 100%;
+ height: 5px;
+
+}
+
+.Ldt-sliderForeground {
+ background-color: #747474;
+ z-index: 2;
+ width: 0px;
+ position: absolute;
+ bottom: 1px;
+ height: 5px;
+}
+
+.Ldt-sliderPositionMarker {
+ position: absolute;
+ z-index: 100;
+ background-color: #f7268e;
+ height: 5px;
+ width: 5px;
+ bottom: 1px;
+ border-left: 1px solid white;
+ border-right: 1px solid white;
+}
+
+/* tweet Widget */
+.Ldt-tweetWidget {
+ font-size: 12px;
+ font-family: "Arial", "Verdana", "sans-serif";
+ background:url('imgs/wire_pattern.png') repeat scroll transparent ;
+ border: 1px solid #b6b8b8;
+ border-top: none;
+ overflow: auto;
+}
+
+.Ldt-tweet-DoubleBorder {
+ border: 1px solid white;
+ padding: 5px;
+ overflow: auto;
+}
+
+.Ldt-tweetAvatar {
+ float: left;
+}
+
+.Ldt-tweetAvatar-profileArrow {
+ float: left;
+ height: 48px;
+ margin-left: 5px;
+ margin-right: 5px;
+ background:url('imgs/profile_arrow.png');
+ background-position: 7 10px;
+}
+
+.Ldt-tweet_userHandle {
+ float: left;
+ color: #5c8df1;
+}
+
+.Ldt-tweet_realName {
+ float: left;
+ margin-left: 3px;
+}
+
+.Ldt-tweetContents {
+}
+
+.Ldt-tweet_date {
+ float: left;
+}
+
+.Ldt-tweetWidgetKeepOpen {
+ position: relative;
+ float: right;
+ height: 17px;
+ width: 17px;
+ margin-right: 1px;
+ background:url('imgs/minimize.png');
+}
+
+.Ldt-tweetWidgetMinimize {
+ position: relative;
+ float: right;
+ height: 17px;
+ width: 17px;
+ right: 9px;
+ background:url('imgs/minimize.png');
+}
+
+.Ldt-tweetWidget * a:link {
+ color: #729efa;
+
+}
+
+.Ldt-TweetReply {
+ float: left;
+ margin-left: 16px;
+}
+
+.Ldt-TweetReplyIcon {
+ background:url('imgs/reply_sprite.png') no-repeat scroll 0 0 transparent ;
+ width: 14px;
+ height: 11px;
+ float: left;
+ margin-top: 2px;
+}
+
+.Ldt-TweetReplyIcon:hover {
+ background-position: 0 -11px;
+}
+
+.Ldt-TweetReplyIcon:active {
+ background-position: 0 -22px;
+}
+
+.Ldt-Retweet {
+ float: left;
+ margin-left: 16px;
+}
+
+.Ldt-RetweetIcon {
+ background:url('imgs/retweet_sprite.png') no-repeat scroll 0 0 transparent ;
+ width: 14px;
+ height: 8px;
+ float: left;
+ margin-top: 3px;
+}
+
+.Ldt-RetweetIcon:hover {
+ background-position: 0 -8px;
+}
+
+.Ldt-RetweetIcon:active {
+ background-position: 0 -16px;
+}
+
+/* styling of a "++" in a tweet */
+.Ldt-PolemicPlusPlus {
+ background-color: #1d973d;
+}
+
+/* styling of a "==" in a tweet */
+.Ldt-PolemicEqualEqual {
+ background-color: #5c8df1
+}
+
+/* styling of a "--" in a tweet */
+.Ldt-PolemicMinusMinus {
+ background-color: #ce0a15;
+}
+
+/* styling of a "??" in a tweet */
+.Ldt-PolemicQuestion {
+ background-color: #c5a62d;
+}
+
+/* the styling of a spacer div */
+.Ldt-spacer {
+ background-color:#eeeeee;
+}
+
+/* sparkline widget */
+.Ldt-sparklineWidget {
+ position: relative;
+ margin-bottom: 5px;
+}
+
+.Ldt-sparkLinePositionMarker {
+ position: absolute;
+ top: 0px;
+ width: 0px;
+ background-color: #333333;
+ border-right: solid 1px pink;
+ z-index: 3;
+ opacity: 0.2;
+}
+
+.Ldt-sparkLine {
+ position: absolute;
+ top: 0px;
+}
+
+.Ldt-sparkLineClickOverlay {
+ position: absolute;
+ width: 640px;
+ height: 60px;
+ z-index: 4;
+ top: 0px;
+ opacity: 0.3;
+}
+
+.Ldt-sliceWidget {
+ position: relative;
+ width: 100%;
+ height: 25px;
+ margin-top: 3px;
+}
+
+.Ldt-sliceBackground {
+ width: 100%;
+ background-color: #b6b8b8;
+ height: 12px;
+}
+
+.Ldt-sliceZone {
+ position: absolute;
+ top: 0px;
+ background:url('imgs/wire_pattern.png') repeat scroll transparent;
+ height: 12px;
+ z-index: 2;
+}
+
+.Ldt-sliceLeftHandle {
+ position: absolute;
+ top: 0px;
+ height: 25px;
+ width: 7px;
+ background:url('imgs/left_handle.gif') no-repeat scroll transparent;
+ z-index: 2;
+}
+
+.Ldt-sliceRightHandle {
+ position: absolute;
+ top: 0px;
+ height: 25px;
+ width: 7px;
+ background:url('imgs/right_handle.gif') no-repeat scroll transparent;
+ z-index: 2;
+}
+
+.Ldt-createAnnotationWidget {
+ font-size: 12px;
+ font-family: "Arial", "Verdana", "sans-serif";
+ background-color:#eeeeee;
+ background:url('imgs/wire_pattern.png') repeat scroll transparent ;
+ border: 1px solid #b6b8b8;
+}
+
+.Ldt-createAnnotation-DoubleBorder {
+ border: 1px solid white;
+ overflow: auto;
+ padding: 7px;
+}
+
+.Ldt-createAnnotation-Title {
+ font-size: 12pt;
+ color : #0068c4;
+ float: left;
+ margin-right: 5px;
+}
+
+.Ldt-createAnnotation-TimeFrame {
+ font-size: 12pt;
+ color : #ff5589;
+ float: left;
+}
+
+.Ldt-createAnnotation-Container {
+ float: left; width: 100%; clear: both;
+}
+
+.Ldt-createAnnotation-userAvatar {
+ float: right;
+ width: 48px;
+ height: 48px;
+ margin: 7px 0;
+ border: 1px solid #babcbc;
+}
+
+.Ldt-createAnnotation-userAvatar img {
+ float: right;
+ display: block;
+ max-width: 100%;
+ max-height: 100%;
+}
+
+.Ldt-createAnnotation-profileArrow {
+ float: right;
+ vertical-align: top;
+ height: 48px;
+ width: 15px;
+ margin: 7px 5px;
+ background:url('imgs/profile_arrow.png') center no-repeat;
+}
+
+.Ldt-createAnnotation-Description {
+ float: left;
+ width: 520px;
+ height: 56px; padding: 2px;
+ resize: none;
+}
+
+.Ldt-createAnnotation-btnblock {
+ float: left; width: 450px; margin: 5px 0;
+}
+
+.Ldt-createAnnotation-btnblock label {
+ float: left; margin-left: 12px; margin: 2px 8px 2px 0; font-size: 12px;
+}
+
+.Ldt-createAnnotation-keyword-button {
+ border: 1px solid #ffffff;
+ background-color: #217bcb;
+ color: #ffffff;
+ padding: 3px 4px;
+ cursor: pointer;
+}
+
+.Ldt-createAnnotation-active-button .Ldt-createAnnotation-keyword-button {
+ background-color: #d93c71;
+}
+
+.Ldt-createAnnotation-submitButton {
+ float: right;
+ background-color: #d93c71;
+ color: #ffffff;
+ cursor: pointer;
+ background-image: url('imgs/submit_annotation.png');
+ background-repeat: no-repeat;
+ height: 48px;
+ width: 48px;
+ position: relative;
+ margin-top: 3px;
+ padding: 28px 0 0;
+ font-size: 13px;
+ border: none;
+ text-align: center;
+}
+
+.Ldt-createAnnotation-endScreen {
+ background-color: #ffffff;
+ margin-left: 5px;
+ margin-right: 5px;
+ border: 1px solid #d6d6d6;
+ padding: 10px;
+ font-size: 13px;
+ font-weight: bold;
+ color : #f7268e;
+ text-align: center;
+}
+
+.Ldt-createAnnotation-errorMessage {
+ color: #D93C71;
+}
+
+.Ldt-createAnnotation-Minimize {
+ position: relative;
+ float: right;
+ height: 17px;
+ width: 17px;
+ right: 0px;
+ background:url('imgs/minimize.png');
+}
+
+/* polemic tweet annotation buttons */
+
+.Ldt-createAnnotation-polemic-button {
+ margin: 0;
+ border: 0;
+ padding: 0;
+ margin-right: 2px;
+ width: 38px;
+ height: 26px;
+ text-indent: -999px;
+ background: url(imgs/polemic_buttons_sprite.png);
+ cursor: pointer;
+}
+
+.Ldt-createAnnotation-polemic-positive:hover {
+ background-position: 0 -26px;
+}
+.Ldt-createAnnotation-active-button .Ldt-createAnnotation-polemic-positive {
+ background-position: 0 -52px;
+}
+
+.Ldt-createAnnotation-polemic-negative {
+ background-position: -38px 0;
+}
+.Ldt-createAnnotation-polemic-negative:hover {
+ background-position: -38px -26px;
+}
+.Ldt-createAnnotation-active-button .Ldt-createAnnotation-polemic-negative {
+ background-position: -38px -52px;
+}
+
+.Ldt-createAnnotation-polemic-reference {
+ background-position: -76px 0;
+}
+.Ldt-createAnnotation-polemic-reference:hover {
+ background-position: -76px -26px;
+}
+.Ldt-createAnnotation-active-button .Ldt-createAnnotation-polemic-reference {
+ background-position: -76px -52px;
+}
+
+.Ldt-createAnnotation-polemic-question {
+ background-position: -114px 0;
+}
+.Ldt-createAnnotation-polemic-question:hover {
+ background-position: -114px -26px;
+}
+.Ldt-createAnnotation-active-button .Ldt-createAnnotation-polemic-question {
+ background-position: -114px -52px;
+}
+
+.Ldt-createAnnotation-spinner {
+ display: inline;
+ width: 16px;
+ height: 16px;
+ background-image('imgs/spinner.gif');
+}
+
+.Ldt-createAnnotation-endScreen-TweetLink {
+ width: 54px;
+ height: 20px;
+ background-image('imgs/tweet_button.png');
+}
+
+.Ldt-createAnnotation-endScreen-FbLink {
+ width: 55px;
+ height: 20px;
+ background-image('imgs/facebook_button.png');
+}
+
+.Ldt-createAnnotation-endScreen-GplusLink {
+ width: 50px;
+ height: 20px;
+ background-image('imgs/gplus_button.png');
+}
+/* AnnotationsListWidget */
+
+.Ldt-AnnotationsListWidget {
+ font-size: 12px;
+ font-family: "Arial", "Verdana", "sans-serif";
+ border: 1px solid #b6b8b8;
+ overflow: auto;
+ max-height: 480px;
+}
+
+ul.Ldt-AnnotationsList-ul {
+ list-style: none;
+ padding: 0 3px;
+}
+
+li.Ldt-AnnotationsList-li {
+ cursor: pointer;
+ float: left; width: 100%; clear: both;
+ margin: 2px 0; padding: 2px 0;
+}
+
+.Ldt-AnnotationsList-li:hover {
+ background-color: #e9e9e9;
+}
+
+.Ldt-AnnotationsList-highlight {
+ background: #F7268E; color: #ffffff;
+}
+
+.Ldt-AnnotationsListWidget a {
+ text-decoration: none;
+}
+
+.Ldt-AnnotationsList-Thumb-Placeholder {
+ float: left;
+ height: 64px;
+ width: 64px;
+ background-image: url('imgs/video_sequence.png');
+}
+
+.Ldt-AnnotationsList-Thumbnail {
+ border: none;
+ float: left;
+ max-width: 64px;
+ max-height: 64px;
+}
+
+.Ldt-AnnotationsList-Duration {
+ color : #f7268e;
+ float: right; text-align: right;
+}
+
+.Ldt-AnnotationsList-Title {
+ color: #0068c4;
+ font-size: 13px;
+ margin: 0 0 2px 64px;
+}
+
+.Ldt-AnnotationsList-Description {
+ clear: both;
+ margin: 2px 0;
+}
+
+ul.Ldt-AnnotationsList-Tags {
+ width: 100%; list-style: none; clear: both; padding: 0; margin: 2px 0;
+}
+
+li.Ldt-AnnotationsList-Tag-Li {
+ float: left; margin: 2px; background: #0068c4; color: #fff; padding: 4px;
+}
+
+li.Ldt-AnnotationsList-Tag-Li:hover {
+ background: #F7268E;
+}
+
+/* Tagcloud */
+
+.Ldt-TagCloud {
+ font-family: "PT Sans", Arial, Helvetica, sans-serif;
+}
+
+.Ldt-TagCloud ul {
+ list-style: none; padding: 0; margin: 5px; text-align: center;
+}
+
+.Ldt-TagCloud li {
+ display: inline-block; margin: 2px; cursor:pointer; cursor:hand;
+}
+
+.Ldt-TagCloud li:hover {
+ color: #0099ff;
+}
+
+.Ldt-TagCloud-actif {
+ color: #c000c0;
+}
diff -r 7b55777486c3 -r 75ba66457232 src/css/LdtPlayerFc.css
--- a/src/css/LdtPlayerFc.css Tue Oct 04 11:16:06 2011 +0200
+++ /dev/null Thu Jan 01 00:00:00 1970 +0000
@@ -1,182 +0,0 @@
- #demo-frame > div.demo { padding: 5px !important; };
-
- button.ui-button-icon-only {
- height:1.5em;
- width:1.5em;
- }
-
- #Ldt-loader{
- background:url(imgs/transBlack.gif);
- width:10px;
- height:10px;
- }
-
- #Ldt-controler {
- font-size: 62.5%;
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- background-color:#EEE;
- height:35px;
- padding:5px;
- }
-
- .Ldt-iri-chapter{
- padding-top:10px;
- padding-bottom:5px;
- border-left:solid 1px #000;
- border-right:solid 1px #000;
- }
-
- #Ldt-loader {
- background:url(imgs/loader_fc.gif) no-repeat;
- width:20px;
- height:16px;
- float:left;
- }
-
- .tooltip {
- display:none;
- background:transparent url(imgs/white_arrow_mini.png);
- font-size:12px;
- height:55px;
- width:180px;
- padding:10px;
- padding-left:15px;
- padding-top:15px;
- padding-right:15px;
- color:#000;
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- }
- #Ldt-Root{
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- }
- #Ldt-Hat{
- height:3px;
- }
- #Ldt-Annotations{
- padding-left:5px;
- width:470px;
- float:left;
- font-size: 62.5%;
- }
- #Ldt-SaTitle{
- padding-top:2px;
- padding-bottom:5px;
- font-size:18px;
- height:22p;
- color:#4D4D4D;
- }
- #Ldt-SaDescription{
- font-size:12px;
- }
- #Ldt-Show-Arrow-container{
- margin-left:60px;
- }
- #Ldt-Show-Arrow{
- position:relative;
- background:url(imgs/purple_arrow_Show.png);
- width:27px;
- height:13px;
- margin-top:12px;
- margin-left:-10px;
- z-index:999999999;
- }
-
- #Ldt-output{
- display:none;
- }
- #Ldt-Show-Tags{
- position:relative;
- height:13px;
- margin-top:-10px;
- border: solid 1px #000;
- }
- #Ldt-ShowAnnotation-video{
- position:absolute;
- z-index: 999;
- padding:5px;
- background:url(imgs/transBlack.png);
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- color:#FFF;
- }
- #Ldt-ShowAnnotation-audio{
- position:relative;
- padding:5px;
- background-color:#decfe2;
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- color:#4D4D4D;
- }
- #Ldt-SaKeyword{
- background-color:#bc85be;
- color:#4D4D4D;
- padding:5px;
- font-weight:bold;
- text-align:left;
- float:left;
- font-size:10px;
- }
- #Ldt-SaShareTools{
- text-align:right;
- float:right;
- }
-
-
- #Ldt-PlaceHolder{
- position:absolue;
- float:none;
- }
- .Ldt-Search-select{
- padding-top:25px;
- }
- .Ldt-Search-unselect{
- border-top:0px;
- }
-
- .Ldt-mode-radio{
- visibility:hidden;
- height:0px;
- display:none
- }
-
- .Ldt-Control1{
- width:60px;
- float:left;
- }
- .Ldt-Control2{
- padding-left:10px;
- width:60px;
- float:left;
- }
- .Ldt-cleaner {
- clear:both;
- }
- .share {
- background:url('imgs/widget20.png') no-repeat scroll 0 0 transparent ;
- display:block;
- height:16px;
- line-height:16px !important;
- overflow:hidden;
- width:16px;
- float:left;
- cursor:pointer;
- margin:2px;
- }
- .shareFacebook{
- background-position:0 -704px;
- }
- .shareMySpace{
- background-position:0 -736px;
- }
- .shareTwitter{
- background-position:0 -1072px;
- }
- .shareGoogle{
- background-position:0 -752px;
- }
- .shareDelicious{
- background-position:0 -672px;
- }
- .shareJamesPot{
- background-position:0 -1808px;
- }
-
-
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 src/css/LdtPlayerUniverScience.css
--- a/src/css/LdtPlayerUniverScience.css Tue Oct 04 11:16:06 2011 +0200
+++ /dev/null Thu Jan 01 00:00:00 1970 +0000
@@ -1,170 +0,0 @@
- #demo-frame > div.demo { padding: 5px !important; };
-
- .ui-widget {
- font-size: 1.5em;
- }
- #Ldt-loader {
- background:url(imgs/loader.gif) no-repeat;
- width:20px;
- height:16px;
- float:left;
- }
-
- #Ldt-controler {
- font-size: 62.5%;
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- background-color:#262626;
- height:35px;
- padding:5px;
-
- margin-left:213px;
- }
-
- .Ldt-iri-chapter{
- padding-top:10px;
- padding-bottom:5px;
- border-left:solid 1px #000;
- border-right:solid 1px #000;
- }
-
- .tooltip {
- display:none;
- background:transparent url(imgs/white_arrow_mini.png);
- font-size:12px;
- height:55px;
- width:180px;
- padding:10px;
- padding-left:15px;
- padding-top:15px;
- padding-right:15px;
- color:#000;
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- }
- #Ldt-Root{
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- }
- #Ldt-Hat{
- height:3px;
- }
- #Ldt-Annotations{
- padding-left:5px;
- width:470px;
- float:left;
- font-size: 62.5%;
- }
- #Ldt-SaTitle{
- padding-top:2px;
- padding-bottom:5px;
- font-size:18px;
- height:22p;
- }
- #Ldt-SaDescription{
- font-size:12px;
- visibility:hidden;
- display:none;
- }
- #Ldt-Show-Arrow-container{
- margin-left:60px;
- }
- #Ldt-Show-Arrow{
- position:relative;
- background:url(http://www.cybunk.com/iritest/universcience/des-souris-dans-un-labyrinthe_fichiers/grey_arrow_Show.png);
- width:27px;
- height:13px;
- margin-top:20px;
- margin-left:-10px;
- }
-
- #Ldt-Show-Tags{
- position:relative;
- height:13px;
- margin-top:-10px;
- border: solid 1px #000;
- }
- #Ldt-ShowAnnotation-video{
- position:absolute;
- z-index: 999;
- padding:5px;
- background:url(imgs/transBlack.png);
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- color:#FFF;
- }
- #Ldt-ShowAnnotation-audio{
- position:relative;
- padding:5px;
- background-color:#131313;
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- color:#fff;
- margin-left:213px;
- }
- #Ldt-SaKeyword{
- background-color:#444343;
- color:#fff;
- padding:5px;
- font-weight:bold;
- text-align:left;
- float:left;
- font-size:10px;
-
- margin-left:213px;
- }
- #Ldt-SaShareTools{
- text-align:right;
- float:right;
- }
-
-
- #Ldt-PlaceHolder{
- position:absolue;
- float:none;
- }
-
- .Ldt-mode-radio{
- visibility:hidden;
- height:0px;
- display:none
- }
-
- .Ldt-Control1{
- width:60px;
- float:left;
- }
- .Ldt-Control2{
- padding-left:10px;
- width:60px;
- float:left;
- }
- .Ldt-cleaner {
- clear:both;
- }
- .share {
- background:url('imgs/widget20.png') no-repeat scroll 0 0 transparent ;
- display:block;
- height:16px;
- line-height:16px !important;
- overflow:hidden;
- width:16px;
- float:left;
- cursor:pointer;
- margin:2px;
- }
- .shareFacebook{
- background-position:0 -704px;
- }
- .shareMySpace{
- background-position:0 -736px;
- }
- .shareTwitter{
- background-position:0 -1072px;
- }
- .shareGoogle{
- background-position:0 -752px;
- }
- .shareDelicious{
- background-position:0 -672px;
- }
- .shareJamesPot{
- background-position:0 -1808px;
- }
-
-
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 src/css/demo.css
--- a/src/css/demo.css Tue Oct 04 11:16:06 2011 +0200
+++ /dev/null Thu Jan 01 00:00:00 1970 +0000
@@ -1,175 +0,0 @@
- #demo-frame > div.demo { padding: 5px !important; };
-
- button.ui-button-icon-only {
- height:1.5em;
- width:1.5em;
- }
-
- #Ldt-loader{
- background:url(imgs/transBlack.gif);
- width:10px;
- height:10px;
- }
-
- #Ldt-controler {
- font-size: 62.5%;
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- background-color:#DECFE2;
- height:35px;
- padding:5px;
- }
-
- .Ldt-iri-chapter{
- padding-top:10px;
- padding-bottom:5px;
- border-left:solid 1px #000;
- border-right:solid 1px #000;
- }
-
- #Ldt-loader {
- background:url(imgs/loader_fc.gif) no-repeat;
- width:20px;
- height:16px;
- float:left;
- }
-
- .tooltip {
- display:none;
- background:transparent url(imgs/white_arrow_mini.png);
- font-size:12px;
- height:55px;
- width:180px;
- padding:10px;
- padding-left:15px;
- padding-top:15px;
- padding-right:15px;
- color:#000;
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- }
- #Ldt-Root{
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- }
- #Ldt-Hat{
- height:3px;
- }
- #Ldt-Annotations{
- padding-left:5px;
- width:470px;
- float:left;
- font-size: 62.5%;
- }
- #Ldt-SaTitle{
- padding-top:2px;
- padding-bottom:5px;
- font-size:18px;
- height:22p;
- color:#FFF;
- }
- #Ldt-SaDescription{
- font-size:12px;
- }
- #Ldt-Show-Arrow-container{
- margin-left:60px;
- }
- #Ldt-Show-Arrow{
- position:relative;
- background:url(imgs/grey_arrow_Show.png);
- width:27px;
- height:13px;
- margin-top:12px;
- margin-left:-10px;
- }
-
- #Ldt-output{
- display:none;
- }
- #Ldt-Show-Tags{
- position:relative;
- height:13px;
- margin-top:-10px;
- border: solid 1px #000;
- }
- #Ldt-ShowAnnotation-video{
- position:absolute;
- z-index: 999;
- padding:5px;
- background:url(imgs/transBlack.png);
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- color:#FFF;
- }
- #Ldt-ShowAnnotation-audio{
- position:relative;
- padding:5px;
- background-color:#773584;
- font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
- color:#000000;
- }
- #Ldt-SaKeyword{
- background-color:#28042D;
- color:#FFFFFF;
- padding:5px;
- font-weight:bold;
- text-align:left;
- float:left;
- font-size:10px;
- }
- #Ldt-SaShareTools{
- text-align:right;
- float:right;
- }
-
-
- #Ldt-PlaceHolder{
- position:absolue;
- float:none;
- }
-
- .Ldt-mode-radio{
- visibility:hidden;
- height:0px;
- display:none
- }
-
- .Ldt-Control1{
- width:60px;
- float:left;
- }
- .Ldt-Control2{
- padding-left:10px;
- width:60px;
- float:left;
- }
- .Ldt-cleaner {
- clear:both;
- }
- .share {
- background:url('imgs/widget20.png') no-repeat scroll 0 0 transparent ;
- display:block;
- height:16px;
- line-height:16px !important;
- overflow:hidden;
- width:16px;
- float:left;
- cursor:pointer;
- margin:2px;
- }
- .shareFacebook{
- background-position:0 -704px;
- }
- .shareMySpace{
- background-position:0 -736px;
- }
- .shareTwitter{
- background-position:0 -1072px;
- }
- .shareGoogle{
- background-position:0 -752px;
- }
- .shareDelicious{
- background-position:0 -672px;
- }
- .shareJamesPot{
- background-position:0 -1808px;
- }
-
-
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/annotate_arrow.png
Binary file src/css/imgs/annotate_arrow.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/arrow.png
Binary file src/css/imgs/arrow.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/facebook.png
Binary file src/css/imgs/facebook.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/facebook_button.png
Binary file src/css/imgs/facebook_button.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/google.png
Binary file src/css/imgs/google.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/gplus_button.png
Binary file src/css/imgs/gplus_button.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/left_edge_arrow.png
Binary file src/css/imgs/left_edge_arrow.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/left_handle.gif
Binary file src/css/imgs/left_handle.gif has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/loader.gif
Binary file src/css/imgs/loader.gif has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/loader_fc.gif
Binary file src/css/imgs/loader_fc.gif has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/loader_fc2.gif
Binary file src/css/imgs/loader_fc2.gif has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/minimize.png
Binary file src/css/imgs/minimize.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/player-sprites.png
Binary file src/css/imgs/player-sprites.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/player_gradient.png
Binary file src/css/imgs/player_gradient.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/polemic_buttons_sprite.png
Binary file src/css/imgs/polemic_buttons_sprite.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/profile_arrow.png
Binary file src/css/imgs/profile_arrow.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/reply_sprite.png
Binary file src/css/imgs/reply_sprite.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/retweet_sprite.png
Binary file src/css/imgs/retweet_sprite.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/right_edge_arrow.png
Binary file src/css/imgs/right_edge_arrow.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/right_handle.gif
Binary file src/css/imgs/right_handle.gif has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/spinner.gif
Binary file src/css/imgs/spinner.gif has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/submit_annotation.png
Binary file src/css/imgs/submit_annotation.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/tweet_button.png
Binary file src/css/imgs/tweet_button.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/twitter.png
Binary file src/css/imgs/twitter.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/user_default_icon.png
Binary file src/css/imgs/user_default_icon.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/video_sequence.png
Binary file src/css/imgs/video_sequence.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/white_arrow_long.png
Binary file src/css/imgs/white_arrow_long.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/css/imgs/wire_pattern.png
Binary file src/css/imgs/wire_pattern.png has changed
diff -r 7b55777486c3 -r 75ba66457232 src/js/LdtPlayer.js
--- a/src/js/LdtPlayer.js Tue Oct 04 11:16:06 2011 +0200
+++ /dev/null Thu Jan 01 00:00:00 1970 +0000
@@ -1,1129 +0,0 @@
-/*
- * Copyright 2010 Institut de recherche et d'innovation
- * contributor(s) : Samuel Huron
- * Use Silvia Pfeiffer 's javascript mediafragment implementation
- *
- * contact@iri.centrepompidou.fr
- * http://www.iri.centrepompidou.fr
- *
- * This software is a computer program whose purpose is to show and add annotations on a video .
- * This software is governed by the CeCILL-C license under French law and
- * abiding by the rules of distribution of free software. You can use,
- * modify and/ or redistribute the software under the terms of the CeCILL-C
- * license as circulated by CEA, CNRS and INRIA at the following URL
- * "http://www.cecill.info".
- *
- * The fact that you are presently reading this means that you have had
- * knowledge of the CeCILL-C license and that you accept its terms.
-*/
-
-if ( window.IriSP === undefined && window.__IriSP === undefined ) {
- var IriSP = {};
- var __IriSP = IriSP; /* for backward compatibility */
-}
-
-
-// Official instance - to refactor ?
-IriSP.MyLdt = null;
-IriSP.MyTags = null;
-IriSP.MyApiPlayer = null;
-IriSP.player = null;
-
-// genral var (old code) - to refactor
-IriSP.Durration = null;
-IriSP.playerLdtWidth = null;
-IriSP.playerLdtHeight = null;
-
-
-IriSP.init = function ( config ) {
- if ( config === null ) {
- IriSP.config = IriSP.configDefault;
- } else {
-
- IriSP.config = config;
-
- if ( IriSP.config.player.params == null ) {
- IriSP.config.player.params = IriSP.configDefault.player.params;
- }
-
- if ( IriSP.config.player.flashvars == null ) {
- IriSP.config.player.flashvars = IriSP.configDefault.player.flashvars;
- }
-
- if ( IriSP.config.player.attributes == null ) {
- IriSP.config.player.attributes = IriSP.configDefault.player.attributes;
- }
- }
-
- var metadataSrc = IriSP.config.metadata.src;
- var guiContainer = IriSP.config.gui.container;
- var guiMode = IriSP.config.gui.mode;
- var guiLdtShareTool = IriSP.LdtShareTool;
-
- // Localize jQuery variable
- IriSP.jQuery = null;
-
- /* FIXME : to refactor using popcorn.getscript ? */
- /******** Load jQuery if not present *********/
- if ( window.jQuery === undefined || window.jQuery.fn.jquery !== '1.4.2' ) {
-
- var script_tag = document.createElement( 'script' );
- script_tag.setAttribute( "type", "text/javascript" );
- script_tag.setAttribute( "src", IriSP.lib.jQuery );
-
- script_tag.onload = scriptLibHandler;
- script_tag.onreadystatechange = function () { // Same thing but for IE
- if ( this.readyState == 'complete' || this.readyState == 'loaded' ) {
- scriptLibHandler();
- }
- };
-
- // Try to find the head, otherwise default to the documentElement
- ( document.getElementsByTagName("head")[0] || document.documentElement ).appendChild( script_tag );
- } else {
- // The jQuery version on the window is the one we want to use
- IriSP.jQuery = window.jQuery;
- scriptLibHandler();
- }
-
- /******** Called once jQuery has loaded ******/
- function scriptLibHandler() {
-
- var script_jqUi_tooltip = document.createElement( 'script' );
- script_jqUi_tooltip.setAttribute( "type", "text/javascript" );
- script_jqUi_tooltip.setAttribute( "src", IriSP.lib.jQueryToolTip );
- script_jqUi_tooltip.onload = scriptLoadHandler;
- script_jqUi_tooltip.onreadystatechange = function () { // Same thing but for IE
- if ( this.readyState == 'complete' || this.readyState == 'loaded' ) {
- scriptLoadHandler( "jquery.tools.min.js loded" );
- }
- };
-
- var script_swfObj = document.createElement('script');
- script_swfObj.setAttribute( "type","text/javascript" );
- script_swfObj.setAttribute( "src",IriSP.lib.swfObject );
- script_swfObj.onload = scriptLoadHandler;
- script_swfObj.onreadystatechange = function () { // Same thing but for IE
- if ( this.readyState == 'complete' || this.readyState == 'loaded' ) {
- scriptLoadHandler( "swfobject.js loded" );
- }
- };
-
- var script_jqUi = document.createElement( 'script' );
- script_jqUi.setAttribute( "type","text/javascript" );
- script_jqUi.setAttribute( "src",IriSP.lib.jQueryUI );
- script_jqUi.onload = scriptLoadHandler;
- script_jqUi.onreadystatechange = function () { // Same thing but for IE
- if ( this.readyState == 'complete' || this.readyState == 'loaded' ) {
- scriptLoadHandler( "jquery-ui.min.js loded" );
- }
- };
-
-
- ( document.getElementsByTagName("head")[0] || document.documentElement ).appendChild( script_jqUi_tooltip);
- ( document.getElementsByTagName("head")[0] || document.documentElement ).appendChild( script_jqUi );
- ( document.getElementsByTagName("head")[0] || document.documentElement ).appendChild( script_swfObj );
-
-
- };
-
- /******** Called once all lib are loaded ******/
- var loadLib = 0;
- /* FIXME : ugly */
- function scriptLoadHandler( Mylib ) {
- //alert(Mylib);
- loadLib +=1;
- if( loadLib===3 ) {
- main();
- }
- };
-
- /******** Our main function ********/
- function main() {
-
-
- // Make our own IriSP.jQuery and restore window.jQuery if there was one.
- IriSP.jQuery = window.jQuery.noConflict( true );
- // Call ours Jquery
- IriSP.jQuery( document ).ready( function($) {
-
- /******* Load CSS *******/
- var css_link_jquery = IriSP.jQuery( "", {
- rel: "stylesheet",
- type: "text/css",
- href: IriSP.lib.cssjQueryUI,
- 'class': "dynamic_css"
- } );
- var css_link_custom = IriSP.jQuery( "", {
- rel: "stylesheet",
- type: "text/css",
- href: IriSP.config.gui.css,
- 'class': "dynamic_css"
- } );
-
- css_link_jquery.appendTo( 'head' );
- css_link_custom.appendTo( 'head' );
-
- // to see dynamicly loaded css on IE
- if ( $.browser.msie ) {
- $( '.dynamic_css' ).clone().appendTo( 'head' );
- }
-
- //__IriSP.trace("main","ready createMyHtml");
-
- IriSP.createPlayerChrome();
-
- /******* Load Metadata *******/
- IriSP.getMetadata();
-
- });
- }
-
-};
-
-
-__IriSP.Media = function ( id, url, duration, title, description ) {
- this.id = id;
- this.url = url;
- this.title = title;
- this.description = description;
- this.duration = duration;
- this.lignes = new Array();
-
- IriSP.trace( "__IriSP.Media" , "Media ID : "+id);
- IriSP.trace( "__IriSP.Media" , "Media URL : "+url);
- IriSP.trace( "__IriSP.Media" , "Media title : "+title);
-};
-
-__IriSP.Media.prototype.createPlayerMedia = function ( width, height, MyStreamer, MySwfPath) {
- IriSP.MyApiPlayer = new __IriSP.APIplayer( width, height, this.url, this.duration, MyStreamer, MySwfPath);
- //createPlayer(width,height,this.url,this.duration,MyStreamer,MySwfPath);
-};
-
-__IriSP.Media.prototype.getMediaDuration = function () {
- return (this.duration);
-};
-
-__IriSP.Media.prototype.getMediaTitle = function (){
- return (this.title);
-};
-
-
-
-
-
-
-/* FIXME : API player - work in progress ... need refactoring of code */
-__IriSP.APIplayer = function ( width, height, url, duration, streamerPath, MySwfPath){
-
-
- this.player = null;
- this.hashchangeUpdate = null;
-
- this.width = width;
- this.height = height;
- this.url = url;
- this.duration = duration;
- this.streamerPath = streamerPath;
- this.MySwfPath = MySwfPath;
-
- IriSP.MyApiPlayer = this;
-
- IriSP.createPlayer( this.url, this.streamerPath );
- IriSP.trace( "__IriSP.APIplayer", "__IriSP.createPlayer" );
-
- //__IriSP.config.player
- /*
- - dailymotion // &enableApi=1&chromeless=1
- - youtube
- - html5
- - flowplayer
- - jwplayer
- */
-
-};
-
-__IriSP.APIplayer.prototype.ready = function( player ) {
-
- //__IriSP.trace("__IriSP.APIplayer.prototype.APIpReady"," __IriSP.createInterface");
- IriSP.createInterface( this.width, this.height, this.duration );
- //__IriSP.trace("__IriSP.APIplayer.prototype.APIpReady","END __IriSP.createInterface");
-
- // hashchange EVENT
- if ( window.addEventListener ){
-
- // for firefox hashchange EVENT
- window.addEventListener( "hashchange", function() {
- var url = window.location.href;
- var time = IriSP.retrieveTimeFragment( url );
- IriSP.trace( "__IriSP.APIplayer.prototype.ready", time );
- if( IriSP.MyApiPlayer.hashchangeUpdate==null ){
- IriSP.MyApiPlayer.seek( time );
-
- } else {
- IriSP.MyApiPlayer.hashchangeUpdate = null;
- }
- }, false );
-
- } else if (window.attachEvent){
- // for ie hashchange EVENT
- window.attachEvent( "onhashchange", function() {
- IriSP.trace( "hashchange",time );
- var url = window.location.href;
- var time = IriSP.retrieveTimeFragment( url );
- if( IriSP.MyApiPlayer.hashchangeUpdate == null ){
- IriSP.MyApiPlayer.seek(time);
- } else {
- IriSP.MyApiPlayer.hashchangeUpdate = null;
- }
- }, false);
- }
-
- // Search
- //__IriSP.jQuery("#LdtSearchInput").change(function() {__IriSP.Search(this.value);});
- //__IriSP.jQuery("#LdtSearchInput").live('change', function(event) {__IriSP.Search(this.value);});
- IriSP.jQuery( "#LdtSearchInput" ).keydown( function() { IriSP.Search( this.value );} );
- IriSP.jQuery("#LdtSearchInput").keyup( function() { IriSP.Search( this.value );} );
-
-};
-
-__IriSP.APIplayer.prototype.pause = function(){
- this.hashchangeUpdate = true;
- IriSP.player.sendEvent( 'PAUSE' );
-};
-
-__IriSP.APIplayer.prototype.play = function() {
- this.hashchangeUpdate = true;
- //__IriSP.trace("__IriSP.config.player.type",__IriSP.config.player.type);
- if( IriSP.config.player.type=='jwplayer' ){
-
- IriSP.player.sendEvent( 'PLAY' );
-
- } else if(IriSP.config.player.type == 'dailymotion'
- || IriSP.config.player.type == 'youtube' ) {
-
- var status = IriSP.player.getPlayerState();
- IriSP.trace( "__IriSP.APIplayer.prototype.play.status", status);
- if ( status != 1 ){
- IriSP.player.playVideo();
- } else {
- IriSP.player.pauseVideo();
- }
- }
-};
-
-__IriSP.APIplayer.prototype.mute = function() {
- IriSP.player.sendEvent( 'MUTE' );
-
- //alert(__IriSP.jQuery(".ui-icon-volume-on").css("background-position-x"));
- /* FIXME : remove hardcoded values */
- if ( IriSP.jQuery( ".ui-icon-volume-on" ).css( "background-position" ) == "-144px -160px" ){
- IriSP.jQuery(" .ui-icon-volume-on ").css(" background-position ", "-130px -160px");
- } else {
- IriSP.jQuery( ".ui-icon-volume-on" ).css( "background-position", "-144px -160px" );
- }
-};
-
-/* FIXME : rename */
-__IriSP.APIplayer.prototype.share = function( network ) {
-
- /* FIXME : remove hardcoded */
- var MyMessage = encodeURIComponent( "J'écoute Les Retours du Dimanche : " );
- var MyURLNow = window.location.href;
- var shareURL = null;
- //alert(network+" : "+MyURLNow);
-
- /* FIXME : use a sharing library */
- if(network == "facebook"){
- shareURL = "http://www.facebook.com/share.php?u=";
- }else if(network == "twitter"){
- shareURL = "http://twitter.com/home?status="+MyMessage;
- }else if(network == "myspace"){
- shareURL ="http://www.myspace.com/Modules/PostTo/Pages/?u=";
- }else if(network == "delicious"){
- shareURL = "http://delicious.com/save?url=";
- }else if(network == "JameSpot"){
- shareURL = "http://www.jamespot.com/?action=spotit&u=";
- //alert(network+" non actif pour l'instant : "+MyURLNow);
- }
-
- if (shareURL != null)
- window.open( shareURL+encodeURIComponent(MyURLNow) );
- //window.location.href = shareURL+encodeURIComponent(MyURLNow);
-};
-
-__IriSP.APIplayer.prototype.seek = function (time) {
-
- if( time==0 ) { time=1; }
-
- IriSP.trace( "__IriSP.APIplayer.prototype.seek", time );
-
- if( IriSP.config.player.type=='jwplayer') {
- //__IriSP.MyApiPlayer.play()
- IriSP.player.sendEvent( 'SEEK', time );
- } else if( IriSP.config.player.type=='dailymotion'
- || IriSP.config.player.type=='youtube' ) {
- IriSP.player.seekTo( time );
- }
-
- this.changePageUrlOffset( time );
-};
-
-__IriSP.APIplayer.prototype.update = function (time) {
-
- if( time != 0 ) {
- this.hashchangeUpdate = true;
-
- IriSP.trace( "__IriSP.APIplayer.prototype.update" ,time);
- IriSP.player.sendEvent( 'SEEK', time );
- }
-};
-
-__IriSP.APIplayer.prototype.changePageUrlOffset = function ( time ) {
- //alert(time);
- IriSP.trace( "__IriSP.APIplayer.prototype.changePageUrlOffset" , "CHANGE URL "+ time);
-
- window.location.hash = "#t=" + time;
- window.location.href = window.location.href;
-
-};
-
-/* Media Fragment functionality by Silvia Pfeiffer */
-
-IriSP.jumpToTimeoffset = function ( form ) {
- var time = form.time.value;
- IriSP.MyApiPlayer.changePageUrlOffset( time );
-};
-
-IriSP.retrieveTimeFragment = function ( url ) {
- var pageoffset = 0;
- var offsettime = 0;
-
- if ( url.split("#")[1] != null ) {
- pageoffset = url.split( "#" )[1];
- if ( pageoffset.substring( 2 ) != null ) {
- offsettime = pageoffset.substring( 2 );
- }
- }
- return offsettime;
-};
-
-IriSP.ignoreTimeFragment = function( url ){
-
- var pageurl = url;
-
- if ( url.split( "#" )[1] != null ) {
- pageurl = url.split( "#" )[0];
- }
-
- return pageurl;
-};
-
-
-/* code specific to jwplayer / creation and listener */
-
-IriSP.currentPosition = 0;
-IriSP.currentVolume = 50;
-IriSP.player = null;
-IriSP.startPosition = null;
-IriSP.firstplay = false;
-
-
-
-IriSP.createPlayer = function ( url, streamerPath ) {
- if( IriSP.config.player.type=='dailymotion' ) {
- IriSP.config.player.src = IriSP.config.player.src+"&chromeless=1&enableApi=1";
- } else if ( IriSP.config.player.type=='youtube' ){
- IriSP.config.player.src = IriSP.config.player.src+"&enablejsapi=1&version=3";
- }
-
- IriSP.trace( "__IriSP.createPlayer", "start" );
-
- IriSP.myUrlFragment = url.split( streamerPath );
-
- var configTemp = IriSP.jQuery.extend( true, {}, IriSP.config );
- configTemp.player.flashvars.autostart = "true";
- configTemp.player.flashvars.streamer = streamerPath;
- configTemp.player.flashvars.file = IriSP.myUrlFragment[1];
-
- var flashvars = configTemp.player.flashvars;
- var params = configTemp.player.params;
- var attributes = configTemp.player.attributes;
-
- IriSP.trace(
- "__IriSP.createPlayer",
- "SWFOBJECT src:"+
- IriSP.config.player.src+
- " " +IriSP.config.gui.width+
- " " +IriSP.config.gui.height
- );
-
- swfobject.embedSWF(
- IriSP.config.player.src,
- "Ldt-PlaceHolder",
- IriSP.config.gui.width,
- IriSP.config.gui.height,
- "9.0.115", // FIXME : de-hardcode version ?
- false,
- flashvars,
- params,
- attributes
- );
-
- // need a methode to
- // re execute if this swf call does'nt work
-};
-
-
-/* jw player api */
-IriSP.playerReady = function (thePlayer) {
-
- //__IriSP.trace("__IriSP.playerReady","PLAYER READY !!!!!!!!!!!!");
- IriSP.player = window.document[thePlayer.id];
- //__IriSP.trace("__IriSP.playerReady","API CALL "+__IriSP.player);
- IriSP.MyApiPlayer.ready( IriSP.player );
- //__IriSP.trace("__IriSP.playerReady","API CALL END ");
-
- var url = document.location.href;
- var time = IriSP.retrieveTimeFragment( url );
- //__IriSP.trace("__IriSP.playerReady"," "+url+" "+time );
- IriSP.startPosition = time;
- //__IriSP.trace("__IriSP.playerReady"," LISTENER LAUCHER");
- IriSP.addListeners();
- //__IriSP.trace("__IriSP.playerReady"," LISTENER END");
-
-};
-
-IriSP.addListeners = function () {
- if ( IriSP.player ) {
- IriSP.trace("__IriSP.addListeners","ADD Listener ");
- IriSP.player.addModelListener( "TIME", "__IriSP.positionListener");
- IriSP.player.addControllerListener( "VOLUME", "__IriSP.volumeListener" );
- IriSP.player.addModelListener( 'STATE', '__IriSP.stateMonitor' );
- } else {
- IriSP.setTimeout( "__IriSP.addListeners()", 100 );
- }
-
- // et changer les boutons
-};
-
-IriSP.stateMonitor = function ( obj ) {
-
- if(obj.newstate == 'PAUSED') {
- IriSP.trace( "__IriSP.stateMonitor", "PAUSE" );
- IriSP.MyApiPlayer.changePageUrlOffset( IriSP.currentPosition );
- IriSP.jQuery( ".ui-icon-play" ).css( "background-position","0px -160px" );
-
- } else if (obj.newstate == 'PLAYING' ){
-
- IriSP.trace( "__IriSP.stateMonitor", "PLAYING "+IriSP.startPosition );
-
- // force buffering even if autostart is disabled.
- if ( IriSP.config.player.flashvars.autostart == "false" && IriSP.firstplay == false && IriSP.startPosition == 0 ) {
- IriSP.trace("__IriSP.stateMonitor","first stop ???");
- IriSP.MyApiPlayer.play();
- IriSP.firstplay = true;
- IriSP.MyLdt.checkTime( 1 );
- }
-
- // once that the video is loaded, move it to the correct timecode
- if( IriSP.startPosition!=null ){
- IriSP.MyApiPlayer.update( IriSP.startPosition );
- IriSP.startPosition = null;
- }
-
-
- IriSP.jQuery( ".ui-icon-play" ).css( "background-position", "-16px -160px" );
- } else if (obj.newstate == 'BUFFERING'){
- IriSP.trace( "__IriSP.stateMonitor", "BUFFERING : "+IriSP.config.player.flashvars.autostart );
- //changePageUrlOffset(currentPosition);
- }
-
-};
-
-IriSP.positionListener = function(obj) {
- //__IriSP.trace("__IriSP.positionListener",obj.position);
- IriSP.currentPosition = obj.position;
- var tmp = document.getElementById( "posit" );
- if (tmp) { tmp.innerHTML = "position: " + IriSP.currentPosition; }
- IriSP.jQuery( "#slider-range-min" ).slider( "value", obj.position);
- IriSP.jQuery( "#amount" ).val(obj.position+" s");
- // display annotation
- IriSP.MyLdt.checkTime( IriSP.currentPosition );
-
-};
-
-IriSP.volumeListener = function (obj) {
- IriSP.currentVolume = obj.percentage;
- var tmp = document.getElementById("vol");
- if (tmp) { tmp.innerHTML = "volume: " + IriSP.currentVolume; }
-};
-
-
-/* dailymotion api */
-onDailymotionPlayerReady = function (playerid) {
-
- //alert(playerid);
- IriSP.player = document.getElementById( IriSP.config.player.attributes.id );
- IriSP.MyApiPlayer.ready( IriSP.player );
-
- var url = document.location.href;
- var time = IriSP.retrieveTimeFragment( url );
- IriSP.startPosition = time;
- IriSP.DailymotionAddListeners();
-
- IriSP.MyApiPlayer.ready(playerid);
-};
-
-IriSP.DailymotionAddListeners = function () {
- if ( IriSP.player ) {
- IriSP.trace( "__IriSP.addListeners","ADD Listener " );
- //__IriSP.player.addEventListener("onStateChange", "__IriSP.DailymotionPositionListener");
- setTimeout( "__IriSP.DailymotionPositionListener()", 100);
- IriSP.DailymotionPositionListener();
- /* FIXME : works only with jwplayer */
- IriSP.player.addModelListener( "VOLUME", "__IriSP.volumeListener" );
- //__IriSP.player.addModelListener('STATE', '__IriSP.stateMonitor');
- } else {
- IriSP.setTimeout( "__IriSP.DailymotionAddListeners()", 100);
- }
-};
-
-IriSP.DailymotionPositionListener = function() {
-
- IriSP.currentPosition = IriSP.player.getCurrentTime();
- //__IriSP.trace("__IriSP.DailymotionPositionListener",__IriSP.currentPosition);
- //__IriSP.trace("__IriSP.currentPosition",__IriSP.currentPosition);
-
- IriSP.jQuery( "#slider-range-min" ).slider( "value" , IriSP.currentPosition);
- IriSP.jQuery( "#amount" ).val( IriSP.currentPosition+" s" );
- // afficher annotation
- /*__IriSP.MyLdt.checkTime(__IriSP.currentPosition);
- */
-
- setTimeout( "__IriSP.DailymotionPositionListener()", 10 );
-};
-
-/* youtube api */
-onYouTubePlayerReady= function (playerid){
-
- var url = document.location.href;
- var time = IriSP.retrieveTimeFragment( url );
- IriSP.player = document.getElementById( IriSP.config.player.attributes.id );
- IriSP.startPosition = time;
-
- IriSP.MyApiPlayer.ready( IriSP.player );
-
- IriSP.MyApiPlayer.seek( time );
- IriSP.MyApiPlayer.play();
-
-
- IriSP.YouTubeAddListeners();
- IriSP.trace( "onYouTubePlayerReady=", time);
- //__IriSP.MyApiPlayer.ready(playerid);
-};
-
-IriSP.YouTubeAddListeners = function () {
- if ( IriSP.player ) {
- IriSP.trace( "__IriSP.addListeners", "ADD Listener " );
- IriSP.player.addEventListener( "onStateChange", "__IriSP.YouTubeStateMonitor" );
- setTimeout( "__IriSP.YouTubePositionListener()", 100 );
-
- /* FIXME : works only with jwplayer */
- IriSP.player.addModelListener( "VOLUME", "__IriSP.volumeListener" );
- //__IriSP.player.addModelListener('STATE', '__IriSP.stateMonitor');
- } else {
- }
-};
-
-IriSP.YouTubePositionListener = function() {
-
- IriSP.currentPosition = IriSP.player.getCurrentTime();
- //__IriSP.trace("__IriSP.YouTubePositionListener",__IriSP.currentPosition);
- //__IriSP.trace("__IriSP.currentPosition",__IriSP.currentPosition);
-
- IriSP.MyLdt.checkTime(IriSP.currentPosition);
- IriSP.jQuery( "#slider-range-min" ).slider( "value", IriSP.currentPosition );
- IriSP.jQuery( "#amount" ).val( IriSP.currentPosition+" s" );
- // afficher annotation
- IriSP.MyLdt.checkTime( IriSP.currentPosition );
-
-
- setTimeout( "__IriSP.YouTubePositionListener()", 10 );
-};
-
-IriSP.YouTubeStateMonitor = function (obj) {
- IriSP.player.addModelListener( '__IriSP.YouTubeStateMonitor ', newstate );
- //alert(newstate+" "+obj.newstate);
- if(newstate == '2') {
- IriSP.trace("__IriSP.stateMonitor","PAUSE");
- IriSP.MyApiPlayer.changePageUrlOffset( IriSP.currentPosition );
-
- } else if (newstate == '1' || newstate == '1') {
- // une fois la video prete a lire la déplacer au bon timecode
- if( IriSP.startPosition!=null ) {
- IriSP.MyApiPlayer.update( IriSP.startPosition );
- IriSP.startPosition = null;
- }
- } else if (newstate == '3'){
- IriSP.trace("__IriSP.stateMonitor","BUFFERING : ");
- //changePageUrlOffset(currentPosition);
- }
-
-};
-
-
-/* utils */
-// code from http://stackoverflow.com/questions/822452/strip-html-from-text-javascript
-/* FIXME: maybe make it a little more robust */
-IriSP.stripHtml = function(s){
- return s.replace(/\\&/g, '&').replace(/\\/g, '>').replace(/\\t/g, ' ').replace(/\\n/g, '", data.urls, '
'); + } + + if (xmode === 'style') { + output.push('
CSS.
'); + } else if (data.json && !err) { + output.push('JSON: good.
'); + } else if (data.globals) { + output.push('Global ' +
+ data.globals.sort().join(', ') + '
');
+ } else {
+ output.push('No new global variables introduced.
');
+ }
+
+ for (i = 0; i < data.functions.length; i += 1) {
+ the_function = data.functions[i];
+ names = [];
+ if (the_function.params) {
+ for (j = 0; j < the_function.params.length; j += 1) {
+ names[j] = the_function.params[j].string;
+ }
+ }
+ output.push('' +
+ String(the_function.line) + ' ' +
+ the_function.name.entityify() +
+ '(' + names.join(', ') + ')
');
+ detail('Undefined', the_function['undefined']);
+ detail('Unused', the_function.unused);
+ detail('Closure', the_function.closure);
+ detail('Variable', the_function['var']);
+ detail('Exception', the_function.exception);
+ detail('Outer', the_function.outer);
+ detail('Global', the_function.global);
+ detail('Label', the_function.label);
+ detail('Complexity', the_function['(complexity)']);
+ }
+
+ if (data.member) {
+ keys = Object.keys(data.member);
+ if (keys.length) {
+ keys = keys.sort();
+ output.push('/*properties'); + } + output.push('
'); + mem = ' '; + italics = 0; + j = 0; + if (option.confusion) { + for (i = 0; i < keys.length; i += 1) { + key = keys[i]; + if (typeof standard_property_type[key] !== 'string') { + name = ix.test(key) + ? key + : '\'' + key.entityify().replace(nx, sanitize) + '\''; + if (data.member[key] === 1) { + name = '' + name + ''; + italics += 1; + j = 1; + } + if (i < keys.length - 1) { + name += ', '; + } + if (mem.length + name.length - (italics * 7) > 80) { + output.push(mem + '
'); + mem = ' '; + italics = j; + } + mem += name; + j = 0; + } + } + } else { + for (i = 0; i < keys.length; i += 1) { + key = keys[i]; + type = property_type[key]; + if (typeof type !== 'string') { + type = ''; + } + if (standard_property_type[key] !== type) { + name = ix.test(key) + ? key + : '\'' + key.entityify().replace(nx, sanitize) + '\''; + length += name.length + 2; + if (data.member[key] === 1) { + name = '' + name + ''; + italics += 1; + j = 1; + } + if (type) { + name += ': ' + type; + } + if (i < keys.length - 1) { + name += ', '; + } + if (mem.length + name.length - (italics * 7) > 80) { + output.push(mem + '
'); + mem = ' '; + italics = j; + } + mem += name; + j = 0; + } + } + } + output.push(mem + '
*/
').replace(/'/g, ''').replace(/"/g, '"'); -}; - -// conversion de couleur Decimal vers HexaDecimal || 000 si fff -/* FIXME : move it somewhere else */ -IriSP.DEC_HEXA_COLOR = function (dec) { - var hexa='0123456789ABCDEF',hex=''; - var tmp; - while (dec>15){ - tmp = dec-(Math.floor(dec/16))*16; - hex = hexa.charAt(tmp)+hex; - dec = Math.floor(dec/16); - } - hex = hexa.charAt(dec)+hex; - if (hex == "FFCC00"){ hex="";/* by default color of Ldt annotation */ } - return(hex); -}; - - -/* Search methods */ -IriSP.SearchOldValue=""; -IriSP.searchblockOpen=false; -IriSP.searchblock = function () { - IriSP.trace( "__IriSP.searchblock", IriSP.searchblockOpen ); - - if ( IriSP.searchblockOpen == false ) { - IriSP.jQuery( ".ui-icon-search" ).css( "background-position", "-144px -112px" ); - //__IriSP.jQuery("#LdtSearch").animate({height:26},250); - IriSP.jQuery("#LdtSearch").show(250); - /* FIXME : refactor this */ - IriSP.jQuery("#LdtSearchInput").css('background-color','#fff'); - IriSP.jQuery("#LdtSearchInput").focus(); - IriSP.jQuery("#LdtSearchInput").attr('value',IriSP.SearchOldValue); - IriSP.Search(IriSP.SearchOldValue); - IriSP.searchblockOpen = true; - } else { - IriSP.SearchOldValue = IriSP.jQuery("#LdtSearchInput").attr('value'); - IriSP.jQuery("#LdtSearchInput").attr('value',''); - IriSP.SearchClean(); - IriSP.jQuery(".ui-icon-search").css("background-position","-160px -112px"); - //__IriSP.jQuery("#LdtSearch").animate({height:0},250); - IriSP.jQuery("#LdtSearch").hide(250); - IriSP.searchblockOpen = false; - } -}; - -/* Search with typeahead */ -IriSP.Search = function ( value ){ - - annotations = IriSP.LDTligne.annotations; - - IriSP.trace("__IriSP.Search", annotations.length+" "+value); - - var found = 0; - var findmem = 0; - var factor = 0; - IriSP.trace(value,value.length); - var valueS = value.toLowerCase(); - IriSP.trace("__IriSP.Search", annotations.length+" "+valueS); - if(valueS.length>=3){ - - for (var i=0; i < annotations.length; ++i){ - annotation = annotations[i]; - - IriSP.jQuery("#output2").text(annotation.title+" ?= "+value); - - chaine1 = annotation.title.toLowerCase(); - chaine2 = annotation.description.toLowerCase(); - chaine3 = annotation.htmlTags.toLowerCase(); - - if(chaine1.indexOf(valueS,0) !=-1){ - found+=1; - } - if(chaine2.indexOf(valueS,0) !=-1){ - found+=1; - } - if(chaine3.indexOf(valueS,0) !=-1){ - found+=1; - } - - findmem += found; - if(found>0){ - factor = found*8; - IriSP.jQuery("#"+annotation.id).dequeue(); - IriSP.jQuery("#"+annotation.id).animate({height:factor},200); - IriSP.jQuery("#"+annotation.id).css('border','2px'); - IriSP.jQuery("#"+annotation.id).css('border-color','red'); - IriSP.jQuery("#"+annotation.id).animate({opacity:0.6},200); - - IriSP.trace("!!!!!!!!!!!!!!!!!!"," ?= "+annotation.id); - IriSP.jQuery("#LdtSearchInput").css('background-color','#e1ffe1'); - }else { - IriSP.jQuery("#"+annotation.id).dequeue(); - IriSP.jQuery("#"+annotation.id).animate({height:0},250); - IriSP.jQuery("#"+annotation.id).animate({opacity:0.3},200); - } - - found = 0; - } - if(findmem==0){ - IriSP.jQuery("#LdtSearchInput").css('background-color','#f6f6f6'); - } - - } else if(value.length==0){ - IriSP.SearchClean(); - IriSP.jQuery("#LdtSearchInput").css('background-color','#fff'); - } else { - IriSP.SearchClean(); - IriSP.jQuery("#LdtSearchInput").css('background-color','#f6f6f6'); - } -}; - -IriSP.SearchClean = function (){ - annotations = IriSP.LDTligne.annotations; - - for (var i=0; i < annotations.length; ++i){ - annotation = annotations[i]; - IriSP.jQuery("#"+annotation.id).dequeue(); - IriSP.jQuery("#"+annotation.id).animate({height:0},100); - IriSP.jQuery("#"+annotation.id).css('border','0px'); - IriSP.jQuery("#"+annotation.id).css('border-color','red'); - IriSP.jQuery("#"+annotation.id).animate({opacity:0.3},100); - } -}; - - -IriSP.SearchThisSegment = function (annotation){ - /* FIXME: to implement */ - IriSP.jQuery("#LdtSearchInput").text(annotation.title); - IriSP.trace("__IriSP.Ligne.prototype.checkTimeLigne",annotation.title); - /*__IriSP.jQuery("#Ldt-SaDescription").text(annotationTempo.description); - __IriSP.jQuery("#Ldt-SaKeywordText").html("Mots clefs : "+annotationTempo.htmlTags);*/ -}; - - -/* CLASS Ligne (annotationType) */ - -IriSP.LDTligne = null; -__IriSP.Ligne = function( id, title, description, duration ) { - this.id = id; - this.title = title; - this.description = description; - // - this.annotations = new Array(); - this.duration = duration; - this.annotationOldRead = ""; - IriSP.LDTligne = this; - IriSP.trace("__IriSP.Ligne","CREATE "+IriSP.LDTligne); -}; - -__IriSP.Ligne.prototype.addAnnotation = function ( id, begin, end, media, title, description, color, tags ) { - var myAnnotation = new __IriSP.Annotation(id,begin,end,media,title,description,color,tags,this.duration); - this.annotations.push(myAnnotation); - //__IriSP.trace("__IriSP.Ligne.prototype.addAnnotation ","add annotation "+title); -}; - -__IriSP.Ligne.prototype.onClickLigneAnnotation = function( id ) { - /* TODO implement */ - //changePageUrlOffset(currentPosition); - //player.sendEvent('SEEK', this.start); - //__IriSP.trace("SEEK",this.start); -}; - -__IriSP.Ligne.prototype.searchLigneAnnotation = function( id ) { - /* TODO implement */ - /*for (){ - }*/ -}; - -__IriSP.Ligne.prototype.listAnnotations = function() { - /* TODO implement */ -}; - -__IriSP.Ligne.prototype.nextAnnotation = function () { - - var annotationCibleNumber = this.numAnnotation(this.annotationOldRead)+1; - var annotationCible = this.annotations[annotationCibleNumber]; - - if( annotationCibleNumber
=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=
+0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=
+false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
+;/*
+ * jQuery UI Position 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
+left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
+k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
+m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
+d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
+a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
+g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
+;/*
+ * jQuery UI Draggable 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
+"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
+this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options;this.helper=
+this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});
+this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);
+this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=
+d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",
+a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
+a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a=
+{left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&
+d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=
+this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions=
+{width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+
+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!="hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),
+10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-
+this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&
+d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.leftg[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1];h=g?!(h-this.offset.click.topg[3])?h:!(h-this.offset.click.topg[2])?e:!(e-this.offset.click.left<
+g[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:h-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");
+this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.13"});
+d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var h=d.data(this,"sortable");if(h&&!h.options.disabled){c.sortables.push({instance:h,shouldRevert:h.options.revert});h.refreshPositions();h._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=
+0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=
+c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,
+true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=
+0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=
+a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");
+if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e=j&&f<=l||h>=j&&h<=l||fl)&&(e>=
+i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f
').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
+top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
+this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
+nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d'+(c?h:"")+(this._isInRange(a,r)?'":"")+(c?"":h)+"
":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),A=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),C=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x'+(/all|left/.test(t)&&x==0?c?
+f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,A,v)+'
| '+this._get(a,"weekHeader")+" | ":"";for(t=0;t<7;t++){var q=(t+h)%7;D+="'+this._get(a,"calculateWeek")(q)+" | ";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[q]):[true,""],F=q.getMonth()!=g,L=F&&!K||!I[0]||k&&q"+(F&&!C?" ":L?''+q.getDate()+ +"":''+q.getDate()+"")+" | ";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}y+=R+""}g++;if(g>11){g=0;m++}y+="
|---|
',o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?
+r:s};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=
+(h||!(j&&l)?" ":"")+o;k+="
";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,
+"max");b=c&&b"+"
| t |
","
"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=f.isFunction(a);return this.each(function(c){f(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f.clean(arguments);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f.clean(arguments));return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function()
+{for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(W,""):null;if(typeof a=="string"&&!ba.test(a)&&(f.support.leadingWhitespace||!X.test(a))&&!bg[(Z.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Y,"<$1>");try{for(var c=0,d=this.length;c","
"];c.fn.extend({text:function(a){if(c.isFunction(a))return this.each(function(b){var d=
+c(this);d.text(a.call(this,b,d.text()))});if(typeof a!=="object"&&a!==w)return this.empty().append((this[0]&&this[0].ownerDocument||s).createTextNode(a));return c.text(this)},wrapAll:function(a){if(c.isFunction(a))return this.each(function(d){c(this).wrapAll(a.call(this,d))});if(this[0]){var b=c(a,this[0].ownerDocument).eq(0).clone(true);this[0].parentNode&&b.insertBefore(this[0]);b.map(function(){for(var d=this;d.firstChild&&d.firstChild.nodeType===1;)d=d.firstChild;return d}).append(this)}return this},
+wrapInner:function(a){if(c.isFunction(a))return this.each(function(b){c(this).wrapInner(a.call(this,b))});return this.each(function(){var b=c(this),d=b.contents();d.length?d.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){c(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){c.nodeName(this,"body")||c(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.appendChild(a)})},
+prepend:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,this)});else if(arguments.length){var a=c(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,
+this.nextSibling)});else if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,c(arguments[0]).toArray());return a}},remove:function(a,b){for(var d=0,f;(f=this[d])!=null;d++)if(!a||c.filter(a,[f]).length){if(!b&&f.nodeType===1){c.cleanData(f.getElementsByTagName("*"));c.cleanData([f])}f.parentNode&&f.parentNode.removeChild(f)}return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++)for(b.nodeType===1&&c.cleanData(b.getElementsByTagName("*"));b.firstChild;)b.removeChild(b.firstChild);
+return this},clone:function(a){var b=this.map(function(){if(!c.support.noCloneEvent&&!c.isXMLDoc(this)){var d=this.outerHTML,f=this.ownerDocument;if(!d){d=f.createElement("div");d.appendChild(this.cloneNode(true));d=d.innerHTML}return c.clean([d.replace(Ja,"").replace(/=([^="'>\s]+\/)>/g,'="$1">').replace(V,"")],f)[0]}else return this.cloneNode(true)});if(a===true){ra(this,b);ra(this.find("*"),b.find("*"))}return b},html:function(a){if(a===w)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(Ja,
+""):null;else if(typeof a==="string"&&!ta.test(a)&&(c.support.leadingWhitespace||!V.test(a))&&!F[(La.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Ka,Ma);try{for(var b=0,d=this.length;bFlash version "+b.version+ +" or greater is required
"+(g[0]>0?"Your version is "+g:"You have no flash plugin installed")+"
"+(a.tagName=="A"?"Click here to download latest version
":"Download latest version from here
");if(a.tagName=="A")a.onclick=function(){location.href=k}}if(b.onFail){var d=b.onFail.call(this);if(typeof d=="string")a.innerHTML=d}}if(i)window[b.id]=document.getElementById(b.id);f(this,{getRoot:function(){return a},getOptions:function(){return b},getConf:function(){return c}, +getApi:function(){return a.firstChild}})}var i=document.all,k="http://www.adobe.com/go/getflashplayer",n=typeof jQuery=="function",o=/(\d+)[^\d]+(\d+)[^\d]*(\d*)/,j={width:"100%",height:"100%",id:"_"+(""+Math.random()).slice(9),allowfullscreen:true,allowscriptaccess:"always",quality:"high",version:[3,0],onFail:null,expressInstall:null,w3c:false,cachebusting:false};window.attachEvent&&window.attachEvent("onbeforeunload",function(){__flash_unloadHandler=function(){};__flash_savedUnloadHandler=function(){}}); +window.flashembed=function(a,b,c){if(typeof a=="string")a=document.getElementById(a.replace("#",""));if(a){if(typeof b=="string")b={src:b};return new m(a,f(f({},j),b),c)}};var e=f(window.flashembed,{conf:j,getVersion:function(){var a,b;try{b=navigator.plugins["Shockwave Flash"].description.slice(16)}catch(c){try{b=(a=new ActiveXObject("ShockwaveFlash.ShockwaveFlash.7"))&&a.GetVariable("$version")}catch(d){try{b=(a=new ActiveXObject("ShockwaveFlash.ShockwaveFlash.6"))&&a.GetVariable("$version")}catch(h){}}}return(b= +o.exec(b))?[b[1],b[3]]:[0,0]},asString:function(a){if(a===null||a===undefined)return null;var b=typeof a;if(b=="object"&&a.push)b="array";switch(b){case "string":a=a.replace(new RegExp('(["\\\\])',"g"),"\\$1");a=a.replace(/^\s?(\d+\.?\d+)%/,"$1pct");return'"'+a+'"';case "array":return"["+l(a,function(d){return e.asString(d)}).join(",")+"]";case "function":return'"function()"';case "object":b=[];for(var c in a)a.hasOwnProperty(c)&&b.push('"'+c+'":'+e.asString(a[c]));return"{"+b.join(",")+"}"}return String(a).replace(/\s/g, +" ").replace(/\'/g,'"')},getHTML:function(a,b){a=f({},a);var c='';a.width=a.height=a.id=a.w3c=a.src=null;a.onFail=a.version=a.expressInstall=null;for(var d in a)if(a[d])c+= +'';a="";if(b){for(var h in b)if(b[h]){d=b[h];a+=h+"="+(/function|object/.test(typeof d)?e.asString(d):d)+"&"}a=a.slice(0,-1);c+='"}c+="";return c},isSupported:function(a){return g[0]>a[0]||g[0]==a[0]&&g[1]>=a[1]}}),g=e.getVersion();if(n){jQuery.tools=jQuery.tools||{version:"1.2.5"};jQuery.tools.flashembed={conf:j};jQuery.fn.flashembed=function(a,b){return this.each(function(){$(this).data("flashembed",flashembed(this, +a,b))})}}})(); +(function(b){function h(c){if(c){var a=d.contentWindow.document;a.open().close();a.location.hash=c}}var g,d,f,i;b.tools=b.tools||{version:"1.2.5"};b.tools.history={init:function(c){if(!i){if(b.browser.msie&&b.browser.version<"8"){if(!d){d=b("").attr("src","javascript:false;").hide().get(0);b("body").append(d);setInterval(function(){var a=d.contentWindow.document;a=a.location.hash;g!==a&&b.event.trigger("hash",a)},100);h(location.hash||"#")}}else setInterval(function(){var a=location.hash; +a!==g&&b.event.trigger("hash",a)},100);f=!f?c:f.add(c);c.click(function(a){var e=b(this).attr("href");d&&h(e);if(e.slice(0,1)!="#"){location.href="#"+e;return a.preventDefault()}});i=true}}};b(window).bind("hash",function(c,a){a?f.filter(function(){var e=b(this).attr("href");return e==a||e==a.replace("#","")}).trigger("history",[a]):f.eq(0).trigger("history",[a]);g=a});b.fn.history=function(c){b.tools.history.init(this);return this.bind("history",c)}})(jQuery); +(function(b){function k(){if(b.browser.msie){var a=b(document).height(),d=b(window).height();return[window.innerWidth||document.documentElement.clientWidth||document.body.clientWidth,a-d<20?d:a]}return[b(document).width(),b(document).height()]}function h(a){if(a)return a.call(b.mask)}b.tools=b.tools||{version:"1.2.5"};var l;l=b.tools.expose={conf:{maskId:"exposeMask",loadSpeed:"slow",closeSpeed:"fast",closeOnClick:true,closeOnEsc:true,zIndex:9998,opacity:0.8,startOpacity:0,color:"#fff",onLoad:null, +onClose:null}};var c,i,e,g,j;b.mask={load:function(a,d){if(e)return this;if(typeof a=="string")a={color:a};a=a||g;g=a=b.extend(b.extend({},l.conf),a);c=b("#"+a.maskId);if(!c.length){c=b("").attr("id",a.maskId);b("body").append(c)}var m=k();c.css({position:"absolute",top:0,left:0,width:m[0],height:m[1],display:"none",opacity:a.startOpacity,zIndex:a.zIndex});a.color&&c.css("backgroundColor",a.color);if(h(a.onBeforeLoad)===false)return this;a.closeOnEsc&&b(document).bind("keydown.mask",function(f){f.keyCode== +27&&b.mask.close(f)});a.closeOnClick&&c.bind("click.mask",function(f){b.mask.close(f)});b(window).bind("resize.mask",function(){b.mask.fit()});if(d&&d.length){j=d.eq(0).css("zIndex");b.each(d,function(){var f=b(this);/relative|absolute|fixed/i.test(f.css("position"))||f.css("position","relative")});i=d.css({zIndex:Math.max(a.zIndex+1,j=="auto"?0:j)})}c.css({display:"block"}).fadeTo(a.loadSpeed,a.opacity,function(){b.mask.fit();h(a.onLoad);e="full"});e=true;return this},close:function(){if(e){if(h(g.onBeforeClose)=== +false)return this;c.fadeOut(g.closeSpeed,function(){h(g.onClose);i&&i.css({zIndex:j});e=false});b(document).unbind("keydown.mask");c.unbind("click.mask");b(window).unbind("resize.mask")}return this},fit:function(){if(e){var a=k();c.css({width:a[0],height:a[1]})}},getMask:function(){return c},isLoaded:function(a){return a?e=="full":e},getConf:function(){return g},getExposed:function(){return i}};b.fn.mask=function(a){b.mask.load(a);return this};b.fn.expose=function(a){b.mask.load(a,this);return this}})(jQuery); +(function(b){function c(a){switch(a.type){case "mousemove":return b.extend(a.data,{clientX:a.clientX,clientY:a.clientY,pageX:a.pageX,pageY:a.pageY});case "DOMMouseScroll":b.extend(a,a.data);a.delta=-a.detail/3;break;case "mousewheel":a.delta=a.wheelDelta/120;break}a.type="wheel";return b.event.handle.call(this,a,a.delta)}b.fn.mousewheel=function(a){return this[a?"bind":"trigger"]("wheel",a)};b.event.special.wheel={setup:function(){b.event.add(this,d,c,{})},teardown:function(){b.event.remove(this, +d,c)}};var d=!b.browser.mozilla?"mousewheel":"DOMMouseScroll"+(b.browser.version<"1.9"?" mousemove":"")})(jQuery); +(function(c){function p(d,b,a){var e=this,l=d.add(this),h=d.find(a.tabs),i=b.jquery?b:d.children(b),j;h.length||(h=d.children());i.length||(i=d.parent().find(b));i.length||(i=c(b));c.extend(this,{click:function(f,g){var k=h.eq(f);if(typeof f=="string"&&f.replace("#","")){k=h.filter("[href*="+f.replace("#","")+"]");f=Math.max(h.index(k),0)}if(a.rotate){var n=h.length-1;if(f<0)return e.click(n,g);if(f>n)return e.click(0,g)}if(!k.length){if(j>=0)return e;f=a.initialIndex;k=h.eq(f)}if(f===j)return e; +g=g||c.Event();g.type="onBeforeClick";l.trigger(g,[f]);if(!g.isDefaultPrevented()){o[a.effect].call(e,f,function(){g.type="onClick";l.trigger(g,[f])});j=f;h.removeClass(a.current);k.addClass(a.current);return e}},getConf:function(){return a},getTabs:function(){return h},getPanes:function(){return i},getCurrentPane:function(){return i.eq(j)},getCurrentTab:function(){return h.eq(j)},getIndex:function(){return j},next:function(){return e.click(j+1)},prev:function(){return e.click(j-1)},destroy:function(){h.unbind(a.event).removeClass(a.current); +i.find("a[href^=#]").unbind("click.T");return e}});c.each("onBeforeClick,onClick".split(","),function(f,g){c.isFunction(a[g])&&c(e).bind(g,a[g]);e[g]=function(k){k&&c(e).bind(g,k);return e}});if(a.history&&c.fn.history){c.tools.history.init(h);a.event="history"}h.each(function(f){c(this).bind(a.event,function(g){e.click(f,g);return g.preventDefault()})});i.find("a[href^=#]").bind("click.T",function(f){e.click(c(this).attr("href"),f)});if(location.hash&&a.tabs=="a"&&d.find("[href="+location.hash+"]").length)e.click(location.hash); +else if(a.initialIndex===0||a.initialIndex>0)e.click(a.initialIndex)}c.tools=c.tools||{version:"1.2.5"};c.tools.tabs={conf:{tabs:"a",current:"current",onBeforeClick:null,onClick:null,effect:"default",initialIndex:0,event:"click",rotate:false,history:false},addEffect:function(d,b){o[d]=b}};var o={"default":function(d,b){this.getPanes().hide().eq(d).show();b.call()},fade:function(d,b){var a=this.getConf(),e=a.fadeOutSpeed,l=this.getPanes();e?l.fadeOut(e):l.hide();l.eq(d).fadeIn(a.fadeInSpeed,b)},slide:function(d, +b){this.getPanes().slideUp(200);this.getPanes().eq(d).slideDown(400,b)},ajax:function(d,b){this.getPanes().eq(0).load(this.getTabs().eq(d).attr("href"),b)}},m;c.tools.tabs.addEffect("horizontal",function(d,b){m||(m=this.getPanes().eq(0).width());this.getCurrentPane().animate({width:0},function(){c(this).hide()});this.getPanes().eq(d).animate({width:m},function(){c(this).show();b.call()})});c.fn.tabs=function(d,b){var a=this.data("tabs");if(a){a.destroy();this.removeData("tabs")}if(c.isFunction(b))b= +{onBeforeClick:b};b=c.extend({},c.tools.tabs.conf,b);this.each(function(){a=new p(c(this),d,b);c(this).data("tabs",a)});return b.api?a:this}})(jQuery); +(function(c){function p(g,a){function m(f){var e=c(f);return e.length<2?e:g.parent().find(f)}var b=this,i=g.add(this),d=g.data("tabs"),h,j=true,n=m(a.next).click(function(){d.next()}),k=m(a.prev).click(function(){d.prev()});c.extend(b,{getTabs:function(){return d},getConf:function(){return a},play:function(){if(h)return b;var f=c.Event("onBeforePlay");i.trigger(f);if(f.isDefaultPrevented())return b;h=setInterval(d.next,a.interval);j=false;i.trigger("onPlay");return b},pause:function(){if(!h)return b; +var f=c.Event("onBeforePause");i.trigger(f);if(f.isDefaultPrevented())return b;h=clearInterval(h);i.trigger("onPause");return b},stop:function(){b.pause();j=true}});c.each("onBeforePlay,onPlay,onBeforePause,onPause".split(","),function(f,e){c.isFunction(a[e])&&c(b).bind(e,a[e]);b[e]=function(q){return c(b).bind(e,q)}});a.autopause&&d.getTabs().add(n).add(k).add(d.getPanes()).hover(b.pause,function(){j||b.play()});a.autoplay&&b.play();a.clickable&&d.getPanes().click(function(){d.next()});if(!d.getConf().rotate){var l= +a.disabledClass;d.getIndex()||k.addClass(l);d.onBeforeClick(function(f,e){k.toggleClass(l,!e);n.toggleClass(l,e==d.getTabs().length-1)})}}var o;o=c.tools.tabs.slideshow={conf:{next:".forward",prev:".backward",disabledClass:"disabled",autoplay:false,autopause:true,interval:3E3,clickable:true,api:false}};c.fn.slideshow=function(g){var a=this.data("slideshow");if(a)return a;g=c.extend({},o.conf,g);this.each(function(){a=new p(c(this),g);c(this).data("slideshow",a)});return g.api?a:this}})(jQuery); +(function(f){function p(a,b,c){var h=c.relative?a.position().top:a.offset().top,d=c.relative?a.position().left:a.offset().left,i=c.position[0];h-=b.outerHeight()-c.offset[0];d+=a.outerWidth()+c.offset[1];if(/iPad/i.test(navigator.userAgent))h-=f(window).scrollTop();var j=b.outerHeight()+a.outerHeight();if(i=="center")h+=j/2;if(i=="bottom")h+=j;i=c.position[1];a=b.outerWidth()+a.outerWidth();if(i=="center")d-=a/2;if(i=="left")d-=a;return{top:h,left:d}}function u(a,b){var c=this,h=a.add(c),d,i=0,j= +0,m=a.attr("title"),q=a.attr("data-tooltip"),r=o[b.effect],l,s=a.is(":input"),v=s&&a.is(":checkbox, :radio, select, :button, :submit"),t=a.attr("type"),k=b.events[t]||b.events[s?v?"widget":"input":"def"];if(!r)throw'Nonexistent effect "'+b.effect+'"';k=k.split(/,\s*/);if(k.length!=2)throw"Tooltip: bad events configuration for "+t;a.bind(k[0],function(e){clearTimeout(i);if(b.predelay)j=setTimeout(function(){c.show(e)},b.predelay);else c.show(e)}).bind(k[1],function(e){clearTimeout(j);if(b.delay)i= +setTimeout(function(){c.hide(e)},b.delay);else c.hide(e)});if(m&&b.cancelDefault){a.removeAttr("title");a.data("title",m)}f.extend(c,{show:function(e){if(!d){if(q)d=f(q);else if(b.tip)d=f(b.tip).eq(0);else if(m)d=f(b.layout).addClass(b.tipClass).appendTo(document.body).hide().append(m);else{d=a.next();d.length||(d=a.parent().next())}if(!d.length)throw"Cannot find tooltip for "+a;}if(c.isShown())return c;d.stop(true,true);var g=p(a,d,b);b.tip&&d.html(a.data("title"));e=e||f.Event();e.type="onBeforeShow"; +h.trigger(e,[g]);if(e.isDefaultPrevented())return c;g=p(a,d,b);d.css({position:"absolute",top:g.top,left:g.left});l=true;r[0].call(c,function(){e.type="onShow";l="full";h.trigger(e)});g=b.events.tooltip.split(/,\s*/);if(!d.data("__set")){d.bind(g[0],function(){clearTimeout(i);clearTimeout(j)});g[1]&&!a.is("input:not(:checkbox, :radio), textarea")&&d.bind(g[1],function(n){n.relatedTarget!=a[0]&&a.trigger(k[1].split(" ")[0])});d.data("__set",true)}return c},hide:function(e){if(!d||!c.isShown())return c; +e=e||f.Event();e.type="onBeforeHide";h.trigger(e);if(!e.isDefaultPrevented()){l=false;o[b.effect][1].call(c,function(){e.type="onHide";h.trigger(e)});return c}},isShown:function(e){return e?l=="full":l},getConf:function(){return b},getTip:function(){return d},getTrigger:function(){return a}});f.each("onHide,onBeforeShow,onShow,onBeforeHide".split(","),function(e,g){f.isFunction(b[g])&&f(c).bind(g,b[g]);c[g]=function(n){n&&f(c).bind(g,n);return c}})}f.tools=f.tools||{version:"1.2.5"};f.tools.tooltip= +{conf:{effect:"toggle",fadeOutSpeed:"fast",predelay:0,delay:30,opacity:1,tip:0,position:["top","center"],offset:[0,0],relative:false,cancelDefault:true,events:{def:"mouseenter,mouseleave",input:"focus,blur",widget:"focus mouseenter,blur mouseleave",tooltip:"mouseenter,mouseleave"},layout:"",tipClass:"tooltip"},addEffect:function(a,b,c){o[a]=[b,c]}};var o={toggle:[function(a){var b=this.getConf(),c=this.getTip();b=b.opacity;b<1&&c.css({opacity:b});c.show();a.call()},function(a){this.getTip().hide(); +a.call()}],fade:[function(a){var b=this.getConf();this.getTip().fadeTo(b.fadeInSpeed,b.opacity,a)},function(a){this.getTip().fadeOut(this.getConf().fadeOutSpeed,a)}]};f.fn.tooltip=function(a){var b=this.data("tooltip");if(b)return b;a=f.extend(true,{},f.tools.tooltip.conf,a);if(typeof a.position=="string")a.position=a.position.split(/,?\s/);this.each(function(){b=new u(f(this),a);f(this).data("tooltip",b)});return a.api?b:this}})(jQuery); +(function(d){var i=d.tools.tooltip;d.extend(i.conf,{direction:"up",bounce:false,slideOffset:10,slideInSpeed:200,slideOutSpeed:200,slideFade:!d.browser.msie});var e={up:["-","top"],down:["+","top"],left:["-","left"],right:["+","left"]};i.addEffect("slide",function(g){var a=this.getConf(),f=this.getTip(),b=a.slideFade?{opacity:a.opacity}:{},c=e[a.direction]||e.up;b[c[1]]=c[0]+"="+a.slideOffset;a.slideFade&&f.css({opacity:0});f.show().animate(b,a.slideInSpeed,g)},function(g){var a=this.getConf(),f=a.slideOffset, +b=a.slideFade?{opacity:0}:{},c=e[a.direction]||e.up,h=""+c[0];if(a.bounce)h=h=="+"?"-":"+";b[c[1]]=h+"="+f;this.getTip().animate(b,a.slideOutSpeed,function(){d(this).hide();g.call()})})})(jQuery); +(function(g){function j(a){var c=g(window),d=c.width()+c.scrollLeft(),h=c.height()+c.scrollTop();return[a.offset().top<=c.scrollTop(),d<=a.offset().left+a.width(),h<=a.offset().top+a.height(),c.scrollLeft()>=a.offset().left]}function k(a){for(var c=a.length;c--;)if(a[c])return false;return true}var i=g.tools.tooltip;i.dynamic={conf:{classNames:"top right bottom left"}};g.fn.dynamic=function(a){if(typeof a=="number")a={speed:a};a=g.extend({},i.dynamic.conf,a);var c=a.classNames.split(/\s/),d;this.each(function(){var h= +g(this).tooltip().onBeforeShow(function(e,f){e=this.getTip();var b=this.getConf();d||(d=[b.position[0],b.position[1],b.offset[0],b.offset[1],g.extend({},b)]);g.extend(b,d[4]);b.position=[d[0],d[1]];b.offset=[d[2],d[3]];e.css({visibility:"hidden",position:"absolute",top:f.top,left:f.left}).show();f=j(e);if(!k(f)){if(f[2]){g.extend(b,a.top);b.position[0]="top";e.addClass(c[0])}if(f[3]){g.extend(b,a.right);b.position[1]="right";e.addClass(c[1])}if(f[0]){g.extend(b,a.bottom);b.position[0]="bottom";e.addClass(c[2])}if(f[1]){g.extend(b, +a.left);b.position[1]="left";e.addClass(c[3])}if(f[0]||f[2])b.offset[0]*=-1;if(f[1]||f[3])b.offset[1]*=-1}e.css({visibility:"visible"}).hide()});h.onBeforeShow(function(){var e=this.getConf();this.getTip();setTimeout(function(){e.position=[d[0],d[1]];e.offset=[d[2],d[3]]},0)});h.onHide(function(){var e=this.getTip();e.removeClass(a.classNames)});ret=h});return a.api?ret:this}})(jQuery); +(function(e){function p(f,c){var b=e(c);return b.length<2?b:f.parent().find(c)}function u(f,c){var b=this,n=f.add(b),g=f.children(),l=0,j=c.vertical;k||(k=b);if(g.length>1)g=e(c.items,f);e.extend(b,{getConf:function(){return c},getIndex:function(){return l},getSize:function(){return b.getItems().size()},getNaviButtons:function(){return o.add(q)},getRoot:function(){return f},getItemWrap:function(){return g},getItems:function(){return g.children(c.item).not("."+c.clonedClass)},move:function(a,d){return b.seekTo(l+ +a,d)},next:function(a){return b.move(1,a)},prev:function(a){return b.move(-1,a)},begin:function(a){return b.seekTo(0,a)},end:function(a){return b.seekTo(b.getSize()-1,a)},focus:function(){return k=b},addItem:function(a){a=e(a);if(c.circular){g.children("."+c.clonedClass+":last").before(a);g.children("."+c.clonedClass+":first").replaceWith(a.clone().addClass(c.clonedClass))}else g.append(a);n.trigger("onAddItem",[a]);return b},seekTo:function(a,d,h){a.jquery||(a*=1);if(c.circular&&a===0&&l==-1&&d!== +0)return b;if(!c.circular&&a<0||a>b.getSize()||a<-1)return b;var i=a;if(a.jquery)a=b.getItems().index(a);else i=b.getItems().eq(a);var r=e.Event("onBeforeSeek");if(!h){n.trigger(r,[a,d]);if(r.isDefaultPrevented()||!i.length)return b}i=j?{top:-i.position().top}:{left:-i.position().left};l=a;k=b;if(d===undefined)d=c.speed;g.animate(i,d,c.easing,h||function(){n.trigger("onSeek",[a])});return b}});e.each(["onBeforeSeek","onSeek","onAddItem"],function(a,d){e.isFunction(c[d])&&e(b).bind(d,c[d]);b[d]=function(h){h&& +e(b).bind(d,h);return b}});if(c.circular){var s=b.getItems().slice(-1).clone().prependTo(g),t=b.getItems().eq(1).clone().appendTo(g);s.add(t).addClass(c.clonedClass);b.onBeforeSeek(function(a,d,h){if(!a.isDefaultPrevented())if(d==-1){b.seekTo(s,h,function(){b.end(0)});return a.preventDefault()}else d==b.getSize()&&b.seekTo(t,h,function(){b.begin(0)})});b.seekTo(0,0,function(){})}var o=p(f,c.prev).click(function(){b.prev()}),q=p(f,c.next).click(function(){b.next()});if(!c.circular&&b.getSize()>1){b.onBeforeSeek(function(a, +d){setTimeout(function(){if(!a.isDefaultPrevented()){o.toggleClass(c.disabledClass,d<=0);q.toggleClass(c.disabledClass,d>=b.getSize()-1)}},1)});c.initialIndex||o.addClass(c.disabledClass)}c.mousewheel&&e.fn.mousewheel&&f.mousewheel(function(a,d){if(c.mousewheel){b.move(d<0?1:-1,c.wheelSpeed||50);return false}});if(c.touch){var m={};g[0].ontouchstart=function(a){a=a.touches[0];m.x=a.clientX;m.y=a.clientY};g[0].ontouchmove=function(a){if(a.touches.length==1&&!g.is(":animated")){var d=a.touches[0],h= +m.x-d.clientX;d=m.y-d.clientY;b[j&&d>0||!j&&h>0?"next":"prev"]();a.preventDefault()}}}c.keyboard&&e(document).bind("keydown.scrollable",function(a){if(!(!c.keyboard||a.altKey||a.ctrlKey||e(a.target).is(":input")))if(!(c.keyboard!="static"&&k!=b)){var d=a.keyCode;if(j&&(d==38||d==40)){b.move(d==38?-1:1);return a.preventDefault()}if(!j&&(d==37||d==39)){b.move(d==37?-1:1);return a.preventDefault()}}});c.initialIndex&&b.seekTo(c.initialIndex,0,function(){})}e.tools=e.tools||{version:"1.2.5"};e.tools.scrollable= +{conf:{activeClass:"active",circular:false,clonedClass:"cloned",disabledClass:"disabled",easing:"swing",initialIndex:0,item:null,items:".items",keyboard:true,mousewheel:false,next:".next",prev:".prev",speed:400,vertical:false,touch:true,wheelSpeed:0}};var k;e.fn.scrollable=function(f){var c=this.data("scrollable");if(c)return c;f=e.extend({},e.tools.scrollable.conf,f);this.each(function(){c=new u(e(this),f);e(this).data("scrollable",c)});return f.api?c:this}})(jQuery); +(function(b){var f=b.tools.scrollable;f.autoscroll={conf:{autoplay:true,interval:3E3,autopause:true}};b.fn.autoscroll=function(c){if(typeof c=="number")c={interval:c};var d=b.extend({},f.autoscroll.conf,c),g;this.each(function(){var a=b(this).data("scrollable");if(a)g=a;var e,h=true;a.play=function(){if(!e){h=false;e=setInterval(function(){a.next()},d.interval)}};a.pause=function(){e=clearInterval(e)};a.stop=function(){a.pause();h=true};d.autopause&&a.getRoot().add(a.getNaviButtons()).hover(a.pause, +a.play);d.autoplay&&a.play()});return d.api?g:this}})(jQuery); +(function(d){function p(b,g){var h=d(g);return h.length<2?h:b.parent().find(g)}var m=d.tools.scrollable;m.navigator={conf:{navi:".navi",naviItem:null,activeClass:"active",indexed:false,idPrefix:null,history:false}};d.fn.navigator=function(b){if(typeof b=="string")b={navi:b};b=d.extend({},m.navigator.conf,b);var g;this.each(function(){function h(a,c,i){e.seekTo(c);if(j){if(location.hash)location.hash=a.attr("href").replace("#","")}else return i.preventDefault()}function f(){return k.find(b.naviItem|| +"> *")}function n(a){var c=d("<"+(b.naviItem||"a")+"/>").click(function(i){h(d(this),a,i)}).attr("href","#"+a);a===0&&c.addClass(l);b.indexed&&c.text(a+1);b.idPrefix&&c.attr("id",b.idPrefix+a);return c.appendTo(k)}function o(a,c){a=f().eq(c.replace("#",""));a.length||(a=f().filter("[href="+c+"]"));a.click()}var e=d(this).data("scrollable"),k=b.navi.jquery?b.navi:p(e.getRoot(),b.navi),q=e.getNaviButtons(),l=b.activeClass,j=b.history&&d.fn.history;if(e)g=e;e.getNaviButtons=function(){return q.add(k)}; +f().length?f().each(function(a){d(this).click(function(c){h(d(this),a,c)})}):d.each(e.getItems(),function(a){n(a)});e.onBeforeSeek(function(a,c){setTimeout(function(){if(!a.isDefaultPrevented()){var i=f().eq(c);!a.isDefaultPrevented()&&i.length&&f().removeClass(l).eq(c).addClass(l)}},1)});e.onAddItem(function(a,c){c=n(e.getItems().index(c));j&&c.history(o)});j&&f().history(o)});return b.api?g:this}})(jQuery); +(function(a){function t(d,b){var c=this,j=d.add(c),o=a(window),k,f,m,g=a.tools.expose&&(b.mask||b.expose),n=Math.random().toString().slice(10);if(g){if(typeof g=="string")g={color:g};g.closeOnClick=g.closeOnEsc=false}var p=b.target||d.attr("rel");f=p?a(p):d;if(!f.length)throw"Could not find Overlay: "+p;d&&d.index(f)==-1&&d.click(function(e){c.load(e);return e.preventDefault()});a.extend(c,{load:function(e){if(c.isOpened())return c;var h=q[b.effect];if(!h)throw'Overlay: cannot find effect : "'+b.effect+ +'"';b.oneInstance&&a.each(s,function(){this.close(e)});e=e||a.Event();e.type="onBeforeLoad";j.trigger(e);if(e.isDefaultPrevented())return c;m=true;g&&a(f).expose(g);var i=b.top,r=b.left,u=f.outerWidth({margin:true}),v=f.outerHeight({margin:true});if(typeof i=="string")i=i=="center"?Math.max((o.height()-v)/2,0):parseInt(i,10)/100*o.height();if(r=="center")r=Math.max((o.width()-u)/2,0);h[0].call(c,{top:i,left:r},function(){if(m){e.type="onLoad";j.trigger(e)}});g&&b.closeOnClick&&a.mask.getMask().one("click", +c.close);b.closeOnClick&&a(document).bind("click."+n,function(l){a(l.target).parents(f).length||c.close(l)});b.closeOnEsc&&a(document).bind("keydown."+n,function(l){l.keyCode==27&&c.close(l)});return c},close:function(e){if(!c.isOpened())return c;e=e||a.Event();e.type="onBeforeClose";j.trigger(e);if(!e.isDefaultPrevented()){m=false;q[b.effect][1].call(c,function(){e.type="onClose";j.trigger(e)});a(document).unbind("click."+n).unbind("keydown."+n);g&&a.mask.close();return c}},getOverlay:function(){return f}, +getTrigger:function(){return d},getClosers:function(){return k},isOpened:function(){return m},getConf:function(){return b}});a.each("onBeforeLoad,onStart,onLoad,onBeforeClose,onClose".split(","),function(e,h){a.isFunction(b[h])&&a(c).bind(h,b[h]);c[h]=function(i){i&&a(c).bind(h,i);return c}});k=f.find(b.close||".close");if(!k.length&&!b.close){k=a('');f.prepend(k)}k.click(function(e){c.close(e)});b.load&&c.load()}a.tools=a.tools||{version:"1.2.5"};a.tools.overlay={addEffect:function(d, +b,c){q[d]=[b,c]},conf:{close:null,closeOnClick:true,closeOnEsc:true,closeSpeed:"fast",effect:"default",fixed:!a.browser.msie||a.browser.version>6,left:"center",load:false,mask:null,oneInstance:true,speed:"normal",target:null,top:"10%"}};var s=[],q={};a.tools.overlay.addEffect("default",function(d,b){var c=this.getConf(),j=a(window);if(!c.fixed){d.top+=j.scrollTop();d.left+=j.scrollLeft()}d.position=c.fixed?"fixed":"absolute";this.getOverlay().css(d).fadeIn(c.speed,b)},function(d){this.getOverlay().fadeOut(this.getConf().closeSpeed, +d)});a.fn.overlay=function(d){var b=this.data("overlay");if(b)return b;if(a.isFunction(d))d={onBeforeLoad:d};d=a.extend(true,{},a.tools.overlay.conf,d);this.each(function(){b=new t(a(this),d);s.push(b);a(this).data("overlay",b)});return d.api?b:this}})(jQuery); +(function(h){function k(d){var e=d.offset();return{top:e.top+d.height()/2,left:e.left+d.width()/2}}var l=h.tools.overlay,f=h(window);h.extend(l.conf,{start:{top:null,left:null},fadeInSpeed:"fast",zIndex:9999});function o(d,e){var a=this.getOverlay(),c=this.getConf(),g=this.getTrigger(),p=this,m=a.outerWidth({margin:true}),b=a.data("img"),n=c.fixed?"fixed":"absolute";if(!b){b=a.css("backgroundImage");if(!b)throw"background-image CSS property not set for overlay";b=b.slice(b.indexOf("(")+1,b.indexOf(")")).replace(/\"/g, +"");a.css("backgroundImage","none");b=h('"+IriSP.traceNum+" - "+msg+" : "+value+"
" ).appendTo( "#Ldt-output" );
}
+*/
+};
+
+/* used in callbacks - because in callbacks we lose "this",
+ we need to have a special function which wraps "this" in
+ a closure. This way, the
+*/
+IriSP.wrap = function (obj, fn) {
+ return function() {
+ var args = Array.prototype.slice.call(arguments, 0);
+ return fn.apply(obj, args);
+ }
+}
+
+/* convert a time to a percentage in the media */
+IriSP.timeToPourcent = function(time, timetotal){
+ var time = Math.abs(time);
+ var timetotal = Math.abs(timetotal);
+
+ return Math.floor((time/timetotal) * 100);
+};
+
+IriSP.padWithZeros = function(num) {
+ if (Math.abs(num) < 10) {
+ return "0" + num.toString();
+ } else {
+ return num.toString();
+ }
+};
+
+/* convert a number of milliseconds to a tuple of the form
+ [hours, minutes, seconds]
+*/
+IriSP.msToTime = function(ms) {
+ return IriSP.secondsToTime(ms / 1000);
+}
+/* convert a number of seconds to a tuple of the form
+ [hours, minutes, seconds]
+*/
+IriSP.secondsToTime = function(secs) {
+ var hours = Math.abs(parseInt( secs / 3600 ) % 24);
+ var minutes = Math.abs(parseInt( secs / 60 ) % 60);
+ var seconds = parseFloat(Math.abs(secs % 60).toFixed(0));
+
+ var toString_fn = function() {
+ var ret = "";
+ if (hours > 0)
+ ret = IriSP.padWithZeros(this.hours) + ":";
+ ret += IriSP.padWithZeros(this.minutes) + ":" + IriSP.padWithZeros(this.seconds);
+
+ return ret;
+ }
+ return {"hours" : hours, "minutes" : minutes, "seconds" : seconds, toString: toString_fn};
+};
+
+/* format a tweet - replaces @name by a link to the profile, #hashtag, etc. */
+IriSP.formatTweet = function(tweet) {
+ /*
+ an array of arrays which hold a regexp and its replacement.
+ */
+ var regExps = [
+ /* copied from http://codegolf.stackexchange.com/questions/464/shortest-url-regex-match-in-javascript/480#480 */
+ [/((https?:\/\/)?[\w-]+(\.[\w-]+)+\.?(:\d+)?(\/\S*)?)/gi, "$1"],
+ [/@(\w+)/gi, "@$1"], // matches a @handle
+ [/#(\w+)/gi, "#$1"],// matches a hashtag
+ [/(\+\+)/gi, "$1"],
+ [/(--)/gi, "$1"],
+ [/(==)/gi, "$1"],
+ [/(\?\?)/gi, "$1"]
+ ];
+
+ var i = 0;
+ for(i = 0; i < regExps.length; i++) {
+ tweet = tweet.replace(regExps[i][0], regExps[i][1]);
+ }
+
+ return tweet;
+};
+
+IriSP.countProperties = function(obj) {
+ var count = 0;
+
+ for(var prop in obj) {
+ if(obj.hasOwnProperty(prop))
+ ++count;
+ }
+
+ return count;
};
+// conversion de couleur Decimal vers HexaDecimal || 000 si fff
+IriSP.DEC_HEXA_COLOR = function (dec) {
+ var val = +dec;
+ var str = val.toString(16);
+ var zeroes = "";
+ if (str.length < 6) {
+ for (var i = 0; i < 6 - str.length; i++)
+ zeroes += "0";
+ }
+ return zeroes + str;
+};
+
+/* shortcut to have global variables in templates */
+IriSP.templToHTML = function(template, values) {
+ var params = IriSP.underscore.extend(
+ { "defaults" : IriSP.default_templates_vars,
+ "l10n" : IriSP.i18n.getMessages()
+ },
+ values);
+ return Mustache.to_html(template, params);
+};
+
+/* we need to be stricter than encodeURIComponent,
+ because of twitter
+*/
+IriSP.encodeURI = function(str) {
+ return encodeURIComponent(str).replace(/!/g, '%21').replace(/'/g, '%27').replace(/\(/g, '%28').
+ replace(/\)/g, '%29').replace(/\*/g, '%2A');
+}
+
+IriSP.jqEscape = function(text) {
+ return text.replace(/(:|\.)/g,'\\$1')
+}
+
+IriSP.jqId = function (text) {
+ return IriSP.jQuery('#' + IriSP.jqEscape(text));
+ }
+
+IriSP.__guidCounter = 0;
+IriSP.guid = function(prefix) {
+ IriSP.__guidCounter += 1;
+ return prefix + IriSP.__guidCounter;
+};
+
+/** returns an url to share on facebook */
+IriSP.mkFbUrl = function(url, text) {
+ if (typeof(text) === "undefined")
+ text = "I'm watching ";
+
+ return "http://www.facebook.com/share.php?u=" + IriSP.encodeURI(text) + IriSP.shorten_url(url);
+};
+
+/** returns an url to share on twitter */
+IriSP.mkTweetUrl = function(url, text) {
+ if (typeof(text) === "undefined")
+ text = "I'm watching ";
+
+ return "http://twitter.com/home?status=" + IriSP.encodeURI(text) + IriSP.shorten_url(url);
+};
+
+/** returns an url to share on google + */
+IriSP.mkGplusUrl = function(url, text) {
+ return "https://plusone.google.com/_/+1/confirm?hl=en&url=" + IriSP.shorten_url(url);
+};
+
+/** test if a value is null or undefined */
+IriSP.null_or_undefined = function(val) {
+ return (typeof(val) === "undefined" || val === null);
+};
+
+/** get a property that can have multiple names **/
+
+IriSP.get_aliased = function(_obj, _aliases) {
+ for (var _i = 0; _i < _aliases.length; _i++) {
+ if (typeof _obj[_aliases[_i]] !== "undefined") {
+ return _obj[_aliases[_i]];
+ }
+ }
+ return null;
+}
+
+/** issue a call to an url shortener and return the shortened url */
+IriSP.shorten_url = function(url) {
+ if (IriSP.config.shortener.hasOwnProperty("shortening_function"))
+ return IriSP.config.shortener.shortening_function(url);
+
+ return url;
+};
+
+
+/* for ie compatibility
+if (Object.prototype.__defineGetter__&&!Object.defineProperty) {
+ Object.defineProperty=function(obj,prop,desc) {
+ if ("get" in desc) obj.__defineGetter__(prop,desc.get);
+ if ("set" in desc) obj.__defineSetter__(prop,desc.set);
+ }
+}
+*/
+
+/* Creates regexps from text */
+IriSP.regexpFromText = function(_text) {
+ return new RegExp('(' + _text.replace(/(\W)/gim,'\\$1') + ')','gim');
+}
diff -r 7b55777486c3 -r 75ba66457232 src/js/widgets.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/js/widgets.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,96 @@
+/* the widget classes and definitions */
+
+/**
+ * @class Widget is an "abstract" class. It's mostly used to define some properties common to every widget.
+ *
+ * Note that widget constructors are never called directly by the user. Instead, the widgets are instantiated by functions
+ * defined in init.js
+ *
+ * @constructor
+ * @param Popcorn a reference to the popcorn Object
+ * @param config configuration options for the widget
+ * @param Serializer a serializer instance from which the widget reads data fromCharCode
+*/
+IriSP.Widget = function(Popcorn, config, Serializer) {
+
+ if (config === undefined || config === null) {
+ config = {}
+ }
+
+ this._Popcorn = Popcorn;
+ this._config = config;
+ this._serializer = Serializer;
+
+ if (config.hasOwnProperty("container")) {
+ this._id = config.container;
+ this.selector = IriSP.jQuery("#" + this._id);
+ }
+
+ if (config.hasOwnProperty("spacer")) {
+ this._spacerId = config.spacer;
+ this.spacer = IriSP.jQuery("#" + this._spacerId);
+ }
+
+
+ if (config.hasOwnProperty("width")) {
+ // this.width and not this._width because we consider it public.
+ this.width = config.width;
+ }
+
+ if (config.hasOwnProperty("height")) {
+ this.height = config.height;
+ }
+
+ if (config.hasOwnProperty("heightmax")) {
+ this.heightmax = config.heightmax;
+ }
+
+ if (config.hasOwnProperty("widthmax")) {
+ this.widthmax = config.widthmax;
+ }
+
+ if (config.hasOwnProperty("layoutManager")) {
+ this.layoutManager = config.layoutManager;
+ }
+ if (typeof this.selector != "undefined") {
+ this.selector.addClass("Ldt-TraceMe").addClass("Ldt-Widget");
+ this.selector.attr("widget-type", this._config.type);
+ }
+
+ // Parsing Widget Defaults
+ var _this = this;
+
+ if (typeof config.type == "string" && typeof IriSP.widgetsDefaults[config.type] == "object") {
+ IriSP._(IriSP.widgetsDefaults[config.type]).each(function(_v, _k) {
+ if (typeof config[_k] != "undefined") {
+ _this[_k] = config[_k];
+ } else {
+ _this[_k] = _v;
+ }
+ });
+ }
+
+};
+
+
+IriSP.Widget.prototype.currentMedia = function() {
+ return this._serializer.currentMedia();
+}
+
+IriSP.Widget.prototype.getDuration = function() {
+ return this._serializer.getDuration();
+}
+
+/**
+ * This method responsible of drawing a widget on screen.
+ */
+IriSP.Widget.prototype.draw = function() {
+ /* implemented by "sub-classes" */
+};
+
+/**
+ * Optional method if you want your widget to support redraws.
+ */
+IriSP.Widget.prototype.redraw = function() {
+ /* implemented by "sub-classes" */
+};
diff -r 7b55777486c3 -r 75ba66457232 src/js/widgets/annotationsListWidget.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/js/widgets/annotationsListWidget.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,281 @@
+IriSP.AnnotationsListWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+ this.__counter = 0;
+ this.__oldList = [];
+ this.searchRe = null;
+ this._ajax_cache = [];
+ var _this = this;
+
+ this._Popcorn.listen("IriSP.search", function(searchString) {
+ _this.searchHandler(searchString);
+ });
+ this._Popcorn.listen("IriSP.search.closed", function() {
+ _this.searchHandler(false);
+ });
+ this._Popcorn.listen("IriSP.search.cleared", function() {
+ _this.searchHandler(false);
+ });
+};
+
+
+IriSP.AnnotationsListWidget.prototype = new IriSP.Widget();
+
+IriSP.AnnotationsListWidget.prototype.clear = function() {
+};
+
+IriSP.AnnotationsListWidget.prototype.clearWidget = function() {
+};
+
+IriSP.AnnotationsListWidget.prototype.searchHandler = function(searchString) {
+ this.searchRe = (searchString && searchString.length) ? IriSP.regexpFromText(searchString) : null;
+ if (this.ajax_mode && !this.cinecast_version) {
+ var _this = this,
+ _annotations = (
+ this.searchRe === null
+ ? this._ajax_cache
+ : IriSP.underscore.filter(this._ajax_cache, function(_a) {
+ return (_this.searchRe.test(_a.desc) || _this.searchRe.test(_a.title));
+ })
+ );
+ this.do_redraw(_annotations);
+ if (_annotations.length) {
+ this._Popcorn.trigger("IriSP.search.matchFound");
+ } else {
+ this._Popcorn.trigger("IriSP.search.noMatchFound");
+ }
+ } else {
+ this.drawList();
+ }
+}
+
+/** effectively redraw the widget - called by drawList */
+IriSP.AnnotationsListWidget.prototype.do_redraw = function(list) {
+ var _html = IriSP.templToHTML(
+ IriSP.annotationsListWidget_template, {
+ annotations: list
+ }),
+ _this = this;
+
+ this.selector.html(_html);
+
+ this.selector.find('.Ldt-AnnotationsList-Tag-Li').click(function() {
+ _this._Popcorn.trigger("IriSP.search.triggeredSearch", IriSP.jQuery(this).text().trim());
+ })
+
+ if (this.searchRe !== null) {
+ this.selector.find(".Ldt-AnnotationsList-Title a, .Ldt-AnnotationsList-Description")
+ .each(function() {
+ var _$ = IriSP.jQuery(this);
+ _$.html(_$.text().trim().replace(_this.searchRe, '$1'))
+ })
+ }
+};
+
+IriSP.AnnotationsListWidget.prototype.transformAnnotation = function(a) {
+ var _this = this;
+ return {
+ "id" : a.id,
+ "title": this.cinecast_version ? IriSP.get_aliased(a.meta, ['creator_name', 'creator']) : a.content.title,
+ "desc" : this.cinecast_version ? a.content.data : a.content.description,
+ "begin": IriSP.msToTime(a.begin),
+ "end" : IriSP.msToTime(a.end),
+ "thumbnail" : (typeof a.meta == "object" && typeof a.meta.thumbnail == "string") ? a.meta.thumbnail : this.default_thumbnail,
+ "url" : (typeof a.meta == "object" && typeof a.meta.url == "string") ? a.meta.url : null,
+ "created_at" :(typeof a.meta == "object" && typeof a.meta.created == "string") ? Date.parse(a.meta.created.replace(/^(\d{4})-(\d{2})-(\d{2})T(\d{2}\:\d{2}\:\d{2}).*$/,"$2/$3/$1 $4 UTC+0000")) : null,
+ "tags": typeof a.tags == "object"
+ ? IriSP.underscore(a.tags)
+ .chain()
+ .map(function(_t) {
+ if (typeof _t == "string") {
+ return _t.replace(/^.*:/,'#');
+ } else {
+ if (typeof _t['id-ref'] != "undefined") {
+ var _f = IriSP.underscore.find(_this._serializer._data.tags, function(_tag) {
+ return _tag.id == _t['id-ref'];
+ });
+ if (typeof _f != "undefined") {
+ return IriSP.get_aliased(_f.meta, ['dc:title', 'title']);
+ }
+ }
+ }
+ return null;
+ })
+ .filter(function(_t) {
+ return _t !== null && _t !== ""
+ })
+ .value()
+ : []
+ }
+}
+
+/** draw the annotation list */
+IriSP.AnnotationsListWidget.prototype.drawList = function(force_redraw) {
+ var _this = this;
+
+// var view_type = this._serializer.getContributions();
+ var annotations = this._serializer._data.annotations;
+ var currentTime = this._Popcorn.currentTime();
+ var list = [];
+
+/* if (typeof(view_type) === "undefined") {
+ return;
+} */
+ for (i = 0; i < annotations.length; i++) {
+ var obj = this.transformAnnotation(annotations[i]);
+ obj.iterator = i;
+ obj.distance = Math.abs((annotations[i].end + annotations[i].begin) / 2000 - currentTime);
+ if (!this.cinecast_version || annotations[i].type == "cinecast:UserAnnotation") {
+ list.push(obj);
+ }
+
+ }
+
+ if (this.searchRe !== null) {
+ list = list.filter(function(_a) {
+ return (_this.searchRe.test(_a.desc) || _this.searchRe.test(_a.title));
+ });
+ if (list.length) {
+ this._Popcorn.trigger("IriSP.search.matchFound");
+ } else {
+ this._Popcorn.trigger("IriSP.search.noMatchFound");
+ }
+ }
+ list = IriSP.underscore(list)
+ .chain()
+ .sortBy(function(_o) {
+ return _o.distance;
+ })
+ .first(10)
+ .sortBy(function(_o) {
+ return (_this.cinecast_version ? - _o.created_at : _o.iterator);
+ })
+ .value();
+ var idList = IriSP.underscore.pluck(list, "id").sort();
+
+
+ if (!IriSP.underscore.isEqual(this.__oldList, idList) || this.lastSearch !== this.searchRe || typeof(force_redraw) !== "undefined") {
+ this.do_redraw(list);
+ this.__oldList = idList;
+ this.lastSearch = this.searchRe;
+ }
+ /* save for next call */
+
+
+};
+
+IriSP.AnnotationsListWidget.prototype.ajaxRedraw = function(timecode) {
+
+ /* the seeked signal sometimes passes an argument - depending on if we're using
+ our popcorn lookalike or the real thing - if it's the case, use it as it's
+ more precise than currentTime which sometimes contains the place we where at */
+ if (IriSP.null_or_undefined(timecode) || typeof(timecode) != "number") {
+ var tcode = this._Popcorn.currentTime();
+ } else {
+ var tcode = timecode;
+ }
+
+
+ /* the platform gives us a special url - of the type : http://path/{{media}}/{{begin}}/{{end}}
+ we double the braces using regexps and we feed it to mustache to build the correct url
+ we have to do that because the platform only knows at run time what view it's displaying.
+ */
+
+ var media_id = this.currentMedia()["id"];
+ var duration = this.getDuration();
+
+ var begin_timecode = (Math.floor(tcode) - 300) * 1000;
+ if (begin_timecode < 0)
+ begin_timecode = 0;
+
+ var end_timecode = (Math.floor(tcode) + 300) * 1000;
+ if (end_timecode > duration)
+ end_timecode = duration;
+
+ var templ = Mustache.to_html(this.ajax_url, {media: media_id, begin: begin_timecode,
+ end: end_timecode});
+
+ /* we create on the fly a serializer to get the ajax */
+ var serializer = new IriSP.JSONSerializer(IriSP.__dataloader, templ);
+ serializer.sync(IriSP.wrap(this, function(json) { this.processJson(json, serializer) }));
+};
+
+/** process the received json - it's a bit hackish */
+IriSP.AnnotationsListWidget.prototype.processJson = function(json, serializer) {
+ /* FIXME: DRY the whole thing */
+ var annotations = serializer._data.annotations;
+ if (IriSP.null_or_undefined(annotations))
+ return;
+
+ /*
+ commented in case we wanted to discriminate against some annotation types.
+ var view_types = serializer.getIds("Contributions");
+ */
+ var l = [];
+
+ var media = this.currentMedia()["id"];
+
+ for (i = 0; i < annotations.length; i++) {
+ var obj = this.transformAnnotation(annotations[i])
+ if (typeof obj.url == "undefined" || !obj.url) {
+ /* only if the annotation isn't present in the document create an
+ external link */
+ if (this.annotations_ids.indexOf(obj.id.toLowerCase()) == -1) {
+ // braindead url; jacques didn't want to create a new one in the platform,
+ // so we append the cutting id to the url.
+ obj.url = this.project_url + "/" + media + "/" +
+ annotations[i].meta.project + "/" +
+ annotations[i].meta["id-ref"] + '#id=' + annotations[i].id;
+
+ // obj.url = document.location.href.split("#")[0] + "/" + annotation.meta.project;
+ }
+ }
+ l.push(obj);
+ }
+ this._ajax_cache = l;
+ this.do_redraw(l);
+};
+IriSP.AnnotationsListWidget.prototype.draw = function() {
+
+ /* build a table of the annotations present in the document for faster
+ lookup
+ */
+ this.annotations_ids = IriSP.underscore(this._serializer._data.annotations).map(function(_a) {
+ return _a.id.toLowerCase();
+ });
+
+ var _this = this;
+
+ if (!this.ajax_mode || this.cinecast_version) {
+ var _throttled = IriSP.underscore.throttle(function() {
+ _this.drawList();
+ }, 1500);
+ _throttled();
+ this._Popcorn.listen("IriSP.createAnnotationWidget.addedAnnotation", _throttled);
+ this._Popcorn.listen("timeupdate", _throttled);
+ if (this.cinecast_version) {
+ window.setInterval(function() {
+ var _tmpSerializer = new IriSP.JSONSerializer(IriSP.__dataloader, _this._config.metadata.src, true);
+ _tmpSerializer.sync(function(json) {
+ IriSP.underscore(json.annotations).each(function(_a) {
+ var _j = _this.annotations_ids.indexOf(_a.id);
+ if (_j == -1) {
+ _this._serializer._data.annotations.push(_a);
+ _this.annotations_ids.push(_a.id);
+ } else {
+ _this._serializer._data.annotations[_j] = _a;
+ }
+ _throttled();
+ });
+ }, true); // true is for force_refresh
+ },this.refresh_interval);
+ }
+ } else {
+ /* update the widget when the video has finished loading and when it's seeked and paused */
+ this._Popcorn.listen("seeked", IriSP.wrap(this, this.ajaxRedraw));
+ this._Popcorn.listen("loadedmetadata", IriSP.wrap(this, this.ajaxRedraw));
+ this._Popcorn.listen("paused", IriSP.wrap(this, this.ajaxRedraw));
+
+ this._Popcorn.listen("IriSP.createAnnotationWidget.addedAnnotation", IriSP.wrap(this, this.ajaxRedraw));
+ }
+
+};
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 src/js/widgets/annotationsWidget.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/js/widgets/annotationsWidget.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,139 @@
+/* Internationalization for this widget */
+
+IriSP.i18n.addMessages(
+ {
+ "fr": {
+ "keywords": "Mots-clés"
+ },
+ "en": {
+ "keywords": "Keywords"
+ }
+ }
+);
+
+IriSP.AnnotationsWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+ /* flag used when we're creating an annotation */
+ this._hidden = false;
+};
+
+
+IriSP.AnnotationsWidget.prototype = new IriSP.Widget();
+
+IriSP.AnnotationsWidget.prototype.clear = function() {
+ this.selector.find(".Ldt-SaTitle").text("");
+ this.selector.find(".Ldt-SaDescription").text("");
+ this.selector.find(".Ldt-SaKeywordText").text("");
+};
+
+IriSP.AnnotationsWidget.prototype.displayAnnotation = function(annotation) {
+ var title = annotation.content.title;
+ var description = annotation.content.description;
+ var keywords = "";
+ var begin = +annotation.begin / 1000;
+ var end = +annotation.end / 1000;
+ var duration = this.getDuration();
+ var tags = "";
+
+ var title_templ = "{{title}} - ( {{begin}} - {{end}} )";
+ var endstr = Mustache.to_html(title_templ, {title: title, begin: IriSP.secondsToTime(begin), end: IriSP.secondsToTime(end)});
+
+ this.selector.find(".Ldt-SaTitle").text(endstr);
+ this.selector.find(".Ldt-SaDescription").text(description);
+
+
+ if (!IriSP.null_or_undefined(annotation.tags) && !IriSP.null_or_undefined(this._serializer._data.tags)) {
+ /* save the tag id and keywords in a unique structure */
+ var tag_list = {};
+ for (var i = 0; i < this._serializer._data.tags.length; i++) {
+ var id = this._serializer._data.tags[i]["id"];
+ var keyword = IriSP.get_aliased(this._serializer._data.tags[i]["meta"], ["dc:title", "title"]);
+
+ tag_list[id] = keyword;
+ }
+
+ /* then browse the list of defined tags for the current annotation */
+ for (var i = 0; i < annotation.tags.length; i++) {
+ if (tag_list.hasOwnProperty(annotation.tags[i]["id-ref"]))
+ tags += tag_list[annotation.tags[i]["id-ref"]] + ", ";
+ }
+ }
+
+ tags = IriSP.i18n.getMessage("keywords") + ": " + tags.slice(0, tags.length - 2);
+
+ this.selector.find(".Ldt-SaKeywords").text(tags);
+
+ // update sharing buttons
+ var url = document.location.href + "#id=" + annotation.id;
+ this.selector.find(".Ldt-fbShare").attr("href", IriSP.mkFbUrl(url, this.share_text));
+ this.selector.find(".Ldt-TwShare").attr("href", IriSP.mkTweetUrl(url, this.share_text));
+ this.selector.find(".Ldt-GplusShare").attr("href", IriSP.mkGplusUrl(url, this.share_text));
+};
+
+IriSP.AnnotationsWidget.prototype.clearWidget = function() {
+ /* retract the pane between two annotations */
+ this.selector.find(".Ldt-SaTitle").text("");
+ this.selector.find(".Ldt-SaDescription").text("");
+ this.selector.find(".Ldt-SaKeywordText").html("");
+ this.selector.find(".Ldt-ShowAnnotation").slideUp();
+};
+
+IriSP.AnnotationsWidget.prototype.draw = function() {
+ var _this = this;
+
+ var annotationMarkup = IriSP.templToHTML(IriSP.annotationWidget_template);
+ this.selector.append(annotationMarkup);
+
+ this._Popcorn.listen("IriSP.AnnotationsWidget.show",
+ IriSP.wrap(this, this.show));
+ this._Popcorn.listen("IriSP.AnnotationsWidget.hide",
+ IriSP.wrap(this, this.hide));
+
+ var legal_ids = [];
+ if (typeof(this._serializer.getChapitrage()) !== "undefined")
+ legal_ids.push(this._serializer.getChapitrage());
+ else
+ legal_ids = this._serializer.getNonTweetIds();
+
+ var annotations = this._serializer._data.annotations;
+ var i;
+
+ for (i in annotations) {
+ var annotation = annotations[i];
+ var begin = Math.round((+ annotation.begin) / 1000);
+ var end = Math.round((+ annotation.end) / 1000);
+
+ if (typeof(annotation.meta) !== "undefined" && typeof(annotation.meta["id-ref"]) !== "undefined"
+ && !IriSP.underscore.include(legal_ids, annotation.meta["id-ref"])) {
+ continue;
+ }
+
+
+ var conf = {start: begin, end: end,
+ onStart:
+ function(annotation) {
+ return function() {
+ _this.displayAnnotation(annotation);
+
+ } }(annotation),
+ onEnd:
+ function() { _this.clearWidget.call(_this); }
+ };
+ this._Popcorn = this._Popcorn.code(conf);
+ }
+
+};
+
+IriSP.AnnotationsWidget.prototype.hide = function() {
+ if (this._hidden == false) {
+ this.selector.hide();
+ this._hidden = true;
+ }
+};
+
+IriSP.AnnotationsWidget.prototype.show = function() {
+ if (this._hidden == true) {
+ this.selector.show();
+ this._hidden = false;
+ }
+};
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 src/js/widgets/arrowWidget.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/js/widgets/arrowWidget.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,91 @@
+IriSP.ArrowWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+
+ this._oldAnnotation = null;
+ this._blockArrow = false;
+};
+
+
+IriSP.ArrowWidget.prototype = new IriSP.Widget();
+
+IriSP.ArrowWidget.prototype.clear = function() {
+
+};
+
+IriSP.ArrowWidget.prototype.clearWidget = function() {
+};
+
+IriSP.ArrowWidget.prototype.draw = function() {
+ var templ = Mustache.to_html(IriSP.arrowWidget_template, {});
+ this.selector.append(templ);
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.timeUpdateHandler));
+ this._Popcorn.listen("IriSP.ArrowWidget.blockArrow", IriSP.wrap(this, this.blockArrow));
+ this._Popcorn.listen("IriSP.ArrowWidget.releaseArrow", IriSP.wrap(this, this.releaseArrow));
+
+};
+
+IriSP.ArrowWidget.prototype.timeUpdateHandler = function(percents) {
+ if (this._blockArrow)
+ return;
+
+ var currentTime = this._Popcorn.currentTime();
+ var currentAnnotation = this._serializer.currentChapitre(currentTime);
+ if (IriSP.null_or_undefined(currentAnnotation)) {
+ var c_annots = this._serializer.currentAnnotation(currentTime)
+ if (c_annots.length != 0)
+ var currentAnnotation = c_annots[0]; // FIXME : use the others ?
+ else
+ return;
+ }
+
+ /* move the arrow only if the current annotation changes */
+ if (currentAnnotation != this._oldAnnotation) {
+ var begin = (+ currentAnnotation.begin) / 1000;
+ var end = (+ currentAnnotation.end) / 1000;
+
+ var duration = this.getDuration() / 1000;
+ var middle_time = (begin + end) / 2;
+ var percents = middle_time / duration;
+
+ // we need to apply a fix because the arrow has a certain length
+ // it's half the length of the arrow (27 / 2). We need to convert
+ // it in percents though.
+ var totalWidth = this.selector.width();
+ var pixels = percents * totalWidth;
+ var correction = (27 / 2);
+ var corrected_pixels = pixels - correction;
+
+ /* make sure that the arrow is aligned with the pattern
+ of the widget under it */
+ if (corrected_pixels % 3 != 0)
+ corrected_pixels -= (corrected_pixels % 3 - 1);
+
+ /* don't move out of the screen */
+ if (corrected_pixels <= 0)
+ corrected_pixels = 0;
+
+ if (corrected_pixels <= 15) {
+ this.selector.children(".Ldt-arrowWidget").removeClass("Ldt-arrowLeftEdge Ldt-arrowCenter Ldt-arrowRightEdge")
+ .addClass("Ldt-arrowLeftEdge");
+ } else if (corrected_pixels >= totalWidth - 25) {
+ this.selector.children(".Ldt-arrowWidget").removeClass("Ldt-arrowLeftEdge Ldt-arrowCenter Ldt-arrowRightEdge")
+ .addClass("Ldt-arrowRightEdge");
+ } else {
+ this.selector.children(".Ldt-arrowWidget").removeClass("Ldt-arrowLeftEdge Ldt-arrowCenter Ldt-arrowRightEdge")
+ .addClass("Ldt-arrowCenter");
+ }
+
+ this.selector.children(".Ldt-arrowWidget").animate({"left" : corrected_pixels + "px"});
+
+ this._oldAnnotation = currentAnnotation;
+ }
+};
+
+/** Block the arrow for instance when the user is annotating */
+IriSP.ArrowWidget.prototype.blockArrow = function() {
+ this._blockArrow = true;
+};
+
+IriSP.ArrowWidget.prototype.releaseArrow = function() {
+ this._blockArrow = false;
+};
diff -r 7b55777486c3 -r 75ba66457232 src/js/widgets/createAnnotationWidget.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/js/widgets/createAnnotationWidget.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,511 @@
+/* Internationalization for this widget */
+
+IriSP.i18n.addMessages(
+ {
+ "en": {
+ "submit": "Submit",
+ "add_keywords": "Add keywords",
+ "add_polemic_keywords": "Add polemic keywords",
+ "your_name": "Your name",
+ "type_here": "Type your annotation here.",
+ "wait_while_processed": "Please wait while your request is being processed...",
+ "error_while_contacting": "An error happened while contacting the server. Your annotation has not been saved.",
+ "empty_annotation": "Your annotation is empty. Please write something before submitting.",
+ "annotation_saved": "Thank you, your annotation has been saved.",
+ "share_annotation": "Would you like to share it on social networks ?",
+ "share_on": "Share on",
+ "more_tags": "More tags"
+ },
+ "fr": {
+ "submit": "Envoyer",
+ "add_keywords": "Ajouter des mots-clés",
+ "add_polemic_keywords": "Ajouter des mots-clés polémiques",
+ "your_name": "Votre nom",
+ "type_here": "Rédigez votre annotation ici.",
+ "wait_while_processed": "Veuillez patienter pendant le traitement de votre requête...",
+ "error_while_contacting": "Une erreur s'est produite en contactant le serveur. Votre annotation n'a pas été enregistrée",
+ "empty_annotation": "Votre annotation est vide. Merci de rédiger un texte avant de l'envoyer.",
+ "annotation_saved": "Merci, votre annotation a été enregistrée.",
+ "share_annotation": "Souhaitez-vous la partager sur les réseaux sociaux ?",
+ "share_on": "Partager sur",
+ "more_tags": "Plus de mots-clés"
+ }
+ }
+);
+
+IriSP.createAnnotationWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+ this._hidden = true;
+
+ if (!IriSP.null_or_undefined(IriSP.user)) {
+ if (!IriSP.null_or_undefined(IriSP.user.avatar)) {
+ this.user_avatar = IriSP.user.avatar;
+ }
+ if (!IriSP.null_or_undefined(IriSP.user.name)) {
+ this.user_name = IriSP.user.name;
+ }
+ }
+
+ /* variables to save the current position of the slicer */
+ if (this.cinecast_version) {
+ this.sliceLeft = 0;
+ this.sliceWidth = 0;
+ }
+};
+
+
+IriSP.createAnnotationWidget.prototype = new IriSP.Widget();
+
+IriSP.createAnnotationWidget.prototype.clear = function() {
+ this.selector.find(".Ldt-SaTitle").text("");
+ this.selector.find(".Ldt-SaDescription").text("");
+ this.selector.find(".Ldt-SaKeywordText").text("");
+};
+
+IriSP.createAnnotationWidget.prototype.draw = function() {
+ var _this = this;
+ if (typeof this.remote_tags == "object") {
+ IriSP.jQuery.getJSON((typeof this.remote_tags.alias == "string" ? this.remote_tags.alias : this.remote_tags.url), function(_json) {
+ _this.tags = _json.tags;
+ _this.drawCallback();
+ });
+ } else {
+ this.drawCallback();
+ }
+}
+
+IriSP.createAnnotationWidget.prototype.drawCallback = function() {
+ var _this = this;
+
+ var annotationMarkup = IriSP.templToHTML(IriSP.createAnnotationWidget_template,
+ this);
+
+ this.selector.append(annotationMarkup);
+
+ if (!this.cinecast_version)
+ this.selector.hide();
+ else {
+ this.showStartScreen();
+ }
+
+ if (this.random_tags) {
+ this.selector.find(".Ldt-createAnnotation-keywords li").hide();
+ this.showMoreTags();
+ this.selector.find('.Ldt-createAnnotation-moar-keywordz').click(function() {
+ _this.showMoreTags();
+ })
+ }
+ // Add onclick event to both polemic and keywords buttons
+
+ this.selector.find(".Ldt-createAnnotation-keyword-button, .Ldt-createAnnotation-polemic-button").click(function() {
+ _this.addKeyword(IriSP.jQuery(this).text());
+ return false;
+ });
+
+ // js_mod is a custom event because there's no simple way to test for a js
+ // change in a textfield.
+ this.selector.find(".Ldt-createAnnotation-Description")
+ .bind("propertychange keyup input paste click js_mod", IriSP.wrap(this, this.handleTextChanges))
+ .keyup(function(_e) {
+ console.log(_e);
+ });
+
+ /* the cinecast version of the player is supposed to pause when the user clicks on the button */
+
+ /* the cinecast version expects the user to comment on a defined segment.
+ As the widget is always shown, we need a way to update it's content as
+ time passes. We do this like we did with the annotationsWidget : we schedule
+ a .code start function which will be called at the right time.
+ */
+ if (this.cinecast_version) {
+ var legal_ids;
+ if (typeof(this._serializer.getChapitrage()) !== "undefined")
+ legal_id = this._serializer.getChapitrage();
+ else
+ legal_id = this._serializer.getNonTweetIds()[0];
+
+ var annotations = this._serializer._data.annotations;
+ var i;
+
+ for (i in annotations) {
+ var annotation = annotations[i];
+ if (typeof(annotation.meta) !== "undefined" && typeof(annotation.meta["id-ref"]) !== "undefined"
+ && legal_id !== annotation.meta["id-ref"]) {
+ continue;
+ }
+
+ code = {start: annotation.begin / 1000, end: annotation.end / 1000,
+ onStart: function(annotation) { return function() {
+ if (typeof(annotation.content) !== "undefined")
+ _this.selector.find(".Ldt-createAnnotation-Title").html(annotation.content.title);
+
+ _this._currentAnnotation = annotation;
+ var beginTime = IriSP.msToTime(annotation.begin);
+ var endTime = IriSP.msToTime(annotation.end);
+ var timeTemplate = IriSP.templToHTML("- ({{begin}} - {{ end }})", {begin: beginTime, end: endTime });
+ _this.selector.find(".Ldt-createAnnotation-TimeFrame").html(timeTemplate);
+ } }(annotation)
+ };
+
+ this._Popcorn.code(code);
+ }
+ }
+
+ this.selector.find(".Ldt-createAnnotation-submitButton").click(IriSP.wrap(this, this.handleButtonClick));
+
+ if (!this.cinecast_version) {
+ this._Popcorn.listen("IriSP.PlayerWidget.AnnotateButton.clicked",
+ IriSP.wrap(this, this.handleAnnotateSignal));
+
+ // handle clicks on the cancel button too.
+ this.selector.find(".Ldt-createAnnotation-Minimize").click(IriSP.wrap(this,
+ function() {
+ // we've got to simulate the pressing of the button because there's no
+ // other way to minimize the widget and show the widgets that were hidden
+ // same time
+ this._Popcorn.trigger("IriSP.PlayerWidget.AnnotateButton.clicked");
+ }
+ ));
+ }
+};
+
+IriSP.createAnnotationWidget.prototype.showMoreTags = function() {
+ for (var j=0; j < this.random_tags; j++) {
+ var _jq = this.selector.find(".Ldt-createAnnotation-keywords li:hidden");
+ if (_jq.length > 1) {
+ IriSP.jQuery(_jq[Math.floor(_jq.length*Math.random())]).show();
+ } else {
+ _jq.show();
+ break;
+ }
+ }
+ if (this.selector.find(".Ldt-createAnnotation-keywords li:hidden").length == 0) {
+ this.selector.find('.Ldt-createAnnotation-moar-keywordz').hide();
+ }
+}
+
+/* Handles adding keywords and polemics */
+IriSP.createAnnotationWidget.prototype.addKeyword = function(_keyword) {
+ var _field = this.selector.find(".Ldt-createAnnotation-Description"),
+ _rx = IriSP.regexpFromText(_keyword),
+ _contents = _field.val();
+ _contents = ( _rx.test(_contents)
+ ? _contents.replace(_rx,"").replace(" "," ").trim()
+ : _contents.trim() + " " + _keyword
+ );
+ _field.val(_contents.trim());
+ _field.trigger("js_mod");
+}
+
+/** handles clicks on the annotate button. Works only for the non-cinecast version */
+IriSP.createAnnotationWidget.prototype.handleAnnotateSignal = function() {
+
+ if (this._hidden == false && this._state == 'startScreen') {
+ this.selector.hide();
+ this._hidden = true;
+
+ // free the arrow.
+ this._Popcorn.trigger("IriSP.ArrowWidget.releaseArrow");
+ this._Popcorn.trigger("IriSP.SliceWidget.hide");
+ this._Popcorn.trigger("IriSP.AnnotationsWidget.show");
+
+ } else {
+ this._Popcorn.trigger("IriSP.AnnotationsWidget.hide");
+ this.showStartScreen();
+ this.selector.show();
+ this._hidden = false;
+ var currentTime = this._Popcorn.currentTime();
+
+ // block the arrow.
+ this._Popcorn.trigger("IriSP.ArrowWidget.blockArrow");
+
+ var duration = this.getDuration();
+
+ var currentChapter = this._serializer.currentChapitre(currentTime);
+
+ if (IriSP.null_or_undefined(currentChapter)) {
+ var left = this.selector.width() / 2;
+ var width = this.selector.width() / 10;
+ } else {
+ var left = (currentChapter.begin / duration) * this.selector.width();
+ var width = (currentChapter.end / duration) * this.selector.width() - left;
+ }
+
+ // slider position and length is kept in percents.
+ this.sliceLeft = (left / this.selector.width()) * 100;
+ this.sliceWidth = (width / this.selector.width()) * 100;
+
+ this._Popcorn.trigger("IriSP.SliceWidget.position", [left, width]);
+ this._Popcorn.listen("IriSP.SliceWidget.zoneChange", IriSP.wrap(this, this.handleSliderChanges));
+ this._Popcorn.trigger("IriSP.SliceWidget.show");
+
+ if (!IriSP.null_or_undefined(currentChapter)) {
+ this.selector.find(".Ldt-createAnnotation-Title").html(currentChapter.content.title);
+
+ this._currentcurrentChapter = currentChapter;
+ var beginTime = IriSP.msToTime(currentChapter.begin);
+ var endTime = IriSP.msToTime(currentChapter.end);
+ var timeTemplate = IriSP.templToHTML("- ({{begin}} - {{ end }})", {begin: beginTime, end: endTime });
+ this.selector.find(".Ldt-createAnnotation-TimeFrame").html(timeTemplate);
+ }
+ }
+};
+
+
+/** watch for changes in the textfield and change the buttons accordingly */
+IriSP.createAnnotationWidget.prototype.handleTextChanges = function(event) {
+ var contents = this.selector.find(".Ldt-createAnnotation-Description").val();
+ if (this.cinecast_version) {
+ this._Popcorn.pause();
+ }
+ this.selector.find(".Ldt-createAnnotation-btnblock button").each(function() {
+ var _rx = IriSP.regexpFromText(IriSP.jQuery(this).text());
+ if (_rx.test(contents)) {
+ IriSP.jQuery(this).parent().addClass("Ldt-createAnnotation-active-button");
+ } else {
+ IriSP.jQuery(this).parent().removeClass("Ldt-createAnnotation-active-button");
+ }
+ });
+
+};
+
+IriSP.createAnnotationWidget.prototype.showStartScreen = function() {
+ this.selector.find(".Ldt-createAnnotation-screen").hide();
+ this.selector.find(".Ldt-createAnnotation-startScreen").show();
+
+ var jqTextfield = this.selector.find(".Ldt-createAnnotation-Description"); // handle on the textfield. used for the closure
+
+ /* test if the browser supports the placeholder attribute */
+ if (!IriSP.null_or_undefined(jqTextfield.get(0).placeholder)) {
+ jqTextfield.attr("placeholder", IriSP.i18n.getMessage('type_here'));
+ } else {
+ jqTextfield.val(IriSP.i18n.getMessage('type_here'));
+ jqTextfield.one("click", IriSP.wrap(this, function() { jqTextfield.val(""); }));
+ }
+
+
+
+ this._state = "startScreen";
+};
+
+IriSP.createAnnotationWidget.prototype.showWaitScreen = function() {
+ this.selector.find(".Ldt-createAnnotation-screen").hide();
+ this.selector.find(".Ldt-createAnnotation-waitScreen").show();
+ this._state = "waitScreen";
+};
+
+IriSP.createAnnotationWidget.prototype.showErrorScreen = function() {
+ this.selector.find(".Ldt-createAnnotation-screen").hide();
+ this.selector.find(".Ldt-createAnnotation-errorScreen").show();
+ this._state = "errorScreen";
+ var _this = this;
+ window.setTimeout(function() { _this.showStartScreen(); }, 2000);
+};
+
+/** update show the final screen with links to share the created annotation */
+IriSP.createAnnotationWidget.prototype.showEndScreen = function(annotation) {
+ this.selector.find(".Ldt-createAnnotation-screen").hide();
+
+ if (this.cinecast_version) {
+ this.selector.find(".Ldt-createAnnotation-Title").parent().show();
+ }
+
+ var url = ( (typeof annotation.meta == "object" && typeof annotation.meta.url == "string" && annotation.meta.url.length)
+ ? annotation.meta.url
+ : ( document.location.href + "#id=" + annotation.id ) );
+ var twStatus = IriSP.mkTweetUrl(url);
+ var gpStatus = IriSP.mkGplusUrl(url);
+ var fbStatus = IriSP.mkFbUrl(url);
+
+ this.selector.find(".Ldt-createAnnotation-endScreen-TweetLink").attr("href", twStatus);
+ this.selector.find(".Ldt-createAnnotation-endScreen-FbLink").attr("href", fbStatus);
+ this.selector.find(".Ldt-createAnnotation-endScreen-GplusLink").attr("href", gpStatus);
+
+ this.selector.find(".Ldt-createAnnotation-endScreen").show();
+ this._state = "endScreen";
+};
+
+/** handle clicks on "send annotation" button */
+IriSP.createAnnotationWidget.prototype.handleButtonClick = function(event) {
+ var _this = this;
+ var textfield = this.selector.find(".Ldt-createAnnotation-Description");
+ var contents = textfield.val();
+
+ if (contents === "") {
+ if (this.selector.find(".Ldt-createAnnotation-errorMessage").length === 0) {
+ this.selector.find(".Ldt-createAnnotation-Container")
+ .after(IriSP.templToHTML(IriSP.createAnnotation_errorMessage_template));
+ textfield.css("background-color", "#d93c71");
+ } else {
+ this.selector.find(".Ldt-createAnnotation-errorMessage").show();
+ }
+
+ textfield.one("js_mod propertychange keyup input paste", IriSP.wrap(this, function() {
+ var contents = textfield.val();
+
+ if (contents !== "") {
+ this.selector.find(".Ldt-createAnnotation-errorMessage").hide();
+ textfield.css("background-color", "");
+ }
+ }));
+ } else {
+ this.showWaitScreen();
+
+ this.sendLdtData(contents, function(annotation) {
+ if (_this.cinecast_version) {
+ if (_this._Popcorn.media.paused)
+ _this._Popcorn.play();
+ }
+
+ if (_this._state == "waitScreen") {
+ _this.showEndScreen(annotation);
+ if (_this.cinecast_version) {
+ window.setTimeout(function() { _this.showStartScreen(); }, 5000);
+ }
+ }
+ // hide the slicer widget
+ if (!_this.cinecast_version) {
+ _this._Popcorn.trigger("IriSP.SliceWidget.hide");
+ }
+ });
+ }
+};
+
+IriSP.createAnnotationWidget.prototype.handleSliderChanges = function(params) {
+ this.sliceLeft = params[0];
+ this.sliceWidth = params[1];
+};
+
+IriSP.createAnnotationWidget.prototype.sendLdtData = function(contents, callback) {
+ var _this = this;
+ var apiJson = {
+ format : "http://advene.org/ns/cinelab/",
+ annotations : [
+ {}
+ ],
+ meta: {}};
+ var annotation = apiJson.annotations[0];
+
+ annotation.media = this.currentMedia()["id"];
+
+ if (this.cinecast_version) {
+ annotation.begin = Math.round(this._Popcorn.currentTime() * 1000);
+ annotation.end = annotation.begin;
+ } else {
+ var duration = this.getDuration();
+ annotation.begin = +((duration * (this.sliceLeft / 100)).toFixed(0));
+ annotation.end = +((duration * ((this.sliceWidth + this.sliceLeft) / 100)).toFixed(0));
+ }
+
+ // boundary checks
+ annotation.begin = Math.max(0, annotation.begin);
+ annotation.end = Math.min(this.getDuration(), annotation.end);
+
+ annotation.type = ( this.cinecast_version ? "cinecast:UserAnnotation" : ( this._serializer.getContributions() || "" ));
+ if (typeof(annotation.type) === "undefined")
+ annotation.type = "";
+
+ annotation.type_title = "Contributions";
+ annotation.content = {};
+ annotation.content.data = contents;
+ if (this.cinecast_version) {
+ var _extract = IriSP.underscore(this._serializer._data.annotations)
+ .filter(function(_a) {
+ return (_a.begin <= annotation.begin && _a.end >= annotation.begin && _a.type == "cinecast:MovieExtract");
+ })
+ if (_extract.length) {
+ annotation.extract = _extract[0].id;
+ }
+ }
+
+ var meta = apiJson.meta;
+
+
+ var _username = this.selector.find(".Ldt-createAnnotation-userName").val();
+ meta.creator = (
+ (_username && _username.length)
+ ? _username
+ : (
+ (!IriSP.null_or_undefined(IriSP.user) && !IriSP.null_or_undefined(IriSP.user.name))
+ ? IriSP.user.name
+ : "Anonymous user"
+ )
+ );
+
+ meta.created = Date().toString();
+
+ var _tags = [];
+ IriSP._(this.tags).each(function(_v) {
+ var _rx = IriSP.regexpFromText(_v.meta.description);
+ if (_rx.test(contents)) {
+ _tags.push(_v.id);
+ }
+ });
+
+ if (typeof this.remote_tags == "object") {
+ _tags = IriSP._(_tags).map(function(_t) {
+ return _this.remote_tags.id + ':' + _t
+ });
+ if (typeof apiJson.imports == "undefined") {
+ apiJson.imports = [];
+ }
+ apiJson.imports.push({
+ "id" : this.remote_tags.id,
+ "url" : this.remote_tags.url
+ })
+ }
+ annotation.tags = IriSP.underscore.uniq(_tags);
+
+ var jsonString = JSON.stringify(apiJson);
+ var project_id = this._serializer._data.meta.id;
+
+ //TODO: extract magic url
+ var url = Mustache.to_html(this.api_endpoint_template,
+ {id: project_id});
+
+ IriSP.jQuery.ajax({
+ url: url,
+ type: this.api_method,
+ contentType: 'application/json',
+ data: jsonString,
+ //dataType: 'json',
+ success: IriSP.wrap(this, function(json, textStatus, XMLHttpRequest) {
+ /* add the annotation to the annotation and tell the world */
+ var annotation = json.annotations[0];
+
+ if (!this.cinecast_version) {
+ /* if the media doesn't have a contributions line, we need to add one */
+ if (typeof(this._serializer.getContributions()) === "undefined") {
+ /* set up a basic view */
+ var tmp_view = {"dc:contributor": "perso", "dc:creator": "perso", "dc:title": "Contributions",
+ "id": json.annotations[0].type}
+
+
+ IriSP.get_aliased(this._serializer._data, ["annotation_types", "annotation-types"]).push(tmp_view);
+ }
+
+ delete annotation.tags;
+ annotation.content.description = annotation.content.data;
+ annotation.content.title = "";
+ delete annotation.content.data;
+ annotation.id = json.annotations[0].id;
+
+ annotation.meta = meta;
+ annotation.meta["id-ref"] = json.annotations[0]["type"];
+ } else {
+ annotation.type = "cinecast:UserAnnotation";
+ }
+ annotation.is_new = true;
+ // everything is shared so there's no need to propagate the change
+ _this._serializer._data.annotations.push(annotation);
+
+ _this._Popcorn.trigger("IriSP.createAnnotationWidget.addedAnnotation", annotation);
+ this.selector.find(".Ldt-createAnnotation-Description").val("");
+ callback(annotation);
+ }),
+ error:
+ function(jqXHR, textStatus, errorThrown) {
+ console.log("an error occured while contacting "
+ + url + " and sending " + jsonString + textStatus );
+ _this.showErrorScreen(); } });
+};
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 src/js/widgets/helloWorldWidget.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/js/widgets/helloWorldWidget.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,17 @@
+IriSP.HelloWorldWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+}
+
+IriSP.HelloWorldWidget.prototype = new IriSP.Widget();
+
+IriSP.HelloWorldWidget.prototype.draw = function() {
+ this.selector
+ .html('Hello, world')
+ .css({
+ "text-align" : "center",
+ "padding": "10px 0",
+ "font-size" : "14px"
+ });
+
+ console.log(this);
+}
diff -r 7b55777486c3 -r 75ba66457232 src/js/widgets/playerWidget.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/js/widgets/playerWidget.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,284 @@
+/* Internationalization for this widget */
+
+IriSP.i18n.addMessages(
+ {
+ "en": {
+ "play_pause": "Play/Pause",
+ "mute_unmute": "Mute/Unmute",
+ "play": "Play",
+ "pause": "Pause",
+ "mute": "Mute",
+ "unmute": "Unmute",
+ "annotate": "Annotate",
+ "search": "Search",
+ "elapsed_time": "Elapsed time",
+ "total_time": "Total time",
+ "volume": "Volume",
+ "volume_control": "Volume control"
+ },
+ "fr": {
+ "play_pause": "Lecture/Pause",
+ "mute_unmute": "Couper/Activer le son",
+ "play": "Lecture",
+ "pause": "Pause",
+ "mute": "Couper le son",
+ "unmute": "Activer le son",
+ "annotate": "Annoter",
+ "search": "Rechercher",
+ "elapsed_time": "Durée écoulée",
+ "total_time": "Durée totale",
+ "volume": "Niveau sonore",
+ "volume_control": "Réglage du niveau sonore"
+ }
+ }
+);
+
+
+IriSP.PlayerWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+
+ this._searchBlockOpen = false;
+ this._searchLastValue = "";
+};
+
+IriSP.PlayerWidget.prototype = new IriSP.Widget();
+
+IriSP.PlayerWidget.prototype.draw = function() {
+ var self = this;
+ var width = this.width;
+ var height = this.height;
+ var heightS = this.height-20;
+
+ var playerTempl = IriSP.templToHTML(IriSP.player_template, this._config);
+ this.selector.append(playerTempl);
+
+ this.selector.children(".Ldt-controler").show();
+
+ // handle clicks by the user on the video.
+ this._Popcorn.listen("play", IriSP.wrap(this, this.playButtonUpdater));
+ this._Popcorn.listen("pause", IriSP.wrap(this, this.playButtonUpdater));
+
+ this._Popcorn.listen("volumechange", IriSP.wrap(this, this.volumeUpdater));
+
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.timeDisplayUpdater));
+ // update the time display for the first time.
+ this._Popcorn.listen("loadedmetadata", IriSP.wrap(this, this.timeDisplayUpdater));
+
+ this._Popcorn.listen("IriSP.search.matchFound", IriSP.wrap(this, this.searchMatch));
+ this._Popcorn.listen("IriSP.search.noMatchFound", IriSP.wrap(this, this.searchNoMatch));
+ this._Popcorn.listen("IriSP.search.triggeredSearch", IriSP.wrap(this, this.triggeredSearch));
+
+
+ this.selector.find(".Ldt-CtrlPlay").click(function() { self.playHandler.call(self); });
+ this.selector.find(".Ldt-CtrlAnnotate").click(function()
+ { self._Popcorn.trigger("IriSP.PlayerWidget.AnnotateButton.clicked"); });
+ this.selector.find(".Ldt-CtrlSearch").click(function() { self.searchButtonHandler.call(self); });
+
+ var _volctrl = this.selector.find(".Ldt-Ctrl-Volume-Control");
+ this.selector.find('.Ldt-CtrlSound')
+ .click(function() { self.muteHandler.call(self); } )
+ .mouseover(function() {
+ _volctrl.show();
+ })
+ .mouseout(function() {
+ _volctrl.hide();
+ });
+ _volctrl.mouseover(function() {
+ _volctrl.show();
+ }).mouseout(function() {
+ _volctrl.hide();
+ });
+
+ /*
+ var searchButtonPos = this.selector.find(".Ldt-CtrlSearch").position();
+ var searchBox = Mustache.to_html(IriSP.search_template, {margin_left : searchButtonPos.left + "px"});
+ this.selector.find(".Ldt-CtrlSearch").after(searchBox);
+ */
+
+ // trigger an IriSP.PlayerWidget.MouseOver to the widgets that are interested (i.e : sliderWidget)
+ this.selector.hover(function() { self._Popcorn.trigger("IriSP.PlayerWidget.MouseOver"); },
+ function() { self._Popcorn.trigger("IriSP.PlayerWidget.MouseOut"); });
+ this.selector.find(".Ldt-Ctrl-Volume-Cursor").draggable({
+ axis: "x",
+ drag: function(event, ui) {
+ var _vol = Math.max(0, Math.min( 1, ui.position.left / (ui.helper.parent().width() - ui.helper.outerWidth())));
+ ui.helper.attr("title",IriSP.i18n.getMessage('volume')+': ' + Math.floor(100*_vol) + '%');
+ self._Popcorn.volume(_vol);
+ },
+ containment: "parent"
+ });
+
+ setTimeout(function() {
+ self.volumeUpdater();
+ }, 1000); /* some player - jwplayer notable - save the state of the mute button between sessions */
+};
+
+/* Update the elasped time div */
+IriSP.PlayerWidget.prototype.timeDisplayUpdater = function() {
+
+ if (this._previousSecond === undefined) {
+ this._previousSecond = this._Popcorn.roundTime();
+ }
+ else {
+ /* we're still in the same second, so it's not necessary to update time */
+ if (this._Popcorn.roundTime() == this._previousSecond)
+ return;
+
+ }
+
+ // we get it at each call because it may change.
+ var duration = this.getDuration() / 1000;
+ var totalTime = IriSP.secondsToTime(duration);
+ var elapsedTime = IriSP.secondsToTime(this._Popcorn.currentTime());
+
+ this.selector.find(".Ldt-ElapsedTime").html(elapsedTime.toString());
+ this.selector.find(".Ldt-TotalTime").html(totalTime.toString());
+ this._previousSecond = this._Popcorn.roundTime();
+};
+
+/* update the icon of the button - separate function from playHandler
+ because in some cases (for instance, when the user directly clicks on
+ the jwplayer window) we have to change the icon without playing/pausing
+*/
+IriSP.PlayerWidget.prototype.playButtonUpdater = function() {
+ var status = this._Popcorn.media.paused;
+
+ if ( status == true ){
+ /* the background sprite is changed by adding/removing the correct classes */
+ this.selector.find(".Ldt-CtrlPlay").attr("title", IriSP.i18n.getMessage('play'));
+ this.selector.find(".Ldt-CtrlPlay").removeClass("Ldt-CtrlPlay-PauseState").addClass("Ldt-CtrlPlay-PlayState");
+ } else {
+ this.selector.find(".Ldt-CtrlPlay").attr("title", IriSP.i18n.getMessage('pause'));
+ this.selector.find(".Ldt-CtrlPlay").removeClass("Ldt-CtrlPlay-PlayState").addClass("Ldt-CtrlPlay-PauseState");
+ }
+
+ return;
+};
+
+
+IriSP.PlayerWidget.prototype.playHandler = function() {
+ var status = this._Popcorn.media.paused;
+
+ if ( status == true ){
+ this._Popcorn.play();
+ } else {
+ this._Popcorn.pause();
+ }
+};
+
+IriSP.PlayerWidget.prototype.muteHandler = function() {
+ this._Popcorn.mute(!this._Popcorn.muted());
+};
+
+IriSP.PlayerWidget.prototype.volumeUpdater = function() {
+ var _muted = this._Popcorn.muted(),
+ _vol = this._Popcorn.volume();
+ if (_vol === false) {
+ _vol = .5;
+ }
+ var _soundCtl = this.selector.find(".Ldt-CtrlSound");
+ _soundCtl.removeClass("Ldt-CtrlSound-Mute Ldt-CtrlSound-Half Ldt-CtrlSound-Full");
+ if (_muted) {
+ _soundCtl.attr("title", IriSP.i18n.getMessage('unmute'))
+ .addClass("Ldt-CtrlSound-Mute");
+ } else {
+ _soundCtl.attr("title", IriSP.i18n.getMessage('mute'))
+ .addClass(_vol < .5 ? "Ldt-CtrlSound-Half" : "Ldt-CtrlSound-Full" )
+ }
+ var _cursor = this.selector.find(".Ldt-Ctrl-Volume-Cursor");
+ _cursor.css({
+ "left": ( _muted ? 0 : Math.floor(_vol * (_cursor.parent().width() - _cursor.outerWidth())) ) + "px"
+ })
+};
+
+IriSP.PlayerWidget.prototype.showSearchBlock = function() {
+ var self = this;
+
+ if (this._searchBlockOpen == false) {
+ this.selector.find(".LdtSearch").show("blind", { direction: "horizontal"}, 100);
+ this.selector.find(".LdtSearchInput").css('background-color','#fff');
+
+ this._searchBlockOpen = true;
+ this.selector.find(".LdtSearchInput").bind('keyup', null, function() { self.searchHandler.call(self); } );
+ this.selector.find(".LdtSearchInput").focus();
+
+ // we need this variable because some widget can find a match in
+ // their data while at the same time other's don't. As we want the
+ // search field to become green when there's a match, we need a
+ // variable to remember that we had one.
+ this._positiveMatch = false;
+
+ // tell the world the field is open
+ this._Popcorn.trigger("IriSP.search.open");
+ }
+};
+
+IriSP.PlayerWidget.prototype.hideSearchBlock = function() {
+ if (this._searchBlockOpen == true) {
+ this._searchLastValue = this.selector.find(".LdtSearchInput").attr('value');
+ this.selector.find(".LdtSearchInput").attr('value','');
+ this.selector.find(".LdtSearch").hide("blind", { direction: "horizontal"}, 75);
+
+ // unbind the watcher event.
+ this.selector.find(".LdtSearchInput").unbind('keypress set');
+ this._searchBlockOpen = false;
+
+ this._positiveMatch = false;
+
+ this._Popcorn.trigger("IriSP.search.closed");
+ }
+};
+
+/** react to clicks on the search button */
+IriSP.PlayerWidget.prototype.searchButtonHandler = function() {
+ var self = this;
+
+ /* show the search field if it is not shown */
+ if ( this._searchBlockOpen == false ) {
+ this.showSearchBlock();
+ this.selector.find(".LdtSearchInput").attr('value', this._searchLastValue);
+ this._Popcorn.trigger("IriSP.search", this._searchLastValue); // trigger the search to make it more natural.
+ } else {
+ this.hideSearchBlock();
+ }
+};
+
+/** this handler is called whenever the content of the search
+ field changes */
+IriSP.PlayerWidget.prototype.searchHandler = function() {
+ this._searchLastValue = this.selector.find(".LdtSearchInput").attr('value');
+ this._positiveMatch = false;
+
+ // do nothing if the search field is empty, instead of highlighting everything.
+ if (this._searchLastValue == "") {
+ this._Popcorn.trigger("IriSP.search.cleared");
+ this.selector.find(".LdtSearchInput").css('background-color','');
+ } else {
+ this._Popcorn.trigger("IriSP.search", this._searchLastValue);
+ }
+};
+
+/**
+ handler for the IriSP.search.found message, which is sent by some views when they
+ highlight a match.
+*/
+IriSP.PlayerWidget.prototype.searchMatch = function() {
+ this._positiveMatch = true;
+ this.selector.find(".LdtSearchInput").css('background-color','#e1ffe1');
+};
+
+/** the same, except that no value could be found */
+IriSP.PlayerWidget.prototype.searchNoMatch = function() {
+ if (this._positiveMatch !== true)
+ this.selector.find(".LdtSearchInput").css('background-color', "#d62e3a");
+};
+
+/** react to an IriSP.Player.triggeredSearch - that is, when
+ a widget ask the PlayerWidget to do a search on his behalf */
+IriSP.PlayerWidget.prototype.triggeredSearch = function(searchString) {
+ this.showSearchBlock();
+ this.selector.find(".LdtSearchInput").attr('value', searchString);
+ this._Popcorn.trigger("IriSP.search", searchString); // trigger the search to make it more natural.
+};
+
+
diff -r 7b55777486c3 -r 75ba66457232 src/js/widgets/polemicWidget.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/js/widgets/polemicWidget.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,448 @@
+/*
+ *
+ * Copyright 2010 Institut de recherche et d'innovation
+ * contributor(s) : Samuel Huron
+ *
+ * contact@iri.centrepompidou.fr
+ * http://www.iri.centrepompidou.fr
+ *
+ * This software is a computer program whose purpose is to show and add annotations on a video .
+ * This software is governed by the CeCILL-C license under French law and
+ * abiding by the rules of distribution of free software. You can use,
+ * modify and/ or redistribute the software under the terms of the CeCILL-C
+ * license as circulated by CEA, CNRS and INRIA at the following URL
+ * "http://www.cecill.info".
+ *
+ * The fact that you are presently reading this means that you have had
+ * knowledge of the CeCILL-C license and that you accept its terms.
+*/
+// CHART TIMELINE / VERSION PROTOTYPE ::
+
+/** the polemic widget */
+IriSP.PolemicWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+
+ this.userPol = new Array();
+ this.userNoPol = new Array();
+ this.userst = new Array();
+ this.numberOfTweet = 0;
+ this.Users;
+ this.TweetPolemic;
+ this.yMax = this.height;
+ this.PaperSlider;
+ this.heightOfChart;
+ this.tweets = new Array();
+ this.svgElements = {};
+
+ this.oldSearchMatches = [];
+};
+
+IriSP.PolemicWidget.prototype = new IriSP.Widget();
+
+IriSP.PolemicWidget.prototype.draw = function() {
+
+ // variable
+ // yMax
+
+ var self = this;
+ var yCoef = 2; // coef for height of 1 tweet
+ var frameSize = 5; // frame size
+ var margin = 1; // marge between frame
+ var lineSize = this.width; // timeline pixel width
+ var nbrframes = lineSize/frameSize; // frame numbers
+ var numberOfTweet = 0; // number of tweet overide later
+ var duration = this.getDuration(); // timescale width
+ var frameLength = lineSize / frameSize; // frame timescale
+ var timeline;
+ var colors = new Array("","#1D973D","#036AAE","#CE0A15","#C5A62D","#585858");
+
+ // array
+ //var tweets = new Array();
+ var element = new Array();
+ var cluster = new Array();
+ var frames = new Array(frameLength);
+ var slices = new Array();
+
+
+ // Classes =======================================================================
+ var Frames = function(){
+
+ var Myclusters;
+ var x;
+ var y;
+ var width;
+ var height;
+ };
+ Frames = function(json){
+ // make my clusters
+ // ou Frame vide
+ };
+ Frames.prototype.draw = function(){
+ };
+ Frames.prototype.zoom = function(){
+ };
+ Frames.prototype.inside = function(){
+ };
+ var Clusters = function(){
+ var Object;
+ var yDist;
+ var x;
+ var y;
+ var width;
+ var height;
+ };
+ Clusters = function(json){
+ // make my object
+ };
+ var Tweet = function(){
+ };
+ // Classes =======================================================================
+
+ // Refactoring (parametere) ************************************************************
+ // color translastion
+ var qTweet_0 =0;
+ var qTweet_Q =0;
+ var qTweet_REF=0;
+ var qTweet_OK =0;
+ var qTweet_KO =0;
+ function colorTranslation(value){
+ if(value == "Q"){
+ qTweet_Q+=1;
+ return 2;
+ }else if(value =="REF"){
+ qTweet_REF+=1;
+ return 4;
+ }else if(value =="OK"){
+ qTweet_OK+=1;
+ return 1;
+ }else if(value =="KO"){
+ qTweet_KO+=1;
+ return 3;
+ }else if(value ==""){
+ qTweet_0+=1;
+ return 5;
+ }
+ }
+
+
+ this._serializer.sync(function(data) { loaded_callback.call(self, data); return; });
+
+ function loaded_callback (json) {
+ var view_type = this._serializer.getTweets();
+
+
+ if (typeof(view_type) === "undefined") {
+ var view_type = this._serializer.getTweetIds()[0];
+ if (typeof(view_type) === "undefined") {
+ // default to guessing if nothing else works.
+ var view = json.views[0];
+
+ if(typeof(view.annotation_types) !== "undefined") {
+ /* we need to be backward compatible with the old files which used to
+ feature only two lines : Chapitrage and Tweets. We've added a
+ "Contributions" line so we need to discriminate against that */
+ if (view.annotation_types.length === 2 && typeof(this._serializer.getContributions()) === "undefined") {
+ var view_type = view.annotation_types[1];
+ } else {
+ console.log("PolemicWidget: invalid file - minimizing");
+ return;
+ }
+ }
+ }
+ }
+
+ // Make and define the Raphael area
+ this.paper = Raphael(document.getElementById(this._id), this._config.width, this._config.height);
+
+ // event handlers
+ this._Popcorn.listen("IriSP.search", IriSP.wrap(this, function(searchString) { this.searchHandler(searchString); }));
+ this._Popcorn.listen("IriSP.search.closed", IriSP.wrap(this, this.searchFieldClosedHandler));
+ this._Popcorn.listen("IriSP.search.cleared", IriSP.wrap(this, this.searchFieldClearedHandler));
+ this.selector.mouseleave(IriSP.wrap(this, function() { self.TooltipWidget.hide.call(self.TooltipWidget); }));
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.sliderUpdater));
+ this._Popcorn.listen("IriSP.Mediafragment.showAnnotation", IriSP.wrap(this, this.showAnnotation));
+
+ for(var i = 0; i < json.annotations.length; i++) {
+ var item = json.annotations[i];
+ var MyTime = Math.floor(item.begin/duration*lineSize);
+ var Myframe = Math.floor(MyTime/lineSize*frameLength);
+
+ if (typeof(item.meta) !== "undefined"
+ && typeof(item.meta["id-ref"]) !== "undefined"
+ && item.meta["id-ref"] === view_type) {
+
+ var MyTJson = {},
+ _source = IriSP.get_aliased(item.meta, ['dc:source', 'source']);
+ if (_source !== null) {
+ var MyTJson = JSON.parse(_source['content']);
+ }
+
+ if (item.content['polemics'] != undefined
+ && item.content['polemics'][0] != null) {
+
+ // a tweet can have many polemics at the same time.
+ for(var j=0; j" : "" ) + annotation.content.description.replace(/(^.{120,140})[\s].+$/,'$1…'); + + var thumbUrl = annotation.meta.thumbnail || ''; + + var hexa_color = typeof(annotation.content.color) !== "undefined" + ? '#' + IriSP.DEC_HEXA_COLOR(annotation.content.color) + : typeof(annotation.color) !== "undefined" + ? '#' + IriSP.DEC_HEXA_COLOR(annotation.color) + : this.defaultColors[i % this.defaultColors.length]; + + /* + if (hexa_color === "FFCC00") + hexa_color = "333"; + */ + if (hexa_color.length == 5) + hexa_color = hexa_color + '00'; + + + var annotationTemplate = Mustache.to_html(IriSP.annotation_template, + {"divTitle" : divTitle, "id" : id, "startPixel" : startPixel, + "pxWidth" : pxWidth, "hexa_color" : hexa_color, + "seekPlace" : Math.round(begin/1000), "thumbnailUrl": thumbUrl}); + + + this.selector.append(annotationTemplate); + + /* add a special class to the last segment and change its border */ + if (annotation.id === lastSegment.id) { + IriSP.jqId(id).addClass("Ldt-lastSegment").css("border-color", hexa_color); + } + } + // react to mediafragment messages. + this._Popcorn.listen("IriSP.Mediafragment.showAnnotation", + function(id, divTitle) { + + var divObject = IriSP.jqId(id); + if (divObject.length) { + divObject.fadeTo(0,1); + var offset_x = divObject.position().left + divObject.outerWidth() / 2; + self.TooltipWidget.show(divObject.attr("title"), IriSP.jQuery(this).css("background-color"), offset_x, 0); + IriSP.jQuery(document).one("mousemove", function() { divObject.fadeTo(0,.5); + self.TooltipWidget.hide(); }); + } + }); + + this.selector.find(".Ldt-iri-chapter") + .fadeTo(0, .5) + .click(function() { + self._Popcorn.trigger("IriSP.SegmentsWidget.click", this.id); + self._Popcorn.currentTime(IriSP.jQuery(this).attr("data-seek")); + }) + .mouseover( function(event) { + var divObject = IriSP.jQuery(this); + divObject.fadeTo(0,1); + var offset_x = divObject.position().left + divObject.outerWidth() / 2; + var thumb = divObject.attr("thumbnail-url"); + var txt = divObject.attr("title") + (thumb && thumb.length ? '
- ' + IriSP._(this.tags).map(function(_tag, _i) {
+ return '
- ' + + ~~(100 * _valeurs[_i]) + + '% de ' + + _tag.description + + ' '; + }).join('') + '
- '
+ + IriSP._(_words)
+ .chain()
+ .shuffle()
+ .map(function(_word) {
+ var _size = 10 + _scale * Math.sqrt(_word.count - _min);
+ return '
- ' + + _word.word + + ' ' + }) + .value() + .join("") + + '
{{real_name}}
" +
+ "{{{ contents }}}
" +
+ "{{ date }}
",
+ {creator: creator, real_name: real_name, contents : title, date : formatted_date});
+
+ this.selector.find(".Ldt-TweetReply").attr("href", "http://twitter.com/home?status=@" + creator + ":%20");
+
+
+ var rtText = Mustache.to_html("http://twitter.com/home?status=RT @{{creator}}: {{text}}",
+ {creator: creator, text: IriSP.encodeURI(annotation.content.title)});
+ this.selector.find(".Ldt-Retweet").attr("href", rtText);
+ }
+
+ this.selector.find(".Ldt-tweetContents").html(title);
+ this.selector.find(".Ldt-tweetAvatar").html(imageMarkup);
+ this.selector.show("blind", 250);
+};
+
+IriSP.TweetsWidget.prototype.displayTweet = function(annotation) {
+ if (this._displayingTweet === false) {
+ this._displayingTweet = true;
+ } else {
+ window.clearTimeout(this._timeoutId);
+ }
+
+ this.drawTweet(annotation);
+
+ var time = this._Popcorn.currentTime();
+ this._timeoutId = window.setTimeout(IriSP.wrap(this, this.clearPanel), this.tweet_display_period);
+};
+
+
+IriSP.TweetsWidget.prototype.clearPanel = function() {
+ this._displayingTweet = false;
+ this._timeoutId = undefined;
+ this.closePanel();
+
+};
+
+IriSP.TweetsWidget.prototype.closePanel = function() {
+ if (this._timeoutId != undefined) {
+ /* we're called from the "close window" link */
+ /* cancel the timeout */
+ window.clearTimeout(this._timeoutId);
+ this._timeoutId = null;
+ }
+
+ this.selector.hide("blind", 400);
+
+};
+
+/* cancel the timeout if the user clicks on the keep panel open button */
+IriSP.TweetsWidget.prototype.keepPanel = function() {
+ if (this._timeoutId != undefined) {
+ /* we're called from the "close window" link */
+ /* cancel the timeout */
+ window.clearTimeout(this._timeoutId);
+ this._timeoutId = null;
+ }
+};
+
+IriSP.TweetsWidget.prototype.draw = function() {
+ var _this = this;
+
+ var tweetMarkup = IriSP.templToHTML(IriSP.tweetWidget_template, {"share_template" : IriSP.share_template});
+ this.selector.append(tweetMarkup);
+ this.selector.hide();
+ this.selector.find(".Ldt-tweetWidgetMinimize").click(IriSP.wrap(this, this.closePanel));
+ this.selector.find(".Ldt-tweetWidgetKeepOpen").click(IriSP.wrap(this, this.keepPanel));
+
+ this._Popcorn.listen("IriSP.PolemicTweet.click", IriSP.wrap(this, this.PolemicTweetClickHandler));
+ this._Popcorn.listen("IriSP.PlayerWidget.AnnotateButton.clicked",
+ IriSP.wrap(this, this.handleAnnotateSignal));
+};
+
+IriSP.TweetsWidget.prototype.PolemicTweetClickHandler = function(tweet_id) {
+ var index, annotation;
+ for (index in this._serializer._data.annotations) {
+ annotation = this._serializer._data.annotations[index];
+
+ if (annotation.id === tweet_id)
+ break;
+ }
+
+ if (annotation.id !== tweet_id)
+ /* we haven't found it */
+ return;
+
+ this.displayTweet(annotation);
+ return;
+};
+
+/** handle clicks on the annotate button by hiding/showing itself */
+IriSP.TweetsWidget.prototype.handleAnnotateSignal = function() {
+ if (this._hidden == false) {
+ this.selector.hide();
+ this._hidden = true;
+ } else {
+ if (this._displayingTweet !== false)
+ this.selector.show();
+
+
+ this._hidden = false;
+ }
+};
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 src/templates/annotation.html
--- a/src/templates/annotation.html Tue Oct 04 11:16:06 2011 +0200
+++ b/src/templates/annotation.html Fri Apr 06 16:55:34 2012 +0200
@@ -1,6 +1,10 @@
+{{! template for an annotation displayed in a segmentWidget }}
-
\ No newline at end of file
+ class='Ldt-iri-chapter Ldt-TraceMe'
+ style='left: {{startPixel}}px;
+ width: {{pxWidth}}px;
+ background-color:{{hexa_color}};'
+ data-seek='{{seekPlace}}'
+ thumbnail-url='{{thumbnailUrl}}'
+ >
+
diff -r 7b55777486c3 -r 75ba66457232 src/templates/annotationWidget.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/templates/annotationWidget.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,19 @@
+{{! template for the annotation widget }}
+
diff -r 7b55777486c3 -r 75ba66457232 src/templates/annotation_loading.html
--- a/src/templates/annotation_loading.html Tue Oct 04 11:16:06 2011 +0200
+++ b/src/templates/annotation_loading.html Fri Apr 06 16:55:34 2012 +0200
@@ -1,3 +1,4 @@
+{{! template shown while the annotation widget is loading }}
+
diff -r 7b55777486c3 -r 75ba66457232 src/templates/arrowWidget.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/templates/arrowWidget.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,2 @@
+-
+ {{#annotations}}
+
-
+ {{^url}} {{/url}}
+ {{! otherwise link to url }}
+ {{#url}} {{/url}}
+
+ +
+ {{begin}} + - + {{end}} +++ {{! if the url is not present, it means that the annotation exists + in the current project }} + {{title}} ++ + {{#tags.length}} +-
+ {{#tags}}
+
-
+ {{.}}+
+ {{/tags}}
+
+ {{/annotations}}
+ -
+
+
diff -r 7b55777486c3 -r 75ba66457232 src/templates/createAnnotationWidget.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/templates/createAnnotationWidget.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,75 @@
+{{! template for the annotation creation widget }}
+
+
+
diff -r 7b55777486c3 -r 75ba66457232 src/templates/createAnnotation_errorMessage.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/templates/createAnnotation_errorMessage.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,3 @@
+
+
+
+
+
+
+
+ {{^cinecast_version}}
+ {{/cinecast_version}}
+
+
+ {{#show_from_field}}
+
+ {{/show_from_field}}
+
+
+
+ {{#tags.length}}
+
+ {{^user_avatar}} 
+ {{/user_avatar}}
+ {{#user_avatar}} 
+ {{/user_avatar}}
+
+
+
+ {{/user_avatar}}
+ {{#user_avatar}}
+
+
+ {{#random_tags}}
+
+ {{/random_tags}}
+ {{/tags.length}}
+ {{#polemic_mode}}
+ {{#polemics.length}}
+ -
+ {{#tags}}
+
+ {{/tags}}
+
+
+
+ {{/polemics.length}}
+ {{/polemic_mode}}
+ -
+ {{#polemics}}
+
+ {{/polemics}}
+
+
+ {{l10n.wait_while_processed}}
+
+
+
+ {{l10n.error_while_contacting}}
+
+
+
+ + {{l10n.empty_annotation}} +
\ No newline at end of file diff -r 7b55777486c3 -r 75ba66457232 src/templates/loading.html --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/src/templates/loading.html Fri Apr 06 16:55:34 2012 +0200 @@ -0,0 +1,1 @@ +{{l10n.loading_wait}}
diff -r 7b55777486c3 -r 75ba66457232 src/templates/overlay_marker.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/templates/overlay_marker.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,3 @@
+{{! the template for the small bars which is z-indexed over our segment widget }}
+
+
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 src/templates/player.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/templates/player.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,32 @@
+{{! template for the radio player }}
+
+
diff -r 7b55777486c3 -r 75ba66457232 src/templates/radio.html
--- a/src/templates/radio.html Tue Oct 04 11:16:06 2011 +0200
+++ /dev/null Thu Jan 01 00:00:00 1970 +0000
@@ -1,43 +0,0 @@
-
+
+
+ {{^disable_annotate_btn}}
+
+
+ {{/disable_annotate_btn}}
+ {{^disable_search_btn}}
+
+
+ {{/disable_search_btn}}
+
+
+
+
+
+
+
+
+
+
+
+ 00:00
+ /
+ 00:00
+
+
+
+
+
- ![]()
").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('').addClass(this._triggerClass).html(f==""?c:d("![]()
").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);
+return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;gh){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);
+if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('');
+this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/
+2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,
+"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=
+false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=
+true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;
+for(var b=0;b-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);
+d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");H(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=
+null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=
+null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],
+top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing=true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){var b=d.datepicker._getBorders(a.dpDiv);J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");
+c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");
+a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},
+_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-
+g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b);this._curInst=
+null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},
+_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"):
+0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear=
+false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=
+d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);
+else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=
+a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,
+g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=A+1-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=
+c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,
+h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+112?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||
+a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?
+new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&nn;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));
+n=this._canAdjustMonth(a,-1,m,g)?''+n+"":f?"":''+n+"";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m,
+g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?''+r+"":f?"":''+r+"";j=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&&
+a.currentDay?u:b;j=!h?j:this.formatDate(j,r,this._getFormatConfig(a));h=!a.inline?'":"";e=e?'1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='
"+(l?"
"+(i[0]>0&&G==i[1]-1?'':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'':
+"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='
- Get flash to see
- this player
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- {{{share_template}}}
-
- Mots clefs :
-
-
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 src/templates/search.html
--- a/src/templates/search.html Tue Oct 04 11:16:06 2011 +0200
+++ b/src/templates/search.html Fri Apr 06 16:55:34 2012 +0200
@@ -1,9 +1,10 @@
-
- ");
+this.handles=c.add(d(e.join("")).appendTo(b.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle",
+g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!b.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");i=b._start(g,l);if(i===false)return}break}m=b.options.step;i=b.options.values&&b.options.values.length?
+(h=b.values(l)):(h=b.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=b._valueMin();break;case d.ui.keyCode.END:h=b._valueMax();break;case d.ui.keyCode.PAGE_UP:h=b._trimAlignValue(i+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=b._trimAlignValue(i-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===b._valueMax())return;h=b._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===b._valueMin())return;h=b._trimAlignValue(i-
+m);break}b._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(g,k);b._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy();
+return this},_mouseCapture:function(b){var a=this.options,c,f,e,j,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(a.range===true&&this.values(1)===a.min){g+=1;e=d(this.handles[g])}if(this._start(b,g)===false)return false;
+this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();a=e.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-e.width()/2,top:b.pageY-a.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(b){var a=
+this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a;if(this.orientation==="horizontal"){a=
+this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);
+c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var f;if(this.options.values&&this.options.values.length){f=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>f||a===1&&c1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},
+_refreshValue:function(){var b=this.options.range,a=this.options,c=this,f=!this._animateOff?a.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},a.animate);
+if(h===1)c.range[f?"animate":"css"]({width:e-g+"%"},{queue:false,duration:a.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},a.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:a.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1,
+1)[f?"animate":"css"]({width:e+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.13"})})(jQuery);
+;/*
+ * jQuery UI Tabs 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ */
+(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"#{label} "},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&&
+e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b=
+d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]||
+(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all");
+this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected=
+this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active");
+if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected"));
+this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+
+g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal",
+function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")};
+this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected=
+-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier.";
+d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e=
+d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b,
+e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]);
+j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove();
+if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null,
+this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this},
+load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c,
+"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this},
+url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.13"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k
'))}function N(a){return a.delegate("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a",
+"mouseout",function(){d(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).delegate("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a","mouseover",function(){if(!d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");
+d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==B)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.13"}});var z=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},
+_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){H(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,
+b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d(''))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",
+function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d(''+c+"");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);
+if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("
-
+{{! template for the search container }}
+
").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(a.range==="min"||a.range==="max"?" ui-slider-range-"+a.range:""))}for(var j=c.length;j
+
diff -r 7b55777486c3 -r 75ba66457232 src/templates/share.html
--- a/src/templates/share.html Tue Oct 04 11:16:06 2011 +0200
+++ b/src/templates/share.html Fri Apr 06 16:55:34 2012 +0200
@@ -1,4 +1,5 @@
-
-
-
-
\ No newline at end of file
+{{! social network sharing template }}
+
+
+
+
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 src/templates/sliceWidget.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/templates/sliceWidget.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,10 @@
+{{! template for the slice widget }}
+
+
+ {{! the whole bar }}
+
+
+
+ {{! the zone which represents our slice }}
+
+
+
diff -r 7b55777486c3 -r 75ba66457232 src/templates/sliderWidget.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/templates/sliderWidget.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,5 @@
+{{! template for the slider widget - it's composed of two divs we one overlayed on top
+ of the other }}
+
+
+
diff -r 7b55777486c3 -r 75ba66457232 src/templates/tooltip.html
--- a/src/templates/tooltip.html Tue Oct 04 11:16:06 2011 +0200
+++ b/src/templates/tooltip.html Fri Apr 06 16:55:34 2012 +0200
@@ -1,5 +1,6 @@
-
-
\ No newline at end of file
+{{! template used by the jquery ui tooltip }}
+{{title}}
-{{begin}} : {{end}}
-{{description}}
-
+
diff -r 7b55777486c3 -r 75ba66457232 src/templates/tooltipWidget.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/templates/tooltipWidget.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,6 @@
+{{! template for the tooltip widget }}
+
+{{title}}
+ {{begin}} : {{end}}
+ {{description}}
+
+
+ i||a.bottomb&&a.rightg&&a.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable");
+this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a===
+"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&
+!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,
+left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};
+this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=
+document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);
+return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],
+e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();
+c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):
+this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,
+dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},
+toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+jg&&b+la[this.floating?"width":"height"]?j:g0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();
+if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),
+this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=
+this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=
+d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||
+0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",
+a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-
+f)this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-
+this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?f:!(f-this.offset.click.left=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,
+this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",
+a,this._uiHash());for(e=0;e li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix");
+a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion",
+function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a=
+this.options;if(a.icons){c("").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex");
+this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons();
+b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target);
+a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+
+c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options;
+if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);
+if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(),
+e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight||
+e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false",
+"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.13",
+animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/);
+f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide",
+paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery);
+;/*
+ * jQuery UI Autocomplete 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.position.js
+ */
+(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g=
+false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=
+a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};
+this.menu=d("").data("item.autocomplete",b).append(d("").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,
+"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery);
+(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
+-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");
+this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,
+this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||
+this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||
+this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,f=d.primary&&d.secondary,e=[];if(d.primary||d.secondary){if(this.options.text)e.push("ui-button-text-icon"+(f?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("");d.secondary&&b.append("");if(!this.options.text){e.push(f?"ui-button-icons-only":
+"ui-button-icon-only");this.hasTitle||b.attr("title",c)}}else e.push("ui-button-text-only");b.addClass(e.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()},
+destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy");a.Widget.prototype.destroy.call(this)}})})(jQuery);
+;/*
+ * jQuery UI Dialog 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.button.js
+ * jquery.ui.draggable.js
+ * jquery.ui.mouse.js
+ * jquery.ui.position.js
+ * jquery.ui.resizable.js
+ */
+(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,
+position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+
+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),
+h=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("").addClass("ui-dialog-title").attr("id",
+e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");
+a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==
+b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=
+1;d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===
+f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,
+function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",
+handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,
+originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",
+f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):
+[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);
+if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):
+e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=
+this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-
+b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.13",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),
+create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()
").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),
+height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);
+b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a
+
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 src/templates/tweetWidget.html
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/src/templates/tweetWidget.html Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,14 @@
+{{! template for the tweet widget }}
+
diff -r 7b55777486c3 -r 75ba66457232 src/templates/video.html
--- a/src/templates/video.html Tue Oct 04 11:16:06 2011 +0200
+++ /dev/null Thu Jan 01 00:00:00 1970 +0000
@@ -1,59 +0,0 @@
-
-
-
-
-
-
-
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ Publicité : votre vidéo commence dans | secondes]]>
+
+
+
+
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/allocine_test/skin_fr.swf
Binary file test/integration/allocine_dossier_independant/allocine_test/skin_fr.swf has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/LdtPlayer.css
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/test/integration/allocine_dossier_independant/css/LdtPlayer.css Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,529 @@
+/* Some general styling classes */
+
+.Ldt-floatClear {
+ display: block; width: 100%; height: 0; clear: both;
+}
+
+ul.Ldt-floatList {
+ padding: 0; margin: 0; list-style: none;
+}
+
+.Ldt-floatList li {
+ float: left;
+}
+
+/* */
+
+#demo-frame > div.demo { padding: 5px !important; };
+
+button.ui-button-icon-only {
+ height:1.5em;
+ width:1.5em;
+}
+
+#Ldt-loader {
+ background:url(imgs/loader.gif) center no-repeat;
+ text-indent: -9999px;
+ position: absolute;
+}
+
+/* general class for all buttons */
+.Ldt-button {
+
+}
+
+.Ldt-SegmentsWidget {
+ /* overflow: auto; /* clear the floats */
+ margin-top: 1px;
+ padding-bottom: 8px; /* FIXME: only a temporary fix. This should be put into the layout manager. */
+}
+
+.Ldt-iri-chapter {
+ position: absolute;
+ height: 10px;
+ border-right: 1px solid white;
+}
+
+.Ldt-SegmentPositionMarker {
+ position: absolute;
+ z-index: 100;
+ width: 1px;
+ height: 10px;
+ background-color: white;
+}
+.tooltip {
+ display:none;
+ background:transparent url(imgs/black_arrow_mini.png);
+ font-size:12px;
+ height:55px;
+ width:180px;
+ padding:10px;
+ padding-left:15px;
+ padding-top:15px;
+ padding-right:15px;
+ color:#000;
+ font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
+}
+#Ldt-Root{
+ font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
+}
+#Ldt-Hat{
+ height:3px;
+}
+
+.Ldt-AnnotationsWidget {
+ font-size: 12px;
+ font-family: "Arial", "Verdana", "sans-serif";
+ background-color:#eeeeee;
+}
+
+.Ldt-AnnotationContent {
+ padding:5px;
+ padding-left: 12px;
+
+}
+
+.Ldt-fbShare {
+ display: block;
+ float: left;
+ width: 24px;
+ height: 24px;
+ background:url('imgs/facebook.png');
+}
+
+.Ldt-TwShare {
+ display: block;
+ float: left;
+ width: 24px;
+ height: 24px;
+ background:url('imgs/twitter.png');
+}
+
+.Ldt-GplusShare {
+ display: block;
+ float: left;
+ width: 24px;
+ height: 24px;
+ background:url('imgs/google.png');
+}
+
+.Ldt-SaTitle{
+ padding-top:2px;
+ padding-bottom:3px;
+ font-size: 12pt;
+ color : #0068c4;
+}
+
+.Ldt-SaDescription{
+ font-size:12px;
+}
+
+.Ldt-SaKeywords {
+ font-weight:bold;
+ font-size:10px;
+}
+
+.Ldt-AnnotationShareIcons {
+ float:right;
+ position: relative;
+}
+
+
+#Ldt-PlaceHolder{
+ position:absolue;
+ float:none;
+}
+
+.Ldt-Segments{
+ float:left;
+ font-size: 62.5%;
+}
+
+.Ldt-mode-radio{
+ visibility:hidden;
+ height:0px;
+ display:none
+}
+
+.Ldt-cleaner {
+ clear:both;
+}
+
+.cleaner {
+ clear:both;
+}
+
+.share {
+ background:url('imgs/widget20.png') no-repeat scroll 0 0 transparent ;
+ display:block;
+ height:16px;
+ line-height:16px !important;
+ overflow:hidden;
+ width:16px;
+ float:left;
+ cursor:pointer;
+ margin:2px;
+}
+.shareFacebook{
+ background-position:0 -704px;
+}
+.shareMySpace{
+ background-position:0 -736px;
+}
+.shareTwitter{
+ background-position:0 -1072px;
+}
+.shareGoogle{
+ background-position:0 -752px;
+}
+.shareDelicious{
+ background-position:0 -672px;
+}
+.shareJamesPot{
+ background-position:0 -1808px;
+}
+
+.tip{
+ position: absolute;
+ padding : 3px;
+ z-index: 10000000000;
+ max-width: 200px;
+ background: transparent url("imgs/black_arrow_long.png");
+ font-size: 12px;
+ height: 115px;
+ width: 180px;
+ padding: 15px 15px 20px;
+ color: #ffffff;
+ font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif";
+ overflow:hidden;
+}
+
+.tipcolor {
+ float: left; margin: 2px 4px 2px 0;
+}
+
+.tip img {
+ max-width: 140px; max-height: 70px; margin: 0 20px;
+}
+
+
+
+/* sparkline widget */
+.Ldt-sparklineWidget {
+ position: relative;
+ margin-bottom: 5px;
+}
+
+.Ldt-sparkLinePositionMarker {
+ position: absolute;
+ top: 0px;
+ width: 0px;
+ background-color: #333333;
+ border-right: solid 1px pink;
+ z-index: 3;
+ opacity: 0.2;
+}
+
+.Ldt-sparkLine {
+ position: absolute;
+ top: 0px;
+}
+
+.Ldt-sparkLineClickOverlay {
+ position: absolute;
+ width: 640px;
+ height: 60px;
+ z-index: 4;
+ top: 0px;
+ opacity: 0.3;
+}
+
+/* CINECAST Annotation Widget block */
+
+.Ldt-createAnnotationWidget {
+ width: 610px; padding-bottom: 10px; clear: both;
+ color: #fff;
+ background: url(img-cinecast/createannbgd.png) no-repeat bottom right;
+}
+
+.Ldt-createAnnotation-DoubleBorder {
+ width: 590px; position: relative; clear: both;
+ background: url(img-cinecast/createannbgd.png) no-repeat top left;
+ padding: 20px 10px 0;
+ min-height: 150px;
+}
+/* */
+
+.Ldt-createAnnotation-Title {
+ font-size: 12pt;
+ color : #0068c4;
+ float: left;
+ margin-right: 5px;
+}
+
+.Ldt-createAnnotation-TimeFrame {
+ font-size: 12pt;
+ color : #ff5589;
+ float: left;
+}
+.Ldt-createAnnotation-Container {
+ float: left; width: 100%; clear: both;
+}
+
+.Ldt-createAnnotation-userAvatar {
+ float: right;
+ width: 80px;
+ height: 64px;
+ border: 1px #ffffff;
+ margin: 5px 0;
+}
+
+.Ldt-createAnnotation-userAvatar img {
+ margin: 0 auto;
+ display: block;
+ max-width: 100%;
+ max-height: 100%;
+}
+
+.Ldt-createAnnotationWidget .Ldt-floatClear {
+ height: 30px; background: url(img-cinecast/logo.iri.small.png) left no-repeat;
+}
+
+/* CINECAST HIDE ARROW */
+
+.Ldt-createAnnotation-profileArrow {
+ display: none;
+}
+
+/* CINECAST SPECIFIC TEXTAREA */
+
+.Ldt-createAnnotation-Description {
+ float: left; background: url(img-cinecast/textarea.png); border: none; margin: 0; padding: 4px 8px 4px 4px; width: 493px; height: 68px;
+ resize: none;
+}
+/* */
+
+.Ldt-createAnnotation-btnblock {
+}
+
+.Ldt-createAnnotation-btnblock label {
+ float: left; margin-top: 20px; width: 480px; font-size: 14px; color: #ffffff;
+}
+
+/* CINECAST SPECIFIC TAG BUTTONS */
+
+.Ldt-createAnnotation-keywords ul {
+ width: 100%; clear: both;
+}
+
+.Ldt-createAnnotation-keywords li {
+ border: none; margin: 0 10px 5px 0; height: 23px; padding: 0 0 0 15px;
+ background: url(img-cinecast/tag.png) left top no-repeat;
+ cursor: pointer;
+}
+
+.Ldt-createAnnotation-keyword-button {
+ font-size: 13px; color: #ffffff; width: 170px; text-shadow: 1px 1px 1px #000000;
+ height: 23px; padding: 0 5px 0 0; border: none; margin: 0;
+ background: url(img-cinecast/tag.png) right top no-repeat;
+ cursor: pointer;
+}
+
+.Ldt-createAnnotation-keywords li:hover {
+ background-position: left -23px;
+}
+
+.Ldt-createAnnotation-keywords li:hover .Ldt-createAnnotation-keyword-button {
+ background-position: right -23px;
+}
+
+.Ldt-createAnnotation-keywords li.Ldt-createAnnotation-active-button {
+ background-position: left -46px; margin: 0 0 5px 0;
+}
+
+.Ldt-createAnnotation-keywords li.Ldt-createAnnotation-active-button .Ldt-createAnnotation-keyword-button {
+ background-position: right -46px; padding: 0 15px 0 0; width: 180px;
+}
+/* */
+
+/* CINECAST SUBMIT BUTTON */
+
+.Ldt-createAnnotation-submitButton {
+ float: right;
+ width: 96px;
+ height: 34px;
+ background: url(img-cinecast/greenbutton.png);
+ border: none;
+ margin: 8px 0;
+ font-size: 13px;
+ text-transform: uppercase;
+ cursor: pointer;
+}
+
+.Ldt-createAnnotation-submitButton:hover {
+ background-position: 0 -34px;
+}
+
+/* */
+
+.Ldt-createAnnotation-endScreen {
+ background-color: #ffffff;
+ margin-left: 5px;
+ margin-right: 5px;
+ border: 1px solid #d6d6d6;
+ padding: 10px;
+ font-size: 13px;
+ font-weight: bold;
+ color : #f7268e;
+ text-align: center;
+}
+
+.Ldt-createAnnotation-errorMessage {
+ color: #D93C71;
+}
+
+.Ldt-createAnnotation-Minimize {
+ position: relative;
+ float: right;
+ height: 17px;
+ width: 17px;
+ right: 0px;
+ background:url('imgs/minimize.png');
+}
+
+/* */
+
+.Ldt-createAnnotation-spinner {
+ display: inline;
+ width: 16px;
+ height: 16px;
+ background-image('imgs/spinner.gif');
+}
+
+.Ldt-createAnnotation-endScreen-TweetLink {
+ width: 54px;
+ height: 20px;
+ background-image('imgs/tweet_button.png');
+}
+
+.Ldt-createAnnotation-endScreen-FbLink {
+ width: 55px;
+ height: 20px;
+ background-image('imgs/facebook_button.png');
+}
+
+.Ldt-createAnnotation-endScreen-GplusLink {
+ width: 50px;
+ height: 20px;
+ background-image('imgs/gplus_button.png');
+}
+/* AnnotationsListWidget */
+
+.Ldt-AnnotationsListWidget {
+ font-size: 12px;
+ font-family: "Arial", "Verdana", "sans-serif";
+}
+
+.Ldt-AnnotationsList-ul {
+ list-style: none;
+ padding: 0 3px;
+}
+
+.Ldt-AnnotationsList-li {
+ float: left; width: 100%; clear: both;
+ margin: 2px 0; padding: 2px 0;
+ position: relative;
+ min-height: 70px;
+ background: #000000;
+}
+
+.Ldt-AnnotationsList-li:hover {
+ background-color: #333333;
+}
+
+.Ldt-AnnotationsListWidget a {
+ text-decoration: none;
+}
+
+.Ldt-AnnotationsListWidget a:hover {
+ text-decoration: underline;
+}
+
+.Ldt-AnnotationsList-Thumbnail {
+ border: none;
+ float: left;
+ max-width: 75px;
+ max-height: 48px;
+}
+
+.Ldt-AnnotationsList-Duration {
+ color : #ffffff;
+ position: absolute; top: 55px; left: 5px; text-align: center;
+}
+
+.Ldt-AnnotationsList-TcSeparator, .Ldt-AnnotationsList-End {
+ display: none;
+}
+
+.Ldt-AnnotationsList-Title {
+ font-size: 13px;
+ margin: 0 0 2px 80px;
+ color: #ffffff;
+}
+
+.Ldt-AnnotationsList-Description {
+ font-style: italic;
+ margin: 0 0 2px 80px;
+}
+
+.Ldt-AnnotationsList-Description a {
+ color: #dddddd;
+}
+
+.Ldt-AnnotationsList-Tags {
+ float: left; clear: both; padding: 0; margin: 2px 0 0 80px; list-style: none;
+}
+
+.Ldt-AnnotationsList-Tag-Li {
+ float: left; border: none; margin: 0 0 0 5px; height: 23px; padding: 0 0 0 20px;
+ background: url(img-cinecast/tag.png) left top no-repeat;
+ cursor: pointer;
+}
+
+.Ldt-AnnotationsList-Tag-Div {
+ font-size: 13px; color: #ffffff; text-shadow: 1px 1px 1px #000000;
+ height: 19px; padding: 4px 5px 0 0; border: none; margin: 0;
+ background: url(img-cinecast/tag.png) right top no-repeat;
+ cursor: pointer;
+}
+
+.Ldt-createAnnotation-moar-keywordz {
+ float: right; font-size: 13px; color: #ffffff; text-shadow: 1px 1px 1px #000000; cursor: pointer;
+ width: 140px; height: 23px; background: url(img-cinecast/moar.png); border: none; margin: 0 15px;
+}
+
+.Ldt-createAnnotation-moar-keywordz:hover {
+ background-position: bottom;
+}
+
+/* Tagcloud */
+
+.Ldt-TagCloud {
+ font-family: "PT Sans", Arial, Helvetica, sans-serif;
+}
+
+.Ldt-TagCloud ul {
+ list-style: none; padding: 0; margin: 5px; text-align: center;
+}
+
+.Ldt-TagCloud li {
+ display: inline-block; margin: 2px; cursor:pointer; cursor:hand;
+}
+
+.Ldt-TagCloud li:hover {
+ color: #0099ff;
+}
+
+.Ldt-TagCloud-actif {
+ color: #c000c0;
+}
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/img-cinecast/controlbarbgd.png
Binary file test/integration/allocine_dossier_independant/css/img-cinecast/controlbarbgd.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/img-cinecast/controlbarspacer.png
Binary file test/integration/allocine_dossier_independant/css/img-cinecast/controlbarspacer.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/img-cinecast/createannbgd.png
Binary file test/integration/allocine_dossier_independant/css/img-cinecast/createannbgd.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/img-cinecast/greenbutton.png
Binary file test/integration/allocine_dossier_independant/css/img-cinecast/greenbutton.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/img-cinecast/logo.iri.small.png
Binary file test/integration/allocine_dossier_independant/css/img-cinecast/logo.iri.small.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/img-cinecast/moar.png
Binary file test/integration/allocine_dossier_independant/css/img-cinecast/moar.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/img-cinecast/player-sprites.png
Binary file test/integration/allocine_dossier_independant/css/img-cinecast/player-sprites.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/img-cinecast/sliderpos.png
Binary file test/integration/allocine_dossier_independant/css/img-cinecast/sliderpos.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/img-cinecast/tag.png
Binary file test/integration/allocine_dossier_independant/css/img-cinecast/tag.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/img-cinecast/textarea.png
Binary file test/integration/allocine_dossier_independant/css/img-cinecast/textarea.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/annotate_arrow.png
Binary file test/integration/allocine_dossier_independant/css/imgs/annotate_arrow.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/arrow.png
Binary file test/integration/allocine_dossier_independant/css/imgs/arrow.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/black.png
Binary file test/integration/allocine_dossier_independant/css/imgs/black.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/black_arrow.png
Binary file test/integration/allocine_dossier_independant/css/imgs/black_arrow.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/black_arrow_big.png
Binary file test/integration/allocine_dossier_independant/css/imgs/black_arrow_big.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/black_arrow_long.png
Binary file test/integration/allocine_dossier_independant/css/imgs/black_arrow_long.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/black_big.png
Binary file test/integration/allocine_dossier_independant/css/imgs/black_big.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/delicious.png
Binary file test/integration/allocine_dossier_independant/css/imgs/delicious.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/facebook.png
Binary file test/integration/allocine_dossier_independant/css/imgs/facebook.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/facebook_button.png
Binary file test/integration/allocine_dossier_independant/css/imgs/facebook_button.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/google.png
Binary file test/integration/allocine_dossier_independant/css/imgs/google.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/gplus_button.png
Binary file test/integration/allocine_dossier_independant/css/imgs/gplus_button.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/grey_arrow_Show.png
Binary file test/integration/allocine_dossier_independant/css/imgs/grey_arrow_Show.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/left_edge_arrow.png
Binary file test/integration/allocine_dossier_independant/css/imgs/left_edge_arrow.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/left_handle.gif
Binary file test/integration/allocine_dossier_independant/css/imgs/left_handle.gif has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/linkedin.png
Binary file test/integration/allocine_dossier_independant/css/imgs/linkedin.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/loader.gif
Binary file test/integration/allocine_dossier_independant/css/imgs/loader.gif has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/minimize.png
Binary file test/integration/allocine_dossier_independant/css/imgs/minimize.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/player_gradient.png
Binary file test/integration/allocine_dossier_independant/css/imgs/player_gradient.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/polemic_buttons_sprite.png
Binary file test/integration/allocine_dossier_independant/css/imgs/polemic_buttons_sprite.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/purple_arrow_Show.png
Binary file test/integration/allocine_dossier_independant/css/imgs/purple_arrow_Show.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/reply_sprite.png
Binary file test/integration/allocine_dossier_independant/css/imgs/reply_sprite.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/retweet_sprite.png
Binary file test/integration/allocine_dossier_independant/css/imgs/retweet_sprite.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/right_edge_arrow.png
Binary file test/integration/allocine_dossier_independant/css/imgs/right_edge_arrow.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/right_handle.gif
Binary file test/integration/allocine_dossier_independant/css/imgs/right_handle.gif has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/spinner.gif
Binary file test/integration/allocine_dossier_independant/css/imgs/spinner.gif has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/submit_annotation.png
Binary file test/integration/allocine_dossier_independant/css/imgs/submit_annotation.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/transBlack.png
Binary file test/integration/allocine_dossier_independant/css/imgs/transBlack.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/tweet_button.png
Binary file test/integration/allocine_dossier_independant/css/imgs/tweet_button.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/twitter.png
Binary file test/integration/allocine_dossier_independant/css/imgs/twitter.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/user_default_icon.png
Binary file test/integration/allocine_dossier_independant/css/imgs/user_default_icon.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/video_sequence.png
Binary file test/integration/allocine_dossier_independant/css/imgs/video_sequence.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/white.png
Binary file test/integration/allocine_dossier_independant/css/imgs/white.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/white_arrow.png
Binary file test/integration/allocine_dossier_independant/css/imgs/white_arrow.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/white_arrow_big.png
Binary file test/integration/allocine_dossier_independant/css/imgs/white_arrow_big.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/white_arrow_long.png
Binary file test/integration/allocine_dossier_independant/css/imgs/white_arrow_long.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/white_arrow_mini.png
Binary file test/integration/allocine_dossier_independant/css/imgs/white_arrow_mini.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/white_big.png
Binary file test/integration/allocine_dossier_independant/css/imgs/white_big.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/widget20.png
Binary file test/integration/allocine_dossier_independant/css/imgs/widget20.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/css/imgs/wire_pattern.png
Binary file test/integration/allocine_dossier_independant/css/imgs/wire_pattern.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/LdtPlayer-release.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/test/integration/allocine_dossier_independant/js/LdtPlayer-release.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,6263 @@
+/*
+ *
+ * Copyright 2010-2012 Institut de recherche et d'innovation
+ * contributor(s) : Karim Hamidou, Samuel Huron, Raphael Velt, Thibaut Cavalie
+ *
+ * contact@iri.centrepompidou.fr
+ * http://www.iri.centrepompidou.fr
+ *
+ * This software is a computer program whose purpose is to show and add annotations on a video .
+ * This software is governed by the CeCILL-C license under French law and
+ * abiding by the rules of distribution of free software. You can use,
+ * modify and/ or redistribute the software under the terms of the CeCILL-C
+ * license as circulated by CEA, CNRS and INRIA at the following URL
+ * "http://www.cecill.info".
+ *
+ * The fact that you are presently reading this means that you have had
+ * knowledge of the CeCILL-C license and that you accept its terms.
+*/
+/*! LAB.js (LABjs :: Loading And Blocking JavaScript)
+ v2.0.3 (c) Kyle Simpson
+ MIT License
+*/
+
+(function(global){
+ var _$LAB = global.$LAB,
+
+ // constants for the valid keys of the options object
+ _UseLocalXHR = "UseLocalXHR",
+ _AlwaysPreserveOrder = "AlwaysPreserveOrder",
+ _AllowDuplicates = "AllowDuplicates",
+ _CacheBust = "CacheBust",
+ /*!START_DEBUG*/_Debug = "Debug",/*!END_DEBUG*/
+ _BasePath = "BasePath",
+
+ // stateless variables used across all $LAB instances
+ root_page = /^[^?#]*\//.exec(location.href)[0],
+ root_domain = /^\w+\:\/\/\/?[^\/]+/.exec(root_page)[0],
+ append_to = document.head || document.getElementsByTagName("head"),
+
+ // inferences... ick, but still necessary
+ opera_or_gecko = (global.opera && Object.prototype.toString.call(global.opera) == "[object Opera]") || ("MozAppearance" in document.documentElement.style),
+
+/*!START_DEBUG*/
+ // console.log() and console.error() wrappers
+ log_msg = function(){},
+ log_error = log_msg,
+/*!END_DEBUG*/
+
+ // feature sniffs (yay!)
+ test_script_elem = document.createElement("script"),
+ explicit_preloading = typeof test_script_elem.preload == "boolean", // http://wiki.whatwg.org/wiki/Script_Execution_Control#Proposal_1_.28Nicholas_Zakas.29
+ real_preloading = explicit_preloading || (test_script_elem.readyState && test_script_elem.readyState == "uninitialized"), // will a script preload with `src` set before DOM append?
+ script_ordered_async = !real_preloading && test_script_elem.async === true, // http://wiki.whatwg.org/wiki/Dynamic_Script_Execution_Order
+
+ // XHR preloading (same-domain) and cache-preloading (remote-domain) are the fallbacks (for some browsers)
+ xhr_or_cache_preloading = !real_preloading && !script_ordered_async && !opera_or_gecko
+ ;
+
+/*!START_DEBUG*/
+ // define console wrapper functions if applicable
+ if (global.console && global.console.log) {
+ if (!global.console.error) global.console.error = global.console.log;
+ log_msg = function(msg) { global.console.log(msg); };
+ log_error = function(msg,err) { global.console.error(msg,err); };
+ }
+/*!END_DEBUG*/
+
+ // test for function
+ function is_func(func) { return Object.prototype.toString.call(func) == "[object Function]"; }
+
+ // test for array
+ function is_array(arr) { return Object.prototype.toString.call(arr) == "[object Array]"; }
+
+ // make script URL absolute/canonical
+ function canonical_uri(src,base_path) {
+ var absolute_regex = /^\w+\:\/\//;
+
+ // is `src` is protocol-relative (begins with // or ///), prepend protocol
+ if (/^\/\/\/?/.test(src)) {
+ src = location.protocol + src;
+ }
+ // is `src` page-relative? (not an absolute URL, and not a domain-relative path, beginning with /)
+ else if (!absolute_regex.test(src) && src.charAt(0) != "/") {
+ // prepend `base_path`, if any
+ src = (base_path || "") + src;
+ }
+ // make sure to return `src` as absolute
+ return absolute_regex.test(src) ? src : ((src.charAt(0) == "/" ? root_domain : root_page) + src);
+ }
+
+ // merge `source` into `target`
+ function merge_objs(source,target) {
+ for (var k in source) { if (source.hasOwnProperty(k)) {
+ target[k] = source[k]; // TODO: does this need to be recursive for our purposes?
+ }}
+ return target;
+ }
+
+ // does the chain group have any ready-to-execute scripts?
+ function check_chain_group_scripts_ready(chain_group) {
+ var any_scripts_ready = false;
+ for (var i=0; i 0) {
+ for (var i=0; i=0;) {
+ val = queue.shift();
+ $L = $L[val.type].apply(null,val.args);
+ }
+ return $L;
+ },
+
+ // rollback `[global].$LAB` to what it was before this file was loaded, the return this current instance of $LAB
+ noConflict:function(){
+ global.$LAB = _$LAB;
+ return instanceAPI;
+ },
+
+ // create another clean instance of $LAB
+ sandbox:function(){
+ return create_sandbox();
+ }
+ };
+
+ return instanceAPI;
+ }
+
+ // create the main instance of $LAB
+ global.$LAB = create_sandbox();
+
+
+ /* The following "hack" was suggested by Andrea Giammarchi and adapted from: http://webreflection.blogspot.com/2009/11/195-chars-to-help-lazy-loading.html
+ NOTE: this hack only operates in FF and then only in versions where document.readyState is not present (FF < 3.6?).
+
+ The hack essentially "patches" the **page** that LABjs is loaded onto so that it has a proper conforming document.readyState, so that if a script which does
+ proper and safe dom-ready detection is loaded onto a page, after dom-ready has passed, it will still be able to detect this state, by inspecting the now hacked
+ document.readyState property. The loaded script in question can then immediately trigger any queued code executions that were waiting for the DOM to be ready.
+ For instance, jQuery 1.4+ has been patched to take advantage of document.readyState, which is enabled by this hack. But 1.3.2 and before are **not** safe or
+ fixed by this hack, and should therefore **not** be lazy-loaded by script loader tools such as LABjs.
+ */
+ (function(addEvent,domLoaded,handler){
+ if (document.readyState == null && document[addEvent]){
+ document.readyState = "loading";
+ document[addEvent](domLoaded,handler = function(){
+ document.removeEventListener(domLoaded,handler,false);
+ document.readyState = "complete";
+ },false);
+ }
+ })("addEventListener","DOMContentLoaded");
+
+})(this);/*
+ mustache.js — Logic-less templates in JavaScript
+
+ See http://mustache.github.com/ for more info.
+*/
+
+var Mustache = function () {
+ var _toString = Object.prototype.toString;
+
+ Array.isArray = Array.isArray || function (obj) {
+ return _toString.call(obj) == "[object Array]";
+ }
+
+ var _trim = String.prototype.trim, trim;
+
+ if (_trim) {
+ trim = function (text) {
+ return text == null ? "" : _trim.call(text);
+ }
+ } else {
+ var trimLeft, trimRight;
+
+ // IE doesn't match non-breaking spaces with \s.
+ if ((/\S/).test("\xA0")) {
+ trimLeft = /^[\s\xA0]+/;
+ trimRight = /[\s\xA0]+$/;
+ } else {
+ trimLeft = /^\s+/;
+ trimRight = /\s+$/;
+ }
+
+ trim = function (text) {
+ return text == null ? "" :
+ text.toString().replace(trimLeft, "").replace(trimRight, "");
+ }
+ }
+
+ var escapeMap = {
+ "&": "&",
+ "<": "<",
+ ">": ">",
+ '"': '"',
+ "'": '''
+ };
+
+ function escapeHTML(string) {
+ return String(string).replace(/&(?!\w+;)|[<>"']/g, function (s) {
+ return escapeMap[s] || s;
+ });
+ }
+
+ var regexCache = {};
+ var Renderer = function () {};
+
+ Renderer.prototype = {
+ otag: "{{",
+ ctag: "}}",
+ pragmas: {},
+ buffer: [],
+ pragmas_implemented: {
+ "IMPLICIT-ITERATOR": true
+ },
+ context: {},
+
+ render: function (template, context, partials, in_recursion) {
+ // reset buffer & set context
+ if (!in_recursion) {
+ this.context = context;
+ this.buffer = []; // TODO: make this non-lazy
+ }
+
+ // fail fast
+ if (!this.includes("", template)) {
+ if (in_recursion) {
+ return template;
+ } else {
+ this.send(template);
+ return;
+ }
+ }
+
+ // get the pragmas together
+ template = this.render_pragmas(template);
+
+ // render the template
+ var html = this.render_section(template, context, partials);
+
+ // render_section did not find any sections, we still need to render the tags
+ if (html === false) {
+ html = this.render_tags(template, context, partials, in_recursion);
+ }
+
+ if (in_recursion) {
+ return html;
+ } else {
+ this.sendLines(html);
+ }
+ },
+
+ /*
+ Sends parsed lines
+ */
+ send: function (line) {
+ if (line !== "") {
+ this.buffer.push(line);
+ }
+ },
+
+ sendLines: function (text) {
+ if (text) {
+ var lines = text.split("\n");
+ for (var i = 0; i < lines.length; i++) {
+ this.send(lines[i]);
+ }
+ }
+ },
+
+ /*
+ Looks for %PRAGMAS
+ */
+ render_pragmas: function (template) {
+ // no pragmas
+ if (!this.includes("%", template)) {
+ return template;
+ }
+
+ var that = this;
+ var regex = this.getCachedRegex("render_pragmas", function (otag, ctag) {
+ return new RegExp(otag + "%([\\w-]+) ?([\\w]+=[\\w]+)?" + ctag, "g");
+ });
+
+ return template.replace(regex, function (match, pragma, options) {
+ if (!that.pragmas_implemented[pragma]) {
+ throw({message:
+ "This implementation of mustache doesn't understand the '" +
+ pragma + "' pragma"});
+ }
+ that.pragmas[pragma] = {};
+ if (options) {
+ var opts = options.split("=");
+ that.pragmas[pragma][opts[0]] = opts[1];
+ }
+ return "";
+ // ignore unknown pragmas silently
+ });
+ },
+
+ /*
+ Tries to find a partial in the curent scope and render it
+ */
+ render_partial: function (name, context, partials) {
+ name = trim(name);
+ if (!partials || partials[name] === undefined) {
+ throw({message: "unknown_partial '" + name + "'"});
+ }
+ if (!context || typeof context[name] != "object") {
+ return this.render(partials[name], context, partials, true);
+ }
+ return this.render(partials[name], context[name], partials, true);
+ },
+
+ /*
+ Renders inverted (^) and normal (#) sections
+ */
+ render_section: function (template, context, partials) {
+ if (!this.includes("#", template) && !this.includes("^", template)) {
+ // did not render anything, there were no sections
+ return false;
+ }
+
+ var that = this;
+
+ var regex = this.getCachedRegex("render_section", function (otag, ctag) {
+ // This regex matches _the first_ section ({{#foo}}{{/foo}}), and captures the remainder
+ return new RegExp(
+ "^([\\s\\S]*?)" + // all the crap at the beginning that is not {{*}} ($1)
+
+ otag + // {{
+ "(\\^|\\#)\\s*(.+)\\s*" + // #foo (# == $2, foo == $3)
+ ctag + // }}
+
+ "\n*([\\s\\S]*?)" + // between the tag ($2). leading newlines are dropped
+
+ otag + // {{
+ "\\/\\s*\\3\\s*" + // /foo (backreference to the opening tag).
+ ctag + // }}
+
+ "\\s*([\\s\\S]*)$", // everything else in the string ($4). leading whitespace is dropped.
+
+ "g");
+ });
+
+
+ // for each {{#foo}}{{/foo}} section do...
+ return template.replace(regex, function (match, before, type, name, content, after) {
+ // before contains only tags, no sections
+ var renderedBefore = before ? that.render_tags(before, context, partials, true) : "",
+
+ // after may contain both sections and tags, so use full rendering function
+ renderedAfter = after ? that.render(after, context, partials, true) : "",
+
+ // will be computed below
+ renderedContent,
+
+ value = that.find(name, context);
+
+ if (type === "^") { // inverted section
+ if (!value || Array.isArray(value) && value.length === 0) {
+ // false or empty list, render it
+ renderedContent = that.render(content, context, partials, true);
+ } else {
+ renderedContent = "";
+ }
+ } else if (type === "#") { // normal section
+ if (Array.isArray(value)) { // Enumerable, Let's loop!
+ renderedContent = that.map(value, function (row) {
+ return that.render(content, that.create_context(row), partials, true);
+ }).join("");
+ } else if (that.is_object(value)) { // Object, Use it as subcontext!
+ renderedContent = that.render(content, that.create_context(value),
+ partials, true);
+ } else if (typeof value == "function") {
+ // higher order section
+ renderedContent = value.call(context, content, function (text) {
+ return that.render(text, context, partials, true);
+ });
+ } else if (value) { // boolean section
+ renderedContent = that.render(content, context, partials, true);
+ } else {
+ renderedContent = "";
+ }
+ }
+
+ return renderedBefore + renderedContent + renderedAfter;
+ });
+ },
+
+ /*
+ Replace {{foo}} and friends with values from our view
+ */
+ render_tags: function (template, context, partials, in_recursion) {
+ // tit for tat
+ var that = this;
+
+ var new_regex = function () {
+ return that.getCachedRegex("render_tags", function (otag, ctag) {
+ return new RegExp(otag + "(=|!|>|&|\\{|%)?([^#\\^]+?)\\1?" + ctag + "+", "g");
+ });
+ };
+
+ var regex = new_regex();
+ var tag_replace_callback = function (match, operator, name) {
+ switch(operator) {
+ case "!": // ignore comments
+ return "";
+ case "=": // set new delimiters, rebuild the replace regexp
+ that.set_delimiters(name);
+ regex = new_regex();
+ return "";
+ case ">": // render partial
+ return that.render_partial(name, context, partials);
+ case "{": // the triple mustache is unescaped
+ case "&": // & operator is an alternative unescape method
+ return that.find(name, context);
+ default: // escape the value
+ return escapeHTML(that.find(name, context));
+ }
+ };
+ var lines = template.split("\n");
+ for(var i = 0; i < lines.length; i++) {
+ lines[i] = lines[i].replace(regex, tag_replace_callback, this);
+ if (!in_recursion) {
+ this.send(lines[i]);
+ }
+ }
+
+ if (in_recursion) {
+ return lines.join("\n");
+ }
+ },
+
+ set_delimiters: function (delimiters) {
+ var dels = delimiters.split(" ");
+ this.otag = this.escape_regex(dels[0]);
+ this.ctag = this.escape_regex(dels[1]);
+ },
+
+ escape_regex: function (text) {
+ // thank you Simon Willison
+ if (!arguments.callee.sRE) {
+ var specials = [
+ '/', '.', '*', '+', '?', '|',
+ '(', ')', '[', ']', '{', '}', '\\'
+ ];
+ arguments.callee.sRE = new RegExp(
+ '(\\' + specials.join('|\\') + ')', 'g'
+ );
+ }
+ return text.replace(arguments.callee.sRE, '\\$1');
+ },
+
+ /*
+ find `name` in current `context`. That is find me a value
+ from the view object
+ */
+ find: function (name, context) {
+ name = trim(name);
+
+ // Checks whether a value is thruthy or false or 0
+ function is_kinda_truthy(bool) {
+ return bool === false || bool === 0 || bool;
+ }
+
+ var value;
+
+ // check for dot notation eg. foo.bar
+ if (name.match(/([a-z_]+)\./ig)) {
+ var childValue = this.walk_context(name, context);
+ if (is_kinda_truthy(childValue)) {
+ value = childValue;
+ }
+ } else {
+ if (is_kinda_truthy(context[name])) {
+ value = context[name];
+ } else if (is_kinda_truthy(this.context[name])) {
+ value = this.context[name];
+ }
+ }
+
+ if (typeof value == "function") {
+ return value.apply(context);
+ }
+ if (value !== undefined) {
+ return value;
+ }
+ // silently ignore unkown variables
+ return "";
+ },
+
+ walk_context: function (name, context) {
+ var path = name.split('.');
+ // if the var doesn't exist in current context, check the top level context
+ var value_context = (context[path[0]] != undefined) ? context : this.context;
+ var value = value_context[path.shift()];
+ while (value != undefined && path.length > 0) {
+ value_context = value;
+ value = value[path.shift()];
+ }
+ // if the value is a function, call it, binding the correct context
+ if (typeof value == "function") {
+ return value.apply(value_context);
+ }
+ return value;
+ },
+
+ // Utility methods
+
+ /* includes tag */
+ includes: function (needle, haystack) {
+ return haystack.indexOf(this.otag + needle) != -1;
+ },
+
+ // by @langalex, support for arrays of strings
+ create_context: function (_context) {
+ if (this.is_object(_context)) {
+ return _context;
+ } else {
+ var iterator = ".";
+ if (this.pragmas["IMPLICIT-ITERATOR"]) {
+ iterator = this.pragmas["IMPLICIT-ITERATOR"].iterator;
+ }
+ var ctx = {};
+ ctx[iterator] = _context;
+ return ctx;
+ }
+ },
+
+ is_object: function (a) {
+ return a && typeof a == "object";
+ },
+
+ /*
+ Why, why, why? Because IE. Cry, cry cry.
+ */
+ map: function (array, fn) {
+ if (typeof array.map == "function") {
+ return array.map(fn);
+ } else {
+ var r = [];
+ var l = array.length;
+ for(var i = 0; i < l; i++) {
+ r.push(fn(array[i]));
+ }
+ return r;
+ }
+ },
+
+ getCachedRegex: function (name, generator) {
+ var byOtag = regexCache[this.otag];
+ if (!byOtag) {
+ byOtag = regexCache[this.otag] = {};
+ }
+
+ var byCtag = byOtag[this.ctag];
+ if (!byCtag) {
+ byCtag = byOtag[this.ctag] = {};
+ }
+
+ var regex = byCtag[name];
+ if (!regex) {
+ regex = byCtag[name] = generator(this.otag, this.ctag);
+ }
+
+ return regex;
+ }
+ };
+
+ return({
+ name: "mustache.js",
+ version: "0.5.0-dev",
+
+ /*
+ Turns a template and view into HTML
+ */
+ to_html: function (template, view, partials, send_fun) {
+ var renderer = new Renderer();
+ if (send_fun) {
+ renderer.send = send_fun;
+ }
+ renderer.render(template, view || {}, partials);
+ if (!send_fun) {
+ return renderer.buffer.join("\n");
+ }
+ }
+ });
+}();
+// Underscore.js 1.2.3
+// (c) 2009-2011 Jeremy Ashkenas, DocumentCloud Inc.
+// Underscore is freely distributable under the MIT license.
+// Portions of Underscore are inspired or borrowed from Prototype,
+// Oliver Steele's Functional, and John Resig's Micro-Templating.
+// For all details and documentation:
+// http://documentcloud.github.com/underscore
+(function(){function r(a,c,d){if(a===c)return a!==0||1/a==1/c;if(a==null||c==null)return a===c;if(a._chain)a=a._wrapped;if(c._chain)c=c._wrapped;if(a.isEqual&&b.isFunction(a.isEqual))return a.isEqual(c);if(c.isEqual&&b.isFunction(c.isEqual))return c.isEqual(a);var e=l.call(a);if(e!=l.call(c))return false;switch(e){case "[object String]":return a==String(c);case "[object Number]":return a!=+a?c!=+c:a==0?1/a==1/c:a==+c;case "[object Date]":case "[object Boolean]":return+a==+c;case "[object RegExp]":return a.source==
+c.source&&a.global==c.global&&a.multiline==c.multiline&&a.ignoreCase==c.ignoreCase}if(typeof a!="object"||typeof c!="object")return false;for(var f=d.length;f--;)if(d[f]==a)return true;d.push(a);var f=0,g=true;if(e=="[object Array]"){if(f=a.length,g=f==c.length)for(;f--;)if(!(g=f in a==f in c&&r(a[f],c[f],d)))break}else{if("constructor"in a!="constructor"in c||a.constructor!=c.constructor)return false;for(var h in a)if(m.call(a,h)&&(f++,!(g=m.call(c,h)&&r(a[h],c[h],d))))break;if(g){for(h in c)if(m.call(c,
+h)&&!f--)break;g=!f}}d.pop();return g}var s=this,F=s._,o={},k=Array.prototype,p=Object.prototype,i=k.slice,G=k.concat,H=k.unshift,l=p.toString,m=p.hasOwnProperty,v=k.forEach,w=k.map,x=k.reduce,y=k.reduceRight,z=k.filter,A=k.every,B=k.some,q=k.indexOf,C=k.lastIndexOf,p=Array.isArray,I=Object.keys,t=Function.prototype.bind,b=function(a){return new n(a)};if(typeof exports!=="undefined"){if(typeof module!=="undefined"&&module.exports)exports=module.exports=b;exports._=b}else typeof define==="function"&&
+define.amd?define("underscore",function(){return b}):s._=b;b.VERSION="1.2.3";var j=b.each=b.forEach=function(a,c,b){if(a!=null)if(v&&a.forEach===v)a.forEach(c,b);else if(a.length===+a.length)for(var e=0,f=a.length;e2;a==null&&(a=[]);if(x&&a.reduce===x)return e&&(c=b.bind(c,e)),f?a.reduce(c,d):a.reduce(c);j(a,function(a,b,i){f?d=c.call(e,d,a,b,i):(d=a,f=true)});if(!f)throw new TypeError("Reduce of empty array with no initial value");return d};b.reduceRight=b.foldr=function(a,c,d,e){var f=arguments.length>2;a==null&&(a=[]);if(y&&a.reduceRight===y)return e&&(c=b.bind(c,e)),f?a.reduceRight(c,d):a.reduceRight(c);var g=b.toArray(a).reverse();e&&!f&&(c=b.bind(c,e));return f?b.reduce(g,
+c,d,e):b.reduce(g,c)};b.find=b.detect=function(a,c,b){var e;D(a,function(a,g,h){if(c.call(b,a,g,h))return e=a,true});return e};b.filter=b.select=function(a,c,b){var e=[];if(a==null)return e;if(z&&a.filter===z)return a.filter(c,b);j(a,function(a,g,h){c.call(b,a,g,h)&&(e[e.length]=a)});return e};b.reject=function(a,c,b){var e=[];if(a==null)return e;j(a,function(a,g,h){c.call(b,a,g,h)||(e[e.length]=a)});return e};b.every=b.all=function(a,c,b){var e=true;if(a==null)return e;if(A&&a.every===A)return a.every(c,
+b);j(a,function(a,g,h){if(!(e=e&&c.call(b,a,g,h)))return o});return e};var D=b.some=b.any=function(a,c,d){c||(c=b.identity);var e=false;if(a==null)return e;if(B&&a.some===B)return a.some(c,d);j(a,function(a,b,h){if(e||(e=c.call(d,a,b,h)))return o});return!!e};b.include=b.contains=function(a,c){var b=false;if(a==null)return b;return q&&a.indexOf===q?a.indexOf(c)!=-1:b=D(a,function(a){return a===c})};b.invoke=function(a,c){var d=i.call(arguments,2);return b.map(a,function(a){return(c.call?c||a:a[c]).apply(a,
+d)})};b.pluck=function(a,c){return b.map(a,function(a){return a[c]})};b.max=function(a,c,d){if(!c&&b.isArray(a))return Math.max.apply(Math,a);if(!c&&b.isEmpty(a))return-Infinity;var e={computed:-Infinity};j(a,function(a,b,h){b=c?c.call(d,a,b,h):a;b>=e.computed&&(e={value:a,computed:b})});return e.value};b.min=function(a,c,d){if(!c&&b.isArray(a))return Math.min.apply(Math,a);if(!c&&b.isEmpty(a))return Infinity;var e={computed:Infinity};j(a,function(a,b,h){b=c?c.call(d,a,b,h):a;bd?1:0}),"value")};b.groupBy=function(a,c){var d={},e=b.isFunction(c)?c:function(a){return a[c]};j(a,function(a,b){var c=e(a,b);(d[c]||(d[c]=[])).push(a)});return d};b.sortedIndex=
+function(a,c,d){d||(d=b.identity);for(var e=0,f=a.length;e>1;d(a[g])=0})})};b.difference=function(a){var c=b.flatten(i.call(arguments,1));return b.filter(a,function(a){return!b.include(c,a)})};b.zip=function(){for(var a=i.call(arguments),c=b.max(b.pluck(a,"length")),d=Array(c),e=0;e=0;d--)b=[a[d].apply(this,b)];return b[0]}};b.after=
+function(a,b){return a<=0?b():function(){if(--a<1)return b.apply(this,arguments)}};b.keys=I||function(a){if(a!==Object(a))throw new TypeError("Invalid object");var b=[],d;for(d in a)m.call(a,d)&&(b[b.length]=d);return b};b.values=function(a){return b.map(a,b.identity)};b.functions=b.methods=function(a){var c=[],d;for(d in a)b.isFunction(a[d])&&c.push(d);return c.sort()};b.extend=function(a){j(i.call(arguments,1),function(b){for(var d in b)b[d]!==void 0&&(a[d]=b[d])});return a};b.defaults=function(a){j(i.call(arguments,
+1),function(b){for(var d in b)a[d]==null&&(a[d]=b[d])});return a};b.clone=function(a){return!b.isObject(a)?a:b.isArray(a)?a.slice():b.extend({},a)};b.tap=function(a,b){b(a);return a};b.isEqual=function(a,b){return r(a,b,[])};b.isEmpty=function(a){if(b.isArray(a)||b.isString(a))return a.length===0;for(var c in a)if(m.call(a,c))return false;return true};b.isElement=function(a){return!!(a&&a.nodeType==1)};b.isArray=p||function(a){return l.call(a)=="[object Array]"};b.isObject=function(a){return a===
+Object(a)};b.isArguments=function(a){return l.call(a)=="[object Arguments]"};if(!b.isArguments(arguments))b.isArguments=function(a){return!(!a||!m.call(a,"callee"))};b.isFunction=function(a){return l.call(a)=="[object Function]"};b.isString=function(a){return l.call(a)=="[object String]"};b.isNumber=function(a){return l.call(a)=="[object Number]"};b.isNaN=function(a){return a!==a};b.isBoolean=function(a){return a===true||a===false||l.call(a)=="[object Boolean]"};b.isDate=function(a){return l.call(a)==
+"[object Date]"};b.isRegExp=function(a){return l.call(a)=="[object RegExp]"};b.isNull=function(a){return a===null};b.isUndefined=function(a){return a===void 0};b.noConflict=function(){s._=F;return this};b.identity=function(a){return a};b.times=function(a,b,d){for(var e=0;eb.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=
+a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=
+this.helper||this.element,a=0;a
');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-
+c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,
+arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,
+element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.13"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};
+if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),
+p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,
+c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),
+g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),
+10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,
+top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;
+g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:
+0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));
+if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&
+!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost==
+"string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;
+var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,
+10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
+;/*
+ * jQuery UI Selectable 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"),
+selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX,
+c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting",
+c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d=
+this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right
- Get flash to see
- this player
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
-
- \;
-
-
-
-
-
-
-
-
-
-
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 test/index.htm
--- a/test/index.htm Tue Oct 04 11:16:06 2011 +0200
+++ b/test/index.htm Fri Apr 06 16:55:34 2012 +0200
@@ -1,6 +1,5 @@
-
+
@@ -43,7 +42,7 @@
type:'jwplayer',
src:'../res/swf/player.swf'}
};
- __IriSP.init(config);
+ IriSP.init(config);
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/allocine_test/AcPlayer_v3.0_new.swf
Binary file test/integration/allocine_dossier_independant/allocine_test/AcPlayer_v3.0_new.swf has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/allocine_test/avatar.png
Binary file test/integration/allocine_dossier_independant/allocine_test/avatar.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/allocine_test/data_cinecast_new.xml
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/test/integration/allocine_dossier_independant/allocine_test/data_cinecast_new.xml Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,198 @@
+
+
-
-
-
-
-
-
-
-
-
-
-
-
- {{{share_template}}}
-
-
- Mots clefs :
- - {{#annotations}}
- {{^url}} {{/url}} {{! otherwise link to url }} {{#url}} {{/url}} {{begin}} - {{end}}{{! if the url is not present, it means that the annotation exists in the current project }} {{title}}{{#tags.length}}
- {{#tags}}
- {{.}} {{/tags}}
{{/annotations}} -
{{^cinecast_version}} {{/cinecast_version}}
{{#show_from_field}} {{/show_from_field}}
{{#tags.length}} {{^user_avatar}} {{/user_avatar}} {{#user_avatar}} {{/user_avatar}}
{{/user_avatar}} {{#user_avatar}} - {{#tags}} {{/tags}}
- {{#polemics}} {{/polemics}}
{{l10n.wait_while_processed}}
{{l10n.error_while_contacting}}
{{l10n.empty_annotation}}
"; +IriSP.loading_template = "{{l10n.loading_wait}}
";
+IriSP.overlay_marker_template = "{{! the template for the small bars which is z-indexed over our segment widget }}";
+IriSP.player_template = "{{! template for the radio player }} {{^disable_annotate_btn}} {{/disable_annotate_btn}} {{^disable_search_btn}} {{/disable_search_btn}}
00:00
/
00:00
{{! the whole bar }} {{! the zone which represents our slice }}
";
+IriSP.sliderWidget_template = "{{! template for the slider widget - it's composed of two divs we one overlayed on top of the other }}";
+IriSP.tooltip_template = "{{! template used by the jquery ui tooltip }}{{title}}
{{begin}} : {{end}}
{{description}}
";
+IriSP.tweetWidget_template = "{{! template for the tweet widget }}";/* utils.js - various utils that don't belong anywhere else */
+
+/* trace function, for debugging */
+
+IriSP.traceNum = 0;
+IriSP.trace = function( msg, value ) {
+/*
+ if( IriSP.config.gui.debug === true ) {
+ IriSP.traceNum += 1;
+ IriSP.jQuery( "
');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
+String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
+this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();
+var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=
+false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});
+this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff=
+{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];
+if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=
+false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);
+c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,
+d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidth"+IriSP.traceNum+" - "+msg+" : "+value+"
" ).appendTo( "#Ldt-output" );
+ }
+*/
+};
+
+/* used in callbacks - because in callbacks we lose "this",
+ we need to have a special function which wraps "this" in
+ a closure. This way, the
+*/
+IriSP.wrap = function (obj, fn) {
+ return function() {
+ var args = Array.prototype.slice.call(arguments, 0);
+ return fn.apply(obj, args);
+ }
+}
+
+/* convert a time to a percentage in the media */
+IriSP.timeToPourcent = function(time, timetotal){
+ var time = Math.abs(time);
+ var timetotal = Math.abs(timetotal);
+
+ return Math.floor((time/timetotal) * 100);
+};
+
+IriSP.padWithZeros = function(num) {
+ if (Math.abs(num) < 10) {
+ return "0" + num.toString();
+ } else {
+ return num.toString();
+ }
+};
+
+/* convert a number of milliseconds to a tuple of the form
+ [hours, minutes, seconds]
+*/
+IriSP.msToTime = function(ms) {
+ return IriSP.secondsToTime(ms / 1000);
+}
+/* convert a number of seconds to a tuple of the form
+ [hours, minutes, seconds]
+*/
+IriSP.secondsToTime = function(secs) {
+ var hours = Math.abs(parseInt( secs / 3600 ) % 24);
+ var minutes = Math.abs(parseInt( secs / 60 ) % 60);
+ var seconds = parseFloat(Math.abs(secs % 60).toFixed(0));
+
+ var toString_fn = function() {
+ var ret = "";
+ if (hours > 0)
+ ret = IriSP.padWithZeros(this.hours) + ":";
+ ret += IriSP.padWithZeros(this.minutes) + ":" + IriSP.padWithZeros(this.seconds);
+
+ return ret;
+ }
+ return {"hours" : hours, "minutes" : minutes, "seconds" : seconds, toString: toString_fn};
+};
+
+/* format a tweet - replaces @name by a link to the profile, #hashtag, etc. */
+IriSP.formatTweet = function(tweet) {
+ /*
+ an array of arrays which hold a regexp and its replacement.
+ */
+ var regExps = [
+ /* copied from http://codegolf.stackexchange.com/questions/464/shortest-url-regex-match-in-javascript/480#480 */
+ [/((https?:\/\/)?[\w-]+(\.[\w-]+)+\.?(:\d+)?(\/\S*)?)/gi, "$1"],
+ [/@(\w+)/gi, "@$1"], // matches a @handle
+ [/#(\w+)/gi, "#$1"],// matches a hashtag
+ [/(\+\+)/gi, "$1"],
+ [/(--)/gi, "$1"],
+ [/(==)/gi, "$1"],
+ [/(\?\?)/gi, "$1"]
+ ];
+
+ var i = 0;
+ for(i = 0; i < regExps.length; i++) {
+ tweet = tweet.replace(regExps[i][0], regExps[i][1]);
+ }
+
+ return tweet;
+};
+
+IriSP.countProperties = function(obj) {
+ var count = 0;
+
+ for(var prop in obj) {
+ if(obj.hasOwnProperty(prop))
+ ++count;
+ }
+
+ return count;
+};
+
+// conversion de couleur Decimal vers HexaDecimal || 000 si fff
+IriSP.DEC_HEXA_COLOR = function (dec) {
+ var val = +dec;
+ var str = val.toString(16);
+ var zeroes = "";
+ if (str.length < 6) {
+ for (var i = 0; i < 6 - str.length; i++)
+ zeroes += "0";
+ }
+ return zeroes + str;
+};
+
+/* shortcut to have global variables in templates */
+IriSP.templToHTML = function(template, values) {
+ var params = IriSP.underscore.extend(
+ { "defaults" : IriSP.default_templates_vars,
+ "l10n" : IriSP.i18n.getMessages()
+ },
+ values);
+ return Mustache.to_html(template, params);
+};
+
+/* we need to be stricter than encodeURIComponent,
+ because of twitter
+*/
+IriSP.encodeURI = function(str) {
+ return encodeURIComponent(str).replace(/!/g, '%21').replace(/'/g, '%27').replace(/\(/g, '%28').
+ replace(/\)/g, '%29').replace(/\*/g, '%2A');
+}
+
+IriSP.jqEscape = function(text) {
+ return text.replace(/(:|\.)/g,'\\$1')
+}
+
+IriSP.jqId = function (text) {
+ return IriSP.jQuery('#' + IriSP.jqEscape(text));
+ }
+
+IriSP.__guidCounter = 0;
+IriSP.guid = function(prefix) {
+ IriSP.__guidCounter += 1;
+ return prefix + IriSP.__guidCounter;
+};
+
+/** returns an url to share on facebook */
+IriSP.mkFbUrl = function(url, text) {
+ if (typeof(text) === "undefined")
+ text = "I'm watching ";
+
+ return "http://www.facebook.com/share.php?u=" + IriSP.encodeURI(text) + IriSP.shorten_url(url);
+};
+
+/** returns an url to share on twitter */
+IriSP.mkTweetUrl = function(url, text) {
+ if (typeof(text) === "undefined")
+ text = "I'm watching ";
+
+ return "http://twitter.com/home?status=" + IriSP.encodeURI(text) + IriSP.shorten_url(url);
+};
+
+/** returns an url to share on google + */
+IriSP.mkGplusUrl = function(url, text) {
+ return "https://plusone.google.com/_/+1/confirm?hl=en&url=" + IriSP.shorten_url(url);
+};
+
+/** test if a value is null or undefined */
+IriSP.null_or_undefined = function(val) {
+ return (typeof(val) === "undefined" || val === null);
+};
+
+/** get a property that can have multiple names **/
+
+IriSP.get_aliased = function(_obj, _aliases) {
+ for (var _i = 0; _i < _aliases.length; _i++) {
+ if (typeof _obj[_aliases[_i]] !== "undefined") {
+ return _obj[_aliases[_i]];
+ }
+ }
+ return null;
+}
+
+/** issue a call to an url shortener and return the shortened url */
+IriSP.shorten_url = function(url) {
+ if (IriSP.config.shortener.hasOwnProperty("shortening_function"))
+ return IriSP.config.shortener.shortening_function(url);
+
+ return url;
+};
+
+
+/* for ie compatibility
+if (Object.prototype.__defineGetter__&&!Object.defineProperty) {
+ Object.defineProperty=function(obj,prop,desc) {
+ if ("get" in desc) obj.__defineGetter__(prop,desc.get);
+ if ("set" in desc) obj.__defineSetter__(prop,desc.set);
+ }
+}
+*/
+
+/* Creates regexps from text */
+IriSP.regexpFromText = function(_text) {
+ return new RegExp('(' + _text.replace(/(\W)/gim,'\\$1') + ')','gim');
+}
+/* wrapper that simulates popcorn.js because
+ popcorn is a bit unstable at the time */
+
+IriSP.PopcornReplacement = {
+};
+
+/** base class for our popcorn-compatible players.
+ */
+IriSP.PopcornReplacement.player = function(container, options) {
+ /* the jwplayer calls the callbacks in the global space so we need to
+ preserve them using IriSP.wrap */
+ this.callbacks = {
+ onReady: IriSP.wrap(this, this.__initApi),
+ onTime: IriSP.wrap(this, this.__timeHandler),
+ onPlay: IriSP.wrap(this, this.__playHandler),
+ onPause: IriSP.wrap(this, this.__pauseHandler),
+ onSeek: IriSP.wrap(this, this.__seekHandler)
+ };
+
+ this.media = {
+ "paused": true,
+ "muted": false
+ };
+
+ this.container = container.slice(1); //eschew the '#'
+
+ this.msgPump = {}; /* dictionnary used to receive and send messages */
+ this.__codes = []; /* used to schedule the execution of a piece of code in
+ a segment (similar to the popcorn.code plugin). */
+
+ this._options = options;
+
+};
+
+IriSP.PopcornReplacement.player.prototype.listen = function(msg, callback) {
+ if (!this.msgPump.hasOwnProperty(msg))
+ this.msgPump[msg] = [];
+
+ this.msgPump[msg].push(callback);
+};
+
+IriSP.PopcornReplacement.player.prototype.trigger = function(msg, params) {
+ if (!this.msgPump.hasOwnProperty(msg))
+ return;
+
+ var d = this.msgPump[msg];
+
+ for(var i = 0; i < d.length; i++) {
+ d[i].call(window, params);
+ }
+
+};
+
+IriSP.PopcornReplacement.player.prototype.guid = function(prefix) {
+ var str = 'xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g, function(c) {
+ var r = Math.random()*16|0, v = c == 'x' ? r : (r&0x3|0x8);
+ return v.toString(16);
+ });
+
+ return prefix + str;
+};
+
+/** init the api after that flash player has been setup - called by the callback
+ defined by the embedded flash player
+*/
+IriSP.PopcornReplacement.player.prototype.__initApi = function() {
+ this.trigger("loadedmetadata"); // we've done more than loading metadata of course,
+ // but popcorn doesn't need to know more.
+ this.media.muted = this.playerFns.getMute();
+ /* some programmed segments are supposed to be run at the beginning */
+ var i = 0;
+ for(i = 0; i < this.__codes.length; i++) {
+ var c = this.__codes[i];
+ if (0 == c.start) {
+ c.onStart();
+ }
+
+ if (0 == c.end) {
+ c.onEnd();
+ }
+ }
+};
+
+/*
+IriSP.PopcornReplacement.jwplayer = function(container, options) {
+ IriSP.PopcornReplacement._container = container.slice(1); //eschew the '#'
+ options.events = {
+ onReady: IriSP.PopcornReplacement.__initApi,
+ onTime: IriSP.PopcornReplacement.__timeHandler,
+ onPlay: IriSP.PopcornReplacement.__playHandler,
+ onPause: IriSP.PopcornReplacement.__pauseHandler,
+ onSeek: IriSP.PopcornReplacement.__seekHandler
+ }
+
+ jwplayer(IriSP.PopcornReplacement._container).setup(options);
+ IriSP.PopcornReplacement.media.duration = options.duration;
+ return IriSP.PopcornReplacement;
+};
+*/
+
+IriSP.PopcornReplacement.player.prototype.currentTime = function(time) {
+ if (typeof(time) === "undefined") {
+ return this.playerFns.getPosition();
+ } else {
+ var currentTime = +time;
+ this.playerFns.seek(currentTime);
+ return currentTime;
+ }
+};
+
+IriSP.PopcornReplacement.player.prototype.play = function() {
+ this.media.paused = false;
+ this.trigger("play");
+ //IriSP.PopcornReplacement.trigger("playing");
+ this.playerFns.play();
+};
+
+IriSP.PopcornReplacement.player.prototype.pause = function() {
+// if ( !this.media.paused ) {
+ this.media.paused = true;
+ this.trigger( "pause" );
+ this.playerFns.pause();
+// }
+};
+
+IriSP.PopcornReplacement.player.prototype.muted = function(val) {
+ if (typeof(val) !== "undefined") {
+
+ if (this.playerFns.getMute() !== val) {
+ if (val) {
+ this.playerFns.setMute(true);
+ this.media.muted = true;
+ } else {
+ this.playerFns.setMute(false);
+ this.media.muted = false;
+ }
+
+ this.trigger( "volumechange" );
+ }
+
+ return this.playerFns.getMute();
+ } else {
+ return this.playerFns.getMute();
+ }
+};
+
+IriSP.PopcornReplacement.player.prototype.volume = function(val) {
+ if (typeof this.playerFns.getVolume == "undefined" || typeof this.playerFns.setVolume == "undefined") {
+ return false;
+ }
+ var _vol = this.playerFns.getVolume();
+ if (typeof(val) !== "undefined" && parseFloat(val) !== NaN) {
+ val = Math.max(0, Math.min(1, val));
+ if (parseFloat(val) != parseFloat(_vol)) {
+ this.playerFns.setVolume(val);
+ this.trigger("volumechange");
+ _vol = this.playerFns.getVolume();
+ }
+ }
+ return _vol;
+};
+
+IriSP.PopcornReplacement.player.prototype.mute = IriSP.PopcornReplacement.player.prototype.muted;
+
+IriSP.PopcornReplacement.player.prototype.code = function(options) {
+ this.__codes.push(options);
+ return this;
+};
+
+/* called everytime the player updates itself
+ (onTime event)
+ */
+
+IriSP.PopcornReplacement.player.prototype.__timeHandler = function(event) {
+ var pos = event.position;
+
+ var i = 0;
+ for(i = 0; i < this.__codes.length; i++) {
+ var c = this.__codes[i];
+
+ if (pos >= c.start && pos < c.end &&
+ pos - 1 <= c.start) {
+ c.onStart();
+ }
+
+ if (pos > c.start && pos > c.end &&
+ pos - 1 <= c.end) {
+ c.onEnd();
+ }
+
+ }
+
+ this.trigger("timeupdate");
+};
+
+IriSP.PopcornReplacement.player.prototype.__seekHandler = function(event) {
+ var i = 0;
+
+ for(i = 0; i < this.__codes.length; i++) {
+ var c = this.__codes[i];
+
+ if (event.position >= c.start && event.position < c.end) {
+ c.onEnd();
+ }
+ }
+
+ for(i = 0; i < this.__codes.length; i++) {
+ var c = this.__codes[i];
+
+ if (typeof(event.offset) === "undefined")
+ event.offset = 0;
+
+ if (event.offset >= c.start && event.offset < c.end) {
+ c.onStart();
+ }
+
+ }
+
+ /* this signal sends as an extra argument the position in the video.
+ As far as I know, this argument is not provided by popcorn */
+ this.trigger("seeked", event.offset);
+};
+
+IriSP.PopcornReplacement.player.prototype.__playHandler = function(event) {
+ this.media.paused = false;
+ this.trigger("play");
+};
+
+IriSP.PopcornReplacement.player.prototype.__pauseHandler = function(event) {
+ this.media.paused = true;
+ this.trigger("pause");
+};
+
+IriSP.PopcornReplacement.player.prototype.roundTime = function() {
+ var currentTime = this.currentTime();
+ return Math.round(currentTime);
+};/* data.js - this file deals with how the players gets and sends data */
+
+IriSP.DataLoader = function() {
+ this._cache = {};
+
+ /*
+ A structure to hold callbacks for specific urls. We need it because
+ ajax calls are asynchronous, so it means that sometimes we ask
+ multiple times for a ressource because the first call hasn't been
+ received yet.
+ */
+ this._callbacks = {};
+};
+
+IriSP.DataLoader.prototype.get = function(url, callback, force_reload) {
+ var base_url = url.split("&")[0];
+ if (typeof force_reload != "undefined" && force_reload && this._cache.hasOwnProperty(base_url)) {
+ delete this._cache[base_url]
+ }
+ if (this._cache.hasOwnProperty(base_url)) {
+ callback(this._cache[base_url]);
+ } else {
+ if (!this._callbacks.hasOwnProperty(base_url)) {
+ this._callbacks[base_url] = [callback];
+ /* we need a closure because this gets lost when it's called back */
+
+ // uncomment you don't want to use caching.
+ // IriSP.jQuery.get(url, callback);
+
+ var func = function(data) {
+ this._cache[base_url] = data;
+ var i = 0;
+
+ for (i = 0; i < this._callbacks[base_url].length; i++) {
+ this._callbacks[base_url][i](this._cache[base_url]);
+ }
+ delete this._callbacks[base_url];
+ };
+
+ /* automagically choose between json and jsonp */
+ if (url.indexOf(document.location.hostname) === -1 &&
+ url.indexOf("http://") !== -1 /* not a relative url */ ) {
+ // we contacting a foreign domain, use JSONP
+
+ IriSP.jQuery.get(url, {}, IriSP.wrap(this, func), "jsonp");
+ } else {
+
+ // otherwise, hey, whatever rows your boat
+ IriSP.jQuery.get(url, IriSP.wrap(this, func));
+ }
+
+ } else {
+ /* simply push the callback - it'll get called when the ressource
+ has been received */
+
+ this._callbacks[base_url].push(callback);
+
+ }
+ }
+}
+
+/* the base abstract "class" */
+IriSP.Serializer = function(DataLoader, url) {
+ this._DataLoader = DataLoader;
+ this._url = url;
+ this._data = [];
+};
+
+IriSP.Serializer.prototype.serialize = function(data) { };
+IriSP.Serializer.prototype.deserialize = function(data) {};
+
+IriSP.Serializer.prototype.currentMedia = function() {
+};
+
+IriSP.Serializer.prototype.getDuration = function() {
+};
+
+IriSP.Serializer.prototype.sync = function(callback) {
+ this._DataLoader.get(this._url, callback, force_refresh);
+};
+
+IriSP.SerializerFactory = function(DataLoader) {
+ this._dataloader = DataLoader;
+};
+
+IriSP.SerializerFactory.prototype.getSerializer = function(metadataOptions) {
+ /* This function returns serializer set-up with the correct
+ configuration - takes a metadata struct describing the metadata source
+ */
+
+ if (metadataOptions === undefined)
+ /* return an empty serializer */
+ return IriSP.Serializer("", "");
+
+ switch(metadataOptions.type) {
+ case "json":
+ return new IriSP.JSONSerializer(this._dataloader, metadataOptions.src);
+ break;
+
+ case "dummy": /* only used for unit testing - not defined in production */
+ return new IriSP.MockSerializer(this._dataloader, metadataOptions.src);
+ break;
+
+ case "empty":
+ return new IriSP.Serializer("", "empty");
+ break;
+
+ default:
+ return undefined;
+ }
+};
+IriSP.language = 'en';
+
+IriSP.libFiles = {
+ defaultDir : "js/libs/",
+ inDefaultDir : {
+ jQuery : "jquery.min.js",
+ jQueryUI : "jquery-ui.min.js",
+ jQueryToolTip : "jquery.tools.min.js",
+ swfObject : "swfobject.js",
+ cssjQueryUI : "jquery-ui.css",
+ popcorn : "popcorn.js",
+ jwplayer : "jwplayer.js",
+ raphael : "raphael.js",
+ "popcorn.mediafragment" : "popcorn.mediafragment.js",
+ "popcorn.code" : "popcorn.code.js",
+ "popcorn.jwplayer" : "popcorn.jwplayer.js",
+ "popcorn.youtube" : "popcorn.youtube.js",
+ "tracemanager" : "tracemanager.js"
+ },
+ locations : {
+ // use to define locations outside defautl_dir
+ },
+ cdn : {
+ jQueryUI : "http://ajax.googleapis.com/ajax/libs/jqueryui/1.8.17/jquery-ui.js",
+ jQueryToolTip : "http://cdn.jquerytools.org/1.2.4/all/jquery.tools.min.js",
+ swfObject : "http://ajax.googleapis.com/ajax/libs/swfobject/2.2/swfobject.js",
+ cssjQueryUI : "http://ajax.googleapis.com/ajax/libs/jqueryui/1.8.4/themes/base/jquery-ui.css"
+ },
+ useCdn : false
+}
+
+IriSP.widgetsDefaults = {
+ "LayoutManager" : {
+ spacer_div_height : 0
+ },
+ "PlayerWidget" : {
+
+ },
+ "AnnotationsWidget" : {
+ "share_text" : "I'm watching "
+ },
+ "TweetsWidget" : {
+ default_profile_picture : "https://si0.twimg.com/sticky/default_profile_images/default_profile_1_normal.png",
+ tweet_display_period : 10000 // how long do we show a tweet ?
+ },
+ "SliderWidget" : {
+ minimize_period : 850 // how long does the slider stays maximized after the user leaves the zone ?
+ },
+ "SegmentsWidget" : {
+ cinecast_version : false
+ },
+ "createAnnotationWidget" : {
+ tags : [
+ {
+ "id" : "digitalstudies",
+ "meta" : {
+ "description" : "#digital-studies"
+ }
+ },
+ {
+ "id" : "amateur",
+ "meta" : {
+ "description" : "#amateur"
+ },
+ }
+ ],
+ remote_tags : false,
+ random_tags : false,
+ show_from_field : false,
+ polemic_mode : true, /* enable polemics ? */
+ polemics : [{
+ "className" : "positive",
+ "keyword" : "++"
+ }, {
+ "className" : "negative",
+ "keyword" : "--"
+ }, {
+ "className" : "reference",
+ "keyword" : "=="
+ }, {
+ "className" : "question",
+ "keyword" : "??"
+ }],
+ cinecast_version : false, /* put to false to enable the platform version, true for the festival cinecast one. */
+
+ /* where does the widget PUT the annotations - this is a mustache template. id refers to the id of the media ans is filled
+ by the widget.
+ */
+ api_endpoint_template : "", // platform_url + "/ldtplatform/api/ldt/annotations/{{id}}.json",
+ api_method : "PUT"
+ },
+ "SparklineWidget" : {
+ lineColor : "#7492b4",
+ fillColor : "#aeaeb8",
+ lineWidth : 2
+ },
+ "AnnotationsListWidget" : {
+ ajax_mode : true, /* use ajax to get information about the annotations.
+ if set to false, only search in the annotations for the
+ current project. */
+ /* the platform generates some funky urls. We replace them afterwards to point to the
+ correct place - this setting will probably be overwritten by the platform
+ implementers.
+ Note that the player has to replace the variables between {{ and }} by its own values.
+ */
+ ajax_url : "", //platform_url + "/ldtplatform/api/ldt/segments/{{media}}/{{begin}}/{{end}}",
+ ajax_granularity : 10000, /* how much ms should we look before and after the current timecode */
+ default_thumbnail : "http://ldt.iri.centrepompidou.fr/static/site/ldt/css/imgs/video_sequence.png",
+ project_url : "", //platform_url + "/ldtplatform/ldt/front/player/"
+ /* the beginning of a link to the new front */
+ cinecast_version : false,
+ refresh_interval : 10000
+ },
+ "StackGraphWidget" : {
+ defaultcolor : "#585858",
+ tags : [
+ {
+ "keywords" : [ "++" ],
+ "description" : "positif",
+ "color" : "#1D973D"
+ },
+ {
+ "keywords" : [ "--" ],
+ "description" : "negatif",
+ "color" : "#CE0A15"
+ },
+ {
+ "keywords" : [ "==" ],
+ "description" : "reference",
+ "color" : "#C5A62D"
+ },
+ {
+ "keywords" : [ "??" ],
+ "description" : "question",
+ "color" : "#036AAE"
+ }
+ ],
+ streamgraph : false
+ }
+}/* the widget classes and definitions */
+
+/**
+ * @class Widget is an "abstract" class. It's mostly used to define some properties common to every widget.
+ *
+ * Note that widget constructors are never called directly by the user. Instead, the widgets are instantiated by functions
+ * defined in init.js
+ *
+ * @constructor
+ * @param Popcorn a reference to the popcorn Object
+ * @param config configuration options for the widget
+ * @param Serializer a serializer instance from which the widget reads data fromCharCode
+*/
+IriSP.Widget = function(Popcorn, config, Serializer) {
+
+ if (config === undefined || config === null) {
+ config = {}
+ }
+
+ this._Popcorn = Popcorn;
+ this._config = config;
+ this._serializer = Serializer;
+
+ if (config.hasOwnProperty("container")) {
+ this._id = config.container;
+ this.selector = IriSP.jQuery("#" + this._id);
+ }
+
+ if (config.hasOwnProperty("spacer")) {
+ this._spacerId = config.spacer;
+ this.spacer = IriSP.jQuery("#" + this._spacerId);
+ }
+
+
+ if (config.hasOwnProperty("width")) {
+ // this.width and not this._width because we consider it public.
+ this.width = config.width;
+ }
+
+ if (config.hasOwnProperty("height")) {
+ this.height = config.height;
+ }
+
+ if (config.hasOwnProperty("heightmax")) {
+ this.heightmax = config.heightmax;
+ }
+
+ if (config.hasOwnProperty("widthmax")) {
+ this.widthmax = config.widthmax;
+ }
+
+ if (config.hasOwnProperty("layoutManager")) {
+ this.layoutManager = config.layoutManager;
+ }
+ if (typeof this.selector != "undefined") {
+ this.selector.addClass("Ldt-TraceMe").addClass("Ldt-Widget");
+ this.selector.attr("widget-type", this._config.type);
+ }
+
+ // Parsing Widget Defaults
+ var _this = this;
+
+ if (typeof config.type == "string" && typeof IriSP.widgetsDefaults[config.type] == "object") {
+ IriSP._(IriSP.widgetsDefaults[config.type]).each(function(_v, _k) {
+ if (typeof config[_k] != "undefined") {
+ _this[_k] = config[_k];
+ } else {
+ _this[_k] = _v;
+ }
+ });
+ }
+
+};
+
+
+IriSP.Widget.prototype.currentMedia = function() {
+ return this._serializer.currentMedia();
+}
+
+IriSP.Widget.prototype.getDuration = function() {
+ return this._serializer.getDuration();
+}
+
+/**
+ * This method responsible of drawing a widget on screen.
+ */
+IriSP.Widget.prototype.draw = function() {
+ /* implemented by "sub-classes" */
+};
+
+/**
+ * Optional method if you want your widget to support redraws.
+ */
+IriSP.Widget.prototype.redraw = function() {
+ /* implemented by "sub-classes" */
+};
+/* modules are non-graphical entities, similar to widgets */
+
+IriSP.Module = function(Popcorn, config, Serializer) {
+
+ if (config === undefined || config === null) {
+ config = {}
+ }
+
+ this._Popcorn = Popcorn;
+ this._config = config;
+ this._serializer = Serializer;
+};
+/* layout.js - very basic layout management */
+
+/**
+ @class a layout manager manages a div and the layout of objects
+ inside it.
+*/
+IriSP.LayoutManager = function(options) {
+ this._Popcorn = null;
+ this._widgets = [];
+
+ this._div = "LdtPlayer";
+ this._width = 640;
+
+ if (options === undefined) {
+ options = {};
+ };
+
+ if (options.hasOwnProperty('container')) {
+ this._div = options.container;
+ }
+
+ if (options.hasOwnProperty('width')) {
+ this._width = options.width;
+ }
+
+ if (options.hasOwnProperty('height')) {
+ this._height = options.height;
+ }
+
+ /* this is a shortcut */
+ this.selector = IriSP.jQuery("#" + this._div);
+
+ this.selector.css({
+ "width": this._width,
+ "clear": "both"
+ });
+
+ if (this._height !== undefined)
+ this.selector.css("height", this._height);
+};
+
+/**
+ Set the popcorn instance used by the manager.
+
+ we need this special setter because of a chicken and egg problem :
+ we want the manager to use popcorn but the popcorn div will be managed
+ by the manager. So we need a way to set the instance the manager uses
+*/
+
+IriSP.LayoutManager.prototype.setPopcornInstance = function(popcorn) {
+ this._Popcorn = popcorn;
+}
+
+/** create a subdiv with an unique id, and a spacer div as well.
+ @param widgetName the name of the widget.
+ @return an array of the form [createdivId, spacerdivId].
+*/
+IriSP.LayoutManager.prototype.createDiv = function(widgetName) {
+ if (typeof(widgetName) === "undefined")
+ widgetName = "";
+
+ var newDiv = IriSP.guid(this._div + "_widget_" + widgetName + "_");
+ var spacerDiv = IriSP.guid("LdtPlayer_spacer_");
+ this._widgets.push([widgetName, newDiv]);
+
+ var divTempl = "");
+
+ if (options.hasOwnProperty("width"))
+ IriSP.jQuery("#" + containerDiv).css("width", options.width);
+
+ if (options.hasOwnProperty("height"))
+ IriSP.jQuery("#" + containerDiv).css("height", options.height);
+
+ pop = Popcorn("#" + tmpId);
+ break;
+
+ case "jwplayer":
+ var opts = IriSP.jQuery.extend({}, options);
+ delete opts.container;
+ delete opts.type;
+
+
+ /* Try to guess options.file and options.streamer only if file and streamer
+ are not already defined in the configuration */
+ if (options.provider === "rtmp" && !opts.hasOwnProperty("file") && !opts.hasOwnProperty("streamer")) {
+ /* exit if we can't access the metadata */
+ if (typeof(IriSP.__jsonMetadata) === "undefined") {
+ break;
+ };
+
+ // the json format is totally illogical
+ //opts.streamer = IriSP.__jsonMetadata["medias"][0]["meta"]["item"]["value"];
+ //var source = IriSP.__jsonMetadata["medias"][0]["href"];
+
+ // the source if a full url but jwplayer wants an url relative to the
+ // streamer url, so we've got to remove the common part.
+ //opts.file = source.slice(opts.streamer.length);
+
+ /* sometimes we get served a file with a wrong path and streamer.
+ as a streamer is of the form rtmp://domain/path/ and the media is
+ the rest, we uglily do this :
+ */
+ opts.file = "";
+ opts.streamer = "";
+ var fullPath = IriSP.get_aliased(IriSP.__jsonMetadata["medias"][0], ["href","url"]);
+
+ if (fullPath === null) {
+ console.log("no url or href field defined in the metadata.");
+ }
+
+ var pathSplit = fullPath.split('/');
+
+ for (var i = 0; i < pathSplit.length; i++) {
+ if (i < 4) {
+ opts.streamer += pathSplit[i] + "/";
+ } else {
+ opts.file += pathSplit[i];
+ /* omit the last slash if we're on the last element */
+ if (i < pathSplit.length - 1)
+ opts.file += "/";
+ }
+ }
+ } else {
+ /* other providers type, video for instance -
+ pass everything as is */
+ }
+
+ if (!options.hasOwnProperty("flashplayer")) {
+ opts.flashplayer = IriSP.jwplayer_swf_path;
+ }
+
+ if (!options.hasOwnProperty("controlbar.position")) {
+ opts["controlbar.position"] = "none";
+ }
+
+ pop = new IriSP.PopcornReplacement.jwplayer("#" + containerDiv, opts);
+ break;
+
+ case "youtube":
+ var opts = IriSP.jQuery.extend({}, options);
+ delete opts.container;
+ opts.controls = 0;
+ opts.autostart = false;
+ templ = "width: {{width}}px; height: {{height}}px;";
+ var str = Mustache.to_html(templ, {width: opts.width, height: opts.height});
+ // Popcorn.youtube wants us to specify the size of the player in the style attribute of its container div.
+ IriSP.jQuery("#" + containerDiv).attr("style", str);
+
+ pop = Popcorn.youtube("#" + containerDiv, opts.video, opts);
+ break;
+
+ case "dailymotion":
+ pop = new IriSP.PopcornReplacement.dailymotion("#" + containerDiv, options);
+ break;
+
+ case "allocine":
+ /* pass the options as-is to the allocine player and let it handle everything */
+ pop = new IriSP.PopcornReplacement.allocine("#" + containerDiv, options);
+ break;
+
+ default:
+ pop = undefined;
+ };
+
+ return pop;
+};
+
+/** Configure the gui and instantiate the widgets passed as parameters
+ @param guiOptions the gui object as seen in the examples.
+ */
+IriSP.configureWidgets = function (popcornInstance, layoutManager, guiOptions) {
+
+ var serialFactory = new IriSP.SerializerFactory(IriSP.__dataloader);
+ var params = {width: guiOptions.width, height: guiOptions.height};
+
+ var default_options = guiOptions.default_options;
+ if (IriSP.null_or_undefined(default_options))
+ default_options = {};
+
+ var ret_widgets = [];
+ var index;
+
+ for (index = 0; index < guiOptions.widgets.length; index++) {
+ var widget = IriSP.instantiateWidget(popcornInstance, serialFactory, layoutManager, guiOptions.widgets[index], default_options);
+
+ ret_widgets.push(widget);
+ };
+
+ return ret_widgets;
+};
+
+/** configure modules. @see configureWidgets */
+IriSP.configureModules = function (popcornInstance, modulesList) {
+ if (IriSP.null_or_undefined(modulesList))
+ return;
+
+ var serialFactory = new IriSP.SerializerFactory(IriSP.__dataloader);
+ var ret_modules = [];
+ var index;
+
+ for (index = 0; index < modulesList.length; index++) {
+ var moduleConfig = modulesList[index];
+
+ var serializer = serialFactory.getSerializer(moduleConfig.metadata);
+ var module = new IriSP[moduleConfig.type](popcornInstance, moduleConfig, serializer);
+ ret_modules.push(module);
+ };
+
+ return ret_modules;
+};
+
+/** instantiate a widget - only called by configureWidgets, never by the user. Handles widget
+ dependencies.
+ @param popcornInstance popcorn instance the widget will user
+ @param serialFactory serializer factory to instantiate the widget with
+ @param layoutManager layout manager
+ @param widgetConfig configuration options for the widget
+ @param defaultOptions a dictionnary with some options defined for every widget.
+ */
+IriSP.instantiateWidget = function(popcornInstance, serialFactory, layoutManager, widgetConfig, defaultOptions) {
+
+ if (IriSP.null_or_undefined(defaultOptions))
+ defaultOptions = {};
+
+ widgetConfig = IriSP.underscore.defaults(widgetConfig, defaultOptions);
+
+ var arr = IriSP.jQuery.extend({}, widgetConfig);
+
+ /* create a div for those widgets who didn't already specify a container; */
+ if (!arr.hasOwnProperty("container")) {
+ /* create div returns us a container for the widget and a spacer */
+ var ret = layoutManager.createDiv(widgetConfig.type);
+ var container = ret[0];
+ var spacer = ret[1];
+ arr.container = container;
+ arr.spacer = spacer;
+ arr.layoutManager = layoutManager;
+ }
+ var serializer = serialFactory.getSerializer(widgetConfig.metadata);
+
+ if (typeof serializer == "undefined")
+ debugger;
+
+ // instantiate the object passed as a string
+ var widget = new IriSP[widgetConfig.type](popcornInstance, arr, serializer);
+
+ if (widgetConfig.hasOwnProperty("requires")) {
+ // also create the widgets this one depends on.
+ // the dependency widget is available in the parent widget context as
+ // this.WidgetName (for instance, this.TipWidget);
+
+ var i = 0;
+ for(i = 0; i < widgetConfig.requires.length; i++) {
+ var widgetName = widgetConfig.requires[i]["type"],
+ _configobj = IriSP.jQuery.extend({}, widgetConfig.requires[i]),
+ _div = document.createElement('div'),
+ _container = IriSP.guid(arr.container + '_' + widgetName + '_');
+ _configobj.container = _container;
+ _div.id = _container;
+ widget.selector.append(_div);
+ widget[widgetName] = IriSP.instantiateWidget(popcornInstance, serialFactory, layoutManager, _configobj, defaultOptions);
+ }
+ }
+
+ serializer.sync(IriSP.wrap(widget, function() { this.draw(); }));
+ return widget;
+};
+
+/** single point of entry for the metadataplayer */
+IriSP.initPlayer = function(config, metadata_url) {
+ document.getElementById(config.gui.container).innerHTML = IriSP.templToHTML(IriSP.loading_template, config.gui);
+ IriSP.loadLibs(config, metadata_url,
+ function() {
+
+ var layoutManager = new IriSP.LayoutManager(config.gui);
+
+ var pop = IriSP.configurePopcorn(layoutManager, config.player);
+
+ var widgets = IriSP.configureWidgets(pop, layoutManager, config.gui);
+ var modules = IriSP.configureModules(pop, config.modules);
+ IriSP.jQuery('#Ldt-loader').detach();
+ });
+};IriSP.I18n = function() {
+ this.messages = {};
+ this.base_lang = 'en';
+}
+
+IriSP.I18n.prototype.getLanguage = function(lang) {
+ var _lang = (
+ typeof lang != "undefined"
+ ? lang
+ : (
+ typeof IriSP.language != "undefined"
+ ? IriSP.language
+ : this.base_lang
+ )
+ );
+ return (
+ typeof this.messages[_lang] == "object"
+ ? _lang
+ : (
+ typeof this.messages[this.base_lang] == "object"
+ ? this.base_lang
+ : null
+ )
+ )
+}
+
+IriSP.I18n.prototype.getMessages = function(lang) {
+ var _lang = this.getLanguage(lang);
+ return (
+ _lang != null
+ ? this.messages[_lang]
+ : {}
+ );
+}
+
+IriSP.I18n.prototype.getMessage = function(message, lang) {
+ var _msgs = this.getMessages(lang);
+ return (
+ typeof _msgs[message] != "undefined"
+ ? _msgs[message]
+ : message
+ )
+}
+
+IriSP.I18n.prototype.addMessage = function(lang, messagekey, messagevalue) {
+ if (typeof this.messages[lang] == "undefined") {
+ this.messages[lang] = {};
+ }
+ this.messages[lang][messagekey] = messagevalue;
+}
+
+IriSP.I18n.prototype.addMessages = function(messagesObj) {
+ var _this = this;
+ IriSP.underscore(messagesObj).each(function(_messages, _lang) {
+ IriSP.underscore(_messages).each(function(_value, _key) {
+ _this.addMessage(_lang, _key, _value);
+ })
+ });
+}
+
+IriSP.i18n = new IriSP.I18n();
+
+IriSP.i18n.addMessages({
+ "fr": {
+ "loading_wait": "Chargement en cours, veuillez patienter…"
+ },
+ "en": {
+ "loading_wait": "Loading, please wait…"
+ }
+})
+/* To wrap a player the develop should create a new class derived from
+the IriSP.PopcornReplacement.player and defining the correct functions */
+
+/** allocine player wrapper */
+IriSP.PopcornReplacement.allocine = function(container, options) {
+// console.log("Calling allocine player");
+ /* appel du parent pour initialiser les structures communes à tous les players */
+ IriSP.PopcornReplacement.player.call(this, container, options);
+
+ var _this = this;
+
+ /* Définition des fonctions de l'API - */
+
+ this.playerFns = {
+ play : function() {
+ return _this.apiCall("play");
+ },
+ pause : function() {
+ return _this.apiCall("pause");
+ },
+ getPosition : function() {
+ return _this.apiCall("getSeek","return") || 0;
+ },
+ seek : function(pos) {
+ return _this.apiCall("seek",pos);
+ },
+ getMute : function() {
+ return _this.apiCall("getMute","return");
+ },
+ setMute : function(p) {
+ return _this.apiCall("setMute", p);
+ }
+ }
+
+ window.onReady = IriSP.wrap(this, this.ready);
+ window.onAllocineStateChange = IriSP.wrap(this, this.stateHandler);
+ window.onTime = IriSP.wrap(this, this.progressHandler);
+
+ var _videoUrl = (
+ typeof options.directVideoPath == "string"
+ ? options.directVideoPath
+ : IriSP.get_aliased(IriSP.__jsonMetadata["medias"][0], ["href","url"])
+ );
+ var _flashVars = {
+ "streamFMS" : true,
+ "adVast" : false,
+ "lg" : "fr_cinecast",
+ "autoPlay" : options.autoPlay,
+ "directVideoTitle" : "",
+ "urlAcData" : options.urlAcData,
+ "directVideoPath" : _videoUrl,
+ "host" : "http://allocine.fr"
+ }
+
+ if (typeof IriSP.__jsonMetadata["medias"][0].meta == "object" && typeof IriSP.__jsonMetadata["medias"][0].meta.subtitles == "string") {
+ _flashVars.subTitlePath = IriSP.__jsonMetadata["medias"][0].meta.subtitles;
+ }
+
+
+ var params = {
+ "allowScriptAccess" : "always",
+ "wmode": "opaque",
+ "flashvars" : IriSP.jQuery.param(_flashVars),
+ "allowfullscreen" : true
+ };
+ var atts = {
+ id : this.container
+ };
+ swfobject.embedSWF(options.acPlayerUrl, this.container, options.width, options.height, "10", null, null, params, atts);
+
+};
+
+IriSP.PopcornReplacement.allocine.prototype = new IriSP.PopcornReplacement.player("", {});
+
+IriSP.PopcornReplacement.allocine.prototype.ready = function() {
+ this.player = document.getElementById(this.container);
+ this.player.addEventListener("onStateChange", "onAllocineStateChange");
+ this.player.cueVideoByUrl(this._options.video);
+ this.callbacks.onReady();
+};
+
+IriSP.PopcornReplacement.allocine.prototype.progressHandler = function(progressInfo) {
+ this.callbacks.onTime({
+ position: progressInfo.mediaTime
+ });
+}
+
+
+IriSP.PopcornReplacement.allocine.prototype.apiCall = function(_method, _arg) {
+ if (this.player) {
+ try {
+ if (typeof _arg == "undefined") {
+ return this.player.sendToActionScript(_method);
+ } else {
+ return this.player.sendToActionScript(_method, _arg);
+ }
+ } catch(e) {
+ console.error('Exception while requesting AcPlayer for "' + _method + (typeof _arg == "undefined" ? '' : '" with argument "' + _arg ) + '"\n', e);
+ return false;
+ }
+ } else {
+ return false;
+ }
+}
+
+IriSP.PopcornReplacement.allocine.prototype.stateHandler = function(state) {
+ console.log("stateHandler");
+ switch(state) {
+ case 1:
+ this.callbacks.onPlay();
+ break;
+
+ case 2:
+ this.callbacks.onPause();
+ break;
+
+ case 3:
+ this.callbacks.onSeek({
+ position: this.player.getCurrentTime()
+ });
+ break;
+
+ /*
+ case 5:
+ this.callbacks.onReady();
+ break;
+ */
+ }
+
+};/* To wrap a player the develop should create a new class derived from
+the IriSP.PopcornReplacement.player and defining the correct functions */
+
+/** jwplayer player wrapper */
+IriSP.PopcornReplacement.dailymotion = function(container, options) {
+ console.log("Calling");
+ /* appel du parent pour initialiser les structures communes à tous les players */
+ IriSP.PopcornReplacement.player.call(this, container, options);
+
+ var _this = this;
+
+ /* Définition des fonctions de l'API - */
+
+ this.playerFns = {
+ play : function() {
+ if (_this.player) {
+ return _this.player.playVideo();
+ } else {
+ return false;
+ }
+ },
+ pause : function() {
+ if (_this.player) {
+ return _this.player.pauseVideo();
+ } else {
+ return false;
+ }
+ },
+ getPosition : function() {
+ if (_this.player) {
+ return _this.player.getCurrentTime();
+ } else {
+ return 0;
+ }
+ },
+ seek : function(pos) {
+ if (_this.player) {
+ return _this.player.seekTo(pos);
+ } else {
+ return false;
+ }
+ },
+ getMute : function() {
+ if (_this.player) {
+ return _this.player.isMuted();
+ } else {
+ return false;
+ }
+ },
+ setMute : function(p) {
+ if (_this.player) {
+ if (p) {
+ _this.player.mute();
+ }
+ else {
+ _this.player.unMute();
+ }
+ }
+ },
+ getVolume : function() {
+ if (_this.player) {
+ return _this.player.getVolume() / 100;
+ } else {
+ return false;
+ }
+ },
+ setVolume : function(p) {
+ if (_this.player) {
+ _this.player.setVolume(Math.floor(100 * p));
+ }
+ },
+ }
+
+ window.onDailymotionPlayerReady = IriSP.wrap(this, this.ready);
+ window.onDailymotionStateChange = IriSP.wrap(this, this.stateHandler);
+ window.onDailymotionVideoProgress = IriSP.wrap(this, this.progressHandler);
+
+ var params = {
+ "allowScriptAccess" : "always",
+ "wmode": "opaque"
+ };
+ var atts = {
+ id : this.container
+ };
+ swfobject.embedSWF("http://www.dailymotion.com/swf?chromeless=1&enableApi=1", this.container, options.width, options.height, "8", null, null, params, atts);
+
+};
+
+IriSP.PopcornReplacement.dailymotion.prototype = new IriSP.PopcornReplacement.player("", {});
+
+IriSP.PopcornReplacement.dailymotion.prototype.ready = function() {
+
+ this.player = document.getElementById(this.container);
+
+ this.player.addEventListener("onStateChange", "onDailymotionStateChange");
+ this.player.addEventListener("onVideoProgress", "onDailymotionVideoProgress");
+ this.player.cueVideoByUrl(this._options.video);
+
+ this.callbacks.onReady();
+};
+
+IriSP.PopcornReplacement.dailymotion.prototype.progressHandler = function(progressInfo) {
+
+ this.callbacks.onTime({
+ position: progressInfo.mediaTime
+ });
+}
+
+IriSP.PopcornReplacement.dailymotion.prototype.stateHandler = function(state) {
+
+ switch(state) {
+ case 1:
+ this.callbacks.onPlay();
+ break;
+
+ case 2:
+ this.callbacks.onPause();
+ break;
+
+ case 3:
+ this.callbacks.onSeek({
+ position: this.player.getCurrentTime()
+ });
+ break;
+
+ /*
+ case 5:
+ this.callbacks.onReady();
+ break;
+ */
+ }
+
+};/* To wrap a player the develop should create a new class derived from
+ the IriSP.PopcornReplacement.player and defining the correct functions */
+
+/** jwplayer player wrapper */
+IriSP.PopcornReplacement.jwplayer = function(container, options) {
+ /* appel du parent pour initialiser les structures communes à tous les players */
+ IriSP.PopcornReplacement.player.call(this, container, options);
+
+ this.media.duration = options.duration; /* optional */
+
+ /* Définition des fonctions de l'API - */
+ this.playerFns = {
+ play: function() { return jwplayer(this.container).play(); },
+ pause: function() { return jwplayer(this.container).pause(); },
+ getPosition: function() { return jwplayer(this.container).getPosition(); },
+ seek: function(pos) { return jwplayer(this.container).seek(pos); },
+ getMute: function() { return jwplayer(this.container).getMute() },
+ setMute: function(p) { return jwplayer(this.container).setMute(p); },
+ getVolume: function() { return jwplayer(this.container).getVolume() / 100; },
+ setVolume: function(p) { return jwplayer(this.container).setVolume(Math.floor(100*p)); }
+ }
+
+ options.events = this.callbacks;
+
+ jwplayer(this.container).setup(options);
+};
+
+IriSP.PopcornReplacement.jwplayer.prototype = new IriSP.PopcornReplacement.player("", {});
+/* embed module - listens and relay hash changes to a parent window. */
+
+IriSP.EmbedModule = function(Popcorn, config, Serializer) {
+ IriSP.Module.call(this, Popcorn, config, Serializer);
+
+ window.addEventListener('message', IriSP.wrap(this, this.handleMessages), false);
+ this._Popcorn.listen("IriSP.Mediafragment.hashchange", IriSP.wrap(this, this.relayChanges));
+};
+
+IriSP.EmbedModule.prototype = new IriSP.Module();
+
+IriSP.EmbedModule.prototype.handleMessages = function(e) {
+ if (e.data.type === "hashchange") {
+ window.location.hash = e.data.value;
+ }
+};
+
+IriSP.EmbedModule.prototype.relayChanges = function(newHash) {
+ window.parent.postMessage({type: "hashchange", value: newHash}, "*");
+ return;
+};/* mediafragment module */
+
+IriSP.MediaFragment = function(Popcorn, config, Serializer) {
+ IriSP.Module.call(this, Popcorn, config, Serializer);
+
+ this.mutex = false; /* a mutex because we access the url from two different functions */
+
+ this._Popcorn.listen( "loadedmetadata", IriSP.wrap(this,this.advanceTime));
+ this._Popcorn.listen( "pause", IriSP.wrap(this,this.updateTime));
+ this._Popcorn.listen( "seeked", IriSP.wrap(this,this.updateTime));
+ this._Popcorn.listen( "IriSP.PolemicTweet.click", IriSP.wrap(this,this.updateAnnotation));
+ this._Popcorn.listen( "IriSP.SegmentsWidget.click", IriSP.wrap(this,this.updateAnnotation));
+
+ window.onhashchange = IriSP.wrap(this, this.advanceTime);
+};
+
+IriSP.MediaFragment.prototype = new IriSP.Module();
+
+IriSP.MediaFragment.prototype.advanceTime = function() {
+ var url = window.location.href;
+
+ if ( url.split( "#" )[ 1 ] != null ) {
+ pageoffset = url.split( "#" )[1];
+
+ if ( pageoffset.substring(0, 2) === "t=") {
+ // timecode
+ if ( pageoffset.substring( 2 ) != null ) {
+ var offsettime = pageoffset.substring( 2 );
+ this._Popcorn.currentTime( parseFloat(offsettime) );
+
+ /* we have to trigger this signal manually because of a
+ bug in the jwplayer */
+ this._Popcorn.trigger("seeked", parseFloat(offsettime));
+ }
+ } else if ( pageoffset.substring(0, 3) === "id=") {
+ // annotation
+ var annotationId = pageoffset.substring( 3 );
+ // there's no better way than that because
+ // of possible race conditions
+ this._serializer.sync(IriSP.wrap(this, function() {
+ this.lookupAnnotation.call(this, annotationId);
+ }));
+ }
+ }
+};
+
+/** handler for the seeked signal. It may have or may have not an argument.
+ @param time if not undefined, the time we're seeking to
+*/
+IriSP.MediaFragment.prototype.updateTime = function(time) {
+ if (this.mutex === true) {
+ return;
+ }
+
+ var history = window.history;
+ if ( !history.pushState ) {
+ return false;
+ }
+
+ if (IriSP.null_or_undefined(time) || typeof(time) != "number") {
+ var ntime = this._Popcorn.currentTime().toFixed(2)
+ } else {
+ var ntime = time.toFixed(2);
+ }
+
+ // used to relay the new hash to the embedder
+ this._Popcorn.trigger("IriSP.Mediafragment.hashchange", "#t=" + ntime);
+
+ splitArr = window.location.href.split( "#" )
+ history.replaceState( {}, "", splitArr[0] + "#t=" + ntime );
+};
+
+
+IriSP.MediaFragment.prototype.updateAnnotation = function(annotationId) {
+ var _this = this;
+ this.mutex = true;
+
+ var history = window.history;
+ if ( !history.pushState ) {
+ return false;
+ }
+
+
+ // used to relay the new hash to the embedder
+ this._Popcorn.trigger("IriSP.Mediafragment.hashchange", "#id=" + annotationId);
+
+ splitArr = window.location.href.split( "#" )
+ history.replaceState( {}, "", splitArr[0] + "#id=" + annotationId);
+
+
+ // reset the mutex afterwards to prevent the module from reacting to his own changes.
+ window.setTimeout(function() { _this.mutex = false }, 50);
+};
+
+// lookup and seek to the beginning of an annotation
+IriSP.MediaFragment.prototype.lookupAnnotation = function(annotationId) {
+ var _this = this;
+ this.mutex = true;
+
+ var annotation = undefined;
+ var annotations = this._serializer._data.annotations;
+
+ var i;
+ for (i = 0; i < annotations.length; i++) {
+ if (annotations[i].id === annotationId) {
+ annotation = annotations[i];
+ break;
+ }
+ }
+
+ if (typeof(annotation) !== "undefined") {
+ this._Popcorn.currentTime(annotation.begin / 1000);
+
+ /* we have to trigger this signal manually because of a
+ bug in the jwplayer */
+ this._Popcorn.trigger("seeked", annotation.begin / 1000);
+ this._Popcorn.trigger("IriSP.Mediafragment.showAnnotation", annotationId);
+ }
+
+ window.setTimeout(function() { _this.mutex = false }, 50);
+};
+IriSP.AnnotationsListWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+ this.__counter = 0;
+ this.__oldList = [];
+ this.searchRe = null;
+ this._ajax_cache = [];
+ var _this = this;
+
+ this._Popcorn.listen("IriSP.search", function(searchString) {
+ _this.searchHandler(searchString);
+ });
+ this._Popcorn.listen("IriSP.search.closed", function() {
+ _this.searchHandler(false);
+ });
+ this._Popcorn.listen("IriSP.search.cleared", function() {
+ _this.searchHandler(false);
+ });
+};
+
+
+IriSP.AnnotationsListWidget.prototype = new IriSP.Widget();
+
+IriSP.AnnotationsListWidget.prototype.clear = function() {
+};
+
+IriSP.AnnotationsListWidget.prototype.clearWidget = function() {
+};
+
+IriSP.AnnotationsListWidget.prototype.searchHandler = function(searchString) {
+ this.searchRe = (searchString && searchString.length) ? IriSP.regexpFromText(searchString) : null;
+ if (this.ajax_mode && !this.cinecast_version) {
+ var _this = this,
+ _annotations = (
+ this.searchRe === null
+ ? this._ajax_cache
+ : IriSP.underscore.filter(this._ajax_cache, function(_a) {
+ return (_this.searchRe.test(_a.desc) || _this.searchRe.test(_a.title));
+ })
+ );
+ this.do_redraw(_annotations);
+ if (_annotations.length) {
+ this._Popcorn.trigger("IriSP.search.matchFound");
+ } else {
+ this._Popcorn.trigger("IriSP.search.noMatchFound");
+ }
+ } else {
+ this.drawList();
+ }
+}
+
+/** effectively redraw the widget - called by drawList */
+IriSP.AnnotationsListWidget.prototype.do_redraw = function(list) {
+ var _html = IriSP.templToHTML(
+ IriSP.annotationsListWidget_template, {
+ annotations: list
+ }),
+ _this = this;
+
+ this.selector.html(_html);
+
+ this.selector.find('.Ldt-AnnotationsList-Tag-Li').click(function() {
+ _this._Popcorn.trigger("IriSP.search.triggeredSearch", IriSP.jQuery(this).text().trim());
+ })
+
+ if (this.searchRe !== null) {
+ this.selector.find(".Ldt-AnnotationsList-Title a, .Ldt-AnnotationsList-Description")
+ .each(function() {
+ var _$ = IriSP.jQuery(this);
+ _$.html(_$.text().trim().replace(_this.searchRe, '$1'))
+ })
+ }
+};
+
+IriSP.AnnotationsListWidget.prototype.transformAnnotation = function(a) {
+ var _this = this;
+ return {
+ "id" : a.id,
+ "title": this.cinecast_version ? IriSP.get_aliased(a.meta, ['creator_name', 'creator']) : a.content.title,
+ "desc" : this.cinecast_version ? a.content.data : a.content.description,
+ "begin": IriSP.msToTime(a.begin),
+ "end" : IriSP.msToTime(a.end),
+ "thumbnail" : (typeof a.meta == "object" && typeof a.meta.thumbnail == "string") ? a.meta.thumbnail : this.default_thumbnail,
+ "url" : (typeof a.meta == "object" && typeof a.meta.url == "string") ? a.meta.url : null,
+ "created_at" :(typeof a.meta == "object" && typeof a.meta.created == "string") ? Date.parse(a.meta.created.replace(/^(\d{4})-(\d{2})-(\d{2})T(\d{2}\:\d{2}\:\d{2}).*$/,"$2/$3/$1 $4 UTC+0000")) : null,
+ "tags": typeof a.tags == "object"
+ ? IriSP.underscore(a.tags)
+ .chain()
+ .map(function(_t) {
+ if (typeof _t == "string") {
+ return _t.replace(/^.*:/,'#');
+ } else {
+ if (typeof _t['id-ref'] != "undefined") {
+ var _f = IriSP.underscore.find(_this._serializer._data.tags, function(_tag) {
+ return _tag.id == _t['id-ref'];
+ });
+ if (typeof _f != "undefined") {
+ return IriSP.get_aliased(_f.meta, ['dc:title', 'title']);
+ }
+ }
+ }
+ return null;
+ })
+ .filter(function(_t) {
+ return _t !== null && _t !== ""
+ })
+ .value()
+ : []
+ }
+}
+
+/** draw the annotation list */
+IriSP.AnnotationsListWidget.prototype.drawList = function(force_redraw) {
+ var _this = this;
+
+// var view_type = this._serializer.getContributions();
+ var annotations = this._serializer._data.annotations;
+ var currentTime = this._Popcorn.currentTime();
+ var list = [];
+
+/* if (typeof(view_type) === "undefined") {
+ return;
+} */
+ for (i = 0; i < annotations.length; i++) {
+ var obj = this.transformAnnotation(annotations[i]);
+ obj.iterator = i;
+ obj.distance = Math.abs((annotations[i].end + annotations[i].begin) / 2000 - currentTime);
+ if (!this.cinecast_version || annotations[i].type == "cinecast:UserAnnotation") {
+ list.push(obj);
+ }
+
+ }
+
+ if (this.searchRe !== null) {
+ list = list.filter(function(_a) {
+ return (_this.searchRe.test(_a.desc) || _this.searchRe.test(_a.title));
+ });
+ if (list.length) {
+ this._Popcorn.trigger("IriSP.search.matchFound");
+ } else {
+ this._Popcorn.trigger("IriSP.search.noMatchFound");
+ }
+ }
+ list = IriSP.underscore(list)
+ .chain()
+ .sortBy(function(_o) {
+ return _o.distance;
+ })
+ .first(10)
+ .sortBy(function(_o) {
+ return (_this.cinecast_version ? - _o.created_at : _o.iterator);
+ })
+ .value();
+ var idList = IriSP.underscore.pluck(list, "id").sort();
+
+
+ if (!IriSP.underscore.isEqual(this.__oldList, idList) || this.lastSearch !== this.searchRe || typeof(force_redraw) !== "undefined") {
+ this.do_redraw(list);
+ this.__oldList = idList;
+ this.lastSearch = this.searchRe;
+ }
+ /* save for next call */
+
+
+};
+
+IriSP.AnnotationsListWidget.prototype.ajaxRedraw = function(timecode) {
+
+ /* the seeked signal sometimes passes an argument - depending on if we're using
+ our popcorn lookalike or the real thing - if it's the case, use it as it's
+ more precise than currentTime which sometimes contains the place we where at */
+ if (IriSP.null_or_undefined(timecode) || typeof(timecode) != "number") {
+ var tcode = this._Popcorn.currentTime();
+ } else {
+ var tcode = timecode;
+ }
+
+
+ /* the platform gives us a special url - of the type : http://path/{{media}}/{{begin}}/{{end}}
+ we double the braces using regexps and we feed it to mustache to build the correct url
+ we have to do that because the platform only knows at run time what view it's displaying.
+ */
+
+ var media_id = this.currentMedia()["id"];
+ var duration = this.getDuration();
+
+ var begin_timecode = (Math.floor(tcode) - 300) * 1000;
+ if (begin_timecode < 0)
+ begin_timecode = 0;
+
+ var end_timecode = (Math.floor(tcode) + 300) * 1000;
+ if (end_timecode > duration)
+ end_timecode = duration;
+
+ var templ = Mustache.to_html(this.ajax_url, {media: media_id, begin: begin_timecode,
+ end: end_timecode});
+
+ /* we create on the fly a serializer to get the ajax */
+ var serializer = new IriSP.JSONSerializer(IriSP.__dataloader, templ);
+ serializer.sync(IriSP.wrap(this, function(json) { this.processJson(json, serializer) }));
+};
+
+/** process the received json - it's a bit hackish */
+IriSP.AnnotationsListWidget.prototype.processJson = function(json, serializer) {
+ /* FIXME: DRY the whole thing */
+ var annotations = serializer._data.annotations;
+ if (IriSP.null_or_undefined(annotations))
+ return;
+
+ /*
+ commented in case we wanted to discriminate against some annotation types.
+ var view_types = serializer.getIds("Contributions");
+ */
+ var l = [];
+
+ var media = this.currentMedia()["id"];
+
+ for (i = 0; i < annotations.length; i++) {
+ var obj = this.transformAnnotation(annotations[i])
+ if (typeof obj.url == "undefined" || !obj.url) {
+ /* only if the annotation isn't present in the document create an
+ external link */
+ if (this.annotations_ids.indexOf(obj.id.toLowerCase()) == -1) {
+ // braindead url; jacques didn't want to create a new one in the platform,
+ // so we append the cutting id to the url.
+ obj.url = this.project_url + "/" + media + "/" +
+ annotations[i].meta.project + "/" +
+ annotations[i].meta["id-ref"] + '#id=' + annotations[i].id;
+
+ // obj.url = document.location.href.split("#")[0] + "/" + annotation.meta.project;
+ }
+ }
+ l.push(obj);
+ }
+ this._ajax_cache = l;
+ this.do_redraw(l);
+};
+IriSP.AnnotationsListWidget.prototype.draw = function() {
+
+ /* build a table of the annotations present in the document for faster
+ lookup
+ */
+ this.annotations_ids = IriSP.underscore(this._serializer._data.annotations).map(function(_a) {
+ return _a.id.toLowerCase();
+ });
+
+ var _this = this;
+
+ if (!this.ajax_mode || this.cinecast_version) {
+ var _throttled = IriSP.underscore.throttle(function() {
+ _this.drawList();
+ }, 1500);
+ _throttled();
+ this._Popcorn.listen("IriSP.createAnnotationWidget.addedAnnotation", _throttled);
+ this._Popcorn.listen("timeupdate", _throttled);
+ if (this.cinecast_version) {
+ window.setInterval(function() {
+ var _tmpSerializer = new IriSP.JSONSerializer(IriSP.__dataloader, _this._config.metadata.src, true);
+ _tmpSerializer.sync(function(json) {
+ IriSP.underscore(json.annotations).each(function(_a) {
+ var _j = _this.annotations_ids.indexOf(_a.id);
+ if (_j == -1) {
+ _this._serializer._data.annotations.push(_a);
+ _this.annotations_ids.push(_a.id);
+ } else {
+ _this._serializer._data.annotations[_j] = _a;
+ }
+ _throttled();
+ });
+ }, true); // true is for force_refresh
+ },this.refresh_interval);
+ }
+ } else {
+ /* update the widget when the video has finished loading and when it's seeked and paused */
+ this._Popcorn.listen("seeked", IriSP.wrap(this, this.ajaxRedraw));
+ this._Popcorn.listen("loadedmetadata", IriSP.wrap(this, this.ajaxRedraw));
+ this._Popcorn.listen("paused", IriSP.wrap(this, this.ajaxRedraw));
+
+ this._Popcorn.listen("IriSP.createAnnotationWidget.addedAnnotation", IriSP.wrap(this, this.ajaxRedraw));
+ }
+
+};/* Internationalization for this widget */
+
+IriSP.i18n.addMessages(
+ {
+ "fr": {
+ "keywords": "Mots-clés"
+ },
+ "en": {
+ "keywords": "Keywords"
+ }
+ }
+);
+
+IriSP.AnnotationsWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+ /* flag used when we're creating an annotation */
+ this._hidden = false;
+};
+
+
+IriSP.AnnotationsWidget.prototype = new IriSP.Widget();
+
+IriSP.AnnotationsWidget.prototype.clear = function() {
+ this.selector.find(".Ldt-SaTitle").text("");
+ this.selector.find(".Ldt-SaDescription").text("");
+ this.selector.find(".Ldt-SaKeywordText").text("");
+};
+
+IriSP.AnnotationsWidget.prototype.displayAnnotation = function(annotation) {
+ var title = annotation.content.title;
+ var description = annotation.content.description;
+ var keywords = "";
+ var begin = +annotation.begin / 1000;
+ var end = +annotation.end / 1000;
+ var duration = this.getDuration();
+ var tags = "";
+
+ var title_templ = "{{title}} - ( {{begin}} - {{end}} )";
+ var endstr = Mustache.to_html(title_templ, {title: title, begin: IriSP.secondsToTime(begin), end: IriSP.secondsToTime(end)});
+
+ this.selector.find(".Ldt-SaTitle").text(endstr);
+ this.selector.find(".Ldt-SaDescription").text(description);
+
+
+ if (!IriSP.null_or_undefined(annotation.tags) && !IriSP.null_or_undefined(this._serializer._data.tags)) {
+ /* save the tag id and keywords in a unique structure */
+ var tag_list = {};
+ for (var i = 0; i < this._serializer._data.tags.length; i++) {
+ var id = this._serializer._data.tags[i]["id"];
+ var keyword = IriSP.get_aliased(this._serializer._data.tags[i]["meta"], ["dc:title", "title"]);
+
+ tag_list[id] = keyword;
+ }
+
+ /* then browse the list of defined tags for the current annotation */
+ for (var i = 0; i < annotation.tags.length; i++) {
+ if (tag_list.hasOwnProperty(annotation.tags[i]["id-ref"]))
+ tags += tag_list[annotation.tags[i]["id-ref"]] + ", ";
+ }
+ }
+
+ tags = IriSP.i18n.getMessage("keywords") + ": " + tags.slice(0, tags.length - 2);
+
+ this.selector.find(".Ldt-SaKeywords").text(tags);
+
+ // update sharing buttons
+ var url = document.location.href + "#id=" + annotation.id;
+ this.selector.find(".Ldt-fbShare").attr("href", IriSP.mkFbUrl(url, this.share_text));
+ this.selector.find(".Ldt-TwShare").attr("href", IriSP.mkTweetUrl(url, this.share_text));
+ this.selector.find(".Ldt-GplusShare").attr("href", IriSP.mkGplusUrl(url, this.share_text));
+};
+
+IriSP.AnnotationsWidget.prototype.clearWidget = function() {
+ /* retract the pane between two annotations */
+ this.selector.find(".Ldt-SaTitle").text("");
+ this.selector.find(".Ldt-SaDescription").text("");
+ this.selector.find(".Ldt-SaKeywordText").html("");
+ this.selector.find(".Ldt-ShowAnnotation").slideUp();
+};
+
+IriSP.AnnotationsWidget.prototype.draw = function() {
+ var _this = this;
+
+ var annotationMarkup = IriSP.templToHTML(IriSP.annotationWidget_template);
+ this.selector.append(annotationMarkup);
+
+ this._Popcorn.listen("IriSP.AnnotationsWidget.show",
+ IriSP.wrap(this, this.show));
+ this._Popcorn.listen("IriSP.AnnotationsWidget.hide",
+ IriSP.wrap(this, this.hide));
+
+ var legal_ids = [];
+ if (typeof(this._serializer.getChapitrage()) !== "undefined")
+ legal_ids.push(this._serializer.getChapitrage());
+ else
+ legal_ids = this._serializer.getNonTweetIds();
+
+ var annotations = this._serializer._data.annotations;
+ var i;
+
+ for (i in annotations) {
+ var annotation = annotations[i];
+ var begin = Math.round((+ annotation.begin) / 1000);
+ var end = Math.round((+ annotation.end) / 1000);
+
+ if (typeof(annotation.meta) !== "undefined" && typeof(annotation.meta["id-ref"]) !== "undefined"
+ && !IriSP.underscore.include(legal_ids, annotation.meta["id-ref"])) {
+ continue;
+ }
+
+
+ var conf = {start: begin, end: end,
+ onStart:
+ function(annotation) {
+ return function() {
+ _this.displayAnnotation(annotation);
+
+ } }(annotation),
+ onEnd:
+ function() { _this.clearWidget.call(_this); }
+ };
+ this._Popcorn = this._Popcorn.code(conf);
+ }
+
+};
+
+IriSP.AnnotationsWidget.prototype.hide = function() {
+ if (this._hidden == false) {
+ this.selector.hide();
+ this._hidden = true;
+ }
+};
+
+IriSP.AnnotationsWidget.prototype.show = function() {
+ if (this._hidden == true) {
+ this.selector.show();
+ this._hidden = false;
+ }
+};IriSP.ArrowWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+
+ this._oldAnnotation = null;
+ this._blockArrow = false;
+};
+
+
+IriSP.ArrowWidget.prototype = new IriSP.Widget();
+
+IriSP.ArrowWidget.prototype.clear = function() {
+
+};
+
+IriSP.ArrowWidget.prototype.clearWidget = function() {
+};
+
+IriSP.ArrowWidget.prototype.draw = function() {
+ var templ = Mustache.to_html(IriSP.arrowWidget_template, {});
+ this.selector.append(templ);
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.timeUpdateHandler));
+ this._Popcorn.listen("IriSP.ArrowWidget.blockArrow", IriSP.wrap(this, this.blockArrow));
+ this._Popcorn.listen("IriSP.ArrowWidget.releaseArrow", IriSP.wrap(this, this.releaseArrow));
+
+};
+
+IriSP.ArrowWidget.prototype.timeUpdateHandler = function(percents) {
+ if (this._blockArrow)
+ return;
+
+ var currentTime = this._Popcorn.currentTime();
+ var currentAnnotation = this._serializer.currentChapitre(currentTime);
+ if (IriSP.null_or_undefined(currentAnnotation)) {
+ var c_annots = this._serializer.currentAnnotation(currentTime)
+ if (c_annots.length != 0)
+ var currentAnnotation = c_annots[0]; // FIXME : use the others ?
+ else
+ return;
+ }
+
+ /* move the arrow only if the current annotation changes */
+ if (currentAnnotation != this._oldAnnotation) {
+ var begin = (+ currentAnnotation.begin) / 1000;
+ var end = (+ currentAnnotation.end) / 1000;
+
+ var duration = this.getDuration() / 1000;
+ var middle_time = (begin + end) / 2;
+ var percents = middle_time / duration;
+
+ // we need to apply a fix because the arrow has a certain length
+ // it's half the length of the arrow (27 / 2). We need to convert
+ // it in percents though.
+ var totalWidth = this.selector.width();
+ var pixels = percents * totalWidth;
+ var correction = (27 / 2);
+ var corrected_pixels = pixels - correction;
+
+ /* make sure that the arrow is aligned with the pattern
+ of the widget under it */
+ if (corrected_pixels % 3 != 0)
+ corrected_pixels -= (corrected_pixels % 3 - 1);
+
+ /* don't move out of the screen */
+ if (corrected_pixels <= 0)
+ corrected_pixels = 0;
+
+ if (corrected_pixels <= 15) {
+ this.selector.children(".Ldt-arrowWidget").removeClass("Ldt-arrowLeftEdge Ldt-arrowCenter Ldt-arrowRightEdge")
+ .addClass("Ldt-arrowLeftEdge");
+ } else if (corrected_pixels >= totalWidth - 25) {
+ this.selector.children(".Ldt-arrowWidget").removeClass("Ldt-arrowLeftEdge Ldt-arrowCenter Ldt-arrowRightEdge")
+ .addClass("Ldt-arrowRightEdge");
+ } else {
+ this.selector.children(".Ldt-arrowWidget").removeClass("Ldt-arrowLeftEdge Ldt-arrowCenter Ldt-arrowRightEdge")
+ .addClass("Ldt-arrowCenter");
+ }
+
+ this.selector.children(".Ldt-arrowWidget").animate({"left" : corrected_pixels + "px"});
+
+ this._oldAnnotation = currentAnnotation;
+ }
+};
+
+/** Block the arrow for instance when the user is annotating */
+IriSP.ArrowWidget.prototype.blockArrow = function() {
+ this._blockArrow = true;
+};
+
+IriSP.ArrowWidget.prototype.releaseArrow = function() {
+ this._blockArrow = false;
+};
+/* Internationalization for this widget */
+
+IriSP.i18n.addMessages(
+ {
+ "en": {
+ "submit": "Submit",
+ "add_keywords": "Add keywords",
+ "add_polemic_keywords": "Add polemic keywords",
+ "your_name": "Your name",
+ "type_here": "Type your annotation here.",
+ "wait_while_processed": "Please wait while your request is being processed...",
+ "error_while_contacting": "An error happened while contacting the server. Your annotation has not been saved.",
+ "empty_annotation": "Your annotation is empty. Please write something before submitting.",
+ "annotation_saved": "Thank you, your annotation has been saved.",
+ "share_annotation": "Would you like to share it on social networks ?",
+ "share_on": "Share on",
+ "more_tags": "More tags"
+ },
+ "fr": {
+ "submit": "Envoyer",
+ "add_keywords": "Ajouter des mots-clés",
+ "add_polemic_keywords": "Ajouter des mots-clés polémiques",
+ "your_name": "Votre nom",
+ "type_here": "Rédigez votre annotation ici.",
+ "wait_while_processed": "Veuillez patienter pendant le traitement de votre requête...",
+ "error_while_contacting": "Une erreur s'est produite en contactant le serveur. Votre annotation n'a pas été enregistrée",
+ "empty_annotation": "Votre annotation est vide. Merci de rédiger un texte avant de l'envoyer.",
+ "annotation_saved": "Merci, votre annotation a été enregistrée.",
+ "share_annotation": "Souhaitez-vous la partager sur les réseaux sociaux ?",
+ "share_on": "Partager sur",
+ "more_tags": "Plus de mots-clés"
+ }
+ }
+);
+
+IriSP.createAnnotationWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+ this._hidden = true;
+
+ if (!IriSP.null_or_undefined(IriSP.user)) {
+ if (!IriSP.null_or_undefined(IriSP.user.avatar)) {
+ this.user_avatar = IriSP.user.avatar;
+ }
+ if (!IriSP.null_or_undefined(IriSP.user.name)) {
+ this.user_name = IriSP.user.name;
+ }
+ }
+
+ /* variables to save the current position of the slicer */
+ if (this.cinecast_version) {
+ this.sliceLeft = 0;
+ this.sliceWidth = 0;
+ }
+};
+
+
+IriSP.createAnnotationWidget.prototype = new IriSP.Widget();
+
+IriSP.createAnnotationWidget.prototype.clear = function() {
+ this.selector.find(".Ldt-SaTitle").text("");
+ this.selector.find(".Ldt-SaDescription").text("");
+ this.selector.find(".Ldt-SaKeywordText").text("");
+};
+
+IriSP.createAnnotationWidget.prototype.draw = function() {
+ var _this = this;
+ if (typeof this.remote_tags == "object") {
+ IriSP.jQuery.getJSON((typeof this.remote_tags.alias == "string" ? this.remote_tags.alias : this.remote_tags.url), function(_json) {
+ _this.tags = _json.tags;
+ _this.drawCallback();
+ });
+ } else {
+ this.drawCallback();
+ }
+}
+
+IriSP.createAnnotationWidget.prototype.drawCallback = function() {
+ var _this = this;
+
+ var annotationMarkup = IriSP.templToHTML(IriSP.createAnnotationWidget_template,
+ this);
+
+ this.selector.append(annotationMarkup);
+
+ if (!this.cinecast_version)
+ this.selector.hide();
+ else {
+ this.showStartScreen();
+ }
+
+ if (this.random_tags) {
+ this.selector.find(".Ldt-createAnnotation-keywords li").hide();
+ this.showMoreTags();
+ this.selector.find('.Ldt-createAnnotation-moar-keywordz').click(function() {
+ _this.showMoreTags();
+ })
+ }
+ // Add onclick event to both polemic and keywords buttons
+
+ this.selector.find(".Ldt-createAnnotation-keyword-button, .Ldt-createAnnotation-polemic-button").click(function() {
+ _this.addKeyword(IriSP.jQuery(this).text());
+ return false;
+ });
+
+ // js_mod is a custom event because there's no simple way to test for a js
+ // change in a textfield.
+ this.selector.find(".Ldt-createAnnotation-Description")
+ .bind("propertychange keyup input paste click js_mod", IriSP.wrap(this, this.handleTextChanges))
+ .keyup(function(_e) {
+ console.log(_e);
+ });
+
+ /* the cinecast version of the player is supposed to pause when the user clicks on the button */
+
+ /* the cinecast version expects the user to comment on a defined segment.
+ As the widget is always shown, we need a way to update it's content as
+ time passes. We do this like we did with the annotationsWidget : we schedule
+ a .code start function which will be called at the right time.
+ */
+ if (this.cinecast_version) {
+ var legal_ids;
+ if (typeof(this._serializer.getChapitrage()) !== "undefined")
+ legal_id = this._serializer.getChapitrage();
+ else
+ legal_id = this._serializer.getNonTweetIds()[0];
+
+ var annotations = this._serializer._data.annotations;
+ var i;
+
+ for (i in annotations) {
+ var annotation = annotations[i];
+ if (typeof(annotation.meta) !== "undefined" && typeof(annotation.meta["id-ref"]) !== "undefined"
+ && legal_id !== annotation.meta["id-ref"]) {
+ continue;
+ }
+
+ code = {start: annotation.begin / 1000, end: annotation.end / 1000,
+ onStart: function(annotation) { return function() {
+ if (typeof(annotation.content) !== "undefined")
+ _this.selector.find(".Ldt-createAnnotation-Title").html(annotation.content.title);
+
+ _this._currentAnnotation = annotation;
+ var beginTime = IriSP.msToTime(annotation.begin);
+ var endTime = IriSP.msToTime(annotation.end);
+ var timeTemplate = IriSP.templToHTML("- ({{begin}} - {{ end }})", {begin: beginTime, end: endTime });
+ _this.selector.find(".Ldt-createAnnotation-TimeFrame").html(timeTemplate);
+ } }(annotation)
+ };
+
+ this._Popcorn.code(code);
+ }
+ }
+
+ this.selector.find(".Ldt-createAnnotation-submitButton").click(IriSP.wrap(this, this.handleButtonClick));
+
+ if (!this.cinecast_version) {
+ this._Popcorn.listen("IriSP.PlayerWidget.AnnotateButton.clicked",
+ IriSP.wrap(this, this.handleAnnotateSignal));
+
+ // handle clicks on the cancel button too.
+ this.selector.find(".Ldt-createAnnotation-Minimize").click(IriSP.wrap(this,
+ function() {
+ // we've got to simulate the pressing of the button because there's no
+ // other way to minimize the widget and show the widgets that were hidden
+ // same time
+ this._Popcorn.trigger("IriSP.PlayerWidget.AnnotateButton.clicked");
+ }
+ ));
+ }
+};
+
+IriSP.createAnnotationWidget.prototype.showMoreTags = function() {
+ for (var j=0; j < this.random_tags; j++) {
+ var _jq = this.selector.find(".Ldt-createAnnotation-keywords li:hidden");
+ if (_jq.length > 1) {
+ IriSP.jQuery(_jq[Math.floor(_jq.length*Math.random())]).show();
+ } else {
+ _jq.show();
+ break;
+ }
+ }
+ if (this.selector.find(".Ldt-createAnnotation-keywords li:hidden").length == 0) {
+ this.selector.find('.Ldt-createAnnotation-moar-keywordz').hide();
+ }
+}
+
+/* Handles adding keywords and polemics */
+IriSP.createAnnotationWidget.prototype.addKeyword = function(_keyword) {
+ var _field = this.selector.find(".Ldt-createAnnotation-Description"),
+ _rx = IriSP.regexpFromText(_keyword),
+ _contents = _field.val();
+ _contents = ( _rx.test(_contents)
+ ? _contents.replace(_rx,"").replace(" "," ").trim()
+ : _contents.trim() + " " + _keyword
+ );
+ _field.val(_contents.trim());
+ _field.trigger("js_mod");
+}
+
+/** handles clicks on the annotate button. Works only for the non-cinecast version */
+IriSP.createAnnotationWidget.prototype.handleAnnotateSignal = function() {
+
+ if (this._hidden == false && this._state == 'startScreen') {
+ this.selector.hide();
+ this._hidden = true;
+
+ // free the arrow.
+ this._Popcorn.trigger("IriSP.ArrowWidget.releaseArrow");
+ this._Popcorn.trigger("IriSP.SliceWidget.hide");
+ this._Popcorn.trigger("IriSP.AnnotationsWidget.show");
+
+ } else {
+ this._Popcorn.trigger("IriSP.AnnotationsWidget.hide");
+ this.showStartScreen();
+ this.selector.show();
+ this._hidden = false;
+ var currentTime = this._Popcorn.currentTime();
+
+ // block the arrow.
+ this._Popcorn.trigger("IriSP.ArrowWidget.blockArrow");
+
+ var duration = this.getDuration();
+
+ var currentChapter = this._serializer.currentChapitre(currentTime);
+
+ if (IriSP.null_or_undefined(currentChapter)) {
+ var left = this.selector.width() / 2;
+ var width = this.selector.width() / 10;
+ } else {
+ var left = (currentChapter.begin / duration) * this.selector.width();
+ var width = (currentChapter.end / duration) * this.selector.width() - left;
+ }
+
+ // slider position and length is kept in percents.
+ this.sliceLeft = (left / this.selector.width()) * 100;
+ this.sliceWidth = (width / this.selector.width()) * 100;
+
+ this._Popcorn.trigger("IriSP.SliceWidget.position", [left, width]);
+ this._Popcorn.listen("IriSP.SliceWidget.zoneChange", IriSP.wrap(this, this.handleSliderChanges));
+ this._Popcorn.trigger("IriSP.SliceWidget.show");
+
+ if (!IriSP.null_or_undefined(currentChapter)) {
+ this.selector.find(".Ldt-createAnnotation-Title").html(currentChapter.content.title);
+
+ this._currentcurrentChapter = currentChapter;
+ var beginTime = IriSP.msToTime(currentChapter.begin);
+ var endTime = IriSP.msToTime(currentChapter.end);
+ var timeTemplate = IriSP.templToHTML("- ({{begin}} - {{ end }})", {begin: beginTime, end: endTime });
+ this.selector.find(".Ldt-createAnnotation-TimeFrame").html(timeTemplate);
+ }
+ }
+};
+
+
+/** watch for changes in the textfield and change the buttons accordingly */
+IriSP.createAnnotationWidget.prototype.handleTextChanges = function(event) {
+ var contents = this.selector.find(".Ldt-createAnnotation-Description").val();
+ if (this.cinecast_version) {
+ this._Popcorn.pause();
+ }
+ this.selector.find(".Ldt-createAnnotation-btnblock button").each(function() {
+ var _rx = IriSP.regexpFromText(IriSP.jQuery(this).text());
+ if (_rx.test(contents)) {
+ IriSP.jQuery(this).parent().addClass("Ldt-createAnnotation-active-button");
+ } else {
+ IriSP.jQuery(this).parent().removeClass("Ldt-createAnnotation-active-button");
+ }
+ });
+
+};
+
+IriSP.createAnnotationWidget.prototype.showStartScreen = function() {
+ this.selector.find(".Ldt-createAnnotation-screen").hide();
+ this.selector.find(".Ldt-createAnnotation-startScreen").show();
+
+ var jqTextfield = this.selector.find(".Ldt-createAnnotation-Description"); // handle on the textfield. used for the closure
+
+ /* test if the browser supports the placeholder attribute */
+ if (!IriSP.null_or_undefined(jqTextfield.get(0).placeholder)) {
+ jqTextfield.attr("placeholder", IriSP.i18n.getMessage('type_here'));
+ } else {
+ jqTextfield.val(IriSP.i18n.getMessage('type_here'));
+ jqTextfield.one("click", IriSP.wrap(this, function() { jqTextfield.val(""); }));
+ }
+
+
+
+ this._state = "startScreen";
+};
+
+IriSP.createAnnotationWidget.prototype.showWaitScreen = function() {
+ this.selector.find(".Ldt-createAnnotation-screen").hide();
+ this.selector.find(".Ldt-createAnnotation-waitScreen").show();
+ this._state = "waitScreen";
+};
+
+IriSP.createAnnotationWidget.prototype.showErrorScreen = function() {
+ this.selector.find(".Ldt-createAnnotation-screen").hide();
+ this.selector.find(".Ldt-createAnnotation-errorScreen").show();
+ this._state = "errorScreen";
+ var _this = this;
+ window.setTimeout(function() { _this.showStartScreen(); }, 2000);
+};
+
+/** update show the final screen with links to share the created annotation */
+IriSP.createAnnotationWidget.prototype.showEndScreen = function(annotation) {
+ this.selector.find(".Ldt-createAnnotation-screen").hide();
+
+ if (this.cinecast_version) {
+ this.selector.find(".Ldt-createAnnotation-Title").parent().show();
+ }
+
+ var url = ( (typeof annotation.meta == "object" && typeof annotation.meta.url == "string" && annotation.meta.url.length)
+ ? annotation.meta.url
+ : ( document.location.href + "#id=" + annotation.id ) );
+ var twStatus = IriSP.mkTweetUrl(url);
+ var gpStatus = IriSP.mkGplusUrl(url);
+ var fbStatus = IriSP.mkFbUrl(url);
+
+ this.selector.find(".Ldt-createAnnotation-endScreen-TweetLink").attr("href", twStatus);
+ this.selector.find(".Ldt-createAnnotation-endScreen-FbLink").attr("href", fbStatus);
+ this.selector.find(".Ldt-createAnnotation-endScreen-GplusLink").attr("href", gpStatus);
+
+ this.selector.find(".Ldt-createAnnotation-endScreen").show();
+ this._state = "endScreen";
+};
+
+/** handle clicks on "send annotation" button */
+IriSP.createAnnotationWidget.prototype.handleButtonClick = function(event) {
+ var _this = this;
+ var textfield = this.selector.find(".Ldt-createAnnotation-Description");
+ var contents = textfield.val();
+
+ if (contents === "") {
+ if (this.selector.find(".Ldt-createAnnotation-errorMessage").length === 0) {
+ this.selector.find(".Ldt-createAnnotation-Container")
+ .after(IriSP.templToHTML(IriSP.createAnnotation_errorMessage_template));
+ textfield.css("background-color", "#d93c71");
+ } else {
+ this.selector.find(".Ldt-createAnnotation-errorMessage").show();
+ }
+
+ textfield.one("js_mod propertychange keyup input paste", IriSP.wrap(this, function() {
+ var contents = textfield.val();
+
+ if (contents !== "") {
+ this.selector.find(".Ldt-createAnnotation-errorMessage").hide();
+ textfield.css("background-color", "");
+ }
+ }));
+ } else {
+ this.showWaitScreen();
+
+ this.sendLdtData(contents, function(annotation) {
+ if (_this.cinecast_version) {
+ if (_this._Popcorn.media.paused)
+ _this._Popcorn.play();
+ }
+
+ if (_this._state == "waitScreen") {
+ _this.showEndScreen(annotation);
+ if (_this.cinecast_version) {
+ window.setTimeout(function() { _this.showStartScreen(); }, 5000);
+ }
+ }
+ // hide the slicer widget
+ if (!_this.cinecast_version) {
+ _this._Popcorn.trigger("IriSP.SliceWidget.hide");
+ }
+ });
+ }
+};
+
+IriSP.createAnnotationWidget.prototype.handleSliderChanges = function(params) {
+ this.sliceLeft = params[0];
+ this.sliceWidth = params[1];
+};
+
+IriSP.createAnnotationWidget.prototype.sendLdtData = function(contents, callback) {
+ var _this = this;
+ var apiJson = {
+ format : "http://advene.org/ns/cinelab/",
+ annotations : [
+ {}
+ ],
+ meta: {}};
+ var annotation = apiJson.annotations[0];
+
+ annotation.media = this.currentMedia()["id"];
+
+ if (this.cinecast_version) {
+ annotation.begin = Math.round(this._Popcorn.currentTime() * 1000);
+ annotation.end = annotation.begin;
+ } else {
+ var duration = this.getDuration();
+ annotation.begin = +((duration * (this.sliceLeft / 100)).toFixed(0));
+ annotation.end = +((duration * ((this.sliceWidth + this.sliceLeft) / 100)).toFixed(0));
+ }
+
+ // boundary checks
+ annotation.begin = Math.max(0, annotation.begin);
+ annotation.end = Math.min(this.getDuration(), annotation.end);
+
+ annotation.type = ( this.cinecast_version ? "cinecast:UserAnnotation" : ( this._serializer.getContributions() || "" ));
+ if (typeof(annotation.type) === "undefined")
+ annotation.type = "";
+
+ annotation.type_title = "Contributions";
+ annotation.content = {};
+ annotation.content.data = contents;
+ if (this.cinecast_version) {
+ var _extract = IriSP.underscore(this._serializer._data.annotations)
+ .filter(function(_a) {
+ return (_a.begin <= annotation.begin && _a.end >= annotation.begin && _a.type == "cinecast:MovieExtract");
+ })
+ if (_extract.length) {
+ annotation.extract = _extract[0].id;
+ }
+ }
+
+ var meta = apiJson.meta;
+
+
+ var _username = this.selector.find(".Ldt-createAnnotation-userName").val();
+ meta.creator = (
+ (_username && _username.length)
+ ? _username
+ : (
+ (!IriSP.null_or_undefined(IriSP.user) && !IriSP.null_or_undefined(IriSP.user.name))
+ ? IriSP.user.name
+ : "Anonymous user"
+ )
+ );
+
+ meta.created = Date().toString();
+
+ var _tags = [];
+ IriSP._(this.tags).each(function(_v) {
+ var _rx = IriSP.regexpFromText(_v.meta.description);
+ if (_rx.test(contents)) {
+ _tags.push(_v.id);
+ }
+ });
+
+ if (typeof this.remote_tags == "object") {
+ _tags = IriSP._(_tags).map(function(_t) {
+ return _this.remote_tags.id + ':' + _t
+ });
+ if (typeof apiJson.imports == "undefined") {
+ apiJson.imports = [];
+ }
+ apiJson.imports.push({
+ "id" : this.remote_tags.id,
+ "url" : this.remote_tags.url
+ })
+ }
+ annotation.tags = IriSP.underscore.uniq(_tags);
+
+ var jsonString = JSON.stringify(apiJson);
+ var project_id = this._serializer._data.meta.id;
+
+ //TODO: extract magic url
+ var url = Mustache.to_html(this.api_endpoint_template,
+ {id: project_id});
+
+ IriSP.jQuery.ajax({
+ url: url,
+ type: this.api_method,
+ contentType: 'application/json',
+ data: jsonString,
+ //dataType: 'json',
+ success: IriSP.wrap(this, function(json, textStatus, XMLHttpRequest) {
+ /* add the annotation to the annotation and tell the world */
+ var annotation = json.annotations[0];
+
+ if (!this.cinecast_version) {
+ /* if the media doesn't have a contributions line, we need to add one */
+ if (typeof(this._serializer.getContributions()) === "undefined") {
+ /* set up a basic view */
+ var tmp_view = {"dc:contributor": "perso", "dc:creator": "perso", "dc:title": "Contributions",
+ "id": json.annotations[0].type}
+
+
+ IriSP.get_aliased(this._serializer._data, ["annotation_types", "annotation-types"]).push(tmp_view);
+ }
+
+ delete annotation.tags;
+ annotation.content.description = annotation.content.data;
+ annotation.content.title = "";
+ delete annotation.content.data;
+ annotation.id = json.annotations[0].id;
+
+ annotation.meta = meta;
+ annotation.meta["id-ref"] = json.annotations[0]["type"];
+ } else {
+ annotation.type = "cinecast:UserAnnotation";
+ }
+ annotation.is_new = true;
+ // everything is shared so there's no need to propagate the change
+ _this._serializer._data.annotations.push(annotation);
+
+ _this._Popcorn.trigger("IriSP.createAnnotationWidget.addedAnnotation", annotation);
+ this.selector.find(".Ldt-createAnnotation-Description").val("");
+ callback(annotation);
+ }),
+ error:
+ function(jqXHR, textStatus, errorThrown) {
+ console.log("an error occured while contacting "
+ + url + " and sending " + jsonString + textStatus );
+ _this.showErrorScreen(); } });
+};IriSP.HelloWorldWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+}
+
+IriSP.HelloWorldWidget.prototype = new IriSP.Widget();
+
+IriSP.HelloWorldWidget.prototype.draw = function() {
+ this.selector
+ .html('Hello, world')
+ .css({
+ "text-align" : "center",
+ "padding": "10px 0",
+ "font-size" : "14px"
+ });
+
+ console.log(this);
+}
+/* Internationalization for this widget */
+
+IriSP.i18n.addMessages(
+ {
+ "en": {
+ "play_pause": "Play/Pause",
+ "mute_unmute": "Mute/Unmute",
+ "play": "Play",
+ "pause": "Pause",
+ "mute": "Mute",
+ "unmute": "Unmute",
+ "annotate": "Annotate",
+ "search": "Search",
+ "elapsed_time": "Elapsed time",
+ "total_time": "Total time",
+ "volume": "Volume",
+ "volume_control": "Volume control"
+ },
+ "fr": {
+ "play_pause": "Lecture/Pause",
+ "mute_unmute": "Couper/Activer le son",
+ "play": "Lecture",
+ "pause": "Pause",
+ "mute": "Couper le son",
+ "unmute": "Activer le son",
+ "annotate": "Annoter",
+ "search": "Rechercher",
+ "elapsed_time": "Durée écoulée",
+ "total_time": "Durée totale",
+ "volume": "Niveau sonore",
+ "volume_control": "Réglage du niveau sonore"
+ }
+ }
+);
+
+
+IriSP.PlayerWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+
+ this._searchBlockOpen = false;
+ this._searchLastValue = "";
+};
+
+IriSP.PlayerWidget.prototype = new IriSP.Widget();
+
+IriSP.PlayerWidget.prototype.draw = function() {
+ var self = this;
+ var width = this.width;
+ var height = this.height;
+ var heightS = this.height-20;
+
+ var playerTempl = IriSP.templToHTML(IriSP.player_template, this._config);
+ this.selector.append(playerTempl);
+
+ this.selector.children(".Ldt-controler").show();
+
+ // handle clicks by the user on the video.
+ this._Popcorn.listen("play", IriSP.wrap(this, this.playButtonUpdater));
+ this._Popcorn.listen("pause", IriSP.wrap(this, this.playButtonUpdater));
+
+ this._Popcorn.listen("volumechange", IriSP.wrap(this, this.volumeUpdater));
+
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.timeDisplayUpdater));
+ // update the time display for the first time.
+ this._Popcorn.listen("loadedmetadata", IriSP.wrap(this, this.timeDisplayUpdater));
+
+ this._Popcorn.listen("IriSP.search.matchFound", IriSP.wrap(this, this.searchMatch));
+ this._Popcorn.listen("IriSP.search.noMatchFound", IriSP.wrap(this, this.searchNoMatch));
+ this._Popcorn.listen("IriSP.search.triggeredSearch", IriSP.wrap(this, this.triggeredSearch));
+
+
+ this.selector.find(".Ldt-CtrlPlay").click(function() { self.playHandler.call(self); });
+ this.selector.find(".Ldt-CtrlAnnotate").click(function()
+ { self._Popcorn.trigger("IriSP.PlayerWidget.AnnotateButton.clicked"); });
+ this.selector.find(".Ldt-CtrlSearch").click(function() { self.searchButtonHandler.call(self); });
+
+ var _volctrl = this.selector.find(".Ldt-Ctrl-Volume-Control");
+ this.selector.find('.Ldt-CtrlSound')
+ .click(function() { self.muteHandler.call(self); } )
+ .mouseover(function() {
+ _volctrl.show();
+ })
+ .mouseout(function() {
+ _volctrl.hide();
+ });
+ _volctrl.mouseover(function() {
+ _volctrl.show();
+ }).mouseout(function() {
+ _volctrl.hide();
+ });
+
+ /*
+ var searchButtonPos = this.selector.find(".Ldt-CtrlSearch").position();
+ var searchBox = Mustache.to_html(IriSP.search_template, {margin_left : searchButtonPos.left + "px"});
+ this.selector.find(".Ldt-CtrlSearch").after(searchBox);
+ */
+
+ // trigger an IriSP.PlayerWidget.MouseOver to the widgets that are interested (i.e : sliderWidget)
+ this.selector.hover(function() { self._Popcorn.trigger("IriSP.PlayerWidget.MouseOver"); },
+ function() { self._Popcorn.trigger("IriSP.PlayerWidget.MouseOut"); });
+ this.selector.find(".Ldt-Ctrl-Volume-Cursor").draggable({
+ axis: "x",
+ drag: function(event, ui) {
+ var _vol = Math.max(0, Math.min( 1, ui.position.left / (ui.helper.parent().width() - ui.helper.outerWidth())));
+ ui.helper.attr("title",IriSP.i18n.getMessage('volume')+': ' + Math.floor(100*_vol) + '%');
+ self._Popcorn.volume(_vol);
+ },
+ containment: "parent"
+ });
+
+ setTimeout(function() {
+ self.volumeUpdater();
+ }, 1000); /* some player - jwplayer notable - save the state of the mute button between sessions */
+};
+
+/* Update the elasped time div */
+IriSP.PlayerWidget.prototype.timeDisplayUpdater = function() {
+
+ if (this._previousSecond === undefined) {
+ this._previousSecond = this._Popcorn.roundTime();
+ }
+ else {
+ /* we're still in the same second, so it's not necessary to update time */
+ if (this._Popcorn.roundTime() == this._previousSecond)
+ return;
+
+ }
+
+ // we get it at each call because it may change.
+ var duration = this.getDuration() / 1000;
+ var totalTime = IriSP.secondsToTime(duration);
+ var elapsedTime = IriSP.secondsToTime(this._Popcorn.currentTime());
+
+ this.selector.find(".Ldt-ElapsedTime").html(elapsedTime.toString());
+ this.selector.find(".Ldt-TotalTime").html(totalTime.toString());
+ this._previousSecond = this._Popcorn.roundTime();
+};
+
+/* update the icon of the button - separate function from playHandler
+ because in some cases (for instance, when the user directly clicks on
+ the jwplayer window) we have to change the icon without playing/pausing
+*/
+IriSP.PlayerWidget.prototype.playButtonUpdater = function() {
+ var status = this._Popcorn.media.paused;
+
+ if ( status == true ){
+ /* the background sprite is changed by adding/removing the correct classes */
+ this.selector.find(".Ldt-CtrlPlay").attr("title", IriSP.i18n.getMessage('play'));
+ this.selector.find(".Ldt-CtrlPlay").removeClass("Ldt-CtrlPlay-PauseState").addClass("Ldt-CtrlPlay-PlayState");
+ } else {
+ this.selector.find(".Ldt-CtrlPlay").attr("title", IriSP.i18n.getMessage('pause'));
+ this.selector.find(".Ldt-CtrlPlay").removeClass("Ldt-CtrlPlay-PlayState").addClass("Ldt-CtrlPlay-PauseState");
+ }
+
+ return;
+};
+
+
+IriSP.PlayerWidget.prototype.playHandler = function() {
+ var status = this._Popcorn.media.paused;
+
+ if ( status == true ){
+ this._Popcorn.play();
+ } else {
+ this._Popcorn.pause();
+ }
+};
+
+IriSP.PlayerWidget.prototype.muteHandler = function() {
+ this._Popcorn.mute(!this._Popcorn.muted());
+};
+
+IriSP.PlayerWidget.prototype.volumeUpdater = function() {
+ var _muted = this._Popcorn.muted(),
+ _vol = this._Popcorn.volume();
+ if (_vol === false) {
+ _vol = .5;
+ }
+ var _soundCtl = this.selector.find(".Ldt-CtrlSound");
+ _soundCtl.removeClass("Ldt-CtrlSound-Mute Ldt-CtrlSound-Half Ldt-CtrlSound-Full");
+ if (_muted) {
+ _soundCtl.attr("title", IriSP.i18n.getMessage('unmute'))
+ .addClass("Ldt-CtrlSound-Mute");
+ } else {
+ _soundCtl.attr("title", IriSP.i18n.getMessage('mute'))
+ .addClass(_vol < .5 ? "Ldt-CtrlSound-Half" : "Ldt-CtrlSound-Full" )
+ }
+ var _cursor = this.selector.find(".Ldt-Ctrl-Volume-Cursor");
+ _cursor.css({
+ "left": ( _muted ? 0 : Math.floor(_vol * (_cursor.parent().width() - _cursor.outerWidth())) ) + "px"
+ })
+};
+
+IriSP.PlayerWidget.prototype.showSearchBlock = function() {
+ var self = this;
+
+ if (this._searchBlockOpen == false) {
+ this.selector.find(".LdtSearch").show("blind", { direction: "horizontal"}, 100);
+ this.selector.find(".LdtSearchInput").css('background-color','#fff');
+
+ this._searchBlockOpen = true;
+ this.selector.find(".LdtSearchInput").bind('keyup', null, function() { self.searchHandler.call(self); } );
+ this.selector.find(".LdtSearchInput").focus();
+
+ // we need this variable because some widget can find a match in
+ // their data while at the same time other's don't. As we want the
+ // search field to become green when there's a match, we need a
+ // variable to remember that we had one.
+ this._positiveMatch = false;
+
+ // tell the world the field is open
+ this._Popcorn.trigger("IriSP.search.open");
+ }
+};
+
+IriSP.PlayerWidget.prototype.hideSearchBlock = function() {
+ if (this._searchBlockOpen == true) {
+ this._searchLastValue = this.selector.find(".LdtSearchInput").attr('value');
+ this.selector.find(".LdtSearchInput").attr('value','');
+ this.selector.find(".LdtSearch").hide("blind", { direction: "horizontal"}, 75);
+
+ // unbind the watcher event.
+ this.selector.find(".LdtSearchInput").unbind('keypress set');
+ this._searchBlockOpen = false;
+
+ this._positiveMatch = false;
+
+ this._Popcorn.trigger("IriSP.search.closed");
+ }
+};
+
+/** react to clicks on the search button */
+IriSP.PlayerWidget.prototype.searchButtonHandler = function() {
+ var self = this;
+
+ /* show the search field if it is not shown */
+ if ( this._searchBlockOpen == false ) {
+ this.showSearchBlock();
+ this.selector.find(".LdtSearchInput").attr('value', this._searchLastValue);
+ this._Popcorn.trigger("IriSP.search", this._searchLastValue); // trigger the search to make it more natural.
+ } else {
+ this.hideSearchBlock();
+ }
+};
+
+/** this handler is called whenever the content of the search
+ field changes */
+IriSP.PlayerWidget.prototype.searchHandler = function() {
+ this._searchLastValue = this.selector.find(".LdtSearchInput").attr('value');
+ this._positiveMatch = false;
+
+ // do nothing if the search field is empty, instead of highlighting everything.
+ if (this._searchLastValue == "") {
+ this._Popcorn.trigger("IriSP.search.cleared");
+ this.selector.find(".LdtSearchInput").css('background-color','');
+ } else {
+ this._Popcorn.trigger("IriSP.search", this._searchLastValue);
+ }
+};
+
+/**
+ handler for the IriSP.search.found message, which is sent by some views when they
+ highlight a match.
+*/
+IriSP.PlayerWidget.prototype.searchMatch = function() {
+ this._positiveMatch = true;
+ this.selector.find(".LdtSearchInput").css('background-color','#e1ffe1');
+};
+
+/** the same, except that no value could be found */
+IriSP.PlayerWidget.prototype.searchNoMatch = function() {
+ if (this._positiveMatch !== true)
+ this.selector.find(".LdtSearchInput").css('background-color', "#d62e3a");
+};
+
+/** react to an IriSP.Player.triggeredSearch - that is, when
+ a widget ask the PlayerWidget to do a search on his behalf */
+IriSP.PlayerWidget.prototype.triggeredSearch = function(searchString) {
+ this.showSearchBlock();
+ this.selector.find(".LdtSearchInput").attr('value', searchString);
+ this._Popcorn.trigger("IriSP.search", searchString); // trigger the search to make it more natural.
+};
+
+
+/*
+ *
+ * Copyright 2010 Institut de recherche et d'innovation
+ * contributor(s) : Samuel Huron
+ *
+ * contact@iri.centrepompidou.fr
+ * http://www.iri.centrepompidou.fr
+ *
+ * This software is a computer program whose purpose is to show and add annotations on a video .
+ * This software is governed by the CeCILL-C license under French law and
+ * abiding by the rules of distribution of free software. You can use,
+ * modify and/ or redistribute the software under the terms of the CeCILL-C
+ * license as circulated by CEA, CNRS and INRIA at the following URL
+ * "http://www.cecill.info".
+ *
+ * The fact that you are presently reading this means that you have had
+ * knowledge of the CeCILL-C license and that you accept its terms.
+*/
+// CHART TIMELINE / VERSION PROTOTYPE ::
+
+/** the polemic widget */
+IriSP.PolemicWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+
+ this.userPol = new Array();
+ this.userNoPol = new Array();
+ this.userst = new Array();
+ this.numberOfTweet = 0;
+ this.Users;
+ this.TweetPolemic;
+ this.yMax = this.height;
+ this.PaperSlider;
+ this.heightOfChart;
+ this.tweets = new Array();
+ this.svgElements = {};
+
+ this.oldSearchMatches = [];
+};
+
+IriSP.PolemicWidget.prototype = new IriSP.Widget();
+
+IriSP.PolemicWidget.prototype.draw = function() {
+
+ // variable
+ // yMax
+
+ var self = this;
+ var yCoef = 2; // coef for height of 1 tweet
+ var frameSize = 5; // frame size
+ var margin = 1; // marge between frame
+ var lineSize = this.width; // timeline pixel width
+ var nbrframes = lineSize/frameSize; // frame numbers
+ var numberOfTweet = 0; // number of tweet overide later
+ var duration = this.getDuration(); // timescale width
+ var frameLength = lineSize / frameSize; // frame timescale
+ var timeline;
+ var colors = new Array("","#1D973D","#036AAE","#CE0A15","#C5A62D","#585858");
+
+ // array
+ //var tweets = new Array();
+ var element = new Array();
+ var cluster = new Array();
+ var frames = new Array(frameLength);
+ var slices = new Array();
+
+
+ // Classes =======================================================================
+ var Frames = function(){
+
+ var Myclusters;
+ var x;
+ var y;
+ var width;
+ var height;
+ };
+ Frames = function(json){
+ // make my clusters
+ // ou Frame vide
+ };
+ Frames.prototype.draw = function(){
+ };
+ Frames.prototype.zoom = function(){
+ };
+ Frames.prototype.inside = function(){
+ };
+ var Clusters = function(){
+ var Object;
+ var yDist;
+ var x;
+ var y;
+ var width;
+ var height;
+ };
+ Clusters = function(json){
+ // make my object
+ };
+ var Tweet = function(){
+ };
+ // Classes =======================================================================
+
+ // Refactoring (parametere) ************************************************************
+ // color translastion
+ var qTweet_0 =0;
+ var qTweet_Q =0;
+ var qTweet_REF=0;
+ var qTweet_OK =0;
+ var qTweet_KO =0;
+ function colorTranslation(value){
+ if(value == "Q"){
+ qTweet_Q+=1;
+ return 2;
+ }else if(value =="REF"){
+ qTweet_REF+=1;
+ return 4;
+ }else if(value =="OK"){
+ qTweet_OK+=1;
+ return 1;
+ }else if(value =="KO"){
+ qTweet_KO+=1;
+ return 3;
+ }else if(value ==""){
+ qTweet_0+=1;
+ return 5;
+ }
+ }
+
+
+ this._serializer.sync(function(data) { loaded_callback.call(self, data); return; });
+
+ function loaded_callback (json) {
+ var view_type = this._serializer.getTweets();
+
+
+ if (typeof(view_type) === "undefined") {
+ var view_type = this._serializer.getTweetIds()[0];
+ if (typeof(view_type) === "undefined") {
+ // default to guessing if nothing else works.
+ var view = json.views[0];
+
+ if(typeof(view.annotation_types) !== "undefined") {
+ /* we need to be backward compatible with the old files which used to
+ feature only two lines : Chapitrage and Tweets. We've added a
+ "Contributions" line so we need to discriminate against that */
+ if (view.annotation_types.length === 2 && typeof(this._serializer.getContributions()) === "undefined") {
+ var view_type = view.annotation_types[1];
+ } else {
+ console.log("PolemicWidget: invalid file - minimizing");
+ return;
+ }
+ }
+ }
+ }
+
+ // Make and define the Raphael area
+ this.paper = Raphael(document.getElementById(this._id), this._config.width, this._config.height);
+
+ // event handlers
+ this._Popcorn.listen("IriSP.search", IriSP.wrap(this, function(searchString) { this.searchHandler(searchString); }));
+ this._Popcorn.listen("IriSP.search.closed", IriSP.wrap(this, this.searchFieldClosedHandler));
+ this._Popcorn.listen("IriSP.search.cleared", IriSP.wrap(this, this.searchFieldClearedHandler));
+ this.selector.mouseleave(IriSP.wrap(this, function() { self.TooltipWidget.hide.call(self.TooltipWidget); }));
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.sliderUpdater));
+ this._Popcorn.listen("IriSP.Mediafragment.showAnnotation", IriSP.wrap(this, this.showAnnotation));
+
+ for(var i = 0; i < json.annotations.length; i++) {
+ var item = json.annotations[i];
+ var MyTime = Math.floor(item.begin/duration*lineSize);
+ var Myframe = Math.floor(MyTime/lineSize*frameLength);
+
+ if (typeof(item.meta) !== "undefined"
+ && typeof(item.meta["id-ref"]) !== "undefined"
+ && item.meta["id-ref"] === view_type) {
+
+ var MyTJson = {},
+ _source = IriSP.get_aliased(item.meta, ['dc:source', 'source']);
+ if (_source !== null) {
+ var MyTJson = JSON.parse(_source['content']);
+ }
+
+ if (item.content['polemics'] != undefined
+ && item.content['polemics'][0] != null) {
+
+ // a tweet can have many polemics at the same time.
+ for(var j=0; j max) {
+ max = moy;
+ }
+ }
+
+ var tweetDrawed = new Array();
+ var TweetHeight = 5;
+ var newHeight = TweetHeight * max + 10;
+
+
+ if (newHeight > this.height) {
+ this.paper.setSize(this.width, newHeight);
+ this.height = newHeight;
+ console.log("resizeing");
+ }
+
+
+ // DRAW TWEETS ============================================
+ for(var i = 0; i < nbrframes; i++) {
+ var addEheight = 5;
+ if (frames[i] != undefined){
+ // by type
+
+ for (var j = 6; j > -1; j--) {
+ if (frames[i].qualifVol[j] != undefined) {
+ // show tweet by type
+ for (var k = 0; k < frames[i].mytweetsID.length; k++) {
+
+ if (frames[i].mytweetsID[k].qualification == j) {
+ var x = i * frameSize;
+ var y = this.height - addEheight;
+
+ if (this.yMax > y) {
+ this.yMax = y;
+ }
+
+ /* some tweets seem to be duplicated - so we make a check before
+ creating a new rect */
+ if (this.svgElements.hasOwnProperty(frames[i].mytweetsID[k].cinecast_id))
+ continue;
+
+ var e = this.paper.rect(x, y, frameSize - margin, TweetHeight /* height */)
+ .attr({stroke:"#00","stroke-width":0.1, fill: colors[j]});
+
+ addEheight += TweetHeight;
+
+ /* stick a lot of things into e because that's the easiest way
+ to do it */
+ e.color = colors[j];
+ e.time = frames[i].mytweetsID[k].timeframe;
+ e.title = frames[i].mytweetsID[k].title;
+ e.id = frames[i].mytweetsID[k].cinecast_id;
+ this.svgElements[e.id] = e;
+
+ IriSP.jQuery(e.node).mouseenter(function(element) { return function (_e) {
+ self.TooltipWidget.show.call(self.TooltipWidget, element.title, element.attr("fill"), element.attrs.x + element.attrs.width / 2, element.attrs.y - 2);
+ element.displayed = true;
+ self._Popcorn.trigger("IriSP.TraceWidget.MouseEvents", {
+ "widget" : "StackGraphWidget",
+ "type": "mousemove",
+ "x": _e.pageX,
+ "y": _e.pageY,
+ "annotation_id": element.id
+ });
+ }}(e)).mousedown(function(element) { return function () {
+ self._Popcorn.currentTime(element.time/1000);
+ self._Popcorn.trigger("IriSP.PolemicTweet.click", element.id);
+ }
+ }(e));
+
+ IriSP.jQuery(e.node).attr('id', 't' + k + '');
+ IriSP.jQuery(e.node).attr('title', frames[i].mytweetsID[k].title);
+ IriSP.jQuery(e.node).attr('begin', frames[i].mytweetsID[k].timeframe);
+ }
+ }
+ }
+ }
+ }
+
+ }
+ // DRAW UI :: resize border and bgd
+ this.paperBackground = this.paper.rect(0, 0, this.width, this.height).attr({fill:"#F8F8F8","stroke-width":0.1,opacity: 1});
+
+ // outer borders
+ this.outerBorders = [];
+ this.outerBorders.push(this.paper.rect(0, this.height - 1, this.width, 1).attr({fill:"#ababab",stroke: "none",opacity: 1}));
+ this.outerBorders.push(this.paper.rect(0, 0, this.width, 1).attr({fill:"#ababab",stroke: "none",opacity: 1}));
+
+ // inner borders
+ this.innerBorders = [];
+ this.innerBorders.push(this.paper.rect(1, this.height - 2, this.width, 1).attr({fill:"#efefef",stroke: "none",opacity: 1}));
+ this.innerBorders.push(this.paper.rect(1, 1, this.width, 1).attr({fill:"#efefef",stroke: "none",opacity: 1}));
+ this.innerBorders.push(this.paper.rect(1, 1, 1, this.height - 2).attr({fill:"#d0d1d1",stroke: "none",opacity: 0.8}));
+ this.innerBorders.push(this.paper.rect(this.width - 2, 1, 1, this.height - 2).attr({fill:"#efefef",stroke: "none",opacity: 1}));
+
+
+
+ this.paperSlider = this.paper.rect(0, 0, 0, this.height).attr({fill:"#D4D5D5", stroke: "none", opacity: 1});
+
+ // the small white line displayed over the slider.
+ this.sliderTip = this.paper.rect(0, 0, 1, this.height).attr({fill:"#fc00ff", stroke: "none", opacity: 1});
+ // decalage
+ // tweetSelection = this.paper.rect(-100,-100,5,5).attr({fill:"#fff",stroke: "none",opacity: 1});
+
+
+ this.paperSlider.toBack();
+ this.paperBackground.toBack();
+ this.sliderTip.toFront();
+ }
+
+
+}
+
+/** update the positionMarker as time passes */
+IriSP.PolemicWidget.prototype.sliderUpdater = function() {
+
+ var time = +this._Popcorn.currentTime();
+ var duration = this.getDuration();
+
+ this.paperSlider.attr("width", time * (this.width / (duration / 1000)));
+
+ this.sliderTip.attr("x", time * (this.width / (duration / 1000)));
+};
+
+/** reacts to IriSP.search events */
+IriSP.PolemicWidget.prototype.searchHandler = function(searchString) {
+ if (searchString == "")
+ return;
+
+ var matches = this._serializer.searchTweetsOccurences(searchString);
+
+ if (IriSP.countProperties(matches) > 0) {
+ this._Popcorn.trigger("IriSP.search.matchFound");
+ } else {
+ this._Popcorn.trigger("IriSP.search.noMatchFound");
+ }
+
+
+ // decrease the opacity of the other elements.
+ for (var id in this.svgElements) {
+ var e = this.svgElements[id];
+ e.attr({fill: e.color, opacity: 0.4});
+ }
+
+
+ for (var id in matches) {
+ if (this.svgElements.hasOwnProperty(id)) {
+ var e = this.svgElements[id];
+ this.svgElements[id].attr({fill: "#fc00ff", opacity: 1});
+ }
+ }
+
+ this.oldSearchMatches = matches;
+};
+
+/** reacts to IriSP.search.cleared messages */
+IriSP.PolemicWidget.prototype.searchFieldClearedHandler = function() {
+ for (var id in this.svgElements) {
+ var e = this.svgElements[id];
+ e.attr({fill: e.color, opacity: 1});
+ }
+};
+
+/** reacts to IriSP.search.closed messages by clearing the highlighted elements */
+IriSP.PolemicWidget.prototype.searchFieldClosedHandler = function() {
+ for (var id in this.svgElements) {
+ var e = this.svgElements[id];
+ e.attr({fill: e.color, opacity: 1});
+ }
+
+};
+
+IriSP.PolemicWidget.prototype.showAnnotation = function(id) {
+ if (this.svgElements.hasOwnProperty(id)) {
+ var e = this.svgElements[id];
+ this.TooltipWidget.show(e.title, e.attr("fill"), e.x - 103, e.y - 160);
+ }
+};
+IriSP.SegmentsWidget = function(Popcorn, config, Serializer) {
+
+ var self = this;
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+ this.oldSearchMatches = [];
+
+ // event handlers
+ this._Popcorn.listen("IriSP.search", function(searchString) { self.searchHandler.call(self, searchString); });
+ this._Popcorn.listen("IriSP.search.closed", function() { self.searchFieldClosedHandler.call(self); });
+ this._Popcorn.listen("IriSP.search.cleared", function() { self.searchFieldClearedHandler.call(self); });
+
+ this.defaultColors = ["#1f77b4","#aec7e8","#ff7f0e","#ffbb78","#2ca02c","#98df8a","#d62728","#ff9896","#9467bd","#c5b0d5","#8c564b","#c49c94","#e377c2","#f7b6d2","#7f7f7f","#c7c7c7","#bcbd22","#dbdb8d","#17becf","#9edae5"]
+};
+
+IriSP.SegmentsWidget.prototype = new IriSP.Widget();
+
+IriSP.SegmentsWidget.prototype.draw = function() {
+
+ var self = this;
+ var annotations = this._serializer._data.annotations;
+
+ this.selector.addClass("Ldt-SegmentsWidget");
+ this.selector.append(Mustache.to_html(IriSP.overlay_marker_template));
+
+ this.positionMarker = this.selector.find(".Ldt-SegmentPositionMarker");
+
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.positionUpdater));
+ var duration = this.getDuration();
+
+ if (this.cinecast_version) {
+ var segments_annotations = IriSP.underscore.filter(
+ this._serializer._data.annotations,
+ function(_a) {
+ return _a.type == "cinecast:MovieExtract";
+ }
+ );
+ }
+ else {
+
+ var view_type = this._serializer.getChapitrage();
+ if (typeof(view_type) === "undefined") {
+ view_type = this._serializer.getNonTweetIds()[0];
+ }
+
+
+ var i = 0;
+
+ var segments_annotations = [];
+
+ for (i = 0; i < annotations.length; i++) {
+ var annotation = annotations[i];
+
+ /* filter the annotations whose type is not the one we want */
+ if (view_type != "" && typeof(annotation.meta) !== "undefined" && typeof(annotation.meta["id-ref"]) !== "undefined"
+ && annotation.meta["id-ref"] != view_type) {
+ continue;
+ }
+
+ segments_annotations.push(annotation);
+ }
+}
+ var _w = this.selector.width();
+ var lastSegment = IriSP.underscore.max(segments_annotations, function(annotation) { return annotation.end; });
+
+ for (i = 0; i < segments_annotations.length; i++) {
+
+ var annotation = segments_annotations[i];
+ var begin = (+ annotation.begin);
+ var end = (+ annotation.end);
+ var id = annotation.id;
+
+ var startPixel = Math.floor(_w * (begin / duration));
+
+ var endPixel = Math.floor(_w * (end / duration));
+ if (annotation.id !== lastSegment.id)
+ var pxWidth = endPixel - startPixel -1;
+ else
+ /* the last segment has no segment following it */
+ var pxWidth = endPixel - startPixel;
+
+ var divTitle = this.cinecast_version
+ ? annotation.content.data
+ : annotation.content.title + ( annotation.content.title ? "
" : "" ) + annotation.content.description.replace(/(^.{120,140})[\s].+$/,'$1…'); + + var thumbUrl = annotation.meta.thumbnail || ''; + + var hexa_color = typeof(annotation.content.color) !== "undefined" + ? '#' + IriSP.DEC_HEXA_COLOR(annotation.content.color) + : typeof(annotation.color) !== "undefined" + ? '#' + IriSP.DEC_HEXA_COLOR(annotation.color) + : this.defaultColors[i % this.defaultColors.length]; + + /* + if (hexa_color === "FFCC00") + hexa_color = "333"; + */ + if (hexa_color.length == 5) + hexa_color = hexa_color + '00'; + + + var annotationTemplate = Mustache.to_html(IriSP.annotation_template, + {"divTitle" : divTitle, "id" : id, "startPixel" : startPixel, + "pxWidth" : pxWidth, "hexa_color" : hexa_color, + "seekPlace" : Math.round(begin/1000), "thumbnailUrl": thumbUrl}); + + + this.selector.append(annotationTemplate); + + /* add a special class to the last segment and change its border */ + if (annotation.id === lastSegment.id) { + IriSP.jqId(id).addClass("Ldt-lastSegment").css("border-color", hexa_color); + } + } + // react to mediafragment messages. + this._Popcorn.listen("IriSP.Mediafragment.showAnnotation", + function(id, divTitle) { + + var divObject = IriSP.jqId(id); + if (divObject.length) { + divObject.fadeTo(0,1); + var offset_x = divObject.position().left + divObject.outerWidth() / 2; + self.TooltipWidget.show(divObject.attr("title"), IriSP.jQuery(this).css("background-color"), offset_x, 0); + IriSP.jQuery(document).one("mousemove", function() { divObject.fadeTo(0,.5); + self.TooltipWidget.hide(); }); + } + }); + + this.selector.find(".Ldt-iri-chapter") + .fadeTo(0, .5) + .click(function() { + self._Popcorn.trigger("IriSP.SegmentsWidget.click", this.id); + self._Popcorn.currentTime(IriSP.jQuery(this).attr("data-seek")); + }) + .mouseover( function(event) { + var divObject = IriSP.jQuery(this); + divObject.fadeTo(0,1); + var offset_x = divObject.position().left + divObject.outerWidth() / 2; + var thumb = divObject.attr("thumbnail-url"); + var txt = divObject.attr("title") + (thumb && thumb.length ? '
' : '');
+ self.TooltipWidget.show(txt, IriSP.jQuery(this).css("background-color"), offset_x, 0);
+ })
+ .mouseout(function(){
+ IriSP.jQuery(this).fadeTo(0,.5);
+ self.TooltipWidget.hide();
+ });
+};
+
+/* restores the view after a search */
+IriSP.SegmentsWidget.prototype.clear = function() {
+ this.selector.children(".Ldt-iri-chapter").fadeTo(0,.5);
+};
+
+IriSP.SegmentsWidget.prototype.clickHandler = function(annotation) {
+ this._Popcorn.trigger("IriSP.SegmentsWidget.click", annotation.id);
+ var begin = (+ annotation.begin) / 1000;
+ this._Popcorn.currentTime(Math.round(begin));
+};
+
+IriSP.SegmentsWidget.prototype.searchHandler = function(searchString) {
+
+ if (searchString == "")
+ return;
+
+ var matches = this._serializer.searchOccurences(searchString);
+
+ if (IriSP.countProperties(matches) > 0) {
+ this._Popcorn.trigger("IriSP.search.matchFound");
+ } else {
+ this._Popcorn.trigger("IriSP.search.noMatchFound");
+ }
+
+ // un-highlight all the blocks
+ this.selector.children(".Ldt-iri-chapter").css("opacity", 0.1);
+
+ // then highlight the ones with matches.
+ for (var id in matches) {
+ var factor = 0.5 + matches[id] * 0.2;
+ this.selector.find("#"+id).dequeue();
+ this.selector.find("#"+id).animate({opacity:factor}, 200);
+ }
+
+
+ this.oldSearchMatches = matches;
+};
+
+IriSP.SegmentsWidget.prototype.searchFieldClearedHandler = function() {
+ this.clear();
+};
+
+IriSP.SegmentsWidget.prototype.searchFieldClosedHandler = function() {
+ this.clear();
+};
+
+IriSP.SegmentsWidget.prototype.positionUpdater = function() {
+ var duration = this.getDuration() / 1000;
+ var time = this._Popcorn.currentTime();
+ //var position = ((time / duration) * 100).toFixed(2);
+ var position = ((time / duration) * 100).toFixed(2);
+
+ this.positionMarker.css("left", position + "%");
+};
+
+IriSP.SegmentsWidget.prototype.showAnnotation = function() {
+
+};
+/** A widget to create a new segment */
+IriSP.SliceWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+
+};
+
+IriSP.SliceWidget.prototype = new IriSP.Widget();
+
+IriSP.SliceWidget.prototype.draw = function() {
+ var templ = Mustache.to_html(IriSP.sliceWidget_template);
+ this.selector.append(templ);
+
+ this.sliceZone = this.selector.find(".Ldt-sliceZone");
+
+ /* global variables used to keep the position and width
+ of the zone.
+ */
+ this.zoneLeft = 0;
+ this.zoneWidth = 0;
+
+ this.leftHandle = this.selector.find(".Ldt-sliceLeftHandle");
+ this.rightHandle = this.selector.find(".Ldt-sliceRightHandle");
+
+ var left = this.selector.offset().left;
+ var top = this.selector.offset().top;
+
+ // a bug in firefox makes it use the wrong format
+ if (!IriSP.jQuery.browser.mozilla) {
+ // contain the handles correctly - we cannot set
+ // containment: parent because it wouldn't allow to select the
+ // whole slice, so we have to compute a box in which the slice is
+ // allowed to move.
+ var containment = [left - 8, top, this.selector.width() + left, top];
+
+ // var containment = [left - 16, top, this.selector.width() + left - 8, top];
+ this.leftHandle.draggable({axis: "x",
+ drag: IriSP.wrap(this, this.leftHandleDragged),
+ containment: containment
+ });
+
+ containment = [left, top, this.selector.width() + left, top];
+ // containment = [left, top, this.selector.width() + left - 8, top];
+ this.rightHandle.draggable({axis: "x",
+ drag: IriSP.wrap(this, this.rightHandleDragged),
+ containment: containment
+ });
+
+ } else { // firefox
+ // we need to define a containment specific to firefox.
+
+ var containment = [left - 16, top, this.selector.width() + left - 8, top];
+ this.leftHandle.draggable({axis: "x",
+ drag: IriSP.wrap(this, this.leftHandleDragged),
+ containment: containment
+ });
+
+ containment = [left, top, this.selector.width() + left - 8, top];
+ this.rightHandle.draggable({axis: "x",
+ drag: IriSP.wrap(this, this.rightHandleDragged),
+ containment: containment
+ });
+ }
+
+ this.leftHandle.css("position", "absolute");
+ this.rightHandle.css("position", "absolute");
+
+ this._Popcorn.listen("IriSP.SliceWidget.position",
+ IriSP.wrap(this, this.positionSliceHandler));
+
+ this._Popcorn.listen("IriSP.SliceWidget.show", IriSP.wrap(this, this.show));
+ this._Popcorn.listen("IriSP.SliceWidget.hide", IriSP.wrap(this, this.hide));
+ this.selector.hide();
+};
+
+/** responds to an "IriSP.SliceWidget.position" message
+ @param params an array with the first element being the left distance in
+ percents and the second element the width of the slice in pixels
+*/
+IriSP.SliceWidget.prototype.positionSliceHandler = function(params) {
+ left = params[0];
+ width = params[1];
+
+ this.zoneLeft = left;
+ this.zoneWidth = width;
+ this.sliceZone.css("left", left + "px");
+ this.sliceZone.css("width", width + "px");
+ this.leftHandle.css("left", (left - 7) + "px");
+ this.rightHandle.css("left", left + width + "px");
+
+ this._leftHandleOldLeft = left - 7;
+ this._rightHandleOldLeft = left + width;
+};
+
+/** handle a dragging of the left handle */
+IriSP.SliceWidget.prototype.leftHandleDragged = function(event, ui) {
+ /* we have a special variable, this._leftHandleOldLeft, to keep the
+ previous position of the handle. We do that to know in what direction
+ is the handle being dragged
+ */
+
+ var currentX = this.leftHandle.offset().left;
+ var rightHandleX = Math.floor(this.rightHandle.position()["left"]);
+
+ var container_offset = this.selector.offset().left;
+
+ if (Math.floor(ui.position.left) >= rightHandleX - 7) {
+ /* prevent the handle from moving past the right handle */
+ ui.position.left = rightHandleX - 7;
+ }
+
+ this.zoneWidth = rightHandleX - Math.floor(ui.position.left) - 7;
+ this.zoneLeft = Math.floor(ui.position.left) + 8;
+
+ this.sliceZone.css("width", this.zoneWidth);
+ this.sliceZone.css("left", this.zoneLeft + "px");
+
+ this._leftHandleOldLeft = ui.position.left;
+ this.broadcastChanges();
+
+};
+
+/** handle a dragging of the right handle */
+IriSP.SliceWidget.prototype.rightHandleDragged = function(event, ui) {
+ /* we have a special variable, this._leftHandleOldLeft, to keep the
+ previous position of the handle. We do that to know in what direction
+ is the handle being dragged
+ */
+
+ var currentX = this.leftHandle.position()["left"];
+ var leftHandleX = Math.floor(this.leftHandle.position()["left"]);
+
+ var container_offset = this.selector.offset().left + this.selector.width();
+
+ if (Math.floor(ui.position.left) < leftHandleX + 7) {
+ /* prevent the handle from moving past the left handle */
+ ui.position.left = leftHandleX + 7;
+ }
+
+ this.zoneWidth = Math.floor(ui.position.left) - (leftHandleX + 7);
+
+ this.sliceZone.css("width", this.zoneWidth);
+ //this.sliceZone.css("left", this.zoneLeft + "px");
+ this._rightHandleOldLeft = Math.floor(this._rightHandleOldLeft);
+ this.broadcastChanges();
+};
+
+/** tell to the world that the coordinates of the slice have
+ changed
+*/
+IriSP.SliceWidget.prototype.broadcastChanges = function() {
+ var leftPercent = (this.zoneLeft / this.selector.width()) * 100;
+ var zonePercent = (this.zoneWidth / this.selector.width()) * 100;
+
+ this._Popcorn.trigger("IriSP.SliceWidget.zoneChange", [leftPercent, zonePercent]);
+};
+
+IriSP.SliceWidget.prototype.show = function() {
+ this.selector.show();
+};
+
+IriSP.SliceWidget.prototype.hide = function() {
+ this.selector.hide();
+};IriSP.SliderWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+};
+
+IriSP.SliderWidget.prototype = new IriSP.Widget();
+
+IriSP.SliderWidget.prototype.draw = function() {
+ var self = this;
+
+ this.selector.append(Mustache.to_html(IriSP.sliderWidget_template, {}));
+ this.selector.addClass("Ldt-SliderMinimized");
+
+ this.sliderBackground = this.selector.find(".Ldt-sliderBackground");
+ this.sliderForeground = this.selector.find(".Ldt-sliderForeground");
+ this.positionMarker = this.selector.find(".Ldt-sliderPositionMarker");
+
+
+ // a special variable to stop methods from tinkering
+ // with the positionMarker when the user is dragging it
+ this.draggingOngoing = false;
+
+ // another special variable used by the timeout handler to
+ // open or close the slider.
+ this.sliderMaximized = false;
+ this.timeOutId = null;
+
+
+ this.positionMarker.draggable({axis: "x",
+ start: IriSP.wrap(this, this.positionMarkerDraggingStartedHandler),
+ stop: IriSP.wrap(this, this.positionMarkerDraggedHandler),
+ containment: "parent"
+ });
+ this.positionMarker.css("position", "absolute");
+
+ this.sliderBackground.click(function(event) { self.backgroundClickHandler.call(self, event); });
+ this.sliderForeground.click(function(event) { self.foregroundClickHandler.call(self, event); });
+
+ this.selector.hover(IriSP.wrap(this, this.mouseOverHandler), IriSP.wrap(this, this.mouseOutHandler));
+
+ // update the positions
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.sliderUpdater));
+
+ // special messages :
+ this._Popcorn.listen("IriSP.PlayerWidget.MouseOver", IriSP.wrap(this, this.mouseOverHandler));
+ this._Popcorn.listen("IriSP.PlayerWidget.MouseOut", IriSP.wrap(this, this.mouseOutHandler));
+};
+
+/* update the slider and the position marker as time passes */
+IriSP.SliderWidget.prototype.sliderUpdater = function() {
+ if(this.draggingOngoing || this._disableUpdate)
+ return;
+
+ var time = this._Popcorn.currentTime();
+
+ var duration = this.getDuration() / 1000;
+ var percents = time / duration;
+
+ /* we do these complicated calculations to center exactly
+ the position Marker */
+
+ var divWidth = this.selector.width();
+ var pixels = Math.floor(this.selector.width() * percents);
+ var positionMarker_width = this.positionMarker.width();
+ var correction = (positionMarker_width / 2);
+
+ /* check that we don't leave the left side */
+ var newPos = pixels - correction;
+ if (newPos <= 0)
+ newPos = 0;
+
+ /* check that we don't leave the right side */
+ var rightEdgePos = pixels + 1 * correction;
+
+ if (rightEdgePos >= divWidth)
+ newPos = divWidth - 1 * correction - 1;
+
+ this.sliderForeground.css("width", pixels + "px");
+ this.positionMarker.css("left", newPos + "px");
+
+};
+
+IriSP.SliderWidget.prototype.backgroundClickHandler = function(event) {
+ /* this piece of code is a little bit convoluted - here's how it works :
+ we want to handle clicks on the progress bar and convert those to seeks in the media.
+ However, jquery only gives us a global position, and we want a number of pixels relative
+ to our container div, so we get the parent position, and compute an offset to this position,
+ and finally compute the progress ratio in the media.
+ Finally we multiply this ratio with the duration to get the correct time
+ */
+
+ var parentOffset = this.sliderBackground.parent().offset();
+ var width = this.sliderBackground.width();
+ var relX = event.pageX - parentOffset.left;
+
+ var duration = this.getDuration() / 1000;
+ var newTime = ((relX / width) * duration).toFixed(2);
+
+ this._Popcorn.currentTime(newTime);
+};
+
+/* same function as the previous one, except that it handles clicks
+ on the foreground element */
+IriSP.SliderWidget.prototype.foregroundClickHandler = function(event) {
+ var parentOffset = this.sliderForeground.parent().offset();
+ var width = this.sliderBackground.width();
+ var relX = event.pageX - parentOffset.left;
+
+ var duration = this.getDuration() / 1000;
+ var newTime = ((relX / width) * duration).toFixed(2);
+
+ this._Popcorn.currentTime(newTime);
+};
+
+/* handles mouse over the slider */
+IriSP.SliderWidget.prototype.mouseOverHandler = function(event) {
+
+ if (this.timeOutId !== null) {
+ window.clearTimeout(this.timeOutId);
+ }
+
+ this.sliderMaximized = true;
+
+ this.sliderBackground.animate({"height": "9px"}, 100);
+ this.sliderForeground.animate({"height": "9px"}, 100);
+ this.positionMarker.animate({"height": "9px", "width": "9px"}, 100);
+ //this.positionMarker.css("margin-top", "-4px");
+
+// this.selector.removeClass("Ldt-SliderMinimized");
+// this.selector.addClass("Ldt-SliderMaximized");
+};
+
+/* handles when the mouse leaves the slider */
+IriSP.SliderWidget.prototype.mouseOutHandler = function(event) {
+
+ this.timeOutId = window.setTimeout(IriSP.wrap(this, this.minimizeOnTimeout),
+ this.minimize_period);
+};
+
+IriSP.SliderWidget.prototype.minimizeOnTimeout = function(event) {
+ this.sliderBackground.animate({"height": "5px"}, 100);
+ this.sliderForeground.animate({"height": "5px"}, 100);
+ this.positionMarker.animate({"height": "5px", "width": "5px"}, 100);
+ this.positionMarker.css("margin-top", "0px");
+ this.sliderMinimized = true;
+
+// this.selector.removeClass("Ldt-SliderMaximized");
+// this.selector.addClass("Ldt-SliderMinimized");
+
+};
+
+// called when the user starts dragging the position indicator
+IriSP.SliderWidget.prototype.positionMarkerDraggingStartedHandler = function(event, ui) {
+ this.draggingOngoing = true;
+};
+
+IriSP.SliderWidget.prototype.positionMarkerDraggedHandler = function(event, ui) {
+
+/* this._disableUpdate = true; // disable slider position updates while dragging is ongoing.
+ window.setTimeout(IriSP.wrap(this, function() { this._disableUpdate = false; }), 500);
+*/
+ var parentOffset = this.sliderForeground.parent().offset();
+ var width = this.sliderBackground.width();
+ var relX = event.originalEvent.pageX - parentOffset.left;
+
+ var duration = this.getDuration() / 1000;
+ var newTime = ((relX / width) * duration).toFixed(2);
+ this._Popcorn.currentTime(newTime);
+
+ this.draggingOngoing = false;
+};
+
+/** @class The constructor for the sparkline widget */
+IriSP.SparklineWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+
+ this._oldAnnotation = null;
+ this._results = [];
+
+ this.slices = this._config.slices || Math.floor(this.width/20);
+ if (!this.width) {
+ this.width = this.selector.width();
+ }
+ if (!this.height) {
+ this.height = 40;
+ }
+ this.selector.css("height", this.height + "px");
+ if (this._config.background) {
+ this.selector.css("background", this._config.background);
+ }
+};
+
+
+IriSP.SparklineWidget.prototype = new IriSP.Widget();
+
+IriSP.SparklineWidget.prototype.clear = function() {
+
+};
+
+/** draw the sparkline using jquery sparkline */
+IriSP.SparklineWidget.prototype.draw = function() {
+ this.duration = this.getDuration();
+ this.paper = new Raphael(this.selector[0], this.width, this.height);
+ var _this = this;
+
+ var views = this._serializer._data.views;
+ var stat_view;
+ if (!IriSP.null_or_undefined(views)) {
+ for (var i = 0; i < views.length; i++) {
+ var view = views[i];
+ if (view.id === "stat") {
+ stat_view = view;
+ break;
+ }
+ }
+ }
+
+ var _ = IriSP.underscore;
+ // If we've found the correct view, feed the directly the data from the view
+ // to jquery sparkline. Otherwise, compute it ourselves.
+ if (!IriSP.null_or_undefined(stat_view)) {
+ //console.log("sparklinewidget : using stats embedded in the json");
+ var _results = stat_view.meta.stat.split(",");
+ } else {
+ var _annotations = this._serializer._data.annotations,
+ _sliceDuration = Math.floor( this.duration / this.slices),
+ _results = _(_.range(this.slices)).map(function(_i) {
+ return _(_annotations).filter(function(_a){
+ return (_a.begin <= (1 + _i) * _sliceDuration) && (_a.end >= _i * _sliceDuration)
+ }).length;
+ });
+ }
+ var _max = Math.max(1, _(_results).max()),
+ _h = this.height,
+ _scale = (_h - this.lineWidth) / _max,
+ _width = this.width / this.slices,
+ _y = _(_results).map(function(_v) {
+ return _h - (_scale * _v);
+ }),
+ _d = _(_y).reduce(function(_memo, _v, _k) {
+ return _memo + ( _k
+ ? 'C' + (_k * _width) + ' ' + _y[_k - 1] + ' ' + (_k * _width) + ' ' + _v + ' ' + ((_k + .5) * _width) + ' ' + _v
+ : 'M0 ' + _v + 'L' + (.5*_width) + ' ' + _v )
+ },'') + 'L' + this.width + ' ' + _y[_y.length - 1],
+ _d2 = _d + 'L' + this.width + ' ' + this.height + 'L0 ' + this.height;
+ this.paper.path(_d2).attr({
+ "stroke" : "none",
+ "fill" : this.fillColor
+ });
+
+ this.paper.path(_d).attr({
+ "fill" : "none",
+ "stroke" : this.lineColor,
+ "stroke-width" : this.lineWidth
+ });
+
+ this.rectangleProgress = this.paper.rect(0,0,0,this.height)
+ .attr({
+ "stroke" : "none",
+ "fill" : "#808080",
+ "opacity" : .3
+ });
+ this.ligneProgress = this.paper.path("M0 0L0 "+this.height).attr({"stroke":"#ff00ff", "line-width" : 2});
+ // save the results in an array so that we can re-use them when a new annotation
+ // is added.
+ this._results = _results;
+
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.timeUpdateHandler));
+// this._Popcorn.listen("IriSP.createAnnotationWidget.addedAnnotation", IriSP.wrap(this, this.handleNewAnnotation));
+
+ this.selector.click(IriSP.wrap(this, this.clickHandler));
+};
+
+/** react to a timeupdate event */
+IriSP.SparklineWidget.prototype.timeUpdateHandler = function() {
+ var _currentTime = this._Popcorn.currentTime(),
+ _x = (1000 * _currentTime / this.duration) * this.width;
+ this.rectangleProgress.attr({
+ "width" : _x
+ });
+ this.ligneProgress.attr({
+ "path" : "M" + _x + " 0L" + _x + " " + this.height
+ });
+
+}
+
+/** handle clicks on the widget */
+IriSP.SparklineWidget.prototype.clickHandler = function(event) {
+ var relX = event.pageX - this.selector.offset().left;
+ var newTime = ((relX / this.width) * this.duration/1000).toFixed(2);
+
+ this._Popcorn.trigger("IriSP.SparklineWidget.clicked", newTime);
+ this._Popcorn.currentTime(newTime);
+};
+
+/** react when a new annotation is added */
+IriSP.SparklineWidget.prototype.handleNewAnnotation = function(annotation) {
+// var num_columns = this._results.length;
+// var duration = this._serializer.getDuration();
+// var time_step = Math.round(duration / num_columns); /* the time interval between two columns */
+// var begin = +annotation.begin;
+// var end = +annotation.end;
+//
+// /* increment all the values between the beginning and the end of the annotation */
+// var index_begin = Math.floor(begin / time_step);
+// var index_end = Math.floor(end / time_step);
+//
+// for (var i = index_begin; i < Math.min(index_end, this._results.length); i++) {
+// this._results[i]++;
+// }
+//
+// this.selector.find(".Ldt-sparkLine").sparkline(this._results, {lineColor: "#7492b4", fillColor: "#aeaeb8",
+// spotColor: "#b70056",
+// width: this.width, height: this.height});
+};IriSP.StackGraphWidget = function(Popcorn, config, Serializer) {
+ IriSP.Widget.call(this, Popcorn, config, Serializer);
+}
+
+IriSP.StackGraphWidget.prototype = new IriSP.Widget();
+
+IriSP.StackGraphWidget.prototype.draw = function() {
+ var _ = IriSP._;
+ this.height = this._config.height || 50;
+ this.width = this.selector.width();
+ this.slices = this._config.slices || ~~(this.width/(this.streamgraph ? 20 : 5));
+ _(this.tags).each(function(_a) {
+ _a.regexp = new RegExp(_(_a.keywords).map(function(_k) {
+ return _k.replace(/([\W])/gm,'\\$1');
+ }).join("|"),"im")
+ });
+ this.paper = new Raphael(this.selector[0], this.width, this.height);
+ this.groups = [];
+ this.duration = this.getDuration();
+
+ var _annotationType = this._serializer.getTweets(),
+ _sliceDuration = ~~ ( this.duration / this.slices),
+ _annotations = this._serializer._data.annotations,
+ _groupedAnnotations = _(_.range(this.slices)).map(function(_i) {
+ return _(_annotations).filter(function(_a){
+ return (_a.begin <= (1 + _i) * _sliceDuration) && (_a.end >= _i * _sliceDuration)
+ });
+ }),
+ _max = IriSP._(_groupedAnnotations).max(function(_g) {
+ return _g.length
+ }).length,
+ _scale = this.height / _max,
+ _width = this.width / this.slices,
+ _showTitle = !this._config.excludeTitle,
+ _showDescription = !this._config.excludeDescription;
+
+
+ var _paths = _(this.tags).map(function() {
+ return [];
+ });
+ _paths.push([]);
+
+ for (var i = 0; i < this.slices; i++) {
+ var _group = _groupedAnnotations[i];
+ if (_group) {
+ var _vol = _(this.tags).map(function() {
+ return 0;
+ });
+ for (var j = 0; j < _group.length; j++){
+ var _txt = (_showTitle ? _group[j].content.title : '') + ' ' + (_showDescription ? _group[j].content.description : '')
+ var _tags = _(this.tags).map(function(_tag) {
+ return (_txt.search(_tag.regexp) == -1 ? 0 : 1)
+ }),
+ _nbtags = _(_tags).reduce(function(_a,_b) {
+ return _a + _b;
+ }, 0);
+ if (_nbtags) {
+ IriSP._(_tags).each(function(_v, _k) {
+ _vol[_k] += (_v / _nbtags);
+ });
+ }
+ }
+ var _nbtags = _(_vol).reduce(function(_a,_b) {
+ return _a + _b;
+ }, 0),
+ _nbneutre = _group.length - _nbtags,
+ _h = _nbneutre * _scale,
+ _base = this.height - _h;
+ if (!this.streamgraph) {
+ this.paper.rect(i * _width, _base, _width - 1, _h ).attr({
+ "stroke" : "none",
+ "fill" : this.defaultcolor
+ });
+ }
+ _paths[0].push(_base);
+ for (var j = 0; j < this.tags.length; j++) {
+ _h = _vol[j] * _scale;
+ _base = _base - _h;
+ if (!this.streamgraph) {
+ this.paper.rect(i * _width, _base, _width - 1, _h ).attr({
+ "stroke" : "none",
+ "fill" : this.tags[j].color
+ });
+ }
+ _paths[j+1].push(_base);
+ }
+ this.groups.push(_(_vol).map(function(_v) {
+ return _v / _group.length;
+ }))
+ } else {
+ for (var j = 0; j < _paths.length; j++) {
+ _paths[j].push(this.height);
+ }
+ this.groups.push(_(this.tags).map(function() {
+ return 0;
+ }));
+ }
+ }
+
+ if (this.streamgraph) {
+ for (var j = _paths.length - 1; j >= 0; j--) {
+ var _d = _(_paths[j]).reduce(function(_memo, _v, _k) {
+ return _memo + ( _k
+ ? 'C' + (_k * _width) + ' ' + _paths[j][_k - 1] + ' ' + (_k * _width) + ' ' + _v + ' ' + ((_k + .5) * _width) + ' ' + _v
+ : 'M0 ' + _v + 'L' + (.5*_width) + ' ' + _v )
+ },'') + 'L' + this.width + ' ' + _paths[j][_paths[j].length - 1] + 'L' + this.width + ' ' + this.height + 'L0 ' + this.height;
+ this.paper.path(_d).attr({
+ "stroke" : "none",
+ "fill" : (j ? this.tags[j-1].color : this.defaultcolor)
+ });
+ }
+ }
+ this.rectangleFocus = this.paper.rect(0,0,_width,this.height)
+ .attr({
+ "stroke" : "none",
+ "fill" : "#ff00ff",
+ "opacity" : 0
+ })
+ this.rectangleProgress = this.paper.rect(0,0,0,this.height)
+ .attr({
+ "stroke" : "none",
+ "fill" : "#808080",
+ "opacity" : .3
+ });
+ this.ligneProgress = this.paper.path("M0 0L0 "+this.height).attr({"stroke":"#ff00ff", "line-width" : 2})
+
+ this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.timeUpdateHandler));
+ var _this = this;
+ this.selector
+ .click(IriSP.wrap(this, this.clickHandler))
+ .mousemove(function(_e) {
+ _this.updateTooltip(_e);
+ // Trace
+ var relX = _e.pageX - _this.selector.offset().left;
+ var _duration = _this.getDuration();
+ var _time = parseInt((relX / _this.width) * _duration);
+ _this._Popcorn.trigger("IriSP.TraceWidget.MouseEvents", {
+ "widget" : "StackGraphWidget",
+ "type": "mousemove",
+ "x": _e.pageX,
+ "y": _e.pageY,
+ "time": _time
+ });
+
+ })
+ .mouseout(function() {
+ _this.TooltipWidget.hide();
+ _this.rectangleFocus.attr({
+ "opacity" : 0
+ })
+ })
+}
+
+IriSP.StackGraphWidget.prototype.timeUpdateHandler = function() {
+ var _currentTime = this._Popcorn.currentTime(),
+ _x = (1000 * _currentTime / this.duration) * this.width;
+ this.rectangleProgress.attr({
+ "width" : _x
+ });
+ this.ligneProgress.attr({
+ "path" : "M" + _x + " 0L" + _x + " " + this.height
+ })
+}
+
+IriSP.StackGraphWidget.prototype.clickHandler = function(event) {
+ /* Ctrl-C Ctrl-V'ed from another widget
+ */
+
+ var relX = event.pageX - this.selector.offset().left;
+ var newTime = ((relX / this.width) * this.duration/1000).toFixed(2);
+ this._Popcorn.trigger("IriSP.StackGraphWidget.clicked", newTime);
+ this._Popcorn.currentTime(newTime);
+};
+
+IriSP.StackGraphWidget.prototype.updateTooltip = function(event) {
+ var _segment = Math.max(0,Math.min(this.groups.length - 1, Math.floor(this.slices * (event.pageX - this.selector.offset().left)/this.width))),
+ _valeurs = this.groups[_segment],
+ _width = this.width / this.slices,
+ _html = '",
+ {src : img});
+
+ if (typeof(IriSP.get_aliased(annotation.meta, ["dc:source", "source"]).content) !== "undefined") {
+ var tweetContents = JSON.parse(IriSP.get_aliased(annotation.meta, ["dc:source", "source"]).content);
+ var creator = tweetContents.user.screen_name;
+ var real_name = tweetContents.user.name;
+
+ imageMarkup = IriSP.templToHTML("",
+ {src : img, creator: creator});
+
+ var formatted_date = new Date(tweetContents.created_at).toLocaleDateString();
+ title = IriSP.templToHTML("@{{creator}} - " +
+ "0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=
+false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
+;/*
+ * jQuery UI Position 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
+left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
+k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
+m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
+d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
+a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
+g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
+;/*
+ * jQuery UI Draggable 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
+"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
+this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options;this.helper=
+this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});
+this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);
+this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=
+d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",
+a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
+a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a=
+{left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&
+d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=
+this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions=
+{width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+
+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!="hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),
+10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-
+this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&
+d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.leftg[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1];h=g?!(h-this.offset.click.topg[3])?h:!(h-this.offset.click.topg[2])?e:!(e-this.offset.click.left<
+g[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:h-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");
+this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.13"});
+d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var h=d.data(this,"sortable");if(h&&!h.options.disabled){c.sortables.push({instance:h,shouldRevert:h.options.revert});h.refreshPositions();h._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=
+0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=
+c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,
+true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=
+0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=
+a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");
+if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e=j&&f<=l||h>=j&&h<=l||fl)&&(e>=
+i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f
').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
+top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
+this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
+nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d" : "" ) + annotation.content.description.replace(/(^.{120,140})[\s].+$/,'$1…'); + + var thumbUrl = annotation.meta.thumbnail || ''; + + var hexa_color = typeof(annotation.content.color) !== "undefined" + ? '#' + IriSP.DEC_HEXA_COLOR(annotation.content.color) + : typeof(annotation.color) !== "undefined" + ? '#' + IriSP.DEC_HEXA_COLOR(annotation.color) + : this.defaultColors[i % this.defaultColors.length]; + + /* + if (hexa_color === "FFCC00") + hexa_color = "333"; + */ + if (hexa_color.length == 5) + hexa_color = hexa_color + '00'; + + + var annotationTemplate = Mustache.to_html(IriSP.annotation_template, + {"divTitle" : divTitle, "id" : id, "startPixel" : startPixel, + "pxWidth" : pxWidth, "hexa_color" : hexa_color, + "seekPlace" : Math.round(begin/1000), "thumbnailUrl": thumbUrl}); + + + this.selector.append(annotationTemplate); + + /* add a special class to the last segment and change its border */ + if (annotation.id === lastSegment.id) { + IriSP.jqId(id).addClass("Ldt-lastSegment").css("border-color", hexa_color); + } + } + // react to mediafragment messages. + this._Popcorn.listen("IriSP.Mediafragment.showAnnotation", + function(id, divTitle) { + + var divObject = IriSP.jqId(id); + if (divObject.length) { + divObject.fadeTo(0,1); + var offset_x = divObject.position().left + divObject.outerWidth() / 2; + self.TooltipWidget.show(divObject.attr("title"), IriSP.jQuery(this).css("background-color"), offset_x, 0); + IriSP.jQuery(document).one("mousemove", function() { divObject.fadeTo(0,.5); + self.TooltipWidget.hide(); }); + } + }); + + this.selector.find(".Ldt-iri-chapter") + .fadeTo(0, .5) + .click(function() { + self._Popcorn.trigger("IriSP.SegmentsWidget.click", this.id); + self._Popcorn.currentTime(IriSP.jQuery(this).attr("data-seek")); + }) + .mouseover( function(event) { + var divObject = IriSP.jQuery(this); + divObject.fadeTo(0,1); + var offset_x = divObject.position().left + divObject.outerWidth() / 2; + var thumb = divObject.attr("thumbnail-url"); + var txt = divObject.attr("title") + (thumb && thumb.length ? '
- ' + IriSP._(this.tags).map(function(_tag, _i) {
+ return '
- ' + + ~~(100 * _valeurs[_i]) + + '% de ' + + _tag.description + + ' '; + }).join('') + '
- '
+ + IriSP._(_words)
+ .chain()
+ .shuffle()
+ .map(function(_word) {
+ var _size = 10 + _scale * Math.sqrt(_word.count - _min);
+ return '
- ' + + _word.word + + ' ' + }) + .value() + .join("") + + '
{{real_name}}
" +
+ "{{{ contents }}}
" +
+ "{{ date }}
",
+ {creator: creator, real_name: real_name, contents : title, date : formatted_date});
+
+ this.selector.find(".Ldt-TweetReply").attr("href", "http://twitter.com/home?status=@" + creator + ":%20");
+
+
+ var rtText = Mustache.to_html("http://twitter.com/home?status=RT @{{creator}}: {{text}}",
+ {creator: creator, text: IriSP.encodeURI(annotation.content.title)});
+ this.selector.find(".Ldt-Retweet").attr("href", rtText);
+ }
+
+ this.selector.find(".Ldt-tweetContents").html(title);
+ this.selector.find(".Ldt-tweetAvatar").html(imageMarkup);
+ this.selector.show("blind", 250);
+};
+
+IriSP.TweetsWidget.prototype.displayTweet = function(annotation) {
+ if (this._displayingTweet === false) {
+ this._displayingTweet = true;
+ } else {
+ window.clearTimeout(this._timeoutId);
+ }
+
+ this.drawTweet(annotation);
+
+ var time = this._Popcorn.currentTime();
+ this._timeoutId = window.setTimeout(IriSP.wrap(this, this.clearPanel), this.tweet_display_period);
+};
+
+
+IriSP.TweetsWidget.prototype.clearPanel = function() {
+ this._displayingTweet = false;
+ this._timeoutId = undefined;
+ this.closePanel();
+
+};
+
+IriSP.TweetsWidget.prototype.closePanel = function() {
+ if (this._timeoutId != undefined) {
+ /* we're called from the "close window" link */
+ /* cancel the timeout */
+ window.clearTimeout(this._timeoutId);
+ this._timeoutId = null;
+ }
+
+ this.selector.hide("blind", 400);
+
+};
+
+/* cancel the timeout if the user clicks on the keep panel open button */
+IriSP.TweetsWidget.prototype.keepPanel = function() {
+ if (this._timeoutId != undefined) {
+ /* we're called from the "close window" link */
+ /* cancel the timeout */
+ window.clearTimeout(this._timeoutId);
+ this._timeoutId = null;
+ }
+};
+
+IriSP.TweetsWidget.prototype.draw = function() {
+ var _this = this;
+
+ var tweetMarkup = IriSP.templToHTML(IriSP.tweetWidget_template, {"share_template" : IriSP.share_template});
+ this.selector.append(tweetMarkup);
+ this.selector.hide();
+ this.selector.find(".Ldt-tweetWidgetMinimize").click(IriSP.wrap(this, this.closePanel));
+ this.selector.find(".Ldt-tweetWidgetKeepOpen").click(IriSP.wrap(this, this.keepPanel));
+
+ this._Popcorn.listen("IriSP.PolemicTweet.click", IriSP.wrap(this, this.PolemicTweetClickHandler));
+ this._Popcorn.listen("IriSP.PlayerWidget.AnnotateButton.clicked",
+ IriSP.wrap(this, this.handleAnnotateSignal));
+};
+
+IriSP.TweetsWidget.prototype.PolemicTweetClickHandler = function(tweet_id) {
+ var index, annotation;
+ for (index in this._serializer._data.annotations) {
+ annotation = this._serializer._data.annotations[index];
+
+ if (annotation.id === tweet_id)
+ break;
+ }
+
+ if (annotation.id !== tweet_id)
+ /* we haven't found it */
+ return;
+
+ this.displayTweet(annotation);
+ return;
+};
+
+/** handle clicks on the annotate button by hiding/showing itself */
+IriSP.TweetsWidget.prototype.handleAnnotateSignal = function() {
+ if (this._hidden == false) {
+ this.selector.hide();
+ this._hidden = true;
+ } else {
+ if (this._displayingTweet !== false)
+ this.selector.show();
+
+
+ this._hidden = false;
+ }
+};/** @class This class implement a serializer for the JSON-Cinelab format
+ @params DataLoader a dataloader reference
+ @url the url from which to get our cinelab
+ */
+IriSP.JSONSerializer = function(DataLoader, url) {
+ IriSP.Serializer.call(this, DataLoader, url);
+};
+
+IriSP.JSONSerializer.prototype = new IriSP.Serializer();
+
+/** serialize data */
+IriSP.JSONSerializer.prototype.serialize = function(data) {
+ return JSON.stringify(data);
+};
+
+/** deserialize data */
+IriSP.JSONSerializer.prototype.deserialize = function(data) {
+ return JSON.parse(data);
+};
+
+/** load JSON-cinelab data and also sort the annotations by start time
+ @param callback function to call when the data is ready.
+ */
+IriSP.JSONSerializer.prototype.sync = function(callback, force_refresh) {
+ /* we don't have to do much because jQuery handles json for us */
+
+ var self = this;
+
+ var fn = function(data) {
+ //TODO: seems taht data can be null here
+ if (data !== null) {
+ self._data = data;
+ if (typeof(self._data["annotations"]) === "undefined" ||
+ self._data["annotations"] === null)
+ self._data["annotations"] = [];
+
+ // sort the data too
+ self._data["annotations"].sort(function(a, b)
+ { var a_begin = +a.begin;
+ var b_begin = +b.begin;
+ return a_begin - b_begin;
+ });
+ }
+ callback(data);
+ };
+ this._DataLoader.get(this._url, fn, force_refresh);
+};
+
+/** @return the metadata about the media being read FIXME: always return the first media. */
+IriSP.JSONSerializer.prototype.currentMedia = function() {
+ return (typeof this._data.medias == "object" && this._data.medias.length) ? this._data.medias[0] : IriSP.__jsonMetadata.medias[0];
+};
+
+IriSP.JSONSerializer.prototype.getDuration = function() {
+ var _m = this.currentMedia();
+ if (_m === null || typeof _m.meta == "undefined") {
+ return 0;
+ }
+ return +(IriSP.get_aliased(_m.meta, ["dc:duration", "duration"]) || 0);
+}
+
+
+/** searches for an annotation which matches title, description and keyword
+ "" matches any field.
+ Note: it ignores tweets.
+ @return a list of matching ids.
+*/
+IriSP.JSONSerializer.prototype.searchAnnotations = function(title, description, keyword) {
+ /* we can have many types of annotations. We want search to only look for regular segments */
+ /* the next two lines are a bit verbose because for some test data, _serializer.data.view is either
+ null or undefined.
+ */
+ var view;
+
+ if (typeof(this._data.views) !== "undefined" && this._data.views !== null)
+ view = this._data.views[0];
+
+ var searchViewType = "";
+
+ if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) {
+ searchViewType = view.annotation_types[0];
+ }
+
+ var filterfn = function(annotation) {
+ if( searchViewType != "" &&
+ typeof(annotation.meta) !== "undefined" &&
+ typeof(annotation.meta["id-ref"]) !== "undefined" &&
+ annotation.meta["id-ref"] !== searchViewType) {
+ return true; // don't pass
+ } else {
+ return false;
+ }
+ };
+
+ return this.searchAnnotationsFilter(title, description, keyword, filterfn);
+
+};
+
+/* only look for tweets */
+IriSP.JSONSerializer.prototype.searchTweets = function(title, description, keyword) {
+ /* we can have many types of annotations. We want search to only look for regular segments */
+ /* the next two lines are a bit verbose because for some test data, _serializer.data.view is either
+ null or undefined.
+ */
+
+ var searchViewType = this.getTweets();
+ if (typeof(searchViewType) === "undefined") {
+ var view;
+
+ if (typeof(this._data.views) !== "undefined" && this._data.views !== null)
+ view = this._data.views[0];
+
+ if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) {
+ searchViewType = view.annotation_types[0];
+ }
+ }
+ var filterfn = function(annotation) {
+ if( searchViewType != "" &&
+ typeof(annotation.meta) !== "undefined" &&
+ typeof(annotation.meta["id-ref"]) !== "undefined" &&
+ annotation.meta["id-ref"] === searchViewType) {
+ return false; // pass
+ } else {
+ return true;
+ }
+ };
+
+ return this.searchAnnotationsFilter(title, description, keyword, filterfn);
+
+};
+
+/**
+ search an annotation according to its title, description and keyword
+ @param filter a function to filter the results with. Used to select between annotation types.
+ */
+IriSP.JSONSerializer.prototype.searchAnnotationsFilter = function(title, description, keyword, filter) {
+
+ var rTitle;
+ var rDescription;
+ var rKeyword;
+ /* match anything if given the empty string */
+ if (title == "")
+ title = ".*";
+ if (description == "")
+ description = ".*";
+ if (keyword == "")
+ keyword = ".*";
+
+ rTitle = new RegExp(title, "i");
+ rDescription = new RegExp(description, "i");
+ rKeyword = new RegExp(keyword, "i");
+
+ var ret_array = [];
+
+ var i;
+ for (i in this._data.annotations) {
+ var annotation = this._data.annotations[i];
+
+ /* filter the annotations whose type is not the one we want */
+ if (filter(annotation)) {
+ continue;
+ }
+
+ if (rTitle.test(annotation.content.title) &&
+ rDescription.test(annotation.content.description)) {
+ /* FIXME : implement keyword support */
+ ret_array.push(annotation);
+ }
+ }
+
+ return ret_array;
+};
+
+/** breaks a string in words and searches each of these words. Returns an array
+ of objects with the id of the annotation and its number of occurences.
+
+ @param searchString a string of words.
+ FIXME: optimize ? seems to be n^2 in the worst case.
+*/
+IriSP.JSONSerializer.prototype.searchOccurences = function(searchString) {
+ var ret = { };
+ var keywords = searchString.split(/\s+/);
+
+ for (var i in keywords) {
+ var keyword = keywords[i];
+
+ // search this keyword in descriptions and title
+ var found_annotations = []
+ found_annotations = found_annotations.concat(this.searchAnnotations(keyword, "", ""));
+ found_annotations = found_annotations.concat(this.searchAnnotations("", keyword, ""));
+
+ for (var j in found_annotations) {
+ var current_annotation = found_annotations[j];
+
+ if (!ret.hasOwnProperty(current_annotation.id)) {
+ ret[current_annotation.id] = 1;
+ } else {
+ ret[current_annotation.id] += 1;
+ }
+
+ }
+
+ };
+
+ return ret;
+};
+
+/** breaks a string in words and searches each of these words. Returns an array
+ of objects with the id of the annotation and its number of occurences.
+
+ FIXME: optimize ? seems to be n^2 in the worst case.
+*/
+IriSP.JSONSerializer.prototype.searchTweetsOccurences = function(searchString) {
+ var ret = { };
+ var keywords = searchString.split(/\s+/);
+
+ for (var i in keywords) {
+ var keyword = keywords[i];
+
+ // search this keyword in descriptions and title
+ var found_annotations = []
+ found_annotations = found_annotations.concat(this.searchTweets(keyword, "", ""));
+ found_annotations = found_annotations.concat(this.searchTweets("", keyword, ""));
+
+ for (var j in found_annotations) {
+ var current_annotation = found_annotations[j];
+
+ if (!ret.hasOwnProperty(current_annotation.id)) {
+ ret[current_annotation.id] = 1;
+ } else {
+ ret[current_annotation.id] += 1;
+ }
+
+ }
+
+ };
+
+ return ret;
+};
+
+/** returns all the annotations that are displayable at the moment
+ NB: only takes account the first type of annotations - ignores tweets
+ currentTime is in seconds.
+
+ @param currentTime the time at which we search.
+ @param (optional) the if of the type of the annotations we want to get.
+ */
+
+IriSP.JSONSerializer.prototype.currentAnnotations = function(currentTime, id) {
+ var view;
+ var currentTimeMs = 1000 * currentTime;
+
+ if (typeof(id) === "undefined") {
+ var legal_ids = this.getNonTweetIds();
+ } else {
+ legal_ids = [id];
+ }
+
+ var ret_array = [];
+
+ var i;
+
+ for (i in this._data.annotations) {
+ var annotation = this._data.annotations[i];
+
+ if (IriSP.underscore.include(legal_ids, annotation.meta["id-ref"]) &&
+ annotation.begin <= currentTimeMs &&
+ annotation.end >= currentTimeMs)
+ ret_array.push(annotation);
+ }
+
+ if (ret_array == []) {
+ console.log("ret_array empty, ", legal_ids);
+ }
+
+ return ret_array;
+};
+
+/** return the current chapitre
+ @param currentTime the current time, in seconds.
+*/
+IriSP.JSONSerializer.prototype.currentChapitre = function(currentTime) {
+ return this.currentAnnotations(currentTime, this.getChapitrage())[0];
+};
+
+/** returns a list of ids of tweet lines (aka: groups in cinelab) */
+IriSP.JSONSerializer.prototype.getTweetIds = function() {
+ if (IriSP.null_or_undefined(this._data.lists) || IriSP.null_or_undefined(this._data.lists) ||
+ IriSP.null_or_undefined(this._data.views) || IriSP.null_or_undefined(this._data.views[0]))
+ return [];
+
+
+ /* Get the displayable types
+ We've got to jump through a few hoops because the json sometimes defines
+ fields with underscores and sometimes with dashes
+ */
+ var annotation_types = IriSP.get_aliased(this._data.views[0], ["annotation_types", "annotation-types"]);
+ if (annotation_types === null) {
+ console.log("neither view.annotation_types nor view.annotation-types are defined");
+ return;
+ }
+
+ var available_types = IriSP.get_aliased(this._data, ["annotation_types", "annotation-types"]);
+ if (available_types === null) {
+ console.log("neither view.annotation_types nor view.annotation-types are defined");
+ return;
+ }
+
+ var potential_types = [];
+
+ // Get the list of types which contain "Tw" in their content
+ for (var i = 0; i < available_types.length; i++) {
+ if (/Tw/i.test(IriSP.get_aliased(available_types[i], ['dc:title', 'title']))) {
+ potential_types.push(available_types[i].id);
+ }
+ }
+
+ // Get the intersection of both.
+ var tweetsId = IriSP.underscore.intersection(annotation_types, potential_types);
+
+ return tweetsId;
+};
+
+/** this function returns a list of lines which are not tweet lines */
+IriSP.JSONSerializer.prototype.getNonTweetIds = function() {
+ if (IriSP.null_or_undefined(this._data.lists) || IriSP.null_or_undefined(this._data.lists) ||
+ IriSP.null_or_undefined(this._data.views) || IriSP.null_or_undefined(this._data.views[0]))
+ return [];
+
+ /* Get the displayable types
+ We've got to jump through a few hoops because the json sometimes defines
+ fields with underscores and sometimes with dashes
+ */
+ var annotation_types = IriSP.get_aliased(this._data.views[0], ["annotation_types", "annotation-types"]);
+ if (annotation_types === null) {
+ console.log("neither view.annotation_types nor view.annotation-types are defined");
+ return;
+ }
+
+ var available_types = IriSP.get_aliased(this._data, ["annotation_types", "annotation-types"]);
+ if (available_types === null) {
+ console.log("neither view.annotation_types nor view.annotation-types are defined");
+ return;
+ }
+
+ var potential_types = [];
+
+ // Get the list of types which do not contain "Tw" in their content
+ for (var i = 0; i < available_types.length; i++) {
+ if (!(/Tw/i.test(IriSP.get_aliased(available_types[i], ['dc:title', 'title'])))) {
+ potential_types.push(available_types[i].id);
+ }
+ }
+
+ // Get the intersection of both.
+ var nonTweetsId = IriSP.underscore.intersection(annotation_types, potential_types);
+
+ return nonTweetsId;
+
+};
+
+/** return the id of the ligne de temps which contains name
+ @param name of the ligne de temps
+*/
+IriSP.JSONSerializer.prototype.getId = function(name) {
+ var available_types = IriSP.get_aliased(this._data, ["annotation_types", "annotation-types"]);
+
+ if (available_types == null)
+ return;
+
+ name = name.toUpperCase();
+ var e;
+ e = IriSP.underscore.find(available_types,
+ function(entry) {
+ if (IriSP.get_aliased(entry, ['dc:title', 'title']) === null)
+ return false;
+ return (entry["dc:title"].toUpperCase().indexOf(name) !== -1);
+ });
+
+ if (typeof(e) === "undefined")
+ return;
+
+ var id = e.id;
+
+ return id;
+};
+
+/** return the list of id's of the ligne de temps which contains name
+ @param name of the ligne de temps
+*/
+IriSP.JSONSerializer.prototype.getIds = function(name) {
+ var available_types = IriSP.get_aliased(this._data, ["annotation_types", "annotation-types"]);
+
+ if (available_types == null)
+ return;
+
+ name = name.toUpperCase();
+ var e = [];
+ e = IriSP.underscore.filter(available_types,
+ function(entry) { return (IriSP.get_aliased(entry, ['dc:title', 'title']).toUpperCase().indexOf(name) !== -1) });
+ return IriSP.underscore.pluck(e, "id");
+};
+
+/** return the id of the ligne de temps named "Chapitrage" */
+IriSP.JSONSerializer.prototype.getChapitrage = function() {
+ var val = this.getId("Chapitrage");
+ if (typeof(val) === "undefined")
+ val = this.getId("Chapter");
+ if (typeof(val) === "undefined")
+ val = this.getId("Chapit");
+ if (typeof(val) === "undefined")
+ val = this.getId("Chap");
+
+ return val;
+};
+
+/** return the id of the ligne de temps named "Tweets" */
+IriSP.JSONSerializer.prototype.getTweets = function() {
+ var val = this.getId("Tweets");
+ if (typeof(val) === "undefined")
+ val = this.getId("Tweet");
+ if (typeof(val) === "undefined")
+ val = this.getId("Twitter");
+ if (typeof(val) === "undefined")
+ val = this.getId("twit");
+ if (typeof(val) === "undefined")
+ val = this.getId("Polemic");
+
+ return val;
+};
+
+/** return the id of the ligne de temps named "Contributions" */
+IriSP.JSONSerializer.prototype.getContributions = function() {
+ var val = this.getId("Contribution");
+ if (typeof(val) === "undefined")
+ val = this.getId("Particip");
+ if (typeof(val) === "undefined")
+ val = this.getId("Contr");
+ if (typeof(val) === "undefined")
+ val = this.getId("Publ");
+
+ return val;
+};
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/images/ui-bg_flat_0_aaaaaa_40x100.png
Binary file test/integration/allocine_dossier_independant/js/libs/images/ui-bg_flat_0_aaaaaa_40x100.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/images/ui-bg_flat_75_ffffff_40x100.png
Binary file test/integration/allocine_dossier_independant/js/libs/images/ui-bg_flat_75_ffffff_40x100.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/images/ui-bg_glass_55_fbf9ee_1x400.png
Binary file test/integration/allocine_dossier_independant/js/libs/images/ui-bg_glass_55_fbf9ee_1x400.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/images/ui-bg_glass_65_ffffff_1x400.png
Binary file test/integration/allocine_dossier_independant/js/libs/images/ui-bg_glass_65_ffffff_1x400.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/images/ui-bg_glass_75_dadada_1x400.png
Binary file test/integration/allocine_dossier_independant/js/libs/images/ui-bg_glass_75_dadada_1x400.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/images/ui-bg_glass_75_e6e6e6_1x400.png
Binary file test/integration/allocine_dossier_independant/js/libs/images/ui-bg_glass_75_e6e6e6_1x400.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/images/ui-bg_glass_95_fef1ec_1x400.png
Binary file test/integration/allocine_dossier_independant/js/libs/images/ui-bg_glass_95_fef1ec_1x400.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/images/ui-bg_highlight-soft_75_cccccc_1x100.png
Binary file test/integration/allocine_dossier_independant/js/libs/images/ui-bg_highlight-soft_75_cccccc_1x100.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/images/ui-icons_222222_256x240.png
Binary file test/integration/allocine_dossier_independant/js/libs/images/ui-icons_222222_256x240.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/images/ui-icons_2e83ff_256x240.png
Binary file test/integration/allocine_dossier_independant/js/libs/images/ui-icons_2e83ff_256x240.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/images/ui-icons_454545_256x240.png
Binary file test/integration/allocine_dossier_independant/js/libs/images/ui-icons_454545_256x240.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/images/ui-icons_888888_256x240.png
Binary file test/integration/allocine_dossier_independant/js/libs/images/ui-icons_888888_256x240.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/images/ui-icons_cd0a0a_256x240.png
Binary file test/integration/allocine_dossier_independant/js/libs/images/ui-icons_cd0a0a_256x240.png has changed
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/jquery-ui.css
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/test/integration/allocine_dossier_independant/js/libs/jquery-ui.css Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,570 @@
+/*
+ * jQuery UI CSS Framework @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute; left: -99999999px; }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+/*
+ * jQuery UI Accordion @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Accordion#theming
+ */
+/* IE/Win - Fix animation bug - #4615 */
+.ui-accordion { width: 100%; }
+.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; }
+.ui-accordion .ui-accordion-li-fix { display: inline; }
+.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; }
+.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; }
+.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; }
+.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; }
+.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; }
+.ui-accordion .ui-accordion-content-active { display: block; }/*
+ * jQuery UI Autocomplete @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+ list-style:none;
+ padding: 2px;
+ margin: 0;
+ display:block;
+ float: left;
+}
+.ui-menu .ui-menu {
+ margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+ margin:0;
+ padding: 0;
+ zoom: 1;
+ float: left;
+ clear: left;
+ width: 100%;
+}
+.ui-menu .ui-menu-item a {
+ text-decoration:none;
+ display:block;
+ padding:.2em .4em;
+ line-height:1.5;
+ zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+ font-weight: normal;
+ margin: -1px;
+}
+/*
+ * jQuery UI Button @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Button#theming
+ */
+.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */
+.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */
+button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */
+.ui-button-icons-only { width: 3.4em; }
+button.ui-button-icons-only { width: 3.7em; }
+
+/*button text element */
+.ui-button .ui-button-text { display: block; line-height: 1.4; }
+.ui-button-text-only .ui-button-text { padding: .4em 1em; }
+.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; }
+.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; }
+.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; }
+.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; }
+/* no icon support for input elements, provide padding by default */
+input.ui-button { padding: .4em 1em; }
+
+/*button icon element(s) */
+.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; }
+.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; }
+.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; }
+.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; }
+
+/*button sets*/
+.ui-buttonset { margin-right: 7px; }
+.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; }
+
+/* workarounds */
+button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */
+/*
+ * jQuery UI Datepicker @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Datepicker#theming
+ */
+.ui-datepicker { width: 17em; padding: .2em .2em 0; }
+.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; }
+.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; }
+.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; }
+.ui-datepicker .ui-datepicker-prev { left:2px; }
+.ui-datepicker .ui-datepicker-next { right:2px; }
+.ui-datepicker .ui-datepicker-prev-hover { left:1px; }
+.ui-datepicker .ui-datepicker-next-hover { right:1px; }
+.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; }
+.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; }
+.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; }
+.ui-datepicker select.ui-datepicker-month-year {width: 100%;}
+.ui-datepicker select.ui-datepicker-month,
+.ui-datepicker select.ui-datepicker-year { width: 49%;}
+.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; }
+.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; }
+.ui-datepicker td { border: 0; padding: 1px; }
+.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; }
+.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; }
+.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
+.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; }
+
+/* with multiple calendars */
+.ui-datepicker.ui-datepicker-multi { width:auto; }
+.ui-datepicker-multi .ui-datepicker-group { float:left; }
+.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; }
+.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; }
+.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; }
+.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; }
+.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; }
+.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; }
+.ui-datepicker-row-break { clear:both; width:100%; }
+
+/* RTL support */
+.ui-datepicker-rtl { direction: rtl; }
+.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; }
+.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; }
+.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group { float:right; }
+.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; }
+
+/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */
+.ui-datepicker-cover {
+ display: none; /*sorry for IE5*/
+ display/**/: block; /*sorry for IE5*/
+ position: absolute; /*must have*/
+ z-index: -1; /*must have*/
+ filter: mask(); /*must have*/
+ top: -4px; /*must have*/
+ left: -4px; /*must have*/
+ width: 200px; /*must have*/
+ height: 200px; /*must have*/
+}/*
+ * jQuery UI Dialog @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog#theming
+ */
+.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; }
+.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; }
+.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; }
+.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; }
+.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; }
+.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; }
+.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; }
+.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; }
+.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; }
+.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; }
+.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; }
+.ui-draggable .ui-dialog-titlebar { cursor: move; }
+/*
+ * jQuery UI Progressbar @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Progressbar#theming
+ */
+.ui-progressbar { height:2em; text-align: left; }
+.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/*
+ * jQuery UI Resizable @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Resizable#theming
+ */
+.ui-resizable { position: relative;}
+.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;}
+.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; }
+.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; }
+.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; }
+.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; }
+.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; }
+.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; }
+.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; }
+.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; }
+.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/*
+ * jQuery UI Selectable @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Selectable#theming
+ */
+.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; }
+/*
+ * jQuery UI Slider @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Slider#theming
+ */
+.ui-slider { position: relative; text-align: left; }
+.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; }
+.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; }
+
+.ui-slider-horizontal { height: .8em; }
+.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; }
+.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; }
+.ui-slider-horizontal .ui-slider-range-min { left: 0; }
+.ui-slider-horizontal .ui-slider-range-max { right: 0; }
+
+.ui-slider-vertical { width: .8em; height: 100px; }
+.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; }
+.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; }
+.ui-slider-vertical .ui-slider-range-min { bottom: 0; }
+.ui-slider-vertical .ui-slider-range-max { top: 0; }/*
+ * jQuery UI Tabs @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Tabs#theming
+ */
+.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */
+.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; }
+.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; }
+.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; }
+.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; }
+.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */
+.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; }
+.ui-tabs .ui-tabs-hide { display: none !important; }
+/*
+ * jQuery UI CSS Framework @VERSION
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; }
+.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; }
+.ui-widget-content a { color: #222222/*{fcContent}*/; }
+.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; }
+.ui-widget-header a { color: #222222/*{fcHeader}*/; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-top { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-right { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-left { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; }
+.ui-corner-all { -moz-border-radius: 4px/*{cornerRadius}*/; -webkit-border-radius: 4px/*{cornerRadius}*/; border-radius: 4px/*{cornerRadius}*/; }
+
+/* Overlays */
+.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; }
+.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; }
\ No newline at end of file
diff -r 7b55777486c3 -r 75ba66457232 test/integration/allocine_dossier_independant/js/libs/jquery-ui.min.js
--- /dev/null Thu Jan 01 00:00:00 1970 +0000
+++ b/test/integration/allocine_dossier_independant/js/libs/jquery-ui.min.js Fri Apr 06 16:55:34 2012 +0200
@@ -0,0 +1,784 @@
+/*!
+ * jQuery UI 1.8.13
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.13",
+keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();
+b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,
+"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",
+function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,
+outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a,"tabindex"),d=isNaN(b);
+return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=
+0;e'+(c?h:"")+(this._isInRange(a,r)?'":"")+(c?"":h)+"
":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),A=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),C=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x'+(/all|left/.test(t)&&x==0?c?
+f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,A,v)+'
| '+this._get(a,"weekHeader")+" | ":"";for(t=0;t<7;t++){var q=(t+h)%7;D+="'+this._get(a,"calculateWeek")(q)+" | ";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[q]):[true,""],F=q.getMonth()!=g,L=F&&!K||!I[0]||k&&q"+(F&&!C?" ":L?''+q.getDate()+ +"":''+q.getDate()+"")+" | ";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}y+=R+""}g++;if(g>11){g=0;m++}y+="
|---|
',o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?
+r:s};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=
+(h||!(j&&l)?" ":"")+o;k+="
";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,
+"max");b=c&&b"+"
| t |
","
"]),f.fn.extend({text:function(a){if(f.isFunction(a))return this.each(function(b){var c=f(this);c.text(a.call(this,b,c.text()))});if(typeof a!="object"&&a!==b)return this.empty().append((this[0]&&this[0].ownerDocument||c).createTextNode(a));return f.text(this)},wrapAll:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapAll(a.call(this,b))});if(this[0]){var b=f(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&a.firstChild.nodeType===1)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){if(f.isFunction(a))return this.each(function(b){f(this).wrapInner(a.call(this,b))});return this.each(function(){var b=f(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=f.isFunction(a);return this.each(function(c){f(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){f.nodeName(this,"body")||f(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.appendChild(a)})},prepend:function(){return this.domManip(arguments,!0,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this)});if(arguments.length){var a=f.clean(arguments);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,!1,function(a){this.parentNode.insertBefore(a,this.nextSibling)});if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,f.clean(arguments));return a}},remove:function(a,b){for(var c=0,d;(d=this[c])!=null;c++)if(!a||f.filter(a,[d]).length)!b&&d.nodeType===1&&(f.cleanData(d.getElementsByTagName("*")),f.cleanData([d])),d.parentNode&&d.parentNode.removeChild(d);return this},empty:function()
+{for(var a=0,b;(b=this[a])!=null;a++){b.nodeType===1&&f.cleanData(b.getElementsByTagName("*"));while(b.firstChild)b.removeChild(b.firstChild)}return this},clone:function(a,b){a=a==null?!1:a,b=b==null?a:b;return this.map(function(){return f.clone(this,a,b)})},html:function(a){if(a===b)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(W,""):null;if(typeof a=="string"&&!ba.test(a)&&(f.support.leadingWhitespace||!X.test(a))&&!bg[(Z.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Y,"<$1>");try{for(var c=0,d=this.length;c