# HG changeset patch # User hamidouk # Date 1323954135 -3600 # Node ID d4dc097a6083d3bd30479535f0345fd713a05e07 first import. diff -r 000000000000 -r d4dc097a6083 crea/imgs/background.png Binary file crea/imgs/background.png has changed diff -r 000000000000 -r d4dc097a6083 crea/imgs/banner.png Binary file crea/imgs/banner.png has changed diff -r 000000000000 -r d4dc097a6083 crea/imgs/bgd-degrade.png Binary file crea/imgs/bgd-degrade.png has changed diff -r 000000000000 -r d4dc097a6083 crea/imgs/bgd-top.png Binary file crea/imgs/bgd-top.png has changed diff -r 000000000000 -r d4dc097a6083 crea/imgs/cinecast.png Binary file crea/imgs/cinecast.png has changed diff -r 000000000000 -r d4dc097a6083 crea/imgs/close.png Binary file crea/imgs/close.png has changed diff -r 000000000000 -r d4dc097a6083 crea/imgs/iri.png Binary file crea/imgs/iri.png has changed diff -r 000000000000 -r d4dc097a6083 crea/imgs/partners.png Binary file crea/imgs/partners.png has changed diff -r 000000000000 -r d4dc097a6083 crea/imgs/technos.gif Binary file crea/imgs/technos.gif has changed diff -r 000000000000 -r d4dc097a6083 crea/imgs/technos.png Binary file crea/imgs/technos.png has changed diff -r 000000000000 -r d4dc097a6083 crea/imgs/top-bgd.gif Binary file crea/imgs/top-bgd.gif has changed diff -r 000000000000 -r d4dc097a6083 crea/psd/bandeau.psd Binary file crea/psd/bandeau.psd has changed diff -r 000000000000 -r d4dc097a6083 crea/psd/banner.PSD Binary file crea/psd/banner.PSD has changed diff -r 000000000000 -r d4dc097a6083 crea/psd/cinecast.psd Binary file crea/psd/cinecast.psd has changed diff -r 000000000000 -r d4dc097a6083 crea/psd/iri.psd Binary file crea/psd/iri.psd has changed diff -r 000000000000 -r d4dc097a6083 crea/psd/technos.psd Binary file crea/psd/technos.psd has changed diff -r 000000000000 -r d4dc097a6083 web/LdtPlayer-release.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/web/LdtPlayer-release.js Thu Dec 15 14:02:15 2011 +0100 @@ -0,0 +1,11115 @@ +/* + * + * Copyright 2010 Institut de recherche et d'innovation + * contributor(s) : Samuel Huron + * + * contact@iri.centrepompidou.fr + * http://www.iri.centrepompidou.fr + * + * This software is a computer program whose purpose is to show and add annotations on a video . + * This software is governed by the CeCILL-C license under French law and + * abiding by the rules of distribution of free software. You can use, + * modify and/ or redistribute the software under the terms of the CeCILL-C + * license as circulated by CEA, CNRS and INRIA at the following URL + * "http://www.cecill.info". + * + * The fact that you are presently reading this means that you have had + * knowledge of the CeCILL-C license and that you accept its terms. +*/ +(function(global, document) { + + // Popcorn.js does not support archaic browsers + if ( !document.addEventListener ) { + global.Popcorn = { + isSupported: false + }; + + var methods = ( "forEach extend effects error guid sizeOf isArray nop position disable enable destroy " + + "addTrackEvent removeTrackEvent getTrackEvents getTrackEvent getLastTrackEventId " + + "timeUpdate plugin removePlugin compose effect parser xhr getJSONP getScript" ).split(/\s+/); + + while ( methods.length ) { + global.Popcorn[ methods.shift() ] = function() {}; + } + return; + } + + var + + AP = Array.prototype, + OP = Object.prototype, + + forEach = AP.forEach, + slice = AP.slice, + hasOwn = OP.hasOwnProperty, + toString = OP.toString, + + // Copy global Popcorn (may not exist) + _Popcorn = global.Popcorn, + + // ID string matching + rIdExp = /^(#([\w\-\_\.]+))$/, + + // Ready fn cache + readyStack = [], + readyBound = false, + readyFired = false, + + // Non-public internal data object + internal = { + events: { + hash: {}, + apis: {} + } + }, + + // Non-public `requestAnimFrame` + // http://paulirish.com/2011/requestanimationframe-for-smart-animating/ + requestAnimFrame = (function(){ + return global.requestAnimationFrame || + global.webkitRequestAnimationFrame || + global.mozRequestAnimationFrame || + global.oRequestAnimationFrame || + global.msRequestAnimationFrame || + function( callback, element ) { + global.setTimeout( callback, 16 ); + }; + }()), + + refresh = function( obj ) { + var currentTime = obj.media.currentTime, + animation = obj.options.frameAnimation, + disabled = obj.data.disabled, + tracks = obj.data.trackEvents, + animating = tracks.animating, + start = tracks.startIndex, + registryByName = Popcorn.registryByName, + animIndex = 0, + byStart, natives, type; + + start = Math.min( start + 1, tracks.byStart.length - 2 ); + + while ( start > 0 && tracks.byStart[ start ] ) { + + byStart = tracks.byStart[ start ]; + natives = byStart._natives; + type = natives && natives.type; + + if ( !natives || + ( !!registryByName[ type ] || !!obj[ type ] ) ) { + + if ( ( byStart.start <= currentTime && byStart.end > currentTime ) && + disabled.indexOf( type ) === -1 ) { + + if ( !byStart._running ) { + byStart._running = true; + natives.start.call( obj, null, byStart ); + + // if the 'frameAnimation' option is used, + // push the current byStart object into the `animating` cue + if ( animation && + ( byStart && byStart._running && byStart.natives.frame ) ) { + + natives.frame.call( obj, null, byStart, currentTime ); + } + } + } else if ( byStart._running === true ) { + + byStart._running = false; + natives.end.call( obj, null, byStart ); + + if ( animation && byStart._natives.frame ) { + animIndex = animating.indexOf( byStart ); + if ( animIndex >= 0 ) { + animating.splice( animIndex, 1 ); + } + } + } + } + + start--; + } + }, + + // Declare constructor + // Returns an instance object. + Popcorn = function( entity, options ) { + // Return new Popcorn object + return new Popcorn.p.init( entity, options || null ); + }; + + // Popcorn API version, automatically inserted via build system. + Popcorn.version = "@VERSION"; + + // Boolean flag allowing a client to determine if Popcorn can be supported + Popcorn.isSupported = true; + + // Instance caching + Popcorn.instances = []; + + // Declare a shortcut (Popcorn.p) to and a definition of + // the new prototype for our Popcorn constructor + Popcorn.p = Popcorn.prototype = { + + init: function( entity, options ) { + + var matches; + + // Supports Popcorn(function () { /../ }) + // Originally proposed by Daniel Brooks + + if ( typeof entity === "function" ) { + + // If document ready has already fired + if ( document.readyState === "interactive" || document.readyState === "complete" ) { + + entity( document, Popcorn ); + + return; + } + // Add `entity` fn to ready stack + readyStack.push( entity ); + + // This process should happen once per page load + if ( !readyBound ) { + + // set readyBound flag + readyBound = true; + + var DOMContentLoaded = function() { + + readyFired = true; + + // Remove global DOM ready listener + document.removeEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + + // Execute all ready function in the stack + for ( var i = 0, readyStackLength = readyStack.length; i < readyStackLength; i++ ) { + + readyStack[ i ].call( document, Popcorn ); + + } + // GC readyStack + readyStack = null; + }; + + // Register global DOM ready listener + document.addEventListener( "DOMContentLoaded", DOMContentLoaded, false ); + } + + return; + } + + // Check if entity is a valid string id + matches = rIdExp.exec( entity ); + + // Get media element by id or object reference + this.media = matches && matches.length && matches[ 2 ] ? + document.getElementById( matches[ 2 ] ) : + entity; + + // Create an audio or video element property reference + this[ ( this.media.nodeName && this.media.nodeName.toLowerCase() ) || "video" ] = this.media; + + // Register new instance + Popcorn.instances.push( this ); + + this.options = options || {}; + + this.isDestroyed = false; + + this.data = { + + // Executed by either timeupdate event or in rAF loop + timeUpdate: Popcorn.nop, + + // Allows disabling a plugin per instance + disabled: [], + + // Stores DOM event queues by type + events: {}, + + // Stores Special event hooks data + hooks: {}, + + // Store track event history data + history: [], + + // Stores ad-hoc state related data] + state: { + volume: this.media.volume + }, + + // Store track event object references by trackId + trackRefs: {}, + + // Playback track event queues + trackEvents: { + byStart: [{ + + start: -1, + end: -1 + }], + byEnd: [{ + start: -1, + end: -1 + }], + animating: [], + startIndex: 0, + endIndex: 0, + previousUpdateTime: -1 + } + }; + + // Wrap true ready check + var isReady = function( that ) { + + var duration, videoDurationPlus; + + if ( that.media.readyState >= 2 ) { + // Adding padding to the front and end of the arrays + // this is so we do not fall off either end + + duration = that.media.duration; + // Check for no duration info (NaN) + videoDurationPlus = duration != duration ? Number.MAX_VALUE : duration + 1; + + Popcorn.addTrackEvent( that, { + start: videoDurationPlus, + end: videoDurationPlus + }); + + if ( that.options.frameAnimation ) { + // if Popcorn is created with frameAnimation option set to true, + // requestAnimFrame is used instead of "timeupdate" media event. + // This is for greater frame time accuracy, theoretically up to + // 60 frames per second as opposed to ~4 ( ~every 15-250ms) + that.data.timeUpdate = function () { + + Popcorn.timeUpdate( that, {} ); + + that.trigger( "timeupdate" ); + + !that.isDestroyed && requestAnimFrame( that.data.timeUpdate ); + }; + + !that.isDestroyed && requestAnimFrame( that.data.timeUpdate ); + + } else { + + that.data.timeUpdate = function( event ) { + Popcorn.timeUpdate( that, event ); + }; + + if ( !that.isDestroyed ) { + that.media.addEventListener( "timeupdate", that.data.timeUpdate, false ); + } + } + } else { + global.setTimeout(function() { + isReady( that ); + }, 1 ); + } + }; + + isReady( this ); + + return this; + } + }; + + // Extend constructor prototype to instance prototype + // Allows chaining methods to instances + Popcorn.p.init.prototype = Popcorn.p; + + Popcorn.forEach = function( obj, fn, context ) { + + if ( !obj || !fn ) { + return {}; + } + + context = context || this; + + var key, len; + + // Use native whenever possible + if ( forEach && obj.forEach === forEach ) { + return obj.forEach( fn, context ); + } + + if ( toString.call( obj ) === "[object NodeList]" ) { + for ( key = 0, len = obj.length; key < len; key++ ) { + fn.call( context, obj[ key ], key, obj ); + } + return obj; + } + + for ( key in obj ) { + if ( hasOwn.call( obj, key ) ) { + fn.call( context, obj[ key ], key, obj ); + } + } + return obj; + }; + + Popcorn.extend = function( obj ) { + var dest = obj, src = slice.call( arguments, 1 ); + + Popcorn.forEach( src, function( copy ) { + for ( var prop in copy ) { + dest[ prop ] = copy[ prop ]; + } + }); + + return dest; + }; + + + // A Few reusable utils, memoized onto Popcorn + Popcorn.extend( Popcorn, { + noConflict: function( deep ) { + + if ( deep ) { + global.Popcorn = _Popcorn; + } + + return Popcorn; + }, + error: function( msg ) { + throw new Error( msg ); + }, + guid: function( prefix ) { + Popcorn.guid.counter++; + return ( prefix ? prefix : "" ) + ( +new Date() + Popcorn.guid.counter ); + }, + sizeOf: function( obj ) { + var size = 0; + + for ( var prop in obj ) { + size++; + } + + return size; + }, + isArray: Array.isArray || function( array ) { + return toString.call( array ) === "[object Array]"; + }, + + nop: function() {}, + + position: function( elem ) { + + var clientRect = elem.getBoundingClientRect(), + bounds = {}, + doc = elem.ownerDocument, + docElem = document.documentElement, + body = document.body, + clientTop, clientLeft, scrollTop, scrollLeft, top, left; + + // Determine correct clientTop/Left + clientTop = docElem.clientTop || body.clientTop || 0; + clientLeft = docElem.clientLeft || body.clientLeft || 0; + + // Determine correct scrollTop/Left + scrollTop = ( global.pageYOffset && docElem.scrollTop || body.scrollTop ); + scrollLeft = ( global.pageXOffset && docElem.scrollLeft || body.scrollLeft ); + + // Temp top/left + top = Math.ceil( clientRect.top + scrollTop - clientTop ); + left = Math.ceil( clientRect.left + scrollLeft - clientLeft ); + + for ( var p in clientRect ) { + bounds[ p ] = Math.round( clientRect[ p ] ); + } + + return Popcorn.extend({}, bounds, { top: top, left: left }); + }, + + disable: function( instance, plugin ) { + + var disabled = instance.data.disabled; + + if ( disabled.indexOf( plugin ) === -1 ) { + disabled.push( plugin ); + } + + refresh( instance ); + + return instance; + }, + enable: function( instance, plugin ) { + + var disabled = instance.data.disabled, + index = disabled.indexOf( plugin ); + + if ( index > -1 ) { + disabled.splice( index, 1 ); + } + + refresh( instance ); + + return instance; + }, + destroy: function( instance ) { + var events = instance.data.events, + singleEvent, item, fn; + + // Iterate through all events and remove them + for ( item in events ) { + singleEvent = events[ item ]; + for ( fn in singleEvent ) { + delete singleEvent[ fn ]; + } + events[ item ] = null; + } + + if ( !instance.isDestroyed ) { + instance.data.timeUpdate && instance.media.removeEventListener( "timeupdate", instance.data.timeUpdate, false ); + instance.isDestroyed = true; + } + } + }); + + // Memoized GUID Counter + Popcorn.guid.counter = 1; + + // Factory to implement getters, setters and controllers + // as Popcorn instance methods. The IIFE will create and return + // an object with defined methods + Popcorn.extend(Popcorn.p, (function() { + + var methods = "load play pause currentTime playbackRate volume duration preload playbackRate " + + "autoplay loop controls muted buffered readyState seeking paused played seekable ended", + ret = {}; + + + // Build methods, store in object that is returned and passed to extend + Popcorn.forEach( methods.split( /\s+/g ), function( name ) { + + ret[ name ] = function( arg ) { + + if ( typeof this.media[ name ] === "function" ) { + + // Support for shorthanded play(n)/pause(n) jump to currentTime + // If arg is not null or undefined and called by one of the + // allowed shorthandable methods, then set the currentTime + // Supports time as seconds or SMPTE + if ( arg != null && /play|pause/.test( name ) ) { + this.media.currentTime = Popcorn.util.toSeconds( arg ); + } + + this.media[ name ](); + + return this; + } + + + if ( arg != null ) { + + this.media[ name ] = arg; + + return this; + } + + return this.media[ name ]; + }; + }); + + return ret; + + })() + ); + + Popcorn.forEach( "enable disable".split(" "), function( method ) { + Popcorn.p[ method ] = function( plugin ) { + return Popcorn[ method ]( this, plugin ); + }; + }); + + Popcorn.extend(Popcorn.p, { + + // Rounded currentTime + roundTime: function() { + return -~this.media.currentTime; + }, + + // Attach an event to a single point in time + exec: function( time, fn ) { + + // Creating a one second track event with an empty end + Popcorn.addTrackEvent( this, { + start: time, + end: time + 1, + _running: false, + _natives: { + start: fn || Popcorn.nop, + end: Popcorn.nop, + type: "exec" + } + }); + + return this; + }, + + // Mute the calling media, optionally toggle + mute: function( toggle ) { + + var event = toggle == null || toggle === true ? "muted" : "unmuted"; + + // If `toggle` is explicitly `false`, + // unmute the media and restore the volume level + if ( event === "unmuted" ) { + this.media.muted = false; + this.media.volume = this.data.state.volume; + } + + // If `toggle` is either null or undefined, + // save the current volume and mute the media element + if ( event === "muted" ) { + this.data.state.volume = this.media.volume; + this.media.muted = true; + } + + // Trigger either muted|unmuted event + this.trigger( event ); + + return this; + }, + + // Convenience method, unmute the calling media + unmute: function( toggle ) { + + return this.mute( toggle == null ? false : !toggle ); + }, + + // Get the client bounding box of an instance element + position: function() { + return Popcorn.position( this.media ); + }, + + // Toggle a plugin's playback behaviour (on or off) per instance + toggle: function( plugin ) { + return Popcorn[ this.data.disabled.indexOf( plugin ) > -1 ? "enable" : "disable" ]( this, plugin ); + }, + + // Set default values for plugin options objects per instance + defaults: function( plugin, defaults ) { + + // If an array of default configurations is provided, + // iterate and apply each to this instance + if ( Popcorn.isArray( plugin ) ) { + + Popcorn.forEach( plugin, function( obj ) { + for ( var name in obj ) { + this.defaults( name, obj[ name ] ); + } + }, this ); + + return this; + } + + if ( !this.options.defaults ) { + this.options.defaults = {}; + } + + if ( !this.options.defaults[ plugin ] ) { + this.options.defaults[ plugin ] = {}; + } + + Popcorn.extend( this.options.defaults[ plugin ], defaults ); + + return this; + } + }); + + Popcorn.Events = { + UIEvents: "blur focus focusin focusout load resize scroll unload", + MouseEvents: "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave click dblclick", + Events: "loadstart progress suspend emptied stalled play pause " + + "loadedmetadata loadeddata waiting playing canplay canplaythrough " + + "seeking seeked timeupdate ended ratechange durationchange volumechange" + }; + + Popcorn.Events.Natives = Popcorn.Events.UIEvents + " " + + Popcorn.Events.MouseEvents + " " + + Popcorn.Events.Events; + + internal.events.apiTypes = [ "UIEvents", "MouseEvents", "Events" ]; + + // Privately compile events table at load time + (function( events, data ) { + + var apis = internal.events.apiTypes, + eventsList = events.Natives.split( /\s+/g ), + idx = 0, len = eventsList.length, prop; + + for( ; idx < len; idx++ ) { + data.hash[ eventsList[idx] ] = true; + } + + apis.forEach(function( val, idx ) { + + data.apis[ val ] = {}; + + var apiEvents = events[ val ].split( /\s+/g ), + len = apiEvents.length, + k = 0; + + for ( ; k < len; k++ ) { + data.apis[ val ][ apiEvents[ k ] ] = true; + } + }); + })( Popcorn.Events, internal.events ); + + Popcorn.events = { + + isNative: function( type ) { + return !!internal.events.hash[ type ]; + }, + getInterface: function( type ) { + + if ( !Popcorn.events.isNative( type ) ) { + return false; + } + + var eventApi = internal.events, + apis = eventApi.apiTypes, + apihash = eventApi.apis, + idx = 0, len = apis.length, api, tmp; + + for ( ; idx < len; idx++ ) { + tmp = apis[ idx ]; + + if ( apihash[ tmp ][ type ] ) { + api = tmp; + break; + } + } + return api; + }, + // Compile all native events to single array + all: Popcorn.Events.Natives.split( /\s+/g ), + // Defines all Event handling static functions + fn: { + trigger: function( type, data ) { + + var eventInterface, evt; + // setup checks for custom event system + if ( this.data.events[ type ] && Popcorn.sizeOf( this.data.events[ type ] ) ) { + + eventInterface = Popcorn.events.getInterface( type ); + + if ( eventInterface ) { + + evt = document.createEvent( eventInterface ); + evt.initEvent( type, true, true, global, 1 ); + + this.media.dispatchEvent( evt ); + + return this; + } + + // Custom events + Popcorn.forEach( this.data.events[ type ], function( obj, key ) { + + obj.call( this, data ); + + }, this ); + + } + + return this; + }, + listen: function( type, fn ) { + + var self = this, + hasEvents = true, + eventHook = Popcorn.events.hooks[ type ], + origType = type, + tmp; + + if ( !this.data.events[ type ] ) { + this.data.events[ type ] = {}; + hasEvents = false; + } + + // Check and setup event hooks + if ( eventHook ) { + + // Execute hook add method if defined + if ( eventHook.add ) { + eventHook.add.call( this, {}, fn ); + } + + // Reassign event type to our piggyback event type if defined + if ( eventHook.bind ) { + type = eventHook.bind; + } + + // Reassign handler if defined + if ( eventHook.handler ) { + tmp = fn; + + fn = function wrapper( event ) { + eventHook.handler.call( self, event, tmp ); + }; + } + + // assume the piggy back event is registered + hasEvents = true; + + // Setup event registry entry + if ( !this.data.events[ type ] ) { + this.data.events[ type ] = {}; + // Toggle if the previous assumption was untrue + hasEvents = false; + } + } + + // Register event and handler + this.data.events[ type ][ fn.name || ( fn.toString() + Popcorn.guid() ) ] = fn; + + // only attach one event of any type + if ( !hasEvents && Popcorn.events.all.indexOf( type ) > -1 ) { + + this.media.addEventListener( type, function( event ) { + + Popcorn.forEach( self.data.events[ type ], function( obj, key ) { + if ( typeof obj === "function" ) { + obj.call( self, event ); + } + }); + + }, false); + } + return this; + }, + unlisten: function( type, fn ) { + + if ( this.data.events[ type ] && this.data.events[ type ][ fn ] ) { + + delete this.data.events[ type ][ fn ]; + + return this; + } + + this.data.events[ type ] = null; + + return this; + } + }, + hooks: { + canplayall: { + bind: "canplaythrough", + add: function( event, callback ) { + + var state = false; + + if ( this.media.readyState ) { + + callback.call( this, event ); + + state = true; + } + + this.data.hooks.canplayall = { + fired: state + }; + }, + // declare special handling instructions + handler: function canplayall( event, callback ) { + + if ( !this.data.hooks.canplayall.fired ) { + // trigger original user callback once + callback.call( this, event ); + + this.data.hooks.canplayall.fired = true; + } + } + } + } + }; + + // Extend Popcorn.events.fns (listen, unlisten, trigger) to all Popcorn instances + Popcorn.forEach( [ "trigger", "listen", "unlisten" ], function( key ) { + Popcorn.p[ key ] = Popcorn.events.fn[ key ]; + }); + + // Internal Only - Adds track events to the instance object + Popcorn.addTrackEvent = function( obj, track ) { + + // Determine if this track has default options set for it + // If so, apply them to the track object + if ( track && track._natives && track._natives.type && + ( obj.options.defaults && obj.options.defaults[ track._natives.type ] ) ) { + + track = Popcorn.extend( {}, obj.options.defaults[ track._natives.type ], track ); + } + + if ( track._natives ) { + // Supports user defined track event id + track._id = !track.id ? Popcorn.guid( track._natives.type ) : track.id; + + // Push track event ids into the history + obj.data.history.push( track._id ); + } + + track.start = Popcorn.util.toSeconds( track.start, obj.options.framerate ); + track.end = Popcorn.util.toSeconds( track.end, obj.options.framerate ); + + // Store this definition in an array sorted by times + var byStart = obj.data.trackEvents.byStart, + byEnd = obj.data.trackEvents.byEnd, + startIndex, endIndex, + currentTime; + + for ( startIndex = byStart.length - 1; startIndex >= 0; startIndex-- ) { + + if ( track.start >= byStart[ startIndex ].start ) { + byStart.splice( startIndex + 1, 0, track ); + break; + } + } + + for ( endIndex = byEnd.length - 1; endIndex >= 0; endIndex-- ) { + + if ( track.end > byEnd[ endIndex ].end ) { + byEnd.splice( endIndex + 1, 0, track ); + break; + } + } + + // Display track event immediately if it's enabled and current + if ( track._natives && + ( !!Popcorn.registryByName[ track._natives.type ] || !!obj[ track._natives.type ] ) ) { + + currentTime = obj.media.currentTime; + if ( track.end > currentTime && + track.start <= currentTime && + obj.data.disabled.indexOf( track._natives.type ) === -1 ) { + + track._running = true; + track._natives.start.call( obj, null, track ); + + if ( obj.options.frameAnimation && + track._natives.frame ) { + + obj.data.trackEvents.animating.push( track ); + track._natives.frame.call( obj, null, track, currentTime ); + } + } + } + + // update startIndex and endIndex + if ( startIndex <= obj.data.trackEvents.startIndex && + track.start <= obj.data.trackEvents.previousUpdateTime ) { + + obj.data.trackEvents.startIndex++; + } + + if ( endIndex <= obj.data.trackEvents.endIndex && + track.end < obj.data.trackEvents.previousUpdateTime ) { + + obj.data.trackEvents.endIndex++; + } + + this.timeUpdate( obj, null, true ); + + // Store references to user added trackevents in ref table + if ( track._id ) { + Popcorn.addTrackEvent.ref( obj, track ); + } + }; + + // Internal Only - Adds track event references to the instance object's trackRefs hash table + Popcorn.addTrackEvent.ref = function( obj, track ) { + obj.data.trackRefs[ track._id ] = track; + + return obj; + }; + + Popcorn.removeTrackEvent = function( obj, trackId ) { + + var historyLen = obj.data.history.length, + indexWasAt = 0, + byStart = [], + byEnd = [], + animating = [], + history = []; + + Popcorn.forEach( obj.data.trackEvents.byStart, function( o, i, context ) { + // Preserve the original start/end trackEvents + if ( !o._id ) { + byStart.push( obj.data.trackEvents.byStart[i] ); + byEnd.push( obj.data.trackEvents.byEnd[i] ); + } + + // Filter for user track events (vs system track events) + if ( o._id ) { + + // Filter for the trackevent to remove + if ( o._id !== trackId ) { + byStart.push( obj.data.trackEvents.byStart[i] ); + byEnd.push( obj.data.trackEvents.byEnd[i] ); + } + + // Capture the position of the track being removed. + if ( o._id === trackId ) { + indexWasAt = i; + o._natives._teardown && o._natives._teardown.call( obj, o ); + } + } + + }); + + if ( obj.data.trackEvents.animating.length ) { + Popcorn.forEach( obj.data.trackEvents.animating, function( o, i, context ) { + // Preserve the original start/end trackEvents + if ( !o._id ) { + animating.push( obj.data.trackEvents.animating[i] ); + } + + // Filter for user track events (vs system track events) + if ( o._id ) { + // Filter for the trackevent to remove + if ( o._id !== trackId ) { + animating.push( obj.data.trackEvents.animating[i] ); + } + } + }); + } + + // Update + if ( indexWasAt <= obj.data.trackEvents.startIndex ) { + obj.data.trackEvents.startIndex--; + } + + if ( indexWasAt <= obj.data.trackEvents.endIndex ) { + obj.data.trackEvents.endIndex--; + } + + obj.data.trackEvents.byStart = byStart; + obj.data.trackEvents.byEnd = byEnd; + obj.data.trackEvents.animating = animating; + + for ( var i = 0; i < historyLen; i++ ) { + if ( obj.data.history[ i ] !== trackId ) { + history.push( obj.data.history[ i ] ); + } + } + + // Update ordered history array + obj.data.history = history; + + // Update track event references + Popcorn.removeTrackEvent.ref( obj, trackId ); + }; + + // Internal Only - Removes track event references from instance object's trackRefs hash table + Popcorn.removeTrackEvent.ref = function( obj, trackId ) { + delete obj.data.trackRefs[ trackId ]; + + return obj; + }; + + // Return an array of track events bound to this instance object + Popcorn.getTrackEvents = function( obj ) { + + var trackevents = [], + refs = obj.data.trackEvents.byStart, + length = refs.length, + idx = 0, + ref; + + for ( ; idx < length; idx++ ) { + ref = refs[ idx ]; + // Return only user attributed track event references + if ( ref._id ) { + trackevents.push( ref ); + } + } + + return trackevents; + }; + + // Internal Only - Returns an instance object's trackRefs hash table + Popcorn.getTrackEvents.ref = function( obj ) { + return obj.data.trackRefs; + }; + + // Return a single track event bound to this instance object + Popcorn.getTrackEvent = function( obj, trackId ) { + return obj.data.trackRefs[ trackId ]; + }; + + // Internal Only - Returns an instance object's track reference by track id + Popcorn.getTrackEvent.ref = function( obj, trackId ) { + return obj.data.trackRefs[ trackId ]; + }; + + Popcorn.getLastTrackEventId = function( obj ) { + return obj.data.history[ obj.data.history.length - 1 ]; + }; + + Popcorn.timeUpdate = function( obj, event ) { + + var currentTime = obj.media.currentTime, + previousTime = obj.data.trackEvents.previousUpdateTime, + tracks = obj.data.trackEvents, + animating = tracks.animating, + end = tracks.endIndex, + start = tracks.startIndex, + animIndex = 0, + + registryByName = Popcorn.registryByName, + + byEnd, byStart, byAnimate, natives, type; + + // Playbar advancing + if ( previousTime <= currentTime ) { + + while ( tracks.byEnd[ end ] && tracks.byEnd[ end ].end <= currentTime ) { + + byEnd = tracks.byEnd[ end ]; + natives = byEnd._natives; + type = natives && natives.type; + + // If plugin does not exist on this instance, remove it + if ( !natives || + ( !!registryByName[ type ] || + !!obj[ type ] ) ) { + + if ( byEnd._running === true ) { + byEnd._running = false; + natives.end.call( obj, event, byEnd ); + } + + end++; + } else { + // remove track event + Popcorn.removeTrackEvent( obj, byEnd._id ); + return; + } + } + + while ( tracks.byStart[ start ] && tracks.byStart[ start ].start <= currentTime ) { + + byStart = tracks.byStart[ start ]; + natives = byStart._natives; + type = natives && natives.type; + + // If plugin does not exist on this instance, remove it + if ( !natives || + ( !!registryByName[ type ] || + !!obj[ type ] ) ) { + + if ( byStart.end > currentTime && + byStart._running === false && + obj.data.disabled.indexOf( type ) === -1 ) { + + byStart._running = true; + natives.start.call( obj, event, byStart ); + + // If the `frameAnimation` option is used, + // push the current byStart object into the `animating` cue + if ( obj.options.frameAnimation && + ( byStart && byStart._running && byStart._natives.frame ) ) { + + animating.push( byStart ); + } + } + start++; + } else { + // remove track event + Popcorn.removeTrackEvent( obj, byStart._id ); + return; + } + } + + // If the `frameAnimation` option is used, iterate the animating track + // and execute the `frame` callback + if ( obj.options.frameAnimation ) { + while ( animIndex < animating.length ) { + + byAnimate = animating[ animIndex ]; + + if ( !byAnimate._running ) { + animating.splice( animIndex, 1 ); + } else { + byAnimate._natives.frame.call( obj, event, byAnimate, currentTime ); + animIndex++; + } + } + } + + // Playbar receding + } else if ( previousTime > currentTime ) { + + while ( tracks.byStart[ start ] && tracks.byStart[ start ].start > currentTime ) { + + byStart = tracks.byStart[ start ]; + natives = byStart._natives; + type = natives && natives.type; + + // if plugin does not exist on this instance, remove it + if ( !natives || + ( !!registryByName[ type ] || + !!obj[ type ] ) ) { + + if ( byStart._running === true ) { + byStart._running = false; + natives.end.call( obj, event, byStart ); + } + start--; + } else { + // remove track event + Popcorn.removeTrackEvent( obj, byStart._id ); + return; + } + } + + while ( tracks.byEnd[ end ] && tracks.byEnd[ end ].end > currentTime ) { + + byEnd = tracks.byEnd[ end ]; + natives = byEnd._natives; + type = natives && natives.type; + + // if plugin does not exist on this instance, remove it + if ( !natives || + ( !!registryByName[ type ] || + !!obj[ type ] ) ) { + + if ( byEnd.start <= currentTime && + byEnd._running === false && + obj.data.disabled.indexOf( type ) === -1 ) { + + byEnd._running = true; + natives.start.call( obj, event, byEnd ); + + // If the `frameAnimation` option is used, + // push the current byEnd object into the `animating` cue + if ( obj.options.frameAnimation && + ( byEnd && byEnd._running && byEnd._natives.frame ) ) { + + animating.push( byEnd ); + } + } + end--; + } else { + // remove track event + Popcorn.removeTrackEvent( obj, byEnd._id ); + return; + } + } + + // If the `frameAnimation` option is used, iterate the animating track + // and execute the `frame` callback + if ( obj.options.frameAnimation ) { + while ( animIndex < animating.length ) { + + byAnimate = animating[ animIndex ]; + + if ( !byAnimate._running ) { + animating.splice( animIndex, 1 ); + } else { + byAnimate._natives.frame.call( obj, event, byAnimate, currentTime ); + animIndex++; + } + } + } + // time bar is not moving ( video is paused ) + } + + tracks.endIndex = end; + tracks.startIndex = start; + tracks.previousUpdateTime = currentTime; + }; + + // Map and Extend TrackEvent functions to all Popcorn instances + Popcorn.extend( Popcorn.p, { + + getTrackEvents: function() { + return Popcorn.getTrackEvents.call( null, this ); + }, + + getTrackEvent: function( id ) { + return Popcorn.getTrackEvent.call( null, this, id ); + }, + + getLastTrackEventId: function() { + return Popcorn.getLastTrackEventId.call( null, this ); + }, + + removeTrackEvent: function( id ) { + + Popcorn.removeTrackEvent.call( null, this, id ); + return this; + }, + + removePlugin: function( name ) { + Popcorn.removePlugin.call( null, this, name ); + return this; + }, + + timeUpdate: function( event ) { + Popcorn.timeUpdate.call( null, this, event ); + return this; + }, + + destroy: function() { + Popcorn.destroy.call( null, this ); + return this; + } + }); + + // Plugin manifests + Popcorn.manifest = {}; + // Plugins are registered + Popcorn.registry = []; + Popcorn.registryByName = {}; + // An interface for extending Popcorn + // with plugin functionality + Popcorn.plugin = function( name, definition, manifest ) { + + if ( Popcorn.protect.natives.indexOf( name.toLowerCase() ) >= 0 ) { + Popcorn.error( "'" + name + "' is a protected function name" ); + return; + } + + // Provides some sugar, but ultimately extends + // the definition into Popcorn.p + var reserved = [ "start", "end" ], + plugin = {}, + setup, + isfn = typeof definition === "function", + methods = [ "_setup", "_teardown", "start", "end", "frame" ]; + + // combines calls of two function calls into one + var combineFn = function( first, second ) { + + first = first || Popcorn.nop; + second = second || Popcorn.nop; + + return function() { + first.apply( this, arguments ); + second.apply( this, arguments ); + }; + }; + + // If `manifest` arg is undefined, check for manifest within the `definition` object + // If no `definition.manifest`, an empty object is a sufficient fallback + Popcorn.manifest[ name ] = manifest = manifest || definition.manifest || {}; + + // apply safe, and empty default functions + methods.forEach(function( method ) { + definition[ method ] = safeTry( definition[ method ] || Popcorn.nop, name ); + }); + + var pluginFn = function( setup, options ) { + + if ( !options ) { + return this; + } + + // Storing the plugin natives + var natives = options._natives = {}, + compose = "", + defaults, originalOpts, manifestOpts, mergedSetupOpts; + + Popcorn.extend( natives, setup ); + + options._natives.type = name; + options._running = false; + + natives.start = natives.start || natives[ "in" ]; + natives.end = natives.end || natives[ "out" ]; + + // extend teardown to always call end if running + natives._teardown = combineFn(function() { + + var args = slice.call( arguments ); + + // end function signature is not the same as teardown, + // put null on the front of arguments for the event parameter + args.unshift( null ); + + // only call end if event is running + args[ 1 ]._running && natives.end.apply( this, args ); + }, natives._teardown ); + + // Check for previously set default options + defaults = this.options.defaults && this.options.defaults[ options._natives && options._natives.type ]; + + // default to an empty string if no effect exists + // split string into an array of effects + options.compose = options.compose && options.compose.split( " " ) || []; + options.effect = options.effect && options.effect.split( " " ) || []; + + // join the two arrays together + options.compose = options.compose.concat( options.effect ); + + options.compose.forEach(function( composeOption ) { + + // if the requested compose is garbage, throw it away + compose = Popcorn.compositions[ composeOption ] || {}; + + // extends previous functions with compose function + methods.forEach(function( method ) { + natives[ method ] = combineFn( natives[ method ], compose[ method ] ); + }); + }); + + // Ensure a manifest object, an empty object is a sufficient fallback + options._natives.manifest = manifest; + + // Checks for expected properties + if ( !( "start" in options ) ) { + options.start = options[ "in" ] || 0; + } + + if ( !( "end" in options ) ) { + options.end = options[ "out" ] || this.duration() || Number.MAX_VALUE; + } + + // Merge with defaults if they exist, make sure per call is prioritized + mergedSetupOpts = defaults ? Popcorn.extend( {}, defaults, options ) : + options; + + // Resolves 239, 241, 242 + if ( !mergedSetupOpts.target ) { + + // Sometimes the manifest may be missing entirely + // or it has an options object that doesn't have a `target` property + manifestOpts = "options" in manifest && manifest.options; + + mergedSetupOpts.target = manifestOpts && "target" in manifestOpts && manifestOpts.target; + } + + // Trigger _setup method if exists + options._natives._setup && options._natives._setup.call( this, mergedSetupOpts ); + + // Create new track event for this instance + Popcorn.addTrackEvent( this, Popcorn.extend( mergedSetupOpts, options ) ); + + // Future support for plugin event definitions + // for all of the native events + Popcorn.forEach( setup, function( callback, type ) { + + if ( type !== "type" ) { + + if ( reserved.indexOf( type ) === -1 ) { + + this.listen( type, callback ); + } + } + + }, this ); + + return this; + }; + + // Assign new named definition + plugin[ name ] = function( options ) { + return pluginFn.call( this, isfn ? definition.call( this, options ) : definition, + options ); + }; + + // Extend Popcorn.p with new named definition + Popcorn.extend( Popcorn.p, plugin ); + + // Push into the registry + var entry = { + fn: plugin[ name ], + definition: definition, + base: definition, + parents: [], + name: name + }; + Popcorn.registry.push( + Popcorn.extend( plugin, entry, { + type: name + }) + ); + Popcorn.registryByName[ name ] = entry; + + return plugin; + }; + + // Storage for plugin function errors + Popcorn.plugin.errors = []; + + // Returns wrapped plugin function + function safeTry( fn, pluginName ) { + return function() { + + // When Popcorn.plugin.debug is true, do not suppress errors + if ( Popcorn.plugin.debug ) { + return fn.apply( this, arguments ); + } + + try { + return fn.apply( this, arguments ); + } catch ( ex ) { + + // Push plugin function errors into logging queue + Popcorn.plugin.errors.push({ + plugin: pluginName, + thrown: ex, + source: fn.toString() + }); + + // Trigger an error that the instance can listen for + // and react to + this.trigger( "error", Popcorn.plugin.errors ); + } + }; + } + + // Debug-mode flag for plugin development + Popcorn.plugin.debug = false; + + // removePlugin( type ) removes all tracks of that from all instances of popcorn + // removePlugin( obj, type ) removes all tracks of type from obj, where obj is a single instance of popcorn + Popcorn.removePlugin = function( obj, name ) { + + // Check if we are removing plugin from an instance or from all of Popcorn + if ( !name ) { + + // Fix the order + name = obj; + obj = Popcorn.p; + + if ( Popcorn.protect.natives.indexOf( name.toLowerCase() ) >= 0 ) { + Popcorn.error( "'" + name + "' is a protected function name" ); + return; + } + + var registryLen = Popcorn.registry.length, + registryIdx; + + // remove plugin reference from registry + for ( registryIdx = 0; registryIdx < registryLen; registryIdx++ ) { + if ( Popcorn.registry[ registryIdx ].name === name ) { + Popcorn.registry.splice( registryIdx, 1 ); + delete Popcorn.registryByName[ name ]; + delete Popcorn.manifest[ name ]; + + // delete the plugin + delete obj[ name ]; + + // plugin found and removed, stop checking, we are done + return; + } + } + + } + + var byStart = obj.data.trackEvents.byStart, + byEnd = obj.data.trackEvents.byEnd, + animating = obj.data.trackEvents.animating, + idx, sl; + + // remove all trackEvents + for ( idx = 0, sl = byStart.length; idx < sl; idx++ ) { + + if ( ( byStart[ idx ] && byStart[ idx ]._natives && byStart[ idx ]._natives.type === name ) && + ( byEnd[ idx ] && byEnd[ idx ]._natives && byEnd[ idx ]._natives.type === name ) ) { + + byStart[ idx ]._natives._teardown && byStart[ idx ]._natives._teardown.call( obj, byStart[ idx ] ); + + byStart.splice( idx, 1 ); + byEnd.splice( idx, 1 ); + + // update for loop if something removed, but keep checking + idx--; sl--; + if ( obj.data.trackEvents.startIndex <= idx ) { + obj.data.trackEvents.startIndex--; + obj.data.trackEvents.endIndex--; + } + } + } + + //remove all animating events + for ( idx = 0, sl = animating.length; idx < sl; idx++ ) { + + if ( animating[ idx ] && animating[ idx ]._natives && animating[ idx ]._natives.type === name ) { + + animating.splice( idx, 1 ); + + // update for loop if something removed, but keep checking + idx--; sl--; + } + } + + }; + + Popcorn.compositions = {}; + + // Plugin inheritance + Popcorn.compose = function( name, definition, manifest ) { + + // If `manifest` arg is undefined, check for manifest within the `definition` object + // If no `definition.manifest`, an empty object is a sufficient fallback + Popcorn.manifest[ name ] = manifest = manifest || definition.manifest || {}; + + // register the effect by name + Popcorn.compositions[ name ] = definition; + }; + + Popcorn.plugin.effect = Popcorn.effect = Popcorn.compose; + + // stores parsers keyed on filetype + Popcorn.parsers = {}; + + // An interface for extending Popcorn + // with parser functionality + Popcorn.parser = function( name, type, definition ) { + + if ( Popcorn.protect.natives.indexOf( name.toLowerCase() ) >= 0 ) { + Popcorn.error( "'" + name + "' is a protected function name" ); + return; + } + + // fixes parameters for overloaded function call + if ( typeof type === "function" && !definition ) { + definition = type; + type = ""; + } + + if ( typeof definition !== "function" || typeof type !== "string" ) { + return; + } + + // Provides some sugar, but ultimately extends + // the definition into Popcorn.p + + var natives = Popcorn.events.all, + parseFn, + parser = {}; + + parseFn = function( filename, callback ) { + + if ( !filename ) { + return this; + } + + var that = this; + + Popcorn.xhr({ + url: filename, + dataType: type, + success: function( data ) { + + var tracksObject = definition( data ), + tracksData, + tracksDataLen, + tracksDef, + idx = 0; + + tracksData = tracksObject.data || []; + tracksDataLen = tracksData.length; + tracksDef = null; + + // If no tracks to process, return immediately + if ( !tracksDataLen ) { + return; + } + + // Create tracks out of parsed object + for ( ; idx < tracksDataLen; idx++ ) { + + tracksDef = tracksData[ idx ]; + + for ( var key in tracksDef ) { + + if ( hasOwn.call( tracksDef, key ) && !!that[ key ] ) { + + that[ key ]( tracksDef[ key ] ); + } + } + } + if ( callback ) { + callback(); + } + } + }); + + return this; + }; + + // Assign new named definition + parser[ name ] = parseFn; + + // Extend Popcorn.p with new named definition + Popcorn.extend( Popcorn.p, parser ); + + // keys the function name by filetype extension + //Popcorn.parsers[ name ] = true; + + return parser; + }; + + Popcorn.player = function( name, player ) { + + player = player || {}; + + var playerFn = function( target, src, options ) { + + options = options || {}; + + // List of events + var date = new Date() / 1000, + baselineTime = date, + currentTime = 0, + volume = 1, + muted = false, + events = {}, + + // The container div of the resource + container = document.getElementById( rIdExp.exec( target ) && rIdExp.exec( target )[ 2 ] ) || + document.getElementById( target ) || + target, + basePlayer = {}, + timeout, + popcorn; + + // copies a div into the media object + for( var val in container ) { + + if ( typeof container[ val ] === "object" ) { + + basePlayer[ val ] = container[ val ]; + } else if ( typeof container[ val ] === "function" ) { + + basePlayer[ val ] = (function( value ) { + + // this is a stupid ugly kludgy hack in honour of Safari + // in Safari a NodeList is a function, not an object + if ( "length" in container[ value ] && !container[ value ].call ) { + + return container[ value ]; + } else { + + return function() { + + return container[ value ].apply( container, arguments ); + }; + } + }( val )); + } else { + + Popcorn.player.defineProperty( basePlayer, val, { + get: (function( value ) { + + return function() { + + return container[ value ]; + }; + }( val )), + set: Popcorn.nop, + configurable: true + }); + } + } + + var timeupdate = function() { + + date = new Date() / 1000; + + if ( !basePlayer.paused ) { + + basePlayer.currentTime = basePlayer.currentTime + ( date - baselineTime ); + basePlayer.dispatchEvent( "timeupdate" ); + timeout = setTimeout( timeupdate, 10 ); + } + + baselineTime = date; + }; + + basePlayer.play = function() { + + this.paused = false; + + if ( basePlayer.readyState >= 4 ) { + + baselineTime = new Date() / 1000; + basePlayer.dispatchEvent( "play" ); + timeupdate(); + } + }; + + basePlayer.pause = function() { + + this.paused = true; + basePlayer.dispatchEvent( "pause" ); + }; + + Popcorn.player.defineProperty( basePlayer, "currentTime", { + get: function() { + + return currentTime; + }, + set: function( val ) { + + // make sure val is a number + currentTime = +val; + basePlayer.dispatchEvent( "timeupdate" ); + return currentTime; + }, + configurable: true + }); + + Popcorn.player.defineProperty( basePlayer, "volume", { + get: function() { + + return volume; + }, + set: function( val ) { + + // make sure val is a number + volume = +val; + basePlayer.dispatchEvent( "volumechange" ); + return volume; + }, + configurable: true + }); + + Popcorn.player.defineProperty( basePlayer, "muted", { + get: function() { + + return muted; + }, + set: function( val ) { + + // make sure val is a number + muted = +val; + basePlayer.dispatchEvent( "volumechange" ); + return muted; + }, + configurable: true + }); + + // Adds an event listener to the object + basePlayer.addEventListener = function( evtName, fn ) { + + if ( !events[ evtName ] ) { + + events[ evtName ] = []; + } + + events[ evtName ].push( fn ); + return fn; + }; + + // Can take event object or simple string + basePlayer.dispatchEvent = function( oEvent ) { + + var evt, + self = this, + eventInterface, + eventName = oEvent.type; + + // A string was passed, create event object + if ( !eventName ) { + + eventName = oEvent; + eventInterface = Popcorn.events.getInterface( eventName ); + + if ( eventInterface ) { + + evt = document.createEvent( eventInterface ); + evt.initEvent( eventName, true, true, window, 1 ); + } + } + + Popcorn.forEach( events[ eventName ], function( val ) { + + val.call( self, evt, self ); + }); + }; + + // Attempt to get src from playerFn parameter + basePlayer.src = src || ""; + basePlayer.readyState = 0; + basePlayer.duration = 0; + basePlayer.paused = true; + basePlayer.ended = 0; + + if ( player._setup ) { + + player._setup.call( basePlayer, options ); + } else { + + // there is no setup, which means there is nothing to load + basePlayer.readyState = 4; + basePlayer.dispatchEvent( "load" ); + basePlayer.dispatchEvent( "loadeddata" ); + } + + // when a custom player is loaded, load basePlayer state into custom player + basePlayer.addEventListener( "load", function() { + + // if a player is not ready before currentTime is called, this will set it after it is ready + basePlayer.currentTime = currentTime; + + // same as above with volume and muted + basePlayer.volume = volume; + basePlayer.muted = muted; + }); + + basePlayer.addEventListener( "loadeddata", function() { + + // if play was called before player ready, start playing video + !basePlayer.paused && basePlayer.play(); + }); + + popcorn = new Popcorn.p.init( basePlayer, options ); + + return popcorn; + }; + + Popcorn[ name ] = Popcorn[ name ] || playerFn; + }; + + Popcorn.player.defineProperty = Object.defineProperty || function( object, description, options ) { + + object.__defineGetter__( description, options.get || Popcorn.nop ); + object.__defineSetter__( description, options.set || Popcorn.nop ); + }; + + // Cache references to reused RegExps + var rparams = /\?/, + // XHR Setup object + setup = { + url: "", + data: "", + dataType: "", + success: Popcorn.nop, + type: "GET", + async: true, + xhr: function() { + return new global.XMLHttpRequest(); + } + }; + + Popcorn.xhr = function( options ) { + + options.dataType = options.dataType && options.dataType.toLowerCase() || null; + + if ( options.dataType && + ( options.dataType === "jsonp" || options.dataType === "script" ) ) { + + Popcorn.xhr.getJSONP( + options.url, + options.success, + options.dataType === "script" + ); + return; + } + + var settings = Popcorn.extend( {}, setup, options ); + + // Create new XMLHttpRequest object + settings.ajax = settings.xhr(); + + if ( settings.ajax ) { + + if ( settings.type === "GET" && settings.data ) { + + // append query string + settings.url += ( rparams.test( settings.url ) ? "&" : "?" ) + settings.data; + + // Garbage collect and reset settings.data + settings.data = null; + } + + + settings.ajax.open( settings.type, settings.url, settings.async ); + settings.ajax.send( settings.data || null ); + + return Popcorn.xhr.httpData( settings ); + } + }; + + + Popcorn.xhr.httpData = function( settings ) { + + var data, json = null, + parser, xml = null; + + settings.ajax.onreadystatechange = function() { + + if ( settings.ajax.readyState === 4 ) { + + try { + json = JSON.parse( settings.ajax.responseText ); + } catch( e ) { + //suppress + } + + data = { + xml: settings.ajax.responseXML, + text: settings.ajax.responseText, + json: json + }; + + // Normalize: data.xml is non-null in IE9 regardless of if response is valid xml + if ( !data.xml || !data.xml.documentElement ) { + data.xml = null; + + try { + parser = new DOMParser(); + xml = parser.parseFromString( settings.ajax.responseText, "text/xml" ); + + if ( !xml.getElementsByTagName( "parsererror" ).length ) { + data.xml = xml; + } + } catch ( e ) { + // data.xml remains null + } + } + + // If a dataType was specified, return that type of data + if ( settings.dataType ) { + data = data[ settings.dataType ]; + } + + + settings.success.call( settings.ajax, data ); + + } + }; + return data; + }; + + Popcorn.xhr.getJSONP = function( url, success, isScript ) { + + var head = document.head || document.getElementsByTagName( "head" )[ 0 ] || document.documentElement, + script = document.createElement( "script" ), + paramStr = url.split( "?" )[ 1 ], + isFired = false, + params = [], + callback, parts, callparam; + + if ( paramStr && !isScript ) { + params = paramStr.split( "&" ); + } + + if ( params.length ) { + parts = params[ params.length - 1 ].split( "=" ); + } + + callback = params.length ? ( parts[ 1 ] ? parts[ 1 ] : parts[ 0 ] ) : "jsonp"; + + if ( !paramStr && !isScript ) { + url += "?callback=" + callback; + } + + if ( callback && !isScript ) { + + // If a callback name already exists + if ( !!window[ callback ] ) { + // Create a new unique callback name + callback = Popcorn.guid( callback ); + } + + // Define the JSONP success callback globally + window[ callback ] = function( data ) { + // Fire success callbacks + success && success( data ); + isFired = true; + }; + + // Replace callback param and callback name + url = url.replace( parts.join( "=" ), parts[ 0 ] + "=" + callback ); + } + + script.onload = function() { + + // Handling remote script loading callbacks + if ( isScript ) { + // getScript + success && success(); + } + + // Executing for JSONP requests + if ( isFired ) { + // Garbage collect the callback + delete window[ callback ]; + } + // Garbage collect the script resource + head.removeChild( script ); + }; + + script.src = url; + + head.insertBefore( script, head.firstChild ); + + return; + }; + + Popcorn.getJSONP = Popcorn.xhr.getJSONP; + + Popcorn.getScript = Popcorn.xhr.getScript = function( url, success ) { + + return Popcorn.xhr.getJSONP( url, success, true ); + }; + + Popcorn.util = { + // Simple function to parse a timestamp into seconds + // Acceptable formats are: + // HH:MM:SS.MMM + // HH:MM:SS;FF + // Hours and minutes are optional. They default to 0 + toSeconds: function( timeStr, framerate ) { + // Hours and minutes are optional + // Seconds must be specified + // Seconds can be followed by milliseconds OR by the frame information + var validTimeFormat = /^([0-9]+:){0,2}[0-9]+([.;][0-9]+)?$/, + errorMessage = "Invalid time format", + digitPairs, lastIndex, lastPair, firstPair, + frameInfo, frameTime; + + if ( typeof timeStr === "number" ) { + return timeStr; + } + + if ( typeof timeStr === "string" && + !validTimeFormat.test( timeStr ) ) { + Popcorn.error( errorMessage ); + } + + digitPairs = timeStr.split( ":" ); + lastIndex = digitPairs.length - 1; + lastPair = digitPairs[ lastIndex ]; + + // Fix last element: + if ( lastPair.indexOf( ";" ) > -1 ) { + + frameInfo = lastPair.split( ";" ); + frameTime = 0; + + if ( framerate && ( typeof framerate === "number" ) ) { + frameTime = parseFloat( frameInfo[ 1 ], 10 ) / framerate; + } + + digitPairs[ lastIndex ] = parseInt( frameInfo[ 0 ], 10 ) + frameTime; + } + + firstPair = digitPairs[ 0 ]; + + return { + + 1: parseFloat( firstPair, 10 ), + + 2: ( parseInt( firstPair, 10 ) * 60 ) + + parseFloat( digitPairs[ 1 ], 10 ), + + 3: ( parseInt( firstPair, 10 ) * 3600 ) + + ( parseInt( digitPairs[ 1 ], 10 ) * 60 ) + + parseFloat( digitPairs[ 2 ], 10 ) + + }[ digitPairs.length || 1 ]; + } + }; + + + // Initialize locale data + // Based on http://en.wikipedia.org/wiki/Language_localisation#Language_tags_and_codes + function initLocale( arg ) { + + var locale = typeof arg === "string" ? arg : [ arg.language, arg.region ].join( "-" ), + parts = locale.split( "-" ); + + // Setup locale data table + return { + iso6391: locale, + language: parts[ 0 ] || "", + region: parts[ 1 ] || "" + }; + } + + // Declare locale data table + var localeData = initLocale( global.navigator.userLanguage || global.navigator.language ); + + Popcorn.locale = { + + // Popcorn.locale.get() + // returns reference to privately + // defined localeData + get: function() { + return localeData; + }, + + // Popcorn.locale.set( string|object ); + set: function( arg ) { + + localeData = initLocale( arg ); + + Popcorn.locale.broadcast(); + + return localeData; + }, + + // Popcorn.locale.broadcast( type ) + // Sends events to all popcorn media instances that are + // listening for locale events + broadcast: function( type ) { + + var instances = Popcorn.instances, + length = instances.length, + idx = 0, + instance; + + type = type || "locale:changed"; + + // Iterate all current instances + for ( ; idx < length; idx++ ) { + instance = instances[ idx ]; + + // For those instances with locale event listeners, + // trigger a locale change event + if ( type in instance.data.events ) { + instance.trigger( type ); + } + } + } + }; + + // alias for exec function + Popcorn.p.cue = Popcorn.p.exec; + + function getItems() { + + var item, + list = []; + + if ( Object.keys ) { + list = Object.keys( Popcorn.p ); + } else { + + for ( item in Popcorn.p ) { + if ( hasOwn.call( Popcorn.p, item ) ) { + list.push( item ); + } + } + } + + return list.join( "," ).toLowerCase().split( ","); + } + + // Protected API methods + Popcorn.protect = { + natives: getItems() + }; + + // Exposes Popcorn to global context + global.Popcorn = Popcorn; + +})(window, window.document); +// A global callback for youtube... that makes me angry +var onYouTubePlayerReady = function( containerId ) { + + onYouTubePlayerReady[ containerId ] && onYouTubePlayerReady[ containerId ](); +}; +onYouTubePlayerReady.stateChangeEventHandler = {}; + +Popcorn.player( "youtube", { + _setup: function( options ) { + + var media = this, + youtubeObject, + container = document.createElement( "div" ), + currentTime = 0, + seekTime = 0, + seeking = false, + + // state code for volume changed polling + volumeChanged = false, + lastMuted = false, + lastVolume = 0; + + container.id = media.id + Popcorn.guid(); + + media.appendChild( container ); + + var youtubeInit = function() { + + var flashvars, + params, + attributes, + src; + + // expose a callback to this scope, that is called from the global callback youtube calls + onYouTubePlayerReady[ container.id ] = function() { + + youtubeObject = document.getElementById( container.id ); + + // more youtube callback nonsense + onYouTubePlayerReady.stateChangeEventHandler[ container.id ] = function( state ) { + + // playing is state 1 + // paused is state 2 + if ( state === 1 ) { + + media.paused && media.play(); + // youtube fires paused events while seeking + // this is the only way to get seeking events + } else if ( state === 2 ) { + + // silly logic forced on me by the youtube API + // calling youtube.seekTo triggers multiple events + // with the second events getCurrentTime being the old time + if ( seeking && seekTime === currentTime && seekTime !== youtubeObject.getCurrentTime() ) { + + seeking = false; + youtubeObject.seekTo( currentTime ); + return; + } + + currentTime = youtubeObject.getCurrentTime(); + media.dispatchEvent( "timeupdate" ); + !media.paused && media.pause(); + } + }; + + // youtube requires callbacks to be a string to a function path from the global scope + youtubeObject.addEventListener( "onStateChange", "onYouTubePlayerReady.stateChangeEventHandler." + container.id ); + + var timeupdate = function() { + + if ( !media.paused ) { + + currentTime = youtubeObject.getCurrentTime(); + media.dispatchEvent( "timeupdate" ); + setTimeout( timeupdate, 10 ); + } + }; + + var volumeupdate = function() { + + if ( lastMuted !== youtubeObject.isMuted() ) { + + lastMuted = youtubeObject.isMuted(); + media.dispatchEvent( "volumechange" ); + } + + if ( lastVolume !== youtubeObject.getVolume() ) { + + lastVolume = youtubeObject.getVolume(); + media.dispatchEvent( "volumechange" ); + } + + setTimeout( volumeupdate, 250 ); + }; + + media.play = function() { + + media.paused = false; + media.dispatchEvent( "play" ); + + media.dispatchEvent( "playing" ); + timeupdate(); + youtubeObject.playVideo(); + }; + + media.pause = function() { + + if ( !media.paused ) { + + media.paused = true; + media.dispatchEvent( "pause" ); + youtubeObject.pauseVideo(); + } + }; + + Popcorn.player.defineProperty( media, "currentTime", { + set: function( val ) { + + // make sure val is a number + currentTime = seekTime = +val; + seeking = true; + media.dispatchEvent( "seeked" ); + media.dispatchEvent( "timeupdate" ); + youtubeObject.seekTo( currentTime ); + return currentTime; + }, + get: function() { + + return currentTime; + } + }); + + Popcorn.player.defineProperty( media, "muted", { + set: function( val ) { + + if ( youtubeObject.isMuted() !== val ) { + + if ( val ) { + + youtubeObject.mute(); + } else { + + youtubeObject.unMute(); + } + + lastMuted = youtubeObject.isMuted(); + media.dispatchEvent( "volumechange" ); + } + + return youtubeObject.isMuted(); + }, + get: function() { + + return youtubeObject.isMuted(); + } + }); + + Popcorn.player.defineProperty( media, "volume", { + set: function( val ) { + + if ( youtubeObject.getVolume() !== val ) { + + youtubeObject.setVolume( val ); + lastVolume = youtubeObject.getVolume(); + media.dispatchEvent( "volumechange" ); + } + + return youtubeObject.getVolume(); + }, + get: function() { + + return youtubeObject.getVolume(); + } + }); + + media.readyState = 4; + media.dispatchEvent( "load" ); + media.duration = youtubeObject.getDuration(); + media.dispatchEvent( "durationchange" ); + volumeupdate(); + + media.dispatchEvent( "loadeddata" ); + }; + + options.controls = +options.controls === 0 || +options.controls === 1 ? options.controls : 1; + options.annotations = +options.annotations === 1 || +options.annotations === 3 ? options.annotations : 1; + + flashvars = { + playerapiid: container.id, + controls: options.controls, + iv_load_policy: options.annotations + }; + + params = { + wmode: "transparent", + allowScriptAccess: "always" + }; + + attributes = { + id: container.id + }; + + src = /^.*[\/=](.{11})/.exec( media.src )[ 1 ]; + + swfobject.embedSWF( "http://www.youtube.com/e/" + src + "?enablejsapi=1&playerapiid=" + container.id + "&version=3", + container.id, media.offsetWidth, media.offsetHeight, "8", null, + flashvars, params, attributes ); + }; + + if ( !window.swfobject ) { + + Popcorn.getScript( "http://ajax.googleapis.com/ajax/libs/swfobject/2.2/swfobject.js", youtubeInit ); + } else { + + youtubeInit(); + } + } +}); + +// PLUGIN: Code + +(function ( Popcorn ) { + + /** + * Code Popcorn Plug-in + * + * Adds the ability to run arbitrary code (JavaScript functions) according to video timing. + * + * @param {Object} options + * + * Required parameters: start, end, template, data, and target. + * Optional parameter: static. + * + * start: the time in seconds when the mustache template should be rendered + * in the target div. + * + * end: the time in seconds when the rendered mustache template should be + * removed from the target div. + * + * onStart: the function to be run when the start time is reached. + * + * onFrame: [optional] a function to be run on each paint call + * (e.g., called ~60 times per second) between the start and end times. + * + * onEnd: [optional] a function to be run when the end time is reached. + * + * Example: + var p = Popcorn('#video') + + // onStart function only + .code({ + start: 1, + end: 4, + onStart: function( options ) { + // called on start + } + }) + + // onStart + onEnd only + .code({ + start: 6, + end: 8, + onStart: function( options ) { + // called on start + }, + onEnd: function ( options ) { + // called on end + } + }) + + // onStart, onEnd, onFrame + .code({ + start: 10, + end: 14, + onStart: function( options ) { + // called on start + }, + onFrame: function ( options ) { + // called on every paint frame between start and end. + // uses mozRequestAnimationFrame, webkitRequestAnimationFrame, + // or setTimeout with 16ms window. + }, + onEnd: function ( options ) { + // called on end + } + }); + * + */ + + Popcorn.plugin( "code" , function( options ) { + var running = false; + + // Setup a proper frame interval function (60fps), favouring paint events. + var step = (function() { + + var buildFrameRunner = function( runner ) { + return function( f, options ) { + + var _f = function() { + running && f(); + running && runner( _f ); + }; + + _f(); + }; + }; + + // Figure out which level of browser support we have for this + if ( window.webkitRequestAnimationFrame ) { + return buildFrameRunner( window.webkitRequestAnimationFrame ); + } else if ( window.mozRequestAnimationFrame ) { + return buildFrameRunner( window.mozRequestAnimationFrame ); + } else { + return buildFrameRunner( function( f ) { + window.setTimeout( f, 16 ); + }); + } + + })(); + + if ( !options.onStart || typeof options.onStart !== "function" ) { + + if ( Popcorn.plugin.debug ) { + throw new Error( "Popcorn Code Plugin Error: onStart must be a function." ); + } + options.onStart = Popcorn.nop; + } + + if ( options.onEnd && typeof options.onEnd !== "function" ) { + + if ( Popcorn.plugin.debug ) { + throw new Error( "Popcorn Code Plugin Error: onEnd must be a function." ); + } + options.onEnd = undefined; + } + + if ( options.onFrame && typeof options.onFrame !== "function" ) { + + if ( Popcorn.plugin.debug ) { + throw new Error( "Popcorn Code Plugin Error: onFrame must be a function." ); + } + options.onFrame = undefined; + } + + return { + start: function( event, options ) { + options.onStart( options ); + + if ( options.onFrame ) { + running = true; + step( options.onFrame, options ); + } + }, + + end: function( event, options ) { + if ( options.onFrame ) { + running = false; + } + + if ( options.onEnd ) { + options.onEnd( options ); + } + } + }; + }, + { + about: { + name: "Popcorn Code Plugin", + version: "0.1", + author: "David Humphrey (@humphd)", + website: "http://vocamus.net/dave" + }, + options: { + start: { + elem: "input", + type: "text", + label: "In" + }, + end: { + elem: "input", + type: "text", + label: "Out" + }, + onStart: { + elem: "input", + type: "function", + label: "onStart" + }, + onFrame: { + elem: "input", + type: "function", + label: "onFrame" + }, + onEnd: { + elem: "input", + type: "function", + label: "onEnd" + } + } + }); +})( Popcorn ); +var jwplayerObjects = {}; + +Popcorn.player( "jwplayer", { + _setup: function( options ) { + + var media = this, + player = {}, + container = document.createElement( "div" ), + currentTime = 0, + seekTime = 0, + seeking = false, + dataLoaded = false; + container.id = media.id + Popcorn.guid(); + + media.appendChild( container ); + + var initApi = function () { + jwplayer( container.id ).onTime(function() { + currentTime = jwplayer(container.id).getPosition(); + media.dispatchEvent( "timeupdate" ); + // timeout = setTimeout( timeupdate, 10 ); + }); + + media.play = function() { + media.paused = false; + media.dispatchEvent( "play" ); + + media.dispatchEvent( "playing" ); + jwplayer( container.id ).play(); + }; + + media.pause = function() { + + if ( !media.paused ) { + media.paused = true; + media.dispatchEvent( "pause" ); + jwplayer( container.id ).pause(); + } + }; + + Popcorn.player.defineProperty( media, "currentTime", { + set: function( val ) { + // make sure val is a number + currentTime = seekTime = +val; + seeking = true; + media.dispatchEvent( "seeked" ); + media.dispatchEvent( "timeupdate" ); + jwplayer( container.id ).seek( currentTime ); + return currentTime; + }, + get: function() { + return jwplayer( container.id ).getPosition(); + } + }); + + Popcorn.player.defineProperty( media, "muted", { + set: function( val ) { + if ( jwplayer( container.id ).getMute() !== val ) { + if ( val ) { + jwplayer( container.id ).setMute(true); + } else { + jwplayer( container.id ).setMute(false); + } + + media.dispatchEvent( "volumechange" ); + } + + return jwplayer( container.id ).getMute(); + }, + get: function() { + return jwplayer( container.id ).getMute(); + } + }); + + Popcorn.player.defineProperty( media, "volume", { + + set: function( val ) { + + if ( jwplayer( container.id ).getVolume() !== val *100 ) { + jwplayer( container.id ).setVolume( val * 100); + media.dispatchEvent( "volumechange" ); + } + + return (jwplayer( container.id ).getVolume()) / 100; + }, + + get: function() { + return jwplayer( container.id ).getVolume() / 100; + } + }); + + media.readyState = 4; + media.dispatchEvent( 'load' ); + dataLoaded = true; + + media.duration = options.duration; + media.dispatchEvent( 'durationchange' ); + + media.paused && media.dispatchEvent( 'loadeddata' ); + + }; + + options.events = { + onReady: initApi + }; + + jwplayer( container.id ).setup(options); + + } +}); + +// PLUGIN: Mediafragment + +(function ( Popcorn ) { + + /** + * Mediafragment popcorn plug-in + * Adds (limited) support for mediafragment requests + * to a popcorn video. + * @param {Object} options + * + **/ + Popcorn.plugin( "mediafragment" , { + + manifest: { + about: { + name: "Popcorn mediafragment plugin", + version: "0.1", + author: "Karim Hamidou", + website: "http://neyret.fr/~karim" + }, + options: { + } + }, + + _setup: function( options ) { + var advanceTime = function() { + var url = window.location.href; + + if ( url.split( "#" )[ 1 ] != null ) { + pageoffset = url.split( "#" )[1]; + + if ( pageoffset.substring( 2 ) != null ) { + var offsettime = pageoffset.substring( 2 ); + this.currentTime( parseFloat( offsettime ) ); + } + } + } + + var updateTime = function() { + var history = window.history; + if ( !history.pushState ) { + return false; + } + + splitArr = window.location.href.split( "#" ) + history.replaceState( {}, "", splitArr[0] + "#t=" + this.currentTime().toFixed( 2 ) ); + }; + + this.listen( "loadedmetadata", advanceTime ); + this.listen( "pause", updateTime ); + this.listen( "seeked", updateTime ); + }, + + _teardown: function( options ) { + // FIXME: anything to implement here ? + } + }); +})( Popcorn ); +if(typeof jwplayer=="undefined"){var jwplayer=function(a){if(jwplayer.api){return jwplayer.api.selectPlayer(a)}};var $jw=jwplayer;jwplayer.version="5.7.1896";jwplayer.vid=document.createElement("video");jwplayer.audio=document.createElement("audio");jwplayer.source=document.createElement("source");(function(b){b.utils=function(){};b.utils.typeOf=function(d){var c=typeof d;if(c==="object"){if(d){if(d instanceof Array){c="array"}}else{c="null"}}return c};b.utils.extend=function(){var c=b.utils.extend["arguments"];if(c.length>1){for(var e=1;e-1){return c.substr(c.lastIndexOf(".")+1,c.length).toLowerCase()}return};b.utils.html=function(c,d){c.innerHTML=d};b.utils.wrap=function(c,d){if(c.parentNode){c.parentNode.replaceChild(d,c)}d.appendChild(c)};b.utils.ajax=function(g,f,c){var e;if(window.XMLHttpRequest){e=new XMLHttpRequest()}else{e=new ActiveXObject("Microsoft.XMLHTTP")}e.onreadystatechange=function(){if(e.readyState===4){if(e.status===200){if(f){f(e)}}else{if(c){c(g)}}}};try{e.open("GET",g,true);e.send(null)}catch(d){if(c){c(g)}}return e};b.utils.load=function(d,e,c){d.onreadystatechange=function(){if(d.readyState===4){if(d.status===200){if(e){e()}}else{if(c){c()}}}}};b.utils.find=function(d,c){return d.getElementsByTagName(c)};b.utils.append=function(c,d){c.appendChild(d)};b.utils.isIE=function(){return((!+"\v1")||(typeof window.ActiveXObject!="undefined"))};b.utils.isLegacyAndroid=function(){var c=navigator.userAgent.toLowerCase();return(c.match(/android 2.[012]/i)!==null)};b.utils.isIOS=function(d){if(typeof d=="undefined"){d=/iP(hone|ad|od)/i}var c=navigator.userAgent.toLowerCase();return(c.match(d)!==null)};b.utils.isIPad=function(){return b.utils.isIOS(/iPad/i)};b.utils.isIPod=function(){return b.utils.isIOS(/iP(hone|od)/i)};b.utils.getFirstPlaylistItemFromConfig=function(c){var d={};var e;if(c.playlist&&c.playlist.length){e=c.playlist[0]}else{e=c}d.file=e.file;d.levels=e.levels;d.streamer=e.streamer;d.playlistfile=e.playlistfile;d.provider=e.provider;if(!d.provider){if(d.file&&(d.file.toLowerCase().indexOf("youtube.com")>-1||d.file.toLowerCase().indexOf("youtu.be")>-1)){d.provider="youtube"}if(d.streamer&&d.streamer.toLowerCase().indexOf("rtmp://")==0){d.provider="rtmp"}if(e.type){d.provider=e.type.toLowerCase()}}if(d.provider=="audio"){d.provider="sound"}return d};b.utils.getOuterHTML=function(c){if(c.outerHTML){return c.outerHTML}else{try{return new XMLSerializer().serializeToString(c)}catch(d){return""}}};b.utils.setOuterHTML=function(f,e){if(f.outerHTML){f.outerHTML=e}else{var g=document.createElement("div");g.innerHTML=e;var c=document.createRange();c.selectNodeContents(g);var d=c.extractContents();f.parentNode.insertBefore(d,f);f.parentNode.removeChild(f)}};b.utils.hasFlash=function(){if(typeof navigator.plugins!="undefined"&&typeof navigator.plugins["Shockwave Flash"]!="undefined"){return true}if(typeof window.ActiveXObject!="undefined"){try{new ActiveXObject("ShockwaveFlash.ShockwaveFlash");return true}catch(c){}}return false};b.utils.getPluginName=function(c){if(c.lastIndexOf("/")>=0){c=c.substring(c.lastIndexOf("/")+1,c.length)}if(c.lastIndexOf("-")>=0){c=c.substring(0,c.lastIndexOf("-"))}if(c.lastIndexOf(".swf")>=0){c=c.substring(0,c.lastIndexOf(".swf"))}if(c.lastIndexOf(".js")>=0){c=c.substring(0,c.lastIndexOf(".js"))}return c};b.utils.getPluginVersion=function(c){if(c.lastIndexOf("-")>=0){if(c.lastIndexOf(".js")>=0){return c.substring(c.lastIndexOf("-")+1,c.lastIndexOf(".js"))}else{if(c.lastIndexOf(".swf")>=0){return c.substring(c.lastIndexOf("-")+1,c.lastIndexOf(".swf"))}else{return c.substring(c.lastIndexOf("-")+1)}}}return""};b.utils.getAbsolutePath=function(j,h){if(!b.utils.exists(h)){h=document.location.href}if(!b.utils.exists(j)){return undefined}if(a(j)){return j}var k=h.substring(0,h.indexOf("://")+3);var g=h.substring(k.length,h.indexOf("/",k.length+1));var d;if(j.indexOf("/")===0){d=j.split("/")}else{var e=h.split("?")[0];e=e.substring(k.length+g.length+1,e.lastIndexOf("/"));d=e.split("/").concat(j.split("/"))}var c=[];for(var f=0;f0&&(c<0||(c>e)))}b.utils.pluginPathType={ABSOLUTE:"ABSOLUTE",RELATIVE:"RELATIVE",CDN:"CDN"};b.utils.getPluginPathType=function(d){if(typeof d!="string"){return}d=d.split("?")[0];var e=d.indexOf("://");if(e>0){return b.utils.pluginPathType.ABSOLUTE}var c=d.indexOf("/");var f=b.utils.extension(d);if(e<0&&c<0&&(!f||!isNaN(f))){return b.utils.pluginPathType.CDN}return b.utils.pluginPathType.RELATIVE};b.utils.mapEmpty=function(c){for(var d in c){return false}return true};b.utils.mapLength=function(d){var c=0;for(var e in d){c++}return c};b.utils.log=function(d,c){if(typeof console!="undefined"&&typeof console.log!="undefined"){if(c){console.log(d,c)}else{console.log(d)}}};b.utils.css=function(d,g,c){if(b.utils.exists(d)){for(var e in g){try{if(typeof g[e]==="undefined"){continue}else{if(typeof g[e]=="number"&&!(e=="zIndex"||e=="opacity")){if(isNaN(g[e])){continue}if(e.match(/color/i)){g[e]="#"+b.utils.strings.pad(g[e].toString(16),6)}else{g[e]=Math.ceil(g[e])+"px"}}}d.style[e]=g[e]}catch(f){}}}};b.utils.isYouTube=function(c){return(c.indexOf("youtube.com")>-1||c.indexOf("youtu.be")>-1)};b.utils.transform=function(c,d){c.style.webkitTransform=d;c.style.MozTransform=d;c.style.OTransform=d};b.utils.stretch=function(h,n,m,f,l,g){if(typeof m=="undefined"||typeof f=="undefined"||typeof l=="undefined"||typeof g=="undefined"){return}var d=m/l;var e=f/g;var k=0;var j=0;n.style.overflow="hidden";b.utils.transform(n,"");var c={};switch(h.toUpperCase()){case b.utils.stretching.NONE:c.width=l;c.height=g;break;case b.utils.stretching.UNIFORM:if(d>e){c.width=l*e;c.height=g*e}else{c.width=l*d;c.height=g*d}break;case b.utils.stretching.FILL:if(d>e){c.width=l*d;c.height=g*d}else{c.width=l*e;c.height=g*e}break;case b.utils.stretching.EXACTFIT:b.utils.transform(n,["scale(",d,",",e,")"," translate(0px,0px)"].join(""));c.width=l;c.height=g;break;default:break}c.top=(f-c.height)/2;c.left=(m-c.width)/2;b.utils.css(n,c)};b.utils.stretching={NONE:"NONE",FILL:"FILL",UNIFORM:"UNIFORM",EXACTFIT:"EXACTFIT"};b.utils.deepReplaceKeyName=function(h,e,c){switch(b.utils.typeOf(h)){case"array":for(var g=0;g0);break;case"object":return(c!==null);case"undefined":return false}return true};b.utils.empty=function(c){if(typeof c.hasChildNodes=="function"){while(c.hasChildNodes()){c.removeChild(c.firstChild)}}};b.utils.parseDimension=function(c){if(typeof c=="string"){if(c===""){return 0}else{if(c.lastIndexOf("%")>-1){return c}else{return parseInt(c.replace("px",""),10)}}}return c};b.utils.getDimensions=function(c){if(c&&c.style){return{x:b.utils.parseDimension(c.style.left),y:b.utils.parseDimension(c.style.top),width:b.utils.parseDimension(c.style.width),height:b.utils.parseDimension(c.style.height)}}else{return{}}};b.utils.timeFormat=function(c){str="00:00";if(c>0){str=Math.floor(c/60)<10?"0"+Math.floor(c/60)+":":Math.floor(c/60)+":";str+=Math.floor(c%60)<10?"0"+Math.floor(c%60):Math.floor(c%60)}return str}})(jwplayer);(function(a){a.events=function(){};a.events.COMPLETE="COMPLETE";a.events.ERROR="ERROR"})(jwplayer);(function(jwplayer){jwplayer.events.eventdispatcher=function(debug){var _debug=debug;var _listeners;var _globallisteners;this.resetEventListeners=function(){_listeners={};_globallisteners=[]};this.resetEventListeners();this.addEventListener=function(type,listener,count){try{if(!jwplayer.utils.exists(_listeners[type])){_listeners[type]=[]}if(typeof(listener)=="string"){eval("listener = "+listener)}_listeners[type].push({listener:listener,count:count})}catch(err){jwplayer.utils.log("error",err)}return false};this.removeEventListener=function(type,listener){if(!_listeners[type]){return}try{for(var listenerIndex=0;listenerIndex<_listeners[type].length;listenerIndex++){if(_listeners[type][listenerIndex].listener.toString()==listener.toString()){_listeners[type].splice(listenerIndex,1);break}}}catch(err){jwplayer.utils.log("error",err)}return false};this.addGlobalListener=function(listener,count){try{if(typeof(listener)=="string"){eval("listener = "+listener)}_globallisteners.push({listener:listener,count:count})}catch(err){jwplayer.utils.log("error",err)}return false};this.removeGlobalListener=function(listener){if(!_globallisteners[type]){return}try{for(var globalListenerIndex=0;globalListenerIndex<_globallisteners.length;globalListenerIndex++){if(_globallisteners[globalListenerIndex].listener.toString()==listener.toString()){_globallisteners.splice(globalListenerIndex,1);break}}}catch(err){jwplayer.utils.log("error",err)}return false};this.sendEvent=function(type,data){if(!jwplayer.utils.exists(data)){data={}}if(_debug){jwplayer.utils.log(type,data)}if(typeof _listeners[type]!="undefined"){for(var listenerIndex=0;listenerIndex<_listeners[type].length;listenerIndex++){try{_listeners[type][listenerIndex].listener(data)}catch(err){jwplayer.utils.log("There was an error while handling a listener: "+err.toString(),_listeners[type][listenerIndex].listener)}if(_listeners[type][listenerIndex]){if(_listeners[type][listenerIndex].count===1){delete _listeners[type][listenerIndex]}else{if(_listeners[type][listenerIndex].count>0){_listeners[type][listenerIndex].count=_listeners[type][listenerIndex].count-1}}}}}for(var globalListenerIndex=0;globalListenerIndex<_globallisteners.length;globalListenerIndex++){try{_globallisteners[globalListenerIndex].listener(data)}catch(err){jwplayer.utils.log("There was an error while handling a listener: "+err.toString(),_globallisteners[globalListenerIndex].listener)}if(_globallisteners[globalListenerIndex]){if(_globallisteners[globalListenerIndex].count===1){delete _globallisteners[globalListenerIndex]}else{if(_globallisteners[globalListenerIndex].count>0){_globallisteners[globalListenerIndex].count=_globallisteners[globalListenerIndex].count-1}}}}}}})(jwplayer);(function(a){var b={};a.utils.animations=function(){};a.utils.animations.transform=function(c,d){c.style.webkitTransform=d;c.style.MozTransform=d;c.style.OTransform=d;c.style.msTransform=d};a.utils.animations.transformOrigin=function(c,d){c.style.webkitTransformOrigin=d;c.style.MozTransformOrigin=d;c.style.OTransformOrigin=d;c.style.msTransformOrigin=d};a.utils.animations.rotate=function(c,d){a.utils.animations.transform(c,["rotate(",d,"deg)"].join(""))};a.utils.cancelAnimation=function(c){delete b[c.id]};a.utils.fadeTo=function(m,f,e,j,h,d){if(b[m.id]!=d&&a.utils.exists(d)){return}if(m.style.opacity==f){return}var c=new Date().getTime();if(d>c){setTimeout(function(){a.utils.fadeTo(m,f,e,j,0,d)},d-c)}if(m.style.display=="none"){m.style.display="block"}if(!a.utils.exists(j)){j=m.style.opacity===""?1:m.style.opacity}if(m.style.opacity==f&&m.style.opacity!==""&&a.utils.exists(d)){if(f===0){m.style.display="none"}return}if(!a.utils.exists(d)){d=c;b[m.id]=d}if(!a.utils.exists(h)){h=0}var k=(e>0)?((c-d)/(e*1000)):0;k=k>1?1:k;var l=f-j;var g=j+(k*l);if(g>1){g=1}else{if(g<0){g=0}}m.style.opacity=g;if(h>0){b[m.id]=d+h*1000;a.utils.fadeTo(m,f,e,j,0,b[m.id]);return}setTimeout(function(){a.utils.fadeTo(m,f,e,j,0,d)},10)}})(jwplayer);(function(a){a.utils.arrays=function(){};a.utils.arrays.indexOf=function(c,d){for(var b=0;b-1){c.splice(b,1)}}})(jwplayer);(function(a){a.utils.extensionmap={"3gp":{html5:"video/3gpp",flash:"video"},"3gpp":{html5:"video/3gpp"},"3g2":{html5:"video/3gpp2",flash:"video"},"3gpp2":{html5:"video/3gpp2"},flv:{flash:"video"},f4a:{html5:"audio/mp4"},f4b:{html5:"audio/mp4",flash:"video"},f4v:{html5:"video/mp4",flash:"video"},mov:{html5:"video/quicktime",flash:"video"},m4a:{html5:"audio/mp4",flash:"video"},m4b:{html5:"audio/mp4"},m4p:{html5:"audio/mp4"},m4v:{html5:"video/mp4",flash:"video"},mp4:{html5:"video/mp4",flash:"video"},rbs:{flash:"sound"},aac:{html5:"audio/aac",flash:"video"},mp3:{html5:"audio/mp3",flash:"sound"},ogg:{html5:"audio/ogg"},oga:{html5:"audio/ogg"},ogv:{html5:"video/ogg"},webm:{html5:"video/webm"},m3u8:{html5:"audio/x-mpegurl"},gif:{flash:"image"},jpeg:{flash:"image"},jpg:{flash:"image"},swf:{flash:"image"},png:{flash:"image"},wav:{html5:"audio/x-wav"}}})(jwplayer);(function(e){e.utils.mediaparser=function(){};var g={element:{width:"width",height:"height",id:"id","class":"className",name:"name"},media:{src:"file",preload:"preload",autoplay:"autostart",loop:"repeat",controls:"controls"},source:{src:"file",type:"type",media:"media","data-jw-width":"width","data-jw-bitrate":"bitrate"},video:{poster:"image"}};var f={};e.utils.mediaparser.parseMedia=function(j){return d(j)};function c(k,j){if(!e.utils.exists(j)){j=g[k]}else{e.utils.extend(j,g[k])}return j}function d(n,j){if(f[n.tagName.toLowerCase()]&&!e.utils.exists(j)){return f[n.tagName.toLowerCase()](n)}else{j=c("element",j);var o={};for(var k in j){if(k!="length"){var m=n.getAttribute(k);if(e.utils.exists(m)){o[j[k]]=m}}}var l=n.style["#background-color"];if(l&&!(l=="transparent"||l=="rgba(0, 0, 0, 0)")){o.screencolor=l}return o}}function h(n,k){k=c("media",k);var l=[];var j=e.utils.selectors("source",n);for(var m in j){if(!isNaN(m)){l.push(a(j[m]))}}var o=d(n,k);if(e.utils.exists(o.file)){l[0]={file:o.file}}o.levels=l;return o}function a(l,k){k=c("source",k);var j=d(l,k);j.width=j.width?j.width:0;j.bitrate=j.bitrate?j.bitrate:0;return j}function b(l,k){k=c("video",k);var j=h(l,k);return j}f.media=h;f.audio=h;f.source=a;f.video=b})(jwplayer);(function(a){a.utils.loaderstatus={NEW:"NEW",LOADING:"LOADING",ERROR:"ERROR",COMPLETE:"COMPLETE"};a.utils.scriptloader=function(c){var d=a.utils.loaderstatus.NEW;var b=new a.events.eventdispatcher();a.utils.extend(this,b);this.load=function(){if(d==a.utils.loaderstatus.NEW){d=a.utils.loaderstatus.LOADING;var e=document.createElement("script");e.onload=function(f){d=a.utils.loaderstatus.COMPLETE;b.sendEvent(a.events.COMPLETE)};e.onerror=function(f){d=a.utils.loaderstatus.ERROR;b.sendEvent(a.events.ERROR)};e.onreadystatechange=function(){if(e.readyState=="loaded"||e.readyState=="complete"){d=a.utils.loaderstatus.COMPLETE;b.sendEvent(a.events.COMPLETE)}};document.getElementsByTagName("head")[0].appendChild(e);e.src=c}};this.getStatus=function(){return d}}})(jwplayer);(function(a){a.utils.selectors=function(b,e){if(!a.utils.exists(e)){e=document}b=a.utils.strings.trim(b);var c=b.charAt(0);if(c=="#"){return e.getElementById(b.substr(1))}else{if(c=="."){if(e.getElementsByClassName){return e.getElementsByClassName(b.substr(1))}else{return a.utils.selectors.getElementsByTagAndClass("*",b.substr(1))}}else{if(b.indexOf(".")>0){var d=b.split(".");return a.utils.selectors.getElementsByTagAndClass(d[0],d[1])}else{return e.getElementsByTagName(b)}}}return null};a.utils.selectors.getElementsByTagAndClass=function(e,h,g){var j=[];if(!a.utils.exists(g)){g=document}var f=g.getElementsByTagName(e);for(var d=0;d5||b.length==0){return b}else{return Number(b)}}}}};a.utils.strings.seconds=function(d){d=d.replace(",",".");var b=d.split(":");var c=0;if(d.substr(-1)=="s"){c=Number(d.substr(0,d.length-1))}else{if(d.substr(-1)=="m"){c=Number(d.substr(0,d.length-1))*60}else{if(d.substr(-1)=="h"){c=Number(d.substr(0,d.length-1))*3600}else{if(b.length>1){c=Number(b[b.length-1]);c+=Number(b[b.length-2])*60;if(b.length==3){c+=Number(b[b.length-3])*3600}}else{c=Number(d)}}}}return c};a.utils.strings.xmlAttribute=function(b,c){for(var d=0;d=0){return"boolean"}else{if(d.test(f)){return"color"}else{if(!isNaN(parseInt(f,10))&&parseInt(f,10).toString().length==f.length){return"integer"}else{if(!isNaN(parseFloat(f))&&parseFloat(f).toString().length==f.length){return"float"}}}}return"string"}function e(g,f){if(!c.utils.exists(f)){return g}switch(f){case"color":if(g.length>0){return a(g)}return null;case"integer":return parseInt(g,10);case"float":return parseFloat(g);case"boolean":if(g.toLowerCase()=="true"){return true}else{if(g=="1"){return true}}return false}return g}function a(f){switch(f.toLowerCase()){case"blue":return parseInt("0000FF",16);case"green":return parseInt("00FF00",16);case"red":return parseInt("FF0000",16);case"cyan":return parseInt("00FFFF",16);case"magenta":return parseInt("FF00FF",16);case"yellow":return parseInt("FFFF00",16);case"black":return parseInt("000000",16);case"white":return parseInt("FFFFFF",16);default:f=f.replace(/(#|0x)?([0-9A-F]{3,6})$/gi,"$2");if(f.length==3){f=f.charAt(0)+f.charAt(0)+f.charAt(1)+f.charAt(1)+f.charAt(2)+f.charAt(2)}return parseInt(f,16)}return parseInt("000000",16)}})(jwplayer);(function(a){a.utils.parsers=function(){};a.utils.parsers.localName=function(b){if(!b){return""}else{if(b.localName){return b.localName}else{if(b.baseName){return b.baseName}else{return""}}}};a.utils.parsers.textContent=function(b){if(!b){return""}else{if(b.textContent){return b.textContent}else{if(b.text){return b.text}else{return""}}}}})(jwplayer);(function(a){a.utils.parsers.jwparser=function(){};a.utils.parsers.jwparser.PREFIX="jwplayer";a.utils.parsers.jwparser.parseEntry=function(c,d){for(var b=0;b-1){d.file=d.link}}return d};a.utils.parsers.jwparser.getProvider=function(c){if(c.type){return c.type}else{if(c.file.indexOf("youtube.com/w")>-1||c.file.indexOf("youtube.com/v")>-1||c.file.indexOf("youtu.be/")>-1){return"youtube"}else{if(c.streamer&&c.streamer.indexOf("rtmp")==0){return"rtmp"}else{if(c.streamer&&c.streamer.indexOf("http")==0){return"http"}else{var b=a.utils.strings.extension(c.file);if(extensions.hasOwnProperty(b)){return extensions[b]}}}}}return""}})(jwplayer);(function(a){a.utils.parsers.mediaparser=function(){};a.utils.parsers.mediaparser.PREFIX="media";a.utils.parsers.mediaparser.parseGroup=function(d,f){var e=false;for(var c=0;c0){f=a.utils.parsers.mediaparser.parseGroup(d.childNodes[c],f)}if(a.utils.strings.xmlAttribute(d.childNodes[c],"width")||a.utils.strings.xmlAttribute(d.childNodes[c],"bitrate")||a.utils.strings.xmlAttribute(d.childNodes[c],"url")){if(!f.levels){f.levels=[]}f.levels.push({width:a.utils.strings.xmlAttribute(d.childNodes[c],"width"),bitrate:a.utils.strings.xmlAttribute(d.childNodes[c],"bitrate"),file:a.utils.strings.xmlAttribute(d.childNodes[c],"url")})}break;case"title":f.title=a.utils.parsers.textContent(d.childNodes[c]);break;case"description":f.description=a.utils.parsers.textContent(d.childNodes[c]);break;case"keywords":f.tags=a.utils.parsers.textContent(d.childNodes[c]);break;case"thumbnail":f.image=a.utils.strings.xmlAttribute(d.childNodes[c],"url");break;case"credit":f.author=a.utils.parsers.textContent(d.childNodes[c]);break;case"player":var b=d.childNodes[c].url;if(b.indexOf("youtube.com")>=0||b.indexOf("youtu.be")>=0){e=true;f.file=a.utils.strings.xmlAttribute(d.childNodes[c],"url")}break;case"group":a.utils.parsers.mediaparser.parseGroup(d.childNodes[c],f);break}}}return f}})(jwplayer);(function(b){b.utils.parsers.rssparser=function(){};b.utils.parsers.rssparser.parse=function(f){var c=[];for(var e=0;e0){k=b;j=a.utils.loaderstatus.COMPLETE;c.sendEvent(a.events.COMPLETE);return}j=a.utils.loaderstatus.LOADING;var m=new a.utils.scriptloader(e());m.addEventListener(a.events.COMPLETE,g);m.addEventListener(a.events.ERROR,f);m.load()}};this.registerPlugin=function(o,n,m){if(l){clearTimeout(l);l=undefined}if(n&&m){k=m;h=n}else{if(typeof n=="string"){k=n}else{if(typeof n=="function"){h=n}else{if(!n&&!m){k=o}}}}j=a.utils.loaderstatus.COMPLETE;c.sendEvent(a.events.COMPLETE)};this.getStatus=function(){return j};this.getPluginName=function(){return a.utils.getPluginName(b)};this.getFlashPath=function(){if(k){switch(a.utils.getPluginPathType(k)){case a.utils.pluginPathType.ABSOLUTE:return k;case a.utils.pluginPathType.RELATIVE:if(b.lastIndexOf(".swf")>0){return a.utils.getAbsolutePath(k,window.location.href)}return a.utils.getAbsolutePath(k,e());case a.utils.pluginPathType.CDN:if(k.indexOf("-")>-1){return k+"h"}return k+"-h"}}return null};this.getJS=function(){return h};this.getPluginmode=function(){if(typeof k!="undefined"&&typeof h!="undefined"){return a.plugins.pluginmodes.HYBRID}else{if(typeof k!="undefined"){return a.plugins.pluginmodes.FLASH}else{if(typeof h!="undefined"){return a.plugins.pluginmodes.JAVASCRIPT}}}};this.getNewInstance=function(n,m,o){return new h(n,m,o)};this.getURL=function(){return b}}})(jwplayer);(function(a){a.plugins.pluginloader=function(h,e){var g={};var k=a.utils.loaderstatus.NEW;var d=false;var b=false;var c=new a.events.eventdispatcher();a.utils.extend(this,c);function f(){if(!b){b=true;k=a.utils.loaderstatus.COMPLETE;c.sendEvent(a.events.COMPLETE)}}function j(){if(!b){var m=0;for(plugin in g){var l=g[plugin].getStatus();if(l==a.utils.loaderstatus.LOADING||l==a.utils.loaderstatus.NEW){m++}}if(m==0){f()}}}this.setupPlugins=function(n,l,s){var m={length:0,plugins:{}};var p={length:0,plugins:{}};for(var o in g){var q=g[o].getPluginName();if(g[o].getFlashPath()){m.plugins[g[o].getFlashPath()]=l.plugins[o];m.plugins[g[o].getFlashPath()].pluginmode=g[o].getPluginmode();m.length++}if(g[o].getJS()){var r=document.createElement("div");r.id=n.id+"_"+q;r.style.position="absolute";r.style.zIndex=p.length+10;p.plugins[q]=g[o].getNewInstance(n,l.plugins[o],r);p.length++;if(typeof p.plugins[q].resize!="undefined"){n.onReady(s(p.plugins[q],r,true));n.onResize(s(p.plugins[q],r))}}}n.plugins=p.plugins;return m};this.load=function(){k=a.utils.loaderstatus.LOADING;d=true;for(var l in e){if(a.utils.exists(l)){g[l]=h.addPlugin(l);g[l].addEventListener(a.events.COMPLETE,j);g[l].addEventListener(a.events.ERROR,j)}}for(l in g){g[l].load()}d=false;j()};this.pluginFailed=function(){f()};this.getStatus=function(){return k}}})(jwplayer);(function(b){var a=[];b.api=function(d){this.container=d;this.id=d.id;var n={};var s={};var q={};var c=[];var h=undefined;var l=false;var j=[];var p=b.utils.getOuterHTML(d);var r={};var k={};this.getBuffer=function(){return this.callInternal("jwGetBuffer")};this.getContainer=function(){return this.container};function e(u,t){return function(z,v,w,x){if(u.renderingMode=="flash"||u.renderingMode=="html5"){var y;if(v){k[z]=v;y="jwplayer('"+u.id+"').callback('"+z+"')"}else{if(!v&&k[z]){delete k[z]}}h.jwDockSetButton(z,y,w,x)}return t}}this.getPlugin=function(t){var v=this;var u={};if(t=="dock"){return b.utils.extend(u,{setButton:e(v,u),show:function(){v.callInternal("jwDockShow");return u},hide:function(){v.callInternal("jwDockHide");return u},onShow:function(w){v.componentListener("dock",b.api.events.JWPLAYER_COMPONENT_SHOW,w);return u},onHide:function(w){v.componentListener("dock",b.api.events.JWPLAYER_COMPONENT_HIDE,w);return u}})}else{if(t=="controlbar"){return b.utils.extend(u,{show:function(){v.callInternal("jwControlbarShow");return u},hide:function(){v.callInternal("jwControlbarHide");return u},onShow:function(w){v.componentListener("controlbar",b.api.events.JWPLAYER_COMPONENT_SHOW,w);return u},onHide:function(w){v.componentListener("controlbar",b.api.events.JWPLAYER_COMPONENT_HIDE,w);return u}})}else{if(t=="display"){return b.utils.extend(u,{show:function(){v.callInternal("jwDisplayShow");return u},hide:function(){v.callInternal("jwDisplayHide");return u},onShow:function(w){v.componentListener("display",b.api.events.JWPLAYER_COMPONENT_SHOW,w);return u},onHide:function(w){v.componentListener("display",b.api.events.JWPLAYER_COMPONENT_HIDE,w);return u}})}else{return this.plugins[t]}}}};this.callback=function(t){if(k[t]){return k[t]()}};this.getDuration=function(){return this.callInternal("jwGetDuration")};this.getFullscreen=function(){return this.callInternal("jwGetFullscreen")};this.getHeight=function(){return this.callInternal("jwGetHeight")};this.getLockState=function(){return this.callInternal("jwGetLockState")};this.getMeta=function(){return this.getItemMeta()};this.getMute=function(){return this.callInternal("jwGetMute")};this.getPlaylist=function(){var u=this.callInternal("jwGetPlaylist");if(this.renderingMode=="flash"){b.utils.deepReplaceKeyName(u,"__dot__",".")}for(var t=0;t0){var u=j.shift();this.callInternal(u.method,u.parameters)}};this.getItemMeta=function(){return r};this.getCurrentItem=function(){return this.callInternal("jwGetPlaylistIndex")};function o(v,x,w){var t=[];if(!x){x=0}if(!w){w=v.length-1}for(var u=x;u<=w;u++){t.push(v[u])}return t}return this};b.api.selectPlayer=function(d){var c;if(!b.utils.exists(d)){d=0}if(d.nodeType){c=d}else{if(typeof d=="string"){c=document.getElementById(d)}}if(c){var e=b.api.playerById(c.id);if(e){return e}else{return b.api.addPlayer(new b.api(c))}}else{if(typeof d=="number"){return b.getPlayers()[d]}}return null};b.api.events={API_READY:"jwplayerAPIReady",JWPLAYER_READY:"jwplayerReady",JWPLAYER_FULLSCREEN:"jwplayerFullscreen",JWPLAYER_RESIZE:"jwplayerResize",JWPLAYER_ERROR:"jwplayerError",JWPLAYER_COMPONENT_SHOW:"jwplayerComponentShow",JWPLAYER_COMPONENT_HIDE:"jwplayerComponentHide",JWPLAYER_MEDIA_BUFFER:"jwplayerMediaBuffer",JWPLAYER_MEDIA_BUFFER_FULL:"jwplayerMediaBufferFull",JWPLAYER_MEDIA_ERROR:"jwplayerMediaError",JWPLAYER_MEDIA_LOADED:"jwplayerMediaLoaded",JWPLAYER_MEDIA_COMPLETE:"jwplayerMediaComplete",JWPLAYER_MEDIA_SEEK:"jwplayerMediaSeek",JWPLAYER_MEDIA_TIME:"jwplayerMediaTime",JWPLAYER_MEDIA_VOLUME:"jwplayerMediaVolume",JWPLAYER_MEDIA_META:"jwplayerMediaMeta",JWPLAYER_MEDIA_MUTE:"jwplayerMediaMute",JWPLAYER_PLAYER_STATE:"jwplayerPlayerState",JWPLAYER_PLAYLIST_LOADED:"jwplayerPlaylistLoaded",JWPLAYER_PLAYLIST_ITEM:"jwplayerPlaylistItem"};b.api.events.state={BUFFERING:"BUFFERING",IDLE:"IDLE",PAUSED:"PAUSED",PLAYING:"PLAYING"};b.api.playerById=function(d){for(var c=0;c=0){var c=document.getElementById(a[f].id);if(document.getElementById(a[f].id+"_wrapper")){c=document.getElementById(a[f].id+"_wrapper")}if(c){if(d){b.utils.setOuterHTML(c,d)}else{var h=document.createElement("div");var e=c.id;if(c.id.indexOf("_wrapper")==c.id.length-8){newID=c.id.substring(0,c.id.length-8)}h.setAttribute("id",e);c.parentNode.replaceChild(h,c)}}a.splice(f,1)}return null};b.getPlayers=function(){return a.slice(0)}})(jwplayer);var _userPlayerReady=(typeof playerReady=="function")?playerReady:undefined;playerReady=function(b){var a=jwplayer.api.playerById(b.id);if(a){a.playerReady(b)}else{jwplayer.api.selectPlayer(b.id).playerReady(b)}if(_userPlayerReady){_userPlayerReady.call(this,b)}};(function(a){a.embed=function(g){var j={width:400,height:300,components:{controlbar:{position:"over"}}};var f=a.utils.mediaparser.parseMedia(g.container);var e=new a.embed.config(a.utils.extend(j,f,g.config),this);var h=a.plugins.loadPlugins(g.id,e.plugins);function c(m,l){for(var k in l){if(typeof m[k]=="function"){(m[k]).call(m,l[k])}}}function d(){if(h.getStatus()==a.utils.loaderstatus.COMPLETE){for(var m=0;m-1){return parseInt(k)}}return k}var g=["playlist","dock","controlbar","logo","display"];function f(k){var n={};switch(e.utils.typeOf(k.plugins)){case"object":for(var m in k.plugins){n[e.utils.getPluginName(m)]=m}break;case"string":var o=k.plugins.split(",");for(var l=0;l-1){var o=p.split(".");var n=o[0];var p=o[1];if(e.utils.isInArray(g,n)){d(l,"components",n,p)}else{if(m[n]){d(l,"plugins",m[n],p)}}}}return l};e.embed.config=function(k,u){var t=e.utils.extend({},k);var r;if(c(t.playlist)){r=t.playlist;delete t.playlist}t=e.embed.deserialize(t);t.height=j(t.height);t.width=j(t.width);if(typeof t.plugins=="string"){var l=t.plugins.split(",");if(typeof t.plugins!="object"){t.plugins={}}for(var p=0;p-1)){return true}if(!l||(l&&l=="video")){var m=a.utils.extension(j);if(m&&a.utils.extensionmap[m]){return true}}return false}}})(jwplayer);(function(a){a.embed.flash=function(f,g,l,e,j){function m(o,n,p){var q=document.createElement("param");q.setAttribute("name",n);q.setAttribute("value",p);o.appendChild(q)}function k(o,p,n){return function(q){if(n){document.getElementById(j.id+"_wrapper").appendChild(p)}var s=document.getElementById(j.id).getPluginConfig("display");o.resize(s.width,s.height);var r={left:s.x,top:s.y};a.utils.css(p,r)}}function d(p){if(!p){return{}}var r={};for(var o in p){var n=p[o];for(var q in n){r[o+"."+q]=n[q]}}return r}function h(q,p){if(q[p]){var s=q[p];for(var o in s){var n=s[o];if(typeof n=="string"){if(!q[o]){q[o]=n}}else{for(var r in n){if(!q[o+"."+r]){q[o+"."+r]=n[r]}}}}delete q[p]}}function b(q){if(!q){return{}}var t={},s=[];for(var n in q){var p=a.utils.getPluginName(n);var o=q[n];s.push(n);for(var r in o){t[p+"."+r]=o[r]}}t.plugins=s.join(",");return t}function c(p){var n=p.netstreambasepath?"":"netstreambasepath="+encodeURIComponent(window.location.href.split("#")[0])+"&";for(var o in p){if(typeof(p[o])=="object"){n+=o+"="+encodeURIComponent("[[JSON]]"+a.utils.strings.jsonToString(p[o]))+"&"}else{n+=o+"="+encodeURIComponent(p[o])+"&"}}return n.substring(0,n.length-1)}this.embed=function(){l.id=j.id;var y;var q=a.utils.extend({},l);var n=q.width;var w=q.height;if(f.id+"_wrapper"==f.parentNode.id){y=document.getElementById(f.id+"_wrapper")}else{y=document.createElement("div");y.id=f.id+"_wrapper";a.utils.wrap(f,y);a.utils.css(y,{position:"relative",width:n,height:w})}var o=e.setupPlugins(j,q,k);if(o.length>0){a.utils.extend(q,b(o.plugins))}else{delete q.plugins}var r=["height","width","modes","events"];for(var u=0;u';v+='';v+='';v+='';v+='';v+='';v+='';v+="";a.utils.setOuterHTML(f,v);t=document.getElementById(f.id)}else{var s=document.createElement("object");s.setAttribute("type","application/x-shockwave-flash");s.setAttribute("data",g.src);s.setAttribute("width","100%");s.setAttribute("height","100%");s.setAttribute("bgcolor","#000000");s.setAttribute("id",f.id);s.setAttribute("name",f.id);s.setAttribute("tabindex",0);m(s,"allowfullscreen","true");m(s,"allowscriptaccess","always");m(s,"seamlesstabbing","true");m(s,"wmode",p);m(s,"flashvars",c(q));f.parentNode.replaceChild(s,f);t=s}j.container=t;j.setPlayer(t,"flash")};this.supportsConfig=function(){if(a.utils.hasFlash()){if(l){var o=a.utils.getFirstPlaylistItemFromConfig(l);if(typeof o.file=="undefined"&&typeof o.levels=="undefined"){return true}else{if(o.file){return flashCanPlay(o.file,o.provider)}else{if(o.levels&&o.levels.length){for(var n=0;n0){j.skin=j.skin.replace(/\.zip/i,".xml")}var l=new (a.html5(c)).setup(j);f.container=document.getElementById(f.id);f.setPlayer(l,"html5")}else{return null}};this.supportsConfig=function(){if(!!a.vid.canPlayType){if(b){var j=a.utils.getFirstPlaylistItemFromConfig(b);if(typeof j.file=="undefined"&&typeof j.levels=="undefined"){return true}else{if(j.file){return html5CanPlay(a.vid,j.file,j.provider,j.playlistfile)}else{if(j.levels&&j.levels.length){for(var h=0;h0){D+=F.length;var J=F.indexOf("playlist"),I=F.indexOf("controlbar");if(J>=0&&I>=0){F[J]=F.splice(I,1,F[J])[0]}o(l,F,true)}}else{if(!(navigator&&navigator.vendor&&navigator.vendor.indexOf("Apple")==0)){o(B,G,true)}}y()}function o(J,G,H){var F=[];for(var E=0;E-1){percentage=parseFloat(x.width.substring(0,x.width.lastIndexOf("%")))/100;E=Math.round(window.innerWidth*percentage)}if(typeof x.height=="string"&&x.height.lastIndexOf("%")>-1){percentage=parseFloat(x.height.substring(0,x.height.lastIndexOf("%")))/100;F=Math.round(window.innerHeight*percentage)}return{position:"absolute",width:(E-d.parseDimension(s.style.left)-d.parseDimension(s.style.right)),height:(F-d.parseDimension(s.style.top)-d.parseDimension(s.style.bottom)),zIndex:H}}function B(E,F){return{position:"fixed",width:x.width,height:x.height,zIndex:F}}function y(){if(!d.exists(x.getMedia())){return}s.style.position="absolute";var H=x.getMedia().getDisplayElement();if(H&&H.tagName.toLowerCase()=="video"){H.style.position="absolute";var E,I;if(s.style.width.toString().lastIndexOf("%")>-1||s.style.width.toString().lastIndexOf("%")>-1){var F=s.getBoundingClientRect();E=Math.abs(F.left)+Math.abs(F.right);I=Math.abs(F.top)+Math.abs(F.bottom)}else{E=d.parseDimension(s.style.width);I=d.parseDimension(s.style.height)}if(H.parentNode){H.parentNode.style.left=s.style.left;H.parentNode.style.top=s.style.top}d.stretch(u.jwGetStretching(),H,E,I,H.videoWidth?H.videoWidth:400,H.videoHeight?H.videoHeight:300)}else{var G=x.plugins.object.display.getDisplayElement();if(G){x.getMedia().resize(d.parseDimension(G.style.width),d.parseDimension(G.style.height))}else{x.getMedia().resize(d.parseDimension(s.style.width),d.parseDimension(s.style.height))}}}function e(F){var G={position:"absolute",margin:0,padding:0,top:null};var E=x.plugins.config[F].currentPosition.toLowerCase();switch(E.toUpperCase()){case b.html5.view.positions.TOP:G.top=d.parseDimension(s.style.top);G.left=d.parseDimension(s.style.left);G.width=g-d.parseDimension(s.style.left)-d.parseDimension(s.style.right);G.height=x.plugins.object[F].height;s.style[E]=d.parseDimension(s.style[E])+x.plugins.object[F].height+"px";s.style.height=d.parseDimension(s.style.height)-G.height+"px";break;case b.html5.view.positions.RIGHT:G.top=d.parseDimension(s.style.top);G.right=d.parseDimension(s.style.right);G.width=x.plugins.object[F].width;G.height=C-d.parseDimension(s.style.top)-d.parseDimension(s.style.bottom);s.style[E]=d.parseDimension(s.style[E])+x.plugins.object[F].width+"px";s.style.width=d.parseDimension(s.style.width)-G.width+"px";break;case b.html5.view.positions.BOTTOM:G.bottom=d.parseDimension(s.style.bottom);G.left=d.parseDimension(s.style.left);G.width=g-d.parseDimension(s.style.left)-d.parseDimension(s.style.right);G.height=x.plugins.object[F].height;s.style[E]=d.parseDimension(s.style[E])+x.plugins.object[F].height+"px";s.style.height=d.parseDimension(s.style.height)-G.height+"px";break;case b.html5.view.positions.LEFT:G.top=d.parseDimension(s.style.top);G.left=d.parseDimension(s.style.left);G.width=x.plugins.object[F].width;G.height=C-d.parseDimension(s.style.top)-d.parseDimension(s.style.bottom);s.style[E]=d.parseDimension(s.style[E])+x.plugins.object[F].width+"px";s.style.width=d.parseDimension(s.style.width)-G.width+"px";break;default:break}return G}this.resize=j;this.fullscreen=function(H){if(navigator&&navigator.vendor&&navigator.vendor.indexOf("Apple")===0){if(x.getMedia().getDisplayElement().webkitSupportsFullscreen){if(H){try{x.getMedia().getDisplayElement().webkitEnterFullscreen()}catch(G){}}else{try{x.getMedia().getDisplayElement().webkitExitFullscreen()}catch(G){}}}}else{if(H){document.onkeydown=h;clearInterval(p);var F=document.body.getBoundingClientRect();x.width=Math.abs(F.left)+Math.abs(F.right);x.height=window.innerHeight;var E={position:"fixed",width:"100%",height:"100%",top:0,left:0,zIndex:2147483000};c(w,E);E.zIndex=1;if(x.getMedia()&&x.getMedia().getDisplayElement()){c(x.getMedia().getDisplayElement(),E)}E.zIndex=2;c(s,E)}else{document.onkeydown="";x.width=g;x.height=C;c(w,{position:"relative",height:x.height,width:x.width,zIndex:0})}j(x.width,x.height)}}};function a(e){return([b.html5.view.positions.TOP,b.html5.view.positions.RIGHT,b.html5.view.positions.BOTTOM,b.html5.view.positions.LEFT].toString().indexOf(e.toUpperCase())>-1)}b.html5.view.positions={TOP:"TOP",RIGHT:"RIGHT",BOTTOM:"BOTTOM",LEFT:"LEFT",OVER:"OVER",NONE:"NONE"}})(jwplayer);(function(a){var b={backgroundcolor:"",margin:10,font:"Arial,sans-serif",fontsize:10,fontcolor:parseInt("000000",16),fontstyle:"normal",fontweight:"bold",buttoncolor:parseInt("ffffff",16),position:a.html5.view.positions.BOTTOM,idlehide:false,layout:{left:{position:"left",elements:[{name:"play",type:"button"},{name:"divider",type:"divider"},{name:"prev",type:"button"},{name:"divider",type:"divider"},{name:"next",type:"button"},{name:"divider",type:"divider"},{name:"elapsed",type:"text"}]},center:{position:"center",elements:[{name:"time",type:"slider"}]},right:{position:"right",elements:[{name:"duration",type:"text"},{name:"blank",type:"button"},{name:"divider",type:"divider"},{name:"mute",type:"button"},{name:"volume",type:"slider"},{name:"divider",type:"divider"},{name:"fullscreen",type:"button"}]}}};_utils=a.utils;_css=_utils.css;_hide=function(c){_css(c,{display:"none"})};_show=function(c){_css(c,{display:"block"})};a.html5.controlbar=function(l,V){var k=l;var D=_utils.extend({},b,k.skin.getComponentSettings("controlbar"),V);if(D.position==a.html5.view.positions.NONE||typeof a.html5.view.positions[D.position]=="undefined"){return}if(_utils.mapLength(k.skin.getComponentLayout("controlbar"))>0){D.layout=k.skin.getComponentLayout("controlbar")}var ac;var P;var ab;var E;var v="none";var g;var j;var ad;var f;var e;var y;var Q={};var p=false;var c={};var Y;var h=false;var o;var d;var S=false;var G=false;var W=new a.html5.eventdispatcher();_utils.extend(this,W);function J(){if(!Y){Y=k.skin.getSkinElement("controlbar","background");if(!Y){Y={width:0,height:0,src:null}}}return Y}function N(){ab=0;E=0;P=0;if(!p){var ak={height:J().height,backgroundColor:D.backgroundcolor};ac=document.createElement("div");ac.id=k.id+"_jwplayer_controlbar";_css(ac,ak)}var aj=(k.skin.getSkinElement("controlbar","capLeft"));var ai=(k.skin.getSkinElement("controlbar","capRight"));if(aj){x("capLeft","left",false,ac)}var al={position:"absolute",height:J().height,left:(aj?aj.width:0),zIndex:0};Z("background",ac,al,"img");if(J().src){Q.background.src=J().src}al.zIndex=1;Z("elements",ac,al);if(ai){x("capRight","right",false,ac)}}this.getDisplayElement=function(){return ac};this.resize=function(ak,ai){_utils.cancelAnimation(ac);document.getElementById(k.id).onmousemove=A;e=ak;y=ai;if(G!=k.jwGetFullscreen()){G=k.jwGetFullscreen();d=undefined}var aj=w();A();I({id:k.id,duration:ad,position:j});u({id:k.id,bufferPercent:f});return aj};this.show=function(){if(h){h=false;_show(ac);T()}};this.hide=function(){if(!h){h=true;_hide(ac);aa()}};function q(){var aj=["timeSlider","volumeSlider","timeSliderRail","volumeSliderRail"];for(var ak in aj){var ai=aj[ak];if(typeof Q[ai]!="undefined"){c[ai]=Q[ai].getBoundingClientRect()}}}function A(ai){if(h){return}if(D.position==a.html5.view.positions.OVER||k.jwGetFullscreen()){clearTimeout(o);switch(k.jwGetState()){case a.api.events.state.PAUSED:case a.api.events.state.IDLE:if(!D.idlehide||_utils.exists(ai)){U()}if(D.idlehide){o=setTimeout(function(){z()},2000)}break;default:if(ai){U()}o=setTimeout(function(){z()},2000);break}}}function z(ai){aa();_utils.cancelAnimation(ac);_utils.fadeTo(ac,0,0.1,1,0)}function U(){T();_utils.cancelAnimation(ac);_utils.fadeTo(ac,1,0,1,0)}function H(ai){return function(){if(S&&d!=ai){d=ai;W.sendEvent(ai,{component:"controlbar",boundingRect:O()})}}}var T=H(a.api.events.JWPLAYER_COMPONENT_SHOW);var aa=H(a.api.events.JWPLAYER_COMPONENT_HIDE);function O(){if(D.position==a.html5.view.positions.OVER||k.jwGetFullscreen()){return _utils.getDimensions(ac)}else{return{x:0,y:0,width:0,height:0}}}function Z(am,al,ak,ai){var aj;if(!p){if(!ai){ai="div"}aj=document.createElement(ai);Q[am]=aj;aj.id=ac.id+"_"+am;al.appendChild(aj)}else{aj=document.getElementById(ac.id+"_"+am)}if(_utils.exists(ak)){_css(aj,ak)}return aj}function M(){ah(D.layout.left);ah(D.layout.right,-1);ah(D.layout.center)}function ah(al,ai){var am=al.position=="right"?"right":"left";var ak=_utils.extend([],al.elements);if(_utils.exists(ai)){ak.reverse()}for(var aj=0;aj0||al.indexOf("divider")===0){var an={height:J().height,position:"absolute",display:"block",top:0};if((al.indexOf("next")===0||al.indexOf("prev")===0)&&k.jwGetPlaylist().length<2){aj=false;an.display="none"}var at;if(al.indexOf("Text")>0){al.innerhtml="00:00";an.font=D.fontsize+"px/"+(J().height+1)+"px "+D.font;an.color=D.fontcolor;an.textAlign="center";an.fontWeight=D.fontweight;an.fontStyle=D.fontstyle;an.cursor="default";at=14+3*D.fontsize}else{if(al.indexOf("divider")===0){if(ai){if(!isNaN(parseInt(ai))){at=parseInt(ai)}}else{if(ak){var ap=k.skin.getSkinElement("controlbar",ak);if(ap){an.background="url("+ap.src+") repeat-x center left";at=ap.width}}else{an.background="url("+k.skin.getSkinElement("controlbar","divider").src+") repeat-x center left";at=k.skin.getSkinElement("controlbar","divider").width}}}else{an.background="url("+k.skin.getSkinElement("controlbar",al).src+") repeat-x center left";at=k.skin.getSkinElement("controlbar",al).width}}if(ao=="left"){an.left=isNaN(am)?ab:am;if(aj){ab+=at}}else{if(ao=="right"){an.right=isNaN(am)?E:am;if(aj){E+=at}}}if(_utils.typeOf(ar)=="undefined"){ar=Q.elements}an.width=at;if(p){_css(Q[al],an)}else{var aq=Z(al,ar,an);if(_utils.exists(k.skin.getSkinElement("controlbar",al+"Over"))){aq.onmouseover=function(au){aq.style.backgroundImage=["url(",k.skin.getSkinElement("controlbar",al+"Over").src,")"].join("")};aq.onmouseout=function(au){aq.style.backgroundImage=["url(",k.skin.getSkinElement("controlbar",al).src,")"].join("")}}}}}function F(){k.jwAddEventListener(a.api.events.JWPLAYER_PLAYLIST_LOADED,B);k.jwAddEventListener(a.api.events.JWPLAYER_PLAYLIST_ITEM,s);k.jwAddEventListener(a.api.events.JWPLAYER_MEDIA_BUFFER,u);k.jwAddEventListener(a.api.events.JWPLAYER_PLAYER_STATE,r);k.jwAddEventListener(a.api.events.JWPLAYER_MEDIA_TIME,I);k.jwAddEventListener(a.api.events.JWPLAYER_MEDIA_MUTE,ag);k.jwAddEventListener(a.api.events.JWPLAYER_MEDIA_VOLUME,m);k.jwAddEventListener(a.api.events.JWPLAYER_MEDIA_COMPLETE,L)}function B(){N();M();w();ae()}function s(ai){ad=k.jwGetPlaylist()[ai.index].duration;I({id:k.id,duration:ad,position:0});u({id:k.id,bufferProgress:0})}function ae(){I({id:k.id,duration:k.jwGetDuration(),position:0});u({id:k.id,bufferProgress:0});ag({id:k.id,mute:k.jwGetMute()});r({id:k.id,newstate:a.api.events.state.IDLE});m({id:k.id,volume:k.jwGetVolume()})}function R(ak,al,aj){if(p){return}if(_utils.exists(k.skin.getSkinElement("controlbar",ak))){var ai=Q[ak];if(_utils.exists(ai)){_css(ai,{cursor:"pointer"});if(al=="fullscreen"){ai.onmouseup=function(am){am.stopPropagation();k.jwSetFullscreen(!k.jwGetFullscreen())}}else{ai.onmouseup=function(am){am.stopPropagation();if(_utils.exists(aj)){k[al](aj)}else{k[al]()}}}}}}function X(ai){if(p){return}var aj=Q[ai+"Slider"];_css(Q.elements,{cursor:"pointer"});_css(aj,{cursor:"pointer"});aj.onmousedown=function(ak){v=ai};aj.onmouseup=function(ak){ak.stopPropagation();af(ak.pageX)};aj.onmousemove=function(ak){if(v=="time"){g=true;var al=ak.pageX-c[ai+"Slider"].left-window.pageXOffset;_css(Q.timeSliderThumb,{left:al})}}}function af(aj){g=false;var ai;if(v=="time"){ai=aj-c.timeSliderRail.left+window.pageXOffset;var al=ai/c.timeSliderRail.width*ad;if(al<0){al=0}else{if(al>ad){al=ad-3}}if(k.jwGetState()==a.api.events.state.PAUSED||k.jwGetState()==a.api.events.state.IDLE){k.jwPlay()}k.jwSeek(al)}else{if(v=="volume"){ai=aj-c.volumeSliderRail.left-window.pageXOffset;var ak=Math.round(ai/c.volumeSliderRail.width*100);if(ak<0){ak=0}else{if(ak>100){ak=100}}if(k.jwGetMute()){k.jwSetMute(false)}k.jwSetVolume(ak)}}v="none"}function u(aj){if(_utils.exists(aj.bufferPercent)){f=aj.bufferPercent}if(c.timeSliderRail){var ak=c.timeSliderRail.width;var ai=isNaN(Math.round(ak*f/100))?0:Math.round(ak*f/100);_css(Q.timeSliderBuffer,{width:ai})}}function ag(ai){if(ai.mute){_hide(Q.muteButton);_show(Q.unmuteButton);_hide(Q.volumeSliderProgress)}else{_show(Q.muteButton);_hide(Q.unmuteButton);_show(Q.volumeSliderProgress)}}function r(ai){if(ai.newstate==a.api.events.state.BUFFERING||ai.newstate==a.api.events.state.PLAYING){_show(Q.pauseButton);_hide(Q.playButton)}else{_hide(Q.pauseButton);_show(Q.playButton)}A();if(ai.newstate==a.api.events.state.IDLE){_hide(Q.timeSliderBuffer);_hide(Q.timeSliderProgress);_hide(Q.timeSliderThumb);I({id:k.id,duration:k.jwGetDuration(),position:0})}else{_show(Q.timeSliderBuffer);if(ai.newstate!=a.api.events.state.BUFFERING){_show(Q.timeSliderProgress);_show(Q.timeSliderThumb)}}}function L(ai){u({bufferPercent:0});I(_utils.extend(ai,{position:0,duration:ad}))}function I(al){if(_utils.exists(al.position)){j=al.position}if(_utils.exists(al.duration)){ad=al.duration}var aj=(j===ad===0)?0:j/ad;var am=c.timeSliderRail;if(am){var ai=isNaN(Math.round(am.width*aj))?0:Math.round(am.width*aj);var ak=ai;if(Q.timeSliderProgress){Q.timeSliderProgress.style.width=ai+"px";if(!g){if(Q.timeSliderThumb){Q.timeSliderThumb.style.left=ak+"px"}}}}if(Q.durationText){Q.durationText.innerHTML=_utils.timeFormat(ad)}if(Q.elapsedText){Q.elapsedText.innerHTML=_utils.timeFormat(j)}}function n(){var am,aj;var ak=document.getElementById(ac.id+"_elements");if(!ak){return}var al=ak.childNodes;for(var ai in ak.childNodes){if(isNaN(parseInt(ai,10))){continue}if(al[ai].id.indexOf(ac.id+"_divider")===0&&aj&&aj.id.indexOf(ac.id+"_divider")===0&&al[ai].style.backgroundImage==aj.style.backgroundImage){al[ai].style.display="none"}else{if(al[ai].id.indexOf(ac.id+"_divider")===0&&am&&am.style.display!="none"){al[ai].style.display="block"}}if(al[ai].style.display!="none"){aj=al[ai]}am=al[ai]}}function w(){n();if(k.jwGetFullscreen()){_show(Q.normalscreenButton);_hide(Q.fullscreenButton)}else{_hide(Q.normalscreenButton);_show(Q.fullscreenButton)}var aj={width:e};var ai={};if(D.position==a.html5.view.positions.OVER||k.jwGetFullscreen()){aj.left=D.margin;aj.width-=2*D.margin;aj.top=y-J().height-D.margin;aj.height=J().height}var al=k.skin.getSkinElement("controlbar","capLeft");var ak=k.skin.getSkinElement("controlbar","capRight");ai.left=al?al.width:0;ai.width=aj.width-ai.left-(ak?ak.width:0);var am=!_utils.exists(k.skin.getSkinElement("controlbar","timeSliderCapLeft"))?0:k.skin.getSkinElement("controlbar","timeSliderCapLeft").width;_css(Q.timeSliderRail,{width:(ai.width-ab-E),left:am});if(_utils.exists(Q.timeSliderCapRight)){_css(Q.timeSliderCapRight,{left:am+(ai.width-ab-E)})}_css(ac,aj);_css(Q.elements,ai);_css(Q.background,ai);q();return aj}function m(am){if(_utils.exists(Q.volumeSliderRail)){var ak=isNaN(am.volume/100)?1:am.volume/100;var al=_utils.parseDimension(Q.volumeSliderRail.style.width);var ai=isNaN(Math.round(al*ak))?0:Math.round(al*ak);var an=_utils.parseDimension(Q.volumeSliderRail.style.right);var aj=(!_utils.exists(k.skin.getSkinElement("controlbar","volumeSliderCapLeft")))?0:k.skin.getSkinElement("controlbar","volumeSliderCapLeft").width;_css(Q.volumeSliderProgress,{width:ai,left:aj});if(_utils.exists(Q.volumeSliderCapLeft)){_css(Q.volumeSliderCapLeft,{left:0})}}}function t(){N();M();q();p=true;F();D.idlehide=(D.idlehide.toString().toLowerCase()=="true");if(D.position==a.html5.view.positions.OVER&&D.idlehide){ac.style.opacity=0;S=true}else{setTimeout((function(){S=true;T()}),1)}ae()}t();return this}})(jwplayer);(function(b){var a=["width","height","state","playlist","item","position","buffer","duration","volume","mute","fullscreen"];var c=b.utils;b.html5.controller=function(z,w,h,v){var C=z;var G=h;var g=v;var o=w;var J=true;var e=-1;var A=c.exists(G.config.debug)&&(G.config.debug.toString().toLowerCase()=="console");var m=new b.html5.eventdispatcher(o.id,A);c.extend(this,m);var E=[];var d=false;function r(M){if(d){m.sendEvent(M.type,M)}else{E.push(M)}}function K(M){if(!d){m.sendEvent(b.api.events.JWPLAYER_READY,M);if(b.utils.exists(window.playerReady)){playerReady(M)}if(b.utils.exists(window[h.config.playerReady])){window[h.config.playerReady](M)}while(E.length>0){var O=E.shift();m.sendEvent(O.type,O)}if(h.config.autostart&&!b.utils.isIOS()){t(G.item)}while(p.length>0){var N=p.shift();x(N.method,N.arguments)}d=true}}G.addGlobalListener(r);G.addEventListener(b.api.events.JWPLAYER_MEDIA_BUFFER_FULL,function(){G.getMedia().play()});G.addEventListener(b.api.events.JWPLAYER_MEDIA_TIME,function(M){if(M.position>=G.playlist[G.item].start&&e>=0){G.playlist[G.item].start=e;e=-1}});G.addEventListener(b.api.events.JWPLAYER_MEDIA_COMPLETE,function(M){setTimeout(s,25)});function u(){try{f(G.item);if(G.playlist[G.item].levels[0].file.length>0){if(J||G.state==b.api.events.state.IDLE){G.getMedia().load(G.playlist[G.item]);J=false}else{if(G.state==b.api.events.state.PAUSED){G.getMedia().play()}}}return true}catch(M){m.sendEvent(b.api.events.JWPLAYER_ERROR,M)}return false}function I(){try{if(G.playlist[G.item].levels[0].file.length>0){switch(G.state){case b.api.events.state.PLAYING:case b.api.events.state.BUFFERING:G.getMedia().pause();break}}return true}catch(M){m.sendEvent(b.api.events.JWPLAYER_ERROR,M)}return false}function D(M){try{if(G.playlist[G.item].levels[0].file.length>0){if(typeof M!="number"){M=parseFloat(M)}switch(G.state){case b.api.events.state.IDLE:if(e<0){e=G.playlist[G.item].start;G.playlist[G.item].start=M}u();break;case b.api.events.state.PLAYING:case b.api.events.state.PAUSED:case b.api.events.state.BUFFERING:G.seek(M);break}}return true}catch(N){m.sendEvent(b.api.events.JWPLAYER_ERROR,N)}return false}function n(M){if(!c.exists(M)){M=true}try{G.getMedia().stop(M);return true}catch(N){m.sendEvent(b.api.events.JWPLAYER_ERROR,N)}return false}function k(){try{if(G.playlist[G.item].levels[0].file.length>0){if(G.config.shuffle){f(y())}else{if(G.item+1==G.playlist.length){f(0)}else{f(G.item+1)}}}if(G.state!=b.api.events.state.IDLE){var N=G.state;G.state=b.api.events.state.IDLE;m.sendEvent(b.api.events.JWPLAYER_PLAYER_STATE,{oldstate:N,newstate:b.api.events.state.IDLE})}u();return true}catch(M){m.sendEvent(b.api.events.JWPLAYER_ERROR,M)}return false}function j(){try{if(G.playlist[G.item].levels[0].file.length>0){if(G.config.shuffle){f(y())}else{if(G.item===0){f(G.playlist.length-1)}else{f(G.item-1)}}}if(G.state!=b.api.events.state.IDLE){var N=G.state;G.state=b.api.events.state.IDLE;m.sendEvent(b.api.events.JWPLAYER_PLAYER_STATE,{oldstate:N,newstate:b.api.events.state.IDLE})}u();return true}catch(M){m.sendEvent(b.api.events.JWPLAYER_ERROR,M)}return false}function y(){var M=null;if(G.playlist.length>1){while(!c.exists(M)){M=Math.floor(Math.random()*G.playlist.length);if(M==G.item){M=null}}}else{M=0}return M}function t(N){if(!G.playlist||!G.playlist[N]){return false}try{if(G.playlist[N].levels[0].file.length>0){var O=G.state;if(O!==b.api.events.state.IDLE){if(G.playlist[G.item].provider==G.playlist[N].provider){n(false)}else{n()}}f(N);u()}return true}catch(M){m.sendEvent(b.api.events.JWPLAYER_ERROR,M)}return false}function f(M){if(!G.playlist[M]){return}G.setActiveMediaProvider(G.playlist[M]);if(G.item!=M){G.item=M;J=true;m.sendEvent(b.api.events.JWPLAYER_PLAYLIST_ITEM,{index:M})}}function H(N){try{f(G.item);var O=G.getMedia();switch(typeof(N)){case"number":O.volume(N);break;case"string":O.volume(parseInt(N,10));break}return true}catch(M){m.sendEvent(b.api.events.JWPLAYER_ERROR,M)}return false}function q(N){try{f(G.item);var O=G.getMedia();if(typeof N=="undefined"){O.mute(!G.mute)}else{if(N.toString().toLowerCase()=="true"){O.mute(true)}else{O.mute(false)}}return true}catch(M){m.sendEvent(b.api.events.JWPLAYER_ERROR,M)}return false}function l(N,M){try{G.width=N;G.height=M;g.resize(N,M);m.sendEvent(b.api.events.JWPLAYER_RESIZE,{width:G.width,height:G.height});return true}catch(O){m.sendEvent(b.api.events.JWPLAYER_ERROR,O)}return false}function B(N){try{if(typeof N=="undefined"){G.fullscreen=!G.fullscreen;g.fullscreen(!G.fullscreen)}else{if(N.toString().toLowerCase()=="true"){G.fullscreen=true;g.fullscreen(true)}else{G.fullscreen=false;g.fullscreen(false)}}m.sendEvent(b.api.events.JWPLAYER_RESIZE,{width:G.width,height:G.height});m.sendEvent(b.api.events.JWPLAYER_FULLSCREEN,{fullscreen:N});return true}catch(M){m.sendEvent(b.api.events.JWPLAYER_ERROR,M)}return false}function L(M){try{n();G.loadPlaylist(M);f(G.item);return true}catch(N){m.sendEvent(b.api.events.JWPLAYER_ERROR,N)}return false}b.html5.controller.repeatoptions={LIST:"LIST",ALWAYS:"ALWAYS",SINGLE:"SINGLE",NONE:"NONE"};function s(){switch(G.config.repeat.toUpperCase()){case b.html5.controller.repeatoptions.SINGLE:u();break;case b.html5.controller.repeatoptions.ALWAYS:if(G.item==G.playlist.length-1&&!G.config.shuffle){t(0)}else{k()}break;case b.html5.controller.repeatoptions.LIST:if(G.item==G.playlist.length-1&&!G.config.shuffle){n();f(0)}else{k()}break;default:n();break}}var p=[];function F(M){return function(){if(d){x(M,arguments)}else{p.push({method:M,arguments:arguments})}}}function x(O,N){var M=[];for(i=0;i';this.xml=null;if(window.DOMParser){parser=new DOMParser();this.xml=parser.parseFromString(this.text,"text/xml")}else{this.xml=new ActiveXObject("Microsoft.XMLDOM");this.xml.async="false";this.xml.loadXML(this.text)}return this}})(jwplayer);(function(a){_utils=a.utils;_css=_utils.css;_hide=function(b){_css(b,{display:"none"})};_show=function(b){_css(b,{display:"block"})};a.html5.display=function(k,G){var j={icons:true,showmute:false};var Q=_utils.extend({},j,G);var h=k;var P={};var e;var u;var w;var N;var s;var I;var A;var J=!_utils.exists(h.skin.getComponentSettings("display").bufferrotation)?15:parseInt(h.skin.getComponentSettings("display").bufferrotation,10);var q=!_utils.exists(h.skin.getComponentSettings("display").bufferinterval)?100:parseInt(h.skin.getComponentSettings("display").bufferinterval,10);var z=-1;var t="";var K=true;var d;var g=false;var n=false;var H=new a.html5.eventdispatcher();_utils.extend(this,H);var D={display:{style:{cursor:"pointer",top:0,left:0,overflow:"hidden"},click:m},display_icon:{style:{cursor:"pointer",position:"absolute",top:((h.skin.getSkinElement("display","background").height-h.skin.getSkinElement("display","playIcon").height)/2),left:((h.skin.getSkinElement("display","background").width-h.skin.getSkinElement("display","playIcon").width)/2),border:0,margin:0,padding:0,zIndex:3,display:"none"}},display_iconBackground:{style:{cursor:"pointer",position:"absolute",top:((u-h.skin.getSkinElement("display","background").height)/2),left:((e-h.skin.getSkinElement("display","background").width)/2),border:0,backgroundImage:(["url(",h.skin.getSkinElement("display","background").src,")"]).join(""),width:h.skin.getSkinElement("display","background").width,height:h.skin.getSkinElement("display","background").height,margin:0,padding:0,zIndex:2,display:"none"}},display_image:{style:{display:"none",width:e,height:u,position:"absolute",cursor:"pointer",left:0,top:0,margin:0,padding:0,textDecoration:"none",zIndex:1}},display_text:{style:{zIndex:4,position:"relative",opacity:0.8,backgroundColor:parseInt("000000",16),color:parseInt("ffffff",16),textAlign:"center",fontFamily:"Arial,sans-serif",padding:"0 5px",fontSize:14}}};h.jwAddEventListener(a.api.events.JWPLAYER_PLAYER_STATE,p);h.jwAddEventListener(a.api.events.JWPLAYER_MEDIA_MUTE,p);h.jwAddEventListener(a.api.events.JWPLAYER_PLAYLIST_ITEM,p);h.jwAddEventListener(a.api.events.JWPLAYER_ERROR,o);L();function L(){P.display=C("div","display");P.display_text=C("div","display_text");P.display.appendChild(P.display_text);P.display_image=C("img","display_image");P.display_image.onerror=function(R){_hide(P.display_image)};P.display_image.onload=y;P.display_icon=C("div","display_icon");P.display_iconBackground=C("div","display_iconBackground");P.display.appendChild(P.display_image);P.display_iconBackground.appendChild(P.display_icon);P.display.appendChild(P.display_iconBackground);f();setTimeout((function(){n=true;if(Q.icons.toString()=="true"){F()}}),1)}this.getDisplayElement=function(){return P.display};this.resize=function(S,R){_css(P.display,{width:S,height:R});_css(P.display_text,{width:(S-10),top:((R-P.display_text.getBoundingClientRect().height)/2)});_css(P.display_iconBackground,{top:((R-h.skin.getSkinElement("display","background").height)/2),left:((S-h.skin.getSkinElement("display","background").width)/2)});if(e!=S||u!=R){e=S;u=R;d=undefined;F()}c();p({})};this.show=function(){if(g){g=false;r(h.jwGetState())}};this.hide=function(){if(!g){B();g=true}};function y(R){w=P.display_image.naturalWidth;N=P.display_image.naturalHeight;c()}function c(){_utils.stretch(h.jwGetStretching(),P.display_image,e,u,w,N)}function C(R,T){var S=document.createElement(R);S.id=h.id+"_jwplayer_"+T;_css(S,D[T].style);return S}function f(){for(var R in P){if(_utils.exists(D[R].click)){P[R].onclick=D[R].click}}}function m(R){if(typeof R.preventDefault!="undefined"){R.preventDefault()}else{R.returnValue=false}if(h.jwGetState()!=a.api.events.state.PLAYING){h.jwPlay()}else{h.jwPause()}}function O(R){if(A){B();return}P.display_icon.style.backgroundImage=(["url(",h.skin.getSkinElement("display",R).src,")"]).join("");_css(P.display_icon,{width:h.skin.getSkinElement("display",R).width,height:h.skin.getSkinElement("display",R).height,top:(h.skin.getSkinElement("display","background").height-h.skin.getSkinElement("display",R).height)/2,left:(h.skin.getSkinElement("display","background").width-h.skin.getSkinElement("display",R).width)/2});b();if(_utils.exists(h.skin.getSkinElement("display",R+"Over"))){P.display_icon.onmouseover=function(S){P.display_icon.style.backgroundImage=["url(",h.skin.getSkinElement("display",R+"Over").src,")"].join("")};P.display_icon.onmouseout=function(S){P.display_icon.style.backgroundImage=["url(",h.skin.getSkinElement("display",R).src,")"].join("")}}else{P.display_icon.onmouseover=null;P.display_icon.onmouseout=null}}function B(){if(Q.icons.toString()=="true"){_hide(P.display_icon);_hide(P.display_iconBackground);M()}}function b(){if(!g&&Q.icons.toString()=="true"){_show(P.display_icon);_show(P.display_iconBackground);F()}}function o(R){A=true;B();P.display_text.innerHTML=R.error;_show(P.display_text);P.display_text.style.top=((u-P.display_text.getBoundingClientRect().height)/2)+"px"}function E(){P.display_image.style.display="none"}function p(R){if((R.type==a.api.events.JWPLAYER_PLAYER_STATE||R.type==a.api.events.JWPLAYER_PLAYLIST_ITEM)&&A){A=false;_hide(P.display_text)}var S=h.jwGetState();if(S==t){return}t=S;if(z>=0){clearTimeout(z)}if(K||h.jwGetState()==a.api.events.state.PLAYING||h.jwGetState()==a.api.events.state.PAUSED){r(h.jwGetState())}else{z=setTimeout(l(h.jwGetState()),500)}}function l(R){return(function(){r(R)})}function r(R){if(_utils.exists(I)){clearInterval(I);I=null;_utils.animations.rotate(P.display_icon,0)}switch(R){case a.api.events.state.BUFFERING:if(_utils.isIOS()){E();B()}else{if(h.jwGetPlaylist()[h.jwGetItem()].provider=="sound"){v()}s=0;I=setInterval(function(){s+=J;_utils.animations.rotate(P.display_icon,s%360)},q);O("bufferIcon");K=true}break;case a.api.events.state.PAUSED:if(!_utils.isIOS()){if(h.jwGetPlaylist()[h.jwGetItem()].provider!="sound"){_css(P.display_image,{background:"transparent no-repeat center center"})}O("playIcon");K=true}break;case a.api.events.state.IDLE:if(h.jwGetPlaylist()[h.jwGetItem()]&&h.jwGetPlaylist()[h.jwGetItem()].image){v()}else{E()}O("playIcon");K=true;break;default:if(h.jwGetPlaylist()[h.jwGetItem()]&&h.jwGetPlaylist()[h.jwGetItem()].provider=="sound"){if(_utils.isIOS()){E();K=false}else{v()}}else{E();K=false}if(h.jwGetMute()&&Q.showmute){O("muteIcon")}else{B()}break}z=-1}function v(){if(h.jwGetPlaylist()[h.jwGetItem()]&&h.jwGetPlaylist()[h.jwGetItem()].image){_css(P.display_image,{display:"block"});P.display_image.src=_utils.getAbsolutePath(h.jwGetPlaylist()[h.jwGetItem()].image)}}function x(R){return function(){if(!n){return}if(!g&&d!=R){d=R;H.sendEvent(R,{component:"display",boundingRect:_utils.getDimensions(P.display_iconBackground)})}}}var F=x(a.api.events.JWPLAYER_COMPONENT_SHOW);var M=x(a.api.events.JWPLAYER_COMPONENT_HIDE);return this}})(jwplayer);(function(a){_css=a.utils.css;a.html5.dock=function(p,u){function q(){return{align:a.html5.view.positions.RIGHT}}var k=a.utils.extend({},q(),u);if(k.align=="FALSE"){return}var f={};var s=[];var g;var v;var d=false;var t=false;var e={x:0,y:0,width:0,height:0};var r;var j=new a.html5.eventdispatcher();_utils.extend(this,j);var m=document.createElement("div");m.id=p.id+"_jwplayer_dock";p.jwAddEventListener(a.api.events.JWPLAYER_PLAYER_STATE,l);this.getDisplayElement=function(){return m};this.setButton=function(A,x,y,z){if(!x&&f[A]){a.utils.arrays.remove(s,A);m.removeChild(f[A].div);delete f[A]}else{if(x){if(!f[A]){f[A]={}}f[A].handler=x;f[A].outGraphic=y;f[A].overGraphic=z;if(!f[A].div){s.push(A);f[A].div=document.createElement("div");f[A].div.style.position="relative";m.appendChild(f[A].div);f[A].div.appendChild(document.createElement("img"));f[A].div.childNodes[0].style.position="absolute";f[A].div.childNodes[0].style.left=0;f[A].div.childNodes[0].style.top=0;f[A].div.childNodes[0].style.zIndex=10;f[A].div.childNodes[0].style.cursor="pointer";f[A].div.appendChild(document.createElement("img"));f[A].div.childNodes[1].style.position="absolute";f[A].div.childNodes[1].style.left=0;f[A].div.childNodes[1].style.top=0;if(p.skin.getSkinElement("dock","button")){f[A].div.childNodes[1].src=p.skin.getSkinElement("dock","button").src}f[A].div.childNodes[1].style.zIndex=9;f[A].div.childNodes[1].style.cursor="pointer";f[A].div.onmouseover=function(){if(f[A].overGraphic){f[A].div.childNodes[0].src=f[A].overGraphic}if(p.skin.getSkinElement("dock","buttonOver")){f[A].div.childNodes[1].src=p.skin.getSkinElement("dock","buttonOver").src}};f[A].div.onmouseout=function(){if(f[A].outGraphic){f[A].div.childNodes[0].src=f[A].outGraphic}if(p.skin.getSkinElement("dock","button")){f[A].div.childNodes[1].src=p.skin.getSkinElement("dock","button").src}};if(f[A].overGraphic){f[A].div.childNodes[0].src=f[A].overGraphic}if(f[A].outGraphic){f[A].div.childNodes[0].src=f[A].outGraphic}if(p.skin.getSkinElement("dock","button")){f[A].div.childNodes[1].src=p.skin.getSkinElement("dock","button").src}}if(x){f[A].div.onclick=function(B){B.preventDefault();a(p.id).callback(A);if(f[A].overGraphic){f[A].div.childNodes[0].src=f[A].overGraphic}if(p.skin.getSkinElement("dock","button")){f[A].div.childNodes[1].src=p.skin.getSkinElement("dock","button").src}}}}}h(g,v)};function h(x,J){if(s.length>0){var y=10;var I=y;var F=-1;var G=p.skin.getSkinElement("dock","button").height;var E=p.skin.getSkinElement("dock","button").width;var C=x-E-y;var H,B;if(k.align==a.html5.view.positions.LEFT){F=1;C=y}for(var z=0;z((K+1)*J)){I=((K+1)*J)+y;K=Math.floor(I/J)}var A=f[s[z]].div;A.style.top=(I%J)+"px";A.style.left=(C+(p.skin.getSkinElement("dock","button").width+y)*K*F)+"px";var D={x:a.utils.parseDimension(A.style.left),y:a.utils.parseDimension(A.style.top),width:E,height:G};if(!H||(D.x<=H.x&&D.y<=H.y)){H=D}if(!B||(D.x>=B.x&&D.y>=B.y)){B=D}I+=p.skin.getSkinElement("dock","button").height+y}e={x:H.x,y:H.y,width:B.x-H.x+B.width,height:H.y-B.y+B.height}}if(t!=p.jwGetFullscreen()||g!=x||v!=J){g=x;v=J;t=p.jwGetFullscreen();r=undefined;setTimeout(n,1)}}function b(x){return function(){if(!d&&r!=x&&s.length>0){r=x;j.sendEvent(x,{component:"dock",boundingRect:e})}}}function l(x){if(a.utils.isIOS()){switch(x.newstate){case a.api.events.state.IDLE:o();break;default:c();break}}}var n=b(a.api.events.JWPLAYER_COMPONENT_SHOW);var w=b(a.api.events.JWPLAYER_COMPONENT_HIDE);this.resize=h;var o=function(){_css(m,{display:"block"});if(d){d=false;n()}};var c=function(){_css(m,{display:"none"});if(!d){w();d=true}};this.hide=c;this.show=o;return this}})(jwplayer);(function(a){a.html5.eventdispatcher=function(d,b){var c=new a.events.eventdispatcher(b);a.utils.extend(this,c);this.sendEvent=function(e,f){if(!a.utils.exists(f)){f={}}a.utils.extend(f,{id:d,version:a.version,type:e});c.sendEvent(e,f)}}})(jwplayer);(function(a){var b={prefix:"http://l.longtailvideo.com/html5/",file:"logo.png",link:"http://www.longtailvideo.com/players/jw-flv-player/",margin:8,out:0.5,over:1,timeout:5,hide:true,position:"bottom-left"};_css=a.utils.css;a.html5.logo=function(n,r){var q=n;var u;var d;var t;var h=false;g();function g(){o();c();l()}function o(){if(b.prefix){var v=n.version.split(/\W/).splice(0,2).join("/");if(b.prefix.indexOf(v)<0){b.prefix+=v+"/"}}if(r.position==a.html5.view.positions.OVER){r.position=b.position}d=a.utils.extend({},b)}function c(){t=document.createElement("img");t.id=q.id+"_jwplayer_logo";t.style.display="none";t.onload=function(v){_css(t,k());q.jwAddEventListener(a.api.events.JWPLAYER_PLAYER_STATE,j);p()};if(!d.file){return}if(d.file.indexOf("http://")===0){t.src=d.file}else{t.src=d.prefix+d.file}}if(!d.file){return}this.resize=function(w,v){};this.getDisplayElement=function(){return t};function l(){if(d.link){t.onmouseover=f;t.onmouseout=p;t.onclick=s}else{this.mouseEnabled=false}}function s(v){if(typeof v!="undefined"){v.stopPropagation()}if(!h){return}q.jwPause();q.jwSetFullscreen(false);if(d.link){window.open(d.link,"_top")}return}function p(v){if(d.link&&h){t.style.opacity=d.out}return}function f(v){if(d.hide.toString()=="true"&&h){t.style.opacity=d.over}return}function k(){var x={textDecoration:"none",position:"absolute",cursor:"pointer"};x.display=(d.hide.toString()=="true")?"none":"block";var w=d.position.toLowerCase().split("-");for(var v in w){x[w[v]]=d.margin}return x}function m(){if(d.hide.toString()=="true"){t.style.display="block";t.style.opacity=0;a.utils.fadeTo(t,d.out,0.1,parseFloat(t.style.opacity));u=setTimeout(function(){e()},d.timeout*1000)}h=true}function e(){h=false;if(d.hide.toString()=="true"){a.utils.fadeTo(t,0,0.1,parseFloat(t.style.opacity))}}function j(v){if(v.newstate==a.api.events.state.BUFFERING){clearTimeout(u);m()}}return this}})(jwplayer);(function(a){var c={ended:a.api.events.state.IDLE,playing:a.api.events.state.PLAYING,pause:a.api.events.state.PAUSED,buffering:a.api.events.state.BUFFERING};var e=a.utils;var b=e.css;var d=e.isIOS();a.html5.mediavideo=function(h,s){var r={abort:n,canplay:k,canplaythrough:k,durationchange:G,emptied:n,ended:k,error:u,loadeddata:G,loadedmetadata:G,loadstart:k,pause:k,play:n,playing:k,progress:v,ratechange:n,seeked:k,seeking:k,stalled:k,suspend:k,timeupdate:D,volumechange:n,waiting:k,canshowcurrentframe:n,dataunavailable:n,empty:n,load:z,loadedfirstframe:n};var j=new a.html5.eventdispatcher();e.extend(this,j);var y=h,l=s,m,B,A,x,f,H=false,C,p,q;o();this.load=function(J,K){if(typeof K=="undefined"){K=true}x=J;e.empty(m);q=0;if(J.levels&&J.levels.length>0){if(J.levels.length==1){m.src=J.levels[0].file}else{if(m.src){m.removeAttribute("src")}for(var I=0;I0)){var I=m.buffered.length-1;if(I>=0){J=m.buffered.end(I)/m.duration*100}}}if(p===false&&B==a.api.events.state.BUFFERING){j.sendEvent(a.api.events.JWPLAYER_MEDIA_BUFFER_FULL);p=true}if(!C){if(J==100){C=true}if(e.exists(J)&&(J>y.buffer)){y.buffer=Math.round(J);j.sendEvent(a.api.events.JWPLAYER_MEDIA_BUFFER,{bufferPercent:Math.round(J)})}}}function D(J){if(e.exists(J)&&e.exists(J.target)){if(!isNaN(J.target.duration)&&(isNaN(y.duration)||y.duration<1)){if(J.target.duration==Infinity){y.duration=0}else{y.duration=Math.round(J.target.duration*10)/10}}if(!A&&m.readyState>0){m.style.display="block";E(a.api.events.state.PLAYING)}if(B==a.api.events.state.PLAYING){if(!A&&m.readyState>0){A=true;try{if(m.currentTime0?(Math.round(J.target.currentTime*10)/10):0;j.sendEvent(a.api.events.JWPLAYER_MEDIA_TIME,{position:y.position,duration:y.duration});if(y.position>=y.duration&&(y.position>0||y.duration>0)){w()}}}v(J)}function z(I){}function k(I){if(c[I.type]){if(I.type=="ended"){w()}else{E(c[I.type])}}}function G(I){var J={height:I.target.videoHeight,width:I.target.videoWidth,duration:Math.round(I.target.duration*10)/10};if((y.duration===0||isNaN(y.duration))&&I.target.duration!=Infinity){y.duration=Math.round(I.target.duration*10)/10}j.sendEvent(a.api.events.JWPLAYER_MEDIA_META,{metadata:J})}function u(K){if(B==a.api.events.state.IDLE){return}var J="There was an error: ";if((K.target.error&&K.target.tagName.toLowerCase()=="video")||K.target.parentNode.error&&K.target.parentNode.tagName.toLowerCase()=="video"){var I=!e.exists(K.target.error)?K.target.parentNode.error:K.target.error;switch(I.code){case I.MEDIA_ERR_ABORTED:J="You aborted the video playback: ";break;case I.MEDIA_ERR_NETWORK:J="A network error caused the video download to fail part-way: ";break;case I.MEDIA_ERR_DECODE:J="The video playback was aborted due to a corruption problem or because the video used features your browser did not support: ";break;case I.MEDIA_ERR_SRC_NOT_SUPPORTED:J="The video could not be loaded, either because the server or network failed or because the format is not supported: ";break;default:J="An unknown error occurred: ";break}}else{if(K.target.tagName.toLowerCase()=="source"){q--;if(q>0){return}J="The video could not be loaded, either because the server or network failed or because the format is not supported: "}else{e.log("An unknown error occurred. Continuing...");return}}_stop(false);J+=F();_error=true;j.sendEvent(a.api.events.JWPLAYER_ERROR,{error:J});return}function F(){var K="";for(var J in x.levels){var I=x.levels[J];var L=l.ownerDocument.createElement("source");K+=a.utils.getAbsolutePath(I.file);if(J<(x.levels.length-1)){K+=", "}}return K}function t(){if(!e.exists(f)){f=setInterval(function(){v()},100)}}function g(){clearInterval(f);f=null}function w(){if(B!=a.api.events.state.IDLE){_stop(false);j.sendEvent(a.api.events.JWPLAYER_MEDIA_COMPLETE)}}}})(jwplayer);(function(a){var c={ended:a.api.events.state.IDLE,playing:a.api.events.state.PLAYING,pause:a.api.events.state.PAUSED,buffering:a.api.events.state.BUFFERING};var b=a.utils.css;a.html5.mediayoutube=function(j,e){var f=new a.html5.eventdispatcher();a.utils.extend(this,f);var l=j;var h=document.getElementById(e.id);var g=a.api.events.state.IDLE;var n,m;function k(p){if(g!=p){var q=g;l.state=p;g=p;f.sendEvent(a.api.events.JWPLAYER_PLAYER_STATE,{oldstate:q,newstate:p})}}this.getDisplayElement=function(){return h};this.play=function(){if(g==a.api.events.state.IDLE){f.sendEvent(a.api.events.JWPLAYER_MEDIA_BUFFER,{bufferPercent:100});f.sendEvent(a.api.events.JWPLAYER_MEDIA_BUFFER_FULL);k(a.api.events.state.PLAYING)}else{if(g==a.api.events.state.PAUSED){k(a.api.events.state.PLAYING)}}};this.pause=function(){k(a.api.events.state.PAUSED)};this.seek=function(p){};this.stop=function(p){if(!_utils.exists(p)){p=true}l.position=0;k(a.api.events.state.IDLE);if(p){b(h,{display:"none"})}};this.volume=function(p){l.volume=p;f.sendEvent(a.api.events.JWPLAYER_MEDIA_VOLUME,{volume:Math.round(p)})};this.mute=function(p){h.muted=p;l.mute=p;f.sendEvent(a.api.events.JWPLAYER_MEDIA_MUTE,{mute:p})};this.resize=function(q,p){if(q*p>0&&n){n.width=m.width=q;n.height=m.height=p}f.sendEvent(a.api.events.JWPLAYER_MEDIA_RESIZE,{fullscreen:l.fullscreen,width:q,height:p})};this.fullscreen=function(p){if(p===true){this.resize("100%","100%")}else{this.resize(l.config.width,l.config.height)}};this.load=function(p){o(p);b(n,{display:"block"});k(a.api.events.state.BUFFERING);f.sendEvent(a.api.events.JWPLAYER_MEDIA_BUFFER,{bufferPercent:0});f.sendEvent(a.api.events.JWPLAYER_MEDIA_LOADED);this.play()};this.hasChrome=function(){return(g!=a.api.events.state.IDLE)};function o(v){var s=v.levels[0].file;s=["http://www.youtube.com/v/",d(s),"&hl=en_US&fs=1&autoplay=1"].join("");n=document.createElement("object");n.id=h.id;n.style.position="absolute";var u={movie:s,allowfullscreen:"true",allowscriptaccess:"always"};for(var p in u){var t=document.createElement("param");t.name=p;t.value=u[p];n.appendChild(t)}m=document.createElement("embed");n.appendChild(m);var q={src:s,type:"application/x-shockwave-flash",allowfullscreen:"true",allowscriptaccess:"always",width:n.width,height:n.height};for(var r in q){m.setAttribute(r,q[r])}n.appendChild(m);n.style.zIndex=2147483000;if(h!=n&&h.parentNode){h.parentNode.replaceChild(n,h)}h=n}function d(q){var p=q.split(/\?|\#\!/);var s="";for(var r=0;r=0){s=q.substr(q.indexOf("/v/")+3)}else{if(q.indexOf("youtu.be")>=0){s=q.substr(q.indexOf("youtu.be/")+9)}else{s=q}}}if(s.indexOf("?")>-1){s=s.substr(0,s.indexOf("?"))}if(s.indexOf("&")>-1){s=s.substr(0,s.indexOf("&"))}return s}this.embed=m;return this}})(jwplayer);(function(jwplayer){var _configurableStateVariables=["width","height","start","duration","volume","mute","fullscreen","item","plugins","stretching"];jwplayer.html5.model=function(api,container,options){var _api=api;var _container=container;var _model={id:_container.id,playlist:[],state:jwplayer.api.events.state.IDLE,position:0,buffer:0,config:{width:480,height:320,item:-1,skin:undefined,file:undefined,image:undefined,start:0,duration:0,bufferlength:5,volume:90,mute:false,fullscreen:false,repeat:"",stretching:jwplayer.utils.stretching.UNIFORM,autostart:false,debug:undefined,screencolor:undefined}};var _media;var _eventDispatcher=new jwplayer.html5.eventdispatcher();var _components=["display","logo","controlbar","playlist","dock"];jwplayer.utils.extend(_model,_eventDispatcher);for(var option in options){if(typeof options[option]=="string"){var type=/color$/.test(option)?"color":null;options[option]=jwplayer.utils.typechecker(options[option],type)}var config=_model.config;var path=option.split(".");for(var edge in path){if(edge==path.length-1){config[path[edge]]=options[option]}else{if(!jwplayer.utils.exists(config[path[edge]])){config[path[edge]]={}}config=config[path[edge]]}}}for(var index in _configurableStateVariables){var configurableStateVariable=_configurableStateVariables[index];_model[configurableStateVariable]=_model.config[configurableStateVariable]}var pluginorder=_components.concat([]);if(jwplayer.utils.exists(_model.plugins)){if(typeof _model.plugins=="string"){var userplugins=_model.plugins.split(",");for(var userplugin in userplugins){if(typeof userplugins[userplugin]=="string"){pluginorder.push(userplugins[userplugin].replace(/^\s+|\s+$/g,""))}}}}if(jwplayer.utils.isIOS()){pluginorder=["display","logo","dock","playlist"];if(!jwplayer.utils.exists(_model.config.repeat)){_model.config.repeat="list"}}else{if(_model.config.chromeless){pluginorder=["logo","dock","playlist"];if(!jwplayer.utils.exists(_model.config.repeat)){_model.config.repeat="list"}}}_model.plugins={order:pluginorder,config:{},object:{}};if(typeof _model.config.components!="undefined"){for(var component in _model.config.components){_model.plugins.config[component]=_model.config.components[component]}}for(var pluginIndex in _model.plugins.order){var pluginName=_model.plugins.order[pluginIndex];var pluginConfig=!jwplayer.utils.exists(_model.plugins.config[pluginName])?{}:_model.plugins.config[pluginName];_model.plugins.config[pluginName]=!jwplayer.utils.exists(_model.plugins.config[pluginName])?pluginConfig:jwplayer.utils.extend(_model.plugins.config[pluginName],pluginConfig);if(!jwplayer.utils.exists(_model.plugins.config[pluginName].position)){if(pluginName=="playlist"){_model.plugins.config[pluginName].position=jwplayer.html5.view.positions.NONE}else{_model.plugins.config[pluginName].position=jwplayer.html5.view.positions.OVER}}else{_model.plugins.config[pluginName].position=_model.plugins.config[pluginName].position.toString().toUpperCase()}}if(typeof _model.plugins.config.dock!="undefined"){if(typeof _model.plugins.config.dock!="object"){var position=_model.plugins.config.dock.toString().toUpperCase();_model.plugins.config.dock={position:position}}if(typeof _model.plugins.config.dock.position!="undefined"){_model.plugins.config.dock.align=_model.plugins.config.dock.position;_model.plugins.config.dock.position=jwplayer.html5.view.positions.OVER}}function _loadExternal(playlistfile){var loader=new jwplayer.html5.playlistloader();loader.addEventListener(jwplayer.api.events.JWPLAYER_PLAYLIST_LOADED,function(evt){_model.playlist=new jwplayer.html5.playlist(evt);_loadComplete(true)});loader.addEventListener(jwplayer.api.events.JWPLAYER_ERROR,function(evt){_model.playlist=new jwplayer.html5.playlist({playlist:[]});_loadComplete(false)});loader.load(playlistfile)}function _loadComplete(){if(_model.config.shuffle){_model.item=_getShuffleItem()}else{if(_model.config.item>=_model.playlist.length){_model.config.item=_model.playlist.length-1}else{if(_model.config.item<0){_model.config.item=0}}_model.item=_model.config.item}_eventDispatcher.sendEvent(jwplayer.api.events.JWPLAYER_PLAYLIST_LOADED,{playlist:_model.playlist});_eventDispatcher.sendEvent(jwplayer.api.events.JWPLAYER_PLAYLIST_ITEM,{index:_model.item})}_model.loadPlaylist=function(arg){var input;if(typeof arg=="string"){if(arg.indexOf("[")==0||arg.indexOf("{")=="0"){try{input=eval(arg)}catch(err){input=arg}}else{input=arg}}else{input=arg}var config;switch(jwplayer.utils.typeOf(input)){case"object":config=input;break;case"array":config={playlist:input};break;default:_loadExternal(input);return;break}_model.playlist=new jwplayer.html5.playlist(config);if(jwplayer.utils.extension(_model.playlist[0].file)=="xml"){_loadExternal(_model.playlist[0].file)}else{_loadComplete()}};function _getShuffleItem(){var result=null;if(_model.playlist.length>1){while(!jwplayer.utils.exists(result)){result=Math.floor(Math.random()*_model.playlist.length);if(result==_model.item){result=null}}}else{result=0}return result}function forward(evt){if(evt.type==jwplayer.api.events.JWPLAYER_MEDIA_LOADED){_container=_media.getDisplayElement()}_eventDispatcher.sendEvent(evt.type,evt)}var _mediaProviders={};_model.setActiveMediaProvider=function(playlistItem){if(playlistItem.provider=="audio"){playlistItem.provider="sound"}var provider=playlistItem.provider;var current=_media?_media.getDisplayElement():null;if(provider=="sound"||provider=="http"||provider==""){provider="video"}if(!jwplayer.utils.exists(_mediaProviders[provider])){switch(provider){case"video":_media=new jwplayer.html5.mediavideo(_model,current?current:_container);break;case"youtube":_media=new jwplayer.html5.mediayoutube(_model,current?current:_container);break}if(!jwplayer.utils.exists(_media)){return false}_media.addGlobalListener(forward);_mediaProviders[provider]=_media}else{if(_media!=_mediaProviders[provider]){if(_media){_media.stop()}_media=_mediaProviders[provider]}}return true};_model.getMedia=function(){return _media};_model.seek=function(pos){_eventDispatcher.sendEvent(jwplayer.api.events.JWPLAYER_MEDIA_SEEK,{position:_model.position,offset:pos});return _media.seek(pos)};_model.setupPlugins=function(){if(!jwplayer.utils.exists(_model.plugins)||!jwplayer.utils.exists(_model.plugins.order)||_model.plugins.order.length==0){jwplayer.utils.log("No plugins to set up");return _model}for(var i=0;i<_model.plugins.order.length;i++){try{var pluginName=_model.plugins.order[i];if(jwplayer.utils.exists(jwplayer.html5[pluginName])){if(pluginName=="playlist"){_model.plugins.object[pluginName]=new jwplayer.html5.playlistcomponent(_api,_model.plugins.config[pluginName])}else{_model.plugins.object[pluginName]=new jwplayer.html5[pluginName](_api,_model.plugins.config[pluginName])}}else{_model.plugins.order.splice(plugin,plugin+1)}if(typeof _model.plugins.object[pluginName].addGlobalListener=="function"){_model.plugins.object[pluginName].addGlobalListener(forward)}}catch(err){jwplayer.utils.log("Could not setup "+pluginName)}}};return _model}})(jwplayer);(function(a){a.html5.playlist=function(b){var d=[];if(b.playlist&&b.playlist instanceof Array&&b.playlist.length>0){for(var c in b.playlist){if(!isNaN(parseInt(c))){d.push(new a.html5.playlistitem(b.playlist[c]))}}}else{d.push(new a.html5.playlistitem(b))}return d}})(jwplayer);(function(a){var c={size:180,position:a.html5.view.positions.NONE,itemheight:60,thumbs:true,fontcolor:"#000000",overcolor:"",activecolor:"",backgroundcolor:"#f8f8f8",font:"_sans",fontsize:"",fontstyle:"",fontweight:""};var b={_sans:"Arial, Helvetica, sans-serif",_serif:"Times, Times New Roman, serif",_typewriter:"Courier New, Courier, monospace"};_utils=a.utils;_css=_utils.css;_hide=function(d){_css(d,{display:"none"})};_show=function(d){_css(d,{display:"block"})};a.html5.playlistcomponent=function(r,B){var w=r;var e=a.utils.extend({},c,w.skin.getComponentSettings("playlist"),B);if(e.position==a.html5.view.positions.NONE||typeof a.html5.view.positions[e.position]=="undefined"){return}var x;var l;var C;var d;var g;var f;var k=-1;var h={background:undefined,item:undefined,itemOver:undefined,itemImage:undefined,itemActive:undefined};this.getDisplayElement=function(){return x};this.resize=function(F,D){l=F;C=D;if(w.jwGetFullscreen()){_hide(x)}else{var E={display:"block",width:l,height:C};_css(x,E)}};this.show=function(){_show(x)};this.hide=function(){_hide(x)};function j(){x=document.createElement("div");x.id=w.id+"_jwplayer_playlistcomponent";switch(e.position){case a.html5.view.positions.RIGHT:case a.html5.view.positions.LEFT:x.style.width=e.size+"px";break;case a.html5.view.positions.TOP:case a.html5.view.positions.BOTTOM:x.style.height=e.size+"px";break}A();if(h.item){e.itemheight=h.item.height}x.style.backgroundColor="#C6C6C6";w.jwAddEventListener(a.api.events.JWPLAYER_PLAYLIST_LOADED,s);w.jwAddEventListener(a.api.events.JWPLAYER_PLAYLIST_ITEM,u);w.jwAddEventListener(a.api.events.JWPLAYER_PLAYER_STATE,m)}function p(){var D=document.createElement("ul");_css(D,{width:x.style.width,minWidth:x.style.width,height:x.style.height,backgroundColor:e.backgroundcolor,backgroundImage:h.background?"url("+h.background.src+")":"",color:e.fontcolor,listStyle:"none",margin:0,padding:0,fontFamily:b[e.font]?b[e.font]:b._sans,fontSize:(e.fontsize?e.fontsize:11)+"px",fontStyle:e.fontstyle,fontWeight:e.fontweight,overflowY:"auto"});return D}function y(D){return function(){var E=f.getElementsByClassName("item")[D];var F=e.fontcolor;var G=h.item?"url("+h.item.src+")":"";if(D==w.jwGetPlaylistIndex()){if(e.activecolor!==""){F=e.activecolor}if(h.itemActive){G="url("+h.itemActive.src+")"}}_css(E,{color:e.overcolor!==""?e.overcolor:F,backgroundImage:h.itemOver?"url("+h.itemOver.src+")":G})}}function o(D){return function(){var E=f.getElementsByClassName("item")[D];var F=e.fontcolor;var G=h.item?"url("+h.item.src+")":"";if(D==w.jwGetPlaylistIndex()){if(e.activecolor!==""){F=e.activecolor}if(h.itemActive){G="url("+h.itemActive.src+")"}}_css(E,{color:F,backgroundImage:G})}}function q(I){var P=d[I];var O=document.createElement("li");O.className="item";_css(O,{height:e.itemheight,display:"block",cursor:"pointer",backgroundImage:h.item?"url("+h.item.src+")":"",backgroundSize:"100% "+e.itemheight+"px"});O.onmouseover=y(I);O.onmouseout=o(I);var J=document.createElement("div");var F=new Image();var K=0;var L=0;var M=0;if(v()&&(P.image||P["playlist.image"]||h.itemImage)){F.className="image";if(h.itemImage){K=(e.itemheight-h.itemImage.height)/2;L=h.itemImage.width;M=h.itemImage.height}else{L=e.itemheight*4/3;M=e.itemheight}_css(J,{height:M,width:L,"float":"left",styleFloat:"left",cssFloat:"left",margin:"0 5px 0 0",background:"black",overflow:"hidden",margin:K+"px",position:"relative"});_css(F,{position:"relative"});J.appendChild(F);F.onload=function(){a.utils.stretch(a.utils.stretching.FILL,F,L,M,this.naturalWidth,this.naturalHeight)};if(P["playlist.image"]){F.src=P["playlist.image"]}else{if(P.image){F.src=P.image}else{if(h.itemImage){F.src=h.itemImage.src}}}O.appendChild(J)}var E=l-L-K*2;if(C0){G.className="duration";_css(G,{fontSize:(e.fontsize?e.fontsize:11)+"px",fontWeight:(e.fontweight?e.fontweight:"bold"),width:"40px",height:e.fontsize?e.fontsize+10:20,lineHeight:24,"float":"right",styleFloat:"right",cssFloat:"right"});G.innerHTML=_utils.timeFormat(P.duration);D.appendChild(G)}var N=document.createElement("span");N.className="title";_css(N,{padding:"5px 5px 0 "+(K?0:"5px"),height:e.fontsize?e.fontsize+10:20,lineHeight:e.fontsize?e.fontsize+10:20,overflow:"hidden","float":"left",styleFloat:"left",cssFloat:"left",width:((P.duration>0)?E-50:E)-10+"px",fontSize:(e.fontsize?e.fontsize:13)+"px",fontWeight:(e.fontweight?e.fontweight:"bold")});N.innerHTML=P?P.title:"";D.appendChild(N);if(P.description){var H=document.createElement("span");H.className="description";_css(H,{display:"block","float":"left",styleFloat:"left",cssFloat:"left",margin:0,paddingLeft:N.style.paddingLeft,paddingRight:N.style.paddingRight,lineHeight:(e.fontsize?e.fontsize+4:16)+"px",overflow:"hidden",position:"relative"});H.innerHTML=P.description;D.appendChild(H)}O.appendChild(D);return O}function s(E){x.innerHTML="";d=w.jwGetPlaylist();if(!d){return}items=[];f=p();for(var F=0;F=0){o(k)();k=D.index}o(D.index)();n()}function m(){if(e.position==a.html5.view.positions.OVER){switch(w.jwGetState()){case a.api.events.state.IDLE:_show(x);break;default:_hide(x);break}}}function A(){for(var D in h){h[D]=t(D)}}function t(D){return w.skin.getSkinElement("playlist",D)}j();return this}})(jwplayer);(function(b){b.html5.playlistitem=function(d){var e={author:"",date:"",description:"",image:"",link:"",mediaid:"",tags:"",title:"",provider:"",file:"",streamer:"",duration:-1,start:0,currentLevel:-1,levels:[]};var c=b.utils.extend({},e,d);if(c.type){c.provider=c.type;delete c.type}if(c.levels.length===0){c.levels[0]=new b.html5.playlistitemlevel(c)}if(!c.provider){c.provider=a(c.levels[0])}else{c.provider=c.provider.toLowerCase()}return c};function a(e){if(b.utils.isYouTube(e.file)){return"youtube"}else{var f=b.utils.extension(e.file);var c;if(f&&b.utils.extensionmap[f]){if(f=="m3u8"){return"video"}c=b.utils.extensionmap[f].html5}else{if(e.type){c=e.type}}if(c){var d=c.split("/")[0];if(d=="audio"){return"sound"}else{if(d=="video"){return d}}}}return""}})(jwplayer);(function(a){a.html5.playlistitemlevel=function(b){var d={file:"",streamer:"",bitrate:0,width:0};for(var c in d){if(a.utils.exists(b[c])){d[c]=b[c]}}return d}})(jwplayer);(function(a){a.html5.playlistloader=function(){var c=new a.html5.eventdispatcher();a.utils.extend(this,c);this.load=function(e){a.utils.ajax(e,d,b)};function d(g){var f=[];try{var f=a.utils.parsers.rssparser.parse(g.responseXML.firstChild);c.sendEvent(a.api.events.JWPLAYER_PLAYLIST_LOADED,{playlist:new a.html5.playlist({playlist:f})})}catch(h){b("Could not parse the playlist")}}function b(e){c.sendEvent(a.api.events.JWPLAYER_ERROR,{error:e?e:"could not load playlist for whatever reason. too bad"})}}})(jwplayer);(function(a){a.html5.skin=function(){var b={};var c=false;this.load=function(d,e){new a.html5.skinloader(d,function(f){c=true;b=f;e()},function(){new a.html5.skinloader("",function(f){c=true;b=f;e()})})};this.getSkinElement=function(d,e){if(c){try{return b[d].elements[e]}catch(f){a.utils.log("No such skin component / element: ",[d,e])}}return null};this.getComponentSettings=function(d){if(c){return b[d].settings}return null};this.getComponentLayout=function(d){if(c){return b[d].layout}return null}}})(jwplayer);(function(a){a.html5.skinloader=function(f,p,k){var o={};var c=p;var l=k;var e=true;var j;var n=f;var s=false;function m(){if(typeof n!="string"||n===""){d(a.html5.defaultSkin().xml)}else{a.utils.ajax(a.utils.getAbsolutePath(n),function(t){try{if(a.utils.exists(t.responseXML)){d(t.responseXML);return}}catch(u){h()}d(a.html5.defaultSkin().xml)},function(t){d(a.html5.defaultSkin().xml)})}}function d(y){var E=y.getElementsByTagName("component");if(E.length===0){return}for(var H=0;H0){var K=z.getElementsByTagName("setting");for(var P=0;P0){var M=L.getElementsByTagName("group");for(var w=0;w|\\{|%)?([^\\/#\\^]+?)\\1?" + + that.ctag + "+", "g"); + }; + + var regex = new_regex(); + var tag_replace_callback = function(match, operator, name) { + switch(operator) { + case "!": // ignore comments + return ""; + case "=": // set new delimiters, rebuild the replace regexp + that.set_delimiters(name); + regex = new_regex(); + return ""; + case ">": // render partial + return that.render_partial(name, context, partials); + case "{": // the triple mustache is unescaped + return that.find(name, context); + default: // escape the value + return that.escape(that.find(name, context)); + } + }; + var lines = template.split("\n"); + for(var i = 0; i < lines.length; i++) { + lines[i] = lines[i].replace(regex, tag_replace_callback, this); + if(!in_recursion) { + this.send(lines[i]); + } + } + + if(in_recursion) { + return lines.join("\n"); + } + }, + + set_delimiters: function(delimiters) { + var dels = delimiters.split(" "); + this.otag = this.escape_regex(dels[0]); + this.ctag = this.escape_regex(dels[1]); + }, + + escape_regex: function(text) { + // thank you Simon Willison + if(!arguments.callee.sRE) { + var specials = [ + '/', '.', '*', '+', '?', '|', + '(', ')', '[', ']', '{', '}', '\\' + ]; + arguments.callee.sRE = new RegExp( + '(\\' + specials.join('|\\') + ')', 'g' + ); + } + return text.replace(arguments.callee.sRE, '\\$1'); + }, + + /* + find `name` in current `context`. That is find me a value + from the view object + */ + find: function(name, context) { + name = this.trim(name); + + // Checks whether a value is thruthy or false or 0 + function is_kinda_truthy(bool) { + return bool === false || bool === 0 || bool; + } + + var value; + if(is_kinda_truthy(context[name])) { + value = context[name]; + } else if(is_kinda_truthy(this.context[name])) { + value = this.context[name]; + } + + if(typeof value === "function") { + return value.apply(context); + } + if(value !== undefined) { + return value; + } + // silently ignore unkown variables + return ""; + }, + + // Utility methods + + /* includes tag */ + includes: function(needle, haystack) { + return haystack.indexOf(this.otag + needle) != -1; + }, + + /* + Does away with nasty characters + */ + escape: function(s) { + s = String(s === null ? "" : s); + return s.replace(/&(?!\w+;)|["'<>\\]/g, function(s) { + switch(s) { + case "&": return "&"; + case "\\": return "\\\\"; + case '"': return '"'; + case "'": return '''; + case "<": return "<"; + case ">": return ">"; + default: return s; + } + }); + }, + + // by @langalex, support for arrays of strings + create_context: function(_context) { + if(this.is_object(_context)) { + return _context; + } else { + var iterator = "."; + if(this.pragmas["IMPLICIT-ITERATOR"]) { + iterator = this.pragmas["IMPLICIT-ITERATOR"].iterator; + } + var ctx = {}; + ctx[iterator] = _context; + return ctx; + } + }, + + is_object: function(a) { + return a && typeof a == "object"; + }, + + is_array: function(a) { + return Object.prototype.toString.call(a) === '[object Array]'; + }, + + /* + Gets rid of leading and trailing whitespace + */ + trim: function(s) { + return s.replace(/^\s*|\s*$/g, ""); + }, + + /* + Why, why, why? Because IE. Cry, cry cry. + */ + map: function(array, fn) { + if (typeof array.map == "function") { + return array.map(fn); + } else { + var r = []; + var l = array.length; + for(var i = 0; i < l; i++) { + r.push(fn(array[i])); + } + return r; + } + } + }; + + return({ + name: "mustache.js", + version: "0.3.1-dev", + + /* + Turns a template and view into HTML + */ + to_html: function(template, view, partials, send_fun) { + var renderer = new Renderer(); + if(send_fun) { + renderer.send = send_fun; + } + renderer.render(template, view, partials); + if(!send_fun) { + return renderer.buffer.join("\n"); + } + } + }); +}(); +// ┌─────────────────────────────────────────────────────────────────────┠\\ +// │ Raphaël 2.0 - JavaScript Vector Library │ \\ +// ├─────────────────────────────────────────────────────────────────────┤ \\ +// │ Copyright (c) 2008-2011 Dmitry Baranovskiy (http://raphaeljs.com) │ \\ +// │ Copyright (c) 2008-2011 Sencha Labs (http://sencha.com) │ \\ +// │ Licensed under the MIT (http://raphaeljs.com/license.html) license. │ \\ +// └─────────────────────────────────────────────────────────────────────┘ \\ + +// ┌──────────────────────────────────────────────────────────────────────────────────────┠\\ +// │ Eve 0.3.2 - JavaScript Events Library │ \\ +// ├──────────────────────────────────────────────────────────────────────────────────────┤ \\ +// │ Copyright (c) 2008-2011 Dmitry Baranovskiy (http://dmitry.baranovskiy.com/) │ \\ +// │ Licensed under the MIT (http://www.opensource.org/licenses/mit-license.php) license. │ \\ +// └──────────────────────────────────────────────────────────────────────────────────────┘ \\ + +(function (glob) { + var version = "0.3.2", + has = "hasOwnProperty", + separator = /[\.\/]/, + wildcard = "*", + fun = function () {}, + numsort = function (a, b) { + return a - b; + }, + current_event, + stop, + events = {n: {}}, + + eve = function (name, scope) { + var e = events, + oldstop = stop, + args = Array.prototype.slice.call(arguments, 2), + listeners = eve.listeners(name), + z = 0, + f = false, + l, + indexed = [], + queue = {}, + out = [], + errors = []; + current_event = name; + stop = 0; + for (var i = 0, ii = listeners.length; i < ii; i++) if ("zIndex" in listeners[i]) { + indexed.push(listeners[i].zIndex); + if (listeners[i].zIndex < 0) { + queue[listeners[i].zIndex] = listeners[i]; + } + } + indexed.sort(numsort); + while (indexed[z] < 0) { + l = queue[indexed[z++]]; + out.push(l.apply(scope, args)); + if (stop) { + stop = oldstop; + return out; + } + } + for (i = 0; i < ii; i++) { + l = listeners[i]; + if ("zIndex" in l) { + if (l.zIndex == indexed[z]) { + out.push(l.apply(scope, args)); + if (stop) { + stop = oldstop; + return out; + } + do { + z++; + l = queue[indexed[z]]; + l && out.push(l.apply(scope, args)); + if (stop) { + stop = oldstop; + return out; + } + } while (l) + } else { + queue[l.zIndex] = l; + } + } else { + out.push(l.apply(scope, args)); + if (stop) { + stop = oldstop; + return out; + } + } + } + stop = oldstop; + return out.length ? out : null; + }; + + eve.listeners = function (name) { + var names = name.split(separator), + e = events, + item, + items, + k, + i, + ii, + j, + jj, + nes, + es = [e], + out = []; + for (i = 0, ii = names.length; i < ii; i++) { + nes = []; + for (j = 0, jj = es.length; j < jj; j++) { + e = es[j].n; + items = [e[names[i]], e[wildcard]]; + k = 2; + while (k--) { + item = items[k]; + if (item) { + nes.push(item); + out = out.concat(item.f || []); + } + } + } + es = nes; + } + return out; + }; + + + eve.on = function (name, f) { + var names = name.split(separator), + e = events; + for (var i = 0, ii = names.length; i < ii; i++) { + e = e.n; + !e[names[i]] && (e[names[i]] = {n: {}}); + e = e[names[i]]; + } + e.f = e.f || []; + for (i = 0, ii = e.f.length; i < ii; i++) if (e.f[i] == f) { + return fun; + } + e.f.push(f); + return function (zIndex) { + if (+zIndex == +zIndex) { + f.zIndex = +zIndex; + } + }; + }; + + eve.stop = function () { + stop = 1; + }; + + eve.nt = function (subname) { + if (subname) { + return new RegExp("(?:\\.|\\/|^)" + subname + "(?:\\.|\\/|$)").test(current_event); + } + return current_event; + }; + + eve.unbind = function (name, f) { + var names = name.split(separator), + e, + key, + splice, + cur = [events]; + for (var i = 0, ii = names.length; i < ii; i++) { + for (var j = 0; j < cur.length; j += splice.length - 2) { + splice = [j, 1]; + e = cur[j].n; + if (names[i] != wildcard) { + if (e[names[i]]) { + splice.push(e[names[i]]); + } + } else { + for (key in e) if (e[has](key)) { + splice.push(e[key]); + } + } + cur.splice.apply(cur, splice); + } + } + for (i = 0, ii = cur.length; i < ii; i++) { + e = cur[i]; + while (e.n) { + if (f) { + if (e.f) { + for (j = 0, jj = e.f.length; j < jj; j++) if (e.f[j] == f) { + e.f.splice(j, 1); + break; + } + !e.f.length && delete e.f; + } + for (key in e.n) if (e.n[has](key) && e.n[key].f) { + var funcs = e.n[key].f; + for (j = 0, jj = funcs.length; j < jj; j++) if (funcs[j] == f) { + funcs.splice(j, 1); + break; + } + !funcs.length && delete e.n[key].f; + } + } else { + delete e.f; + for (key in e.n) if (e.n[has](key) && e.n[key].f) { + delete e.n[key].f; + } + } + e = e.n; + } + } + }; + + eve.version = version; + eve.toString = function () { + return "You are running Eve " + version; + }; + (typeof module != "undefined" && module.exports) ? (module.exports = eve) : (glob.eve = eve); +})(this); + +// ┌─────────────────────────────────────────────────────────────────────┠\\ +// │ "Raphaël 2.0" - JavaScript Vector Library │ \\ +// ├─────────────────────────────────────────────────────────────────────┤ \\ +// │ Copyright (c) 2008-2011 Dmitry Baranovskiy (http://raphaeljs.com) │ \\ +// │ Copyright (c) 2008-2011 Sencha Labs (http://sencha.com) │ \\ +// │ Licensed under the MIT (http://raphaeljs.com/license.html) license. │ \\ +// └─────────────────────────────────────────────────────────────────────┘ \\ +(function () { + + function R(first) { + if (R.is(first, "function")) { + return loaded ? first() : eve.on("DOMload", first); + } else if (R.is(first, array)) { + var a = first, + cnv = R._engine.create[apply](R, a.splice(0, 3 + R.is(a[0], nu))), + res = cnv.set(), + i = 0, + ii = a.length, + j; + for (; i < ii; i++) { + j = a[i] || {}; + elements[has](j.type) && res.push(cnv[j.type]().attr(j)); + } + return res; + } else { + var args = Array.prototype.slice.call(arguments, 0); + if (R.is(args[args.length - 1], "function")) { + var f = args.pop(); + return loaded ? f.call(R._engine.create[apply](R, args)) : eve.on("DOMload", function () { + f.call(R._engine.create[apply](R, args)); + }); + } else { + return R._engine.create[apply](R, arguments); + } + } + } + R.version = "2.0.0"; + R.eve = eve; + var loaded, + separator = /[, ]+/, + elements = {circle: 1, rect: 1, path: 1, ellipse: 1, text: 1, image: 1}, + formatrg = /\{(\d+)\}/g, + proto = "prototype", + has = "hasOwnProperty", + g = { + doc: document, + win: window + }, + oldRaphael = { + was: Object.prototype[has].call(g.win, "Raphael"), + is: g.win.Raphael + }, + Paper = function () { + + + this.ca = this.customAttributes = {}; + }, + paperproto, + appendChild = "appendChild", + apply = "apply", + concat = "concat", + supportsTouch = "createTouch" in g.doc, + E = "", + S = " ", + Str = String, + split = "split", + events = "click dblclick mousedown mousemove mouseout mouseover mouseup touchstart touchmove touchend touchcancel"[split](S), + touchMap = { + mousedown: "touchstart", + mousemove: "touchmove", + mouseup: "touchend" + }, + lowerCase = Str.prototype.toLowerCase, + math = Math, + mmax = math.max, + mmin = math.min, + abs = math.abs, + pow = math.pow, + PI = math.PI, + nu = "number", + string = "string", + array = "array", + toString = "toString", + fillString = "fill", + objectToString = Object.prototype.toString, + paper = {}, + push = "push", + ISURL = R._ISURL = /^url\(['"]?([^\)]+?)['"]?\)$/i, + colourRegExp = /^\s*((#[a-f\d]{6})|(#[a-f\d]{3})|rgba?\(\s*([\d\.]+%?\s*,\s*[\d\.]+%?\s*,\s*[\d\.]+%?(?:\s*,\s*[\d\.]+%?)?)\s*\)|hsba?\(\s*([\d\.]+(?:deg|\xb0|%)?\s*,\s*[\d\.]+%?\s*,\s*[\d\.]+(?:%?\s*,\s*[\d\.]+)?)%?\s*\)|hsla?\(\s*([\d\.]+(?:deg|\xb0|%)?\s*,\s*[\d\.]+%?\s*,\s*[\d\.]+(?:%?\s*,\s*[\d\.]+)?)%?\s*\))\s*$/i, + isnan = {"NaN": 1, "Infinity": 1, "-Infinity": 1}, + bezierrg = /^(?:cubic-)?bezier\(([^,]+),([^,]+),([^,]+),([^\)]+)\)/, + round = math.round, + setAttribute = "setAttribute", + toFloat = parseFloat, + toInt = parseInt, + upperCase = Str.prototype.toUpperCase, + availableAttrs = R._availableAttrs = { + "arrow-end": "none", + "arrow-start": "none", + blur: 0, + "clip-rect": "0 0 1e9 1e9", + cursor: "default", + cx: 0, + cy: 0, + fill: "#fff", + "fill-opacity": 1, + font: '10px "Arial"', + "font-family": '"Arial"', + "font-size": "10", + "font-style": "normal", + "font-weight": 400, + gradient: 0, + height: 0, + href: "http://raphaeljs.com/", + opacity: 1, + path: "M0,0", + r: 0, + rx: 0, + ry: 0, + src: "", + stroke: "#000", + "stroke-dasharray": "", + "stroke-linecap": "butt", + "stroke-linejoin": "butt", + "stroke-miterlimit": 0, + "stroke-opacity": 1, + "stroke-width": 1, + target: "_blank", + "text-anchor": "middle", + title: "Raphael", + transform: "", + width: 0, + x: 0, + y: 0 + }, + availableAnimAttrs = R._availableAnimAttrs = { + blur: nu, + "clip-rect": "csv", + cx: nu, + cy: nu, + fill: "colour", + "fill-opacity": nu, + "font-size": nu, + height: nu, + opacity: nu, + path: "path", + r: nu, + rx: nu, + ry: nu, + stroke: "colour", + "stroke-opacity": nu, + "stroke-width": nu, + transform: "transform", + width: nu, + x: nu, + y: nu + }, + commaSpaces = /\s*,\s*/, + hsrg = {hs: 1, rg: 1}, + p2s = /,?([achlmqrstvxz]),?/gi, + pathCommand = /([achlmrqstvz])[\s,]*((-?\d*\.?\d*(?:e[\-+]?\d+)?\s*,?\s*)+)/ig, + tCommand = /([rstm])[\s,]*((-?\d*\.?\d*(?:e[\-+]?\d+)?\s*,?\s*)+)/ig, + pathValues = /(-?\d*\.?\d*(?:e[\-+]?\d+)?)\s*,?\s*/ig, + radial_gradient = R._radial_gradient = /^r(?:\(([^,]+?)\s*,\s*([^\)]+?)\))?/, + eldata = {}, + sortByKey = function (a, b) { + return a.key - b.key; + }, + sortByNumber = function (a, b) { + return toFloat(a) - toFloat(b); + }, + fun = function () {}, + pipe = function (x) { + return x; + }, + rectPath = R._rectPath = function (x, y, w, h, r) { + if (r) { + return [["M", x + r, y], ["l", w - r * 2, 0], ["a", r, r, 0, 0, 1, r, r], ["l", 0, h - r * 2], ["a", r, r, 0, 0, 1, -r, r], ["l", r * 2 - w, 0], ["a", r, r, 0, 0, 1, -r, -r], ["l", 0, r * 2 - h], ["a", r, r, 0, 0, 1, r, -r], ["z"]]; + } + return [["M", x, y], ["l", w, 0], ["l", 0, h], ["l", -w, 0], ["z"]]; + }, + ellipsePath = function (x, y, rx, ry) { + if (ry == null) { + ry = rx; + } + return [["M", x, y], ["m", 0, -ry], ["a", rx, ry, 0, 1, 1, 0, 2 * ry], ["a", rx, ry, 0, 1, 1, 0, -2 * ry], ["z"]]; + }, + getPath = R._getPath = { + path: function (el) { + return el.attr("path"); + }, + circle: function (el) { + var a = el.attrs; + return ellipsePath(a.cx, a.cy, a.r); + }, + ellipse: function (el) { + var a = el.attrs; + return ellipsePath(a.cx, a.cy, a.rx, a.ry); + }, + rect: function (el) { + var a = el.attrs; + return rectPath(a.x, a.y, a.width, a.height, a.r); + }, + image: function (el) { + var a = el.attrs; + return rectPath(a.x, a.y, a.width, a.height); + }, + text: function (el) { + var bbox = el._getBBox(); + return rectPath(bbox.x, bbox.y, bbox.width, bbox.height); + } + }, + mapPath = R.mapPath = function (path, matrix) { + if (!matrix) { + return path; + } + var x, y, i, j, pathi; + path = path2curve(path); + for (i = 0, ii = path.length; i < ii; i++) { + pathi = path[i]; + for (j = 1, jj = pathi.length; j < jj; j += 2) { + x = matrix.x(pathi[j], pathi[j + 1]); + y = matrix.y(pathi[j], pathi[j + 1]); + pathi[j] = x; + pathi[j + 1] = y; + } + } + return path; + }; + + R._g = g; + + R.type = (g.win.SVGAngle || g.doc.implementation.hasFeature("http://www.w3.org/TR/SVG11/feature#BasicStructure", "1.1") ? "SVG" : "VML"); + if (R.type == "VML") { + var d = g.doc.createElement("div"), + b; + d.innerHTML = ''; + b = d.firstChild; + b.style.behavior = "url(#default#VML)"; + if (!(b && typeof b.adj == "object")) { + return (R.type = E); + } + d = null; + } + + + R.svg = !(R.vml = R.type == "VML"); + R._Paper = Paper; + + R.fn = paperproto = Paper.prototype = R.prototype; + R._id = 0; + R._oid = 0; + + R.is = function (o, type) { + type = lowerCase.call(type); + if (type == "finite") { + return !isnan[has](+o); + } + if (type == "array") { + return o instanceof Array; + } + return (type == "null" && o === null) || + (type == typeof o && o !== null) || + (type == "object" && o === Object(o)) || + (type == "array" && Array.isArray && Array.isArray(o)) || + objectToString.call(o).slice(8, -1).toLowerCase() == type; + }; + + R.angle = function (x1, y1, x2, y2, x3, y3) { + if (x3 == null) { + var x = x1 - x2, + y = y1 - y2; + if (!x && !y) { + return 0; + } + return (180 + math.atan2(-y, -x) * 180 / PI + 360) % 360; + } else { + return R.angle(x1, y1, x3, y3) - R.angle(x2, y2, x3, y3); + } + }; + + R.rad = function (deg) { + return deg % 360 * PI / 180; + }; + + R.deg = function (rad) { + return rad * 180 / PI % 360; + }; + + R.snapTo = function (values, value, tolerance) { + tolerance = R.is(tolerance, "finite") ? tolerance : 10; + if (R.is(values, array)) { + var i = values.length; + while (i--) if (abs(values[i] - value) <= tolerance) { + return values[i]; + } + } else { + values = +values; + var rem = value % values; + if (rem < tolerance) { + return value - rem; + } + if (rem > values - tolerance) { + return value - rem + values; + } + } + return value; + }; + + + var createUUID = R.createUUID = (function (uuidRegEx, uuidReplacer) { + return function () { + return "xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx".replace(uuidRegEx, uuidReplacer).toUpperCase(); + }; + })(/[xy]/g, function (c) { + var r = math.random() * 16 | 0, + v = c == "x" ? r : (r & 3 | 8); + return v.toString(16); + }); + + + R.setWindow = function (newwin) { + eve("setWindow", R, g.win, newwin); + g.win = newwin; + g.doc = g.win.document; + if (initWin) { + initWin(g.win); + } + }; + var toHex = function (color) { + if (R.vml) { + // http://dean.edwards.name/weblog/2009/10/convert-any-colour-value-to-hex-in-msie/ + var trim = /^\s+|\s+$/g; + var bod; + try { + var docum = new ActiveXObject("htmlfile"); + docum.write(""); + docum.close(); + bod = docum.body; + } catch(e) { + bod = createPopup().document.body; + } + var range = bod.createTextRange(); + toHex = cacher(function (color) { + try { + bod.style.color = Str(color).replace(trim, E); + var value = range.queryCommandValue("ForeColor"); + value = ((value & 255) << 16) | (value & 65280) | ((value & 16711680) >>> 16); + return "#" + ("000000" + value.toString(16)).slice(-6); + } catch(e) { + return "none"; + } + }); + } else { + var i = g.doc.createElement("i"); + i.title = "Rapha\xebl Colour Picker"; + i.style.display = "none"; + g.doc.body.appendChild(i); + toHex = cacher(function (color) { + i.style.color = color; + return g.doc.defaultView.getComputedStyle(i, E).getPropertyValue("color"); + }); + } + return toHex(color); + }, + hsbtoString = function () { + return "hsb(" + [this.h, this.s, this.b] + ")"; + }, + hsltoString = function () { + return "hsl(" + [this.h, this.s, this.l] + ")"; + }, + rgbtoString = function () { + return this.hex; + }, + prepareRGB = function (r, g, b) { + if (g == null && R.is(r, "object") && "r" in r && "g" in r && "b" in r) { + b = r.b; + g = r.g; + r = r.r; + } + if (g == null && R.is(r, string)) { + var clr = R.getRGB(r); + r = clr.r; + g = clr.g; + b = clr.b; + } + if (r > 1 || g > 1 || b > 1) { + r /= 255; + g /= 255; + b /= 255; + } + + return [r, g, b]; + }, + packageRGB = function (r, g, b, o) { + r *= 255; + g *= 255; + b *= 255; + var rgb = { + r: r, + g: g, + b: b, + hex: R.rgb(r, g, b), + toString: rgbtoString + }; + R.is(o, "finite") && (rgb.opacity = o); + return rgb; + }; + + + R.color = function (clr) { + var rgb; + if (R.is(clr, "object") && "h" in clr && "s" in clr && "b" in clr) { + rgb = R.hsb2rgb(clr); + clr.r = rgb.r; + clr.g = rgb.g; + clr.b = rgb.b; + clr.hex = rgb.hex; + } else if (R.is(clr, "object") && "h" in clr && "s" in clr && "l" in clr) { + rgb = R.hsl2rgb(clr); + clr.r = rgb.r; + clr.g = rgb.g; + clr.b = rgb.b; + clr.hex = rgb.hex; + } else { + if (R.is(clr, "string")) { + clr = R.getRGB(clr); + } + if (R.is(clr, "object") && "r" in clr && "g" in clr && "b" in clr) { + rgb = R.rgb2hsl(clr); + clr.h = rgb.h; + clr.s = rgb.s; + clr.l = rgb.l; + rgb = R.rgb2hsb(clr); + clr.v = rgb.b; + } else { + clr = {hex: "none"}; + crl.r = clr.g = clr.b = clr.h = clr.s = clr.v = clr.l = -1; + } + } + clr.toString = rgbtoString; + return clr; + }; + + R.hsb2rgb = function (h, s, v, o) { + if (this.is(h, "object") && "h" in h && "s" in h && "b" in h) { + v = h.b; + s = h.s; + h = h.h; + o = h.o; + } + h *= 360; + var R, G, B, X, C; + h = (h % 360) / 60; + C = v * s; + X = C * (1 - abs(h % 2 - 1)); + R = G = B = v - C; + + h = ~~h; + R += [C, X, 0, 0, X, C][h]; + G += [X, C, C, X, 0, 0][h]; + B += [0, 0, X, C, C, X][h]; + return packageRGB(R, G, B, o); + }; + + R.hsl2rgb = function (h, s, l, o) { + if (this.is(h, "object") && "h" in h && "s" in h && "l" in h) { + l = h.l; + s = h.s; + h = h.h; + } + if (h > 1 || s > 1 || l > 1) { + h /= 360; + s /= 100; + l /= 100; + } + h *= 360; + var R, G, B, X, C; + h = (h % 360) / 60; + C = 2 * s * (l < .5 ? l : 1 - l); + X = C * (1 - abs(h % 2 - 1)); + R = G = B = l - C / 2; + + h = ~~h; + R += [C, X, 0, 0, X, C][h]; + G += [X, C, C, X, 0, 0][h]; + B += [0, 0, X, C, C, X][h]; + return packageRGB(R, G, B, o); + }; + + R.rgb2hsb = function (r, g, b) { + b = prepareRGB(r, g, b); + r = b[0]; + g = b[1]; + b = b[2]; + + var H, S, V, C; + V = mmax(r, g, b); + C = V - mmin(r, g, b); + H = (C == 0 ? null : + V == r ? (g - b) / C : + V == g ? (b - r) / C + 2 : + (r - g) / C + 4 + ); + H = ((H + 360) % 6) * 60 / 360; + S = C == 0 ? 0 : C / V; + return {h: H, s: S, b: V, toString: hsbtoString}; + }; + + R.rgb2hsl = function (r, g, b) { + b = prepareRGB(r, g, b); + r = b[0]; + g = b[1]; + b = b[2]; + + var H, S, L, M, m, C; + M = mmax(r, g, b); + m = mmin(r, g, b); + C = M - m; + H = (C == 0 ? null : + M == r ? (g - b) / C : + M == g ? (b - r) / C + 2 : + (r - g) / C + 4); + H = ((H + 360) % 6) * 60 / 360; + L = (M + m) / 2; + S = (C == 0 ? 0 : + L < .5 ? C / (2 * L) : + C / (2 - 2 * L)); + return {h: H, s: S, l: L, toString: hsltoString}; + }; + R._path2string = function () { + return this.join(",").replace(p2s, "$1"); + }; + function repush(array, item) { + for (var i = 0, ii = array.length; i < ii; i++) if (array[i] === item) { + return array.push(array.splice(i, 1)[0]); + } + } + function cacher(f, scope, postprocessor) { + function newf() { + var arg = Array.prototype.slice.call(arguments, 0), + args = arg.join("\u2400"), + cache = newf.cache = newf.cache || {}, + count = newf.count = newf.count || []; + if (cache[has](args)) { + repush(count, args); + return postprocessor ? postprocessor(cache[args]) : cache[args]; + } + count.length >= 1e3 && delete cache[count.shift()]; + count.push(args); + cache[args] = f[apply](scope, arg); + return postprocessor ? postprocessor(cache[args]) : cache[args]; + } + return newf; + } + + var preload = R._preload = function (src, f) { + var img = g.doc.createElement("img"); + img.style.cssText = "position:absolute;left:-9999em;top-9999em"; + img.onload = function () { + f.call(this); + this.onload = null; + g.doc.body.removeChild(this); + }; + img.onerror = function () { + g.doc.body.removeChild(this); + }; + g.doc.body.appendChild(img); + img.src = src; + }; + + function clrToString() { + return this.hex; + } + + + R.getRGB = cacher(function (colour) { + if (!colour || !!((colour = Str(colour)).indexOf("-") + 1)) { + return {r: -1, g: -1, b: -1, hex: "none", error: 1, toString: clrToString}; + } + if (colour == "none") { + return {r: -1, g: -1, b: -1, hex: "none", toString: clrToString}; + } + !(hsrg[has](colour.toLowerCase().substring(0, 2)) || colour.charAt() == "#") && (colour = toHex(colour)); + var res, + red, + green, + blue, + opacity, + t, + values, + rgb = colour.match(colourRegExp); + if (rgb) { + if (rgb[2]) { + blue = toInt(rgb[2].substring(5), 16); + green = toInt(rgb[2].substring(3, 5), 16); + red = toInt(rgb[2].substring(1, 3), 16); + } + if (rgb[3]) { + blue = toInt((t = rgb[3].charAt(3)) + t, 16); + green = toInt((t = rgb[3].charAt(2)) + t, 16); + red = toInt((t = rgb[3].charAt(1)) + t, 16); + } + if (rgb[4]) { + values = rgb[4][split](commaSpaces); + red = toFloat(values[0]); + values[0].slice(-1) == "%" && (red *= 2.55); + green = toFloat(values[1]); + values[1].slice(-1) == "%" && (green *= 2.55); + blue = toFloat(values[2]); + values[2].slice(-1) == "%" && (blue *= 2.55); + rgb[1].toLowerCase().slice(0, 4) == "rgba" && (opacity = toFloat(values[3])); + values[3] && values[3].slice(-1) == "%" && (opacity /= 100); + } + if (rgb[5]) { + values = rgb[5][split](commaSpaces); + red = toFloat(values[0]); + values[0].slice(-1) == "%" && (red *= 2.55); + green = toFloat(values[1]); + values[1].slice(-1) == "%" && (green *= 2.55); + blue = toFloat(values[2]); + values[2].slice(-1) == "%" && (blue *= 2.55); + (values[0].slice(-3) == "deg" || values[0].slice(-1) == "\xb0") && (red /= 360); + rgb[1].toLowerCase().slice(0, 4) == "hsba" && (opacity = toFloat(values[3])); + values[3] && values[3].slice(-1) == "%" && (opacity /= 100); + return R.hsb2rgb(red, green, blue, opacity); + } + if (rgb[6]) { + values = rgb[6][split](commaSpaces); + red = toFloat(values[0]); + values[0].slice(-1) == "%" && (red *= 2.55); + green = toFloat(values[1]); + values[1].slice(-1) == "%" && (green *= 2.55); + blue = toFloat(values[2]); + values[2].slice(-1) == "%" && (blue *= 2.55); + (values[0].slice(-3) == "deg" || values[0].slice(-1) == "\xb0") && (red /= 360); + rgb[1].toLowerCase().slice(0, 4) == "hsla" && (opacity = toFloat(values[3])); + values[3] && values[3].slice(-1) == "%" && (opacity /= 100); + return R.hsl2rgb(red, green, blue, opacity); + } + rgb = {r: red, g: green, b: blue, toString: clrToString}; + rgb.hex = "#" + (16777216 | blue | (green << 8) | (red << 16)).toString(16).slice(1); + R.is(opacity, "finite") && (rgb.opacity = opacity); + return rgb; + } + return {r: -1, g: -1, b: -1, hex: "none", error: 1, toString: clrToString}; + }, R); + + R.hsb = cacher(function (h, s, b) { + return R.hsb2rgb(h, s, b).hex; + }); + + R.hsl = cacher(function (h, s, l) { + return R.hsl2rgb(h, s, l).hex; + }); + + R.rgb = cacher(function (r, g, b) { + return "#" + (16777216 | b | (g << 8) | (r << 16)).toString(16).slice(1); + }); + + R.getColor = function (value) { + var start = this.getColor.start = this.getColor.start || {h: 0, s: 1, b: value || .75}, + rgb = this.hsb2rgb(start.h, start.s, start.b); + start.h += .075; + if (start.h > 1) { + start.h = 0; + start.s -= .2; + start.s <= 0 && (this.getColor.start = {h: 0, s: 1, b: start.b}); + } + return rgb.hex; + }; + + R.getColor.reset = function () { + delete this.start; + }; + + // http://schepers.cc/getting-to-the-point + function catmullRom2bezier(crp) { + var d = []; + for (var i = 0, iLen = crp.length; iLen - 2 > i; i += 2) { + var p = [{x: +crp[i], y: +crp[i + 1]}, + {x: +crp[i], y: +crp[i + 1]}, + {x: +crp[i + 2], y: +crp[i + 3]}, + {x: +crp[i + 4], y: +crp[i + 5]}]; + if (iLen - 4 == i) { + p[0] = {x: +crp[i - 2], y: +crp[i - 1]}; + p[3] = p[2]; + } else if (i) { + p[0] = {x: +crp[i - 2], y: +crp[i - 1]}; + } + d.push(["C", + (-p[0].x + 6 * p[1].x + p[2].x) / 6, + (-p[0].y + 6 * p[1].y + p[2].y) / 6, + (p[1].x + 6 * p[2].x - p[3].x) / 6, + (p[1].y + 6*p[2].y - p[3].y) / 6, + p[2].x, + p[2].y + ]); + } + + return d; + } + + R.parsePathString = cacher(function (pathString) { + if (!pathString) { + return null; + } + var paramCounts = {a: 7, c: 6, h: 1, l: 2, m: 2, r: 4, q: 4, s: 4, t: 2, v: 1, z: 0}, + data = []; + if (R.is(pathString, array) && R.is(pathString[0], array)) { // rough assumption + data = pathClone(pathString); + } + if (!data.length) { + Str(pathString).replace(pathCommand, function (a, b, c) { + var params = [], + name = b.toLowerCase(); + c.replace(pathValues, function (a, b) { + b && params.push(+b); + }); + if (name == "m" && params.length > 2) { + data.push([b][concat](params.splice(0, 2))); + name = "l"; + b = b == "m" ? "l" : "L"; + } + if (name == "r") { + data.push([b][concat](params)); + } else while (params.length >= paramCounts[name]) { + data.push([b][concat](params.splice(0, paramCounts[name]))); + if (!paramCounts[name]) { + break; + } + } + }); + } + data.toString = R._path2string; + return data; + }); + + R.parseTransformString = cacher(function (TString) { + if (!TString) { + return null; + } + var paramCounts = {r: 3, s: 4, t: 2, m: 6}, + data = []; + if (R.is(TString, array) && R.is(TString[0], array)) { // rough assumption + data = pathClone(TString); + } + if (!data.length) { + Str(TString).replace(tCommand, function (a, b, c) { + var params = [], + name = lowerCase.call(b); + c.replace(pathValues, function (a, b) { + b && params.push(+b); + }); + data.push([b][concat](params)); + }); + } + data.toString = R._path2string; + return data; + }); + + R.findDotsAtSegment = function (p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y, t) { + var t1 = 1 - t, + t13 = pow(t1, 3), + t12 = pow(t1, 2), + t2 = t * t, + t3 = t2 * t, + x = t13 * p1x + t12 * 3 * t * c1x + t1 * 3 * t * t * c2x + t3 * p2x, + y = t13 * p1y + t12 * 3 * t * c1y + t1 * 3 * t * t * c2y + t3 * p2y, + mx = p1x + 2 * t * (c1x - p1x) + t2 * (c2x - 2 * c1x + p1x), + my = p1y + 2 * t * (c1y - p1y) + t2 * (c2y - 2 * c1y + p1y), + nx = c1x + 2 * t * (c2x - c1x) + t2 * (p2x - 2 * c2x + c1x), + ny = c1y + 2 * t * (c2y - c1y) + t2 * (p2y - 2 * c2y + c1y), + ax = t1 * p1x + t * c1x, + ay = t1 * p1y + t * c1y, + cx = t1 * c2x + t * p2x, + cy = t1 * c2y + t * p2y, + alpha = (90 - math.atan2(mx - nx, my - ny) * 180 / PI); + (mx > nx || my < ny) && (alpha += 180); + return { + x: x, + y: y, + m: {x: mx, y: my}, + n: {x: nx, y: ny}, + start: {x: ax, y: ay}, + end: {x: cx, y: cy}, + alpha: alpha + }; + }; + var pathDimensions = cacher(function (path) { + if (!path) { + return {x: 0, y: 0, width: 0, height: 0}; + } + path = path2curve(path); + var x = 0, + y = 0, + X = [], + Y = [], + p; + for (var i = 0, ii = path.length; i < ii; i++) { + p = path[i]; + if (p[0] == "M") { + x = p[1]; + y = p[2]; + X.push(x); + Y.push(y); + } else { + var dim = curveDim(x, y, p[1], p[2], p[3], p[4], p[5], p[6]); + X = X[concat](dim.min.x, dim.max.x); + Y = Y[concat](dim.min.y, dim.max.y); + x = p[5]; + y = p[6]; + } + } + var xmin = mmin[apply](0, X), + ymin = mmin[apply](0, Y); + return { + x: xmin, + y: ymin, + width: mmax[apply](0, X) - xmin, + height: mmax[apply](0, Y) - ymin + }; + }, null, function (o) { + return { + x: o.x, + y: o.y, + width: o.width, + height: o.height + }; + }), + pathClone = function (pathArray) { + var res = []; + if (!R.is(pathArray, array) || !R.is(pathArray && pathArray[0], array)) { // rough assumption + pathArray = R.parsePathString(pathArray); + } + for (var i = 0, ii = pathArray.length; i < ii; i++) { + res[i] = []; + for (var j = 0, jj = pathArray[i].length; j < jj; j++) { + res[i][j] = pathArray[i][j]; + } + } + res.toString = R._path2string; + return res; + }, + pathToRelative = R._pathToRelative = cacher(function (pathArray) { + if (!R.is(pathArray, array) || !R.is(pathArray && pathArray[0], array)) { // rough assumption + pathArray = R.parsePathString(pathArray); + } + var res = [], + x = 0, + y = 0, + mx = 0, + my = 0, + start = 0; + if (pathArray[0][0] == "M") { + x = pathArray[0][1]; + y = pathArray[0][2]; + mx = x; + my = y; + start++; + res.push(["M", x, y]); + } + for (var i = start, ii = pathArray.length; i < ii; i++) { + var r = res[i] = [], + pa = pathArray[i]; + if (pa[0] != lowerCase.call(pa[0])) { + r[0] = lowerCase.call(pa[0]); + switch (r[0]) { + case "a": + r[1] = pa[1]; + r[2] = pa[2]; + r[3] = pa[3]; + r[4] = pa[4]; + r[5] = pa[5]; + r[6] = +(pa[6] - x).toFixed(3); + r[7] = +(pa[7] - y).toFixed(3); + break; + case "v": + r[1] = +(pa[1] - y).toFixed(3); + break; + case "m": + mx = pa[1]; + my = pa[2]; + default: + for (var j = 1, jj = pa.length; j < jj; j++) { + r[j] = +(pa[j] - ((j % 2) ? x : y)).toFixed(3); + } + } + } else { + r = res[i] = []; + if (pa[0] == "m") { + mx = pa[1] + x; + my = pa[2] + y; + } + for (var k = 0, kk = pa.length; k < kk; k++) { + res[i][k] = pa[k]; + } + } + var len = res[i].length; + switch (res[i][0]) { + case "z": + x = mx; + y = my; + break; + case "h": + x += +res[i][len - 1]; + break; + case "v": + y += +res[i][len - 1]; + break; + default: + x += +res[i][len - 2]; + y += +res[i][len - 1]; + } + } + res.toString = R._path2string; + return res; + }, 0, pathClone), + pathToAbsolute = R._pathToAbsolute = cacher(function (pathArray) { + if (!R.is(pathArray, array) || !R.is(pathArray && pathArray[0], array)) { // rough assumption + pathArray = R.parsePathString(pathArray); + } + if (!pathArray || !pathArray.length) { + return [["M", 0, 0]]; + } + var res = [], + x = 0, + y = 0, + mx = 0, + my = 0, + start = 0; + if (pathArray[0][0] == "M") { + x = +pathArray[0][1]; + y = +pathArray[0][2]; + mx = x; + my = y; + start++; + res[0] = ["M", x, y]; + } + for (var r, pa, i = start, ii = pathArray.length; i < ii; i++) { + res.push(r = []); + pa = pathArray[i]; + if (pa[0] != upperCase.call(pa[0])) { + r[0] = upperCase.call(pa[0]); + switch (r[0]) { + case "A": + r[1] = pa[1]; + r[2] = pa[2]; + r[3] = pa[3]; + r[4] = pa[4]; + r[5] = pa[5]; + r[6] = +(pa[6] + x); + r[7] = +(pa[7] + y); + break; + case "V": + r[1] = +pa[1] + y; + break; + case "H": + r[1] = +pa[1] + x; + break; + case "R": + var dots = [x, y][concat](pa.slice(1)); + for (var j = 2, jj = dots.length; j < jj; j++) { + dots[j] = +dots[j] + x; + dots[++j] = +dots[j] + y; + } + res.pop(); + res = res[concat](catmullRom2bezier(dots)); + break; + case "M": + mx = +pa[1] + x; + my = +pa[2] + y; + default: + for (j = 1, jj = pa.length; j < jj; j++) { + r[j] = +pa[j] + ((j % 2) ? x : y); + } + } + } else if (pa[0] == "R") { + dots = [x, y][concat](pa.slice(1)); + res.pop(); + res = res[concat](catmullRom2bezier(dots)); + r = ["R"][concat](pa.slice(-2)); + } else { + for (var k = 0, kk = pa.length; k < kk; k++) { + r[k] = pa[k]; + } + } + switch (r[0]) { + case "Z": + x = mx; + y = my; + break; + case "H": + x = r[1]; + break; + case "V": + y = r[1]; + break; + case "M": + mx = r[r.length - 2]; + my = r[r.length - 1]; + default: + x = r[r.length - 2]; + y = r[r.length - 1]; + } + } + res.toString = R._path2string; + return res; + }, null, pathClone), + l2c = function (x1, y1, x2, y2) { + return [x1, y1, x2, y2, x2, y2]; + }, + q2c = function (x1, y1, ax, ay, x2, y2) { + var _13 = 1 / 3, + _23 = 2 / 3; + return [ + _13 * x1 + _23 * ax, + _13 * y1 + _23 * ay, + _13 * x2 + _23 * ax, + _13 * y2 + _23 * ay, + x2, + y2 + ]; + }, + a2c = function (x1, y1, rx, ry, angle, large_arc_flag, sweep_flag, x2, y2, recursive) { + // for more information of where this math came from visit: + // http://www.w3.org/TR/SVG11/implnote.html#ArcImplementationNotes + var _120 = PI * 120 / 180, + rad = PI / 180 * (+angle || 0), + res = [], + xy, + rotate = cacher(function (x, y, rad) { + var X = x * math.cos(rad) - y * math.sin(rad), + Y = x * math.sin(rad) + y * math.cos(rad); + return {x: X, y: Y}; + }); + if (!recursive) { + xy = rotate(x1, y1, -rad); + x1 = xy.x; + y1 = xy.y; + xy = rotate(x2, y2, -rad); + x2 = xy.x; + y2 = xy.y; + var cos = math.cos(PI / 180 * angle), + sin = math.sin(PI / 180 * angle), + x = (x1 - x2) / 2, + y = (y1 - y2) / 2; + var h = (x * x) / (rx * rx) + (y * y) / (ry * ry); + if (h > 1) { + h = math.sqrt(h); + rx = h * rx; + ry = h * ry; + } + var rx2 = rx * rx, + ry2 = ry * ry, + k = (large_arc_flag == sweep_flag ? -1 : 1) * + math.sqrt(abs((rx2 * ry2 - rx2 * y * y - ry2 * x * x) / (rx2 * y * y + ry2 * x * x))), + cx = k * rx * y / ry + (x1 + x2) / 2, + cy = k * -ry * x / rx + (y1 + y2) / 2, + f1 = math.asin(((y1 - cy) / ry).toFixed(9)), + f2 = math.asin(((y2 - cy) / ry).toFixed(9)); + + f1 = x1 < cx ? PI - f1 : f1; + f2 = x2 < cx ? PI - f2 : f2; + f1 < 0 && (f1 = PI * 2 + f1); + f2 < 0 && (f2 = PI * 2 + f2); + if (sweep_flag && f1 > f2) { + f1 = f1 - PI * 2; + } + if (!sweep_flag && f2 > f1) { + f2 = f2 - PI * 2; + } + } else { + f1 = recursive[0]; + f2 = recursive[1]; + cx = recursive[2]; + cy = recursive[3]; + } + var df = f2 - f1; + if (abs(df) > _120) { + var f2old = f2, + x2old = x2, + y2old = y2; + f2 = f1 + _120 * (sweep_flag && f2 > f1 ? 1 : -1); + x2 = cx + rx * math.cos(f2); + y2 = cy + ry * math.sin(f2); + res = a2c(x2, y2, rx, ry, angle, 0, sweep_flag, x2old, y2old, [f2, f2old, cx, cy]); + } + df = f2 - f1; + var c1 = math.cos(f1), + s1 = math.sin(f1), + c2 = math.cos(f2), + s2 = math.sin(f2), + t = math.tan(df / 4), + hx = 4 / 3 * rx * t, + hy = 4 / 3 * ry * t, + m1 = [x1, y1], + m2 = [x1 + hx * s1, y1 - hy * c1], + m3 = [x2 + hx * s2, y2 - hy * c2], + m4 = [x2, y2]; + m2[0] = 2 * m1[0] - m2[0]; + m2[1] = 2 * m1[1] - m2[1]; + if (recursive) { + return [m2, m3, m4][concat](res); + } else { + res = [m2, m3, m4][concat](res).join()[split](","); + var newres = []; + for (var i = 0, ii = res.length; i < ii; i++) { + newres[i] = i % 2 ? rotate(res[i - 1], res[i], rad).y : rotate(res[i], res[i + 1], rad).x; + } + return newres; + } + }, + findDotAtSegment = function (p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y, t) { + var t1 = 1 - t; + return { + x: pow(t1, 3) * p1x + pow(t1, 2) * 3 * t * c1x + t1 * 3 * t * t * c2x + pow(t, 3) * p2x, + y: pow(t1, 3) * p1y + pow(t1, 2) * 3 * t * c1y + t1 * 3 * t * t * c2y + pow(t, 3) * p2y + }; + }, + curveDim = cacher(function (p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y) { + var a = (c2x - 2 * c1x + p1x) - (p2x - 2 * c2x + c1x), + b = 2 * (c1x - p1x) - 2 * (c2x - c1x), + c = p1x - c1x, + t1 = (-b + math.sqrt(b * b - 4 * a * c)) / 2 / a, + t2 = (-b - math.sqrt(b * b - 4 * a * c)) / 2 / a, + y = [p1y, p2y], + x = [p1x, p2x], + dot; + abs(t1) > "1e12" && (t1 = .5); + abs(t2) > "1e12" && (t2 = .5); + if (t1 > 0 && t1 < 1) { + dot = findDotAtSegment(p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y, t1); + x.push(dot.x); + y.push(dot.y); + } + if (t2 > 0 && t2 < 1) { + dot = findDotAtSegment(p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y, t2); + x.push(dot.x); + y.push(dot.y); + } + a = (c2y - 2 * c1y + p1y) - (p2y - 2 * c2y + c1y); + b = 2 * (c1y - p1y) - 2 * (c2y - c1y); + c = p1y - c1y; + t1 = (-b + math.sqrt(b * b - 4 * a * c)) / 2 / a; + t2 = (-b - math.sqrt(b * b - 4 * a * c)) / 2 / a; + abs(t1) > "1e12" && (t1 = .5); + abs(t2) > "1e12" && (t2 = .5); + if (t1 > 0 && t1 < 1) { + dot = findDotAtSegment(p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y, t1); + x.push(dot.x); + y.push(dot.y); + } + if (t2 > 0 && t2 < 1) { + dot = findDotAtSegment(p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y, t2); + x.push(dot.x); + y.push(dot.y); + } + return { + min: {x: mmin[apply](0, x), y: mmin[apply](0, y)}, + max: {x: mmax[apply](0, x), y: mmax[apply](0, y)} + }; + }), + path2curve = R._path2curve = cacher(function (path, path2) { + var p = pathToAbsolute(path), + p2 = path2 && pathToAbsolute(path2), + attrs = {x: 0, y: 0, bx: 0, by: 0, X: 0, Y: 0, qx: null, qy: null}, + attrs2 = {x: 0, y: 0, bx: 0, by: 0, X: 0, Y: 0, qx: null, qy: null}, + processPath = function (path, d) { + var nx, ny; + if (!path) { + return ["C", d.x, d.y, d.x, d.y, d.x, d.y]; + } + !(path[0] in {T:1, Q:1}) && (d.qx = d.qy = null); + switch (path[0]) { + case "M": + d.X = path[1]; + d.Y = path[2]; + break; + case "A": + path = ["C"][concat](a2c[apply](0, [d.x, d.y][concat](path.slice(1)))); + break; + case "S": + nx = d.x + (d.x - (d.bx || d.x)); + ny = d.y + (d.y - (d.by || d.y)); + path = ["C", nx, ny][concat](path.slice(1)); + break; + case "T": + d.qx = d.x + (d.x - (d.qx || d.x)); + d.qy = d.y + (d.y - (d.qy || d.y)); + path = ["C"][concat](q2c(d.x, d.y, d.qx, d.qy, path[1], path[2])); + break; + case "Q": + d.qx = path[1]; + d.qy = path[2]; + path = ["C"][concat](q2c(d.x, d.y, path[1], path[2], path[3], path[4])); + break; + case "L": + path = ["C"][concat](l2c(d.x, d.y, path[1], path[2])); + break; + case "H": + path = ["C"][concat](l2c(d.x, d.y, path[1], d.y)); + break; + case "V": + path = ["C"][concat](l2c(d.x, d.y, d.x, path[1])); + break; + case "Z": + path = ["C"][concat](l2c(d.x, d.y, d.X, d.Y)); + break; + } + return path; + }, + fixArc = function (pp, i) { + if (pp[i].length > 7) { + pp[i].shift(); + var pi = pp[i]; + while (pi.length) { + pp.splice(i++, 0, ["C"][concat](pi.splice(0, 6))); + } + pp.splice(i, 1); + ii = mmax(p.length, p2 && p2.length || 0); + } + }, + fixM = function (path1, path2, a1, a2, i) { + if (path1 && path2 && path1[i][0] == "M" && path2[i][0] != "M") { + path2.splice(i, 0, ["M", a2.x, a2.y]); + a1.bx = 0; + a1.by = 0; + a1.x = path1[i][1]; + a1.y = path1[i][2]; + ii = mmax(p.length, p2 && p2.length || 0); + } + }; + for (var i = 0, ii = mmax(p.length, p2 && p2.length || 0); i < ii; i++) { + p[i] = processPath(p[i], attrs); + fixArc(p, i); + p2 && (p2[i] = processPath(p2[i], attrs2)); + p2 && fixArc(p2, i); + fixM(p, p2, attrs, attrs2, i); + fixM(p2, p, attrs2, attrs, i); + var seg = p[i], + seg2 = p2 && p2[i], + seglen = seg.length, + seg2len = p2 && seg2.length; + attrs.x = seg[seglen - 2]; + attrs.y = seg[seglen - 1]; + attrs.bx = toFloat(seg[seglen - 4]) || attrs.x; + attrs.by = toFloat(seg[seglen - 3]) || attrs.y; + attrs2.bx = p2 && (toFloat(seg2[seg2len - 4]) || attrs2.x); + attrs2.by = p2 && (toFloat(seg2[seg2len - 3]) || attrs2.y); + attrs2.x = p2 && seg2[seg2len - 2]; + attrs2.y = p2 && seg2[seg2len - 1]; + } + return p2 ? [p, p2] : p; + }, null, pathClone), + parseDots = R._parseDots = cacher(function (gradient) { + var dots = []; + for (var i = 0, ii = gradient.length; i < ii; i++) { + var dot = {}, + par = gradient[i].match(/^([^:]*):?([\d\.]*)/); + dot.color = R.getRGB(par[1]); + if (dot.color.error) { + return null; + } + dot.color = dot.color.hex; + par[2] && (dot.offset = par[2] + "%"); + dots.push(dot); + } + for (i = 1, ii = dots.length - 1; i < ii; i++) { + if (!dots[i].offset) { + var start = toFloat(dots[i - 1].offset || 0), + end = 0; + for (var j = i + 1; j < ii; j++) { + if (dots[j].offset) { + end = dots[j].offset; + break; + } + } + if (!end) { + end = 100; + j = ii; + } + end = toFloat(end); + var d = (end - start) / (j - i + 1); + for (; i < j; i++) { + start += d; + dots[i].offset = start + "%"; + } + } + } + return dots; + }), + tear = R._tear = function (el, paper) { + el == paper.top && (paper.top = el.prev); + el == paper.bottom && (paper.bottom = el.next); + el.next && (el.next.prev = el.prev); + el.prev && (el.prev.next = el.next); + }, + tofront = R._tofront = function (el, paper) { + if (paper.top === el) { + return; + } + tear(el, paper); + el.next = null; + el.prev = paper.top; + paper.top.next = el; + paper.top = el; + }, + toback = R._toback = function (el, paper) { + if (paper.bottom === el) { + return; + } + tear(el, paper); + el.next = paper.bottom; + el.prev = null; + paper.bottom.prev = el; + paper.bottom = el; + }, + insertafter = R._insertafter = function (el, el2, paper) { + tear(el, paper); + el2 == paper.top && (paper.top = el); + el2.next && (el2.next.prev = el); + el.next = el2.next; + el.prev = el2; + el2.next = el; + }, + insertbefore = R._insertbefore = function (el, el2, paper) { + tear(el, paper); + el2 == paper.bottom && (paper.bottom = el); + el2.prev && (el2.prev.next = el); + el.prev = el2.prev; + el2.prev = el; + el.next = el2; + }, + removed = function (methodname) { + return function () { + throw new Error("Rapha\xebl: you are calling to method \u201c" + methodname + "\u201d of removed object"); + }; + }, + extractTransform = R._extractTransform = function (el, tstr) { + if (tstr == null) { + return el._.transform; + } + tstr = Str(tstr).replace(/\.{3}|\u2026/g, el._.transform || E); + var tdata = R.parseTransformString(tstr), + deg = 0, + dx = 0, + dy = 0, + sx = 1, + sy = 1, + _ = el._, + m = new Matrix; + _.transform = tdata || []; + if (tdata) { + for (var i = 0, ii = tdata.length; i < ii; i++) { + var t = tdata[i], + tlen = t.length, + command = Str(t[0]).toLowerCase(), + absolute = t[0] != command, + inver = absolute ? m.invert() : 0, + x1, + y1, + x2, + y2, + bb; + if (command == "t" && tlen == 3) { + if (absolute) { + x1 = inver.x(0, 0); + y1 = inver.y(0, 0); + x2 = inver.x(t[1], t[2]); + y2 = inver.y(t[1], t[2]); + m.translate(x2 - x1, y2 - y1); + } else { + m.translate(t[1], t[2]); + } + } else if (command == "r") { + if (tlen == 2) { + bb = bb || el.getBBox(1); + m.rotate(t[1], bb.x + bb.width / 2, bb.y + bb.height / 2); + deg += t[1]; + } else if (tlen == 4) { + if (absolute) { + x2 = inver.x(t[2], t[3]); + y2 = inver.y(t[2], t[3]); + m.rotate(t[1], x2, y2); + } else { + m.rotate(t[1], t[2], t[3]); + } + deg += t[1]; + } + } else if (command == "s") { + if (tlen == 2 || tlen == 3) { + bb = bb || el.getBBox(1); + m.scale(t[1], t[tlen - 1], bb.x + bb.width / 2, bb.y + bb.height / 2); + sx *= t[1]; + sy *= t[tlen - 1]; + } else if (tlen == 5) { + if (absolute) { + x2 = inver.x(t[3], t[4]); + y2 = inver.y(t[3], t[4]); + m.scale(t[1], t[2], x2, y2); + } else { + m.scale(t[1], t[2], t[3], t[4]); + } + sx *= t[1]; + sy *= t[2]; + } + } else if (command == "m" && tlen == 7) { + m.add(t[1], t[2], t[3], t[4], t[5], t[6]); + } + _.dirtyT = 1; + el.matrix = m; + } + } + + el.matrix = m; + + _.sx = sx; + _.sy = sy; + _.deg = deg; + _.dx = dx = m.e; + _.dy = dy = m.f; + + if (sx == 1 && sy == 1 && !deg && _.bbox) { + _.bbox.x += +dx; + _.bbox.y += +dy; + } else { + _.dirtyT = 1; + } + }, + getEmpty = function (item) { + var l = item[0]; + switch (l.toLowerCase()) { + case "t": return [l, 0, 0]; + case "m": return [l, 1, 0, 0, 1, 0, 0]; + case "r": if (item.length == 4) { + return [l, 0, item[2], item[3]]; + } else { + return [l, 0]; + } + case "s": if (item.length == 5) { + return [l, 1, 1, item[3], item[4]]; + } else if (item.length == 3) { + return [l, 1, 1]; + } else { + return [l, 1]; + } + } + }, + equaliseTransform = R._equaliseTransform = function (t1, t2) { + t2 = Str(t2).replace(/\.{3}|\u2026/g, t1); + t1 = R.parseTransformString(t1) || []; + t2 = R.parseTransformString(t2) || []; + var maxlength = mmax(t1.length, t2.length), + from = [], + to = [], + i = 0, j, jj, + tt1, tt2; + for (; i < maxlength; i++) { + tt1 = t1[i] || getEmpty(t2[i]); + tt2 = t2[i] || getEmpty(tt1); + if ((tt1[0] != tt2[0]) || + (tt1[0].toLowerCase() == "r" && (tt1[2] != tt2[2] || tt1[3] != tt2[3])) || + (tt1[0].toLowerCase() == "s" && (tt1[3] != tt2[3] || tt1[4] != tt2[4])) + ) { + return; + } + from[i] = []; + to[i] = []; + for (j = 0, jj = mmax(tt1.length, tt2.length); j < jj; j++) { + j in tt1 && (from[i][j] = tt1[j]); + j in tt2 && (to[i][j] = tt2[j]); + } + } + return { + from: from, + to: to + }; + }; + R._getContainer = function (x, y, w, h) { + var container; + container = h == null && !R.is(x, "object") ? g.doc.getElementById(x) : x; + if (container == null) { + return; + } + if (container.tagName) { + if (y == null) { + return { + container: container, + width: container.style.pixelWidth || container.offsetWidth, + height: container.style.pixelHeight || container.offsetHeight + }; + } else { + return { + container: container, + width: y, + height: w + }; + } + } + return { + container: 1, + x: x, + y: y, + width: w, + height: h + }; + }; + + R.pathToRelative = pathToRelative; + R._engine = {}; + + R.path2curve = path2curve; + + R.matrix = function (a, b, c, d, e, f) { + return new Matrix(a, b, c, d, e, f); + }; + function Matrix(a, b, c, d, e, f) { + if (a != null) { + this.a = +a; + this.b = +b; + this.c = +c; + this.d = +d; + this.e = +e; + this.f = +f; + } else { + this.a = 1; + this.b = 0; + this.c = 0; + this.d = 1; + this.e = 0; + this.f = 0; + } + } + (function (matrixproto) { + + matrixproto.add = function (a, b, c, d, e, f) { + var out = [[], [], []], + m = [[this.a, this.c, this.e], [this.b, this.d, this.f], [0, 0, 1]], + matrix = [[a, c, e], [b, d, f], [0, 0, 1]], + x, y, z, res; + + if (a && a instanceof Matrix) { + matrix = [[a.a, a.c, a.e], [a.b, a.d, a.f], [0, 0, 1]]; + } + + for (x = 0; x < 3; x++) { + for (y = 0; y < 3; y++) { + res = 0; + for (z = 0; z < 3; z++) { + res += m[x][z] * matrix[z][y]; + } + out[x][y] = res; + } + } + this.a = out[0][0]; + this.b = out[1][0]; + this.c = out[0][1]; + this.d = out[1][1]; + this.e = out[0][2]; + this.f = out[1][2]; + }; + + matrixproto.invert = function () { + var me = this, + x = me.a * me.d - me.b * me.c; + return new Matrix(me.d / x, -me.b / x, -me.c / x, me.a / x, (me.c * me.f - me.d * me.e) / x, (me.b * me.e - me.a * me.f) / x); + }; + + matrixproto.clone = function () { + return new Matrix(this.a, this.b, this.c, this.d, this.e, this.f); + }; + + matrixproto.translate = function (x, y) { + this.add(1, 0, 0, 1, x, y); + }; + + matrixproto.scale = function (x, y, cx, cy) { + y == null && (y = x); + (cx || cy) && this.add(1, 0, 0, 1, cx, cy); + this.add(x, 0, 0, y, 0, 0); + (cx || cy) && this.add(1, 0, 0, 1, -cx, -cy); + }; + + matrixproto.rotate = function (a, x, y) { + a = R.rad(a); + x = x || 0; + y = y || 0; + var cos = +math.cos(a).toFixed(9), + sin = +math.sin(a).toFixed(9); + this.add(cos, sin, -sin, cos, x, y); + this.add(1, 0, 0, 1, -x, -y); + }; + + matrixproto.x = function (x, y) { + return x * this.a + y * this.c + this.e; + }; + + matrixproto.y = function (x, y) { + return x * this.b + y * this.d + this.f; + }; + matrixproto.get = function (i) { + return +this[Str.fromCharCode(97 + i)].toFixed(4); + }; + matrixproto.toString = function () { + return R.svg ? + "matrix(" + [this.get(0), this.get(1), this.get(2), this.get(3), this.get(4), this.get(5)].join() + ")" : + [this.get(0), this.get(2), this.get(1), this.get(3), 0, 0].join(); + }; + matrixproto.toFilter = function () { + return "progid:DXImageTransform.Microsoft.Matrix(M11=" + this.get(0) + + ", M12=" + this.get(2) + ", M21=" + this.get(1) + ", M22=" + this.get(3) + + ", Dx=" + this.get(4) + ", Dy=" + this.get(5) + ", sizingmethod='auto expand')"; + }; + matrixproto.offset = function () { + return [this.e.toFixed(4), this.f.toFixed(4)]; + }; + function norm(a) { + return a[0] * a[0] + a[1] * a[1]; + } + function normalize(a) { + var mag = math.sqrt(norm(a)); + a[0] && (a[0] /= mag); + a[1] && (a[1] /= mag); + } + + matrixproto.split = function () { + var out = {}; + // translation + out.dx = this.e; + out.dy = this.f; + + // scale and shear + var row = [[this.a, this.c], [this.b, this.d]]; + out.scalex = math.sqrt(norm(row[0])); + normalize(row[0]); + + out.shear = row[0][0] * row[1][0] + row[0][1] * row[1][1]; + row[1] = [row[1][0] - row[0][0] * out.shear, row[1][1] - row[0][1] * out.shear]; + + out.scaley = math.sqrt(norm(row[1])); + normalize(row[1]); + out.shear /= out.scaley; + + // rotation + var sin = -row[0][1], + cos = row[1][1]; + if (cos < 0) { + out.rotate = R.deg(math.acos(cos)); + if (sin < 0) { + out.rotate = 360 - out.rotate; + } + } else { + out.rotate = R.deg(math.asin(sin)); + } + + out.isSimple = !+out.shear.toFixed(9) && (out.scalex.toFixed(9) == out.scaley.toFixed(9) || !out.rotate); + out.isSuperSimple = !+out.shear.toFixed(9) && out.scalex.toFixed(9) == out.scaley.toFixed(9) && !out.rotate; + out.noRotation = !+out.shear.toFixed(9) && !out.rotate; + return out; + }; + + matrixproto.toTransformString = function (shorter) { + var s = shorter || this[split](); + if (s.isSimple) { + return "t" + [s.dx, s.dy] + "s" + [s.scalex, s.scaley, 0, 0] + "r" + [s.rotate, 0, 0]; + } else { + return "m" + [this.get(0), this.get(1), this.get(2), this.get(3), this.get(4), this.get(5)]; + } + }; + })(Matrix.prototype); + + // WebKit rendering bug workaround method + var version = navigator.userAgent.match(/Version\/(.*?)\s/) || navigator.userAgent.match(/Chrome\/(\d+)/); + if ((navigator.vendor == "Apple Computer, Inc.") && (version && version[1] < 4 || navigator.platform.slice(0, 2) == "iP") || + (navigator.vendor == "Google Inc." && version && version[1] < 8)) { + + paperproto.safari = function () { + var rect = this.rect(-99, -99, this.width + 99, this.height + 99).attr({stroke: "none"}); + setTimeout(function () {rect.remove();}); + }; + } else { + paperproto.safari = fun; + } + + var preventDefault = function () { + this.returnValue = false; + }, + preventTouch = function () { + return this.originalEvent.preventDefault(); + }, + stopPropagation = function () { + this.cancelBubble = true; + }, + stopTouch = function () { + return this.originalEvent.stopPropagation(); + }, + addEvent = (function () { + if (g.doc.addEventListener) { + return function (obj, type, fn, element) { + var realName = supportsTouch && touchMap[type] ? touchMap[type] : type, + f = function (e) { + var scrollY = g.doc.documentElement.scrollTop || g.doc.body.scrollTop, + scrollX = g.doc.documentElement.scrollLeft || g.doc.body.scrollLeft, + x = e.clientX + scrollX, + y = e.clientY + scrollY; + if (supportsTouch && touchMap[has](type)) { + for (var i = 0, ii = e.targetTouches && e.targetTouches.length; i < ii; i++) { + if (e.targetTouches[i].target == obj) { + var olde = e; + e = e.targetTouches[i]; + e.originalEvent = olde; + e.preventDefault = preventTouch; + e.stopPropagation = stopTouch; + break; + } + } + } + return fn.call(element, e, x, y); + }; + obj.addEventListener(realName, f, false); + return function () { + obj.removeEventListener(realName, f, false); + return true; + }; + }; + } else if (g.doc.attachEvent) { + return function (obj, type, fn, element) { + var f = function (e) { + e = e || g.win.event; + var scrollY = g.doc.documentElement.scrollTop || g.doc.body.scrollTop, + scrollX = g.doc.documentElement.scrollLeft || g.doc.body.scrollLeft, + x = e.clientX + scrollX, + y = e.clientY + scrollY; + e.preventDefault = e.preventDefault || preventDefault; + e.stopPropagation = e.stopPropagation || stopPropagation; + return fn.call(element, e, x, y); + }; + obj.attachEvent("on" + type, f); + var detacher = function () { + obj.detachEvent("on" + type, f); + return true; + }; + return detacher; + }; + } + })(), + drag = [], + dragMove = function (e) { + var x = e.clientX, + y = e.clientY, + scrollY = g.doc.documentElement.scrollTop || g.doc.body.scrollTop, + scrollX = g.doc.documentElement.scrollLeft || g.doc.body.scrollLeft, + dragi, + j = drag.length; + while (j--) { + dragi = drag[j]; + if (supportsTouch) { + var i = e.touches.length, + touch; + while (i--) { + touch = e.touches[i]; + if (touch.identifier == dragi.el._drag.id) { + x = touch.clientX; + y = touch.clientY; + (e.originalEvent ? e.originalEvent : e).preventDefault(); + break; + } + } + } else { + e.preventDefault(); + } + var node = dragi.el.node, + o, + next = node.nextSibling, + parent = node.parentNode, + display = node.style.display; + g.win.opera && parent.removeChild(node); + node.style.display = "none"; + o = dragi.el.paper.getElementByPoint(x, y); + node.style.display = display; + g.win.opera && (next ? parent.insertBefore(node, next) : parent.appendChild(node)); + o && eve("drag.over." + dragi.el.id, dragi.el, o); + x += scrollX; + y += scrollY; + eve("drag.move." + dragi.el.id, dragi.move_scope || dragi.el, x - dragi.el._drag.x, y - dragi.el._drag.y, x, y, e); + } + }, + dragUp = function (e) { + R.unmousemove(dragMove).unmouseup(dragUp); + var i = drag.length, + dragi; + while (i--) { + dragi = drag[i]; + dragi.el._drag = {}; + eve("drag.end." + dragi.el.id, dragi.end_scope || dragi.start_scope || dragi.move_scope || dragi.el, e); + } + drag = []; + }, + + elproto = R.el = {}; + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + for (var i = events.length; i--;) { + (function (eventName) { + R[eventName] = elproto[eventName] = function (fn, scope) { + if (R.is(fn, "function")) { + this.events = this.events || []; + this.events.push({name: eventName, f: fn, unbind: addEvent(this.shape || this.node || g.doc, eventName, fn, scope || this)}); + } + return this; + }; + R["un" + eventName] = elproto["un" + eventName] = function (fn) { + var events = this.events, + l = events.length; + while (l--) if (events[l].name == eventName && events[l].f == fn) { + events[l].unbind(); + events.splice(l, 1); + !events.length && delete this.events; + return this; + } + return this; + }; + })(events[i]); + } + + + elproto.data = function (key, value) { + var data = eldata[this.id] = eldata[this.id] || {}; + if (arguments.length == 1) { + if (R.is(key, "object")) { + for (var i in key) if (key[has](i)) { + this.data(i, key[i]); + } + return this; + } + eve("data.get." + this.id, this, data[key], key); + return data[key]; + } + data[key] = value; + eve("data.set." + this.id, this, value, key); + return this; + }; + + elproto.removeData = function (key) { + if (key == null) { + eldata[this.id] = {}; + } else { + eldata[this.id] && delete eldata[this.id][key]; + } + return this; + }; + + elproto.hover = function (f_in, f_out, scope_in, scope_out) { + return this.mouseover(f_in, scope_in).mouseout(f_out, scope_out || scope_in); + }; + + elproto.unhover = function (f_in, f_out) { + return this.unmouseover(f_in).unmouseout(f_out); + }; + + elproto.drag = function (onmove, onstart, onend, move_scope, start_scope, end_scope) { + function start(e) { + (e.originalEvent || e).preventDefault(); + var scrollY = g.doc.documentElement.scrollTop || g.doc.body.scrollTop, + scrollX = g.doc.documentElement.scrollLeft || g.doc.body.scrollLeft; + this._drag.x = e.clientX + scrollX; + this._drag.y = e.clientY + scrollY; + this._drag.id = e.identifier; + !drag.length && R.mousemove(dragMove).mouseup(dragUp); + drag.push({el: this, move_scope: move_scope, start_scope: start_scope, end_scope: end_scope}); + onstart && eve.on("drag.start." + this.id, onstart); + onmove && eve.on("drag.move." + this.id, onmove); + onend && eve.on("drag.end." + this.id, onend); + eve("drag.start." + this.id, start_scope || move_scope || this, e.clientX + scrollX, e.clientY + scrollY, e); + } + this._drag = {}; + this.mousedown(start); + return this; + }; + + elproto.onDragOver = function (f) { + f ? eve.on("drag.over." + this.id, f) : eve.unbind("drag.over." + this.id); + }; + + elproto.undrag = function () { + var i = drag.length; + while (i--) if (drag[i].el == this) { + R.unmousedown(drag[i].start); + drag.splice(i++, 1); + eve.unbind("drag.*." + this.id); + } + !drag.length && R.unmousemove(dragMove).unmouseup(dragUp); + }; + + paperproto.circle = function (x, y, r) { + var out = R._engine.circle(this, x || 0, y || 0, r || 0); + this.__set__ && this.__set__.push(out); + return out; + }; + + paperproto.rect = function (x, y, w, h, r) { + var out = R._engine.rect(this, x || 0, y || 0, w || 0, h || 0, r || 0); + this.__set__ && this.__set__.push(out); + return out; + }; + + paperproto.ellipse = function (x, y, rx, ry) { + var out = R._engine.ellipse(this, x || 0, y || 0, rx || 0, ry || 0); + this.__set__ && this.__set__.push(out); + return out; + }; + + paperproto.path = function (pathString) { + pathString && !R.is(pathString, string) && !R.is(pathString[0], array) && (pathString += E); + var out = R._engine.path(R.format[apply](R, arguments), this); + this.__set__ && this.__set__.push(out); + return out; + }; + + paperproto.image = function (src, x, y, w, h) { + var out = R._engine.image(this, src || "about:blank", x || 0, y || 0, w || 0, h || 0); + this.__set__ && this.__set__.push(out); + return out; + }; + + paperproto.text = function (x, y, text) { + var out = R._engine.text(this, x || 0, y || 0, Str(text)); + this.__set__ && this.__set__.push(out); + return out; + }; + + paperproto.set = function (itemsArray) { + !R.is(itemsArray, "array") && (itemsArray = Array.prototype.splice.call(arguments, 0, arguments.length)); + var out = new Set(itemsArray); + this.__set__ && this.__set__.push(out); + return out; + }; + + paperproto.setStart = function (set) { + this.__set__ = set || this.set(); + }; + + paperproto.setFinish = function (set) { + var out = this.__set__; + delete this.__set__; + return out; + }; + + paperproto.setSize = function (width, height) { + return R._engine.setSize.call(this, width, height); + }; + + paperproto.setViewBox = function (x, y, w, h, fit) { + return R._engine.setViewBox.call(this, x, y, w, h, fit); + }; + + + paperproto.top = paperproto.bottom = null; + + paperproto.raphael = R; + var getOffset = function (elem) { + var box = elem.getBoundingClientRect(), + doc = elem.ownerDocument, + body = doc.body, + docElem = doc.documentElement, + clientTop = docElem.clientTop || body.clientTop || 0, clientLeft = docElem.clientLeft || body.clientLeft || 0, + top = box.top + (g.win.pageYOffset || docElem.scrollTop || body.scrollTop ) - clientTop, + left = box.left + (g.win.pageXOffset || docElem.scrollLeft || body.scrollLeft) - clientLeft; + return { + y: top, + x: left + }; + }; + + paperproto.getElementByPoint = function (x, y) { + var paper = this, + svg = paper.canvas, + target = g.doc.elementFromPoint(x, y); + if (g.win.opera && target.tagName == "svg") { + var so = getOffset(svg), + sr = svg.createSVGRect(); + sr.x = x - so.x; + sr.y = y - so.y; + sr.width = sr.height = 1; + var hits = svg.getIntersectionList(sr, null); + if (hits.length) { + target = hits[hits.length - 1]; + } + } + if (!target) { + return null; + } + while (target.parentNode && target != svg.parentNode && !target.raphael) { + target = target.parentNode; + } + target == paper.canvas.parentNode && (target = svg); + target = target && target.raphael ? paper.getById(target.raphaelid) : null; + return target; + }; + + paperproto.getById = function (id) { + var bot = this.bottom; + while (bot) { + if (bot.id == id) { + return bot; + } + bot = bot.next; + } + return null; + }; + + paperproto.forEach = function (callback, thisArg) { + var bot = this.bottom; + while (bot) { + if (callback.call(thisArg, bot) === false) { + return this; + } + bot = bot.next; + } + return this; + }; + function x_y() { + return this.x + S + this.y; + } + function x_y_w_h() { + return this.x + S + this.y + S + this.width + " \xd7 " + this.height; + } + + elproto.getBBox = function (isWithoutTransform) { + if (this.removed) { + return {}; + } + var _ = this._; + if (isWithoutTransform) { + if (_.dirty || !_.bboxwt) { + this.realPath = getPath[this.type](this); + _.bboxwt = pathDimensions(this.realPath); + _.bboxwt.toString = x_y_w_h; + _.dirty = 0; + } + return _.bboxwt; + } + if (_.dirty || _.dirtyT || !_.bbox) { + if (_.dirty || !this.realPath) { + _.bboxwt = 0; + this.realPath = getPath[this.type](this); + } + _.bbox = pathDimensions(mapPath(this.realPath, this.matrix)); + _.bbox.toString = x_y_w_h; + _.dirty = _.dirtyT = 0; + } + return _.bbox; + }; + + elproto.clone = function () { + if (this.removed) { + return null; + } + var out = this.paper[this.type]().attr(this.attr()); + this.__set__ && this.__set__.push(out); + return out; + }; + + elproto.glow = function (glow) { + if (this.type == "text") { + return null; + } + glow = glow || {}; + var s = { + width: (glow.width || 10) + (+this.attr("stroke-width") || 1), + fill: glow.fill || false, + opacity: glow.opacity || .5, + offsetx: glow.offsetx || 0, + offsety: glow.offsety || 0, + color: glow.color || "#000" + }, + c = s.width / 2, + r = this.paper, + out = r.set(), + path = this.realPath || getPath[this.type](this); + path = this.matrix ? mapPath(path, this.matrix) : path; + for (var i = 1; i < c + 1; i++) { + out.push(r.path(path).attr({ + stroke: s.color, + fill: s.fill ? s.color : "none", + "stroke-linejoin": "round", + "stroke-linecap": "round", + "stroke-width": +(s.width / c * i).toFixed(3), + opacity: +(s.opacity / c).toFixed(3) + })); + } + return out.insertBefore(this).translate(s.offsetx, s.offsety); + }; + var curveslengths = {}, + getPointAtSegmentLength = function (p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y, length) { + var len = 0, + precision = 100, + name = [p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y].join(), + cache = curveslengths[name], + old, dot; + !cache && (curveslengths[name] = cache = {data: []}); + cache.timer && clearTimeout(cache.timer); + cache.timer = setTimeout(function () {delete curveslengths[name];}, 2e3); + if (length != null && !cache.precision) { + var total = getPointAtSegmentLength(p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y); + cache.precision = ~~total * 10; + cache.data = []; + } + precision = cache.precision || precision; + for (var i = 0; i < precision + 1; i++) { + if (cache.data[i * precision]) { + dot = cache.data[i * precision]; + } else { + dot = R.findDotsAtSegment(p1x, p1y, c1x, c1y, c2x, c2y, p2x, p2y, i / precision); + cache.data[i * precision] = dot; + } + i && (len += pow(pow(old.x - dot.x, 2) + pow(old.y - dot.y, 2), .5)); + if (length != null && len >= length) { + return dot; + } + old = dot; + } + if (length == null) { + return len; + } + }, + getLengthFactory = function (istotal, subpath) { + return function (path, length, onlystart) { + path = path2curve(path); + var x, y, p, l, sp = "", subpaths = {}, point, + len = 0; + for (var i = 0, ii = path.length; i < ii; i++) { + p = path[i]; + if (p[0] == "M") { + x = +p[1]; + y = +p[2]; + } else { + l = getPointAtSegmentLength(x, y, p[1], p[2], p[3], p[4], p[5], p[6]); + if (len + l > length) { + if (subpath && !subpaths.start) { + point = getPointAtSegmentLength(x, y, p[1], p[2], p[3], p[4], p[5], p[6], length - len); + sp += ["C" + point.start.x, point.start.y, point.m.x, point.m.y, point.x, point.y]; + if (onlystart) {return sp;} + subpaths.start = sp; + sp = ["M" + point.x, point.y + "C" + point.n.x, point.n.y, point.end.x, point.end.y, p[5], p[6]].join(); + len += l; + x = +p[5]; + y = +p[6]; + continue; + } + if (!istotal && !subpath) { + point = getPointAtSegmentLength(x, y, p[1], p[2], p[3], p[4], p[5], p[6], length - len); + return {x: point.x, y: point.y, alpha: point.alpha}; + } + } + len += l; + x = +p[5]; + y = +p[6]; + } + sp += p.shift() + p; + } + subpaths.end = sp; + point = istotal ? len : subpath ? subpaths : R.findDotsAtSegment(x, y, p[0], p[1], p[2], p[3], p[4], p[5], 1); + point.alpha && (point = {x: point.x, y: point.y, alpha: point.alpha}); + return point; + }; + }; + var getTotalLength = getLengthFactory(1), + getPointAtLength = getLengthFactory(), + getSubpathsAtLength = getLengthFactory(0, 1); + + R.getTotalLength = getTotalLength; + + R.getPointAtLength = getPointAtLength; + + R.getSubpath = function (path, from, to) { + if (this.getTotalLength(path) - to < 1e-6) { + return getSubpathsAtLength(path, from).end; + } + var a = getSubpathsAtLength(path, to, 1); + return from ? getSubpathsAtLength(a, from).end : a; + }; + + elproto.getTotalLength = function () { + if (this.type != "path") {return;} + if (this.node.getTotalLength) { + return this.node.getTotalLength(); + } + return getTotalLength(this.attrs.path); + }; + + elproto.getPointAtLength = function (length) { + if (this.type != "path") {return;} + return getPointAtLength(this.attrs.path, length); + }; + + elproto.getSubpath = function (from, to) { + if (this.type != "path") {return;} + return R.getSubpath(this.attrs.path, from, to); + }; + + var ef = R.easing_formulas = { + linear: function (n) { + return n; + }, + "<": function (n) { + return pow(n, 1.7); + }, + ">": function (n) { + return pow(n, .48); + }, + "<>": function (n) { + var q = .48 - n / 1.04, + Q = math.sqrt(.1734 + q * q), + x = Q - q, + X = pow(abs(x), 1 / 3) * (x < 0 ? -1 : 1), + y = -Q - q, + Y = pow(abs(y), 1 / 3) * (y < 0 ? -1 : 1), + t = X + Y + .5; + return (1 - t) * 3 * t * t + t * t * t; + }, + backIn: function (n) { + var s = 1.70158; + return n * n * ((s + 1) * n - s); + }, + backOut: function (n) { + n = n - 1; + var s = 1.70158; + return n * n * ((s + 1) * n + s) + 1; + }, + elastic: function (n) { + if (n == !!n) { + return n; + } + return pow(2, -10 * n) * math.sin((n - .075) * (2 * PI) / .3) + 1; + }, + bounce: function (n) { + var s = 7.5625, + p = 2.75, + l; + if (n < (1 / p)) { + l = s * n * n; + } else { + if (n < (2 / p)) { + n -= (1.5 / p); + l = s * n * n + .75; + } else { + if (n < (2.5 / p)) { + n -= (2.25 / p); + l = s * n * n + .9375; + } else { + n -= (2.625 / p); + l = s * n * n + .984375; + } + } + } + return l; + } + }; + ef.easeIn = ef["ease-in"] = ef["<"]; + ef.easeOut = ef["ease-out"] = ef[">"]; + ef.easeInOut = ef["ease-in-out"] = ef["<>"]; + ef["back-in"] = ef.backIn; + ef["back-out"] = ef.backOut; + + var animationElements = [], + requestAnimFrame = window.requestAnimationFrame || + window.webkitRequestAnimationFrame || + window.mozRequestAnimationFrame || + window.oRequestAnimationFrame || + window.msRequestAnimationFrame || + function (callback) { + setTimeout(callback, 16); + }, + animation = function () { + var Now = +new Date, + l = 0; + for (; l < animationElements.length; l++) { + var e = animationElements[l]; + if (e.el.removed || e.paused) { + continue; + } + var time = Now - e.start, + ms = e.ms, + easing = e.easing, + from = e.from, + diff = e.diff, + to = e.to, + t = e.t, + that = e.el, + set = {}, + now, + init = {}, + key; + if (e.initstatus) { + time = (e.initstatus * e.anim.top - e.prev) / (e.percent - e.prev) * ms; + e.status = e.initstatus; + delete e.initstatus; + e.stop && animationElements.splice(l--, 1); + } else { + e.status = (e.prev + (e.percent - e.prev) * (time / ms)) / e.anim.top; + } + if (time < 0) { + continue; + } + if (time < ms) { + var pos = easing(time / ms); + for (var attr in from) if (from[has](attr)) { + switch (availableAnimAttrs[attr]) { + case nu: + now = +from[attr] + pos * ms * diff[attr]; + break; + case "colour": + now = "rgb(" + [ + upto255(round(from[attr].r + pos * ms * diff[attr].r)), + upto255(round(from[attr].g + pos * ms * diff[attr].g)), + upto255(round(from[attr].b + pos * ms * diff[attr].b)) + ].join(",") + ")"; + break; + case "path": + now = []; + for (var i = 0, ii = from[attr].length; i < ii; i++) { + now[i] = [from[attr][i][0]]; + for (var j = 1, jj = from[attr][i].length; j < jj; j++) { + now[i][j] = +from[attr][i][j] + pos * ms * diff[attr][i][j]; + } + now[i] = now[i].join(S); + } + now = now.join(S); + break; + case "transform": + if (diff[attr].real) { + now = []; + for (i = 0, ii = from[attr].length; i < ii; i++) { + now[i] = [from[attr][i][0]]; + for (j = 1, jj = from[attr][i].length; j < jj; j++) { + now[i][j] = from[attr][i][j] + pos * ms * diff[attr][i][j]; + } + } + } else { + var get = function (i) { + return +from[attr][i] + pos * ms * diff[attr][i]; + }; + // now = [["r", get(2), 0, 0], ["t", get(3), get(4)], ["s", get(0), get(1), 0, 0]]; + now = [["m", get(0), get(1), get(2), get(3), get(4), get(5)]]; + } + break; + case "csv": + if (attr == "clip-rect") { + now = []; + i = 4; + while (i--) { + now[i] = +from[attr][i] + pos * ms * diff[attr][i]; + } + } + break; + default: + var from2 = [][concat](from[attr]); + now = []; + i = that.paper.customAttributes[attr].length; + while (i--) { + now[i] = +from2[i] + pos * ms * diff[attr][i]; + } + break; + } + set[attr] = now; + } + that.attr(set); + (function (id, that, anim) { + setTimeout(function () { + eve("anim.frame." + id, that, anim); + }); + })(that.id, that, e.anim); + } else { + (function(f, el, a) { + setTimeout(function() { + eve("anim.frame." + el.id, el, a); + eve("anim.finish." + el.id, el, a); + R.is(f, "function") && f.call(el); + }); + })(e.callback, that, e.anim); + that.attr(to); + animationElements.splice(l--, 1); + if (e.repeat > 1 && !e.next) { + for (key in to) if (to[has](key)) { + init[key] = e.totalOrigin[key]; + } + e.el.attr(init); + runAnimation(e.anim, e.el, e.anim.percents[0], null, e.totalOrigin, e.repeat - 1); + } + if (e.next && !e.stop) { + runAnimation(e.anim, e.el, e.next, null, e.totalOrigin, e.repeat); + } + } + } + R.svg && that && that.paper && that.paper.safari(); + animationElements.length && requestAnimFrame(animation); + }, + upto255 = function (color) { + return color > 255 ? 255 : color < 0 ? 0 : color; + }; + + elproto.animateWith = function (element, anim, params, ms, easing, callback) { + var a = params ? R.animation(params, ms, easing, callback) : anim; + status = element.status(anim); + return this.animate(a).status(a, status * anim.ms / a.ms); + }; + function CubicBezierAtTime(t, p1x, p1y, p2x, p2y, duration) { + var cx = 3 * p1x, + bx = 3 * (p2x - p1x) - cx, + ax = 1 - cx - bx, + cy = 3 * p1y, + by = 3 * (p2y - p1y) - cy, + ay = 1 - cy - by; + function sampleCurveX(t) { + return ((ax * t + bx) * t + cx) * t; + } + function solve(x, epsilon) { + var t = solveCurveX(x, epsilon); + return ((ay * t + by) * t + cy) * t; + } + function solveCurveX(x, epsilon) { + var t0, t1, t2, x2, d2, i; + for(t2 = x, i = 0; i < 8; i++) { + x2 = sampleCurveX(t2) - x; + if (abs(x2) < epsilon) { + return t2; + } + d2 = (3 * ax * t2 + 2 * bx) * t2 + cx; + if (abs(d2) < 1e-6) { + break; + } + t2 = t2 - x2 / d2; + } + t0 = 0; + t1 = 1; + t2 = x; + if (t2 < t0) { + return t0; + } + if (t2 > t1) { + return t1; + } + while (t0 < t1) { + x2 = sampleCurveX(t2); + if (abs(x2 - x) < epsilon) { + return t2; + } + if (x > x2) { + t0 = t2; + } else { + t1 = t2; + } + t2 = (t1 - t0) / 2 + t0; + } + return t2; + } + return solve(t, 1 / (200 * duration)); + } + elproto.onAnimation = function (f) { + f ? eve.on("anim.frame." + this.id, f) : eve.unbind("anim.frame." + this.id); + return this; + }; + function Animation(anim, ms) { + var percents = [], + newAnim = {}; + this.ms = ms; + this.times = 1; + if (anim) { + for (var attr in anim) if (anim[has](attr)) { + newAnim[toFloat(attr)] = anim[attr]; + percents.push(toFloat(attr)); + } + percents.sort(sortByNumber); + } + this.anim = newAnim; + this.top = percents[percents.length - 1]; + this.percents = percents; + } + + Animation.prototype.delay = function (delay) { + var a = new Animation(this.anim, this.ms); + a.times = this.times; + a.del = +delay || 0; + return a; + }; + + Animation.prototype.repeat = function (times) { + var a = new Animation(this.anim, this.ms); + a.del = this.del; + a.times = math.floor(mmax(times, 0)) || 1; + return a; + }; + function runAnimation(anim, element, percent, status, totalOrigin, times) { + percent = toFloat(percent); + var params, + isInAnim, + isInAnimSet, + percents = [], + next, + prev, + timestamp, + ms = anim.ms, + from = {}, + to = {}, + diff = {}; + if (status) { + for (i = 0, ii = animationElements.length; i < ii; i++) { + var e = animationElements[i]; + if (e.el.id == element.id && e.anim == anim) { + if (e.percent != percent) { + animationElements.splice(i, 1); + isInAnimSet = 1; + } else { + isInAnim = e; + } + element.attr(e.totalOrigin); + break; + } + } + } else { + status = +to; // NaN + } + for (var i = 0, ii = anim.percents.length; i < ii; i++) { + if (anim.percents[i] == percent || anim.percents[i] > status * anim.top) { + percent = anim.percents[i]; + prev = anim.percents[i - 1] || 0; + ms = ms / anim.top * (percent - prev); + next = anim.percents[i + 1]; + params = anim.anim[percent]; + break; + } else if (status) { + element.attr(anim.anim[anim.percents[i]]); + } + } + if (!params) { + return; + } + if (!isInAnim) { + for (attr in params) if (params[has](attr)) { + if (availableAnimAttrs[has](attr) || element.paper.customAttributes[has](attr)) { + from[attr] = element.attr(attr); + (from[attr] == null) && (from[attr] = availableAttrs[attr]); + to[attr] = params[attr]; + switch (availableAnimAttrs[attr]) { + case nu: + diff[attr] = (to[attr] - from[attr]) / ms; + break; + case "colour": + from[attr] = R.getRGB(from[attr]); + var toColour = R.getRGB(to[attr]); + diff[attr] = { + r: (toColour.r - from[attr].r) / ms, + g: (toColour.g - from[attr].g) / ms, + b: (toColour.b - from[attr].b) / ms + }; + break; + case "path": + var pathes = path2curve(from[attr], to[attr]), + toPath = pathes[1]; + from[attr] = pathes[0]; + diff[attr] = []; + for (i = 0, ii = from[attr].length; i < ii; i++) { + diff[attr][i] = [0]; + for (var j = 1, jj = from[attr][i].length; j < jj; j++) { + diff[attr][i][j] = (toPath[i][j] - from[attr][i][j]) / ms; + } + } + break; + case "transform": + var _ = element._, + eq = equaliseTransform(_[attr], to[attr]); + if (eq) { + from[attr] = eq.from; + to[attr] = eq.to; + diff[attr] = []; + diff[attr].real = true; + for (i = 0, ii = from[attr].length; i < ii; i++) { + diff[attr][i] = [from[attr][i][0]]; + for (j = 1, jj = from[attr][i].length; j < jj; j++) { + diff[attr][i][j] = (to[attr][i][j] - from[attr][i][j]) / ms; + } + } + } else { + var m = (element.matrix || new Matrix), + to2 = { + _: {transform: _.transform}, + getBBox: function () { + return element.getBBox(1); + } + }; + from[attr] = [ + m.a, + m.b, + m.c, + m.d, + m.e, + m.f + ]; + extractTransform(to2, to[attr]); + to[attr] = to2._.transform; + diff[attr] = [ + (to2.matrix.a - m.a) / ms, + (to2.matrix.b - m.b) / ms, + (to2.matrix.c - m.c) / ms, + (to2.matrix.d - m.d) / ms, + (to2.matrix.e - m.e) / ms, + (to2.matrix.e - m.f) / ms + ]; + // from[attr] = [_.sx, _.sy, _.deg, _.dx, _.dy]; + // var to2 = {_:{}, getBBox: function () { return element.getBBox(); }}; + // extractTransform(to2, to[attr]); + // diff[attr] = [ + // (to2._.sx - _.sx) / ms, + // (to2._.sy - _.sy) / ms, + // (to2._.deg - _.deg) / ms, + // (to2._.dx - _.dx) / ms, + // (to2._.dy - _.dy) / ms + // ]; + } + break; + case "csv": + var values = Str(params[attr])[split](separator), + from2 = Str(from[attr])[split](separator); + if (attr == "clip-rect") { + from[attr] = from2; + diff[attr] = []; + i = from2.length; + while (i--) { + diff[attr][i] = (values[i] - from[attr][i]) / ms; + } + } + to[attr] = values; + break; + default: + values = [][concat](params[attr]); + from2 = [][concat](from[attr]); + diff[attr] = []; + i = element.paper.customAttributes[attr].length; + while (i--) { + diff[attr][i] = ((values[i] || 0) - (from2[i] || 0)) / ms; + } + break; + } + } + } + var easing = params.easing, + easyeasy = R.easing_formulas[easing]; + if (!easyeasy) { + easyeasy = Str(easing).match(bezierrg); + if (easyeasy && easyeasy.length == 5) { + var curve = easyeasy; + easyeasy = function (t) { + return CubicBezierAtTime(t, +curve[1], +curve[2], +curve[3], +curve[4], ms); + }; + } else { + easyeasy = pipe; + } + } + timestamp = params.start || anim.start || +new Date; + e = { + anim: anim, + percent: percent, + timestamp: timestamp, + start: timestamp + (anim.del || 0), + status: 0, + initstatus: status || 0, + stop: false, + ms: ms, + easing: easyeasy, + from: from, + diff: diff, + to: to, + el: element, + callback: params.callback, + prev: prev, + next: next, + repeat: times || anim.times, + origin: element.attr(), + totalOrigin: totalOrigin + }; + animationElements.push(e); + if (status && !isInAnim && !isInAnimSet) { + e.stop = true; + e.start = new Date - ms * status; + if (animationElements.length == 1) { + return animation(); + } + } + if (isInAnimSet) { + e.start = new Date - e.ms * status; + } + animationElements.length == 1 && requestAnimFrame(animation); + } else { + isInAnim.initstatus = status; + isInAnim.start = new Date - isInAnim.ms * status; + } + eve("anim.start." + element.id, element, anim); + } + + R.animation = function (params, ms, easing, callback) { + if (params instanceof Animation) { + return params; + } + if (R.is(easing, "function") || !easing) { + callback = callback || easing || null; + easing = null; + } + params = Object(params); + ms = +ms || 0; + var p = {}, + json, + attr; + for (attr in params) if (params[has](attr) && toFloat(attr) != attr && toFloat(attr) + "%" != attr) { + json = true; + p[attr] = params[attr]; + } + if (!json) { + return new Animation(params, ms); + } else { + easing && (p.easing = easing); + callback && (p.callback = callback); + return new Animation({100: p}, ms); + } + }; + + elproto.animate = function (params, ms, easing, callback) { + var element = this; + if (element.removed) { + callback && callback.call(element); + return element; + } + var anim = params instanceof Animation ? params : R.animation(params, ms, easing, callback); + runAnimation(anim, element, anim.percents[0], null, element.attr()); + return element; + }; + + elproto.setTime = function (anim, value) { + if (anim && value != null) { + this.status(anim, mmin(value, anim.ms) / anim.ms); + } + return this; + }; + + elproto.status = function (anim, value) { + var out = [], + i = 0, + len, + e; + if (value != null) { + runAnimation(anim, this, -1, mmin(value, 1)); + return this; + } else { + len = animationElements.length; + for (; i < len; i++) { + e = animationElements[i]; + if (e.el.id == this.id && (!anim || e.anim == anim)) { + if (anim) { + return e.status; + } + out.push({ + anim: e.anim, + status: e.status + }); + } + } + if (anim) { + return 0; + } + return out; + } + }; + + elproto.pause = function (anim) { + for (var i = 0; i < animationElements.length; i++) if (animationElements[i].el.id == this.id && (!anim || animationElements[i].anim == anim)) { + if (eve("anim.pause." + this.id, this, animationElements[i].anim) !== false) { + animationElements[i].paused = true; + } + } + return this; + }; + + elproto.resume = function (anim) { + for (var i = 0; i < animationElements.length; i++) if (animationElements[i].el.id == this.id && (!anim || animationElements[i].anim == anim)) { + var e = animationElements[i]; + if (eve("anim.resume." + this.id, this, e.anim) !== false) { + delete e.paused; + this.status(e.anim, e.status); + } + } + return this; + }; + + elproto.stop = function (anim) { + for (var i = 0; i < animationElements.length; i++) if (animationElements[i].el.id == this.id && (!anim || animationElements[i].anim == anim)) { + if (eve("anim.stop." + this.id, this, animationElements[i].anim) !== false) { + animationElements.splice(i--, 1); + } + } + return this; + }; + elproto.toString = function () { + return "Rapha\xebl\u2019s object"; + }; + + // Set + var Set = function (items) { + this.items = []; + this.length = 0; + this.type = "set"; + if (items) { + for (var i = 0, ii = items.length; i < ii; i++) { + if (items[i] && (items[i].constructor == elproto.constructor || items[i].constructor == Set)) { + this[this.items.length] = this.items[this.items.length] = items[i]; + this.length++; + } + } + } + }, + setproto = Set.prototype; + + setproto.push = function () { + var item, + len; + for (var i = 0, ii = arguments.length; i < ii; i++) { + item = arguments[i]; + if (item && (item.constructor == elproto.constructor || item.constructor == Set)) { + len = this.items.length; + this[len] = this.items[len] = item; + this.length++; + } + } + return this; + }; + + setproto.pop = function () { + this.length && delete this[this.length--]; + return this.items.pop(); + }; + + setproto.forEach = function (callback, thisArg) { + for (var i = 0, ii = this.items.length; i < ii; i++) { + if (callback.call(thisArg, this.items[i], i) === false) { + return this; + } + } + return this; + }; + for (var method in elproto) if (elproto[has](method)) { + setproto[method] = (function (methodname) { + return function () { + var arg = arguments; + return this.forEach(function (el) { + el[methodname][apply](el, arg); + }); + }; + })(method); + } + setproto.attr = function (name, value) { + if (name && R.is(name, array) && R.is(name[0], "object")) { + for (var j = 0, jj = name.length; j < jj; j++) { + this.items[j].attr(name[j]); + } + } else { + for (var i = 0, ii = this.items.length; i < ii; i++) { + this.items[i].attr(name, value); + } + } + return this; + }; + + setproto.clear = function () { + while (this.length) { + this.pop(); + } + }; + + setproto.splice = function (index, count, insertion) { + index = index < 0 ? mmax(this.length + index, 0) : index; + count = mmax(0, mmin(this.length - index, count)); + var tail = [], + todel = [], + args = [], + i; + for (i = 2; i < arguments.length; i++) { + args.push(arguments[i]); + } + for (i = 0; i < count; i++) { + todel.push(this[index + i]); + } + for (; i < this.length - index; i++) { + tail.push(this[index + i]); + } + var arglen = args.length; + for (i = 0; i < arglen + tail.length; i++) { + this.items[index + i] = this[index + i] = i < arglen ? args[i] : tail[i - arglen]; + } + i = this.items.length = this.length -= count - arglen; + while (this[i]) { + delete this[i++]; + } + return new Set(todel); + }; + + setproto.exclude = function (el) { + for (var i = 0, ii = this.length; i < ii; i++) if (this[i] == el) { + this.splice(i, 1); + return true; + } + }; + setproto.animate = function (params, ms, easing, callback) { + (R.is(easing, "function") || !easing) && (callback = easing || null); + var len = this.items.length, + i = len, + item, + set = this, + collector; + if (!len) { + return this; + } + callback && (collector = function () { + !--len && callback.call(set); + }); + easing = R.is(easing, string) ? easing : collector; + var anim = R.animation(params, ms, easing, collector); + item = this.items[--i].animate(anim); + while (i--) { + this.items[i] && !this.items[i].removed && this.items[i].animateWith(item, anim); + } + return this; + }; + setproto.insertAfter = function (el) { + var i = this.items.length; + while (i--) { + this.items[i].insertAfter(el); + } + return this; + }; + setproto.getBBox = function () { + var x = [], + y = [], + w = [], + h = []; + for (var i = this.items.length; i--;) if (!this.items[i].removed) { + var box = this.items[i].getBBox(); + x.push(box.x); + y.push(box.y); + w.push(box.x + box.width); + h.push(box.y + box.height); + } + x = mmin[apply](0, x); + y = mmin[apply](0, y); + return { + x: x, + y: y, + width: mmax[apply](0, w) - x, + height: mmax[apply](0, h) - y + }; + }; + setproto.clone = function (s) { + s = new Set; + for (var i = 0, ii = this.items.length; i < ii; i++) { + s.push(this.items[i].clone()); + } + return s; + }; + setproto.toString = function () { + return "Rapha\xebl\u2018s set"; + }; + + + R.registerFont = function (font) { + if (!font.face) { + return font; + } + this.fonts = this.fonts || {}; + var fontcopy = { + w: font.w, + face: {}, + glyphs: {} + }, + family = font.face["font-family"]; + for (var prop in font.face) if (font.face[has](prop)) { + fontcopy.face[prop] = font.face[prop]; + } + if (this.fonts[family]) { + this.fonts[family].push(fontcopy); + } else { + this.fonts[family] = [fontcopy]; + } + if (!font.svg) { + fontcopy.face["units-per-em"] = toInt(font.face["units-per-em"], 10); + for (var glyph in font.glyphs) if (font.glyphs[has](glyph)) { + var path = font.glyphs[glyph]; + fontcopy.glyphs[glyph] = { + w: path.w, + k: {}, + d: path.d && "M" + path.d.replace(/[mlcxtrv]/g, function (command) { + return {l: "L", c: "C", x: "z", t: "m", r: "l", v: "c"}[command] || "M"; + }) + "z" + }; + if (path.k) { + for (var k in path.k) if (path[has](k)) { + fontcopy.glyphs[glyph].k[k] = path.k[k]; + } + } + } + } + return font; + }; + + paperproto.getFont = function (family, weight, style, stretch) { + stretch = stretch || "normal"; + style = style || "normal"; + weight = +weight || {normal: 400, bold: 700, lighter: 300, bolder: 800}[weight] || 400; + if (!R.fonts) { + return; + } + var font = R.fonts[family]; + if (!font) { + var name = new RegExp("(^|\\s)" + family.replace(/[^\w\d\s+!~.:_-]/g, E) + "(\\s|$)", "i"); + for (var fontName in R.fonts) if (R.fonts[has](fontName)) { + if (name.test(fontName)) { + font = R.fonts[fontName]; + break; + } + } + } + var thefont; + if (font) { + for (var i = 0, ii = font.length; i < ii; i++) { + thefont = font[i]; + if (thefont.face["font-weight"] == weight && (thefont.face["font-style"] == style || !thefont.face["font-style"]) && thefont.face["font-stretch"] == stretch) { + break; + } + } + } + return thefont; + }; + + paperproto.print = function (x, y, string, font, size, origin, letter_spacing) { + origin = origin || "middle"; // baseline|middle + letter_spacing = mmax(mmin(letter_spacing || 0, 1), -1); + var out = this.set(), + letters = Str(string)[split](E), + shift = 0, + path = E, + scale; + R.is(font, string) && (font = this.getFont(font)); + if (font) { + scale = (size || 16) / font.face["units-per-em"]; + var bb = font.face.bbox[split](separator), + top = +bb[0], + height = +bb[1] + (origin == "baseline" ? bb[3] - bb[1] + (+font.face.descent) : (bb[3] - bb[1]) / 2); + for (var i = 0, ii = letters.length; i < ii; i++) { + var prev = i && font.glyphs[letters[i - 1]] || {}, + curr = font.glyphs[letters[i]]; + shift += i ? (prev.w || font.w) + (prev.k && prev.k[letters[i]] || 0) + (font.w * letter_spacing) : 0; + curr && curr.d && out.push(this.path(curr.d).attr({ + fill: "#000", + stroke: "none", + transform: [["t", shift * scale, 0]] + })); + } + out.transform(["...s", scale, scale, top, height, "t", (x - top) / scale, (y - height) / scale]); + } + return out; + }; + + + R.format = function (token, params) { + var args = R.is(params, array) ? [0][concat](params) : arguments; + token && R.is(token, string) && args.length - 1 && (token = token.replace(formatrg, function (str, i) { + return args[++i] == null ? E : args[i]; + })); + return token || E; + }; + + R.fullfill = (function () { + var tokenRegex = /\{([^\}]+)\}/g, + objNotationRegex = /(?:(?:^|\.)(.+?)(?=\[|\.|$|\()|\[('|")(.+?)\2\])(\(\))?/g, // matches .xxxxx or ["xxxxx"] to run over object properties + replacer = function (all, key, obj) { + var res = obj; + key.replace(objNotationRegex, function (all, name, quote, quotedName, isFunc) { + name = name || quotedName; + if (res) { + if (name in res) { + res = res[name]; + } + typeof res == "function" && isFunc && (res = res()); + } + }); + res = (res == null || res == obj ? all : res) + ""; + return res; + }; + return function (str, obj) { + return String(str).replace(tokenRegex, function (all, key) { + return replacer(all, key, obj); + }); + }; + })(); + + R.ninja = function () { + oldRaphael.was ? (g.win.Raphael = oldRaphael.is) : delete Raphael; + return R; + }; + + R.st = setproto; + // Firefox <3.6 fix: http://webreflection.blogspot.com/2009/11/195-chars-to-help-lazy-loading.html + (function (doc, loaded, f) { + if (doc.readyState == null && doc.addEventListener){ + doc.addEventListener(loaded, f = function () { + doc.removeEventListener(loaded, f, false); + doc.readyState = "complete"; + }, false); + doc.readyState = "loading"; + } + function isLoaded() { + (/in/).test(doc.readyState) ? setTimeout(isLoaded, 9) : R.eve("DOMload"); + } + isLoaded(); + })(document, "DOMContentLoaded"); + + oldRaphael.was ? (g.win.Raphael = R) : (Raphael = R); + + eve.on("DOMload", function () { + loaded = true; + }); +})(); + +// ┌─────────────────────────────────────────────────────────────────────┠\\ +// │ Raphaël 2 - JavaScript Vector Library │ \\ +// ├─────────────────────────────────────────────────────────────────────┤ \\ +// │ SVG Module │ \\ +// ├─────────────────────────────────────────────────────────────────────┤ \\ +// │ Copyright (c) 2008-2011 Dmitry Baranovskiy (http://raphaeljs.com) │ \\ +// │ Copyright (c) 2008-2011 Sencha Labs (http://sencha.com) │ \\ +// │ Licensed under the MIT (http://raphaeljs.com/license.html) license. │ \\ +// └─────────────────────────────────────────────────────────────────────┘ \\ +window.Raphael.svg && function (R) { + var has = "hasOwnProperty", + Str = String, + toFloat = parseFloat, + toInt = parseInt, + math = Math, + mmax = math.max, + abs = math.abs, + pow = math.pow, + separator = /[, ]+/, + eve = R.eve, + E = "", + S = " "; + var xlink = "http://www.w3.org/1999/xlink", + markers = { + block: "M5,0 0,2.5 5,5z", + classic: "M5,0 0,2.5 5,5 3.5,3 3.5,2z", + diamond: "M2.5,0 5,2.5 2.5,5 0,2.5z", + open: "M6,1 1,3.5 6,6", + oval: "M2.5,0A2.5,2.5,0,0,1,2.5,5 2.5,2.5,0,0,1,2.5,0z" + }, + markerCounter = {}; + R.toString = function () { + return "Your browser supports SVG.\nYou are running Rapha\xebl " + this.version; + }; + var $ = function (el, attr) { + if (attr) { + if (typeof el == "string") { + el = $(el); + } + for (var key in attr) if (attr[has](key)) { + if (key.substring(0, 6) == "xlink:") { + el.setAttributeNS(xlink, key.substring(6), Str(attr[key])); + } else { + el.setAttribute(key, Str(attr[key])); + } + } + } else { + el = R._g.doc.createElementNS("http://www.w3.org/2000/svg", el); + el.style && (el.style.webkitTapHighlightColor = "rgba(0,0,0,0)"); + } + return el; + }, + gradients = {}, + rgGrad = /^url\(#(.*)\)$/, + removeGradientFill = function (node, paper) { + var oid = node.getAttribute("fill"); + oid = oid && oid.match(rgGrad); + if (oid && !--gradients[oid[1]]) { + delete gradients[oid[1]]; + paper.defs.removeChild(R._g.doc.getElementById(oid[1])); + } + }, + addGradientFill = function (element, gradient) { + var type = "linear", + id = element.id + gradient, + fx = .5, fy = .5, + o = element.node, + SVG = element.paper, + s = o.style, + el = R._g.doc.getElementById(id); + if (!el) { + gradient = Str(gradient).replace(R._radial_gradient, function (all, _fx, _fy) { + type = "radial"; + if (_fx && _fy) { + fx = toFloat(_fx); + fy = toFloat(_fy); + var dir = ((fy > .5) * 2 - 1); + pow(fx - .5, 2) + pow(fy - .5, 2) > .25 && + (fy = math.sqrt(.25 - pow(fx - .5, 2)) * dir + .5) && + fy != .5 && + (fy = fy.toFixed(5) - 1e-5 * dir); + } + return E; + }); + gradient = gradient.split(/\s*\-\s*/); + if (type == "linear") { + var angle = gradient.shift(); + angle = -toFloat(angle); + if (isNaN(angle)) { + return null; + } + var vector = [0, 0, math.cos(R.rad(angle)), math.sin(R.rad(angle))], + max = 1 / (mmax(abs(vector[2]), abs(vector[3])) || 1); + vector[2] *= max; + vector[3] *= max; + if (vector[2] < 0) { + vector[0] = -vector[2]; + vector[2] = 0; + } + if (vector[3] < 0) { + vector[1] = -vector[3]; + vector[3] = 0; + } + } + var dots = R._parseDots(gradient); + if (!dots) { + return null; + } + if (element.gradient) { + SVG.defs.removeChild(element.gradient); + delete element.gradient; + } + + id = id.replace(/[\(\)\s,\xb0#]/g, "-"); + el = $(type + "Gradient", {id: id}); + element.gradient = el; + $(el, type == "radial" ? { + fx: fx, + fy: fy + } : { + x1: vector[0], + y1: vector[1], + x2: vector[2], + y2: vector[3], + gradientTransform: element.matrix.invert() + }); + SVG.defs.appendChild(el); + for (var i = 0, ii = dots.length; i < ii; i++) { + el.appendChild($("stop", { + offset: dots[i].offset ? dots[i].offset : i ? "100%" : "0%", + "stop-color": dots[i].color || "#fff" + })); + } + } + $(o, { + fill: "url(#" + id + ")", + opacity: 1, + "fill-opacity": 1 + }); + s.fill = E; + s.opacity = 1; + s.fillOpacity = 1; + return 1; + }, + updatePosition = function (o) { + var bbox = o.getBBox(1); + $(o.pattern, {patternTransform: o.matrix.invert() + " translate(" + bbox.x + "," + bbox.y + ")"}); + }, + addArrow = function (o, value, isEnd) { + if (o.type == "path") { + var values = Str(value).toLowerCase().split("-"), + p = o.paper, + se = isEnd ? "end" : "start", + node = o.node, + attrs = o.attrs, + stroke = attrs["stroke-width"], + i = values.length, + type = "classic", + from, + to, + dx, + refX, + attr, + w = 3, + h = 3, + t = 5; + while (i--) { + switch (values[i]) { + case "block": + case "classic": + case "oval": + case "diamond": + case "open": + case "none": + type = values[i]; + break; + case "wide": h = 5; break; + case "narrow": h = 2; break; + case "long": w = 5; break; + case "short": w = 2; break; + } + } + if (type == "open") { + w += 2; + h += 2; + t += 2; + dx = 1; + refX = isEnd ? 4 : 1; + attr = { + fill: "none", + stroke: attrs.stroke + }; + } else { + refX = dx = w / 2; + attr = { + fill: attrs.stroke, + stroke: "none" + }; + } + if (o._.arrows) { + if (isEnd) { + o._.arrows.endPath && markerCounter[o._.arrows.endPath]--; + o._.arrows.endMarker && markerCounter[o._.arrows.endMarker]--; + } else { + o._.arrows.startPath && markerCounter[o._.arrows.startPath]--; + o._.arrows.startMarker && markerCounter[o._.arrows.startMarker]--; + } + } else { + o._.arrows = {}; + } + if (type != "none") { + var pathId = "raphael-marker-" + type, + markerId = "raphael-marker-" + se + type + w + h; + if (!R._g.doc.getElementById(pathId)) { + p.defs.appendChild($($("path"), { + "stroke-linecap": "round", + d: markers[type], + id: pathId + })); + markerCounter[pathId] = 1; + } else { + markerCounter[pathId]++; + } + var marker = R._g.doc.getElementById(markerId), + use; + if (!marker) { + marker = $($("marker"), { + id: markerId, + markerHeight: h, + markerWidth: w, + orient: "auto", + refX: refX, + refY: h / 2 + }); + use = $($("use"), { + "xlink:href": "#" + pathId, + transform: (isEnd ? " rotate(180 " + w / 2 + " " + h / 2 + ") " : S) + "scale(" + w / t + "," + h / t + ")", + "stroke-width": 1 / ((w / t + h / t) / 2) + }); + marker.appendChild(use); + p.defs.appendChild(marker); + markerCounter[markerId] = 1; + } else { + markerCounter[markerId]++; + use = marker.getElementsByTagName("use")[0]; + } + $(use, attr); + var delta = dx * (type != "diamond" && type != "oval"); + if (isEnd) { + from = o._.arrows.startdx * stroke || 0; + to = R.getTotalLength(attrs.path) - delta * stroke; + } else { + from = delta * stroke; + to = R.getTotalLength(attrs.path) - (o._.arrows.enddx * stroke || 0); + } + attr = {}; + attr["marker-" + se] = "url(#" + markerId + ")"; + if (to || from) { + attr.d = Raphael.getSubpath(attrs.path, from, to); + } + $(node, attr); + o._.arrows[se + "Path"] = pathId; + o._.arrows[se + "Marker"] = markerId; + o._.arrows[se + "dx"] = delta; + o._.arrows[se + "Type"] = type; + o._.arrows[se + "String"] = value; + } else { + if (isEnd) { + from = o._.arrows.startdx * stroke || 0; + to = R.getTotalLength(attrs.path) - from; + } else { + from = 0; + to = R.getTotalLength(attrs.path) - (o._.arrows.enddx * stroke || 0); + } + o._.arrows[se + "Path"] && $(node, {d: Raphael.getSubpath(attrs.path, from, to)}); + delete o._.arrows[se + "Path"]; + delete o._.arrows[se + "Marker"]; + delete o._.arrows[se + "dx"]; + delete o._.arrows[se + "Type"]; + delete o._.arrows[se + "String"]; + } + for (attr in markerCounter) if (markerCounter[has](attr) && !markerCounter[attr]) { + var item = R._g.doc.getElementById(attr); + item && item.parentNode.removeChild(item); + } + } + }, + dasharray = { + "": [0], + "none": [0], + "-": [3, 1], + ".": [1, 1], + "-.": [3, 1, 1, 1], + "-..": [3, 1, 1, 1, 1, 1], + ". ": [1, 3], + "- ": [4, 3], + "--": [8, 3], + "- .": [4, 3, 1, 3], + "--.": [8, 3, 1, 3], + "--..": [8, 3, 1, 3, 1, 3] + }, + addDashes = function (o, value, params) { + value = dasharray[Str(value).toLowerCase()]; + if (value) { + var width = o.attrs["stroke-width"] || "1", + butt = {round: width, square: width, butt: 0}[o.attrs["stroke-linecap"] || params["stroke-linecap"]] || 0, + dashes = [], + i = value.length; + while (i--) { + dashes[i] = value[i] * width + ((i % 2) ? 1 : -1) * butt; + } + $(o.node, {"stroke-dasharray": dashes.join(",")}); + } + }, + setFillAndStroke = function (o, params) { + var node = o.node, + attrs = o.attrs, + vis = node.style.visibility; + node.style.visibility = "hidden"; + for (var att in params) { + if (params[has](att)) { + if (!R._availableAttrs[has](att)) { + continue; + } + var value = params[att]; + attrs[att] = value; + switch (att) { + case "blur": + o.blur(value); + break; + case "href": + case "title": + case "target": + var pn = node.parentNode; + if (pn.tagName.toLowerCase() != "a") { + var hl = $("a"); + pn.insertBefore(hl, node); + hl.appendChild(node); + pn = hl; + } + if (att == "target" && value == "blank") { + pn.setAttributeNS(xlink, "show", "new"); + } else { + pn.setAttributeNS(xlink, att, value); + } + break; + case "cursor": + node.style.cursor = value; + break; + case "transform": + o.transform(value); + break; + case "arrow-start": + addArrow(o, value); + break; + case "arrow-end": + addArrow(o, value, 1); + break; + case "clip-rect": + var rect = Str(value).split(separator); + if (rect.length == 4) { + o.clip && o.clip.parentNode.parentNode.removeChild(o.clip.parentNode); + var el = $("clipPath"), + rc = $("rect"); + el.id = R.createUUID(); + $(rc, { + x: rect[0], + y: rect[1], + width: rect[2], + height: rect[3] + }); + el.appendChild(rc); + o.paper.defs.appendChild(el); + $(node, {"clip-path": "url(#" + el.id + ")"}); + o.clip = rc; + } + if (!value) { + var clip = R._g.doc.getElementById(node.getAttribute("clip-path").replace(/(^url\(#|\)$)/g, E)); + clip && clip.parentNode.removeChild(clip); + $(node, {"clip-path": E}); + delete o.clip; + } + break; + case "path": + if (o.type == "path") { + $(node, {d: value ? attrs.path = R._pathToAbsolute(value) : "M0,0"}); + o._.dirty = 1; + if (o._.arrows) { + "startString" in o._.arrows && addArrow(o, o._.arrows.startString); + "endString" in o._.arrows && addArrow(o, o._.arrows.endString, 1); + } + } + break; + case "width": + node.setAttribute(att, value); + o._.dirty = 1; + if (attrs.fx) { + att = "x"; + value = attrs.x; + } else { + break; + } + case "x": + if (attrs.fx) { + value = -attrs.x - (attrs.width || 0); + } + case "rx": + if (att == "rx" && o.type == "rect") { + break; + } + case "cx": + node.setAttribute(att, value); + o.pattern && updatePosition(o); + o._.dirty = 1; + break; + case "height": + node.setAttribute(att, value); + o._.dirty = 1; + if (attrs.fy) { + att = "y"; + value = attrs.y; + } else { + break; + } + case "y": + if (attrs.fy) { + value = -attrs.y - (attrs.height || 0); + } + case "ry": + if (att == "ry" && o.type == "rect") { + break; + } + case "cy": + node.setAttribute(att, value); + o.pattern && updatePosition(o); + o._.dirty = 1; + break; + case "r": + if (o.type == "rect") { + $(node, {rx: value, ry: value}); + } else { + node.setAttribute(att, value); + } + o._.dirty = 1; + break; + case "src": + if (o.type == "image") { + node.setAttributeNS(xlink, "href", value); + } + break; + case "stroke-width": + if (o._.sx != 1 || o._.sy != 1) { + value /= mmax(abs(o._.sx), abs(o._.sy)) || 1; + } + if (o.paper._vbSize) { + value *= o.paper._vbSize; + } + node.setAttribute(att, value); + if (attrs["stroke-dasharray"]) { + addDashes(o, attrs["stroke-dasharray"], params); + } + if (o._.arrows) { + "startString" in o._.arrows && addArrow(o, o._.arrows.startString); + "endString" in o._.arrows && addArrow(o, o._.arrows.endString, 1); + } + break; + case "stroke-dasharray": + addDashes(o, value, params); + break; + case "fill": + var isURL = Str(value).match(R._ISURL); + if (isURL) { + el = $("pattern"); + var ig = $("image"); + el.id = R.createUUID(); + $(el, {x: 0, y: 0, patternUnits: "userSpaceOnUse", height: 1, width: 1}); + $(ig, {x: 0, y: 0, "xlink:href": isURL[1]}); + el.appendChild(ig); + + (function (el) { + R._preload(isURL[1], function () { + var w = this.offsetWidth, + h = this.offsetHeight; + $(el, {width: w, height: h}); + $(ig, {width: w, height: h}); + o.paper.safari(); + }); + })(el); + o.paper.defs.appendChild(el); + node.style.fill = "url(#" + el.id + ")"; + $(node, {fill: "url(#" + el.id + ")"}); + o.pattern = el; + o.pattern && updatePosition(o); + break; + } + var clr = R.getRGB(value); + if (!clr.error) { + delete params.gradient; + delete attrs.gradient; + !R.is(attrs.opacity, "undefined") && + R.is(params.opacity, "undefined") && + $(node, {opacity: attrs.opacity}); + !R.is(attrs["fill-opacity"], "undefined") && + R.is(params["fill-opacity"], "undefined") && + $(node, {"fill-opacity": attrs["fill-opacity"]}); + } else if ((o.type == "circle" || o.type == "ellipse" || Str(value).charAt() != "r") && addGradientFill(o, value)) { + if ("opacity" in attrs || "fill-opacity" in attrs) { + var gradient = R._g.doc.getElementById(node.getAttribute("fill").replace(/^url\(#|\)$/g, E)); + if (gradient) { + var stops = gradient.getElementsByTagName("stop"); + $(stops[stops.length - 1], {"stop-opacity": ("opacity" in attrs ? attrs.opacity : 1) * ("fill-opacity" in attrs ? attrs["fill-opacity"] : 1)}); + } + } + attrs.gradient = value; + attrs.fill = "none"; + break; + } + clr[has]("opacity") && $(node, {"fill-opacity": clr.opacity > 1 ? clr.opacity / 100 : clr.opacity}); + case "stroke": + clr = R.getRGB(value); + node.setAttribute(att, clr.hex); + att == "stroke" && clr[has]("opacity") && $(node, {"stroke-opacity": clr.opacity > 1 ? clr.opacity / 100 : clr.opacity}); + if (att == "stroke" && o._.arrows) { + "startString" in o._.arrows && addArrow(o, o._.arrows.startString); + "endString" in o._.arrows && addArrow(o, o._.arrows.endString, 1); + } + break; + case "gradient": + (o.type == "circle" || o.type == "ellipse" || Str(value).charAt() != "r") && addGradientFill(o, value); + break; + case "opacity": + if (attrs.gradient && !attrs[has]("stroke-opacity")) { + $(node, {"stroke-opacity": value > 1 ? value / 100 : value}); + } + // fall + case "fill-opacity": + if (attrs.gradient) { + gradient = R._g.doc.getElementById(node.getAttribute("fill").replace(/^url\(#|\)$/g, E)); + if (gradient) { + stops = gradient.getElementsByTagName("stop"); + $(stops[stops.length - 1], {"stop-opacity": value}); + } + break; + } + default: + att == "font-size" && (value = toInt(value, 10) + "px"); + var cssrule = att.replace(/(\-.)/g, function (w) { + return w.substring(1).toUpperCase(); + }); + node.style[cssrule] = value; + o._.dirty = 1; + node.setAttribute(att, value); + break; + } + } + } + + tuneText(o, params); + node.style.visibility = vis; + }, + leading = 1.2, + tuneText = function (el, params) { + if (el.type != "text" || !(params[has]("text") || params[has]("font") || params[has]("font-size") || params[has]("x") || params[has]("y"))) { + return; + } + var a = el.attrs, + node = el.node, + fontSize = node.firstChild ? toInt(R._g.doc.defaultView.getComputedStyle(node.firstChild, E).getPropertyValue("font-size"), 10) : 10; + + if (params[has]("text")) { + a.text = params.text; + while (node.firstChild) { + node.removeChild(node.firstChild); + } + var texts = Str(params.text).split("\n"), + tspans = [], + tspan; + for (var i = 0, ii = texts.length; i < ii; i++) { + tspan = $("tspan"); + i && $(tspan, {dy: fontSize * leading, x: a.x}); + tspan.appendChild(R._g.doc.createTextNode(texts[i])); + node.appendChild(tspan); + tspans[i] = tspan; + } + } else { + tspans = node.getElementsByTagName("tspan"); + for (i = 0, ii = tspans.length; i < ii; i++) if (i) { + $(tspans[i], {dy: fontSize * leading, x: a.x}); + } else { + $(tspans[0], {dy: 0}); + } + } + $(node, {x: a.x, y: a.y}); + el._.dirty = 1; + var bb = el._getBBox(), + dif = a.y - (bb.y + bb.height / 2); + dif && R.is(dif, "finite") && $(tspans[0], {dy: dif}); + }, + Element = function (node, svg) { + var X = 0, + Y = 0; + + this[0] = this.node = node; + + node.raphael = true; + + this.id = R._oid++; + node.raphaelid = this.id; + this.matrix = R.matrix(); + this.realPath = null; + + this.paper = svg; + this.attrs = this.attrs || {}; + this._ = { + transform: [], + sx: 1, + sy: 1, + deg: 0, + dx: 0, + dy: 0, + dirty: 1 + }; + !svg.bottom && (svg.bottom = this); + + this.prev = svg.top; + svg.top && (svg.top.next = this); + svg.top = this; + + this.next = null; + }, + elproto = R.el; + + Element.prototype = elproto; + elproto.constructor = Element; + + R._engine.path = function (pathString, SVG) { + var el = $("path"); + SVG.canvas && SVG.canvas.appendChild(el); + var p = new Element(el, SVG); + p.type = "path"; + setFillAndStroke(p, { + fill: "none", + stroke: "#000", + path: pathString + }); + return p; + }; + + elproto.rotate = function (deg, cx, cy) { + if (this.removed) { + return this; + } + deg = Str(deg).split(separator); + if (deg.length - 1) { + cx = toFloat(deg[1]); + cy = toFloat(deg[2]); + } + deg = toFloat(deg[0]); + (cy == null) && (cx = cy); + if (cx == null || cy == null) { + var bbox = this.getBBox(1); + cx = bbox.x + bbox.width / 2; + cy = bbox.y + bbox.height / 2; + } + this.transform(this._.transform.concat([["r", deg, cx, cy]])); + return this; + }; + + elproto.scale = function (sx, sy, cx, cy) { + if (this.removed) { + return this; + } + sx = Str(sx).split(separator); + if (sx.length - 1) { + sy = toFloat(sx[1]); + cx = toFloat(sx[2]); + cy = toFloat(sx[3]); + } + sx = toFloat(sx[0]); + (sy == null) && (sy = sx); + (cy == null) && (cx = cy); + if (cx == null || cy == null) { + var bbox = this.getBBox(1); + } + cx = cx == null ? bbox.x + bbox.width / 2 : cx; + cy = cy == null ? bbox.y + bbox.height / 2 : cy; + this.transform(this._.transform.concat([["s", sx, sy, cx, cy]])); + return this; + }; + + elproto.translate = function (dx, dy) { + if (this.removed) { + return this; + } + dx = Str(dx).split(separator); + if (dx.length - 1) { + dy = toFloat(dx[1]); + } + dx = toFloat(dx[0]) || 0; + dy = +dy || 0; + this.transform(this._.transform.concat([["t", dx, dy]])); + return this; + }; + + elproto.transform = function (tstr) { + var _ = this._; + if (tstr == null) { + return _.transform; + } + R._extractTransform(this, tstr); + + this.clip && $(this.clip, {transform: this.matrix.invert()}); + this.pattern && updatePosition(this); + this.node && $(this.node, {transform: this.matrix}); + + if (_.sx != 1 || _.sy != 1) { + var sw = this.attrs[has]("stroke-width") ? this.attrs["stroke-width"] : 1; + this.attr({"stroke-width": sw}); + } + + return this; + }; + + elproto.hide = function () { + !this.removed && this.paper.safari(this.node.style.display = "none"); + return this; + }; + + elproto.show = function () { + !this.removed && this.paper.safari(this.node.style.display = ""); + return this; + }; + + elproto.remove = function () { + if (this.removed) { + return; + } + this.paper.__set__ && this.paper.__set__.exclude(this); + eve.unbind("*.*." + this.id); + R._tear(this, this.paper); + this.node.parentNode.removeChild(this.node); + for (var i in this) { + delete this[i]; + } + this.removed = true; + }; + elproto._getBBox = function () { + if (this.node.style.display == "none") { + this.show(); + var hide = true; + } + var bbox = {}; + try { + bbox = this.node.getBBox(); + } catch(e) { + // Firefox 3.0.x plays badly here + } finally { + bbox = bbox || {}; + } + hide && this.hide(); + return bbox; + }; + + elproto.attr = function (name, value) { + if (this.removed) { + return this; + } + if (name == null) { + var res = {}; + for (var a in this.attrs) if (this.attrs[has](a)) { + res[a] = this.attrs[a]; + } + res.gradient && res.fill == "none" && (res.fill = res.gradient) && delete res.gradient; + res.transform = this._.transform; + return res; + } + if (value == null && R.is(name, "string")) { + if (name == "fill" && this.attrs.fill == "none" && this.attrs.gradient) { + return this.attrs.gradient; + } + if (name == "transform") { + return this._.transform; + } + var names = name.split(separator), + out = {}; + for (var i = 0, ii = names.length; i < ii; i++) { + name = names[i]; + if (name in this.attrs) { + out[name] = this.attrs[name]; + } else if (R.is(this.paper.customAttributes[name], "function")) { + out[name] = this.paper.customAttributes[name].def; + } else { + out[name] = R._availableAttrs[name]; + } + } + return ii - 1 ? out : out[names[0]]; + } + if (value == null && R.is(name, "array")) { + out = {}; + for (i = 0, ii = name.length; i < ii; i++) { + out[name[i]] = this.attr(name[i]); + } + return out; + } + if (value != null) { + var params = {}; + params[name] = value; + } else if (name != null && R.is(name, "object")) { + params = name; + } + for (var key in params) { + eve("attr." + key + "." + this.id, this, params[key]); + } + for (key in this.paper.customAttributes) if (this.paper.customAttributes[has](key) && params[has](key) && R.is(this.paper.customAttributes[key], "function")) { + var par = this.paper.customAttributes[key].apply(this, [].concat(params[key])); + this.attrs[key] = params[key]; + for (var subkey in par) if (par[has](subkey)) { + params[subkey] = par[subkey]; + } + } + setFillAndStroke(this, params); + return this; + }; + + elproto.toFront = function () { + if (this.removed) { + return this; + } + this.node.parentNode.appendChild(this.node); + var svg = this.paper; + svg.top != this && R._tofront(this, svg); + return this; + }; + + elproto.toBack = function () { + if (this.removed) { + return this; + } + if (this.node.parentNode.firstChild != this.node) { + this.node.parentNode.insertBefore(this.node, this.node.parentNode.firstChild); + R._toback(this, this.paper); + var svg = this.paper; + } + return this; + }; + + elproto.insertAfter = function (element) { + if (this.removed) { + return this; + } + var node = element.node || element[element.length - 1].node; + if (node.nextSibling) { + node.parentNode.insertBefore(this.node, node.nextSibling); + } else { + node.parentNode.appendChild(this.node); + } + R._insertafter(this, element, this.paper); + return this; + }; + + elproto.insertBefore = function (element) { + if (this.removed) { + return this; + } + var node = element.node || element[0].node; + node.parentNode.insertBefore(this.node, node); + R._insertbefore(this, element, this.paper); + return this; + }; + elproto.blur = function (size) { + // Experimental. No Safari support. Use it on your own risk. + var t = this; + if (+size !== 0) { + var fltr = $("filter"), + blur = $("feGaussianBlur"); + t.attrs.blur = size; + fltr.id = R.createUUID(); + $(blur, {stdDeviation: +size || 1.5}); + fltr.appendChild(blur); + t.paper.defs.appendChild(fltr); + t._blur = fltr; + $(t.node, {filter: "url(#" + fltr.id + ")"}); + } else { + if (t._blur) { + t._blur.parentNode.removeChild(t._blur); + delete t._blur; + delete t.attrs.blur; + } + t.node.removeAttribute("filter"); + } + }; + R._engine.circle = function (svg, x, y, r) { + var el = $("circle"); + svg.canvas && svg.canvas.appendChild(el); + var res = new Element(el, svg); + res.attrs = {cx: x, cy: y, r: r, fill: "none", stroke: "#000"}; + res.type = "circle"; + $(el, res.attrs); + return res; + }; + R._engine.rect = function (svg, x, y, w, h, r) { + var el = $("rect"); + svg.canvas && svg.canvas.appendChild(el); + var res = new Element(el, svg); + res.attrs = {x: x, y: y, width: w, height: h, r: r || 0, rx: r || 0, ry: r || 0, fill: "none", stroke: "#000"}; + res.type = "rect"; + $(el, res.attrs); + return res; + }; + R._engine.ellipse = function (svg, x, y, rx, ry) { + var el = $("ellipse"); + svg.canvas && svg.canvas.appendChild(el); + var res = new Element(el, svg); + res.attrs = {cx: x, cy: y, rx: rx, ry: ry, fill: "none", stroke: "#000"}; + res.type = "ellipse"; + $(el, res.attrs); + return res; + }; + R._engine.image = function (svg, src, x, y, w, h) { + var el = $("image"); + $(el, {x: x, y: y, width: w, height: h, preserveAspectRatio: "none"}); + el.setAttributeNS(xlink, "href", src); + svg.canvas && svg.canvas.appendChild(el); + var res = new Element(el, svg); + res.attrs = {x: x, y: y, width: w, height: h, src: src}; + res.type = "image"; + return res; + }; + R._engine.text = function (svg, x, y, text) { + var el = $("text"); + // $(el, {x: x, y: y, "text-anchor": "middle"}); + svg.canvas && svg.canvas.appendChild(el); + var res = new Element(el, svg); + res.attrs = { + x: x, + y: y, + "text-anchor": "middle", + text: text, + font: R._availableAttrs.font, + stroke: "none", + fill: "#000" + }; + res.type = "text"; + setFillAndStroke(res, res.attrs); + return res; + }; + R._engine.setSize = function (width, height) { + this.width = width || this.width; + this.height = height || this.height; + this.canvas.setAttribute("width", this.width); + this.canvas.setAttribute("height", this.height); + if (this._viewBox) { + this.setViewBox.apply(this, this._viewBox); + } + return this; + }; + R._engine.create = function () { + var con = R._getContainer.apply(0, arguments), + container = con && con.container, + x = con.x, + y = con.y, + width = con.width, + height = con.height; + if (!container) { + throw new Error("SVG container not found."); + } + var cnvs = $("svg"), + css = "overflow:hidden;", + isFloating; + x = x || 0; + y = y || 0; + width = width || 512; + height = height || 342; + $(cnvs, { + height: height, + version: 1.1, + width: width, + xmlns: "http://www.w3.org/2000/svg" + }); + if (container == 1) { + cnvs.style.cssText = css + "position:absolute;left:" + x + "px;top:" + y + "px"; + R._g.doc.body.appendChild(cnvs); + isFloating = 1; + } else { + cnvs.style.cssText = css + "position:relative"; + if (container.firstChild) { + container.insertBefore(cnvs, container.firstChild); + } else { + container.appendChild(cnvs); + } + } + container = new R._Paper; + container.width = width; + container.height = height; + container.canvas = cnvs; + // plugins.call(container, container, R.fn); + container.clear(); + container._left = container._top = 0; + isFloating && (container.renderfix = function () {}); + container.renderfix(); + return container; + }; + R._engine.setViewBox = function (x, y, w, h, fit) { + eve("setViewBox", this, this._viewBox, [x, y, w, h, fit]); + var size = mmax(w / this.width, h / this.height), + top = this.top, + aspectRatio = fit ? "meet" : "xMinYMin", + vb, + sw; + if (x == null) { + if (this._vbSize) { + size = 1; + } + delete this._vbSize; + vb = "0 0 " + this.width + S + this.height; + } else { + this._vbSize = size; + vb = x + S + y + S + w + S + h; + } + $(this.canvas, { + viewBox: vb, + preserveAspectRatio: aspectRatio + }); + while (size && top) { + sw = "stroke-width" in top.attrs ? top.attrs["stroke-width"] : 1; + top.attr({"stroke-width": sw}); + top._.dirty = 1; + top._.dirtyT = 1; + top = top.prev; + } + this._viewBox = [x, y, w, h, !!fit]; + return this; + }; + + R.prototype.renderfix = function () { + var cnvs = this.canvas, + s = cnvs.style, + pos = cnvs.getScreenCTM() || cnvs.createSVGMatrix(), + left = -pos.e % 1, + top = -pos.f % 1; + if (left || top) { + if (left) { + this._left = (this._left + left) % 1; + s.left = this._left + "px"; + } + if (top) { + this._top = (this._top + top) % 1; + s.top = this._top + "px"; + } + } + }; + + R.prototype.clear = function () { + R.eve("clear", this); + var c = this.canvas; + while (c.firstChild) { + c.removeChild(c.firstChild); + } + this.bottom = this.top = null; + (this.desc = $("desc")).appendChild(R._g.doc.createTextNode("Created with Rapha\xebl " + R.version)); + c.appendChild(this.desc); + c.appendChild(this.defs = $("defs")); + }; + + R.prototype.remove = function () { + eve("remove", this); + this.canvas.parentNode && this.canvas.parentNode.removeChild(this.canvas); + for (var i in this) { + this[i] = removed(i); + } + }; + var setproto = R.st; + for (var method in elproto) if (elproto[has](method) && !setproto[has](method)) { + setproto[method] = (function (methodname) { + return function () { + var arg = arguments; + return this.forEach(function (el) { + el[methodname].apply(el, arg); + }); + }; + })(method); + } +}(window.Raphael); + +// ┌─────────────────────────────────────────────────────────────────────┠\\ +// │ Raphaël 2 - JavaScript Vector Library │ \\ +// ├─────────────────────────────────────────────────────────────────────┤ \\ +// │ VML Module │ \\ +// ├─────────────────────────────────────────────────────────────────────┤ \\ +// │ Copyright (c) 2008-2011 Dmitry Baranovskiy (http://raphaeljs.com) │ \\ +// │ Copyright (c) 2008-2011 Sencha Labs (http://sencha.com) │ \\ +// │ Licensed under the MIT (http://raphaeljs.com/license.html) license. │ \\ +// └─────────────────────────────────────────────────────────────────────┘ \\ +window.Raphael.vml && function (R) { + var has = "hasOwnProperty", + Str = String, + toFloat = parseFloat, + math = Math, + round = math.round, + mmax = math.max, + mmin = math.min, + abs = math.abs, + fillString = "fill", + separator = /[, ]+/, + eve = R.eve, + ms = " progid:DXImageTransform.Microsoft", + S = " ", + E = "", + map = {M: "m", L: "l", C: "c", Z: "x", m: "t", l: "r", c: "v", z: "x"}, + bites = /([clmz]),?([^clmz]*)/gi, + blurregexp = / progid:\S+Blur\([^\)]+\)/g, + val = /-?[^,\s-]+/g, + cssDot = "position:absolute;left:0;top:0;width:1px;height:1px", + zoom = 21600, + pathTypes = {path: 1, rect: 1, image: 1}, + ovalTypes = {circle: 1, ellipse: 1}, + path2vml = function (path) { + var total = /[ahqstv]/ig, + command = R._pathToAbsolute; + Str(path).match(total) && (command = R._path2curve); + total = /[clmz]/g; + if (command == R._pathToAbsolute && !Str(path).match(total)) { + var res = Str(path).replace(bites, function (all, command, args) { + var vals = [], + isMove = command.toLowerCase() == "m", + res = map[command]; + args.replace(val, function (value) { + if (isMove && vals.length == 2) { + res += vals + map[command == "m" ? "l" : "L"]; + vals = []; + } + vals.push(round(value * zoom)); + }); + return res + vals; + }); + return res; + } + var pa = command(path), p, r; + res = []; + for (var i = 0, ii = pa.length; i < ii; i++) { + p = pa[i]; + r = pa[i][0].toLowerCase(); + r == "z" && (r = "x"); + for (var j = 1, jj = p.length; j < jj; j++) { + r += round(p[j] * zoom) + (j != jj - 1 ? "," : E); + } + res.push(r); + } + return res.join(S); + }, + compensation = function (deg, dx, dy) { + var m = R.matrix(); + m.rotate(-deg, .5, .5); + return { + dx: m.x(dx, dy), + dy: m.y(dx, dy) + }; + }, + setCoords = function (p, sx, sy, dx, dy, deg) { + var _ = p._, + m = p.matrix, + fillpos = _.fillpos, + o = p.node, + s = o.style, + y = 1, + flip = "", + dxdy, + kx = zoom / sx, + ky = zoom / sy; + s.visibility = "hidden"; + if (!sx || !sy) { + return; + } + o.coordsize = abs(kx) + S + abs(ky); + s.rotation = deg * (sx * sy < 0 ? -1 : 1); + if (deg) { + var c = compensation(deg, dx, dy); + dx = c.dx; + dy = c.dy; + } + sx < 0 && (flip += "x"); + sy < 0 && (flip += " y") && (y = -1); + s.flip = flip; + o.coordorigin = (dx * -kx) + S + (dy * -ky); + if (fillpos || _.fillsize) { + var fill = o.getElementsByTagName(fillString); + fill = fill && fill[0]; + o.removeChild(fill); + if (fillpos) { + c = compensation(deg, m.x(fillpos[0], fillpos[1]), m.y(fillpos[0], fillpos[1])); + fill.position = c.dx * y + S + c.dy * y; + } + if (_.fillsize) { + fill.size = _.fillsize[0] * abs(sx) + S + _.fillsize[1] * abs(sy); + } + o.appendChild(fill); + } + s.visibility = "visible"; + }; + R.toString = function () { + return "Your browser doesn\u2019t support SVG. Falling down to VML.\nYou are running Rapha\xebl " + this.version; + }; + addArrow = function (o, value, isEnd) { + var values = Str(value).toLowerCase().split("-"), + se = isEnd ? "end" : "start", + i = values.length, + type = "classic", + w = "medium", + h = "medium"; + while (i--) { + switch (values[i]) { + case "block": + case "classic": + case "oval": + case "diamond": + case "open": + case "none": + type = values[i]; + break; + case "wide": + case "narrow": h = values[i]; break; + case "long": + case "short": w = values[i]; break; + } + } + var stroke = o.node.getElementsByTagName("stroke")[0]; + stroke[se + "arrow"] = type; + stroke[se + "arrowlength"] = w; + stroke[se + "arrowwidth"] = h; + }; + setFillAndStroke = function (o, params) { + // o.paper.canvas.style.display = "none"; + o.attrs = o.attrs || {}; + var node = o.node, + a = o.attrs, + s = node.style, + xy, + newpath = pathTypes[o.type] && (params.x != a.x || params.y != a.y || params.width != a.width || params.height != a.height || params.cx != a.cx || params.cy != a.cy || params.rx != a.rx || params.ry != a.ry || params.r != a.r), + isOval = ovalTypes[o.type] && (a.cx != params.cx || a.cy != params.cy || a.r != params.r || a.rx != params.rx || a.ry != params.ry), + res = o; + + + for (var par in params) if (params[has](par)) { + a[par] = params[par]; + } + if (newpath) { + a.path = R._getPath[o.type](o); + o._.dirty = 1; + } + params.href && (node.href = params.href); + params.title && (node.title = params.title); + params.target && (node.target = params.target); + params.cursor && (s.cursor = params.cursor); + "blur" in params && o.blur(params.blur); + if (params.path && o.type == "path" || newpath) { + node.path = path2vml(~Str(a.path).toLowerCase().indexOf("r") ? R._pathToAbsolute(a.path) : a.path); + if (o.type == "image") { + o._.fillpos = [a.x, a.y]; + o._.fillsize = [a.width, a.height]; + setCoords(o, 1, 1, 0, 0, 0); + } + } + "transform" in params && o.transform(params.transform); + if (isOval) { + var cx = +a.cx, + cy = +a.cy, + rx = +a.rx || +a.r || 0, + ry = +a.ry || +a.r || 0; + node.path = R.format("ar{0},{1},{2},{3},{4},{1},{4},{1}x", round((cx - rx) * zoom), round((cy - ry) * zoom), round((cx + rx) * zoom), round((cy + ry) * zoom), round(cx * zoom)); + } + if ("clip-rect" in params) { + var rect = Str(params["clip-rect"]).split(separator); + if (rect.length == 4) { + rect[2] = +rect[2] + (+rect[0]); + rect[3] = +rect[3] + (+rect[1]); + var div = node.clipRect || R._g.doc.createElement("div"), + dstyle = div.style; + dstyle.clip = R.format("rect({1}px {2}px {3}px {0}px)", rect); + if (!node.clipRect) { + dstyle.position = "absolute"; + dstyle.top = 0; + dstyle.left = 0; + dstyle.width = o.paper.width + "px"; + dstyle.height = o.paper.height + "px"; + node.parentNode.insertBefore(div, node); + div.appendChild(node); + node.clipRect = div; + } + } + if (!params["clip-rect"]) { + node.clipRect && (node.clipRect.style.clip = E); + } + } + if (o.textpath) { + var textpathStyle = o.textpath.style; + params.font && (textpathStyle.font = params.font); + params["font-family"] && (textpathStyle.fontFamily = '"' + params["font-family"].split(",")[0].replace(/^['"]+|['"]+$/g, E) + '"'); + params["font-size"] && (textpathStyle.fontSize = params["font-size"]); + params["font-weight"] && (textpathStyle.fontWeight = params["font-weight"]); + params["font-style"] && (textpathStyle.fontStyle = params["font-style"]); + } + if ("arrow-start" in params) { + addArrow(res, params["arrow-start"]); + } + if ("arrow-end" in params) { + addArrow(res, params["arrow-end"], 1); + } + if (params.opacity != null || + params["stroke-width"] != null || + params.fill != null || + params.src != null || + params.stroke != null || + params["stroke-width"] != null || + params["stroke-opacity"] != null || + params["fill-opacity"] != null || + params["stroke-dasharray"] != null || + params["stroke-miterlimit"] != null || + params["stroke-linejoin"] != null || + params["stroke-linecap"] != null) { + var fill = node.getElementsByTagName(fillString), + newfill = false; + fill = fill && fill[0]; + !fill && (newfill = fill = createNode(fillString)); + if (o.type == "image" && params.src) { + fill.src = params.src; + } + params.fill && (fill.on = true); + if (fill.on == null || params.fill == "none" || params.fill === null) { + fill.on = false; + } + if (fill.on && params.fill) { + var isURL = Str(params.fill).match(R._ISURL); + if (isURL) { + fill.parentNode == node && node.removeChild(fill); + fill.rotate = true; + fill.src = isURL[1]; + fill.type = "tile"; + var bbox = o.getBBox(1); + fill.position = bbox.x + S + bbox.y; + o._.fillpos = [bbox.x, bbox.y]; + + R._preload(isURL[1], function () { + o._.fillsize = [this.offsetWidth, this.offsetHeight]; + }); + } else { + fill.color = R.getRGB(params.fill).hex; + fill.src = E; + fill.type = "solid"; + if (R.getRGB(params.fill).error && (res.type in {circle: 1, ellipse: 1} || Str(params.fill).charAt() != "r") && addGradientFill(res, params.fill, fill)) { + a.fill = "none"; + a.gradient = params.fill; + fill.rotate = false; + } + } + } + if ("fill-opacity" in params || "opacity" in params) { + var opacity = ((+a["fill-opacity"] + 1 || 2) - 1) * ((+a.opacity + 1 || 2) - 1) * ((+R.getRGB(params.fill).o + 1 || 2) - 1); + opacity = mmin(mmax(opacity, 0), 1); + fill.opacity = opacity; + if (fill.src) { + fill.color = "none"; + } + } + node.appendChild(fill); + var stroke = (node.getElementsByTagName("stroke") && node.getElementsByTagName("stroke")[0]), + newstroke = false; + !stroke && (newstroke = stroke = createNode("stroke")); + if ((params.stroke && params.stroke != "none") || + params["stroke-width"] || + params["stroke-opacity"] != null || + params["stroke-dasharray"] || + params["stroke-miterlimit"] || + params["stroke-linejoin"] || + params["stroke-linecap"]) { + stroke.on = true; + } + (params.stroke == "none" || params.stroke === null || stroke.on == null || params.stroke == 0 || params["stroke-width"] == 0) && (stroke.on = false); + var strokeColor = R.getRGB(params.stroke); + stroke.on && params.stroke && (stroke.color = strokeColor.hex); + opacity = ((+a["stroke-opacity"] + 1 || 2) - 1) * ((+a.opacity + 1 || 2) - 1) * ((+strokeColor.o + 1 || 2) - 1); + var width = (toFloat(params["stroke-width"]) || 1) * .75; + opacity = mmin(mmax(opacity, 0), 1); + params["stroke-width"] == null && (width = a["stroke-width"]); + params["stroke-width"] && (stroke.weight = width); + width && width < 1 && (opacity *= width) && (stroke.weight = 1); + stroke.opacity = opacity; + + params["stroke-linejoin"] && (stroke.joinstyle = params["stroke-linejoin"] || "miter"); + stroke.miterlimit = params["stroke-miterlimit"] || 8; + params["stroke-linecap"] && (stroke.endcap = params["stroke-linecap"] == "butt" ? "flat" : params["stroke-linecap"] == "square" ? "square" : "round"); + if (params["stroke-dasharray"]) { + var dasharray = { + "-": "shortdash", + ".": "shortdot", + "-.": "shortdashdot", + "-..": "shortdashdotdot", + ". ": "dot", + "- ": "dash", + "--": "longdash", + "- .": "dashdot", + "--.": "longdashdot", + "--..": "longdashdotdot" + }; + stroke.dashstyle = dasharray[has](params["stroke-dasharray"]) ? dasharray[params["stroke-dasharray"]] : E; + } + newstroke && node.appendChild(stroke); + } + if (res.type == "text") { + res.paper.canvas.style.display = E; + var span = res.paper.span, + m = 100, + fontSize = a.font && a.font.match(/\d+(?:\.\d*)?(?=px)/); + s = span.style; + a.font && (s.font = a.font); + a["font-family"] && (s.fontFamily = a["font-family"]); + a["font-weight"] && (s.fontWeight = a["font-weight"]); + a["font-style"] && (s.fontStyle = a["font-style"]); + fontSize = toFloat(fontSize ? fontSize[0] : a["font-size"]); + s.fontSize = fontSize * m + "px"; + res.textpath.string && (span.innerHTML = Str(res.textpath.string).replace(/")); + var brect = span.getBoundingClientRect(); + res.W = a.w = (brect.right - brect.left) / m; + res.H = a.h = (brect.bottom - brect.top) / m; + // res.paper.canvas.style.display = "none"; + res.X = a.x; + res.Y = a.y + res.H / 2; + + ("x" in params || "y" in params) && (res.path.v = R.format("m{0},{1}l{2},{1}", round(a.x * zoom), round(a.y * zoom), round(a.x * zoom) + 1)); + var dirtyattrs = ["x", "y", "text", "font", "font-family", "font-weight", "font-style", "font-size"]; + for (var d = 0, dd = dirtyattrs.length; d < dd; d++) if (dirtyattrs[d] in params) { + res._.dirty = 1; + break; + } + + // text-anchor emulation + switch (a["text-anchor"]) { + case "start": + res.textpath.style["v-text-align"] = "left"; + res.bbx = res.W / 2; + break; + case "end": + res.textpath.style["v-text-align"] = "right"; + res.bbx = -res.W / 2; + break; + default: + res.textpath.style["v-text-align"] = "center"; + res.bbx = 0; + break; + } + res.textpath.style["v-text-kern"] = true; + } + // res.paper.canvas.style.display = E; + }; + addGradientFill = function (o, gradient, fill) { + o.attrs = o.attrs || {}; + var attrs = o.attrs, + pow = Math.pow, + opacity, + oindex, + type = "linear", + fxfy = ".5 .5"; + o.attrs.gradient = gradient; + gradient = Str(gradient).replace(R._radial_gradient, function (all, fx, fy) { + type = "radial"; + if (fx && fy) { + fx = toFloat(fx); + fy = toFloat(fy); + pow(fx - .5, 2) + pow(fy - .5, 2) > .25 && (fy = math.sqrt(.25 - pow(fx - .5, 2)) * ((fy > .5) * 2 - 1) + .5); + fxfy = fx + S + fy; + } + return E; + }); + gradient = gradient.split(/\s*\-\s*/); + if (type == "linear") { + var angle = gradient.shift(); + angle = -toFloat(angle); + if (isNaN(angle)) { + return null; + } + } + var dots = R._parseDots(gradient); + if (!dots) { + return null; + } + o = o.shape || o.node; + if (dots.length) { + o.removeChild(fill); + fill.on = true; + fill.method = "none"; + fill.color = dots[0].color; + fill.color2 = dots[dots.length - 1].color; + var clrs = []; + for (var i = 0, ii = dots.length; i < ii; i++) { + dots[i].offset && clrs.push(dots[i].offset + S + dots[i].color); + } + fill.colors = clrs.length ? clrs.join() : "0% " + fill.color; + if (type == "radial") { + fill.type = "gradientTitle"; + fill.focus = "100%"; + fill.focussize = "0 0"; + fill.focusposition = fxfy; + fill.angle = 0; + } else { + // fill.rotate= true; + fill.type = "gradient"; + fill.angle = (270 - angle) % 360; + } + o.appendChild(fill); + } + return 1; + }; + Element = function (node, vml) { + this[0] = this.node = node; + node.raphael = true; + this.id = R._oid++; + node.raphaelid = this.id; + this.X = 0; + this.Y = 0; + this.attrs = {}; + this.paper = vml; + this.matrix = R.matrix(); + this._ = { + transform: [], + sx: 1, + sy: 1, + dx: 0, + dy: 0, + deg: 0, + dirty: 1, + dirtyT: 1 + }; + !vml.bottom && (vml.bottom = this); + this.prev = vml.top; + vml.top && (vml.top.next = this); + vml.top = this; + this.next = null; + }; + var elproto = R.el; + + Element.prototype = elproto; + elproto.constructor = Element; + elproto.transform = function (tstr) { + if (tstr == null) { + return this._.transform; + } + var vbs = this.paper._viewBoxShift, + vbt = vbs ? "s" + [vbs.scale, vbs.scale] + "-1-1t" + [vbs.dx, vbs.dy] : E, + oldt; + if (vbs) { + oldt = tstr = Str(tstr).replace(/\.{3}|\u2026/g, this._.transform || E); + } + R._extractTransform(this, vbt + tstr); + var matrix = this.matrix.clone(), + skew = this.skew, + o = this.node, + split, + isGrad = ~Str(this.attrs.fill).indexOf("-"), + isPatt = !Str(this.attrs.fill).indexOf("url("); + matrix.translate(-.5, -.5); + if (isPatt || isGrad || this.type == "image") { + skew.matrix = "1 0 0 1"; + skew.offset = "0 0"; + split = matrix.split(); + if ((isGrad && split.noRotation) || !split.isSimple) { + o.style.filter = matrix.toFilter(); + var bb = this.getBBox(), + bbt = this.getBBox(1), + dx = bb.x - bbt.x, + dy = bb.y - bbt.y; + o.coordorigin = (dx * -zoom) + S + (dy * -zoom); + setCoords(this, 1, 1, dx, dy, 0); + } else { + o.style.filter = E; + setCoords(this, split.scalex, split.scaley, split.dx, split.dy, split.rotate); + } + } else { + o.style.filter = E; + skew.matrix = Str(matrix); + skew.offset = matrix.offset(); + } + oldt && (this._.transform = oldt); + return this; + }; + elproto.rotate = function (deg, cx, cy) { + if (this.removed) { + return this; + } + if (deg == null) { + return; + } + deg = Str(deg).split(separator); + if (deg.length - 1) { + cx = toFloat(deg[1]); + cy = toFloat(deg[2]); + } + deg = toFloat(deg[0]); + (cy == null) && (cx = cy); + if (cx == null || cy == null) { + var bbox = this.getBBox(1); + cx = bbox.x + bbox.width / 2; + cy = bbox.y + bbox.height / 2; + } + this._.dirtyT = 1; + this.transform(this._.transform.concat([["r", deg, cx, cy]])); + return this; + }; + elproto.translate = function (dx, dy) { + if (this.removed) { + return this; + } + dx = Str(dx).split(separator); + if (dx.length - 1) { + dy = toFloat(dx[1]); + } + dx = toFloat(dx[0]) || 0; + dy = +dy || 0; + if (this._.bbox) { + this._.bbox.x += dx; + this._.bbox.y += dy; + } + this.transform(this._.transform.concat([["t", dx, dy]])); + return this; + }; + elproto.scale = function (sx, sy, cx, cy) { + if (this.removed) { + return this; + } + sx = Str(sx).split(separator); + if (sx.length - 1) { + sy = toFloat(sx[1]); + cx = toFloat(sx[2]); + cy = toFloat(sx[3]); + isNaN(cx) && (cx = null); + isNaN(cy) && (cy = null); + } + sx = toFloat(sx[0]); + (sy == null) && (sy = sx); + (cy == null) && (cx = cy); + if (cx == null || cy == null) { + var bbox = this.getBBox(1); + } + cx = cx == null ? bbox.x + bbox.width / 2 : cx; + cy = cy == null ? bbox.y + bbox.height / 2 : cy; + + this.transform(this._.transform.concat([["s", sx, sy, cx, cy]])); + this._.dirtyT = 1; + return this; + }; + elproto.hide = function () { + !this.removed && (this.node.style.display = "none"); + return this; + }; + elproto.show = function () { + !this.removed && (this.node.style.display = E); + return this; + }; + elproto._getBBox = function () { + if (this.removed) { + return {}; + } + if (this.type == "text") { + return { + x: this.X + (this.bbx || 0) - this.W / 2, + y: this.Y - this.H, + width: this.W, + height: this.H + }; + } else { + return pathDimensions(this.attrs.path); + } + }; + elproto.remove = function () { + if (this.removed) { + return; + } + this.paper.__set__ && this.paper.__set__.exclude(this); + R.eve.unbind("*.*." + this.id); + R._tear(this, this.paper); + this.node.parentNode.removeChild(this.node); + this.shape && this.shape.parentNode.removeChild(this.shape); + for (var i in this) { + delete this[i]; + } + this.removed = true; + }; + elproto.attr = function (name, value) { + if (this.removed) { + return this; + } + if (name == null) { + var res = {}; + for (var a in this.attrs) if (this.attrs[has](a)) { + res[a] = this.attrs[a]; + } + res.gradient && res.fill == "none" && (res.fill = res.gradient) && delete res.gradient; + res.transform = this._.transform; + return res; + } + if (value == null && R.is(name, "string")) { + if (name == fillString && this.attrs.fill == "none" && this.attrs.gradient) { + return this.attrs.gradient; + } + var names = name.split(separator), + out = {}; + for (var i = 0, ii = names.length; i < ii; i++) { + name = names[i]; + if (name in this.attrs) { + out[name] = this.attrs[name]; + } else if (R.is(this.paper.customAttributes[name], "function")) { + out[name] = this.paper.customAttributes[name].def; + } else { + out[name] = R._availableAttrs[name]; + } + } + return ii - 1 ? out : out[names[0]]; + } + if (this.attrs && value == null && R.is(name, "array")) { + out = {}; + for (i = 0, ii = name.length; i < ii; i++) { + out[name[i]] = this.attr(name[i]); + } + return out; + } + var params; + if (value != null) { + params = {}; + params[name] = value; + } + value == null && R.is(name, "object") && (params = name); + for (var key in params) { + eve("attr." + key + "." + this.id, this, params[key]); + } + if (params) { + for (key in this.paper.customAttributes) if (this.paper.customAttributes[has](key) && params[has](key) && R.is(this.paper.customAttributes[key], "function")) { + var par = this.paper.customAttributes[key].apply(this, [].concat(params[key])); + this.attrs[key] = params[key]; + for (var subkey in par) if (par[has](subkey)) { + params[subkey] = par[subkey]; + } + } + // this.paper.canvas.style.display = "none"; + if (params.text && this.type == "text") { + this.textpath.string = params.text; + } + setFillAndStroke(this, params); + // this.paper.canvas.style.display = E; + } + return this; + }; + elproto.toFront = function () { + !this.removed && this.node.parentNode.appendChild(this.node); + this.paper && this.paper.top != this && R._tofront(this, this.paper); + return this; + }; + elproto.toBack = function () { + if (this.removed) { + return this; + } + if (this.node.parentNode.firstChild != this.node) { + this.node.parentNode.insertBefore(this.node, this.node.parentNode.firstChild); + R._toback(this, this.paper); + } + return this; + }; + elproto.insertAfter = function (element) { + if (this.removed) { + return this; + } + if (element.constructor == R.st.constructor) { + element = element[element.length - 1]; + } + if (element.node.nextSibling) { + element.node.parentNode.insertBefore(this.node, element.node.nextSibling); + } else { + element.node.parentNode.appendChild(this.node); + } + R._insertafter(this, element, this.paper); + return this; + }; + elproto.insertBefore = function (element) { + if (this.removed) { + return this; + } + if (element.constructor == R.st.constructor) { + element = element[0]; + } + element.node.parentNode.insertBefore(this.node, element.node); + R._insertbefore(this, element, this.paper); + return this; + }; + elproto.blur = function (size) { + var s = this.node.runtimeStyle, + f = s.filter; + f = f.replace(blurregexp, E); + if (+size !== 0) { + this.attrs.blur = size; + s.filter = f + S + ms + ".Blur(pixelradius=" + (+size || 1.5) + ")"; + s.margin = R.format("-{0}px 0 0 -{0}px", round(+size || 1.5)); + } else { + s.filter = f; + s.margin = 0; + delete this.attrs.blur; + } + }; + + R._engine.path = function (pathString, vml) { + var el = createNode("shape"); + el.style.cssText = cssDot; + el.coordsize = zoom + S + zoom; + el.coordorigin = vml.coordorigin; + var p = new Element(el, vml), + attr = {fill: "none", stroke: "#000"}; + pathString && (attr.path = pathString); + p.type = "path"; + p.path = []; + p.Path = E; + setFillAndStroke(p, attr); + vml.canvas.appendChild(el); + var skew = createNode("skew"); + skew.on = true; + el.appendChild(skew); + p.skew = skew; + p.transform(E); + return p; + }; + R._engine.rect = function (vml, x, y, w, h, r) { + var path = R._rectPath(x, y, w, h, r), + res = vml.path(path), + a = res.attrs; + res.X = a.x = x; + res.Y = a.y = y; + res.W = a.width = w; + res.H = a.height = h; + a.r = r; + a.path = path; + res.type = "rect"; + return res; + }; + R._engine.ellipse = function (vml, x, y, rx, ry) { + var res = vml.path(), + a = res.attrs; + res.X = x - rx; + res.Y = y - ry; + res.W = rx * 2; + res.H = ry * 2; + res.type = "ellipse"; + setFillAndStroke(res, { + cx: x, + cy: y, + rx: rx, + ry: ry + }); + return res; + }; + R._engine.circle = function (vml, x, y, r) { + var res = vml.path(), + a = res.attrs; + res.X = x - r; + res.Y = y - r; + res.W = res.H = r * 2; + res.type = "circle"; + setFillAndStroke(res, { + cx: x, + cy: y, + r: r + }); + return res; + }; + R._engine.image = function (vml, src, x, y, w, h) { + var path = R._rectPath(x, y, w, h), + res = vml.path(path).attr({stroke: "none"}), + a = res.attrs, + node = res.node, + fill = node.getElementsByTagName(fillString)[0]; + a.src = src; + res.X = a.x = x; + res.Y = a.y = y; + res.W = a.width = w; + res.H = a.height = h; + a.path = path; + res.type = "image"; + fill.parentNode == node && node.removeChild(fill); + fill.rotate = true; + fill.src = src; + fill.type = "tile"; + res._.fillpos = [x, y]; + res._.fillsize = [w, h]; + node.appendChild(fill); + setCoords(res, 1, 1, 0, 0, 0); + return res; + }; + R._engine.text = function (vml, x, y, text) { + var el = createNode("shape"), + path = createNode("path"), + o = createNode("textpath"); + x = x || 0; + y = y || 0; + text = text || ""; + path.v = R.format("m{0},{1}l{2},{1}", round(x * zoom), round(y * zoom), round(x * zoom) + 1); + path.textpathok = true; + o.string = Str(text); + o.on = true; + el.style.cssText = cssDot; + el.coordsize = zoom + S + zoom; + el.coordorigin = "0 0"; + var p = new Element(el, vml), + attr = { + fill: "#000", + stroke: "none", + font: R._availableAttrs.font, + text: text + }; + p.shape = el; + p.path = path; + p.textpath = o; + p.type = "text"; + p.attrs.text = Str(text); + p.attrs.x = x; + p.attrs.y = y; + p.attrs.w = 1; + p.attrs.h = 1; + setFillAndStroke(p, attr); + el.appendChild(o); + el.appendChild(path); + vml.canvas.appendChild(el); + var skew = createNode("skew"); + skew.on = true; + el.appendChild(skew); + p.skew = skew; + p.transform(E); + return p; + }; + R._engine.setSize = function (width, height) { + var cs = this.canvas.style; + this.width = width; + this.height = height; + width == +width && (width += "px"); + height == +height && (height += "px"); + cs.width = width; + cs.height = height; + cs.clip = "rect(0 " + width + " " + height + " 0)"; + if (this._viewBox) { + setViewBox.apply(this, this._viewBox); + } + return this; + }; + R._engine.setViewBox = function (x, y, w, h, fit) { + R.eve("setViewBox", this, this._viewBox, [x, y, w, h, fit]); + var width = this.width, + height = this.height, + size = 1 / mmax(w / width, h / height), + H, W; + if (fit) { + H = height / h; + W = width / w; + if (w * H < width) { + x -= (width - w * H) / 2 / H; + } + if (h * W < height) { + y -= (height - h * W) / 2 / W; + } + } + this._viewBox = [x, y, w, h, !!fit]; + this._viewBoxShift = { + dx: -x, + dy: -y, + scale: size + }; + this.forEach(function (el) { + el.transform("..."); + }); + return this; + }; + var createNode, + initWin = function (win) { + var doc = win.document; + doc.createStyleSheet().addRule(".rvml", "behavior:url(#default#VML)"); + try { + !doc.namespaces.rvml && doc.namespaces.add("rvml", "urn:schemas-microsoft-com:vml"); + createNode = function (tagName) { + return doc.createElement(''); + }; + } catch (e) { + createNode = function (tagName) { + return doc.createElement('<' + tagName + ' xmlns="urn:schemas-microsoft.com:vml" class="rvml">'); + }; + } + }; + initWin(R._g.win); + R._engine.create = function () { + var con = R._getContainer.apply(0, arguments), + container = con.container, + height = con.height, + s, + width = con.width, + x = con.x, + y = con.y; + if (!container) { + throw new Error("VML container not found."); + } + var res = new R._Paper, + c = res.canvas = R._g.doc.createElement("div"), + cs = c.style; + x = x || 0; + y = y || 0; + width = width || 512; + height = height || 342; + res.width = width; + res.height = height; + width == +width && (width += "px"); + height == +height && (height += "px"); + res.coordsize = zoom * 1e3 + S + zoom * 1e3; + res.coordorigin = "0 0"; + res.span = R._g.doc.createElement("span"); + res.span.style.cssText = "position:absolute;left:-9999em;top:-9999em;padding:0;margin:0;line-height:1;"; + c.appendChild(res.span); + cs.cssText = R.format("top:0;left:0;width:{0};height:{1};display:inline-block;position:relative;clip:rect(0 {0} {1} 0);overflow:hidden", width, height); + if (container == 1) { + R._g.doc.body.appendChild(c); + cs.left = x + "px"; + cs.top = y + "px"; + cs.position = "absolute"; + } else { + if (container.firstChild) { + container.insertBefore(c, container.firstChild); + } else { + container.appendChild(c); + } + } + // plugins.call(res, res, R.fn); + res.renderfix = function () {}; + return res; + }; + R.prototype.clear = function () { + R.eve("clear", this); + this.canvas.innerHTML = E; + this.span = R._g.doc.createElement("span"); + this.span.style.cssText = "position:absolute;left:-9999em;top:-9999em;padding:0;margin:0;line-height:1;display:inline;"; + this.canvas.appendChild(this.span); + this.bottom = this.top = null; + }; + R.prototype.remove = function () { + R.eve("remove", this); + this.canvas.parentNode.removeChild(this.canvas); + for (var i in this) { + this[i] = removed(i); + } + return true; + }; + + var setproto = R.st; + for (var method in elproto) if (elproto[has](method) && !setproto[has](method)) { + setproto[method] = (function (methodname) { + return function () { + var arg = arguments; + return this.forEach(function (el) { + el[methodname].apply(el, arg); + }); + }; + })(method); + } +}(window.Raphael);/* main file */ + +if ( window.IriSP === undefined && window.__IriSP === undefined ) { + var IriSP = {}; + var __IriSP = IriSP; /* for backward compatibility */ +} + +/* crap code will be the first against the wall when the + revolution comes */ +IriSP.loadLibs = function( libs, customCssPath, metadata_url, callback ) { + // Localize jQuery variable + IriSP.jQuery = null; + + /* FIXME : to refactor using popcorn.getscript ? */ + /******** Load jQuery if not present *********/ + if ( window.jQuery === undefined || window.jQuery.fn.jquery !== '1.4.2' ) { + + var script_tag = document.createElement( 'script' ); + script_tag.setAttribute( "type", "text/javascript" ); + script_tag.setAttribute( "src", libs.jQuery ); + + script_tag.onload = scriptLibHandler; + script_tag.onreadystatechange = function () { // Same thing but for IE + if ( this.readyState == 'complete' || this.readyState == 'loaded' ) { + scriptLibHandler(); + } + }; + + // Try to find the head, otherwise default to the documentElement + ( document.getElementsByTagName("head")[0] || document.documentElement ).appendChild( script_tag ); + } else { + // The jQuery version on the window is the one we want to use + IriSP.jQuery = window.jQuery; + scriptLibHandler(); + } + + /******** Called once jQuery has loaded ******/ + function scriptLibHandler() { + + var script_jqUi_tooltip = document.createElement( 'script' ); + script_jqUi_tooltip.setAttribute( "type", "text/javascript" ); + script_jqUi_tooltip.setAttribute( "src", libs.jQueryToolTip ); + script_jqUi_tooltip.onload = scriptLoadHandler; + script_jqUi_tooltip.onreadystatechange = function () { // Same thing but for IE + if ( this.readyState == 'complete' || this.readyState == 'loaded' ) { + scriptLoadHandler( "jquery.tools.min.js loded" ); + } + }; + + var script_swfObj = document.createElement('script'); + script_swfObj.setAttribute( "type","text/javascript" ); + script_swfObj.setAttribute( "src",libs.swfObject ); + script_swfObj.onload = scriptLoadHandler; + script_swfObj.onreadystatechange = function () { // Same thing but for IE + if ( this.readyState == 'complete' || this.readyState == 'loaded' ) { + scriptLoadHandler( "swfobject.js loded" ); + } + }; + + var script_jqUi = document.createElement( 'script' ); + script_jqUi.setAttribute( "type","text/javascript" ); + script_jqUi.setAttribute( "src",libs.jQueryUI ); + script_jqUi.onload = scriptLoadHandler; + script_jqUi.onreadystatechange = function () { // Same thing but for IE + if ( this.readyState == 'complete' || this.readyState == 'loaded' ) { + scriptLoadHandler( "jquery-ui.min.js loded" ); + } + }; + + + ( document.getElementsByTagName("head")[0] || document.documentElement ).appendChild( script_jqUi_tooltip); + ( document.getElementsByTagName("head")[0] || document.documentElement ).appendChild( script_jqUi ); + ( document.getElementsByTagName("head")[0] || document.documentElement ).appendChild( script_swfObj ); + + + }; + + /******** Called once all lib are loaded ******/ + var loadLib = 0; + /* FIXME : ugly */ + function scriptLoadHandler( Mylib ) { + //alert(Mylib); + loadLib +=1; + if( loadLib===3 ) { + main(); + } + }; + + /******** Our main function ********/ + function main() { + + + // Make our own IriSP.jQuery and restore window.jQuery if there was one. + IriSP.jQuery = window.jQuery.noConflict( true ); + // Call our Jquery + IriSP.jQuery( document ).ready( function($) { + + /******* Load CSS *******/ + var css_link_jquery = IriSP.jQuery( "", { + rel: "stylesheet", + type: "text/css", + href: libs.cssjQueryUI, + 'class': "dynamic_css" + } ); + var css_link_custom = IriSP.jQuery( "", { + rel: "stylesheet", + type: "text/css", + href: customCssPath, + 'class': "dynamic_css" + } ); + + css_link_jquery.appendTo( 'head' ); + css_link_custom.appendTo( 'head' ); + + // to see dynamicly loaded css on IE + if ( $.browser.msie ) { + $( '.dynamic_css' ).clone().appendTo( 'head' ); + } + + IriSP.setupDataLoader(); + IriSP.__dataloader.get(metadata_url, + function(data) { + /* save the data so that we could re-use it to + configure the video + */ + IriSP.__jsonMetadata = data; + callback.call(window) }); + }); + } +}; + + +IriSP.annotation_template = "{{! template for an annotation displayed in a segmentWidget }}
"; +IriSP.annotationWidget_template = "{{! template for the annotation widget }}
share on facebook share on twitter share on google+
"; +IriSP.annotation_loading_template = "{{! template shown while the annotation widget is loading }}
 
Chargement...
"; +IriSP.arrowWidget_template = "
"; +IriSP.overlay_marker_template = "{{! the template for the small white bars which is z-indexed over our segment widget }}
"; +IriSP.player_template = "{{! template for the radio player }}
/
"; +IriSP.search_template = "{{! template for the search container }}
"; +IriSP.share_template = "{{! social network sharing template }} "; +IriSP.sliderWidget_template = "{{! template for the slider widget - it's composed of two divs we one overlayed on top of the other }}
"; +IriSP.tooltip_template = "{{! template used by the jquery ui tooltip }}
{{title}}
{{begin}} : {{end}}
{{description}}
"; +IriSP.tooltipWidget_template = "{{! template for the tooltip widget }}
"; +IriSP.tweetWidget_template = "{{! template for the tweet widget }}
dont minimize automatically minimize window
- Retweet
- Reply
";/* wrapper that simulates popcorn.js because + popcorn is a bit unstable at the time */ + +IriSP.PopcornReplacement = { + msgPump : {} /* used by jquery to receive and send messages */ +}; + +IriSP.PopcornReplacement.media = { + "paused": true, + "muted": false +}; + +IriSP.PopcornReplacement.listen = function(msg, callback) { +// IriSP.jQuery(IriSP.PopcornReplacement.msgPump).bind(msg, function(event, rest) { callback(rest); }); + if (!IriSP.PopcornReplacement.msgPump.hasOwnProperty(msg)) + IriSP.PopcornReplacement.msgPump[msg] = []; + + IriSP.PopcornReplacement.msgPump[msg].push(callback); +}; + +IriSP.PopcornReplacement.trigger = function(msg, params) { +// IriSP.jQuery(IriSP.PopcornReplacement.msgPump).trigger(msg, params); + + if (!IriSP.PopcornReplacement.msgPump.hasOwnProperty(msg)) + return; + + var d = IriSP.PopcornReplacement.msgPump[msg]; + for(var entry in d) { + d[entry].call(window, params); + } + +}; + +IriSP.PopcornReplacement.guid = function(prefix) { + var str = 'xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g, function(c) { + var r = Math.random()*16|0, v = c == 'x' ? r : (r&0x3|0x8); + return v.toString(16); + }); + + return prefix + str; +}; + +IriSP.PopcornReplacement.__initApi = function() { + IriSP.PopcornReplacement.trigger("loadedmetadata"); // we've done more than loading metadata of course, + // but popcorn doesn't need to know more. + IriSP.PopcornReplacement.media.muted = jwplayer(IriSP.PopcornReplacement._container).getMute(); +}; + +IriSP.PopcornReplacement.jwplayer = function(container, options) { + IriSP.PopcornReplacement._container = container.slice(1); //eschew the '#' + options.events = { + onReady: IriSP.PopcornReplacement.__initApi, + onTime: IriSP.PopcornReplacement.__timeHandler, + onPlay: IriSP.PopcornReplacement.__playHandler, + onPause: IriSP.PopcornReplacement.__pauseHandler, + onSeek: IriSP.PopcornReplacement.__seekHandler + } + + jwplayer(IriSP.PopcornReplacement._container).setup(options); + IriSP.PopcornReplacement.media.duration = options.duration; + return IriSP.PopcornReplacement; +}; + +IriSP.PopcornReplacement.currentTime = function(time) { + if (typeof(time) === "undefined") { + return jwplayer(IriSP.PopcornReplacement._container).getPosition(); + } else { + var currentTime = +time; + jwplayer( IriSP.PopcornReplacement._container ).seek( currentTime ); + IriSP.PopcornReplacement.trigger("seeked"); + return jwplayer(IriSP.PopcornReplacement._container).getPosition(); + } +}; + +IriSP.PopcornReplacement.play = function() { + IriSP.PopcornReplacement.media.paused = false; + IriSP.PopcornReplacement.trigger("play"); +// IriSP.PopcornReplacement.trigger("playing"); + jwplayer( IriSP.PopcornReplacement._container ).play(); +}; + +IriSP.PopcornReplacement.pause = function() { + if ( !IriSP.PopcornReplacement.media.paused ) { + IriSP.PopcornReplacement.media.paused = true; + IriSP.PopcornReplacement.trigger( "pause" ); + jwplayer( IriSP.PopcornReplacement._container ).pause(); + } +}; + +IriSP.PopcornReplacement.muted = function(val) { + if (typeof(val) !== "undefined") { + + if (jwplayer(IriSP.PopcornReplacement._container).getMute() !== val) { + if (val) { + jwplayer(IriSP.PopcornReplacement._container).setMute(true); + IriSP.PopcornReplacement.media.muted = true; + } else { + jwplayer( IriSP.PopcornReplacement._container ).setMute(false); + IriSP.PopcornReplacement.media.muted = false; + } + + IriSP.PopcornReplacement.trigger( "volumechange" ); + } + + return jwplayer( IriSP.PopcornReplacement._container ).getMute(); + } else { + return jwplayer( IriSP.PopcornReplacement._container ).getMute(); + } +}; + +IriSP.PopcornReplacement.mute = IriSP.PopcornReplacement.muted; + +IriSP.PopcornReplacement.__codes = []; +IriSP.PopcornReplacement.code = function(options) { + IriSP.PopcornReplacement.__codes.push(options); + return IriSP.PopcornReplacement; +}; + +IriSP.PopcornReplacement.__runCode = function() { + var currentTime = jwplayer(IriSP.PopcornReplacement._container).getPosition(); + var i = 0; + for(i = 0; i < IriSP.PopcornReplacement.__codes.length; i++) { + var c = IriSP.PopcornReplacement.__codes[i]; + if (currentTime == c.start) { + c.onStart(); + } + + if (currentTime == c.end) { + c.onEnd(); + } + + } +}; + +/* called everytime the player updates itself + (onTime event) + */ + +IriSP.PopcornReplacement.__timeHandler = function(event) { + var pos = event.position; + + var i = 0; + for(i = 0; i < IriSP.PopcornReplacement.__codes.length; i++) { + var c = IriSP.PopcornReplacement.__codes[i]; + + if (pos >= c.start && pos < c.end && + pos - 0.1 <= c.start) { + c.onStart(); + } + + if (pos >= c.start && pos >= c.end && + pos - 0.1 <= c.end) { + c.onEnd(); + } + + } + + IriSP.PopcornReplacement.trigger("timeupdate"); +}; + +IriSP.PopcornReplacement.__seekHandler = function(event) { + var i = 0; + for(i = 0; i < IriSP.PopcornReplacement.__codes.length; i++) { + var c = IriSP.PopcornReplacement.__codes[i]; + + if (event.position >= c.start && event.position < c.end) { + c.onEnd(); + } + + if (typeof(event.offset) === "undefined") + event.offset = 0; + if (event.offset >= c.start && event.offset < c.end) { + c.onStart(); + } + + } + + IriSP.PopcornReplacement.trigger("timeupdate"); +}; + + +IriSP.PopcornReplacement.__playHandler = function(event) { + IriSP.PopcornReplacement.media.paused = false; + IriSP.PopcornReplacement.trigger("play"); +}; + +IriSP.PopcornReplacement.__pauseHandler = function(event) { + IriSP.PopcornReplacement.media.paused = true; + IriSP.PopcornReplacement.trigger("pause"); +}; + +IriSP.PopcornReplacement.roundTime = function() { + var currentTime = IriSP.PopcornReplacement.currentTime(); + return Math.round(currentTime); +}; +/* utils.js - various utils that don't belong anywhere else */ + +/* trace function, for debugging */ + +IriSP.traceNum = 0; +IriSP.trace = function( msg, value ) { +/* + if( IriSP.config.gui.debug === true ) { + IriSP.traceNum += 1; + IriSP.jQuery( "
"+IriSP.traceNum+" - "+msg+" : "+value+"
" ).appendTo( "#Ldt-output" ); + } +*/ +}; + +/* used in callbacks - because in callbacks we lose "this", + we need to have a special function which wraps "this" in + a closure. This way, the +*/ +IriSP.wrap = function (obj, fn) { + return function() { + var args = Array.prototype.slice.call(arguments, 0); + return fn.apply(obj, args); + } +} + +/* convert a time to a percentage in the media */ +IriSP.timeToPourcent = function(time, timetotal){ + var time = Math.abs(time); + var timetotal = Math.abs(timetotal); + + return Math.floor((time/timetotal) * 100); +}; + +IriSP.padWithZeros = function(num) { + if (Math.abs(num) < 10) { + return "0" + num.toString(); + } else { + return num.toString(); + } +}; +/* convert a number of seconds to a tuple of the form + [hours, minutes, seconds] +*/ +IriSP.secondsToTime = function(secs) { + var hours = Math.abs(parseInt( secs / 3600 ) % 24); + var minutes = Math.abs(parseInt( secs / 60 ) % 60); + var seconds = parseFloat(Math.abs(secs % 60).toFixed(0)); + + var toString_fn = function() { + var ret = ""; + if (hours > 0) + ret = IriSP.padWithZeros(this.hours) + ":"; + ret += IriSP.padWithZeros(this.minutes) + ":" + IriSP.padWithZeros(this.seconds); + + return ret; + } + return {"hours" : hours, "minutes" : minutes, "seconds" : seconds, toString: toString_fn}; +}; + +IriSP.secondsToString + +/* format a tweet - replaces @name by a link to the profile, #hashtag, etc. */ +IriSP.formatTweet = function(tweet) { + /* + an array of arrays which hold a regexp and its replacement. + */ + var regExps = [ + /* copied from http://codegolf.stackexchange.com/questions/464/shortest-url-regex-match-in-javascript/480#480 */ + [/((https?:\/\/)?[\w-]+(\.[\w-]+)+\.?(:\d+)?(\/\S*)?)/gi, "$1"], + [/@(\w+)/gi, "@$1"], // matches a @handle + [/#(\w+)/gi, "#$1"],// matches a hashtag + [/(\+\+)/gi, "$1"], + [/(--)/gi, "$1"], + [/(==)/gi, "$1"], + [/(\?\?)/gi, "$1"] + ]; + + var i = 0; + for(i = 0; i < regExps.length; i++) { + tweet = tweet.replace(regExps[i][0], regExps[i][1]); + } + + return tweet; +}; + +IriSP.countProperties = function(obj) { + var count = 0; + + for(var prop in obj) { + if(obj.hasOwnProperty(prop)) + ++count; + } + + return count; +}; + +// conversion de couleur Decimal vers HexaDecimal || 000 si fff +IriSP.DEC_HEXA_COLOR = function (dec) { + var hexa='0123456789ABCDEF',hex=''; + var tmp; + while (dec>15){ + tmp = dec-(Math.floor(dec/16))*16; + hex = hexa.charAt(tmp)+hex; + dec = Math.floor(dec/16); + } + hex = hexa.charAt(dec)+hex; + if (hex == "FFCC00"){ hex="";/* by default color of Ldt annotation */ } + return(hex); +}; + +/* shortcut to have global variables in templates */ +IriSP.templToHTML = function(template, values) { + var params = IriSP.jQuery.extend(IriSP.default_templates_vars, values); + return Mustache.to_html(template, params); +}; + +/* we need to be stricter than encodeURIComponent, + because of twitter +*/ +IriSP.encodeURI = function(str) { + return encodeURIComponent(str).replace(/!/g, '%21').replace(/'/g, '%27').replace(/\(/g, '%28'). + replace(/\)/g, '%29').replace(/\*/g, '%2A'); +} + + +/* for ie compatibility +if (Object.prototype.__defineGetter__&&!Object.defineProperty) { + Object.defineProperty=function(obj,prop,desc) { + if ("get" in desc) obj.__defineGetter__(prop,desc.get); + if ("set" in desc) obj.__defineSetter__(prop,desc.set); + } +} +*/ +/* data.js - this file deals with how the players gets and sends data */ + +IriSP.DataLoader = function() { + this._cache = {}; + + /* + A structure to hold callbacks for specific urls. We need it because + ajax calls are asynchronous, so it means that sometimes we ask + multiple times for a ressource because the first call hasn't been + received yet. + */ + this._callbacks = {}; +}; + +IriSP.DataLoader.prototype.get = function(url, callback) { + + var base_url = url.split("&")[0] + if (this._cache.hasOwnProperty(base_url)) { + callback(this._cache[base_url]); + } else { + if (!this._callbacks.hasOwnProperty(base_url)) { + this._callbacks[base_url] = []; + this._callbacks[base_url].push(callback); + /* we need a closure because this gets lost when it's called back */ + + // uncomment you don't want to use caching. + // IriSP.jQuery.get(url, callback); + + var func = function(data) { + this._cache[base_url] = data; + var i = 0; + + for (i = 0; i < this._callbacks[base_url].length; i++) { + this._callbacks[base_url][i](this._cache[base_url]); + } + }; + + /* automagically choose between json and jsonp */ + if (url.indexOf(document.location.hostname) === -1 && + url.indexOf("http://") !== -1 /* not a relative url */ ) { + // we contacting a foreign domain, use JSONP + + IriSP.jQuery.get(url, {}, IriSP.wrap(this, func), "jsonp"); + } else { + + // otherwise, hey, whatever rows your boat + IriSP.jQuery.get(url, IriSP.wrap(this, func)); + } + + } else { + /* simply push the callback - it'll get called when the ressource + has been received */ + + this._callbacks[base_url].push(callback); + + } + } +} + +/* the base abstract "class" */ +IriSP.Serializer = function(DataLoader, url) { + this._DataLoader = DataLoader; + this._url = url; + this._data = []; +}; + +IriSP.Serializer.prototype.serialize = function(data) { }; +IriSP.Serializer.prototype.deserialize = function(data) {}; + +IriSP.Serializer.prototype.currentMedia = function() { +}; + +IriSP.Serializer.prototype.sync = function(callback) { + callback.call(this, this._data); +}; + +IriSP.SerializerFactory = function(DataLoader) { + this._dataloader = DataLoader; +}; + +IriSP.SerializerFactory.prototype.getSerializer = function(metadataOptions) { + /* This function returns serializer set-up with the correct + configuration - takes a metadata struct describing the metadata source + */ + + if (metadataOptions === undefined) + /* return an empty serializer */ + return IriSP.Serializer("", ""); + + switch(metadataOptions.type) { + case "json": + return new IriSP.JSONSerializer(this._dataloader, metadataOptions.src); + break; + + case "dummy": /* only used for unit testing - not defined in production */ + return new IriSP.MockSerializer(this._dataloader, metadataOptions.src); + break; + + case "empty": + return new IriSP.Serializer("", "empty"); + break; + + default: + return undefined; + } +}; +/* site.js - all our site-dependent config : player chrome, cdn locations, etc...*/ + +IriSP.lib = { + jQuery : "http://ajax.googleapis.com/ajax/libs/jquery/1.4.2/jquery.js", + jQueryUI : "http://ajax.googleapis.com/ajax/libs/jqueryui/1.8.4/jquery-ui.js", + jQueryToolTip : "http://cdn.jquerytools.org/1.2.4/all/jquery.tools.min.js", + swfObject : "http://ajax.googleapis.com/ajax/libs/swfobject/2.2/swfobject.js", + cssjQueryUI : "http://ajax.googleapis.com/ajax/libs/jqueryui/1.8.4/themes/base/jquery-ui.css", + popcorn : "src/js/libs/popcorn.js", + jwplayer : "src/js/libs/jwplayer.js", + "popcorn.mediafragment" : "src/js/libs/popcorn.mediafragment.js", + "popcorn.code" : "src/js/libs/popcorn.code.js", + "popcorn.jwplayer": "src/js/libs/popcorn.jwplayer.js", + "popcorn.youtube": "src/js/libs/popcorn.youtube.js", + raphael: "src/js/libs/raphael.js" +}; + +//Player Configuration +IriSP.config = undefined; + +IriSP.widgetsDefaults = { + "LayoutManager" : {spacer_div_height : "0px" }, + "PlayerWidget" : {}, + "AnnotationsWidget": {}, + "TweetsWidget" : { + default_profile_picture : "https://si0.twimg.com/sticky/default_profile_images/default_profile_1_normal.png", + tweet_display_period: 10000 // how long do we show a tweet ? + }, + "SliderWidget" : { + minimize_period: 850 // how long does the slider stays maximized after the user leaves the zone ? + } +}; + +IriSP.paths = { +// "imgs": "/tweetlive/res/metadataplayer/src/css/imgs" + "imgs": "/mdp/src/css/imgs" +}; +IriSP.default_templates_vars = { + "img_dir" : IriSP.paths.imgs +}; + +/* ui.js - ui related functions */ + +/* FIXME: use an sharing library */ +IriSP.LdtShareTool = IriSP.share_template; /* the contents come from share.html */ + +IriSP.createPlayerChrome = function(){ + var width = IriSP.config.gui.width; + var height = IriSP.config.gui.height; + var heightS = IriSP.config.gui.height-20; + + // AUDIO */ + // PB dans le html : ; + IriSP.trace( "__IriSP.createMyHtml",IriSP.config.gui.container ); + + + /* FIXME : factor this in another file */ + if( IriSP.config.gui.mode=="radio" ){ + + IriSP.jQuery( "#"+IriSP.config.gui.container ).before(IriSP.search_template); + var radioPlayer = Mustache.to_html(IriSP.radio_template, {"share_template" : IriSP.share_template}); + IriSP.jQuery(radioPlayer).appendTo("#"+IriSP.config.gui.container); + + // special tricks for IE 7 + if (IriSP.jQuery.browser.msie==true && IriSP.jQuery.browser.version=="7.0"){ + //LdtSearchContainer + //__IriSP.jQuery("#LdtPlayer").attr("margin-top","50px"); + IriSP.jQuery("#Ldt-Root").css("padding-top","25px"); + IriSP.trace("__IriSP.createHtml","IE7 SPECIAL "); + } + } else if(IriSP.config.gui.mode=="video") { + + var videoPlayer = Mustache.to_html(IriSP.video_template, {"share_template" : IriSP.share_template, "heightS" : heightS}); + IriSP.jQuery(videoPlayer).appendTo("#"+IriSP.config.gui.container); + } + + IriSP.jQuery("#Ldt-Annotations").width(width-(75*2)); + IriSP.jQuery("#Ldt-Show-Arrow-container").width(width-(75*2)); + IriSP.jQuery("#Ldt-ShowAnnotation-audio").width(width-10); + IriSP.jQuery("#Ldt-ShowAnnotation-video").width(width-10); + IriSP.jQuery("#Ldt-SaKeyword").width(width-10); + IriSP.jQuery("#Ldt-controler").width(width-10); + IriSP.jQuery("#Ldt-Control").attr("z-index","100"); + IriSP.jQuery("#Ldt-controler").hide(); + + IriSP.jQuery(IriSP.annotation_loading_template).appendTo("#Ldt-ShowAnnotation-audio"); + + if(IriSP.config.gui.mode=='radio'){ + IriSP.jQuery("#Ldt-load-container").attr("width",IriSP.config.gui.width); + } + // Show or not the output + if(IriSP.config.gui.debug===true){ + IriSP.jQuery("#Ldt-output").show(); + } else { + IriSP.jQuery("#Ldt-output").hide(); + } + +}; + + +/* create the buttons and the slider */ +IriSP.createInterface = function( width, height, duration ) { + + IriSP.jQuery( "#Ldt-controler" ).show(); + //__IriSP.jQuery("#Ldt-Root").css('display','visible'); + IriSP.trace( "__IriSP.createInterface" , width+","+height+","+duration+"," ); + + IriSP.jQuery( "#Ldt-ShowAnnotation").click( function () { + //__IriSP.jQuery(this).slideUp(); + } ); + + var LdtpPlayerY = IriSP.jQuery("#Ldt-PlaceHolder").attr("top"); + var LdtpPlayerX = IriSP.jQuery("#Ldt-PlaceHolder").attr("left"); + + IriSP.jQuery( "#slider-range-min" ).slider( { //range: "min", + value: 0, + min: 1, + max: duration/1000,//1:54:52.66 = 3600+3240+ + step: 0.1, + slide: function(event, ui) { + + //__IriSP.jQuery("#amount").val(ui.value+" s"); + //player.sendEvent('SEEK', ui.value) + IriSP.MyApiPlayer.seek(ui.value); + //changePageUrlOffset(ui.value); + //player.sendEvent('PAUSE') + } + } ); + + IriSP.trace("__IriSP.createInterface","ICI"); + IriSP.jQuery("#amount").val(IriSP.jQuery("#slider-range-min").slider("value")+" s"); + IriSP.jQuery(".Ldt-Control1 button:first").button({ + icons: { + primary: 'ui-icon-play' + }, + text: false + }).next().button({ + icons: { + primary: 'ui-icon-seek-next' + }, + text: false + }); + IriSP.jQuery(".Ldt-Control2 button:first").button({ + icons: { + primary: 'ui-icon-search'//, + //secondary: 'ui-icon-volume-off' + }, + text: false + }).next().button({ + icons: { + primary: 'ui-icon-volume-on' + }, + text: false + }); + + // /!\ PB A MODIFIER + //__IriSP.MyTags.draw(); + IriSP.trace("__IriSP.createInterface","ICI2"); + IriSP.jQuery( "#ldt-CtrlPlay" ).attr( "style", "background-color:#CD21C24;" ); + + IriSP.jQuery( "#Ldt-load-container" ).hide(); + + if( IriSP.config.gui.mode=="radio" & IriSP.jQuery.browser.msie != true ) { + IriSP.jQuery( "#Ldtplayer1" ).attr( "height", "0" ); + } + IriSP.trace( "__IriSP.createInterface" , "3" ); + + IriSP.trace( "__IriSP.createInterface", "END" ); + + }; +/* the widget classes and definitions */ + +IriSP.Widget = function(Popcorn, config, Serializer) { + + if (config === undefined || config === null) { + config = {} + } + + this._Popcorn = Popcorn; + this._config = config; + this._serializer = Serializer; + + if (config.hasOwnProperty("container")) { + this._id = config.container; + this.selector = IriSP.jQuery("#" + this._id); + } + + if (config.hasOwnProperty("spacer")) { + this._spacerId = config.spacer; + this.spacer = IriSP.jQuery("#" + this._spacerId); + } + + + if (config.hasOwnProperty("width")) { + // this.width and not this._width because we consider it public. + this.width = config.width; + } + + if (config.hasOwnProperty("height")) { + this.height = config.height; + } + + if (config.hasOwnProperty("heightmax")) { + this.heightmax = config.heightmax; + } + + if (config.hasOwnProperty("widthmax")) { + this.widthmax = config.widthmax; + } + +}; + +IriSP.Widget.prototype.draw = function() { + /* implemented by "sub-classes" */ +}; + +IriSP.Widget.prototype.redraw = function() { + /* implemented by "sub-classes" */ +}; +/* modules are non-graphical entities, similar to widgets */ + +IriSP.Module = function(Popcorn, config, Serializer) { + + if (config === undefined || config === null) { + config = {} + } + + this._Popcorn = Popcorn; + this._config = config; + this._serializer = Serializer; +}; +/* layout.js - very basic layout management */ + +/* + a layout manager manages a div and the layout of objects + inside it. +*/ + +IriSP.LayoutManager = function(options) { + this._Popcorn = null; + this._widgets = []; + + this._div = "LdtPlayer"; + this._width = 640; + + if (options === undefined) { + options = {}; + }; + + if (options.hasOwnProperty('container')) { + this._div = options.container; + } + + if (options.hasOwnProperty('width')) { + this._width = options.width; + } + + if (options.hasOwnProperty('height')) { + this._height = options.height; + } + + /* this is a shortcut */ + this.selector = IriSP.jQuery("#" + this._div); + + this.selector.css("width", this._width); + + if (this._height !== undefined) + this.selector.css("height", this._height); +}; + +/* we need this special setter because of a chicken and egg problem : + we want the manager to use popcorn but the popcorn div will be managed + by the manager. So we need a way to set the instance the manager uses +*/ + +IriSP.LayoutManager.prototype.setPopcornInstance = function(popcorn) { + this._Popcorn = popcorn; +} + +/* stem is a string to append to the id of the widget */ +IriSP.LayoutManager.prototype.createDiv = function(stem) { + if (typeof(stem) === "undefined") + stem = ""; + + var newDiv = Popcorn.guid(this._div + "_widget_" + stem + "_"); + var spacerDiv = Popcorn.guid("LdtPlayer_spacer_"); + this._widgets.push(newDiv); + + var divTempl = "
"); + + if (options.hasOwnProperty("width")) + IriSP.jQuery("#" + containerDiv).css("width", options.width); + + if (options.hasOwnProperty("height")) + IriSP.jQuery("#" + containerDiv).css("height", options.height); + + pop = Popcorn("#" + tmpId).mediafragment({start : 0}); + break; + + case "jwplayer": + var opts = IriSP.jQuery.extend({}, options); + delete opts.container; + + if (options.provider === "rtmp") { + /* exit if we can't access the metadata */ + if (typeof(IriSP.__jsonMetadata) === "undefined") { + break; + }; + + + // the json format is totally illogical + opts.streamer = IriSP.__jsonMetadata["medias"][0]["meta"]["item"]["value"]; + var source = IriSP.__jsonMetadata["medias"][0]["href"]; + + // the source if a full url but jwplayer wants an url relative to the + // streamer url, so we've got to remove the common part. + opts.file = source.slice(opts.streamer.length); + } else { + /* other providers type, video for instance - + pass everything as is */ + } + + pop = IriSP.PopcornReplacement.jwplayer("#" + containerDiv, opts); + break; + + case "youtube": + var opts = IriSP.jQuery.extend({}, options); + delete opts.container; + opts.controls = 0; + opts.autostart = false; + templ = "width: {{width}}px; height: {{height}}px;"; + var str = Mustache.to_html(templ, {width: opts.width, height: opts.height}); + // Popcorn.youtube wants us to specify the size of the player in the style attribute of its container div. + IriSP.jQuery("#" + containerDiv).attr("style", str); + + pop = Popcorn.youtube("#" + containerDiv, opts.video, opts).mediafragment({start : 0}); + break; + + default: + pop = undefined; + }; + + return pop; +}; + +IriSP.configureWidgets = function (popcornInstance, layoutManager, guiOptions) { + + var serialFactory = new IriSP.SerializerFactory(IriSP.__dataloader); + var params = {width: guiOptions.width, height: guiOptions.height}; + + var ret_widgets = []; + var index; + + for (index = 0; index < guiOptions.widgets.length; index++) { + var widgetConfig = guiOptions.widgets[index]; + var widget = IriSP.instantiateWidget(popcornInstance, serialFactory, layoutManager, widgetConfig); + ret_widgets.push(widget); + + }; + + return ret_widgets; +}; + +IriSP.configureModules = function (popcornInstance, modulesList) { + + var serialFactory = new IriSP.SerializerFactory(IriSP.__dataloader); + var ret_modules = []; + var index; + + for (index = 0; index < modulesList.length; index++) { + var moduleConfig = modulesList[index]; + + var serializer = serialFactory.getSerializer(moduleConfig.metadata); + var module = new IriSP[moduleConfig.type](popcornInstance, moduleConfig, serializer); + ret_modules.push(module); + }; + + return ret_modules; +}; + +IriSP.instantiateWidget = function(popcornInstance, serialFactory, layoutManager, widgetConfig) { + /* create div returns us a container for the widget and a spacer */ + var ret = layoutManager.createDiv(widgetConfig.type); + var container = ret[0]; + var spacer = ret[1]; + + var arr = IriSP.jQuery.extend({}, widgetConfig); + arr.container = container; + arr.spacer = spacer; + + var serializer = serialFactory.getSerializer(widgetConfig.metadata); + + if (typeof serializer == "undefined") + debugger; + + // instantiate the object passed as a string + var widget = new IriSP[widgetConfig.type](popcornInstance, arr, serializer); + + if (widgetConfig.hasOwnProperty("requires")) { + // also create the widgets this one depends on. + // the dependency widget is available in the parent widget context as + // this.WidgetName (for instance, this.TipWidget); + + var i = 0; + for(i = 0; i < widgetConfig.requires.length; i++) { + var widgetName = widgetConfig.requires[i]["type"]; + widget[widgetName] = IriSP.instantiateWidget(popcornInstance, serialFactory, layoutManager, widgetConfig.requires[i]); + } + } + + serializer.sync(IriSP.wrap(widget, function() { this.draw(); })); + return widget; +}; +/* mediafragment module */ + +IriSP.MediaFragment = function(Popcorn, config, Serializer) { + IriSP.Module.call(this, Popcorn, config, Serializer); + + this.mutex = false; /* a mutex because we access the url from two different functions */ + + this._Popcorn.listen( "loadedmetadata", IriSP.wrap(this, IriSP.MediaFragment.advanceTime)); + this._Popcorn.listen( "pause", IriSP.wrap(this, IriSP.MediaFragment.updateTime)); + this._Popcorn.listen( "seeked", IriSP.wrap(this, IriSP.MediaFragment.updateTime)); + this._Popcorn.listen( "IriSP.PolemicTweet.click", IriSP.wrap(this, IriSP.MediaFragment.updateAnnotation)); + this._Popcorn.listen( "IriSP.SegmentsWidget.click", IriSP.wrap(this, IriSP.MediaFragment.updateAnnotation)); +}; + +IriSP.MediaFragment.advanceTime = function() { + var url = window.location.href; + + if ( url.split( "#" )[ 1 ] != null ) { + pageoffset = url.split( "#" )[1]; + + if ( pageoffset.substring(0, 2) === "t=") { + // timecode + if ( pageoffset.substring( 2 ) != null ) { + var offsettime = pageoffset.substring( 2 ); + this._Popcorn.currentTime( parseFloat( offsettime ) ); + } + } else if ( pageoffset.substring(0, 2) === "a=") { + // annotation + var annotationId = pageoffset.substring( 2 ); + + // there's no better way than that because + // of possible race conditions + this._serializer.sync(IriSP.wrap(this, function() { + IriSP.MediaFragment.lookupAnnotation.call(this, annotationId); + })); + } + } +}; + +IriSP.MediaFragment.updateTime = function() { + if (this.mutex === true) { + return; + } + + var history = window.history; + if ( !history.pushState ) { + return false; + } + + splitArr = window.location.href.split( "#" ) + history.replaceState( {}, "", splitArr[0] + "#t=" + this._Popcorn.currentTime().toFixed( 2 ) ); +}; + + +IriSP.MediaFragment.updateAnnotation = function(annotationId) { + var _this = this; + this.mutex = true; + + var history = window.history; + if ( !history.pushState ) { + return false; + } + + splitArr = window.location.href.split( "#" ) + history.replaceState( {}, "", splitArr[0] + "#a=" + annotationId); + + window.setTimeout(function() { _this.mutex = false }, 50); +}; + +// lookup and seek to the beginning of an annotation +IriSP.MediaFragment.lookupAnnotation = function(annotationId) { + var annotation = undefined; + var annotations = this._serializer._data.annotations; + + var i; + for (i = 0; i < annotations.length; i++) { + if (annotations[i].id === annotationId) { + annotation = annotations[i]; + break; + } + } + + if (typeof(annotation) !== "undefined") { + this._Popcorn.currentTime(annotation.begin / 1000); + } +}; +IriSP.AnnotationsWidget = function(Popcorn, config, Serializer) { + IriSP.Widget.call(this, Popcorn, config, Serializer); + +}; + + +IriSP.AnnotationsWidget.prototype = new IriSP.Widget(); + +IriSP.AnnotationsWidget.prototype.clear = function() { + this.selector.find(".Ldt-SaTitle").text(""); + this.selector.find(".Ldt-SaDescription").text(""); + this.selector.find(".Ldt-SaKeywordText").text(""); +}; + +IriSP.AnnotationsWidget.prototype.displayAnnotation = function(annotation) { + + var title = annotation.content.title; + var description = annotation.content.description; + var keywords = "" // FIXME; + var begin = +annotation.begin / 1000; + var end = +annotation.end / 1000; + var duration = +this._serializer.currentMedia().meta["dc:duration"]; + + var title_templ = "{{title}} - ( {{begin}} - {{end}} )"; + var endstr = Mustache.to_html(title_templ, {title: title, begin: IriSP.secondsToTime(begin), end: IriSP.secondsToTime(end)}); + + this.selector.find(".Ldt-SaTitle").text(endstr); + this.selector.find(".Ldt-SaDescription").text(description); +}; + +IriSP.AnnotationsWidget.prototype.clearWidget = function() { + + + /* retract the pane between two annotations */ + this.selector.find(".Ldt-SaTitle").text(""); + this.selector.find(".Ldt-SaDescription").text(""); + this.selector.find(".Ldt-SaKeywordText").html(""); + this.selector.find(".Ldt-ShowAnnotation").slideUp(); +}; + +IriSP.AnnotationsWidget.prototype.draw = function() { + var _this = this; + + var annotationMarkup = IriSP.templToHTML(IriSP.annotationWidget_template); + this.selector.append(annotationMarkup); + var view; + + if (typeof(this._serializer._data.views) !== "undefined" && this._serializer._data.views !== null) + view = this._serializer._data.views[0]; + + var view_type = ""; + + if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) { + view_type = view.annotation_types[0]; + } + + var annotations = this._serializer._data.annotations; + var i; + + for (i in annotations) { + var annotation = annotations[i]; + var begin = Math.round((+ annotation.begin) / 1000); + var end = Math.round((+ annotation.end) / 1000); + + if (view_type != "" && typeof(annotation.meta) !== "undefined" && typeof(annotation.meta["id-ref"]) !== "undefined" + && annotation.meta["id-ref"] != view_type) { + continue; + } + + + var conf = {start: begin, end: end, + onStart: + function(annotation) { + return function() { + _this.displayAnnotation(annotation); + + } }(annotation), + onEnd: + function() { _this.clearWidget.call(_this); }, + }; + this._Popcorn = this._Popcorn.code(conf); + } + +}; +IriSP.ArrowWidget = function(Popcorn, config, Serializer) { + IriSP.Widget.call(this, Popcorn, config, Serializer); + + this._oldAnnotation = null; + +}; + + +IriSP.ArrowWidget.prototype = new IriSP.Widget(); + +IriSP.ArrowWidget.prototype.clear = function() { + +}; + +IriSP.ArrowWidget.prototype.clearWidget = function() { +}; + +IriSP.ArrowWidget.prototype.draw = function() { + var templ = Mustache.to_html(IriSP.arrowWidget_template, {}); + this.selector.append(templ); + this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.timeUpdateHandler)); +}; + +IriSP.ArrowWidget.prototype.timeUpdateHandler = function(percents) { + var currentTime = this._Popcorn.currentTime(); + var currentAnnotation = this._serializer.currentAnnotations(currentTime)[0]; // FIXME : use the others ? + + /* move the arrow only if the current annotation changes */ + if (currentAnnotation != this._oldAnnotation) { + var begin = (+ currentAnnotation.begin) / 1000; + var end = (+ currentAnnotation.end) / 1000; + + var duration = +this._serializer.currentMedia().meta["dc:duration"] / 1000; + var middle_time = (begin + end) / 2; + var percents = Math.floor((middle_time / duration) * 100); + + // we need to apply a fix because the arrow has a certain length + // it's half the length of the arrow (27 / 2). We need to convert + // it in percents though. + var totalWidth = this.selector.width(); + var correction = ((27 / 2) / totalWidth) * 100; + var corrected_percents = percents - correction; + + /* don't move out of the screen */ + if (corrected_percents <= 0) + corrected_percents = 0; + + this.selector.children(".Ldt-arrowWidget").animate({"left" : corrected_percents + "%"}); + + this._oldAnnotation = currentAnnotation; + } +} +IriSP.PlayerWidget = function(Popcorn, config, Serializer) { + IriSP.Widget.call(this, Popcorn, config, Serializer); + + this._searchBlockOpen = false; + this._searchLastValue = ""; +}; + +IriSP.PlayerWidget.prototype = new IriSP.Widget(); + +IriSP.PlayerWidget.prototype.draw = function() { + var self = this; + var width = this.width; + var height = this.height; + var heightS = this.height-20; + + var Player_templ = Mustache.to_html(IriSP.player_template, {"share_template" : IriSP.share_template}); + this.selector.append(Player_templ); + + this.selector.children(".Ldt-controler").show(); + + // handle clicks by the user on the video. + this._Popcorn.listen("play", IriSP.wrap(this, this.playButtonUpdater)); + this._Popcorn.listen("pause", IriSP.wrap(this, this.playButtonUpdater)); + + this._Popcorn.listen("volumechange", IriSP.wrap(this, this.muteButtonUpdater)); + + this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.timeDisplayUpdater)); + this._Popcorn.listen("IriSP.search.matchFound", IriSP.wrap(this, this.searchMatch)); + this._Popcorn.listen("IriSP.search.noMatchFound", IriSP.wrap(this, this.searchNoMatch)); + + + this.selector.find(".Ldt-CtrlPlay").click(function() { self.playHandler.call(self); }); + this.selector.find(".Ldt-CtrlNext").click(function() { }); + this.selector.find(".Ldt-CtrlSearch").click(function() { self.searchButtonHandler.call(self); }); + + this.selector.find('.Ldt-CtrlSound').click(function() { self.muteHandler.call(self); } ); + + this.selector.find(".Ldt-CtrlPlay").attr( "style", "background-color:#CD21C24;" ); + + var searchButtonPos = this.selector.find(".Ldt-CtrlSearch").position(); + var searchBox = Mustache.to_html(IriSP.search_template, {margin_left : searchButtonPos.left + "px"}); + this.selector.append(searchBox); + + // trigger an IriSP.PlayerWidget.MouseOver to the widgets that are interested (i.e : sliderWidget) + this.selector.hover(function() { self._Popcorn.trigger("IriSP.PlayerWidget.MouseOver"); }, + function() { self._Popcorn.trigger("IriSP.PlayerWidget.MouseOut"); }); + + this.muteButtonUpdater(); /* some player - jwplayer notable - save the state of the mute button between sessions */ +}; + +/* Update the elasped time div */ +IriSP.PlayerWidget.prototype.timeDisplayUpdater = function() { + + if (this._previousSecond === undefined) + this._previousSecond = this._Popcorn.roundTime(); + + else { + /* we're still in the same second, so it's not necessary to update time */ + if (this._Popcorn.roundTime() == this._previousSecond) + return; + + } + + // we get it at each call because it may change. + var duration = +this._serializer.currentMedia().meta["dc:duration"] / 1000; + var totalTime = IriSP.secondsToTime(duration); + var elapsedTime = IriSP.secondsToTime(this._Popcorn.currentTime()); + + this.selector.find(".Ldt-ElapsedTime").html(elapsedTime.toString()); + this.selector.find(".Ldt-TotalTime").html(totalTime.toString()); + this._previousSecond = this._Popcorn.roundTime(); +}; + +/* update the icon of the button - separate function from playHandler + because in some cases (for instance, when the user directly clicks on + the jwplayer window) we have to change the icon without playing/pausing +*/ +IriSP.PlayerWidget.prototype.playButtonUpdater = function() { + var status = this._Popcorn.media.paused; + + if ( status == true ){ + this.selector.find(".Ldt-CtrlPlay").attr("title", "Play"); + + // we use templToHTML because it has some predefined + // vars like where to get the images + var templ = IriSP.templToHTML("url({{img_dir}}/play_sprite.png)"); + this.selector.find(".Ldt-CtrlPlay").css("background-image", templ); + + } else { + this.selector.find(".Ldt-CtrlPlay").attr("title", "Pause"); + + // we use templToHTML because it has some predefined + // vars like where to get the images + var templ = IriSP.templToHTML("url({{img_dir}}/pause_sprite.png)"); + this.selector.find(".Ldt-CtrlPlay").css("background-image", templ); + } + + return; +}; + + +IriSP.PlayerWidget.prototype.playHandler = function() { + var status = this._Popcorn.media.paused; + + if ( status == true ){ + this._Popcorn.play(); + } else { + this._Popcorn.pause(); + } +}; + +IriSP.PlayerWidget.prototype.muteHandler = function() { + if (!this._Popcorn.muted()) { + this._Popcorn.mute(true); + } else { + this._Popcorn.mute(false); + } +}; + +IriSP.PlayerWidget.prototype.muteButtonUpdater = function() { + var status = this._Popcorn.media.muted; + + if ( status == true ){ + this.selector.find(".Ldt-CtrlSound").attr("title", "Unmute"); + + // we use templToHTML because it has some predefined + // vars like where to get the images + var templ = IriSP.templToHTML("url({{img_dir}}/sound_sprite.png)"); + this.selector.find(".Ldt-CtrlSound").css("background-image", templ); + + } else { + this.selector.find(".Ldt-CtrlSound").attr("title", "Mute"); + + // we use templToHTML because it has some predefined + // vars like where to get the images + var templ = IriSP.templToHTML("url({{img_dir}}/mute_sprite.png)"); + this.selector.find(".Ldt-CtrlSound").css("background-image", templ); + } + + return; +}; + + +IriSP.PlayerWidget.prototype.searchButtonHandler = function() { + var self = this; + + /* show the search field if it is not shown */ + if ( this._searchBlockOpen == false ) { + this.selector.find(".LdtSearch").show(100); + + this.selector.find(".LdtSearchInput").css('background-color','#fff'); + this.selector.find(".LdtSearchInput").focus(); + this.selector.find(".LdtSearchInput").attr('value', this._searchLastValue); + this._Popcorn.trigger("IriSP.search", this._searchLastValue); // trigger the search to make it more natural. + + this._searchBlockOpen = true; + this.selector.find(".LdtSearchInput").bind('keyup', null, function() { self.searchHandler.call(self); } ); + + // we need this variable because some widget can find a match in + // their data while at the same time other's don't. As we want the + // search field to become green when there's a match, we need a + // variable to remember that we had one. + this._positiveMatch = false; + + // tell the world the field is open + this._Popcorn.trigger("IriSP.search.open"); + + } else { + this._searchLastValue = this.selector.find(".LdtSearchInput").attr('value'); + this.selector.find(".LdtSearchInput").attr('value',''); + this.selector.find(".LdtSearch").hide(100); + + // unbind the watcher event. + this.selector.find(".LdtSearchInput").unbind('keypress set'); + this._searchBlockOpen = false; + + this._positiveMatch = false; + + this._Popcorn.trigger("IriSP.search.closed"); + } +}; + +/* this handler is called whenever the content of the search + field changes */ +IriSP.PlayerWidget.prototype.searchHandler = function() { + this._searchLastValue = this.selector.find(".LdtSearchInput").attr('value'); + this._positiveMatch = false; + + // do nothing if the search field is empty, instead of highlighting everything. + if (this._searchLastValue == "") { + this._Popcorn.trigger("IriSP.search.cleared"); + this.selector.find(".LdtSearchInput").css('background-color',''); + } else { + this._Popcorn.trigger("IriSP.search", this._searchLastValue); + } +}; + +/* + handler for the IriSP.search.found message, which is sent by some views when they + highlight a match. +*/ +IriSP.PlayerWidget.prototype.searchMatch = function() { + this._positiveMatch = true; + this.selector.find(".LdtSearchInput").css('background-color','#e1ffe1'); +} + +/* the same, except that no value could be found */ +IriSP.PlayerWidget.prototype.searchNoMatch = function() { + if (this._positiveMatch !== true) + this.selector.find(".LdtSearchInput").css('background-color', "#d62e3a"); +} + +/* + * + * Copyright 2010 Institut de recherche et d'innovation + * contributor(s) : Samuel Huron + * + * contact@iri.centrepompidou.fr + * http://www.iri.centrepompidou.fr + * + * This software is a computer program whose purpose is to show and add annotations on a video . + * This software is governed by the CeCILL-C license under French law and + * abiding by the rules of distribution of free software. You can use, + * modify and/ or redistribute the software under the terms of the CeCILL-C + * license as circulated by CEA, CNRS and INRIA at the following URL + * "http://www.cecill.info". + * + * The fact that you are presently reading this means that you have had + * knowledge of the CeCILL-C license and that you accept its terms. +*/ +// CHART TIMELINE / VERSION PROTOTYPE :: + +IriSP.PolemicWidget = function(Popcorn, config, Serializer) { + IriSP.Widget.call(this, Popcorn, config, Serializer); + + this.userPol = new Array(); + this.userNoPol = new Array(); + this.userst = new Array(); + this.numberOfTweet = 0; + this.Users; + this.TweetPolemic; + this.yMax = this.height; + this.PaperSlider; + this.heightOfChart; + this.tweets = new Array(); + this.svgElements = {}; + + // Make and define the Raphael area + this.paper = Raphael(document.getElementById(this._id), config.width, config.height); + + this.oldSearchMatches = []; + + // event handlers + this._Popcorn.listen("IriSP.search", IriSP.wrap(this, function(searchString) { this.searchHandler(searchString); })); + this._Popcorn.listen("IriSP.search.closed", IriSP.wrap(this, this.searchFieldClosedHandler)); + this._Popcorn.listen("IriSP.search.cleared", IriSP.wrap(this, this.searchFieldClearedHandler)); + +}; + +IriSP.PolemicWidget.prototype = new IriSP.Widget(); + +IriSP.PolemicWidget.prototype.draw = function() { + + // variable + // yMax + + var self = this; + var yCoef = 2; // coef for height of 1 tweet + var frameSize = 5; // frame size + var margin = 1; // marge between frame + var lineSize = this.width; // timeline pixel width + var nbrframes = lineSize/frameSize; // frame numbers + var numberOfTweet = 0; // number of tweet overide later + var duration = +this._serializer.currentMedia().meta["dc:duration"]; // timescale width + var frameLength = lineSize / frameSize; // frame timescale + var timeline; + var colors = new Array("","#1D973D","#C5A62D","#CE0A15","#036AAE","#585858"); + + // array + //var tweets = new Array(); + var element = new Array(); + var cluster = new Array(); + var frames = new Array(frameLength); + var slices = new Array(); + + + // Classes ======================================================================= + var Frames = function(){ + + var Myclusters; + var x; + var y; + var width; + var height; + }; + Frames = function(json){ + // make my clusters + // ou Frame vide + }; + Frames.prototype.draw = function(){ + }; + Frames.prototype.zoom = function(){ + }; + Frames.prototype.inside = function(){ + }; + var Clusters = function(){ + var Object; + var yDist; + var x; + var y; + var width; + var height; + }; + Clusters = function(json){ + // make my object + }; + var Tweet = function(){ + }; + // Classes ======================================================================= + + // Refactoring (parametere) ************************************************************ + // color translastion + var qTweet_0 =0; + var qTweet_Q =0; + var qTweet_REF=0; + var qTweet_OK =0; + var qTweet_KO =0; + function colorTranslation(value){ + if(value == "Q"){ + qTweet_Q+=1; + return 2; + }else if(value =="REF"){ + qTweet_REF+=1; + return 4; + }else if(value =="OK"){ + qTweet_OK+=1; + return 1; + }else if(value =="KO"){ + qTweet_KO+=1; + return 3; + }else if(value ==""){ + qTweet_0+=1; + return 5; + } + } + + + this._serializer.sync(function(data) { loaded_callback.call(self, data) }); + + function loaded_callback (json) { + + // get current view (the first ???) + view = json.views[0]; + + // the tweets are by definition of the second annotation type FIXME ? + tweet_annot_type = null; + if(typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) { + tweet_annot_type = view.annotation_types[1]; + } + + for(var i = 0; i < json.annotations.length; i++) { + var item = json.annotations[i]; + var MyTime = Math.floor(item.begin/duration*lineSize); + var Myframe = Math.floor(MyTime/lineSize*frameLength); + + if (typeof(item.meta) !== "undefined" + && typeof(item.meta["id-ref"]) !== "undefined" + && item.meta["id-ref"] === tweet_annot_type) { + + var MyTJson = JSON.parse(item.meta['dc:source']['content']); + + if (item.content['polemics'] != undefined + && item.content['polemics'][0] != null) { + + // a tweet can have many polemics at the same time. + for(var j=0; j max) { + max = moy; + } + } + + var tweetDrawed = new Array(); + var TweetHeight = 5; + + // DRAW TWEETS ============================================ + for(var i = 0; i < nbrframes; i++) { + var addEheight = 5; + if (frames[i] != undefined){ + // by type + + for (var j = 6; j > -1; j--) { + if (frames[i].qualifVol[j] != undefined) { + // show tweet by type + for (var k = 0; k < frames[i].mytweetsID.length; k++) { + + if (frames[i].mytweetsID[k].qualification == j) { + var x = i * frameSize; + var y = this.heightmax - addEheight; + + if (this.yMax > y) { + this.yMax = y; + } + + var e = this.paper.rect(x, y, frameSize - margin, TweetHeight /* height */) + .attr({stroke:"#00","stroke-width":0.1, fill: colors[j]}); + + addEheight += TweetHeight; + + e.color = colors[j]; + e.time = frames[i].mytweetsID[k].timeframe; + e.title = frames[i].mytweetsID[k].title; + e.id = frames[i].mytweetsID[k].cinecast_id; + + this.svgElements[e.id] = e; + + e.mouseover(function(element) { return function (event) { + // event.clientX and event.clientY are to raphael what event.pageX and pageY are to jquery. + self.TooltipWidget.show.call(self.TooltipWidget, element.title, element.attr("fill"), event.clientX - 106, event.clientY - 160); + element.displayed = true; + }}(e)).mouseout(function(element) { return function () { + self.TooltipWidget.hide.call(self.TooltipWidget); + }}(e)).mousedown(function () { + self._Popcorn.currentTime(this.time/1000); + self._Popcorn.trigger("IriSP.PolemicTweet.click", this.id); + }); + + IriSP.jQuery(e.node).attr('id', 't' + k + ''); + IriSP.jQuery(e.node).attr('title', frames[i].mytweetsID[k].title); + IriSP.jQuery(e.node).attr('begin', frames[i].mytweetsID[k].timeframe); + } + } + } + } + } + + } + // DRAW UI :: resize border and bgd + this.paperBackground = this.paper.rect(0, 0, this.width, this.heightmax).attr({fill:"#F8F8F8","stroke-width":0.1,opacity: 1}); + + // outer borders + this.outerBorders = []; + this.outerBorders.push(this.paper.rect(0, this.height - 1, this.width, 1).attr({fill:"#ababab",stroke: "none",opacity: 1})); + this.outerBorders.push(this.paper.rect(0, 0, this.width, 1).attr({fill:"#ababab",stroke: "none",opacity: 1})); + + // inner borders + this.innerBorders = []; + this.innerBorders.push(this.paper.rect(1, this.height - 2, this.width, 1).attr({fill:"#efefef",stroke: "none",opacity: 1})); + this.innerBorders.push(this.paper.rect(1, 1, this.width, 1).attr({fill:"#efefef",stroke: "none",opacity: 1})); + this.innerBorders.push(this.paper.rect(1, 1, 1, this.height - 2).attr({fill:"#d0d1d1",stroke: "none",opacity: 0.8})); + this.innerBorders.push(this.paper.rect(this.width - 2, 1, 1, this.height - 2).attr({fill:"#efefef",stroke: "none",opacity: 1})); + + + + this.paperSlider = this.paper.rect(0, 0, 0, this.heightmax).attr({fill:"#D4D5D5", stroke: "none", opacity: 1}); + + // the small white line displayed over the slider. + this.sliderTip = this.paper.rect(0, 0, 1, this.heightmax).attr({fill:"#fc00ff", stroke: "none", opacity: 1}); + // decalage + // tweetSelection = this.paper.rect(-100,-100,5,5).attr({fill:"#fff",stroke: "none",opacity: 1}); + + + this.paperSlider.toBack(); + this.paperBackground.toBack(); + this.sliderTip.toFront(); + } + + this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.sliderUpdater)); +} + +IriSP.PolemicWidget.prototype.sliderUpdater = function() { + + var time = +this._Popcorn.currentTime(); + var duration = +this._serializer.currentMedia().meta["dc:duration"]; + + this.paperSlider.attr("width", time * (this.width / (duration / 1000))); + + this.sliderTip.attr("x", time * (this.width / (duration / 1000))); +}; + +IriSP.PolemicWidget.prototype.searchHandler = function(searchString) { + if (searchString == "") + return; + + var matches = this._serializer.searchTweetsOccurences(searchString); + + if (IriSP.countProperties(matches) > 0) { + this._Popcorn.trigger("IriSP.search.matchFound"); + } else { + this._Popcorn.trigger("IriSP.search.noMatchFound"); + } + + for (var id in matches) { + if (this.svgElements.hasOwnProperty(id)) { + var e = this.svgElements[id]; + this.svgElements[id].attr({fill: "#fc00ff"}); + } + } + + // clean up the blocks that were in the previous search + // but who aren't in the current one. + for (var id in this.oldSearchMatches) { + if (!matches.hasOwnProperty(id)) { + var e = this.svgElements[id]; + e.attr({fill: e.color}); + } + } + + this.oldSearchMatches = matches; +}; + +IriSP.PolemicWidget.prototype.searchFieldClearedHandler = function() { + // clean up the blocks that were in the previous search + // but who aren't in the current one. + for (var id in this.oldSearchMatches) { + var e = this.svgElements[id]; + e.attr({fill: e.color}); + } + +}; + +IriSP.PolemicWidget.prototype.searchFieldClosedHandler = function() { + // clean up the blocks that were in the previous search + // but who aren't in the current one. + for (var id in this.oldSearchMatches) { + var e = this.svgElements[id]; + e.attr({fill: e.color}); + } + +}; + +IriSP.SegmentsWidget = function(Popcorn, config, Serializer) { + + var self = this; + IriSP.Widget.call(this, Popcorn, config, Serializer); + this.oldSearchMatches = []; + + // event handlers + this._Popcorn.listen("IriSP.search", function(searchString) { self.searchHandler.call(self, searchString); }); + this._Popcorn.listen("IriSP.search.closed", function() { self.searchFieldClosedHandler.call(self); }); + this._Popcorn.listen("IriSP.search.cleared", function() { self.searchFieldClearedHandler.call(self); }); +}; + +IriSP.SegmentsWidget.prototype = new IriSP.Widget(); + +IriSP.SegmentsWidget.prototype.draw = function() { + + var self = this; + var annotations = this._serializer._data.annotations; + + this.selector.addClass("Ldt-SegmentsWidget"); + + /* in case we have different types of annotations, we want to display only the first type */ + /* the next two lines are a bit verbose because for some test data, _serializer.data.view is either + null or undefined. + */ + var view; + + if (typeof(this._serializer._data.views) !== "undefined" && this._serializer._data.views !== null) + view = this._serializer._data.views[0]; + + var view_type = ""; + + if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) { + view_type = view.annotation_types[0]; + } + + this.selector.append(Mustache.to_html(IriSP.overlay_marker_template)); + + this.positionMarker = this.selector.children(":first"); + + this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.positionUpdater)); + + + var i = 0; + var totalWidth = this.selector.width(); + var onePxPercent = 100 / totalWidth; /* the value of a pixel, in percents */ + + for (i = 0; i < annotations.length; i++) { + var annotation = annotations[i]; + + /* filter the annotations whose type is not the one we want */ + if (view_type != "" && typeof(annotation.meta) !== "undefined" && typeof(annotation.meta["id-ref"]) !== "undefined" + && annotation.meta["id-ref"] != view_type) { + continue; + } + + var begin = Math.round((+ annotation.begin) / 1000); + var end = Math.round((+ annotation.end) / 1000); + var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000; + var id = annotation.id; + var startPourcent = IriSP.timeToPourcent(begin, duration); + + /* some sort of collapsing occurs, so we only have to substract one pixel to each box instead of + two + */ + var endPourcent = IriSP.timeToPourcent(end, duration) - startPourcent - onePxPercent * 1; + + /* on the other hand, we have to substract one pixel from the first box because it's the only + one to have to effective 1px margins */ + if (i == 0) { + + endPourcent -= onePxPercent; + } + + var divTitle = annotation.content.title.substr(0,55); + var color = annotation.content.color + + + var annotationTemplate = Mustache.to_html(IriSP.annotation_template, + {"divTitle" : divTitle, "id" : id, "startPourcent" : startPourcent, + "endPourcent" : endPourcent, "hexa_color" : IriSP.DEC_HEXA_COLOR(color), + "seekPlace" : Math.round(begin/1000)}); + + + this.selector.append(annotationTemplate); + +// IriSP.jQuery("#" + id).tooltip({ effect: 'slide'}); + + IriSP.jQuery("#" + id).fadeTo(0, 0.3); + + IriSP.jQuery("#" + id).mouseover( + /* we wrap the handler in another function because js's scoping + rules are function-based - otherwise, the internal vars like + divTitle are preserved but they are looked-up from the draw + method scope, so after that the loop is run, so they're not + preserved */ + (function(divTitle) { + return function(event) { + IriSP.jQuery(this).animate({opacity: 0.6}, 5); + var offset = IriSP.jQuery(this).offset(); + var correction = IriSP.jQuery(this).outerWidth() / 2; + + var offset_x = offset.left + correction - 106; + if (offset_x < 0) + offset_x = 0; + + self.TooltipWidget.show(divTitle, color, offset_x, event.pageY - 160); + } })(divTitle)).mouseout(function(){ + IriSP.jQuery(this).animate({opacity: 0.3}, 5); + self.TooltipWidget.hide(); + }); + + IriSP.jQuery("#" + id).click(function(_this, annotation) { + return function() { _this.clickHandler(annotation)}; + }(this, annotation)); + } +}; + +/* restores the view after a search */ +IriSP.SegmentsWidget.prototype.clear = function() { + this.selector.children(".Ldt-iri-chapter").css('border','none').animate({opacity:0.3}, 100); +}; + +IriSP.SegmentsWidget.prototype.clickHandler = function(annotation) { + this._Popcorn.trigger("IriSP.SegmentsWidget.click", annotation.id); + var begin = (+ annotation.begin) / 1000; + this._Popcorn.currentTime(Math.round(begin)); +}; + +IriSP.SegmentsWidget.prototype.searchHandler = function(searchString) { + + if (searchString == "") + return; + + var matches = this._serializer.searchOccurences(searchString); + + if (IriSP.countProperties(matches) > 0) { + this._Popcorn.trigger("IriSP.search.matchFound"); + } else { + this._Popcorn.trigger("IriSP.search.noMatchFound"); + } + + // un-highlight all the blocks + this.selector.children(".Ldt-iri-chapter").css("opacity", 0.1); + + // then highlight the ones with matches. + for (var id in matches) { + var factor = 0.5 + matches[id] * 0.2; + this.selector.find("#"+id).dequeue(); + this.selector.find("#"+id).css('border','1px red'); + this.selector.find("#"+id).animate({opacity:factor}, 200); + } + + + this.oldSearchMatches = matches; +}; + +IriSP.SegmentsWidget.prototype.searchFieldClearedHandler = function() { + this.clear(); +}; + +IriSP.SegmentsWidget.prototype.searchFieldClosedHandler = function() { + this.clear(); +}; + +IriSP.SegmentsWidget.prototype.positionUpdater = function() { + var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000; + var time = this._Popcorn.currentTime(); + var position = ((time / duration) * 100).toFixed(2); + + this.positionMarker.css("left", position + "%"); +}; +IriSP.SliderWidget = function(Popcorn, config, Serializer) { + IriSP.Widget.call(this, Popcorn, config, Serializer); +}; + +IriSP.SliderWidget.prototype = new IriSP.Widget(); + +IriSP.SliderWidget.prototype.draw = function() { + var self = this; + + this.selector.append(Mustache.to_html(IriSP.sliderWidget_template, {})); + this.selector.addClass("Ldt-SliderMinimized"); + + this.sliderBackground = this.selector.find(".Ldt-sliderBackground"); + this.sliderForeground = this.selector.find(".Ldt-sliderForeground"); + this.positionMarker = this.selector.find(".Ldt-sliderPositionMarker"); + + + // a special variable to stop methods from tinkering + // with the positionMarker when the user is dragging it + this.draggingOngoing = false; + + // another special variable used by the timeout handler to + // open or close the slider. + this.sliderMaximized = false; + this.timeOutId = null; + + this.positionMarker.draggable({axis: "x", + start: IriSP.wrap(this, this.positionMarkerDraggingStartedHandler), + stop: IriSP.wrap(this, this.positionMarkerDraggedHandler), + containment: "parent" + }); + + this.sliderBackground.click(function(event) { self.backgroundClickHandler.call(self, event); }); + this.sliderForeground.click(function(event) { self.foregroundClickHandler.call(self, event); }); + + this.selector.hover(IriSP.wrap(this, this.mouseOverHandler), IriSP.wrap(this, this.mouseOutHandler)); + + // update the positions + this._Popcorn.listen("timeupdate", IriSP.wrap(this, this.sliderUpdater)); + + // special messages : + this._Popcorn.listen("IriSP.PlayerWidget.MouseOver", IriSP.wrap(this, this.mouseOverHandler)); + this._Popcorn.listen("IriSP.PlayerWidget.MouseOut", IriSP.wrap(this, this.mouseOutHandler)); +}; + +/* update the slider and the position marker as time passes */ +IriSP.SliderWidget.prototype.sliderUpdater = function() { + if(this.draggingOngoing) + return; + + var time = this._Popcorn.currentTime(); + + var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000; + var percent = ((time / duration) * 100).toFixed(2); + this.sliderForeground.css("width", percent + "%"); + this.positionMarker.css("left", percent + "%"); + +}; + +IriSP.SliderWidget.prototype.backgroundClickHandler = function(event) { + /* this piece of code is a little bit convoluted - here's how it works : + we want to handle clicks on the progress bar and convert those to seeks in the media. + However, jquery only gives us a global position, and we want a number of pixels relative + to our container div, so we get the parent position, and compute an offset to this position, + and finally compute the progress ratio in the media. + Finally we multiply this ratio with the duration to get the correct time + */ + + var parentOffset = this.sliderBackground.parent().offset(); + var width = this.sliderBackground.width(); + var relX = event.pageX - parentOffset.left; + + var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000; + var newTime = ((relX / width) * duration).toFixed(2); + + this._Popcorn.currentTime(newTime); +}; + +/* same function as the previous one, except that it handles clicks + on the foreground element */ +IriSP.SliderWidget.prototype.foregroundClickHandler = function(event) { + var parentOffset = this.sliderForeground.parent().offset(); + var width = this.sliderBackground.width(); + var relX = event.pageX - parentOffset.left; + + var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000; + var newTime = ((relX / width) * duration).toFixed(2); + + this._Popcorn.currentTime(newTime); +}; + +/* handles mouse over the slider */ +IriSP.SliderWidget.prototype.mouseOverHandler = function(event) { + + if (this.timeOutId !== null) { + window.clearTimeout(this.timeOutId); + } + + this.sliderMaximized = true; + + this.sliderBackground.animate({"height": "9px"}, 100); + this.sliderForeground.animate({"height": "9px"}, 100); + +// this.selector.removeClass("Ldt-SliderMinimized"); +// this.selector.addClass("Ldt-SliderMaximized"); +}; + +/* handles when the mouse leaves the slider */ +IriSP.SliderWidget.prototype.mouseOutHandler = function(event) { + + this.timeOutId = window.setTimeout(IriSP.wrap(this, this.minimizeOnTimeout), + IriSP.widgetsDefaults.SliderWidget.minimize_period); +}; + +IriSP.SliderWidget.prototype.minimizeOnTimeout = function(event) { + this.sliderBackground.animate({"height": "5px"}, 100); + this.sliderForeground.animate({"height": "5px"}, 100); + this.sliderMinimized = true; + +// this.selector.removeClass("Ldt-SliderMaximized"); +// this.selector.addClass("Ldt-SliderMinimized"); + +}; + +// called when the user starts dragging the position indicator +IriSP.SliderWidget.prototype.positionMarkerDraggingStartedHandler = function(event, ui) { + this.draggingOngoing = true; +}; + +IriSP.SliderWidget.prototype.positionMarkerDraggedHandler = function(event, ui) { + var width = this.sliderBackground.width(); + var duration = this._serializer.currentMedia().meta["dc:duration"] / 1000; + var newTime = ((ui.offset.left / width) * duration).toFixed(2); + + this._Popcorn.currentTime(newTime); + + this.draggingOngoing = false; +}; + +/* this widget displays a small tooltip */ +IriSP.TooltipWidget = function(Popcorn, config, Serializer) { + IriSP.Widget.call(this, Popcorn, config, Serializer); +}; + + +IriSP.TooltipWidget.prototype = new IriSP.Widget(); + +IriSP.TooltipWidget.prototype.draw = function() { + var templ = Mustache.to_html(IriSP.tooltipWidget_template); + + this.selector.append(templ); + this.hide(); + +}; + +IriSP.TooltipWidget.prototype.clear = function() { + this.selector.find(".tiptext").text(""); +}; + +IriSP.TooltipWidget.prototype.show = function(text, color, x, y) { + if (this.selector.find(".tiptext").text() == text) + return; + + this.selector.find(".tipcolor").css("background-color", color); + this.selector.find(".tiptext").text(text); + this.selector.find(".tip").css("left", x).css("top", y); +}; + +IriSP.TooltipWidget.prototype.hide = function() { + this.clear(); + this.selector.find(".tip").css("left", -10000).css("top", -100000); +}; +/* a widget that displays tweet - used in conjunction with the polemicWidget */ + +IriSP.TweetsWidget = function(Popcorn, config, Serializer) { + IriSP.Widget.call(this, Popcorn, config, Serializer); + + this._displayingTweet = false; + this._timeoutId = undefined; +}; + + +IriSP.TweetsWidget.prototype = new IriSP.Widget(); + + +IriSP.TweetsWidget.prototype.drawTweet = function(annotation) { + + var title = IriSP.formatTweet(annotation.content.title); + var img = annotation.content.img.src; + if (typeof(img) === "undefined" || img === "" || img === "None") { + img = IriSP.widgetsDefaults.TweetsWidget.default_profile_picture; + } + + var imageMarkup = IriSP.templToHTML("user image", + {src : img}); + + if (typeof(annotation.meta["dc:source"].content) !== "undefined") { + var tweetContents = JSON.parse(annotation.meta["dc:source"].content); + var creator = tweetContents.user.screen_name; + var real_name = tweetContents.user.name; + + imageMarkup = IriSP.templToHTML("user image", + {src : img, creator: creator}); + + var formatted_date = new Date(tweetContents.created_at).toLocaleDateString(); + title = IriSP.templToHTML("@{{creator}} - " + + "
{{real_name}}
" + + "
{{{ contents }}}
" + + "
{{ date }}
", + {creator: creator, real_name: real_name, contents : title, date : formatted_date}); + + this.selector.find(".Ldt-TweetReply").attr("href", "http://twitter.com/home?status=@" + creator + ":%20"); + + + var rtText = Mustache.to_html("http://twitter.com/home?status=RT @{{creator}}: {{text}}", + {creator: creator, text: IriSP.encodeURI(annotation.content.title)}); + this.selector.find(".Ldt-Retweet").attr("href", rtText); + } + + this.selector.find(".Ldt-tweetContents").html(title); + this.selector.find(".Ldt-tweetAvatar").html(imageMarkup); + this.selector.show("blind", 250); +}; + +IriSP.TweetsWidget.prototype.displayTweet = function(annotation) { + if (this._displayingTweet === false) { + this._displayingTweet = true; + } else { + window.clearTimeout(this._timeoutId); + } + + this.drawTweet(annotation); + + var time = this._Popcorn.currentTime(); + this._timeoutId = window.setTimeout(IriSP.wrap(this, this.clearPanel), IriSP.widgetsDefaults.TweetsWidget.tweet_display_period); +}; + + +IriSP.TweetsWidget.prototype.clearPanel = function() { + this._displayingTweet = false; + this._timeoutId = undefined; + this.closePanel(); + +}; + +IriSP.TweetsWidget.prototype.closePanel = function() { + if (this._timeoutId != undefined) { + /* we're called from the "close window" link */ + /* cancel the timeout */ + window.clearTimeout(this._timeoutId); + this._timeoutId = null; + } + + this.selector.hide("blind", 400); + +}; + +/* cancel the timeout if the user clicks on the keep panel open button */ +IriSP.TweetsWidget.prototype.keepPanel = function() { + if (this._timeoutId != undefined) { + /* we're called from the "close window" link */ + /* cancel the timeout */ + window.clearTimeout(this._timeoutId); + this._timeoutId = null; + } +}; + +IriSP.TweetsWidget.prototype.draw = function() { + var _this = this; + + var tweetMarkup = IriSP.templToHTML(IriSP.tweetWidget_template, {"share_template" : IriSP.share_template}); + this.selector.append(tweetMarkup); + this.selector.hide(); + this.selector.find(".Ldt-tweetWidgetMinimize").click(IriSP.wrap(this, this.closePanel)); + this.selector.find(".Ldt-tweetWidgetKeepOpen").click(IriSP.wrap(this, this.keepPanel)); + + this._Popcorn.listen("IriSP.PolemicTweet.click", IriSP.wrap(this, this.PolemicTweetClickHandler)); +}; + +IriSP.TweetsWidget.prototype.PolemicTweetClickHandler = function(tweet_id) { + var index, annotation; + for (index in this._serializer._data.annotations) { + annotation = this._serializer._data.annotations[index]; + + if (annotation.id === tweet_id) + break; + } + + if (annotation.id !== tweet_id) + /* we haven't found it */ + return; + + this.displayTweet(annotation); + return; +}; + +IriSP.JSONSerializer = function(DataLoader, url) { + IriSP.Serializer.call(this, DataLoader, url); +}; + +IriSP.JSONSerializer.prototype = new IriSP.Serializer(); + +IriSP.JSONSerializer.prototype.serialize = function(data) { + return JSON.stringify(data); +}; + +IriSP.JSONSerializer.prototype.deserialize = function(data) { + return JSON.parse(data); +}; + +IriSP.JSONSerializer.prototype.sync = function(callback) { + /* we don't have to do much because jQuery handles json for us */ + + var self = this; + + var fn = function(data) { + self._data = data; + // sort the data too + self._data["annotations"].sort(function(a, b) + { var a_begin = +a.begin; + var b_begin = +b.begin; + return a_begin - b_begin; + }); + + callback(data); + }; + + this._DataLoader.get(this._url, fn); +}; + +IriSP.JSONSerializer.prototype.currentMedia = function() { + return this._data.medias[0]; /* FIXME: don't hardcode it */ +}; + +/* this function searches for an annotation which matches title, description and keyword + "" matches any field. + Note: it ignores tweets. +*/ +IriSP.JSONSerializer.prototype.searchAnnotations = function(title, description, keyword) { + /* we can have many types of annotations. We want search to only look for regular segments */ + /* the next two lines are a bit verbose because for some test data, _serializer.data.view is either + null or undefined. + */ + var view; + + if (typeof(this._data.views) !== "undefined" && this._data.views !== null) + view = this._data.views[0]; + + var searchViewType = ""; + + if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) { + searchViewType = view.annotation_types[0]; + } + + var filterfn = function(annotation) { + if( searchViewType != "" && + typeof(annotation.meta) !== "undefined" && + typeof(annotation.meta["id-ref"]) !== "undefined" && + annotation.meta["id-ref"] !== searchViewType) { + return true; // don't pass + } else { + return false; + } + }; + + return this.searchAnnotationsFilter(title, description, keyword, filterfn); + +}; + +/* only look for tweets */ +IriSP.JSONSerializer.prototype.searchTweets = function(title, description, keyword) { + /* we can have many types of annotations. We want search to only look for regular segments */ + /* the next two lines are a bit verbose because for some test data, _serializer.data.view is either + null or undefined. + */ + var view; + + if (typeof(this._data.views) !== "undefined" && this._data.views !== null) + view = this._data.views[0]; + + var searchViewType = ""; + + if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length > 1) { + searchViewType = view.annotation_types[0]; + } + + var filterfn = function(annotation) { + if( searchViewType != "" && + typeof(annotation.meta) !== "undefined" && + typeof(annotation.meta["id-ref"]) !== "undefined" && + annotation.meta["id-ref"] !== searchViewType) { + return false; // pass + } else { + return true; + } + }; + + return this.searchAnnotationsFilter(title, description, keyword, filterfn); + +}; + +/* + the previous function call this one, which is more general: + */ +IriSP.JSONSerializer.prototype.searchAnnotationsFilter = function(title, description, keyword, filter) { + + var rTitle; + var rDescription; + var rKeyword; + /* match anything if given the empty string */ + if (title == "") + title = ".*"; + if (description == "") + description = ".*"; + if (keyword == "") + keyword = ".*"; + + rTitle = new RegExp(title, "i"); + rDescription = new RegExp(description, "i"); + rKeyword = new RegExp(keyword, "i"); + + var ret_array = []; + + var i; + for (i in this._data.annotations) { + var annotation = this._data.annotations[i]; + + /* filter the annotations whose type is not the one we want */ + if (filter(annotation)) { + continue; + } + + if (rTitle.test(annotation.content.title) && + rDescription.test(annotation.content.description)) { + /* FIXME : implement keyword support */ + ret_array.push(annotation); + } + } + + return ret_array; +}; + +/* breaks a string in words and searches each of these words. Returns an array + of objects with the id of the annotation and its number of occurences. + + FIXME: optimize ? seems to be n^2 in the worst case. +*/ +IriSP.JSONSerializer.prototype.searchOccurences = function(searchString) { + var ret = { }; + var keywords = searchString.split(/\s+/); + + for (var i in keywords) { + var keyword = keywords[i]; + + // search this keyword in descriptions and title + var found_annotations = [] + found_annotations = found_annotations.concat(this.searchAnnotations(keyword, "", "")); + found_annotations = found_annotations.concat(this.searchAnnotations("", keyword, "")); + + for (var j in found_annotations) { + var current_annotation = found_annotations[j]; + + if (!ret.hasOwnProperty(current_annotation.id)) { + ret[current_annotation.id] = 1; + } else { + ret[current_annotation.id] += 1; + } + + } + + }; + + return ret; +}; + +/* breaks a string in words and searches each of these words. Returns an array + of objects with the id of the annotation and its number of occurences. + + FIXME: optimize ? seems to be n^2 in the worst case. +*/ +IriSP.JSONSerializer.prototype.searchTweetsOccurences = function(searchString) { + var ret = { }; + var keywords = searchString.split(/\s+/); + + for (var i in keywords) { + var keyword = keywords[i]; + + // search this keyword in descriptions and title + var found_annotations = [] + found_annotations = found_annotations.concat(this.searchTweets(keyword, "", "")); + found_annotations = found_annotations.concat(this.searchTweets("", keyword, "")); + + for (var j in found_annotations) { + var current_annotation = found_annotations[j]; + + if (!ret.hasOwnProperty(current_annotation.id)) { + ret[current_annotation.id] = 1; + } else { + ret[current_annotation.id] += 1; + } + + } + + }; + + return ret; +}; + +/* takes the currentTime and returns all the annotations that are displayable at the moment + NB: only takes account the first type of annotations - ignores tweets + currentTime is in seconds. + */ + +IriSP.JSONSerializer.prototype.currentAnnotations = function(currentTime) { + var view; + var currentTimeMs = 1000 * currentTime; + + if (typeof(this._data.views) !== "undefined" && this._data.views !== null) + view = this._data.views[0]; + + var view_type = ""; + + if(typeof(view) !== "undefined" && typeof(view.annotation_types) !== "undefined" && view.annotation_types.length >= 1) { + view_type = view.annotation_types[0]; + } + + var ret_array = []; + + var i; + + for (i in this._data.annotations) { + var annotation = this._data.annotations[i]; + + if (annotation.meta["id-ref"] === view_type && annotation.begin <= currentTimeMs && annotation.end >= currentTimeMs) + ret_array.push(annotation); + } + + return ret_array; +}; diff -r 000000000000 -r d4dc097a6083 web/LdtPlayer.css --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/web/LdtPlayer.css Thu Dec 15 14:02:15 2011 +0100 @@ -0,0 +1,496 @@ + #demo-frame > div.demo { padding: 5px !important; }; + + button.ui-button-icon-only { + height:1.5em; + width:1.5em; + } + + #Ldt-loader { + background:url(imgs/loader.gif) no-repeat; + width:20px; + height:16px; + float:left; + } + + /* general class for all buttons */ + .Ldt-button { + + } + + .Ldt-SegmentsWidget { + background-color: #b6b8b7; + overflow: auto; /* clear the floats */ + margin-top: 1px; + } + + .Ldt-iri-chapter{ + float: left; + height: 10px; + } + + .tooltip { + display:none; + background:transparent url(imgs/white_arrow_mini.png); + font-size:12px; + height:55px; + width:180px; + padding:10px; + padding-left:15px; + padding-top:15px; + padding-right:15px; + color:#000; + font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif"; + } + #Ldt-Root{ + font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif"; + } + #Ldt-Hat{ + height:3px; + } + + .Ldt-AnnotationsWidget { + font-size: 12px; + font-family: "Arial", "Verdana", "sans-serif"; + background-color:#eeeeee; + background:url('imgs/wire_pattern.png') repeat scroll transparent ; + border: 1px solid #b6b8b8; + } + + .Ldt-Annotation-DoubleBorder { + border: 1px solid white; + overflow: auto; + } + + .Ldt-AnnotationContent { + padding:5px; + padding-left: 12px; + + } + + .Ldt-SaTitle{ + padding-top:2px; + padding-bottom:3px; + font-size: 12pt; + color : #0068c4; + } + + .Ldt-SaDescription{ + font-size:12px; + } + + .Ldt-SaKeyword{ + background-color:#b9b9b9; + color:#4D4D4D; + padding:5px; + font-weight:bold; + text-align:left; + float:left; + font-size:10px; + } + + .Ldt-AnnotationShareIcons { + float:right; + position: relative; + } + + + #Ldt-PlaceHolder{ + position:absolue; + float:none; + } + + .Ldt-Segments{ + float:left; + font-size: 62.5%; + } + + .Ldt-mode-radio{ + visibility:hidden; + height:0px; + display:none + } + + /* player */ + .Ldt-controler { + font-size: 62.5%; + font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif"; + background:url('imgs/player_gradient.png') repeat-x transparent ; + height: 25px; + border-top: 1px solid #b6b8b8; + border-bottom: 1px solid #b6b8b8; + } + + + .Ldt-LeftPlayerControls { + float:left; + } + + .Ldt-RightPlayerControls { + float: right; + } + + .Ldt-button { + border-left: 1px solid #b6b8b8; + float: left; + cursor: pointer; + + } + + .Ldt-CtrlPlay { + background:url('imgs/play_sprite.png') no-repeat transparent ; + background-position: 0 0; + width: 59px; + height: 25px; + } + + .Ldt-CtrlPlay:hover { + background-position: 0 -25px; + } + + .Ldt-CtrlPlay:active { + background-position: 0 -50px; + } + + .Ldt-CtrlAnnotate { + background:url('imgs/annotate_sprite.png') no-repeat scroll 0 0 transparent ; + width: 33px; + height: 25px; + border-right: 1px solid #b6b8b8; + float: left; + } + + .Ldt-CtrlAnnotate:hover { + background-position: 0 -25px; + } + + .Ldt-CtrlAnnotate:active { + background-position: 0 -50px; + } + + .Ldt-CtrlSearch { + background:url('imgs/search_sprite.png') no-repeat scroll 0 0 transparent ; + width: 33px; + height: 25px; + border-right: 1px solid #b6b8b8; + float: left; + border-left: none; + } + + .Ldt-CtrlSearch:hover { + background-position: 0 -25px; + } + + .Ldt-CtrlSearch:active { + background-position: 0 -50px; + } + + + .Ldt-Time { + position: inherit; + float: left; + border-right: 1px solid #b6b8b8; + height: 25px; + padding-right: 2px; + font-size: 12px; + font-family: Arial, Verdana, sans-serif; + } + + .Ldt-ElapsedTime { + margin-top: 4px; + float: left; + color: #4a4a4a; + } + + .Ldt-TimeSeparator { + margin-top: 4px; + float: left; + padding-left: 1px; + padding-right: 1px; + } + + .Ldt-TotalTime { + margin-top: 4px; + float: left; + color: #b2b2b2; + } + + .Ldt-CtrlSound { + background:url('imgs/sound_sprite.png') no-repeat scroll 0 0 transparent ; + width: 33px; + height: 25px; + border-right: 1px solid #b6b8b8; + float: right; + border-left: none; + } + + .Ldt-CtrlSound:hover { + background-position: 0 -25px; + } + + .Ldt-CtrlSound:active { + background-position: 0 -50px; + } +/* + .Ldt-CtrlSound { + float: right; + border-left: none; + height: 25px; + top: 7px; + position: inherit; + } +*/ + .Ldt-cleaner { + clear:both; + } + + /* Arrow Widget */ + .Ldt-arrowWidget { + position: relative; + background:url('imgs/arrow.png') no-repeat scroll 0 0 transparent ; + height:16px; + width:27px; + margin-bottom: -3px; + z-index: 4; + left: 0%; + } + + .cleaner { + clear:both; + } + + .share { + background:url('imgs/widget20.png') no-repeat scroll 0 0 transparent ; + display:block; + height:16px; + line-height:16px !important; + overflow:hidden; + width:16px; + float:left; + cursor:pointer; + margin:2px; + } + .shareFacebook{ + background-position:0 -704px; + } + .shareMySpace{ + background-position:0 -736px; + } + .shareTwitter{ + background-position:0 -1072px; + } + .shareGoogle{ + background-position:0 -752px; + } + .shareDelicious{ + background-position:0 -672px; + } + .shareJamesPot{ + background-position:0 -1808px; + } + + .tip{ + position : fixed; /* why not absolute instead of fixed ? because the div containing the tooltip widget is not a subdiv of its parent + widget */ + padding : 3px; + z-index: 10000000000; + max-width: 200px; + background: transparent url("imgs/white_arrow_long.png"); + font-size: 12px; + height: 125px; + width: 180px; + padding: 10px; + padding-left: 15px; + padding-top: 15px; + padding-right: 15px; + color: black; + font-family: "Trebuchet MS", "Helvetica", "Arial", "Verdana", "sans-serif"; + overflow:hidden; + } + + /* slider */ + .Ldt-SliderMinimized { + height: 6px; + } + + .Ldt-SliderMaximized { + height: 11px; + } + + .Ldt-sliderElementMinimized { + width: 100%; + height: 5px; + } + + .Ldt-sliderElementMaximized { + width: 100%; + height: 10px; + } + + .Ldt-sliderBackground { + background-color: #B6B8B8; + position: absolute; + z-index: 2; + bottom: 1px; + width: 100%; + height: 5px; + + } + + .Ldt-sliderForeground { + background-color: #747474; + z-index: 2; + width: 0px; + position: absolute; + bottom: 1px; + height: 5px; + } + + .Ldt-sliderPositionMarker { + position: absolute; + z-index: 100; + background-color: blue; + height: 5px; + width: 5px; + top: 0%; + bottom: 1px; + } + + .positionMarker { + position: absolute; + z-index: 100; + width: 1px; + height: 20px; + background-color: white; + } + + /* tweet Widget */ + .Ldt-tweetWidget { + font-size: 12px; + font-family: "Arial", "Verdana", "sans-serif"; + background:url('imgs/wire_pattern.png') repeat scroll transparent ; + border: 1px solid #b6b8b8; + border-top: none; + overflow: auto; + } + + .Ldt-tweet-DoubleBorder { + border: 1px solid white; + padding: 5px; + overflow: auto; + } + + .Ldt-tweetAvatar { + float: left; + } + + .Ldt-tweetAvatar-profileArrow { + float: left; + height: 48px; + margin-left: 5px; + margin-right: 5px; + } + + .Ldt-tweet_userHandle { + float: left; + color: #5c8df1; + } + + .Ldt-tweet_realName { + float: left; + margin-left: 3px; + } + + .Ldt-tweetContents { + } + + .Ldt-tweet_date { + float: left; + } + + .Ldt-tweetWidgetKeepOpen { + position: relative; + float: right; + height: 17px; + width: 17px; + margin-right: 1px; + } + + .Ldt-tweetWidgetMinimize { + position: relative; + float: right; + height: 17px; + width: 17px; + right: 9px; + } + + .Ldt-tweetWidget * a:link { + color: #729efa; + + } + + .Ldt-TweetReply { + float: left; + margin-left: 16px; + } + + .Ldt-TweetReplyIcon { + background:url('imgs/reply_sprite.png') no-repeat scroll 0 0 transparent ; + width: 14px; + height: 11px; + float: left; + margin-top: 2px; + } + + .Ldt-TweetReplyIcon:hover { + background-position: 0 -11px; + } + + .Ldt-TweetReplyIcon:active { + background-position: 0 -22px; + } + + .Ldt-Retweet { + float: left; + margin-left: 16px; + } + + .Ldt-RetweetIcon { + background:url('imgs/retweet_sprite.png') no-repeat scroll 0 0 transparent ; + width: 14px; + height: 8px; + float: left; + margin-top: 3px; + } + + .Ldt-RetweetIcon:hover { + background-position: 0 -8px; + } + + .Ldt-RetweetIcon:active { + background-position: 0 -16px; + } + + /* styling of a "++" in a tweet */ + .Ldt-PolemicPlusPlus { + background-color: #1d973d; + } + + /* styling of a "==" in a tweet */ + .Ldt-PolemicEqualEqual { + background-color: #5c8df1 + } + + /* styling of a "--" in a tweet */ + .Ldt-PolemicMinusMinus { + background-color: #ce0a15; + } + + /* styling of a "??" in a tweet */ + .Ldt-PolemicQuestion { + background-color: #c5a62d; + } + + /* the styling of a spacer div */ + .Ldt-spacer { + background-color:#eeeeee; + } diff -r 000000000000 -r d4dc097a6083 web/entretiens.txt --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/web/entretiens.txt Thu Dec 15 14:02:15 2011 +0100 @@ -0,0 +1,11 @@ +# lines beginning with '#' are comments +# it's a csv file with semicolon for separators +# format : title, stream id, date +# +Histoire et anthropologie de la confiance - Alain Mille et Bernard Stiegler;a972dbcc-26ff-11e1-8869-00145ea49a02;le 25 Mai 2011 10h00-12h01 +Confiance et politique - Albert Ogien;d715c4e0-26ff-11e1-a2ff-00145ea49a02;le 27 mars 2014 +Bernard Stiegler;c609832e-b6e0-11e0-9f0f-00145ea49a02;le 27 mars 2014 +Cécile Méadel;4fa4daa4-2700-11e1-b1b3-00145ea49a02;le 27 mars 2014 +Godefroy Dang Nguyen;921ff558-2700-11e1-9ac7-00145ea49a02;le 27 mars 2014 +Judith Simon;16e0bc56-2700-11e1-bb79-00145ea49a02;le 27 mars 2014 +Nicolas Aurray;d8e8b2d6-2700-11e1-81c9-00145ea49a02;le 27 mars 2014 \ No newline at end of file diff -r 000000000000 -r d4dc097a6083 web/imgs/annotate_sprite.png Binary file web/imgs/annotate_sprite.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/arrow.png Binary file web/imgs/arrow.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/black.png Binary file web/imgs/black.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/black_arrow.png Binary file web/imgs/black_arrow.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/black_arrow_big.png Binary file web/imgs/black_arrow_big.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/black_big.png Binary file web/imgs/black_big.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/close.png Binary file web/imgs/close.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/delicious.png Binary file web/imgs/delicious.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/facebook.png Binary file web/imgs/facebook.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/google.png Binary file web/imgs/google.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/grey_arrow_Show.png Binary file web/imgs/grey_arrow_Show.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/linkedin.png Binary file web/imgs/linkedin.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/loader.gif Binary file web/imgs/loader.gif has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/loader_fc.gif Binary file web/imgs/loader_fc.gif has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/loader_fc2.gif Binary file web/imgs/loader_fc2.gif has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/minimize.png Binary file web/imgs/minimize.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/mute_sprite.png Binary file web/imgs/mute_sprite.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/pause_sprite.png Binary file web/imgs/pause_sprite.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/play_sprite.png Binary file web/imgs/play_sprite.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/player_gradient.png Binary file web/imgs/player_gradient.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/profile_arrow.png Binary file web/imgs/profile_arrow.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/purple_arrow_Show.png Binary file web/imgs/purple_arrow_Show.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/reply_sprite.png Binary file web/imgs/reply_sprite.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/retweet_sprite.png Binary file web/imgs/retweet_sprite.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/search_sprite.png Binary file web/imgs/search_sprite.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/sound_sprite.png Binary file web/imgs/sound_sprite.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/transBlack.png Binary file web/imgs/transBlack.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/twitter.png Binary file web/imgs/twitter.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/white.png Binary file web/imgs/white.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/white_arrow.png Binary file web/imgs/white_arrow.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/white_arrow_big.png Binary file web/imgs/white_arrow_big.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/white_arrow_long.png Binary file web/imgs/white_arrow_long.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/white_arrow_mini.png Binary file web/imgs/white_arrow_mini.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/white_big.png Binary file web/imgs/white_big.png has changed diff -r 000000000000 -r d4dc097a6083 web/imgs/wire_pattern.png Binary file web/imgs/wire_pattern.png has changed diff -r 000000000000 -r d4dc097a6083 web/index.php --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/web/index.php Thu Dec 15 14:02:15 2011 +0100 @@ -0,0 +1,44 @@ + + + + +ENMI - entretiens préparatoires + + + + + + + + + +
+ + +
+
+ Séminaire préparatoire "Economie et technologies de la confiance" +
+
+ $line) { + if ($line[0] == "#") + continue; + + list($title, $stream_id, $date) = explode(";", $line); + echo "
$title - $date
"; + } + ?> +
+
+ +
+ + \ No newline at end of file diff -r 000000000000 -r d4dc097a6083 web/jquery-ui.css --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/web/jquery-ui.css Thu Dec 15 14:02:15 2011 +0100 @@ -0,0 +1,570 @@ +/* + * jQuery UI CSS Framework @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute; left: -99999999px; } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } +/* + * jQuery UI Accordion @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; }/* + * jQuery UI Autocomplete @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/* + * jQuery UI Button @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/* + * jQuery UI Datepicker @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* + * jQuery UI Dialog @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .5em 1em .3em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .2em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * jQuery UI Progressbar @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }/* + * jQuery UI Resizable @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;} +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * jQuery UI Selectable @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * jQuery UI Slider @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * jQuery UI Tabs @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/* + * jQuery UI CSS Framework @VERSION + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/ + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1.1em/*{fsDefault}*/; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Verdana,Arial,sans-serif/*{ffDefault}*/; font-size: 1em; } +.ui-widget-content { border: 1px solid #aaaaaa/*{borderColorContent}*/; background: #ffffff/*{bgColorContent}*/ url(images/ui-bg_flat_75_ffffff_40x100.png)/*{bgImgUrlContent}*/ 50%/*{bgContentXPos}*/ 50%/*{bgContentYPos}*/ repeat-x/*{bgContentRepeat}*/; color: #222222/*{fcContent}*/; } +.ui-widget-content a { color: #222222/*{fcContent}*/; } +.ui-widget-header { border: 1px solid #aaaaaa/*{borderColorHeader}*/; background: #cccccc/*{bgColorHeader}*/ url(images/ui-bg_highlight-soft_75_cccccc_1x100.png)/*{bgImgUrlHeader}*/ 50%/*{bgHeaderXPos}*/ 50%/*{bgHeaderYPos}*/ repeat-x/*{bgHeaderRepeat}*/; color: #222222/*{fcHeader}*/; font-weight: bold; } +.ui-widget-header a { color: #222222/*{fcHeader}*/; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #d3d3d3/*{borderColorDefault}*/; background: #e6e6e6/*{bgColorDefault}*/ url(images/ui-bg_glass_75_e6e6e6_1x400.png)/*{bgImgUrlDefault}*/ 50%/*{bgDefaultXPos}*/ 50%/*{bgDefaultYPos}*/ repeat-x/*{bgDefaultRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #555555/*{fcDefault}*/; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555555/*{fcDefault}*/; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #999999/*{borderColorHover}*/; background: #dadada/*{bgColorHover}*/ url(images/ui-bg_glass_75_dadada_1x400.png)/*{bgImgUrlHover}*/ 50%/*{bgHoverXPos}*/ 50%/*{bgHoverYPos}*/ repeat-x/*{bgHoverRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcHover}*/; } +.ui-state-hover a, .ui-state-hover a:hover { color: #212121/*{fcHover}*/; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #aaaaaa/*{borderColorActive}*/; background: #ffffff/*{bgColorActive}*/ url(images/ui-bg_glass_65_ffffff_1x400.png)/*{bgImgUrlActive}*/ 50%/*{bgActiveXPos}*/ 50%/*{bgActiveYPos}*/ repeat-x/*{bgActiveRepeat}*/; font-weight: normal/*{fwDefault}*/; color: #212121/*{fcActive}*/; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #212121/*{fcActive}*/; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fcefa1/*{borderColorHighlight}*/; background: #fbf9ee/*{bgColorHighlight}*/ url(images/ui-bg_glass_55_fbf9ee_1x400.png)/*{bgImgUrlHighlight}*/ 50%/*{bgHighlightXPos}*/ 50%/*{bgHighlightYPos}*/ repeat-x/*{bgHighlightRepeat}*/; color: #363636/*{fcHighlight}*/; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636/*{fcHighlight}*/; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a/*{borderColorError}*/; background: #fef1ec/*{bgColorError}*/ url(images/ui-bg_glass_95_fef1ec_1x400.png)/*{bgImgUrlError}*/ 50%/*{bgErrorXPos}*/ 50%/*{bgErrorYPos}*/ repeat-x/*{bgErrorRepeat}*/; color: #cd0a0a/*{fcError}*/; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #cd0a0a/*{fcError}*/; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #cd0a0a/*{fcError}*/; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsContent}*/; } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_222222_256x240.png)/*{iconsHeader}*/; } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_888888_256x240.png)/*{iconsDefault}*/; } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsHover}*/; } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_454545_256x240.png)/*{iconsActive}*/; } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_2e83ff_256x240.png)/*{iconsHighlight}*/; } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_cd0a0a_256x240.png)/*{iconsError}*/; } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-tr { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-bl { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-br { -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-top { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-right { -moz-border-radius-topright: 4px/*{cornerRadius}*/; -webkit-border-top-right-radius: 4px/*{cornerRadius}*/; border-top-right-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomright: 4px/*{cornerRadius}*/; -webkit-border-bottom-right-radius: 4px/*{cornerRadius}*/; border-bottom-right-radius: 4px/*{cornerRadius}*/; } +.ui-corner-left { -moz-border-radius-topleft: 4px/*{cornerRadius}*/; -webkit-border-top-left-radius: 4px/*{cornerRadius}*/; border-top-left-radius: 4px/*{cornerRadius}*/; -moz-border-radius-bottomleft: 4px/*{cornerRadius}*/; -webkit-border-bottom-left-radius: 4px/*{cornerRadius}*/; border-bottom-left-radius: 4px/*{cornerRadius}*/; } +.ui-corner-all { -moz-border-radius: 4px/*{cornerRadius}*/; -webkit-border-radius: 4px/*{cornerRadius}*/; border-radius: 4px/*{cornerRadius}*/; } + +/* Overlays */ +.ui-widget-overlay { background: #aaaaaa/*{bgColorOverlay}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlOverlay}*/ 50%/*{bgOverlayXPos}*/ 50%/*{bgOverlayYPos}*/ repeat-x/*{bgOverlayRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityOverlay}*/; } +.ui-widget-shadow { margin: -8px/*{offsetTopShadow}*/ 0 0 -8px/*{offsetLeftShadow}*/; padding: 8px/*{thicknessShadow}*/; background: #aaaaaa/*{bgColorShadow}*/ url(images/ui-bg_flat_0_aaaaaa_40x100.png)/*{bgImgUrlShadow}*/ 50%/*{bgShadowXPos}*/ 50%/*{bgShadowYPos}*/ repeat-x/*{bgShadowRepeat}*/; opacity: .3;filter:Alpha(Opacity=30)/*{opacityShadow}*/; -moz-border-radius: 8px/*{cornerRadiusShadow}*/; -webkit-border-radius: 8px/*{cornerRadiusShadow}*/; border-radius: 8px/*{cornerRadiusShadow}*/; } \ No newline at end of file diff -r 000000000000 -r d4dc097a6083 web/jquery-ui.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/web/jquery-ui.js Thu Dec 15 14:02:15 2011 +0100 @@ -0,0 +1,791 @@ +/*! + * jQuery UI 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.16", +keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({propAttr:c.fn.prop||c.fn.attr,_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d= +this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this, +"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart": +"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight, +outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a, +"tabindex"),d=isNaN(b);return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&& +a.element[0].parentNode)for(var e=0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= +false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +;/* + * jQuery UI Position 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, +left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= +k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= +m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= +d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= +a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), +g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); +;/* + * jQuery UI Draggable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= +this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;if(b.iframeFix)d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('
').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options; +this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); +this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true}, +_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b= +false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, +10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle|| +!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&& +a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= +this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), +10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), +10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, +(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!= +"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"), +10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+ +this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&& +!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.leftg[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.topg[3])?h:!(h-this.offset.click.topg[2])?e:!(e-this.offset.click.left=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e=j&&f<=l||h>=j&&h<=l||fl)&&(e>= +i&&e<=k||g>=i&&g<=k||ek);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f
').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d
');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== +String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); +var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a= +false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"}); +this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff= +{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis]; +if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false}, +_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f, +{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight: +Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(cb.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left= +null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a
');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ +a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+ +c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]); +b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.16"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(), +10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top- +f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType? +e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a= +e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing, +step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement= +e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset; +var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left: +a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top- +d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition, +f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25, +display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b= +e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height= +d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery); +;/* + * jQuery UI Selectable 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), +selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("
")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, +c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", +c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= +this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.righti||a.bottomb&&a.rightg&&a.bottom *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a=== +"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&& +!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, +left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; +this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= +document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); +return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], +e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); +c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): +this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, +dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, +toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+jg&&b+la[this.floating?"width":"height"]?j:g0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); +if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), +this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b= +this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f= +d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")|| +0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out", +a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h- +f)this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g- +this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?f:!(f-this.offset.click.left=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this, +this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop", +a,this._uiHash());for(e=0;e li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); +a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", +function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false","aria-selected":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a= +this.options;if(a.icons){c("").addClass("ui-icon "+a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); +b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); +a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ +c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; +if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); +if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), +e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| +e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", +"aria-selected":"false",tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true","aria-selected":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.16", +animations:{slide:function(a,b){a=c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/); +f[i]={value:j[1],unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide", +paddingTop:"hide",paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); +;/* + * jQuery UI Autocomplete 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.propAttr("readOnly"))){g= +false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= +a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; +this.menu=d("
    ").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& +a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); +d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& +b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= +this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length").data("item.autocomplete",b).append(d("").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, +"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); +(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); +this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b, +this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| +this.first()?":last":":first"))},hasScroll:function(){return this.element.height()").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("");e.secondary&&a.append("");if(!this.options.text){d.push(f?"ui-button-icons-only": +"ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")=== +"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); +b.Widget.prototype.destroy.call(this)}})})(jQuery); +;/* + * jQuery UI Dialog 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, +position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("
    ")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ +b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&!i.isDefaultPrevented()&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("
    ")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), +h=c('').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("").addClass("ui-dialog-title").attr("id", +e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); +a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== +b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()};c.ui.dialog.maxZ+=1; +d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== +f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("
    ").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("
    ").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, +function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", +handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, +originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", +f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): +[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); +if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): +e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= +this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- +b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.16",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), +create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&& +c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(b.range==="min"||b.range==="max"?" ui-slider-range-"+b.range:""))}for(var j=c.length;j"); +this.handles=c.add(d(e.join("")).appendTo(a.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){b.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(b.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle", +g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!a.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!a._keySliding){a._keySliding=true;d(this).addClass("ui-state-active");i=a._start(g,l);if(i===false)return}break}m=a.options.step;i=a.options.values&&a.options.values.length? +(h=a.values(l)):(h=a.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=a._valueMin();break;case d.ui.keyCode.END:h=a._valueMax();break;case d.ui.keyCode.PAGE_UP:h=a._trimAlignValue(i+(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=a._trimAlignValue(i-(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===a._valueMax())return;h=a._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===a._valueMin())return;h=a._trimAlignValue(i- +m);break}a._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(a._keySliding){a._keySliding=false;a._stop(g,k);a._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); +return this},_mouseCapture:function(a){var b=this.options,c,f,e,j,g;if(b.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:a.pageX,y:a.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(b.range===true&&this.values(1)===b.min){g+=1;e=d(this.handles[g])}if(this._start(a,g)===false)return false; +this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();b=e.offset();this._clickOffset=!d(a.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:a.pageX-b.left-e.width()/2,top:a.pageY-b.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(a,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(a){var b= +this._normValueFromMouse({x:a.pageX,y:a.pageY});this._slide(a,this._handleIndex,b);return false},_mouseStop:function(a){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(a,this._handleIndex);this._change(a,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b;if(this.orientation==="horizontal"){b= +this.elementSize.width;a=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{b=this.elementSize.height;a=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}b=a/b;if(b>1)b=1;if(b<0)b=0;if(this.orientation==="vertical")b=1-b;a=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+b*a)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b); +c.values=this.values()}return this._trigger("start",a,c)},_slide:function(a,b,c){var f;if(this.options.values&&this.options.values.length){f=this.values(b?0:1);if(this.options.values.length===2&&this.options.range===true&&(b===0&&c>f||b===1&&c1){this.options.values[a]=this._trimAlignValue(b);this._refreshValue();this._change(null,a)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b;a=a-c;if(Math.abs(c)*2>=b)a+=c>0?b:-b;return parseFloat(a.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var a= +this.options.range,b=this.options,c=this,f=!this._animateOff?b.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,b.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({width:e- +g+"%"},{queue:false,duration:b.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:b.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,b.animate);if(a==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[f?"animate":"css"]({width:e+"%"}, +b.animate);if(a==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:b.animate});if(a==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},b.animate);if(a==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:b.animate})}}});d.extend(d.ui.slider,{version:"1.8.16"})})(jQuery); +;/* + * jQuery UI Tabs 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"
    ",remove:null,select:null,show:null,spinner:"Loading…",tabTemplate:"
  • #{label}
    • "},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& +e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= +d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| +(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ +g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; +this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= +-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= +d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, +e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); +j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); +if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, +this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, +load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, +"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.16"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k'))}function N(a){return a.bind("mouseout", +function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"); +b.addClass("ui-state-hover");b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.16"}});var B=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv}, +setDefaults:function(a){H(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g, +"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('
    '))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker", +function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b);b.settings.disabled&&this._disableDatepicker(a)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d(''+c+"");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c== +"focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('').addClass(this._triggerClass).html(f==""?c:d("").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker(): +d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;gh){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a, +b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.settings.disabled&&this._disableDatepicker(a);b.dpDiv.css("display","block")}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+= +1;this._dialogInput=d('');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/ +2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b= +d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e= +a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a, +"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f== +a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input", +a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c=d.datepicker._get(b,"beforeShow");c=c?c.apply(a,[a,b]):{};if(c!==false){H(b.settings,c);b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value= +"";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b); +c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing= +true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv);J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}); +a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&& +!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(), +h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b= +this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b); +this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, +_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"): +0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e["selected"+(c=="M"? +"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a); +this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField"); +if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"? +b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=A+1-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd", +COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames: +null)||this._defaults.monthNames;var i=function(o){(o=k+1 +12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&& +a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay? +new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&nn;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a)); +n=this._canAdjustMonth(a,-1,m,g)?''+n+"":f?"":''+n+"";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m, +g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?''+s+"":f?"":''+s+"";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&& +a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'":"";e=e?'
    '+(c?h:"")+(this._isInRange(a,s)?'":"")+(c?"":h)+"
    ":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),A=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='
    '+(/all|left/.test(t)&& +x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,A,v)+'
    ';var z=j?'":"";for(t=0;t<7;t++){var r=(t+h)%7;z+="=5?' class="ui-datepicker-week-end"':"")+'>'+q[r]+""}y+=z+"";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay, +z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q";var R=!j?"":'";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&ro;R+='";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+""}g++;if(g>11){g=0;m++}y+="
    '+this._get(a,"weekHeader")+"
    '+this._get(a,"calculateWeek")(r)+""+(F&&!D?" ":L?''+ +r.getDate()+"":''+r.getDate()+"")+"
    "+(l?""+(i[0]>0&&G==i[1]-1?'
    ':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'': +"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='
    ',o="";if(h||!j)o+=''+i[b]+"";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+=''+c+"";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b, +e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="
    ";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c=="Y"?b:0),f=a.drawMonth+ +(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&ba?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");if(b)b.apply(a.input? +a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);c=this._daylightSavingAdjust(new Date(c, +e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a, +"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=function(a){if(!this.length)return this; +if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));return this.each(function(){typeof a== +"string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.16";window["DP_jQuery_"+B]=d})(jQuery); +;/* + * jQuery UI Progressbar 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("
    ").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.16"})})(jQuery); +;/* + * jQuery UI Effects 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], +16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= +a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, +d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})}; +f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, +[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.16",save:function(c,a){for(var b=0;b").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}), +d=document.activeElement;c.wrap(b);if(c[0]===d||f.contains(c[0],d))f(d).focus();b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(e,g){a[g]=c.css(g);if(isNaN(parseInt(a[g],10)))a[g]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){var a,b=document.activeElement; +if(c.parent().is(".ui-effects-wrapper")){a=c.parent().replaceWith(c);if(c[0]===b||f.contains(c[0],b))f(b).focus();return a}return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)}); +return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this, +arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/ +2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b, +d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c, +a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b, +d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ +e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); +;/* + * jQuery UI Effects Fade 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Fold 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], +10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); +;/* + * jQuery UI Effects Highlight 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Pulsate 1.8.16 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); +b.dequeue()})})}})(jQuery); +; \ No newline at end of file diff -r 000000000000 -r d4dc097a6083 web/jquery.min.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/web/jquery.min.js Thu Dec 15 14:02:15 2011 +0100 @@ -0,0 +1,154 @@ +/*! + * jQuery JavaScript Library v1.4.2 + * http://jquery.com/ + * + * Copyright 2010, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2010, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Sat Feb 13 22:33:48 2010 -0500 + */ +(function(A,w){function ma(){if(!c.isReady){try{s.documentElement.doScroll("left")}catch(a){setTimeout(ma,1);return}c.ready()}}function Qa(a,b){b.src?c.ajax({url:b.src,async:false,dataType:"script"}):c.globalEval(b.text||b.textContent||b.innerHTML||"");b.parentNode&&b.parentNode.removeChild(b)}function X(a,b,d,f,e,j){var i=a.length;if(typeof b==="object"){for(var o in b)X(a,o,b[o],f,e,d);return a}if(d!==w){f=!j&&f&&c.isFunction(d);for(o=0;o)[^>]*$|^#([\w-]+)$/,Ua=/^.[^:#\[\.,]*$/,Va=/\S/, +Wa=/^(\s|\u00A0)+|(\s|\u00A0)+$/g,Xa=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,P=navigator.userAgent,xa=false,Q=[],L,$=Object.prototype.toString,aa=Object.prototype.hasOwnProperty,ba=Array.prototype.push,R=Array.prototype.slice,ya=Array.prototype.indexOf;c.fn=c.prototype={init:function(a,b){var d,f;if(!a)return this;if(a.nodeType){this.context=this[0]=a;this.length=1;return this}if(a==="body"&&!b){this.context=s;this[0]=s.body;this.selector="body";this.length=1;return this}if(typeof a==="string")if((d=Ta.exec(a))&& +(d[1]||!b))if(d[1]){f=b?b.ownerDocument||b:s;if(a=Xa.exec(a))if(c.isPlainObject(b)){a=[s.createElement(a[1])];c.fn.attr.call(a,b,true)}else a=[f.createElement(a[1])];else{a=sa([d[1]],[f]);a=(a.cacheable?a.fragment.cloneNode(true):a.fragment).childNodes}return c.merge(this,a)}else{if(b=s.getElementById(d[2])){if(b.id!==d[2])return T.find(a);this.length=1;this[0]=b}this.context=s;this.selector=a;return this}else if(!b&&/^\w+$/.test(a)){this.selector=a;this.context=s;a=s.getElementsByTagName(a);return c.merge(this, +a)}else return!b||b.jquery?(b||T).find(a):c(b).find(a);else if(c.isFunction(a))return T.ready(a);if(a.selector!==w){this.selector=a.selector;this.context=a.context}return c.makeArray(a,this)},selector:"",jquery:"1.4.2",length:0,size:function(){return this.length},toArray:function(){return R.call(this,0)},get:function(a){return a==null?this.toArray():a<0?this.slice(a)[0]:this[a]},pushStack:function(a,b,d){var f=c();c.isArray(a)?ba.apply(f,a):c.merge(f,a);f.prevObject=this;f.context=this.context;if(b=== +"find")f.selector=this.selector+(this.selector?" ":"")+d;else if(b)f.selector=this.selector+"."+b+"("+d+")";return f},each:function(a,b){return c.each(this,a,b)},ready:function(a){c.bindReady();if(c.isReady)a.call(s,c);else Q&&Q.push(a);return this},eq:function(a){return a===-1?this.slice(a):this.slice(a,+a+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(R.apply(this,arguments),"slice",R.call(arguments).join(","))},map:function(a){return this.pushStack(c.map(this, +function(b,d){return a.call(b,d,b)}))},end:function(){return this.prevObject||c(null)},push:ba,sort:[].sort,splice:[].splice};c.fn.init.prototype=c.fn;c.extend=c.fn.extend=function(){var a=arguments[0]||{},b=1,d=arguments.length,f=false,e,j,i,o;if(typeof a==="boolean"){f=a;a=arguments[1]||{};b=2}if(typeof a!=="object"&&!c.isFunction(a))a={};if(d===b){a=this;--b}for(;b
    a"; +var e=d.getElementsByTagName("*"),j=d.getElementsByTagName("a")[0];if(!(!e||!e.length||!j)){c.support={leadingWhitespace:d.firstChild.nodeType===3,tbody:!d.getElementsByTagName("tbody").length,htmlSerialize:!!d.getElementsByTagName("link").length,style:/red/.test(j.getAttribute("style")),hrefNormalized:j.getAttribute("href")==="/a",opacity:/^0.55$/.test(j.style.opacity),cssFloat:!!j.style.cssFloat,checkOn:d.getElementsByTagName("input")[0].value==="on",optSelected:s.createElement("select").appendChild(s.createElement("option")).selected, +parentNode:d.removeChild(d.appendChild(s.createElement("div"))).parentNode===null,deleteExpando:true,checkClone:false,scriptEval:false,noCloneEvent:true,boxModel:null};b.type="text/javascript";try{b.appendChild(s.createTextNode("window."+f+"=1;"))}catch(i){}a.insertBefore(b,a.firstChild);if(A[f]){c.support.scriptEval=true;delete A[f]}try{delete b.test}catch(o){c.support.deleteExpando=false}a.removeChild(b);if(d.attachEvent&&d.fireEvent){d.attachEvent("onclick",function k(){c.support.noCloneEvent= +false;d.detachEvent("onclick",k)});d.cloneNode(true).fireEvent("onclick")}d=s.createElement("div");d.innerHTML="";a=s.createDocumentFragment();a.appendChild(d.firstChild);c.support.checkClone=a.cloneNode(true).cloneNode(true).lastChild.checked;c(function(){var k=s.createElement("div");k.style.width=k.style.paddingLeft="1px";s.body.appendChild(k);c.boxModel=c.support.boxModel=k.offsetWidth===2;s.body.removeChild(k).style.display="none"});a=function(k){var n= +s.createElement("div");k="on"+k;var r=k in n;if(!r){n.setAttribute(k,"return;");r=typeof n[k]==="function"}return r};c.support.submitBubbles=a("submit");c.support.changeBubbles=a("change");a=b=d=e=j=null}})();c.props={"for":"htmlFor","class":"className",readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan",colspan:"colSpan",tabindex:"tabIndex",usemap:"useMap",frameborder:"frameBorder"};var G="jQuery"+J(),Ya=0,za={};c.extend({cache:{},expando:G,noData:{embed:true,object:true, +applet:true},data:function(a,b,d){if(!(a.nodeName&&c.noData[a.nodeName.toLowerCase()])){a=a==A?za:a;var f=a[G],e=c.cache;if(!f&&typeof b==="string"&&d===w)return null;f||(f=++Ya);if(typeof b==="object"){a[G]=f;e[f]=c.extend(true,{},b)}else if(!e[f]){a[G]=f;e[f]={}}a=e[f];if(d!==w)a[b]=d;return typeof b==="string"?a[b]:a}},removeData:function(a,b){if(!(a.nodeName&&c.noData[a.nodeName.toLowerCase()])){a=a==A?za:a;var d=a[G],f=c.cache,e=f[d];if(b){if(e){delete e[b];c.isEmptyObject(e)&&c.removeData(a)}}else{if(c.support.deleteExpando)delete a[c.expando]; +else a.removeAttribute&&a.removeAttribute(c.expando);delete f[d]}}}});c.fn.extend({data:function(a,b){if(typeof a==="undefined"&&this.length)return c.data(this[0]);else if(typeof a==="object")return this.each(function(){c.data(this,a)});var d=a.split(".");d[1]=d[1]?"."+d[1]:"";if(b===w){var f=this.triggerHandler("getData"+d[1]+"!",[d[0]]);if(f===w&&this.length)f=c.data(this[0],a);return f===w&&d[1]?this.data(d[0]):f}else return this.trigger("setData"+d[1]+"!",[d[0],b]).each(function(){c.data(this, +a,b)})},removeData:function(a){return this.each(function(){c.removeData(this,a)})}});c.extend({queue:function(a,b,d){if(a){b=(b||"fx")+"queue";var f=c.data(a,b);if(!d)return f||[];if(!f||c.isArray(d))f=c.data(a,b,c.makeArray(d));else f.push(d);return f}},dequeue:function(a,b){b=b||"fx";var d=c.queue(a,b),f=d.shift();if(f==="inprogress")f=d.shift();if(f){b==="fx"&&d.unshift("inprogress");f.call(a,function(){c.dequeue(a,b)})}}});c.fn.extend({queue:function(a,b){if(typeof a!=="string"){b=a;a="fx"}if(b=== +w)return c.queue(this[0],a);return this.each(function(){var d=c.queue(this,a,b);a==="fx"&&d[0]!=="inprogress"&&c.dequeue(this,a)})},dequeue:function(a){return this.each(function(){c.dequeue(this,a)})},delay:function(a,b){a=c.fx?c.fx.speeds[a]||a:a;b=b||"fx";return this.queue(b,function(){var d=this;setTimeout(function(){c.dequeue(d,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])}});var Aa=/[\n\t]/g,ca=/\s+/,Za=/\r/g,$a=/href|src|style/,ab=/(button|input)/i,bb=/(button|input|object|select|textarea)/i, +cb=/^(a|area)$/i,Ba=/radio|checkbox/;c.fn.extend({attr:function(a,b){return X(this,a,b,true,c.attr)},removeAttr:function(a){return this.each(function(){c.attr(this,a,"");this.nodeType===1&&this.removeAttribute(a)})},addClass:function(a){if(c.isFunction(a))return this.each(function(n){var r=c(this);r.addClass(a.call(this,n,r.attr("class")))});if(a&&typeof a==="string")for(var b=(a||"").split(ca),d=0,f=this.length;d-1)return true;return false},val:function(a){if(a===w){var b=this[0];if(b){if(c.nodeName(b,"option"))return(b.attributes.value||{}).specified?b.value:b.text;if(c.nodeName(b,"select")){var d=b.selectedIndex,f=[],e=b.options;b=b.type==="select-one";if(d<0)return null;var j=b?d:0;for(d=b?d+1:e.length;j=0;else if(c.nodeName(this,"select")){var u=c.makeArray(r);c("option",this).each(function(){this.selected= +c.inArray(c(this).val(),u)>=0});if(!u.length)this.selectedIndex=-1}else this.value=r}})}});c.extend({attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(a,b,d,f){if(!a||a.nodeType===3||a.nodeType===8)return w;if(f&&b in c.attrFn)return c(a)[b](d);f=a.nodeType!==1||!c.isXMLDoc(a);var e=d!==w;b=f&&c.props[b]||b;if(a.nodeType===1){var j=$a.test(b);if(b in a&&f&&!j){if(e){b==="type"&&ab.test(a.nodeName)&&a.parentNode&&c.error("type property can't be changed"); +a[b]=d}if(c.nodeName(a,"form")&&a.getAttributeNode(b))return a.getAttributeNode(b).nodeValue;if(b==="tabIndex")return(b=a.getAttributeNode("tabIndex"))&&b.specified?b.value:bb.test(a.nodeName)||cb.test(a.nodeName)&&a.href?0:w;return a[b]}if(!c.support.style&&f&&b==="style"){if(e)a.style.cssText=""+d;return a.style.cssText}e&&a.setAttribute(b,""+d);a=!c.support.hrefNormalized&&f&&j?a.getAttribute(b,2):a.getAttribute(b);return a===null?w:a}return c.style(a,b,d)}});var O=/\.(.*)$/,db=function(a){return a.replace(/[^\w\s\.\|`]/g, +function(b){return"\\"+b})};c.event={add:function(a,b,d,f){if(!(a.nodeType===3||a.nodeType===8)){if(a.setInterval&&a!==A&&!a.frameElement)a=A;var e,j;if(d.handler){e=d;d=e.handler}if(!d.guid)d.guid=c.guid++;if(j=c.data(a)){var i=j.events=j.events||{},o=j.handle;if(!o)j.handle=o=function(){return typeof c!=="undefined"&&!c.event.triggered?c.event.handle.apply(o.elem,arguments):w};o.elem=a;b=b.split(" ");for(var k,n=0,r;k=b[n++];){j=e?c.extend({},e):{handler:d,data:f};if(k.indexOf(".")>-1){r=k.split("."); +k=r.shift();j.namespace=r.slice(0).sort().join(".")}else{r=[];j.namespace=""}j.type=k;j.guid=d.guid;var u=i[k],z=c.event.special[k]||{};if(!u){u=i[k]=[];if(!z.setup||z.setup.call(a,f,r,o)===false)if(a.addEventListener)a.addEventListener(k,o,false);else a.attachEvent&&a.attachEvent("on"+k,o)}if(z.add){z.add.call(a,j);if(!j.handler.guid)j.handler.guid=d.guid}u.push(j);c.event.global[k]=true}a=null}}},global:{},remove:function(a,b,d,f){if(!(a.nodeType===3||a.nodeType===8)){var e,j=0,i,o,k,n,r,u,z=c.data(a), +C=z&&z.events;if(z&&C){if(b&&b.type){d=b.handler;b=b.type}if(!b||typeof b==="string"&&b.charAt(0)==="."){b=b||"";for(e in C)c.event.remove(a,e+b)}else{for(b=b.split(" ");e=b[j++];){n=e;i=e.indexOf(".")<0;o=[];if(!i){o=e.split(".");e=o.shift();k=new RegExp("(^|\\.)"+c.map(o.slice(0).sort(),db).join("\\.(?:.*\\.)?")+"(\\.|$)")}if(r=C[e])if(d){n=c.event.special[e]||{};for(B=f||0;B=0){a.type= +e=e.slice(0,-1);a.exclusive=true}if(!d){a.stopPropagation();c.event.global[e]&&c.each(c.cache,function(){this.events&&this.events[e]&&c.event.trigger(a,b,this.handle.elem)})}if(!d||d.nodeType===3||d.nodeType===8)return w;a.result=w;a.target=d;b=c.makeArray(b);b.unshift(a)}a.currentTarget=d;(f=c.data(d,"handle"))&&f.apply(d,b);f=d.parentNode||d.ownerDocument;try{if(!(d&&d.nodeName&&c.noData[d.nodeName.toLowerCase()]))if(d["on"+e]&&d["on"+e].apply(d,b)===false)a.result=false}catch(j){}if(!a.isPropagationStopped()&& +f)c.event.trigger(a,b,f,true);else if(!a.isDefaultPrevented()){f=a.target;var i,o=c.nodeName(f,"a")&&e==="click",k=c.event.special[e]||{};if((!k._default||k._default.call(d,a)===false)&&!o&&!(f&&f.nodeName&&c.noData[f.nodeName.toLowerCase()])){try{if(f[e]){if(i=f["on"+e])f["on"+e]=null;c.event.triggered=true;f[e]()}}catch(n){}if(i)f["on"+e]=i;c.event.triggered=false}}},handle:function(a){var b,d,f,e;a=arguments[0]=c.event.fix(a||A.event);a.currentTarget=this;b=a.type.indexOf(".")<0&&!a.exclusive; +if(!b){d=a.type.split(".");a.type=d.shift();f=new RegExp("(^|\\.)"+d.slice(0).sort().join("\\.(?:.*\\.)?")+"(\\.|$)")}e=c.data(this,"events");d=e[a.type];if(e&&d){d=d.slice(0);e=0;for(var j=d.length;e-1?c.map(a.options,function(f){return f.selected}).join("-"):"";else if(a.nodeName.toLowerCase()==="select")d=a.selectedIndex;return d},fa=function(a,b){var d=a.target,f,e;if(!(!da.test(d.nodeName)||d.readOnly)){f=c.data(d,"_change_data");e=Fa(d);if(a.type!=="focusout"||d.type!=="radio")c.data(d,"_change_data", +e);if(!(f===w||e===f))if(f!=null||e){a.type="change";return c.event.trigger(a,b,d)}}};c.event.special.change={filters:{focusout:fa,click:function(a){var b=a.target,d=b.type;if(d==="radio"||d==="checkbox"||b.nodeName.toLowerCase()==="select")return fa.call(this,a)},keydown:function(a){var b=a.target,d=b.type;if(a.keyCode===13&&b.nodeName.toLowerCase()!=="textarea"||a.keyCode===32&&(d==="checkbox"||d==="radio")||d==="select-multiple")return fa.call(this,a)},beforeactivate:function(a){a=a.target;c.data(a, +"_change_data",Fa(a))}},setup:function(){if(this.type==="file")return false;for(var a in ea)c.event.add(this,a+".specialChange",ea[a]);return da.test(this.nodeName)},teardown:function(){c.event.remove(this,".specialChange");return da.test(this.nodeName)}};ea=c.event.special.change.filters}s.addEventListener&&c.each({focus:"focusin",blur:"focusout"},function(a,b){function d(f){f=c.event.fix(f);f.type=b;return c.event.handle.call(this,f)}c.event.special[b]={setup:function(){this.addEventListener(a, +d,true)},teardown:function(){this.removeEventListener(a,d,true)}}});c.each(["bind","one"],function(a,b){c.fn[b]=function(d,f,e){if(typeof d==="object"){for(var j in d)this[b](j,f,d[j],e);return this}if(c.isFunction(f)){e=f;f=w}var i=b==="one"?c.proxy(e,function(k){c(this).unbind(k,i);return e.apply(this,arguments)}):e;if(d==="unload"&&b!=="one")this.one(d,f,e);else{j=0;for(var o=this.length;j0){y=t;break}}t=t[g]}m[q]=y}}}var f=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g, +e=0,j=Object.prototype.toString,i=false,o=true;[0,0].sort(function(){o=false;return 0});var k=function(g,h,l,m){l=l||[];var q=h=h||s;if(h.nodeType!==1&&h.nodeType!==9)return[];if(!g||typeof g!=="string")return l;for(var p=[],v,t,y,S,H=true,M=x(h),I=g;(f.exec(""),v=f.exec(I))!==null;){I=v[3];p.push(v[1]);if(v[2]){S=v[3];break}}if(p.length>1&&r.exec(g))if(p.length===2&&n.relative[p[0]])t=ga(p[0]+p[1],h);else for(t=n.relative[p[0]]?[h]:k(p.shift(),h);p.length;){g=p.shift();if(n.relative[g])g+=p.shift(); +t=ga(g,t)}else{if(!m&&p.length>1&&h.nodeType===9&&!M&&n.match.ID.test(p[0])&&!n.match.ID.test(p[p.length-1])){v=k.find(p.shift(),h,M);h=v.expr?k.filter(v.expr,v.set)[0]:v.set[0]}if(h){v=m?{expr:p.pop(),set:z(m)}:k.find(p.pop(),p.length===1&&(p[0]==="~"||p[0]==="+")&&h.parentNode?h.parentNode:h,M);t=v.expr?k.filter(v.expr,v.set):v.set;if(p.length>0)y=z(t);else H=false;for(;p.length;){var D=p.pop();v=D;if(n.relative[D])v=p.pop();else D="";if(v==null)v=h;n.relative[D](y,v,M)}}else y=[]}y||(y=t);y||k.error(D|| +g);if(j.call(y)==="[object Array]")if(H)if(h&&h.nodeType===1)for(g=0;y[g]!=null;g++){if(y[g]&&(y[g]===true||y[g].nodeType===1&&E(h,y[g])))l.push(t[g])}else for(g=0;y[g]!=null;g++)y[g]&&y[g].nodeType===1&&l.push(t[g]);else l.push.apply(l,y);else z(y,l);if(S){k(S,q,l,m);k.uniqueSort(l)}return l};k.uniqueSort=function(g){if(B){i=o;g.sort(B);if(i)for(var h=1;h":function(g,h){var l=typeof h==="string";if(l&&!/\W/.test(h)){h=h.toLowerCase();for(var m=0,q=g.length;m=0))l||m.push(v);else if(l)h[p]=false;return false},ID:function(g){return g[1].replace(/\\/g,"")},TAG:function(g){return g[1].toLowerCase()}, +CHILD:function(g){if(g[1]==="nth"){var h=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(g[2]==="even"&&"2n"||g[2]==="odd"&&"2n+1"||!/\D/.test(g[2])&&"0n+"+g[2]||g[2]);g[2]=h[1]+(h[2]||1)-0;g[3]=h[3]-0}g[0]=e++;return g},ATTR:function(g,h,l,m,q,p){h=g[1].replace(/\\/g,"");if(!p&&n.attrMap[h])g[1]=n.attrMap[h];if(g[2]==="~=")g[4]=" "+g[4]+" ";return g},PSEUDO:function(g,h,l,m,q){if(g[1]==="not")if((f.exec(g[3])||"").length>1||/^\w/.test(g[3]))g[3]=k(g[3],null,null,h);else{g=k.filter(g[3],h,l,true^q);l||m.push.apply(m, +g);return false}else if(n.match.POS.test(g[0])||n.match.CHILD.test(g[0]))return true;return g},POS:function(g){g.unshift(true);return g}},filters:{enabled:function(g){return g.disabled===false&&g.type!=="hidden"},disabled:function(g){return g.disabled===true},checked:function(g){return g.checked===true},selected:function(g){return g.selected===true},parent:function(g){return!!g.firstChild},empty:function(g){return!g.firstChild},has:function(g,h,l){return!!k(l[3],g).length},header:function(g){return/h\d/i.test(g.nodeName)}, +text:function(g){return"text"===g.type},radio:function(g){return"radio"===g.type},checkbox:function(g){return"checkbox"===g.type},file:function(g){return"file"===g.type},password:function(g){return"password"===g.type},submit:function(g){return"submit"===g.type},image:function(g){return"image"===g.type},reset:function(g){return"reset"===g.type},button:function(g){return"button"===g.type||g.nodeName.toLowerCase()==="button"},input:function(g){return/input|select|textarea|button/i.test(g.nodeName)}}, +setFilters:{first:function(g,h){return h===0},last:function(g,h,l,m){return h===m.length-1},even:function(g,h){return h%2===0},odd:function(g,h){return h%2===1},lt:function(g,h,l){return hl[3]-0},nth:function(g,h,l){return l[3]-0===h},eq:function(g,h,l){return l[3]-0===h}},filter:{PSEUDO:function(g,h,l,m){var q=h[1],p=n.filters[q];if(p)return p(g,l,h,m);else if(q==="contains")return(g.textContent||g.innerText||a([g])||"").indexOf(h[3])>=0;else if(q==="not"){h= +h[3];l=0;for(m=h.length;l=0}},ID:function(g,h){return g.nodeType===1&&g.getAttribute("id")===h},TAG:function(g,h){return h==="*"&&g.nodeType===1||g.nodeName.toLowerCase()===h},CLASS:function(g,h){return(" "+(g.className||g.getAttribute("class"))+" ").indexOf(h)>-1},ATTR:function(g,h){var l=h[1];g=n.attrHandle[l]?n.attrHandle[l](g):g[l]!=null?g[l]:g.getAttribute(l);l=g+"";var m=h[2];h=h[4];return g==null?m==="!=":m=== +"="?l===h:m==="*="?l.indexOf(h)>=0:m==="~="?(" "+l+" ").indexOf(h)>=0:!h?l&&g!==false:m==="!="?l!==h:m==="^="?l.indexOf(h)===0:m==="$="?l.substr(l.length-h.length)===h:m==="|="?l===h||l.substr(0,h.length+1)===h+"-":false},POS:function(g,h,l,m){var q=n.setFilters[h[2]];if(q)return q(g,l,h,m)}}},r=n.match.POS;for(var u in n.match){n.match[u]=new RegExp(n.match[u].source+/(?![^\[]*\])(?![^\(]*\))/.source);n.leftMatch[u]=new RegExp(/(^(?:.|\r|\n)*?)/.source+n.match[u].source.replace(/\\(\d+)/g,function(g, +h){return"\\"+(h-0+1)}))}var z=function(g,h){g=Array.prototype.slice.call(g,0);if(h){h.push.apply(h,g);return h}return g};try{Array.prototype.slice.call(s.documentElement.childNodes,0)}catch(C){z=function(g,h){h=h||[];if(j.call(g)==="[object Array]")Array.prototype.push.apply(h,g);else if(typeof g.length==="number")for(var l=0,m=g.length;l";var l=s.documentElement;l.insertBefore(g,l.firstChild);if(s.getElementById(h)){n.find.ID=function(m,q,p){if(typeof q.getElementById!=="undefined"&&!p)return(q=q.getElementById(m[1]))?q.id===m[1]||typeof q.getAttributeNode!=="undefined"&& +q.getAttributeNode("id").nodeValue===m[1]?[q]:w:[]};n.filter.ID=function(m,q){var p=typeof m.getAttributeNode!=="undefined"&&m.getAttributeNode("id");return m.nodeType===1&&p&&p.nodeValue===q}}l.removeChild(g);l=g=null})();(function(){var g=s.createElement("div");g.appendChild(s.createComment(""));if(g.getElementsByTagName("*").length>0)n.find.TAG=function(h,l){l=l.getElementsByTagName(h[1]);if(h[1]==="*"){h=[];for(var m=0;l[m];m++)l[m].nodeType===1&&h.push(l[m]);l=h}return l};g.innerHTML=""; +if(g.firstChild&&typeof g.firstChild.getAttribute!=="undefined"&&g.firstChild.getAttribute("href")!=="#")n.attrHandle.href=function(h){return h.getAttribute("href",2)};g=null})();s.querySelectorAll&&function(){var g=k,h=s.createElement("div");h.innerHTML="

    ";if(!(h.querySelectorAll&&h.querySelectorAll(".TEST").length===0)){k=function(m,q,p,v){q=q||s;if(!v&&q.nodeType===9&&!x(q))try{return z(q.querySelectorAll(m),p)}catch(t){}return g(m,q,p,v)};for(var l in g)k[l]=g[l];h=null}}(); +(function(){var g=s.createElement("div");g.innerHTML="
    ";if(!(!g.getElementsByClassName||g.getElementsByClassName("e").length===0)){g.lastChild.className="e";if(g.getElementsByClassName("e").length!==1){n.order.splice(1,0,"CLASS");n.find.CLASS=function(h,l,m){if(typeof l.getElementsByClassName!=="undefined"&&!m)return l.getElementsByClassName(h[1])};g=null}}})();var E=s.compareDocumentPosition?function(g,h){return!!(g.compareDocumentPosition(h)&16)}: +function(g,h){return g!==h&&(g.contains?g.contains(h):true)},x=function(g){return(g=(g?g.ownerDocument||g:0).documentElement)?g.nodeName!=="HTML":false},ga=function(g,h){var l=[],m="",q;for(h=h.nodeType?[h]:h;q=n.match.PSEUDO.exec(g);){m+=q[0];g=g.replace(n.match.PSEUDO,"")}g=n.relative[g]?g+"*":g;q=0;for(var p=h.length;q=0===d})};c.fn.extend({find:function(a){for(var b=this.pushStack("","find",a),d=0,f=0,e=this.length;f0)for(var j=d;j0},closest:function(a,b){if(c.isArray(a)){var d=[],f=this[0],e,j= +{},i;if(f&&a.length){e=0;for(var o=a.length;e-1:c(f).is(e)){d.push({selector:i,elem:f});delete j[i]}}f=f.parentNode}}return d}var k=c.expr.match.POS.test(a)?c(a,b||this.context):null;return this.map(function(n,r){for(;r&&r.ownerDocument&&r!==b;){if(k?k.index(r)>-1:c(r).is(a))return r;r=r.parentNode}return null})},index:function(a){if(!a||typeof a=== +"string")return c.inArray(this[0],a?c(a):this.parent().children());return c.inArray(a.jquery?a[0]:a,this)},add:function(a,b){a=typeof a==="string"?c(a,b||this.context):c.makeArray(a);b=c.merge(this.get(),a);return this.pushStack(qa(a[0])||qa(b[0])?b:c.unique(b))},andSelf:function(){return this.add(this.prevObject)}});c.each({parent:function(a){return(a=a.parentNode)&&a.nodeType!==11?a:null},parents:function(a){return c.dir(a,"parentNode")},parentsUntil:function(a,b,d){return c.dir(a,"parentNode", +d)},next:function(a){return c.nth(a,2,"nextSibling")},prev:function(a){return c.nth(a,2,"previousSibling")},nextAll:function(a){return c.dir(a,"nextSibling")},prevAll:function(a){return c.dir(a,"previousSibling")},nextUntil:function(a,b,d){return c.dir(a,"nextSibling",d)},prevUntil:function(a,b,d){return c.dir(a,"previousSibling",d)},siblings:function(a){return c.sibling(a.parentNode.firstChild,a)},children:function(a){return c.sibling(a.firstChild)},contents:function(a){return c.nodeName(a,"iframe")? +a.contentDocument||a.contentWindow.document:c.makeArray(a.childNodes)}},function(a,b){c.fn[a]=function(d,f){var e=c.map(this,b,d);eb.test(a)||(f=d);if(f&&typeof f==="string")e=c.filter(f,e);e=this.length>1?c.unique(e):e;if((this.length>1||gb.test(f))&&fb.test(a))e=e.reverse();return this.pushStack(e,a,R.call(arguments).join(","))}});c.extend({filter:function(a,b,d){if(d)a=":not("+a+")";return c.find.matches(a,b)},dir:function(a,b,d){var f=[];for(a=a[b];a&&a.nodeType!==9&&(d===w||a.nodeType!==1||!c(a).is(d));){a.nodeType=== +1&&f.push(a);a=a[b]}return f},nth:function(a,b,d){b=b||1;for(var f=0;a;a=a[d])if(a.nodeType===1&&++f===b)break;return a},sibling:function(a,b){for(var d=[];a;a=a.nextSibling)a.nodeType===1&&a!==b&&d.push(a);return d}});var Ja=/ jQuery\d+="(?:\d+|null)"/g,V=/^\s+/,Ka=/(<([\w:]+)[^>]*?)\/>/g,hb=/^(?:area|br|col|embed|hr|img|input|link|meta|param)$/i,La=/<([\w:]+)/,ib=/"},F={option:[1,""],legend:[1,"
    ","
    "],thead:[1,"","
    "],tr:[2,"","
    "],td:[3,"","
    "],col:[2,"","
    "],area:[1,"",""],_default:[0,"",""]};F.optgroup=F.option;F.tbody=F.tfoot=F.colgroup=F.caption=F.thead;F.th=F.td;if(!c.support.htmlSerialize)F._default=[1,"div
    ","
    "];c.fn.extend({text:function(a){if(c.isFunction(a))return this.each(function(b){var d= +c(this);d.text(a.call(this,b,d.text()))});if(typeof a!=="object"&&a!==w)return this.empty().append((this[0]&&this[0].ownerDocument||s).createTextNode(a));return c.text(this)},wrapAll:function(a){if(c.isFunction(a))return this.each(function(d){c(this).wrapAll(a.call(this,d))});if(this[0]){var b=c(a,this[0].ownerDocument).eq(0).clone(true);this[0].parentNode&&b.insertBefore(this[0]);b.map(function(){for(var d=this;d.firstChild&&d.firstChild.nodeType===1;)d=d.firstChild;return d}).append(this)}return this}, +wrapInner:function(a){if(c.isFunction(a))return this.each(function(b){c(this).wrapInner(a.call(this,b))});return this.each(function(){var b=c(this),d=b.contents();d.length?d.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){c(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){c.nodeName(this,"body")||c(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.appendChild(a)})}, +prepend:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,this)});else if(arguments.length){var a=c(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b, +this.nextSibling)});else if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,c(arguments[0]).toArray());return a}},remove:function(a,b){for(var d=0,f;(f=this[d])!=null;d++)if(!a||c.filter(a,[f]).length){if(!b&&f.nodeType===1){c.cleanData(f.getElementsByTagName("*"));c.cleanData([f])}f.parentNode&&f.parentNode.removeChild(f)}return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++)for(b.nodeType===1&&c.cleanData(b.getElementsByTagName("*"));b.firstChild;)b.removeChild(b.firstChild); +return this},clone:function(a){var b=this.map(function(){if(!c.support.noCloneEvent&&!c.isXMLDoc(this)){var d=this.outerHTML,f=this.ownerDocument;if(!d){d=f.createElement("div");d.appendChild(this.cloneNode(true));d=d.innerHTML}return c.clean([d.replace(Ja,"").replace(/=([^="'>\s]+\/)>/g,'="$1">').replace(V,"")],f)[0]}else return this.cloneNode(true)});if(a===true){ra(this,b);ra(this.find("*"),b.find("*"))}return b},html:function(a){if(a===w)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(Ja, +""):null;else if(typeof a==="string"&&!ta.test(a)&&(c.support.leadingWhitespace||!V.test(a))&&!F[(La.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Ka,Ma);try{for(var b=0,d=this.length;b0||e.cacheable||this.length>1?k.cloneNode(true):k)}o.length&&c.each(o,Qa)}return this}});c.fragments={};c.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){c.fn[a]=function(d){var f=[];d=c(d);var e=this.length===1&&this[0].parentNode;if(e&&e.nodeType===11&&e.childNodes.length===1&&d.length===1){d[b](this[0]); +return this}else{e=0;for(var j=d.length;e0?this.clone(true):this).get();c.fn[b].apply(c(d[e]),i);f=f.concat(i)}return this.pushStack(f,a,d.selector)}}});c.extend({clean:function(a,b,d,f){b=b||s;if(typeof b.createElement==="undefined")b=b.ownerDocument||b[0]&&b[0].ownerDocument||s;for(var e=[],j=0,i;(i=a[j])!=null;j++){if(typeof i==="number")i+="";if(i){if(typeof i==="string"&&!jb.test(i))i=b.createTextNode(i);else if(typeof i==="string"){i=i.replace(Ka,Ma);var o=(La.exec(i)||["", +""])[1].toLowerCase(),k=F[o]||F._default,n=k[0],r=b.createElement("div");for(r.innerHTML=k[1]+i+k[2];n--;)r=r.lastChild;if(!c.support.tbody){n=ib.test(i);o=o==="table"&&!n?r.firstChild&&r.firstChild.childNodes:k[1]===""&&!n?r.childNodes:[];for(k=o.length-1;k>=0;--k)c.nodeName(o[k],"tbody")&&!o[k].childNodes.length&&o[k].parentNode.removeChild(o[k])}!c.support.leadingWhitespace&&V.test(i)&&r.insertBefore(b.createTextNode(V.exec(i)[0]),r.firstChild);i=r.childNodes}if(i.nodeType)e.push(i);else e= +c.merge(e,i)}}if(d)for(j=0;e[j];j++)if(f&&c.nodeName(e[j],"script")&&(!e[j].type||e[j].type.toLowerCase()==="text/javascript"))f.push(e[j].parentNode?e[j].parentNode.removeChild(e[j]):e[j]);else{e[j].nodeType===1&&e.splice.apply(e,[j+1,0].concat(c.makeArray(e[j].getElementsByTagName("script"))));d.appendChild(e[j])}return e},cleanData:function(a){for(var b,d,f=c.cache,e=c.event.special,j=c.support.deleteExpando,i=0,o;(o=a[i])!=null;i++)if(d=o[c.expando]){b=f[d];if(b.events)for(var k in b.events)e[k]? +c.event.remove(o,k):Ca(o,k,b.handle);if(j)delete o[c.expando];else o.removeAttribute&&o.removeAttribute(c.expando);delete f[d]}}});var kb=/z-?index|font-?weight|opacity|zoom|line-?height/i,Na=/alpha\([^)]*\)/,Oa=/opacity=([^)]*)/,ha=/float/i,ia=/-([a-z])/ig,lb=/([A-Z])/g,mb=/^-?\d+(?:px)?$/i,nb=/^-?\d/,ob={position:"absolute",visibility:"hidden",display:"block"},pb=["Left","Right"],qb=["Top","Bottom"],rb=s.defaultView&&s.defaultView.getComputedStyle,Pa=c.support.cssFloat?"cssFloat":"styleFloat",ja= +function(a,b){return b.toUpperCase()};c.fn.css=function(a,b){return X(this,a,b,true,function(d,f,e){if(e===w)return c.curCSS(d,f);if(typeof e==="number"&&!kb.test(f))e+="px";c.style(d,f,e)})};c.extend({style:function(a,b,d){if(!a||a.nodeType===3||a.nodeType===8)return w;if((b==="width"||b==="height")&&parseFloat(d)<0)d=w;var f=a.style||a,e=d!==w;if(!c.support.opacity&&b==="opacity"){if(e){f.zoom=1;b=parseInt(d,10)+""==="NaN"?"":"alpha(opacity="+d*100+")";a=f.filter||c.curCSS(a,"filter")||"";f.filter= +Na.test(a)?a.replace(Na,b):b}return f.filter&&f.filter.indexOf("opacity=")>=0?parseFloat(Oa.exec(f.filter)[1])/100+"":""}if(ha.test(b))b=Pa;b=b.replace(ia,ja);if(e)f[b]=d;return f[b]},css:function(a,b,d,f){if(b==="width"||b==="height"){var e,j=b==="width"?pb:qb;function i(){e=b==="width"?a.offsetWidth:a.offsetHeight;f!=="border"&&c.each(j,function(){f||(e-=parseFloat(c.curCSS(a,"padding"+this,true))||0);if(f==="margin")e+=parseFloat(c.curCSS(a,"margin"+this,true))||0;else e-=parseFloat(c.curCSS(a, +"border"+this+"Width",true))||0})}a.offsetWidth!==0?i():c.swap(a,ob,i);return Math.max(0,Math.round(e))}return c.curCSS(a,b,d)},curCSS:function(a,b,d){var f,e=a.style;if(!c.support.opacity&&b==="opacity"&&a.currentStyle){f=Oa.test(a.currentStyle.filter||"")?parseFloat(RegExp.$1)/100+"":"";return f===""?"1":f}if(ha.test(b))b=Pa;if(!d&&e&&e[b])f=e[b];else if(rb){if(ha.test(b))b="float";b=b.replace(lb,"-$1").toLowerCase();e=a.ownerDocument.defaultView;if(!e)return null;if(a=e.getComputedStyle(a,null))f= +a.getPropertyValue(b);if(b==="opacity"&&f==="")f="1"}else if(a.currentStyle){d=b.replace(ia,ja);f=a.currentStyle[b]||a.currentStyle[d];if(!mb.test(f)&&nb.test(f)){b=e.left;var j=a.runtimeStyle.left;a.runtimeStyle.left=a.currentStyle.left;e.left=d==="fontSize"?"1em":f||0;f=e.pixelLeft+"px";e.left=b;a.runtimeStyle.left=j}}return f},swap:function(a,b,d){var f={};for(var e in b){f[e]=a.style[e];a.style[e]=b[e]}d.call(a);for(e in b)a.style[e]=f[e]}});if(c.expr&&c.expr.filters){c.expr.filters.hidden=function(a){var b= +a.offsetWidth,d=a.offsetHeight,f=a.nodeName.toLowerCase()==="tr";return b===0&&d===0&&!f?true:b>0&&d>0&&!f?false:c.curCSS(a,"display")==="none"};c.expr.filters.visible=function(a){return!c.expr.filters.hidden(a)}}var sb=J(),tb=//gi,ub=/select|textarea/i,vb=/color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week/i,N=/=\?(&|$)/,ka=/\?/,wb=/(\?|&)_=.*?(&|$)/,xb=/^(\w+:)?\/\/([^\/?#]+)/,yb=/%20/g,zb=c.fn.load;c.fn.extend({load:function(a,b,d){if(typeof a!== +"string")return zb.call(this,a);else if(!this.length)return this;var f=a.indexOf(" ");if(f>=0){var e=a.slice(f,a.length);a=a.slice(0,f)}f="GET";if(b)if(c.isFunction(b)){d=b;b=null}else if(typeof b==="object"){b=c.param(b,c.ajaxSettings.traditional);f="POST"}var j=this;c.ajax({url:a,type:f,dataType:"html",data:b,complete:function(i,o){if(o==="success"||o==="notmodified")j.html(e?c("
    ").append(i.responseText.replace(tb,"")).find(e):i.responseText);d&&j.each(d,[i.responseText,o,i])}});return this}, +serialize:function(){return c.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?c.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||ub.test(this.nodeName)||vb.test(this.type))}).map(function(a,b){a=c(this).val();return a==null?null:c.isArray(a)?c.map(a,function(d){return{name:b.name,value:d}}):{name:b.name,value:a}}).get()}});c.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "), +function(a,b){c.fn[b]=function(d){return this.bind(b,d)}});c.extend({get:function(a,b,d,f){if(c.isFunction(b)){f=f||d;d=b;b=null}return c.ajax({type:"GET",url:a,data:b,success:d,dataType:f})},getScript:function(a,b){return c.get(a,null,b,"script")},getJSON:function(a,b,d){return c.get(a,b,d,"json")},post:function(a,b,d,f){if(c.isFunction(b)){f=f||d;d=b;b={}}return c.ajax({type:"POST",url:a,data:b,success:d,dataType:f})},ajaxSetup:function(a){c.extend(c.ajaxSettings,a)},ajaxSettings:{url:location.href, +global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:A.XMLHttpRequest&&(A.location.protocol!=="file:"||!A.ActiveXObject)?function(){return new A.XMLHttpRequest}:function(){try{return new A.ActiveXObject("Microsoft.XMLHTTP")}catch(a){}},accepts:{xml:"application/xml, text/xml",html:"text/html",script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},lastModified:{},etag:{},ajax:function(a){function b(){e.success&& +e.success.call(k,o,i,x);e.global&&f("ajaxSuccess",[x,e])}function d(){e.complete&&e.complete.call(k,x,i);e.global&&f("ajaxComplete",[x,e]);e.global&&!--c.active&&c.event.trigger("ajaxStop")}function f(q,p){(e.context?c(e.context):c.event).trigger(q,p)}var e=c.extend(true,{},c.ajaxSettings,a),j,i,o,k=a&&a.context||e,n=e.type.toUpperCase();if(e.data&&e.processData&&typeof e.data!=="string")e.data=c.param(e.data,e.traditional);if(e.dataType==="jsonp"){if(n==="GET")N.test(e.url)||(e.url+=(ka.test(e.url)? +"&":"?")+(e.jsonp||"callback")+"=?");else if(!e.data||!N.test(e.data))e.data=(e.data?e.data+"&":"")+(e.jsonp||"callback")+"=?";e.dataType="json"}if(e.dataType==="json"&&(e.data&&N.test(e.data)||N.test(e.url))){j=e.jsonpCallback||"jsonp"+sb++;if(e.data)e.data=(e.data+"").replace(N,"="+j+"$1");e.url=e.url.replace(N,"="+j+"$1");e.dataType="script";A[j]=A[j]||function(q){o=q;b();d();A[j]=w;try{delete A[j]}catch(p){}z&&z.removeChild(C)}}if(e.dataType==="script"&&e.cache===null)e.cache=false;if(e.cache=== +false&&n==="GET"){var r=J(),u=e.url.replace(wb,"$1_="+r+"$2");e.url=u+(u===e.url?(ka.test(e.url)?"&":"?")+"_="+r:"")}if(e.data&&n==="GET")e.url+=(ka.test(e.url)?"&":"?")+e.data;e.global&&!c.active++&&c.event.trigger("ajaxStart");r=(r=xb.exec(e.url))&&(r[1]&&r[1]!==location.protocol||r[2]!==location.host);if(e.dataType==="script"&&n==="GET"&&r){var z=s.getElementsByTagName("head")[0]||s.documentElement,C=s.createElement("script");C.src=e.url;if(e.scriptCharset)C.charset=e.scriptCharset;if(!j){var B= +false;C.onload=C.onreadystatechange=function(){if(!B&&(!this.readyState||this.readyState==="loaded"||this.readyState==="complete")){B=true;b();d();C.onload=C.onreadystatechange=null;z&&C.parentNode&&z.removeChild(C)}}}z.insertBefore(C,z.firstChild);return w}var E=false,x=e.xhr();if(x){e.username?x.open(n,e.url,e.async,e.username,e.password):x.open(n,e.url,e.async);try{if(e.data||a&&a.contentType)x.setRequestHeader("Content-Type",e.contentType);if(e.ifModified){c.lastModified[e.url]&&x.setRequestHeader("If-Modified-Since", +c.lastModified[e.url]);c.etag[e.url]&&x.setRequestHeader("If-None-Match",c.etag[e.url])}r||x.setRequestHeader("X-Requested-With","XMLHttpRequest");x.setRequestHeader("Accept",e.dataType&&e.accepts[e.dataType]?e.accepts[e.dataType]+", */*":e.accepts._default)}catch(ga){}if(e.beforeSend&&e.beforeSend.call(k,x,e)===false){e.global&&!--c.active&&c.event.trigger("ajaxStop");x.abort();return false}e.global&&f("ajaxSend",[x,e]);var g=x.onreadystatechange=function(q){if(!x||x.readyState===0||q==="abort"){E|| +d();E=true;if(x)x.onreadystatechange=c.noop}else if(!E&&x&&(x.readyState===4||q==="timeout")){E=true;x.onreadystatechange=c.noop;i=q==="timeout"?"timeout":!c.httpSuccess(x)?"error":e.ifModified&&c.httpNotModified(x,e.url)?"notmodified":"success";var p;if(i==="success")try{o=c.httpData(x,e.dataType,e)}catch(v){i="parsererror";p=v}if(i==="success"||i==="notmodified")j||b();else c.handleError(e,x,i,p);d();q==="timeout"&&x.abort();if(e.async)x=null}};try{var h=x.abort;x.abort=function(){x&&h.call(x); +g("abort")}}catch(l){}e.async&&e.timeout>0&&setTimeout(function(){x&&!E&&g("timeout")},e.timeout);try{x.send(n==="POST"||n==="PUT"||n==="DELETE"?e.data:null)}catch(m){c.handleError(e,x,null,m);d()}e.async||g();return x}},handleError:function(a,b,d,f){if(a.error)a.error.call(a.context||a,b,d,f);if(a.global)(a.context?c(a.context):c.event).trigger("ajaxError",[b,a,f])},active:0,httpSuccess:function(a){try{return!a.status&&location.protocol==="file:"||a.status>=200&&a.status<300||a.status===304||a.status=== +1223||a.status===0}catch(b){}return false},httpNotModified:function(a,b){var d=a.getResponseHeader("Last-Modified"),f=a.getResponseHeader("Etag");if(d)c.lastModified[b]=d;if(f)c.etag[b]=f;return a.status===304||a.status===0},httpData:function(a,b,d){var f=a.getResponseHeader("content-type")||"",e=b==="xml"||!b&&f.indexOf("xml")>=0;a=e?a.responseXML:a.responseText;e&&a.documentElement.nodeName==="parsererror"&&c.error("parsererror");if(d&&d.dataFilter)a=d.dataFilter(a,b);if(typeof a==="string")if(b=== +"json"||!b&&f.indexOf("json")>=0)a=c.parseJSON(a);else if(b==="script"||!b&&f.indexOf("javascript")>=0)c.globalEval(a);return a},param:function(a,b){function d(i,o){if(c.isArray(o))c.each(o,function(k,n){b||/\[\]$/.test(i)?f(i,n):d(i+"["+(typeof n==="object"||c.isArray(n)?k:"")+"]",n)});else!b&&o!=null&&typeof o==="object"?c.each(o,function(k,n){d(i+"["+k+"]",n)}):f(i,o)}function f(i,o){o=c.isFunction(o)?o():o;e[e.length]=encodeURIComponent(i)+"="+encodeURIComponent(o)}var e=[];if(b===w)b=c.ajaxSettings.traditional; +if(c.isArray(a)||a.jquery)c.each(a,function(){f(this.name,this.value)});else for(var j in a)d(j,a[j]);return e.join("&").replace(yb,"+")}});var la={},Ab=/toggle|show|hide/,Bb=/^([+-]=)?([\d+-.]+)(.*)$/,W,va=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];c.fn.extend({show:function(a,b){if(a||a===0)return this.animate(K("show",3),a,b);else{a=0;for(b=this.length;a").appendTo("body");f=e.css("display");if(f==="none")f="block";e.remove();la[d]=f}c.data(this[a],"olddisplay",f)}}a=0;for(b=this.length;a=0;f--)if(d[f].elem===this){b&&d[f](true);d.splice(f,1)}});b||this.dequeue();return this}});c.each({slideDown:K("show",1),slideUp:K("hide",1),slideToggle:K("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"}},function(a,b){c.fn[a]=function(d,f){return this.animate(b,d,f)}});c.extend({speed:function(a,b,d){var f=a&&typeof a==="object"?a:{complete:d||!d&&b||c.isFunction(a)&&a,duration:a,easing:d&&b||b&&!c.isFunction(b)&&b};f.duration=c.fx.off?0:typeof f.duration=== +"number"?f.duration:c.fx.speeds[f.duration]||c.fx.speeds._default;f.old=f.complete;f.complete=function(){f.queue!==false&&c(this).dequeue();c.isFunction(f.old)&&f.old.call(this)};return f},easing:{linear:function(a,b,d,f){return d+f*a},swing:function(a,b,d,f){return(-Math.cos(a*Math.PI)/2+0.5)*f+d}},timers:[],fx:function(a,b,d){this.options=b;this.elem=a;this.prop=d;if(!b.orig)b.orig={}}});c.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this);(c.fx.step[this.prop]|| +c.fx.step._default)(this);if((this.prop==="height"||this.prop==="width")&&this.elem.style)this.elem.style.display="block"},cur:function(a){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];return(a=parseFloat(c.css(this.elem,this.prop,a)))&&a>-10000?a:parseFloat(c.curCSS(this.elem,this.prop))||0},custom:function(a,b,d){function f(j){return e.step(j)}this.startTime=J();this.start=a;this.end=b;this.unit=d||this.unit||"px";this.now=this.start; +this.pos=this.state=0;var e=this;f.elem=this.elem;if(f()&&c.timers.push(f)&&!W)W=setInterval(c.fx.tick,13)},show:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.show=true;this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur());c(this.elem).show()},hide:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(a){var b=J(),d=true;if(a||b>=this.options.duration+this.startTime){this.now= +this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;for(var f in this.options.curAnim)if(this.options.curAnim[f]!==true)d=false;if(d){if(this.options.display!=null){this.elem.style.overflow=this.options.overflow;a=c.data(this.elem,"olddisplay");this.elem.style.display=a?a:this.options.display;if(c.css(this.elem,"display")==="none")this.elem.style.display="block"}this.options.hide&&c(this.elem).hide();if(this.options.hide||this.options.show)for(var e in this.options.curAnim)c.style(this.elem, +e,this.options.orig[e]);this.options.complete.call(this.elem)}return false}else{e=b-this.startTime;this.state=e/this.options.duration;a=this.options.easing||(c.easing.swing?"swing":"linear");this.pos=c.easing[this.options.specialEasing&&this.options.specialEasing[this.prop]||a](this.state,e,0,1,this.options.duration);this.now=this.start+(this.end-this.start)*this.pos;this.update()}return true}};c.extend(c.fx,{tick:function(){for(var a=c.timers,b=0;b
    "; +a.insertBefore(b,a.firstChild);d=b.firstChild;f=d.firstChild;e=d.nextSibling.firstChild.firstChild;this.doesNotAddBorder=f.offsetTop!==5;this.doesAddBorderForTableAndCells=e.offsetTop===5;f.style.position="fixed";f.style.top="20px";this.supportsFixedPosition=f.offsetTop===20||f.offsetTop===15;f.style.position=f.style.top="";d.style.overflow="hidden";d.style.position="relative";this.subtractsBorderForOverflowNotVisible=f.offsetTop===-5;this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==j;a.removeChild(b); +c.offset.initialize=c.noop},bodyOffset:function(a){var b=a.offsetTop,d=a.offsetLeft;c.offset.initialize();if(c.offset.doesNotIncludeMarginInBodyOffset){b+=parseFloat(c.curCSS(a,"marginTop",true))||0;d+=parseFloat(c.curCSS(a,"marginLeft",true))||0}return{top:b,left:d}},setOffset:function(a,b,d){if(/static/.test(c.curCSS(a,"position")))a.style.position="relative";var f=c(a),e=f.offset(),j=parseInt(c.curCSS(a,"top",true),10)||0,i=parseInt(c.curCSS(a,"left",true),10)||0;if(c.isFunction(b))b=b.call(a, +d,e);d={top:b.top-e.top+j,left:b.left-e.left+i};"using"in b?b.using.call(a,d):f.css(d)}};c.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),d=this.offset(),f=/^body|html$/i.test(b[0].nodeName)?{top:0,left:0}:b.offset();d.top-=parseFloat(c.curCSS(a,"marginTop",true))||0;d.left-=parseFloat(c.curCSS(a,"marginLeft",true))||0;f.top+=parseFloat(c.curCSS(b[0],"borderTopWidth",true))||0;f.left+=parseFloat(c.curCSS(b[0],"borderLeftWidth",true))||0;return{top:d.top- +f.top,left:d.left-f.left}},offsetParent:function(){return this.map(function(){for(var a=this.offsetParent||s.body;a&&!/^body|html$/i.test(a.nodeName)&&c.css(a,"position")==="static";)a=a.offsetParent;return a})}});c.each(["Left","Top"],function(a,b){var d="scroll"+b;c.fn[d]=function(f){var e=this[0],j;if(!e)return null;if(f!==w)return this.each(function(){if(j=wa(this))j.scrollTo(!a?f:c(j).scrollLeft(),a?f:c(j).scrollTop());else this[d]=f});else return(j=wa(e))?"pageXOffset"in j?j[a?"pageYOffset": +"pageXOffset"]:c.support.boxModel&&j.document.documentElement[d]||j.document.body[d]:e[d]}});c.each(["Height","Width"],function(a,b){var d=b.toLowerCase();c.fn["inner"+b]=function(){return this[0]?c.css(this[0],d,false,"padding"):null};c.fn["outer"+b]=function(f){return this[0]?c.css(this[0],d,false,f?"margin":"border"):null};c.fn[d]=function(f){var e=this[0];if(!e)return f==null?null:this;if(c.isFunction(f))return this.each(function(j){var i=c(this);i[d](f.call(this,j,i[d]()))});return"scrollTo"in +e&&e.document?e.document.compatMode==="CSS1Compat"&&e.document.documentElement["client"+b]||e.document.body["client"+b]:e.nodeType===9?Math.max(e.documentElement["client"+b],e.body["scroll"+b],e.documentElement["scroll"+b],e.body["offset"+b],e.documentElement["offset"+b]):f===w?c.css(e,d):this.css(d,typeof f==="string"?f:f+"px")}});A.jQuery=A.$=c})(window); diff -r 000000000000 -r d4dc097a6083 web/jquery.tools.min.js --- /dev/null Thu Jan 01 00:00:00 1970 +0000 +++ b/web/jquery.tools.min.js Thu Dec 15 14:02:15 2011 +0100 @@ -0,0 +1,116 @@ +/* + * jQuery Tools 1.2.4 - The missing UI library for the Web + * + * [toolbox.flashembed, toolbox.history, toolbox.expose, toolbox.mousewheel, tabs, tabs.slideshow, tooltip, tooltip.slide, tooltip.dynamic, scrollable, scrollable.autoscroll, scrollable.navigator, overlay, overlay.apple, dateinput, rangeinput, validator] + * + * NO COPYRIGHTS OR LICENSES. DO WHAT YOU LIKE. + * + * http://flowplayer.org/tools/ + * + * jquery.event.wheel.js - rev 1 + * Copyright (c) 2008, Three Dub Media (http://threedubmedia.com) + * Liscensed under the MIT License (MIT-LICENSE.txt) + * http://www.opensource.org/licenses/mit-license.php + * Created: 2008-07-01 | Updated: 2008-07-14 + * + * ----- + * + * File generated: Wed Aug 18 09:10:10 GMT 2010 + */ +(function(){function f(a,b){if(b)for(var c in b)if(b.hasOwnProperty(c))a[c]=b[c];return a}function l(a,b){var c=[];for(var d in a)if(a.hasOwnProperty(d))c[d]=b(a[d]);return c}function m(a,b,c){if(e.isSupported(b.version))a.innerHTML=e.getHTML(b,c);else if(b.expressInstall&&e.isSupported([6,65]))a.innerHTML=e.getHTML(f(b,{src:b.expressInstall}),{MMredirectURL:location.href,MMplayerType:"PlugIn",MMdoctitle:document.title});else{if(!a.innerHTML.replace(/\s/g,"")){a.innerHTML="

    Flash version "+b.version+ +" or greater is required

    "+(g[0]>0?"Your version is "+g:"You have no flash plugin installed")+"

    "+(a.tagName=="A"?"

    Click here to download latest version

    ":"

    Download latest version from here

    ");if(a.tagName=="A")a.onclick=function(){location.href=k}}if(b.onFail){var d=b.onFail.call(this);if(typeof d=="string")a.innerHTML=d}}if(i)window[b.id]=document.getElementById(b.id);f(this,{getRoot:function(){return a},getOptions:function(){return b},getConf:function(){return c}, +getApi:function(){return a.firstChild}})}var i=document.all,k="http://www.adobe.com/go/getflashplayer",n=typeof jQuery=="function",o=/(\d+)[^\d]+(\d+)[^\d]*(\d*)/,j={width:"100%",height:"100%",id:"_"+(""+Math.random()).slice(9),allowfullscreen:true,allowscriptaccess:"always",quality:"high",version:[3,0],onFail:null,expressInstall:null,w3c:false,cachebusting:false};window.attachEvent&&window.attachEvent("onbeforeunload",function(){__flash_unloadHandler=function(){};__flash_savedUnloadHandler=function(){}}); +window.flashembed=function(a,b,c){if(typeof a=="string")a=document.getElementById(a.replace("#",""));if(a){if(typeof b=="string")b={src:b};return new m(a,f(f({},j),b),c)}};var e=f(window.flashembed,{conf:j,getVersion:function(){var a,b;try{b=navigator.plugins["Shockwave Flash"].description.slice(16)}catch(c){try{b=(a=new ActiveXObject("ShockwaveFlash.ShockwaveFlash.7"))&&a.GetVariable("$version")}catch(d){try{b=(a=new ActiveXObject("ShockwaveFlash.ShockwaveFlash.6"))&&a.GetVariable("$version")}catch(h){}}}return(b= +o.exec(b))?[b[1],b[3]]:[0,0]},asString:function(a){if(a===null||a===undefined)return null;var b=typeof a;if(b=="object"&&a.push)b="array";switch(b){case "string":a=a.replace(new RegExp('(["\\\\])',"g"),"\\$1");a=a.replace(/^\s?(\d+\.?\d+)%/,"$1pct");return'"'+a+'"';case "array":return"["+l(a,function(d){return e.asString(d)}).join(",")+"]";case "function":return'"function()"';case "object":b=[];for(var c in a)a.hasOwnProperty(c)&&b.push('"'+c+'":'+e.asString(a[c]));return"{"+b.join(",")+"}"}return String(a).replace(/\s/g, +" ").replace(/\'/g,'"')},getHTML:function(a,b){a=f({},a);var c='';a.width=a.height=a.id=a.w3c=a.src=null;a.onFail=a.version=a.expressInstall=null;for(var d in a)if(a[d])c+= +'';a="";if(b){for(var h in b)if(b[h]){d=b[h];a+=h+"="+(/function|object/.test(typeof d)?e.asString(d):d)+"&"}a=a.slice(0,-1);c+='"}c+="";return c},isSupported:function(a){return g[0]>a[0]||g[0]==a[0]&&g[1]>=a[1]}}),g=e.getVersion();if(n){jQuery.tools=jQuery.tools||{version:"1.2.4"};jQuery.tools.flashembed={conf:j};jQuery.fn.flashembed=function(a,b){return this.each(function(){$(this).data("flashembed",flashembed(this, +a,b))})}}})(); +(function(b){function h(c){if(c){var a=d.contentWindow.document;a.open().close();a.location.hash=c}}var g,d,f,i;b.tools=b.tools||{version:"1.2.4"};b.tools.history={init:function(c){if(!i){if(b.browser.msie&&b.browser.version<"8"){if(!d){d=b("